Click on a link in the table below to see detail on the selected reaction.
| Records |
|
Reaction |
| 1 record matched | | C6H5CH=NOH → Benzonitrile + H2O |
| 1 record matched | | Benzonitrile + O· → Products |
| 1 record matched | | Benzonitrile + H· → HCN + Phenyl |
| 1 record matched | | Benzonitrile + H· → CN + Benzene |
| 1 record matched | | Benzonitrile + H· → Other Products + H· |
| 2 records matched | | Benzonitrile + H· → Products |
| 1 record matched | | Benzonitrile + ·OH → Other Products + H2O |
| 1 record matched | | Benzonitrile → Other Products + H· |
| 2 records matched | | Benzonitrile → Products |
| 1 record matched | | 4-benzylideneimino-2-cyanoethyl-1,2,4-triazol-3(2H)-one → 2-cyanoethyl-1,2,4-triazol-3(2H)-one + Benzonitrile |
| 1 record matched | | 4-benzylideneimino-2-cyanoethyl-1,2,4-triazol-3(2H)-thione → 2-cyanoethyl-1,2,4-triazol-3(2H)-thione + Benzonitrile |
| 1 record matched | | 4-benzylideneimino-2-N-tetra-O-acetyl-D-glucosyl-1,2,4-triazol-3(2H)-thione → tetra-O-acetyl-D-glucosyl-1,2,4-triazol-3(2H)-thione + Benzonitrile |
| 1 record matched | | C6H5C(O)NHN=CHC6H5 → Benzamide + Benzonitrile |
| 1 record matched | | p-CH3-C6H4-C(O)NHN=CHC6H5 → Benzonitrile + Benzamide, 4-methyl- |
| 1 record matched | | p-CH3O-C6H4-C(O)NHN=CHC6H5 → Benzonitrile + Benzamide, 4-methoxy- |
| 1 record matched | | ClC6H4C(O)NHN=CHC6H5 → Benzonitrile + Benzamide, 4-chloro- |
| 1 record matched | | NO2C6H4C(O)NHN=CHC6H5 → Benzonitrile + Benzamide, 4-nitro- |
| 1 record matched | | C6H5C(O)N(CH3)N=CHC6H5 → Benzonitrile + Benzamide, N-methyl- |
| 1 record matched | | p-CH3-C6H4-C(O)N(CH3)N=CHC6H5 → p-CH3-C6H4-C(O)NHCH3 + Benzonitrile |
| 1 record matched | | p-CH3O-C6H4-C(O)N(CH3)N=CHC6H5 → p-CH3O-C6H4-C(O)NHCH3 + Benzonitrile |
| 1 record matched | | ClC6H4C(O)N(CH3)N=CHC6H5 → p-Cl-C6H4-C(O)NHCH3 + Benzonitrile |
| 1 record matched | | NO2C6H4C(O)N(CH3)N=CHC6H5 → p-NO2-C6H4-C(O)NHCH3 + Benzonitrile |
| 1 record matched | | C6H5C(S)N(CH3)N=CHC6H5 → C6H5C(S)NHCH3 + Benzonitrile |
| 1 record matched | | C6H5C(O)N(C6H5)N=CHC6H5 → Benzamide, N-phenyl- + Benzonitrile |
| 1 record matched | | C6H5C(O)N(CH2C6H5)N=CHC6H5 → Benzonitrile + N-Benzylbenzamide |
| 1 record matched | | C6H5C(O)N(CH2CH=CH2)N=CHC6H5 → Benzonitrile + Benzamide, n-allyl- |
| 1 record matched | | 4-benzylideneimino-1,2,4-triazol-3(2H)-one → 3-hydroxy-(2H)-1,2,4-triazole + Benzonitrile |
| 1 record matched | | 4-p-chlorobenzylideneimino-1,2,4-triazol-3(2H)-thione → 3-mercapto-(2H)-1,2,4-triazole + Benzonitrile |