Kinetics Database Logo

Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences


Rate Our Products and Services


Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty


Administrative Links

NIST home page

MML home page

Chemical and Biochemical Reference Data Division

MML home page

Chemical and Biochemical Reference Data Division

  NIST Logo Home
©NIST, 2013
Accessibility information

Search Results

Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
1 record matched hv(193 nm) + O3 → O(1S) + O2
1 record matched O3 + CH2=C(CH3)C(O)OONO2 → Products
8 records matched O3 + HSO → Products
4 records matched O3 + CH3SOO → Products
5 records matched O3 + CH3SS → Products
3 records matched O3 + CH3S(O) → Products
3 records matched O3 + CH3SO → Products
9 records matched O3 + Cl → O2 + ClO
4 records matched O3 + CF3O → O2 + CF3O2
3 records matched O3 + N → O2 + NO
7 records matched O3 + O· → O2 + O2
5 records matched O3 + OClO → O2 + ClO3
3 records matched O3 + OClO → Products
4 records matched O3 + CF3O2 → O2 + O2 + CF3O
5 records matched O3 + ·CH2SH → Products
5 records matched O3 + BrO → O2 + O2 + Br·
2 records matched O3 + BrO → Products
1 record matched O3 + O2F → O2 + O2 + OF
4 records matched O3 + O2F → Products
6 records matched O3 + ClO → O2 + OClO
5 records matched O3 + ClO → O2 + ClOO
8 records matched O3 + ·F → O2 + OF
2 records matched O3 + ·F → Products
1 record matched O3 + IO → O2 + Iodine dioxide
1 record matched O3 + IO → O2 + O2 + I
8 records matched O3 + I → O2 + IO
9 records matched O3 + SH → O2 + HSO
9 records matched O3 + SO → SO2 + O2
8 records matched O3 + NH2 → Products
2 records matched O3 + NaO → O2 + NaO2
2 records matched O3 + NaO → Na + O2 + O2
3 records matched O3 + H· → ·OH + O2
3 records matched O3 + Cl2O2 → O2 + ClOO + ClO
2 records matched O3 + Cl2O2 → Products
1 record matched O3 + OF → Products
8 records matched O3 + NO2 → O2 + NO3
7 records matched O3 + NO → O2 + NO2
9 records matched O3 + Br· → O2 + BrO
2 records matched O3 → O2 + O·
2 records matched H2S + O3 → Products
2 records matched HNO2 + O3 → HNO3 + O2
18 records matched O2 + O· → O3
6 records matched S + O3 → O2 + SO
2 records matched SO2 + O3 → SO3 + O2
2 records matched Na + O3 → NaO2 + O·
2 records matched Na + O3 → O2 + NaO
7 records matched CH3S· + O3 → Products
8 records matched ·OH + O3 → HO2 + O2
2 records matched HO2 + CH3C(O)OO(·) → CH3C(O)OH + O3
1 record matched HO2 + ClO → HCl + O3
8 records matched HO2 + O3 → ·OH + O2 + O2
1 record matched HO2 + O3 → Other Products + ·OH
6 records matched CS + O3 → COS + O2
6 records matched ·CH3 + O3 → Products
2 records matched CH3O2· + O3 → Products
2 records matched C2Cl4 + O3 → Products
6 records matched CH3CH=CH2 + O3 → Products
1 record matched alpha-pinene + O3 → Products
3 records matched C2HCl3 + O3 → Products
1 record matched CH2=C(CH3)CH=CH2 + O3 → Products
7 records matched (CH3)2S + O3 → Products
6 records matched C2H2 + O3 → Products
6 records matched C2H4 + O3 → Products
3 records matched O(1D) + O3 → O2 + O· + O·
3 records matched O(1D) + O3 → O2 + O2
2 records matched O(1D) + O3 → Products
3 records matched O2(1DELTA) + O3 → O2 + O2 + O·
4 records matched M + O2 + O· → M + O3
1 record matched O(1D) + O3 → O2 + O2
3 records matched O(1D) + O3 → O(3P) + O(3P) + O2
3 records matched O2(1Delta_g) + O3 → O2 + O2 + O·
1 record matched N2(A3Sigma_u+) + O3 → Products
2 records matched O2(b1Sigma_g+) + O3 → Products
1 record matched O3 + (CH3)2CHC(=CH2)CH(CH3)2 → Products
1 record matched O3 + (E)-CF3CH=CHCl → Products
1 record matched O3 + CClF2OO → COF2 + O2 + ClOO
1 record matched O3 + FC(O)O· → O2 + FC(O)OO
2 records matched O3 + FC(O)O· → Products
1 record matched O3 + DSO → O2 + O2 + SD
1 record matched O3 + DSO → Products
1 record matched O3 + HSO → O2 + O2 + SH
3 records matched O3 + HSO → Products
1 record matched O3 + CH3CH=C(C2H5)CH(C2H5)2-(Z) → Products
1 record matched O3 + CH3SOO → Products
2 records matched O3 + OTNE → Products
1 record matched O3 + CH3OCH=CHC(O)CH3 → Products
1 record matched O3 + BrONO2 → Products
1 record matched O3 + Dibenzo[b,e][1,4]dioxin, 1-chloro- → Products
1 record matched O3 + CH2=CHCF3 → Products
2 records matched O3 + acetyl cedrene → Products
1 record matched O3 + 4-methylcyclohex-3-en-1-one → Products
1 record matched O3 + (CH3O)2P(S)NHCH3 → Products
1 record matched O3 + C2H5C(CH3)=C(CH3)C2H5 (unspec.) → Products
1 record matched O3 + CH3SS → Products
1 record matched O3 + (CH3O)2P(S)N(CH3)2 → Products
1 record matched O3 + CH3S(O) → Products
1 record matched O3 + Na2 → Products
1 record matched O3 + CH2=CHC6F13 → Products
1 record matched O3 + CH3SO → Products
1 record matched O3 + S2 → Products
15 records matched O3 + Cl → O2 + ClO
8 records matched O3 + CF3O → O2 + CF3O2
4 records matched O3 + CF3O → Products
1 record matched O3 + C8F17CH=CH2 → Products
2 records matched O3 + BrO2 → Products
1 record matched O3 + C2H5CH=C=O → Products
1 record matched O3 + CH2=CHC4F9 → Products
7 records matched O3 + (E)-β-Famesene → Products
2 records matched O3 + 1-Undecene, 2-methyl- → Products
1 record matched O3 + 7-Octen-2-ol, 2,6-dimethyl- → Products
2 records matched O3 + 1-Tridecene, 2-methyl- → Products
4 records matched O3 + N → O2 + NO
15 records matched O3 + O· → O2 + O2
1 record matched O3 + (Z)-CH3COCH=CHCOCH3 → Products
1 record matched O3 + OClO → O2 + ClO3
1 record matched O3 + (CH3O)2P(S)NH2 → Products
5 records matched O3 + CF3O2 → O2 + O2 + CF3O
1 record matched O3 + CF3O2 → Products
1 record matched O3 + ·CH2SH → Products
1 record matched O3 + 1,4-Oxathiane → Products
2 records matched O3 + 1-Heptene, 2-methyl- → Products
1 record matched O3 + BrO → O2 + BrO2
2 records matched O3 + BrO → O2 + O2 + Br·
1 record matched O3 + BrO → Products
1 record matched O3 + O2F → O2 + O2 + OF
1 record matched O3 + O2F → Products
2 records matched O3 + ClO → O2 + OClO
2 records matched O3 + ClO → O2 + ClOO
1 record matched O3 + ClO → O2 + O2 + Cl
1 record matched O3 + ClO → Products
1 record matched O3 + (E)-4-C8H16 → Products
3 records matched O3 + ·F → O2 + OF
1 record matched O3 + IO → O2 + I
1 record matched O3 + IO → O2 + Iodine dioxide
1 record matched O3 + IO → Products
2 records matched O3 + ClONO2 → Products
6 records matched O3 + I → O2 + IO
2 records matched O3 + 1-Tert-Butyl-4-Isopropylidene-Cyclohexane → Products
3 records matched O3 + SH → O2 + HSO
1 record matched O3 + ClO3 → O2 + O2 + ClOO
7 records matched O3 + SO → SO2 + O2
1 record matched O3 + SD → O2 + DSO
2 records matched O3 + NH2 → O2 + NH2O
4 records matched O3 + NH2 → Products
4 records matched O3 + 3-Carene → Products
1 record matched O3 + NH2O → Products
1 record matched O3 + (E)-3-C6H12 → Products
2 records matched O3 + 3-Methyl-cyclooctene → Products
2 records matched O3 + 1-Decene, 2-methyl- → Products
1 record matched O3 + 1,1'-Biphenyl, 2,2'-dichloro- → Products
1 record matched O3 + FeO2 → O2 + FeO3
4 records matched O3 + NaO → O2 + NaO2
6 records matched O3 + H· → ·OH + O2
1 record matched O3 + H· → HO2 + O·
1 record matched O3 + Cl2O2 → O2 + ClOO + ClO
1 record matched O3 + OF → O2 + O2F
1 record matched O3 + OF → O2 + O2 + ·F
1 record matched O3 + OF → Products
12 records matched O3 + NO2 → O2 + NO3
19 records matched O3 + NO → O2 + NO2
1 record matched O3 + NO → Products
9 records matched O3 + Br· → O2 + BrO
1 record matched O3 + SiO → Products
1 record matched O3 + (E)-ClCH2CH=CHCl → Products
1 record matched O3 + (Z)-ClCH2CH=CHCl → Products
2 records matched O3 + HBr → HO2 + BrO
2 records matched O3 + O3 → O2 + O2 + O2
24 records matched O3 → O2 + O·
1 record matched NO2F + O3 → O2 + O2 + FNO
1 record matched HOCl + O3 → Products
1 record matched FNO + O3 → O2 + NO2F
1 record matched H2S + O3 → SO2 + H2O
1 record matched H2S + O3 → Products
2 records matched HNO2 + O3 → HNO3 + O2
1 record matched Cl2 + O3 → ClOO + ClO
96 records matched O2 + O· → O3
1 record matched O2 + O2 + O· → O2 + O3
1 record matched O2 + O2 → O3 + O·
1 record matched H2O + O3 → H2O2 + O2
1 record matched N2 + O2 + O· → N2 + O3
1 record matched H2O2 + O3 → H2O + O2 + O2
1 record matched S + O3 → O2 + SO
1 record matched (Z)-2-C6H12 + O3 → Products
1 record matched HCl + O3 → O2 + HOCl
1 record matched (Z)-4-C8H16 + O3 → Products
1 record matched (Z)-3-C6H12 + O3 → Products
1 record matched I2 + O3 → Products
1 record matched SO2 + O3 → SO3 + O2
1 record matched He + O2 + O· → He + O3
1 record matched Ar + O2 + O· → Ar + O3
5 records matched Na + O3 → O2 + NaO
3 records matched Hg + O3 → O2 + HgO
1 record matched Mg + O3 → MgO + O2
1 record matched Fe + O3 → FeO + O2
1 record matched (Z)-5-C10H20 + O3 → Products
1 record matched (E)-5-C10H20 + O3 → Products
5 records matched CH3S· + O3 → Products
1 record matched Diethyl methylphosphonothioate + O3 → Products
1 record matched cis-3-Hexenal + O3 → Products
2 records matched Humulene + O3 → Products
1 record matched CH3CH2CH=CH(CH2)2CHO + O3 → Products
1 record matched CH3NHC(O)OCH3 + O3 → Products
1 record matched (CH3)2NN(CH3)2 + O3 → Products
2 records matched Methylenecyclopropane + O3 → Products
1 record matched CH3CH=CHCH2OH + O3 → Products
6 records matched d-Limonene + O3 → Products
1 record matched CH3OCH=CHC(O)OCH3 + O3 → Products
1 record matched Z-CF3CFCHF + O3 → Products
1 record matched (E),(E)-CH3CH=CHCH=CHCH3 + O3 → Products
1 record matched (E),(Z)-CH3CH=CHCH=CHCH3 + O3 → Products
1 record matched C2H5C(O)CH2OH + O3 → Products
1 record matched C2H5CH(OH)C(O)C2H5 + O3 → Products
2 records matched 1-Octene, 2-methyl- + O3 → Products
5 records matched α-Phellandrene (R) + O3 → Products
4 records matched (E)-CH3CH=CHCHO + O3 → Products
1 record matched (CH3)2NNO2 + O3 → Products
2 records matched 1,3-Cycloheptadiene + O3 → Products
2 records matched (E)-2-C6H12 + O3 → Products
1 record matched CH2=C(CH3)CH2CH2CH=CH2 + O3 → Products
2 records matched Copaene + O3 → Products
1 record matched (Z,Z)-1,3-Cyclooctadiene + O3 → Products
3 records matched trans-Ocimene + O3 → Products
3 records matched CH3C(O)OCH2CH2CH=CHCH2CH3-(Z) + O3 → Products
1 record matched C2H5CH(CH3)C(CH3)=CH2 + O3 → Products
3 records matched Sabinene + O3 → Products
12 records matched ·OH + O3 → HO2 + O2
1 record matched 1,3,6-Octatriene, 3,7-dimethyl-,(Z)- + O3 → Products
1 record matched HO2 + CH3CH2C(O)OO → C2H5COOH + O3
8 records matched HO2 + CH3C(O)OO(·) → CH3C(O)OH + O3
2 records matched HO2 + BrO → O3 + HBr
2 records matched HO2 + ClO → HCl + O3
1 record matched HO2 + O3 → ·OH + O2 + O2
8 records matched HO2 + O3 → Other Products + ·OH
7 records matched ·CCl3 + O3 → Products
1 record matched CH3CO + O3 → Products
1 record matched CH3CH2OOH + O3 → Products
1 record matched CH3OOH + O3 → Products
1 record matched Ethanone, 1-cyclobutyl)- + O3 → Products
1 record matched (CH3)2NC(O)SCH3 + O3 → Products
1 record matched CS + O3 → COS + O2
1 record matched (Z)-CHD=CHD + O3 → Products
1 record matched Ethanone, 1-(2,2,3-trimethylcyclobutyl)- + O3 → Products
2 records matched Cyclobutaneacetaldehyde, 3-acetyl-2,2-dimethyl- + O3 → Products
1 record matched SO2F2 + O3 → Products
1 record matched cyclohexene,1-nitro- + O3 → Products
1 record matched (CH3O)2P(S)Cl + O3 → Products
1 record matched (E)-CH3CH=CHC(=O)C2H5 + O3 → Products
1 record matched CH3C(O)OCH2CH=CHCH2CH2CH3-(E) + O3 → Products
2 records matched 1-C13H26 + O3 → Products
1 record matched 1,6-Octadiene, 3,7-dimethyl- + O3 → Products
1 record matched CH3C(O)OONO2 + O3 → Products
1 record matched ·CF3 + O3 → O2 + CF3O
1 record matched ·CH3 + O3 → CH3O· + O2
7 records matched ·CH3 + O3 → Products
1 record matched ·CF2 + O3 → Products
2 records matched CH3O· + O3 → Products
1 record matched n-C3H7 + O3 → Products
1 record matched CH3O2· + O3 → CH3O· + O2 + O2
1 record matched CH3O2· + O3 → Products
1 record matched C6H5O + O3 → Products
1 record matched ·C2H5 + O3 → Products
1 record matched iso-C3H7 + O3 → Products
1 record matched (E)-CH2=CHCH=CHCH3 + O3 → Other Products + ·OH
3 records matched (E)-CH2=CHCH=CHCH3 + O3 → Products
1 record matched (CH2Cl)2C=CH2 + O3 → Products
2 records matched 2-Methyl-2-vinyloxirane + O3 → Products
1 record matched ·CClF2 + O3 → O2 + CF2ClO
2 records matched Cyclohexene, 1,2-dimethyl- + O3 → Products
1 record matched C3H2F4 + O3 → Products
1 record matched C2H5COCH=CH2 + O3 → Products
1 record matched tert-C4H9 + O3 → Products
1 record matched Cyclohexene-d10 + O3 → Other Products + ·OH
1 record matched C2H5CH=CHCH2OH-(Z) + O3 → Products
1 record matched (Z)-CH2=CHCH=CHCH3 + O3 → Other Products + ·OH
2 records matched (Z)-CH2=CHCH=CHCH3 + O3 → Products
2 records matched Methylenecyclopentane + O3 → Products
1 record matched (E)-CHD=CHD + O3 → Products
1 record matched CD3CD=CD2 + O3 → Other Products + ·OH
1 record matched CD3CD=CD2 + O3 → Products
1 record matched Furan, 2,3-dihydro-5-methyl- + O3 → Products
2 records matched CH2=CH-CH2-N=C=O + O3 → Products
4 records matched 1-Methylcycloheptene + O3 → Products
1 record matched FeO + O3 → O2 + FeO2
1 record matched MgO + O3 → O2 + MgO2
1 record matched CaO + O3 → CaO2 + O2
3 records matched Cyclohexane, methylene + O3 → Products
1 record matched Carbonothioic acid, cyclohexylethyl-, S-ethyl ester + O3 → Products
2 records matched 3-Methylcyclopentene + O3 → Products
2 records matched Methylenecyclobutane + O3 → Products
3 records matched 1-Tetradecene + O3 → Products
1 record matched CH2=C(CH3)CH=CHCH3 + O3 → Products
4 records matched Vinyl sulfoxide + O3 → Products
2 records matched Ethylidenecyclohexane + O3 → Products
2 records matched 1-Methylcyclooctene + O3 → Products
3 records matched (Z)-Cyclooctene + O3 → Products
2 records matched cis-Cyclooctene + O3 → Products
2 records matched Bicyclo[2.2.2]oct-2-ene + O3 → Products
2 records matched 2-Cyclohexen-1-one + O3 → Products
1 record matched Cyclopentene, 1-chloro- + O3 → Products
2 records matched 3-Methylfuran + O3 → Products
1 record matched Ethenyloxirane + O3 → Products
3 records matched 3-Hexen-1-ol, (Z)- + O3 → Products
1 record matched CH3CH=CHOC2H5 + O3 → Products
1 record matched t-C4H9OCH=CH2 + O3 → Products
1 record matched 2-Ethylacrolein + O3 → Products
4 records matched (Z)-CH3CH=C(CH3)C2H5 + O3 → Products
1 record matched 2-Pyrrolidone, 1-methyl- + O3 → Products
3 records matched 1-C10H20 + O3 → Products
1 record matched (E)-CH3COCH=CHCOCH3 + O3 → Products
3 records matched CH2=CHOCH2CH2OCH=CH2 + O3 → Products
3 records matched n-C3H7OCH=CH2 + O3 → Products
2 records matched (E)-CH3CH2CH=CHCHO + O3 → Products
2 records matched (CH3)2C=CHCH=C(CH3)2 + O3 → Products
1 record matched CH2=C(CH3)CH2CH=CH2 + O3 → Products
7 records matched C2H5CH2C(CH3)=CH2 + O3 → Products
2 records matched (C2H5)2C=CH2 + O3 → Products
3 records matched C2H5CH(CH3)CH=CH2 + O3 → Products
1 record matched (n-C3H7)2NC(O)SC2H5 + O3 → Products
1 record matched C2F5C(O)CF(CF3)2 + O3 → Products
1 record matched CF3CF=CH2 + O3 → Products
1 record matched Cyclohexane, ethenyl- + O3 → Products
3 records matched 1-Methylcyclopentene + O3 → Products
1 record matched (E)-(CH3)2CHCH=CHCH(CH3)2 + O3 → Products
6 records matched (CH3)2CHCH2CH=CH2 + O3 → Products
1 record matched (CH3)3CCH=CHC2H5-(E) + O3 → Products
1 record matched CF2=CFCF=CF2 + O3 → Products
2 records matched C2D4 + O3 → Products
2 records matched (E)-(CH3)2CHCH=CHCH3 + O3 → Products
5 records matched 2-(E)-C5H10 + O3 → Products
1 record matched CO + O3 → CO2 + O2
1 record matched CO + O3 → Products
3 records matched 1,3,5,7-Cyclooctatetraene + O3 → Products
1 record matched (Z)-Cycloheptene + O3 → Other Products + ·OH
4 records matched (Z)-Cycloheptene + O3 → Products
3 records matched 1,4-Cyclohexadiene + O3 → Products
1 record matched CH2=C(CH3)CH2CH2C(CH3)=CH2 + O3 → Products
1 record matched CH2=CHCH2CH2OH + O3 → Products
5 records matched 2-(Z)-C5H10 + O3 → Products
4 records matched CH3CH=CHC(=O)CH3 (unspecified) + O3 → Products
4 records matched (CH3)2C=CHC2H5 + O3 → Products
1 record matched CH3ONO + O3 → CH3ONO2 + O2
2 records matched (E)-2-C4H8 + O3 → Other Products + ·OH
2 records matched (E)-2-C4H8 + O3 → Other Products + CH3CHO
19 records matched (E)-2-C4H8 + O3 → Products
1 record matched (E)-CH3CH=CHC(O)OCH3 + O3 → Products
1 record matched CH2=CHCH(OH)CH2CH3 + O3 → Products
1 record matched (E)-CH3CH=C(CH3)C2H5 + O3 → Products
1 record matched Anthracene, 9,10-dihydro- + O3 → Products
3 records matched 2-Methylstyrene + O3 → Products
1 record matched CH2=CHCH(OH)CH3 + O3 → Products
1 record matched (CH3)2C=C=O + O3 → Products
1 record matched (CH3O)2P(O)N(CH3)2 + O3 → Products
1 record matched (CH3)3CC(CH3)=CH2 + O3 → Products
1 record matched (CH3)2Se + O3 → Products
6 records matched 1-C7H14 + O3 → Products
2 records matched 1,3-Cyclohexadiene + O3 → Products
4 records matched 2-C6H12 (Unspecified) + O3 → Products
1 record matched CH2=CHCH2CH2CH=CH2 + O3 → Products
15 records matched 1-C6H12 + O3 → Products
2 records matched 2-Butene, 1-chloro- + O3 → Products
1 record matched CH2=CHCH2CH=CH2 + O3 → Products
1 record matched Cyclohexene, 1-methyl- + O3 → Other Products + ·OH
7 records matched Cyclohexene, 1-methyl- + O3 → Products
7 records matched Cyclohexene, 3-methyl- + O3 → Products
2 records matched Cyclohexene, 4-methyl- + O3 → Products
1 record matched CH3C(O)CH2CH2OH + O3 → Products
1 record matched iso-C4H9CHO + O3 → Products
1 record matched (Z)-2-C4H8 + O3 → Other Products + ·OH
1 record matched (Z)-2-C4H8 + O3 → Other Products + CH3CHO
15 records matched (Z)-2-C4H8 + O3 → Products
9 records matched Terpinolene + O3 → Products
1 record matched 2-Nitronaphthalene + O3 → Products
1 record matched Naphthalene, 2,3-dimethyl- + O3 → Products
1 record matched iso-C3H7C(O)CH3 + O3 → Products
3 records matched (CH3)2C=C(CH3)2 + O3 → Other Products + ·OH
8 records matched (CH3)2C=C(CH3)2 + O3 → Products
1 record matched (CH3)2CHC(CH3)=CH2 + O3 → Products
2 records matched CH3CHClCH=CH2 + O3 → Products
2 records matched CH2=C(CH3)CH2Cl + O3 → Products
5 records matched C2H5C(CH3)=CH2 + O3 → Products
5 records matched (CH3)2CHCH=CH2 + O3 → Products
2 records matched (CH3)3CCH=CH2 + O3 → Products
3 records matched CH3CH2OCH2CH=CH2 + O3 → Products
1 record matched (CH3)2C=CHCH2OH + O3 → Products
1 record matched Cyclotetrasiloxane, octamethyl- + O3 → Products
2 records matched CH2CHCH2I + O3 → Products
3 records matched β-Phellandrene + O3 → Products
2 records matched 2-Carene + O3 → Products
1 record matched 1,3,5-Cycloheptatriene + O3 → Products
1 record matched Cyclotrisiloxane, hexamethyl- + O3 → Products
1 record matched Cyclopentasiloxane, decamethyl- + O3 → Products
1 record matched 1,2,3-Trimethylbenzene + O3 → Products
1 record matched CH3CH(OH)C(O)CH3 + O3 → Products
1 record matched CH2=C(CH3)C(CH3)=CH2 + O3 → Other Products + ·OH
3 records matched CH2=C(CH3)C(CH3)=CH2 + O3 → Products
2 records matched (CH3)2C=CHCH3 + O3 → Other Products + ·OH
1 record matched (CH3)2C=CHCH3 + O3 → Other Products + CH3CHO
1 record matched (CH3)2C=CHCH3 + O3 → Other Products + (CH3)2CO
1 record matched (CH3)2C=CHCH3 + O3 → Products + ·OH
12 records matched (CH3)2C=CHCH3 + O3 → Products
1 record matched (CH3O)3PO + O3 → Products
3 records matched (E)-n-C3H7CH=CHCHO + O3 → Products
1 record matched 1,4-Dithiane + O3 → Products
1 record matched CH2=CHCH=CHCH3 + O3 → Products
2 records matched (CH3)2C=CHCH2Cl + O3 → Products
2 records matched CH3CCCH3 + O3 → Products
1 record matched Cyclohexene, 1-methyl-4-(1-methylethenyl-(S))- + O3 → Products
5 records matched Bicyclo[2.2.1]hept-2-ene + O3 → Products
1 record matched 2(5H)-Furanone + O3 → Products
2 records matched CH3CH=C(CH3)CHO + O3 → Products
1 record matched Benzofuran, 2,3-dihydro + O3 → Products
1 record matched 2,3-Dihydroindene + O3 → Products
1 record matched 1,4-Benzodioxin, 2,3-dihydro- + O3 → Products
4 records matched 1,2-Dihydroxy-3-methylbenzene + O3 → Products
2 records matched Longifolene + O3 → Products
1 record matched Cineole + O3 → Products
2 records matched α-Cedrene + O3 → Products
1 record matched H2C=C=O + O3 → Products
2 records matched CH2=C=CH2 + O3 → Products
4 records matched 1,2-Dihydroxy-4-methylbenzene + O3 → Products
1 record matched CH3CF3 + O3 → Products
1 record matched Thiirane + O3 → Products
1 record matched 1-Butene, 3,3,4,4,4-pentafluoro- + O3 → Products
1 record matched 2-C4F8 (unspecified) + O3 → Adduct
2 records matched C2HF3 + O3 → Products
1 record matched 1,3,5-Triazine + O3 → Products
2 records matched Azulene + O3 → Products
1 record matched Benzofuran + O3 → Products
1 record matched Dibenzodioxin + O3 → Products
2 records matched Acenaphthylene + O3 → Products
1 record matched (E)-CHCl=CHCl + O3 → Adduct
1 record matched (E)-CHCl=CHCl + O3 → Products
1 record matched (Z)-CHCl=CHCl + O3 → Adduct
1 record matched (CH3O)3PS + O3 → Products
1 record matched Cyclopentene + O3 → Other Products + ·OH
10 records matched Cyclopentene + O3 → Products
2 records matched (CH3)2C=CHC(=O)CH3 + O3 → Products
1 record matched n-Butyl acrylate + O3 → Products
7 records matched CH2=CHCOOC2H5 + O3 → Products
5 records matched Limonene + O3 → Products
1 record matched Dibenzofuran + O3 → Products
1 record matched 1,4-Naphthalenedione + O3 → Products
12 records matched beta-pinene + O3 → Products
1 record matched CH2=C(CH3)CN + O3 → Products
1 record matched (C2H5O)3PS + O3 → Products
1 record matched (CH3)2NH + O3 → Products
1 record matched CO2 + O2 + O· → CO2 + O3
1 record matched 1-C9H18 + O3 → Products
2 records matched CH3COCH2COCH3 + O3 → Products
4 records matched Myrcene + O3 → Products
1 record matched N,N-Dimethylbenzenamine + O3 → Products
2 records matched 2,5-Norbornadiene + O3 → Products
1 record matched P(OCH3)3 + O3 → Products
1 record matched (C2H5)3N + O3 → Products
4 records matched 1,2-Dihydroxybenzene + O3 → Products
2 records matched Indole + O3 → Products
1 record matched Isoquinoline + O3 → Products
1 record matched methyl salicylate + O3 → Products
1 record matched CF3CF=CF2 + O3 → Adduct
2 records matched CF3CF=CF2 + O3 → Products
2 records matched C2F4 + O3 → Adduct
1 record matched CH3C(O)C(OH)(CH3)2 + O3 → Products
3 records matched CH2=CHC(CH3)2OH + O3 → Products
2 records matched iso-C4H8 + O3 → Other Products + ·OH
15 records matched iso-C4H8 + O3 → Products
4 records matched CH3CH=CH2 + O3 → Other Products + ·OH
17 records matched CH3CH=CH2 + O3 → Products
2 records matched 1-Dodecene + O3 → Products
4 records matched 1,5-Cyclooctadiene (unspecified) + O3 → Products
1 record matched n-C4H9OCH2CH2OH + O3 → Products
4 records matched 1-C8H16 + O3 → Products
2 records matched n-C4H9OCH=CH2 + O3 → Products
1 record matched (CH3)2C=CHCH2CH2C(O)CH3 + O3 → Products
1 record matched Pyridine + O3 → Products
3 records matched Cyclohexene + O3 → Other Products + ·OH
14 records matched Cyclohexene + O3 → Products
3 records matched Thiophene + O3 → Products
1 record matched Furan + O3 → Products
1 record matched Pyrrole + O3 → Products
1 record matched C2H5ONO + O3 → C2H5ONO2 + O2
5 records matched CH2=CHOC2H5 + O3 → Products
1 record matched (C2H5)2NH + O3 → Products
9 records matched 1-C5H10 + O3 → Products
1 record matched (CH3)2CHCH2OCH=CH2 + O3 → Products
1 record matched 5-Hexen-2-one + O3 → Products
3 records matched Toluene + O3 → Products
3 records matched 1,3,5-Trimethylbenzene + O3 → Products
2 records matched 3-Methylphenol + O3 → Products
5 records matched 1,3-Dimethylbenzene + O3 → Products
1 record matched CH3CO2CH=CH2 + O3 → Other Products + Formic acetic anhydride
1 record matched CH3CO2CH=CH2 + O3 → Other Products + CH2O
5 records matched CH3CO2CH=CH2 + O3 → Products
1 record matched (CH3)2NCH2CH2OH + O3 → Products
1 record matched CH3OCH2CH(CH3)OH + O3 → Products
2 records matched (CH3)2C=CHCHO + O3 → Products
1 record matched ((CH3)3Si)2O + O3 → Products
2 records matched (CH3)3CCH=C(CH3)2 + O3 → Products
2 records matched (tert-C4H9)CH2C(CH3)=CH2 + O3 → Products
1 record matched (CHO)2 + O3 → Products
4 records matched CH2=CHCH2OH + O3 → Products
2 records matched CH2CHCN + O3 → Products
2 records matched CH2=CHCH2Cl + O3 → Products
6 records matched CH2=CHCHO + O3 → Products
2 records matched C2H5CCH + O3 → Products
2 records matched 1,3-Butadiene + O3 → Other Products + ·OH
1 record matched 1,3-Butadiene + O3 → Other Products + Ethenyloxirane
1 record matched 1,3-Butadiene + O3 → Other Products + CH2=CHCHO
6 records matched 1,3-Butadiene + O3 → Products
13 records matched 1-C4H8 + O3 → Products
1 record matched n-C4H10 + O3 → Products
2 records matched CH2=CHCH2Br + O3 → Products
2 records matched 4-Methylphenol + O3 → Products
3 records matched 1,4-Dimethylbenzene + O3 → Products
1 record matched 2,6-Octadien-1-ol, 3,7-dimethyl-, (E)- + O3 → Products
1 record matched 6-Octenal, 3,7-dimethyl- + O3 → Products
1 record matched Citronellol + O3 → Products
1 record matched 2-Vinylpyridine + O3 → Products
1 record matched Benzaldehyde + O3 → Products
2 records matched C6H5CH2Cl + O3 → Products
6 records matched Styrene + O3 → Products
2 records matched 1-Methyl-4-isopropylbenzene + O3 → Products
5 records matched α-Terpinene + O3 → Products
3 records matched γ-Terpinene + O3 → Products
1 record matched α-Phellandrene(R,S) + O3 → Products
1 record matched Nitrobenzene + O3 → Products
3 records matched 2-Phenylpropene + O3 → Products
1 record matched CH2=C(CH3)C(O)OCH2CH3 + O3 → Products
1 record matched CH2=CHCOOCH3 + O3 → Other Products + CH3COCOOH
1 record matched CH2=CHCOOCH3 + O3 → Other Products + CH2O
10 records matched CH2=CHCOOCH3 + O3 → Products
1 record matched ClCH2CHBrCH2Br + O3 → Products
1 record matched 1,2,4-Trimethylbenzene + O3 → Products
2 records matched 2-Methylphenol + O3 → Products
4 records matched 1,2-Dimethylbenzene + O3 → Products
6 records matched Indene + O3 → Products
1 record matched Biphenyl + O3 → Products
1 record matched 2-Methylnaphthalene + O3 → Products
1 record matched Quinoline + O3 → Products
2 records matched Naphthalene + O3 → Products
1 record matched 1-Methylnaphthalene + O3 → Products
2 records matched Caryophyllene + O3 → Products
1 record matched 9H-Fluorene + O3 → Products
1 record matched 1-Nitronaphthalene + O3 → Products
1 record matched Acenaphthylene, 1,2-dihydro- + O3 → Products
10 records matched CH2=C(CH3)COOCH3 + O3 → Products
4 records matched alpha-pinene + O3 → Other Products + ·OH
1 record matched alpha-pinene + O3 → Products + ·OH
12 records matched alpha-pinene + O3 → Products
3 records matched Camphene + O3 → Products
4 records matched CH2=C(CH3)COOH + O3 → Products
1 record matched CH2=CHCOOH + O3 → Other Products + OCHCOOH
1 record matched CH2=CHCOOH + O3 → Other Products + CH2O
4 records matched CH2=CHCOOH + O3 → Products
3 records matched CH3C(O)CHO + O3 → Products
1 record matched CH2=CHCOCH3 + O3 → Other Products + CH3C(O)CHO
1 record matched CH2=CHCOCH3 + O3 → Other Products + CH2O
1 record matched CH2=CHCOCH3 + O3 → Products + ·OH
9 records matched CH2=CHCOCH3 + O3 → Products
2 records matched C2H5COCH3 + O3 → Products
6 records matched Methacrolein + O3 → Products
3 records matched CH2=C(CH3)CH=CH2 + O3 → Other Products + ·OH
1 record matched CH2=C(CH3)CH=CH2 + O3 → Products + ·OH
16 records matched CH2=C(CH3)CH=CH2 + O3 → Products
3 records matched (CH3)2C=CHCH2CH2C(CH3)(OH)CH=CH2 + O3 → Products
1 record matched (C2H5)4Pb + O3 → Products
2 records matched Tricyclo[,6]deca-3,8-diene + O3 → Products
1 record matched Bicyclo[2.2.1]heptan-2-one,1,7,7-trimethyl- + O3 → Products
1 record matched (CH3)4Si + O3 → Products
1 record matched (CH3)4Pb + O3 → Products
1 record matched (CH3)3N + O3 → Products
2 records matched CH2=CF2 + O3 → Products
1 record matched CH3CHF2 + O3 → Products
2 records matched CH2=CCl2 + O3 → Products
1 record matched iso-C4H10 + O3 → Products
3 records matched (CH3)2S + O3 → Products
2 records matched CH3CHO + O3 → Products
2 records matched CH2=CHF + O3 → Products
1 record matched CH2=CHCl + O3 → Products
3 records matched CH3CCH + O3 → Products
2 records matched C3H8 + O3 → Products
1 record matched CH3NH2 + O3 → Products
8 records matched C2H2 + O3 → Products
1 record matched C2H4 + O3 → CH2O + CH2OO
3 records matched C2H4 + O3 → Other Products + ·OH
23 records matched C2H4 + O3 → Products
1 record matched C2H6 + O3 → Products
4 records matched CH4 + O3 → Products
2 records matched Benzene + O3 → Products
1 record matched (CH3)2SO2 + O3 → Products
1 record matched (CH3)2SO + O3 → Products
1 record matched CHCl3 + O3 → Products
1 record matched (CH3)2NNO + O3 → Products
1 record matched aniline + O3 → Products
1 record matched CH2O + O3 → Products
1 record matched CH3C(O)CH(CH3)CH2OH + O3 → Products
2 records matched O(1D) + O3 → O3 + O·
16 records matched O(1D) + O3 → O2 + O2
5 records matched O(1D) + O3 → Products
1 record matched O(1D) + O2 → O3
9 records matched O2(1DELTA) + O3 → O2 + O2 + O·
1 record matched O2(1DELTA) + O3 → Products
1 record matched O2(1DELTA) + O2 → O3 + O·
1 record matched C2F5C(O)O2 + HO2 → C2F5COOH + O3
2 records matched Cyclohexene, 4-acetyl-1-methyl- + O3 → Products
1 record matched CH3CH2CH2C(O)OO· + HO2 → n-C3H7COOH + O3
1 record matched C6H5C(O)O2 + HO2 → Benzoic acid + O3
1 record matched CH2=CHC(CH3)=CH2 + O3 → Products
1 record matched O(1S) + O3 → Products
1 record matched a-terpinene + O3 → Products
2 records matched CD2=CD-CD2OD + O3 → Products
1 record matched CH3CH(OOH)CH=CHCH=O + O3 → Products
1 record matched CH3CH2CH(OOH)CH=CHCH=O + O3 → Products
1 record matched (CH3)3COCH2· + O3 → Products
1 record matched (Z)-1,3,3,3-tetrafluoroprop-1-ene + O3 → Products
1 record matched E-CF3CFCHF + O3 → Products
1 record matched CH3C(CH3)2CH=CHCH=CH2 + O3 → Other Products + ·OH
4 records matched CH3C(CH3)2CH=CHCH=CH2 + O3 → Products
1 record matched CH2CHC(CH2)CH2CH2CHO + O3 → Products
1 record matched CH2CHC(CH3)CHCH2CHO + O3 → Products
1 record matched (3E)-4-methylhexa-3,5-dienal + O3 → Products
1 record matched O2(b1Sigma_g+) + O3 → Products
1 record matched O2(b1Sigma_g+) + N2O → Other Products + O3
1 record matched O3 + CH3CH(·)OO· → CH3CHO + O2 + O2
1 record matched O3 + CH3SOO → O2 + CH3SO3
2 records matched O3 + Cl → O2 + ClO
1 record matched O3 + O· → O2 + O2
1 record matched O3 + D → O2 + OD
1 record matched O3 + O2F → O2 + O2 + OF
1 record matched O3 + ·F → O2 + OF
1 record matched O3 + HNO → O2 + HNO2
1 record matched O3 + HNO → Products
1 record matched O3 + HNO → HO3 + NO
1 record matched O3 + SH → O2 + HSO
1 record matched O3 + NH2O → Products
2 records matched O3 + H· → ·OH + O2
1 record matched O3 + H· → HO2 + O·
1 record matched O3 + H· → Products
1 record matched O3 + H· → O2(1DELTA) + ·OH
1 record matched O3 + NO3 → O2 + O2 + NO2
2 records matched O3 + NO2 → O2 + NO3
1 record matched O3 + NO2 → O2 + O2 + NO
2 records matched O3 → O2 + O·
1 record matched H2S + O3 → Products
4 records matched O2 + O· → O3
1 record matched CH3CH2CH + O3 → Products
1 record matched d-Limonene + O3 → d-lemonene 1-endo-molozonide
1 record matched d-Limonene + O3 → d-lemonene 2-endo-molozonide
1 record matched d-Limonene + O3 → d-lemonene 1-exo-molozonide
1 record matched d-Limonene + O3 → d-lemonene 2-exo-molozonide
1 record matched C6H5CH2OO + O3 → O2 + O2 + C6H5CH2O
1 record matched (CH3)3CO2 + O3 → (CH3)3CO + O2 + O2
1 record matched ·OH + BrO2 → O3 + HBr
1 record matched ·OH + CF3O2 → CHF3 + O3
3 records matched ·OH + O3 → HO2 + O2
2 records matched HO2 + CF3C(O)OO(·) → CF3COOH + O3
1 record matched HO2 + CF3CFHO2· → CF3CHO + HF + O3
1 record matched HO2 + CF3CFHO2· → CF3CFHOH + O3
2 records matched HO2 + CH3C(O)CH2OO· → CH3C(O)CH2OH + O3
1 record matched HO2 + CH2ClO2 → O3 + ClCH2OH
3 records matched HO2 + CH3C(O)OO(·) → CH3C(O)OH + O3
1 record matched HO2 + ClO → HCl + O3
1 record matched HO2 + O3 → ·OH + O2 + O2
1 record matched HO2 + O3 → Other Products + ·OH
1 record matched HO2 + O3 → HO3 + O2
1 record matched C2H5OO· + O3 → CH3CH2O· + O2 + O2
1 record matched C2H5OO· + HO2 → C2H5OH + O3
1 record matched C2H3 + O3 → O2 + HOCH=CH
1 record matched C2H3 + O3 → CH3CO + O2
1 record matched C2H3 + O3 → Products
1 record matched C2H3 + O3 → CH2C(·)OH + O2
1 record matched HCO + O3 → CO2 + O2 + H·
1 record matched ·CH3 + O3 → CH3O· + O2
1 record matched Cyclohexyldioxyl + O3 → cyc-[CH(O·)CH2CH2CH2CH2CH2] + O2 + O2
2 records matched CH3O2· + ClO → CH3Cl + O3
1 record matched CH3O2· + O3 → CH3O· + O2 + O2
1 record matched ·C2H5 + O3 → CH3CH2O· + O2
1 record matched (Z)-Cycloheptene + O3 → Products
1 record matched 2,5-Dimethylfuran + O3 → Products
1 record matched (CH3S)2 + O3 → Products
1 record matched (E)-2-C4H8 + O3 → Products
4 records matched CH3F + O3 → HO3 + ·CH2F
1 record matched (CH3)2C=C(CH3)2 + O3 → Products
1 record matched N2H4 + O3 → Products
1 record matched Cyclopentene + O3 → Products
1 record matched beta-pinene + O3 → Bicyclo[3.1.1]heptan-2-one, 6,6-dimethyl- + CH2OO
1 record matched beta-pinene + O3 → Bicyclo[3.1.1]heptane, 6,6-dimethyl-2-peroxy- + CH2O
1 record matched beta-pinene + O3 → Bicyclo[3.1.1]heptane, 6,6-dimethyl-(2,2-peroxy-) + CH2O
1 record matched beta-pinene + O3 → 1-methyl-1-(3-cyclohexenyl,4-peroxy) ethyl + CH2O
1 record matched beta-pinene + O3 → 4-oxabicyclo[4.1.1]octan-3-one, 7,7-dimethyl + CH2O
1 record matched beta-pinene + O3 → Bicyclo[3.1.1]heptan-2-one, 6,6-dimethyl, 3-yl + CH2O + ·OH
1 record matched beta-pinene + O3 → Bicyclo[3.1.1]heptan-2-one, 6,6-dimethyl, 1-yl + CH2O + ·OH
1 record matched iso-C4H8 + O3 → (CH3)2CO + CH2OO
1 record matched iso-C4H8 + O3 → CH2O + (CH3)2C(·)OO·
1 record matched CH3CH=CH2 + O3 → CH3CHO + CH2OO
1 record matched CH3CH=CH2 + O3 → CH2O + CH3CH(·)OO·
1 record matched Cyclohexene + O3 → Products
1 record matched Pyrrole + O3 → Products
1 record matched Phenol + O3 → Phenol primary 3,4-ozonide
1 record matched Phenol + O3 → Phenol primary 2,3-ozonide
1 record matched Phenol + O3 → Phenol primary 1,2-ozonide
1 record matched Phenol + O3 → 1,2-Dihydroxybenzene + O2
1 record matched CH3CH=CHCH3 + O3 → 1,2-dimethylmolozonide
1 record matched 2-Furancarboxaldehyde + O3 → Products
1 record matched Caryophyllene + O3 → Products
1 record matched CH2=C(CH3)CH=CH2 + O3 → 1-methyl-1-ethenyl-2,3,4-trioxacyclopentane
1 record matched CH2=C(CH3)CH=CH2 + O3 → 1-(propen-2-yl)-2,3,4-trioxacyclopentane
1 record matched (CH3)2S + O3 → (CH3)2SO + O2
4 records matched CH2F2 + O3 → HO3 + ·CHF2
2 records matched CH3CHO + O3 → HO3 + *CH2C(O)H
2 records matched CH3CHO + O3 → HO3 + CH3CO
2 records matched CH2=CHF + O3 → C2H3FO3
2 records matched CH2=CHCl + O3 → C2H3ClO3
1 record matched C2H2 + O3 → Products
1 record matched C2H2 + O3 → 1,2,3-Trioxolene
2 records matched C2H4 + O3 → 1,2,3-Trioxolane
1 record matched C2H4 + O3 → Products
1 record matched CH4 + O3 → Products
2 records matched CH4 + O3 → HO3 + ·CH3
2 records matched Benzene + O3 → Benzene primary ozonide
1 record matched (CH3)2SO + O3 → Products
1 record matched CH3NHNH2 + O3 → Products
1 record matched (CH3)2NNH2 + O3 → Products
1 record matched CH2O + O3 → HCOOH + O2
1 record matched CH2O + O3 → HO3 + HCO
2 records matched cis-HONO + O3 → O2(1DELTA) + HNO3
2 records matched trans-HONO + O3 → O2(1DELTA) + HNO3
1 record matched OH(v=4) + O3 → HO2 + O2
1 record matched OH(v=4) + O3 → HO2 + ·OH + O2 + H· + O·
1 record matched OH(v=4) + O3 → Products
1 record matched OH(v=2) + O3 → HO2 + O2
1 record matched OH(v=2) + O3 → HO2 + ·OH + O2 + H· + O·
1 record matched OH(v=2) + O3 → Products
1 record matched OH(v=1) + O3 → HO2 + O2
1 record matched OH(v=1) + O3 → HO2 + ·OH + O2 + H· + O·
1 record matched OH(v=1) + O3 → Products
2 records matched O(3P) + O2 + O2 → O2 + O3
2 records matched O(3P) + N2 + O2 → N2 + O3
1 record matched (CH3)2S-H2O complex + O3 → (CH3)2SO + H2O + O2
1 record matched (CH3)2S-(H2O)2 complex + O3 → (CH3)2SO + H2O + H2O + O2
1 record matched (CH3)2S-(H2O)3 complex + O3 → (CH3)2SO + H2O + H2O + H2O + O2
1 record matched cis-ClOOO → O3 + Cl
1 record matched C6H5C(CH3)2OO· + O3 → C6H5C(O*)(CH3)2 + O2 + O2
1 record matched c-C6H10(CH3)OO· + O3 → c-C6H10(CH3)O· + O2 + O2
1 record matched (CH3)2C(OO·)CH2CH3 + O3 → CH3CH2C(CH3)2O(·) + O2 + O2
1 record matched O3 + (E)-3-C6H12 → C2H5CH(OH)C(O)C2H5
1 record matched (E)-2-C4H8 + O3 → CH3CH(OH)C(O)CH3
1 record matched (E)-2-C4H8 + O3 → CH3CH(OH)CH(OH)CH3
2 records matched alpha-pinene + O3

Search returned 1907 records.