Kinetics Database Logo

Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences

Feedback

Rate Our Products and Services

Help


Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty

More...


Administrative Links

NIST home page

MML home page

Chemical and Biochemical Reference Data Division

MML home page

Chemical and Biochemical Reference Data Division

  NIST Logo Home
©NIST, 2013
Accessibility information

Search Results


Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
1 record matched NO2 + HNO → cis-HONO + NO
1 record matched NO + HCCO → Products
1 record matched NO + NH2 → N2 + H2O
1 record matched NO + NH2 → ·OH + HN=N
1 record matched NO + H· → HNO
1 record matched NO + Cyclohexadienyl, 6-hydroxy- → Products
1 record matched cis-HONO + NO → NO2 + HNO
1 record matched CCl2 (A 1B1) + NO → Products
9 records matched INO + INO → I2 + NO + NO
1 record matched O· + NCO → CO + NO
1 record matched HNO + NCO → HN=C=O + NO
1 record matched HNO + O· → ·OH + NO
3 records matched HNO → NO + H·
1 record matched NH + O· → NO + H·
1 record matched NH2 + O· → H2 + NO
1 record matched H· + HNO → H2 + NO
1 record matched NO3 → O2 + NO
4 records matched N2O3 → NO + NO2
5 records matched NO2 + HSO → NO + HSO2
2 records matched NO2 + CH3S(O) → NO + CH3SOO
1 record matched NO2 + CH3SO → NO + CH3SOO
8 records matched NO2 + O· → O2 + NO
1 record matched NO2 + HNO → HNO2 + NO
8 records matched NO2 + SH → NO + HSO
7 records matched NO2 + SO → SO2 + NO
4 records matched NO2 + H· → ·OH + NO
2 records matched NO2 + NO3 → O2 + NO + NO2
1 record matched NO2 + NO2 → NO + NO3
1 record matched NO2 + NO2 → O2 + NO + NO
4 records matched NO2 → NO + O·
2 records matched NO + CF3CF2OO· → NO2 + CF3OCF2(·)
1 record matched NO + CHF2CF2OO → NO2 + CF3CFHO
1 record matched NO + CHF2CF2OO → CHF2OCF2· + NO2
1 record matched NO + CHF2CF2OO → CHF2CF2O + NO2
2 records matched NO + CHF2OO → NO2 + CHF2O(·)
2 records matched NO + CF2ClCH2OO· → CF2ClCH2O(.) + NO2
2 records matched NO + CFCl2CH2OO(·) → CFCl2CH2O· + NO2
1 record matched NO + CF3CFHO2· → NO2 + CF3CFHO
2 records matched NO + CF3CCl2OO(·) → NO2 + CF3CCl2O(·)
1 record matched NO + CH2FO2 → NO2 + CH2FO(.)
1 record matched NO + CH2FO2 → Other Products + NO2
1 record matched NO + CH2BrOO → CH2O + Br· + NO2
2 records matched NO + CH2BrOO → CH2BrO + NO2
7 records matched NO + CClF2OO → NO2 + CF2ClO
1 record matched NO + CClF2OO → COF2 + NO2 + Cl
1 record matched NO + CH3CH2C(O)OO → NO2 + CH3CH2C(O)O
1 record matched NO + CH3CH2C(O)OO → CO2 + ·C2H5 + NO2
4 records matched NO + CH2ClO2 → NO2 + CH2ClO
7 records matched NO + CCl2FO2 → NO2 + CFCl2O
1 record matched NO + CCl2FO2 → COClF + NO2 + Cl
7 records matched NO + CCl3O2 → NO2 + CCl3O
1 record matched NO + CCl3O2 → COCl2 + NO2 + Cl
1 record matched NO + CCl3O2 → Products
8 records matched NO + HSO → Products
5 records matched NO + CH3SOO → Products
1 record matched NO + HCCO → HCN + CO2
1 record matched NO + HCCO → -10202 + CO
4 records matched NO + n-C3H7O2 → NO2 + n-C3H7O
2 records matched NO + n-C3H7O2 → n-C3H7ONO2
2 records matched NO + HOCH2CH2O2· → NO2 + HOCH2CH2O
3 records matched NO + CH3C(O)OO(·) → NO2 + CH3C(O)O
2 records matched NO + CH3C(O)OO(·) → CO2 + ·CH3 + NO2
2 records matched NO + CH3C(O)OO(·) → Products
1 record matched NO + CH3CH2CH(CH3)O → CH3CH2CH(CH3)ONO
1 record matched NO + n-C5H11O· → n-C5H11ONO
1 record matched NO + (CH3)2CHCH2O → (CH3)2CHCH2ONO
3 records matched NO + Cl → NOCl
4 records matched NO + NCO → Products
4 records matched NO + CF3O → COF2 + FNO
1 record matched NO + n-C4H9O → n-C4H9ONO
4 records matched NO + N → N2 + O·
16 records matched NO + O· → NO2
5 records matched NO + O· → O2 + N
8 records matched NO + OClO → NO2 + ClO
7 records matched NO + CF3O2 → NO2 + CF3O
1 record matched NO + CF3O2 → Products
5 records matched NO + ·CH2SH → Products
1 record matched NO + n-C3H7O → n-C3H7ONO
8 records matched NO + BrO → Br· + NO2
6 records matched NO + O2F → O2 + FNO
9 records matched NO + ClO → NO2 + Cl
4 records matched NO + ·F → FNO
8 records matched NO + IO → NO2 + I
1 record matched NO + IO → Products
1 record matched NO + I + INO → Products
14 records matched NO + I → INO
2 records matched NO + HNO → ·OH + N2O
12 records matched NO + SH → HSN=O
7 records matched NO + NH → Products
1 record matched NO + NH2 → N2 + H2O
1 record matched NO + NH2 → ·OH + HN=N
10 records matched NO + NH2 → Products
2 records matched NO + Iodine dioxide → NO2 + IO
1 record matched NO + C2H5C(CH3)2O(·) → C2H5C(CH3)2ONO
2 records matched NO + NaO → Na + NO2
2 records matched NO + H· → HNO
1 record matched NO + H· → NH + O·
4 records matched NO + H· → ·OH + N
2 records matched NO + Cl2O2 → Products
8 records matched NO + OF → NO2 + ·F
2 records matched NO + NaO2 → NO2 + NaO
9 records matched NO + NO3 → NO2 + NO2
4 records matched NO + NO2 → N2O3
1 record matched NO + NO → N2O + O·
3 records matched NO → O· + N
3 records matched O3 + N → O2 + NO
7 records matched O3 + NO → O2 + NO2
1 record matched N2O + NCO → CO + N2 + NO
3 records matched N2O + O· → NO + NO
3 records matched HNO2 → ·OH + NO
6 records matched O2 + N → NO + O·
5 records matched O2 + NO + NO → NO2 + NO2
1 record matched F2 + NO → FNO + ·F
2 records matched N2 + O· → NO + N
2 records matched C + NO → Products
9 records matched CH3S· + NO2 → NO + CH3SO
8 records matched CH3S· + NO → CH3SNO
2 records matched CH3S· + NO → Products
2 records matched CH3S· + NO → M + CH3SNO
4 records matched (CH3)2CHO2 + NO → i-C3H7O + NO2
2 records matched (CH3)2CHO2 + NO → (CH3)2CHONO2
1 record matched (CH3)2CHO2 + NO → Products
2 records matched i-C3H7O + NO → i-C3H7ONO
1 record matched i-C3H7O + NO → 2-nitropropane
2 records matched i-C3H7O + NO → (CH3)2CO + HNO
1 record matched (CH3)3CO2 + NO → Products
3 records matched ·OH + N → NO + H·
1 record matched ·OH + HNO → H2O + NO
2 records matched ·OH + NO2 → HO2 + NO
16 records matched ·OH + NO → HNO2
2 records matched ·OH + NO → cis-HONO
1 record matched ·CH + NO → Products
9 records matched HO2 + NO → ·OH + NO2
4 records matched C2H5OO· + NO → CH3CH2O· + NO2
2 records matched C2H5OO· + NO → C2H5ONO2
3 records matched C2H5OO· + NO → Products
6 records matched CS + NO2 → COS + NO
2 records matched NOCl + Cl → Cl2 + NO
1 record matched NOCl + O· → NO + ClO
1 record matched NOCl + H· → HCl + NO
1 record matched NOCl → NO + Cl
1 record matched HCO + HNO → CH2O + NO
1 record matched HCO + NO2 → CO2 + NO + H·
1 record matched HCO + NO → CO + HNO
1 record matched ·CH3 + NO2 → CH3O· + NO
7 records matched CH3CH2O· + NO → C2H5ONO
2 records matched CH3CH2O· + NO → CH3CHO + HNO
12 records matched CH3O· + NO → CH3ONO
3 records matched CH3O· + NO → CH2O + HNO
8 records matched CH3O2· + NO → CH3O· + NO2
2 records matched CH3O2· + NO → Products
1 record matched ·C2H + NO → Products
1 record matched H2 + NO → H· + HNO
2 records matched CO + NO2 → CO2 + NO
1 record matched CN + HNO → HCN + NO
1 record matched CN + NO2 → NO + NCO
1 record matched CN + NO → N + NCO
3 records matched CN + NO → ONCN
1 record matched CN + NO → CO + N2
1 record matched CN + N2O → CNN + NO
1 record matched CH2O + NO → HCO + HNO
4 records matched O(1D) + N2O → NO + NO
2 records matched O2(1DELTA) + N → NO + O·
6 records matched CH3SCH2OO· + NO → CH3SCH2O· + NO2
2 records matched CH2FCHFO2· + NO → CH2FCHFO· + NO2
2 records matched M + N2O3 → M + NO + NO2
2 records matched M + NO + O· → M + NO2
1 record matched M + NO + I → M + INO
3 records matched M + NO + SH → M + HSN=O
2 records matched M + NO + NO2 → M + N2O3
3 records matched M + CH3S· + NO → M + CH3SNO
2 records matched M + ·OH + NO → M + HNO2
1 record matched N(2D) + NO → N2 + O·
1 record matched N(2D) + N2O → N2 + NO
1 record matched N(2D) + O2 → O(3P) + NO
1 record matched N(2D) + CO2 → CO + NO
1 record matched N(2P) + NO → Products
1 record matched N(2P) + O2 → NO + O·
3 records matched O(1D) + N2O → NO + NO
1 record matched N2(A3Sigma_u+) + NO → NO(A2Sigma+) + N2
1 record matched CF(O)NO → FCO + NO
1 record matched CH3C(O)NO → CH3CO + NO
4 records matched INO + INO → I2 + NO + NO
1 record matched Nitrous acid phenyl ester → C6H5O + NO
2 records matched O· + HN=N → NO + NH
5 records matched O· + NCO → CO + NO
9 records matched O· + N → NO
1 record matched CF2NO → ·CF2 + NO
1 record matched ClO + N → NO + Cl
4 records matched I + INO → I2 + NO
2 records matched ·N3 + O· → N2 + NO
2 records matched HNO + O· → ·OH + NO
1 record matched HNO + HNO → NO + NHOH
1 record matched NH2 + O· → H2 + NO
1 record matched NOBr → Br· + NO
1 record matched NH2O + Hyponitrous acid → NH2OH + NO + HNO
1 record matched H· + Hyponitrous acid → H2 + NO + HNO
8 records matched H· + HNO → H2 + NO
1 record matched NCl + O· → NO + Cl
2 records matched NO3 → O2 + NO
1 record matched NO2 + CCl2=CCl → NO + ·CCl2C(O)Cl
1 record matched NO2 + CCl2=CCl → CO + ·CCl3 + NO
1 record matched NO2 + CCl2=CCl → CCl3C(O)(.) + NO
2 records matched NO2 + C2H5N(O)=CHCH3 → Other Products + NO
2 records matched NO2 + HSO → NO + HSO2
1 record matched NO2 + HCCO → CO + HCO + NO
2 records matched NO2 + CH3S(O) → NO + CH3SOO
1 record matched NO2 + NCO → CO + NO + NO
1 record matched NO2 + N → NO + NO
35 records matched NO2 + O· → O2 + NO
1 record matched NO2 + D → NO + OD
1 record matched NO2 + SF → NO + SOF
1 record matched NO2 + CH3CH2CO → CO2 + ·C2H5 + NO
1 record matched NO2 + (CH3)2N → (CH3)2NO + NO
1 record matched NO2 + SCl → NO + OSCl
1 record matched NO2 + ·N3 → N2 + NO + NO
6 records matched NO2 + SH → NO + HSO
5 records matched NO2 + SO → SO2 + NO
1 record matched NO2 + SD → NO + DSO
1 record matched NO2 + NH → NO + HNO
2 records matched NO2 + NH2 → NO + NH2O
1 record matched NO2 + BF → NO + OBF
17 records matched NO2 + H· → ·OH + NO
5 records matched NO2 + NO3 → O2 + NO + NO2
4 records matched NO2 + NO2 → NO + NO3
9 records matched NO2 + NO2 → O2 + NO + NO
16 records matched NO2 → NO + O·
1 record matched NO2 → O(1D) + NO
1 record matched NO + CH2=CHC(CH3)(OH)CH2(·) → CH3C(CH2NO)(OH)CH=CH2
1 record matched NO + CCl3CH2OO(·) → Products
1 record matched NO + CF3CFOO(.)CF3 → NO2 + (CF3)2CFO(·)
1 record matched NO + c-COC → CO + NCO
1 record matched NO + CF3CFClOO(·) → NO2 + CF3CFClO(.)
1 record matched NO + CF3CFClOO(·) → Products
1 record matched NO + CF3CF2OO· → NO2 + CF3OCF2(·)
1 record matched NO + CF3CF2OO· → Products
1 record matched NO + CF3CH2OO(·) → Products
1 record matched NO + CF3CH2OO(·) → CF3OCH2(.) + NO2
1 record matched NO + SiH3NO → Products
1 record matched NO + CHF2CF2OO → Products
1 record matched NO + CHF2OO → Products
2 records matched NO + CF3C(O)OO(·) → NO2 + CF3C(O)O
1 record matched NO + CF2ClCH2OO· → Products
1 record matched NO + CFCl2CH2OO(·) → Products
1 record matched NO + CFCl2CH2OO(·) → CFCl2CH2O· + NO2
3 records matched NO + CF3CFHO2· → NO2 + CF3CFHO
1 record matched NO + CF3CCl2OO(·) → NO2 + CF3CCl2O(·)
1 record matched NO + CH2ClCHClO2 → Products
2 records matched NO + CS2OH → Products
1 record matched NO + 1,3,5-Trioxan-2-yldioxy- → Products
1 record matched NO + 1,4-Dioxan-2-yldioxy → Products
1 record matched NO + CH2FO2 → Products
1 record matched NO + CH2BrOO → CH2BrO + NO2
1 record matched NO + FC(O)OO → NO2 + FC(O)O·
2 records matched NO + CD3O2· → CD3O + NO2
2 records matched NO + CClF2OO → NO2 + CF2ClO
1 record matched NO + 2,4-Cyclohexadienylperoxy, 6-hydroxy- → Products
1 record matched NO + DOC(O)· → Products
3 records matched NO + FC(O)O· → CO2 + FNO
3 records matched NO + CH3CH2C(O)OO → NO2 + CH3CH2C(O)O
1 record matched NO + CH3C(O)CH2OO· → CH3C(O)CH2O· + NO2
1 record matched NO + CF3CClHOO(.) → NO2 + CF3CClHO(.)
1 record matched NO + C2H5CH(CH3)CH(CH3)O2 → C2H5CH(CH3)CH(CH3)ONO2
1 record matched NO + CD2OH → Products
5 records matched NO + CH3C=C=CH2 → Products
1 record matched NO + CH2ClO2 → NO2 + CH2ClO
1 record matched NO + CH3OCH2O2 → NO2 + CH3OCH2
1 record matched NO + HOCH2O → Products
3 records matched NO + CCl2FO2 → NO2 + CFCl2O
1 record matched NO + CH3CH(OH)CH2O2 → 1,2-Propanediol 1-nitrate
2 records matched NO + CCl3O2 → NO2 + CCl3O
1 record matched NO + SF5O2 → NO2 + SF5O
2 records matched NO + SiD3 → SiD3NO
1 record matched NO + HOC(CH3)2CH2OO(·) → NO2 + n-C4H9O2
1 record matched NO + HN=NO. → NO2 + HN=N
1 record matched NO + HN=NO. → N2 + HNO2
1 record matched NO + HSO → Products
1 record matched NO + ·CH2 → C(O)NH2
1 record matched NO + ·CH2 → HN=C=O + H·
2 records matched NO + ·CH2 → HCN + ·OH
5 records matched NO + ·CH2 → Products
1 record matched NO + ·CH2 → -10202 + H·
1 record matched NO + CH3SOO → Products
1 record matched NO + CH3ICl → Products
1 record matched NO + n-C3H7CH(C2H5)O2 → n-C3H7CH(C2H5)NO3
1 record matched NO + CH3(CH2)3CH2OO → Nitric acid, pentyl ester
1 record matched NO + CH3(CH2)3CH2OO → 1-pentoxy radical + NO2
2 records matched NO + HCCO → CO + HC-N=O
3 records matched NO + HCCO → HCN + CO2
1 record matched NO + HCCO → Other Products + CO
1 record matched NO + HCCO → Other Products + CO2
5 records matched NO + HCCO → Products
1 record matched NO + HCCO → -10202 + CO
1 record matched NO + n-C3H7O2 → Products
1 record matched NO + (n-C3H7)2CHO2 → Adduct
1 record matched NO + n-C5H11CH(C2H5)O2 → n-C5H11CH(C2H5)NO3
1 record matched NO + n-C4H9CH(C2H5)O2 → n-C4H9CH(C2H5)NO3
2 records matched NO + (C2H5)2CHO2 → (C2H5)2CHNO3
1 record matched NO + CH3(CH2)3CH(CH3)OO → n-C4H9CH(CH3)NO3
2 records matched NO + n-C3H7CH(CH3)O2 → n-C3H7CH(CH3)NO3
1 record matched NO + n-C3H7CH(CH3)O2 → Products
1 record matched NO + HOCH2CH2O2· → Products
1 record matched NO + CCl3CCl2O2 → NO2 + C2Cl5O
8 records matched NO + CH3C(O)OO(·) → NO2 + CH3C(O)O
2 records matched NO + CH3C(O)OO(·) → CO2 + ·CH3 + NO2
2 records matched NO + Benzoyldioxy radical → Methoxy, oxophenyl- + NO2
1 record matched NO + HOSO2 → Products
1 record matched NO + CH3(CH2)4CH(CH3)OO· → n-C5H11CH(CH3)ONO2
1 record matched NO + (CH3)3CCH2OO → Products
1 record matched NO + HOCH2OO → NO2 + HOCH2O
2 records matched NO + CH3CH2CH(CH3)O → C2H5COCH3 + HNO
1 record matched NO + CH3CH2CH(CH3)O → Products
1 record matched NO + (CH3)2CHCH2O → (CH3)2CHCHO + HNO
2 records matched NO + (CH3)2CHS → iso-C3H7SNO
1 record matched NO + Na2 → Products
1 record matched NO + CDO → CO + DNO
2 records matched NO + S2 → Products
26 records matched NO + Cl → NOCl
8 records matched NO + NCO → CO + N2O
2 records matched NO + NCO → CO + N2 + O·
6 records matched NO + NCO → CO2 + N2
9 records matched NO + NCO → Products
11 records matched NO + CF3O → COF2 + FNO
3 records matched NO + CF3O → Products
2 records matched NO + BrO2 → NO2 + BrO
1 record matched NO + n-C8H17O2 → CH3(CH2)6CH2ONO2
2 records matched NO + n-C7H15O2 → n-C7H15ONO2
2 records matched NO + Cylopentyldioxy- → Products
1 record matched NO + C2H5CH(CH3)O2 → C2H5CH(CH3)ONO2
1 record matched NO + n-C4H9O → n-C3H7CHO + HNO
22 records matched NO + N → N2 + O·
52 records matched NO + O· → NO2
5 records matched NO + O· → O2 + N
1 record matched NO + O· → Products
3 records matched NO + OClO → NO2 + ClO
3 records matched NO + CF3O2 → CF3ONO2
10 records matched NO + CF3O2 → NO2 + CF3O
1 record matched NO + CF3O2 → ·CF3 + NO2
1 record matched NO + ·CH2SH → Products
2 records matched NO + D → DNO
1 record matched NO + (CH3)3Si· → (CH3)3SiNO
2 records matched NO + n-C3H7O → C2H5CHO + HNO
1 record matched NO + n-C3H7O → Products
1 record matched NO + SF → Products
1 record matched NO + SCN → Products
5 records matched NO + BrO → Br· + NO2
1 record matched NO + O2F → O2 + FNO
1 record matched NO + O2F → Products
1 record matched NO + (CH3)2N → (CH3)2NNO
2 records matched NO + ND → N2O + D
1 record matched NO + SCl → Products
8 records matched NO + ClO → NO2 + Cl
1 record matched NO + SiBr2 → Products
4 records matched NO + CH3CH2S → C2H5SNO
6 records matched NO + ·F → FNO
6 records matched NO + IO → NO2 + I
2 records matched NO + IO → Products
2 records matched NO + ClONO2 → Products
20 records matched NO + I → INO
1 record matched NO + CHBr2 → CHBr2NO
3 records matched NO + ·N3 → N2 + N2O
1 record matched NO + HNO → ·OH + N2O
2 records matched NO + HNO → Products
1 record matched NO + HgH → Hg + HNO
3 records matched NO + SH → HSN=O
1 record matched NO + SH → HN=S=O
2 records matched NO + SH → Products
6 records matched NO + SiH2 → Products
1 record matched NO + CD → D + NCO
1 record matched NO + CD → DCN + O·
1 record matched NO + CD → CN + OD
1 record matched NO + CD → Products
1 record matched NO + SiH → SiO + NH
1 record matched NO + NH → O· + HN=N
8 records matched NO + NH → N2O + H·
6 records matched NO + NH → ·OH + N2
13 records matched NO + NH → Products
18 records matched NO + NH2 → N2 + H2O
17 records matched NO + NH2 → ·OH + HN=N
2 records matched NO + NH2 → ·OH + N2 + H·
1 record matched NO + NH2 → H2 + N2O
2 records matched NO + NH2 → Other Products + ·OH
25 records matched NO + NH2 → Products
1 record matched NO + BF → N + OBF
7 records matched NO + BH → Products
1 record matched NO + GeH3 → Adduct
1 record matched NO + GeH3 → Products
3 records matched NO + SiH3 → SiH3NO
2 records matched NO + SiH3 → Products
1 record matched NO + PH2 → Products
2 records matched NO + DO2 → NO2 + OD
1 record matched NO + SiCl2 → Products
1 record matched NO + BrNO2 → NO2 + NOBr
1 record matched NO + HOBr → Products
1 record matched NO + Iodine dioxide → NO2 + IO
3 records matched NO + ·CHF → Products
2 records matched NO + ClNO2 → NOCl + NO2
1 record matched NO + BH3 → Products
1 record matched NO + Mo2 → Products
1 record matched NO + NaO → Na + NO2
24 records matched NO + H· → HNO
7 records matched NO + H· → ·OH + N
1 record matched NO + Cl2O2 → Products
1 record matched NO + NCl → N2O + Cl
1 record matched NO + Cyclohexadienyl → Products
1 record matched NO + Cyclohexadienyl → nitrosocyclohexadiene
1 record matched NO + TiO → Products
2 records matched NO + C3 → Products
1 record matched NO + C2O → CN + CO2
4 records matched NO + C2O → Products
1 record matched NO + C2 → C2O + N
1 record matched NO + C2 → CC≡N + O·
2 records matched NO + C2 → Products
2 records matched NO + OF → NO2 + ·F
1 record matched NO + VO → Products
12 records matched NO + NO3 → NO2 + NO2
1 record matched NO + Cyclohexadienyl, 6-hydroxy- → Products
10 records matched NO + NO2 → N2O3
2 records matched NO + NO + HNO → NO2 + HN=NO.
2 records matched NO + NO + HNO → Other Products + NO2
5 records matched NO + NO → N2O + O·
3 records matched NO + NO → N2 + O2
4 records matched NO → O· + N
2 records matched Br· + NOBr → Br2 + NO
3 records matched Br· + NO → NOBr
2 records matched ClOO + NO → NO2 + ClO
1 record matched ClOO + NO → NOCl + O2
5 records matched ClOO + NO → Products
1 record matched HBr + NO → Br· + HNO
4 records matched O3 + N → O2 + NO
19 records matched O3 + NO → O2 + NO2
1 record matched O3 + NO → Products
18 records matched N2O + O· → NO + NO
1 record matched N2O + H2C=N → CH2N2 + NO
1 record matched N2O + CD → DCN + NO
3 records matched N2O + H· → NO + NH
5 records matched N2O + NO → N2 + NO2
1 record matched HOCl + NO → Products
1 record matched HNO2 + NO2 → HNO3 + NO
2 records matched HNO2 + HNO2 → H2O + NO + NO2
1 record matched HNO2 → ·OH + NO
2 records matched Cl2 + NO + NO → NOCl + NOCl
2 records matched Cl2 + NO → NOCl + Cl
1 record matched O2 + NCO → CO2 + NO
13 records matched O2 + N → NO + O·
1 record matched O2 + ·N3 → N2O + NO
4 records matched O2 + NH → ·OH + NO
9 records matched O2 + NO + NO → NO2 + NO2
5 records matched F2 + NO → FNO + ·F
3 records matched H2O + NO + NO2 → HNO2 + HNO2
11 records matched N2 + O· → NO + N
2 records matched Br2 + NO + NO → NOBr + NOBr
1 record matched P + NO2 → NO + PO
4 records matched P + NO → NP + O·
1 record matched H2O2 + NO → H2O + NO2
1 record matched H2O2 + NO → ·OH + HNO2
2 records matched S + NO2 → NO + SO
4 records matched S + NO → SNO
1 record matched S + NO → SO + N
1 record matched S + NO → Products
4 records matched HNO3 + NO → HNO2 + NO2
1 record matched HCl + NO → HNO + Cl
2 records matched SO3 + N → SO2 + NO
3 records matched SO2 + NO2 → SO3 + NO
2 records matched Ca + NO2 → CaO + NO
4 records matched Bi + NO → Products
1 record matched Zr + NO → Products
1 record matched Zn + NO2 → ZnO + NO
1 record matched Y + NO → Products
1 record matched V + NO → VO + N
1 record matched V + NO → Products
1 record matched Hf + NO → Products
1 record matched Ge + NO2 → NO + GeO
1 record matched Ge + NO → Products
1 record matched Co + NO → Products
1 record matched Cr + NO2 → NO + CrO
3 records matched Cr + NO → CrO + N
2 records matched C + NO → CO + N
8 records matched C + NO → CN + O·
6 records matched C + NO → Products
1 record matched C + NO → N(2D) + CO
1 record matched Cd + NO2 → Cadmium oxide + NO
2 records matched Ba + NO2 → BaO + NO
2 records matched As + NO → Products
4 records matched Sb + NO → Products
3 records matched Ti + NO → TiO + N
1 record matched Ti + NO → Products
2 records matched Sn + NO2 → NO + SnO
1 record matched Sn + NO → Products
1 record matched Ta + NO → TaO + N
2 records matched Sr + NO2 → SrO + NO
1 record matched Na + NO → NaNO
1 record matched Na + Ar + NO → Ar + NaNO
3 records matched Si + NO → SiO + N
1 record matched Si + N2O → NO + Silicon nitride
1 record matched Sc + NO → ScO + N
2 records matched Rh + NO → Products
2 records matched Re + NO → Products
1 record matched K + Ar + NO → KNO + Ar
1 record matched Pt + NO → PtNO
1 record matched Ni + NO → Products
1 record matched Mo + NO → MoO + N
1 record matched Mo + NO → Adduct
3 records matched Mo + NO → Products
3 records matched Mg + NO2 → MgO + NO
15 records matched Pb + NO → Products
1 record matched La + NO → Products
1 record matched Fe + NO2 → FeO + NO
2 records matched Fe + NO → Adduct
1 record matched Al + NO → AlNO
1 record matched CH3S· + CH3SNO → (CH3S)2 + NO
4 records matched CH3S· + NO2 → NO + CH3SO
5 records matched CH3S· + NO → CH3SNO
2 records matched CH2=CHO· + NO → Products
1 record matched CD2OD + NO → Products
1 record matched ·CH2Cl + NO → Products
4 records matched CH2=C=CH + NO → Products
1 record matched C2H5CHOH + NO → (CH3)2CO + HNO
1 record matched CH(O)NO → HCO + NO
1 record matched C2H5C(CH3)2ONO → NO + C2H5C(CH3)2O(·)
1 record matched (CH3)2C(OH) + NO → i-C3H7ONO
1 record matched C6H5S + NO → Products
1 record matched CH2=CHCH2OO + NO → Products
1 record matched (CF3)3C· + NO → (CF3)3CNO
1 record matched ·CFBr + NO → Products
1 record matched n-C4F9· + NO → n-C4F9NO
1 record matched HOCH2CH2 + NO → Products
2 records matched *CH2C(O)H + NO → ONCH2CHO
3 records matched (CH3)2CHO2 + NO → i-C3H7O + NO2
2 records matched (CH3)2CHO2 + NO → (CH3)2CHONO2
2 records matched (CH3)2CHO2 + NO → Products
1 record matched i-C3H7O + NO → CH2=CHCH2OH + HNO
4 records matched i-C3H7O + NO → (CH3)2CO + HNO
2 records matched i-C3H7O + NO → Products
1 record matched CBr + NO → Products
1 record matched ·CCl + NO → Products
1 record matched CF + NO → Products
1 record matched NF2 + NO → Products
2 records matched (CH3)3CO2 + NO → (CH3)3CO + NO2
2 records matched (CH3)3CO2 + NO → Products
1 record matched C2F5 + NO → Ethane, pentafluoronitroso-
1 record matched ·OH + HN=NO. → NO + NHOH
8 records matched ·OH + N → NO + H·
5 records matched ·OH + HNO → H2O + NO
3 records matched ·OH + NO2 → HO2 + NO
43 records matched ·OH + NO → HNO2
1 record matched ·OH + NO → Products
4 records matched ·CH + NO2 → HCO + NO
3 records matched ·CH + NO → H· + NCO
1 record matched ·CH + NO → HCO + N
4 records matched ·CH + NO → CO + NH
3 records matched ·CH + NO → HCN + O·
2 records matched ·CH + NO → CN + ·OH
10 records matched ·CH + NO → Products
1 record matched ·CH + N2O → HCN + NO
1 record matched (CF3)2CF + NO → Propane,1,1,1,2,3,3,3-heptafluoro-2-nitro-
1 record matched HO2 + NO → O2 + HNO
7 records matched HO2 + NO → HNO3
30 records matched HO2 + NO → ·OH + NO2
2 records matched HO2 + NO → Products
2 records matched HO2 + FNO → HF + O2 + NO
1 record matched HO2 + H2O + NO → HNO3 + H2O
5 records matched ·CCl3 + NO → Methane, trichloronitroso-
3 records matched n-C3F7 + NO → CF3CF2CF2NO
2 records matched CH3CO + NO2 → NO + CH3C(O)O
1 record matched CH3CO + NO2 → CO2 + ·CH3 + NO
1 record matched CH3CO + NO → CH3C(O)NO
1 record matched CH3CO + NO → Products
5 records matched C2H5OO· + NO → CH3CH2O· + NO2
2 records matched C2H5OO· + NO → C2H5ONO2
4 records matched C2H5OO· + NO → Products
6 records matched (CH3)3CO + NO → (CH3)3CONO
1 record matched (CH3)3CO + NO → Products
4 records matched CH3C(O)CH2(·) + NO → Products
1 record matched CH3CH2OOH + NO → Products
1 record matched CH3OOH + NO → Products
1 record matched CS + NO2 → COS + NO
9 records matched CH2C≡CH + NO → Products
11 records matched NOCl + Cl → Cl2 + NO
2 records matched NOCl + N → NO + NCl
2 records matched NOCl + O· → NO + ClO
1 record matched NOCl + ·F → ClF + NO
1 record matched NOCl + SD → ClSD + NO
2 records matched NOCl + SiH3 → NO + SiH3Cl
6 records matched NOCl + H· → HCl + NO
3 records matched NOCl + NO2 → NO + ClNO2
2 records matched NOCl + Br· → NO + BrCl
3 records matched NOCl + ·OH → HOCl + NO
1 record matched NOCl + NOCl → Cl2 + NO + NO
16 records matched NOCl → NO + Cl
2 records matched C2H3 + NO → CH2O + HCN
2 records matched C2H3 + NO → Products
4 records matched NCN + NO → Products
1 record matched benzoyl + NO → Products
1 record matched ·HCC≡N + NO → Products
1 record matched ClCO + NO2 → CO2 + NO + Cl
1 record matched ClCO + NOCl → COCl2 + NO
2 records matched methyl,(3-fluorophenyl-) + NO → Products
3 records matched HCO + NO2 → NO + HCOO
1 record matched HCO + NO2 → CO + ·OH + NO
3 records matched HCO + NO2 → CO2 + NO + H·
13 records matched HCO + NO → CO + HNO
1 record matched (·)CH2OH + NO → CH2(OH)NO
1 record matched COOH + NO → Products
4 records matched Phenyl + NO → Nitrosobenzene
1 record matched Phenyl + NO → Products
1 record matched 4-Methylbenzyl + NO → Products
2 records matched 2-Methylbenzyl + NO → Products
1 record matched 3-Methylbenzyl + NO → Products
1 record matched CH3CHOH + NO → Products
4 records matched ·CF3 + NO2 → NO + CF3O
14 records matched ·CF3 + NO → CF3NO
1 record matched ·CF3 + NOCl → CF3Cl + NO
7 records matched ·CH3 + NO2 → CH3O· + NO
2 records matched ·CH3 + NO → ·OH + H2C=N
32 records matched ·CH3 + NO → CH3NO
3 records matched ·CH3 + NO → HCN + H2O
4 records matched ·CH3 + NO → Products
2 records matched 2-C4H9O + NO → C2H5COCH3 + HNO
2 records matched 2-C4H9O + NO → Products
2 records matched methyl,(4-fluorophenyl-) + NO → Products
1 record matched ·CF2 + NO2 → COF2 + NO
1 record matched ·CF2 + NO → CF2NO
1 record matched Benzyl + NO → (C6H5)CH2NO
1 record matched Benzyl + NO → Products
4 records matched CH3CH2O· + NO → C2H5ONO
3 records matched CH3CH2O· + NO → CH3CHO + HNO
2 records matched CH3CH2O· + NO → Products
2 records matched CH3O· + HNO → CH3OH + NO
18 records matched CH3O· + NO → CH3ONO
9 records matched CH3O· + NO → CH2O + HNO
7 records matched CH3O· + NO → Products
1 record matched n-C3H7 + NO2 → NO + n-C3H7O
1 record matched n-C3H7 + NO → Propane, 1-nitroso-
2 records matched Cyclohexyldioxyl + NO → cyclohexylnitrate
1 record matched Cyclohexyldioxyl + NO → Products
14 records matched CH3O2· + NO → CH3O· + NO2
1 record matched CH3O2· + NO → CH3ONO2
6 records matched CH3O2· + NO → Products
2 records matched ·C2H + NO → Products
2 records matched C6H5O + NO → Nitrous acid phenyl ester
2 records matched C6H5O + NO → Products
1 record matched ·CHCl + NO → HC-N=O + Cl
1 record matched ·CHCl + NO → HCl + NCO
3 records matched ·CHCl + NO → Products
3 records matched ·C2H5 + NO → C2H5NO
1 record matched ·C2H5 + NO → Products
1 record matched ·CH2CH=CH2 + NO2 → NO + CH2=CHCH2O
1 record matched ·CH2CH=CH2 + NO → CH2=CHCH2NO
1 record matched ·CH2CH=CH2 + NO → Adduct
1 record matched ·CH2CH=CH2 + NO → Products
2 records matched FCO + NO → Products
2 records matched ·CCl2F + NO → Adduct
1 record matched ·CClF2 + NO2 → NO + CF2ClO
2 records matched ·CClF2 + NO → Adduct
3 records matched ·CClF + NO → Products
1 record matched tert-C4H9 + NO → tert-C4H9NO
3 records matched CCl2 (X 1A1) + NO → Products
1 record matched (Z)-CH2=CHCH=CHCH3 + NO → (E)-CH2=CHCH=CHCH3 + NO
1 record matched Pentafluoronitrosobenzene → Phenyl, pentafluoro- + NO
1 record matched FeO + NO2 → NO + FeO2
2 records matched H2 + NO → H· + HNO
1 record matched C2H5NO + NO + NO → ·C2H5 + N2 + NO3
2 records matched CH3CH2CH(CH3)ONO → NO + CH3CH2CH(CH3)O
1 record matched tert-C4H9NO + NO2 → (CH3)3CNO2 + NO
1 record matched tert-C4H9NO → tert-C4H9 + NO
3 records matched CH3NO + NO + NO → ·CH3 + N2 + NO3
1 record matched CH3NO + NO + NO → Products
1 record matched CH3NO + NO → CH3O· + N2O
4 records matched CO + NO2 → CO2 + NO
1 record matched CO + H2 + NO → Products
2 records matched CH3ONO + H· → CH3OH + NO
11 records matched CH3ONO → CH3O· + NO
2 records matched sec-C4H9NO2 + 2-C4H9O → sec-C4H9OH + C2H5COCH3 + NO
1 record matched (CH3)2C(NO2)2 → (CH3)2CO + NO + NO2
1 record matched 1,3-Cyclohexadiene + NO → Products
1 record matched CH3CH=CHCH=CHCH3 + NO → Products
1 record matched (Z)-2-C4H8 + ·OH + NO → Products
1 record matched Nitrosobenzene + NO2 → Nitrobenzene + NO
3 records matched Nitrosobenzene → Phenyl + NO
1 record matched (CH3)2C=C(CH3)2 + ·OH + NO → Products
1 record matched n-C4H9ONO → NO + n-C4H9O
1 record matched n-C3H7ONO → Other Products + NO
4 records matched i-C3H7ONO → i-C3H7O + NO
5 records matched (CH3)3CONO → (CH3)3CO + NO
1 record matched (CH3)2C=CHCH3 + ·OH + NO → Products
1 record matched CF3NO + NO + NO → Other Products + N2
1 record matched CF3NO → ·CF3 + NO
3 records matched CO2 + N → CO + NO
1 record matched CO2 + NO → CO + NO2
1 record matched iso-C4H8 + ·OH + NO → Products
1 record matched (CH3)2O + NO → HNO + CH3OCH2
1 record matched n-C4H9OCH2CH2OH + ·OH + NO → Products
5 records matched C2H5ONO → CH3CH2O· + NO
1 record matched CH3OCH2CH(CH3)OH + ·OH + NO → Products
1 record matched CH3CH=NOH (unspecified) + NO → Products
1 record matched n-C4H10 + O2 + NO → Products
1 record matched (CH3)2S + NO2 → (CH3)2SO + NO
1 record matched C2H2 + NO2 → Other Products + NO
1 record matched C2H2 + NO → HCN + CO + H·
2 records matched C2H2 + NO → Products
1 record matched C2H4 + ·OH + NO → Products
1 record matched CH3OH + O2 + NO → Products
1 record matched C2H5OH + O2 + NO → Products
1 record matched CN + HC-N=O → ·HCC≡N + NO
3 records matched CN + NO2 → NO + NCO
3 records matched CN + NO → N + NCO
9 records matched CN + NO → ONCN
5 records matched CN + NO → CO + N2
2 records matched CN + NO → Products
1 record matched CN + O2 → CO + NO
4 records matched O(1D) + NO2 → O2 + NO
5 records matched O(1D) + NO → O2 + N
1 record matched O(1D) + NO → O(3P) + NO
3 records matched O(1D) + N2O → NO + NO
1 record matched O2(1DELTA) + N → NO + O·
1 record matched O2(1DELTA) + NO → NO2 + O·
4 records matched O2(1DELTA) + NO → O2 + NO
3 records matched CH3SCH2OO· + NO → CH3SCH2O· + NO2
1 record matched (CH3)3CC(CH3)2CH2OO· + NO → Products
1 record matched CH2FCHFO2· + NO → CH2FCHFO· + NO2
1 record matched CH3CF2CH2OO· + NO → Products
1 record matched CH3CFClOO· + NO → CH3CFClO + NO2
1 record matched CF3CF2CFHOO(.) + NO → CF3CF2CFHO(.) + NO2
1 record matched CH2=C(CH3)C(O)OO(.) + NO → Other Products + NO2
1 record matched CHClFOO(.) + NO → NO2 + CHClFO(.)
1 record matched CH3OC(O)OCH2OO(.) + NO → Products
1 record matched CF3CF2CF2OO(.) + NO → Products
1 record matched CCl3CClHO2 + NO → Products
1 record matched CF3CH(OO.)OCH2CF3 + NO → Products
1 record matched CCl(O)NO → ClCO + NO
1 record matched 3-pentoxy radical + NO → Products
1 record matched CCl2 (a 3B1) + NO → CCl2 (X 1A1) + NO
1 record matched CCl2 (A 1B1) + NO → CCl2 (X 1A1) + NO
1 record matched C6H5C(O)O2 + NO → 2C6H5COO + NO2
1 record matched C6H6-OH + NO → Products
1 record matched C6H6-OH-O2 + NO → Other Products + HO2
1 record matched CF3C(O)OCH(OO)CF3 + NO → Products
1 record matched ClS(CH3)2 + NO → Products
1 record matched HOCH2=CH(O2)C(CH3)=CH2 + NO → HOCH2CH(O)CCH3=CH2 + NO2
1 record matched M + NO + Cl → M + NOCl
5 records matched M + NO + H· → M + HNO
2 records matched M + FCO + NO → M + Products
1 record matched N(2S) + NO → Products
2 records matched O(3P) + NO2 → O2 + NO
1 record matched isoprene hydroxy-peroxy + NO → Products
1 record matched C5H8OHO2 + NO → Products
1 record matched C5H8OHO2 + NO → C5H8OHO + NO2
1 record matched CH3CHOCH2CH3 + NO → Products
1 record matched CHBr2OO(·) + NO → CHBr2O(.) + NO2
1 record matched CH2(X3B_1) + NO → H· + HC-N=O
1 record matched CH2(X3B_1) + NO → HCN + ·OH
1 record matched CH2ClCH2OO + NO → Products
1 record matched C3H6ClO2 + NO → Products
1 record matched C4H8ClO2 + NO → Products
1 record matched C4H8ClO2 + NO → Products
1 record matched C4H8ClO2 + NO → Products
1 record matched C4H6ClO2 + NO → Products
1 record matched C5H8ClO2 + NO → Products
5 records matched nitrosocyclohexadiene → NO + Cyclohexadienyl
1 record matched C(3Pj) + NO → Products
1 record matched C3H6(OH)O2 + NO → Products
1 record matched 1-C4H8(OH)O2 + NO → Products
1 record matched 2-C4H8(OH)O2 + NO → Products
1 record matched i-C4H8(OH)O2 + NO → Products
1 record matched 1,3-C4H6(OH)O2 + NO → Products
1 record matched C5H8(OH)O2 + NO → Products
1 record matched CH2=C(CH3)CH(OH)CH2OO· + NO → CH2=C(CH3)CH(OH)CH2ONO2
1 record matched CH3(Cl)S(O)CH3 + NO → Products
1 record matched C2H2F3O + NO → Products
1 record matched m-xylene-OH adduct + NO → Products
1 record matched p-xylene-OH adduct + NO → Products
1 record matched aniline-OH adduct + NO → Products
1 record matched m-cresol-OH adduct + NO → Products
1 record matched CH3C(·)(OH)CH2CH=CH2 + NO → CH3C(NO)(OH)CH2CH=CH2
2 records matched C4H7O4 (peroxy from methyl vinyl ketone) + NO → Products
2 records matched C4H7O4 (peroxy from methacrolein) + NO → Products
1 record matched C2H5ICl + NO → Products
1 record matched (CH3)3COCH2· + NO → Products
2 records matched (CH3)2C(·)CH2+e-) + NO → (CH3)2C(CH2+e-))NO
2 records matched ·C2H4+e-) + NO → CH2(CH2+e-))NO
1 record matched CH3CH2CH2CH(OO ·)CH3 + NO → 2-pentoxy radical + NO2
1 record matched (CH3)2C(OO·)CH2CH3 + NO → CH3CH2C(CH3)2O(·) + NO2
1 record matched (CH3)2CNO2 → (CH3)2CO + NO
1 record matched CF2-trip + NO → Products
1 record matched C4H6ClO3 (chloroperoxy from methacrolein) + NO → Products
1 record matched C4H6ClO3 (chloroperoxy from methyl vinyl ketone) + NO → Products
1 record matched C2(a3PIu) + NO → CN + CO
1 record matched NH2(X2B1 v2 = 0) + NO → Products
1 record matched NH2(X2B1 v2 = 1) + NO → Products
1 record matched Propyldioxy (unspecified) + NO → Propoxy (unspecified) + NO2
1 record matched C4F9OCH2O2 + NO → Products
1 record matched AlNO → Al + NO
2 records matched NCO + HCNO → HCN + CO + NO
1 record matched N + NCO → CN + NO
1 record matched O· + HN=N → NO + NH
1 record matched O· + NCO → CO + NO
1 record matched DNO + D → D2 + NO
7 records matched HNO + O· → ·OH + NO
1 record matched HNO → NO + H·
1 record matched NHOH + HNO → NH2OH + NO
1 record matched NH2 + HNO → NH3 + NO
4 records matched H· + HNO → H2 + NO
2 records matched NO3 → O2 + NO
1 record matched NO2 + CH3SSO → CH3S(S)O2 + NO
1 record matched NO2 + FC(O)O· → NO + FC(O)OO
2 records matched NO2 + CH3SOO → NO + CH3SO3
1 record matched NO2 + CH3SS → NO + CH3SSO
1 record matched NO2 + CH3SO → NO + CH3SOO
2 records matched NO2 + NCO → CO + NO + NO
1 record matched NO2 + O· → O2 + NO
1 record matched NO2 + SCN → SCNO + NO
1 record matched NO2 + ·N3 → N2 + NO + NO
1 record matched NO2 + NH → NO + HNO
1 record matched NO2 + C2O → CO + CO + NO
1 record matched NO2 + C2O → c-OCC-O + NO
2 records matched NO2 + NO3 → O2 + NO + NO2
1 record matched NO2 → NO + O·
1 record matched NO + CH3S(O)2OO → NO2 + CH3SO3
1 record matched NO + CH2ClO → ·CH2Cl + NO2
1 record matched NO + CH2ClO → HC(O)Cl + HNO
1 record matched NO + CH2ClO → CH2ClNO2
1 record matched NO + HN=NO. → N2O + HNO
1 record matched NO + ·CH2 → HN=C=O + H·
1 record matched NO + ·CH2 → HCN + ·OH
1 record matched NO + ·CH2 → Products
1 record matched NO + HCCO → Nitrosoketene
1 record matched NO + HCCO → CO + HC-N=O
2 records matched NO + HCCO → HCN + CO2
1 record matched NO + HCCO → Products
1 record matched NO + BrONO2 → NO3 + NOBr
1 record matched NO + HOCH2CH2O2· → NO2 + HOCH2CH2O
1 record matched NO + HOCH2CH2O2· → NO + HOCH2CH2O
1 record matched NO + HN=N → N2 + HNO
1 record matched NO + HN=N → Products
1 record matched NO + SiH2NH → H2Si=O + HN=N
1 record matched NO + SiH2NH → N2 + H2Si(·)OH
1 record matched NO + SiH2NH → c-SiH2N2-OH
1 record matched NO + SiH2NH → SiH2NN + ·OH
2 records matched NO + CH3CH2CH(CH3)O → CH3CH2CH(CH3)ONO
2 records matched NO + CH3CH2CH(CH3)O → C2H5COCH3 + HNO
1 record matched NO + (CH3)2CHS → iso-C3H7SNO
1 record matched NO + CH3S(O) → CH3SONO
1 record matched NO + (CH3)2CHCH(CH3)CH(·)CH3 → Products
2 records matched NO + Cl → NOCl
1 record matched NO + NCO → CO + N2O
1 record matched NO + NCO → CO + N2 + O·
1 record matched NO + NCO → CO2 + N2
1 record matched NO + CF3O → COF2 + FNO
6 records matched NO + N → N2 + O·
2 records matched NO + O· → NO2
1 record matched NO + O· → O2 + N
1 record matched NO + CF3O2 → CF3ONO2
2 records matched NO + CF3O2 → NO2 + CF3O
1 record matched NO + CF3O2 → NOO + CF3O
1 record matched NO + n-C4H9S → n-C4H9SNO
1 record matched NO + ·CH2Br → Products
1 record matched NO + SCN → COS + N2O
1 record matched NO + ND → Products
1 record matched NO + ClO → Products
1 record matched NO + CH3CH2S → C2H5SNO
1 record matched NO + ·F → FNO
1 record matched NO + IO → INO2
1 record matched NO + IO → NO2 + I
1 record matched NO + IO → IONO
1 record matched NO + I → INO
1 record matched NO + NH → N2O + H·
2 records matched NO + NH → ·OH + N2
3 records matched NO + NH → Products
1 record matched NO + NH2 → N2 + H2O
2 records matched NO + NH2 → ·OH + HN=N
1 record matched NO + NH2 → Other Products + ·OH
4 records matched NO + NH2 → Products
1 record matched NO + C2H5C(CH3)2O(·) → C2H5C(CH3)2ONO
1 record matched NO + Si2 → Products
1 record matched NO + Cyclohexadienyl → Products
1 record matched NO + C2 → CN + CO
2 records matched NO + C2 → O(3P) + CC≡N
1 record matched NO + OF → NO2F
1 record matched NO + NO3 → ONONO2
3 records matched NO + NO3 → NO2 + NO2
1 record matched NO + NO2 → N2O3
1 record matched NO + NO → NO dimer
1 record matched NO + NO → N2O + O·
1 record matched NO + NO → N2 + O2
1 record matched NO → O· + N
1 record matched O3 + HNO → HO3 + NO
1 record matched O3 + NO2 → O2 + O2 + NO
2 records matched N2O + O· → NO + NO
1 record matched N2O + H· → NO + NH
1 record matched N2O + NO → N2 + NO2
1 record matched HNO2 + H· → H2O + NO
1 record matched HNO2 → ·OH + NO
2 records matched O2 + N → NO + O·
4 records matched O2 + NH → ·OH + NO
1 record matched O2 + NO + NO → NO2 + NO2
1 record matched O2 + NO → NO3
1 record matched N2 + NHOH → H2 + N2 + NO
2 records matched HNO3 → HO2 + NO
3 records matched NH3 + NO → NH2 + HNO
1 record matched Ga + NO → GaNO
1 record matched Ga + NO → GaON
1 record matched C + NO2 → CO + NO
2 records matched C + NO → CO + N
4 records matched C + NO → CN + O·
1 record matched B + NO → NBO
1 record matched B + NO → BON
1 record matched B + NO → B(NO)
1 record matched W + NO2 → NO + WO
1 record matched W + NO → WO + N
1 record matched W + NO → NWO
2 records matched Sc + NO → ScO + N
1 record matched Li + Ar + NO → LiNO + Ar
1 record matched Fe + NO2 → FeO + NO
1 record matched Al + NO → AlNO
1 record matched Al + NO → AlON
1 record matched Al + NO → NAlO
1 record matched CH3S· + NO2 → NO + CH3SO
1 record matched CH3S· + NO → CH3SNO
1 record matched CH3S· + NO → CH3SNO2
1 record matched CH3S· + NO → NO + CH3SO
1 record matched CH3S· + NO → CH2S + HNO2
1 record matched CH3S· + NO → cis-HONO + CH2S
1 record matched CH3S· + NO → trans-HONO + CH2S
1 record matched CH3S· + NO → SCH2OH + NO
1 record matched (E)-CH3CH=NOH + NO → (Z)-CH3CH=NOH + NO
1 record matched (Z)-CH3CH=NOH + NO → CH3CN + H2O + NO
1 record matched iso-C4H9 + NO → Products
1 record matched 1-C8H17 + NO → Products
1 record matched (CH3)2NNO2 → (CH3)2NO + NO
1 record matched CC≡N + NO → NCCN + O·
1 record matched CC≡N + NO → CN + NCO
1 record matched CC≡N + NO → NCCNO
3 records matched i-C3H7O + NO → i-C3H7ONO
2 records matched i-C3H7O + NO → (CH3)2CO + HNO
1 record matched ·CH2F + NO2 → NO + CH2FO(.)
1 record matched ·CH2F + NO2 → CH2O + NO + ·F
1 record matched (CH3)3CCH2 + NO → Products
1 record matched CH2=CHNO2 → CH2=CHO· + NO
1 record matched CHCl2 + NO2 → HC(O)Cl + NO + Cl
1 record matched (CH3)3CO2 + NO → Products
3 records matched ·OH + NCO → HCO + NO
5 records matched ·OH + NCO → CO + NO + H·
3 records matched ·OH + N → NO + H·
1 record matched ·OH + SCN → NO + HC=S
3 records matched ·OH + HNO → H2O + NO
1 record matched ·OH + NO2 → HO2 + NO
1 record matched ·OH + NO → HNO2
1 record matched ·OH + NO → Products
1 record matched ·OH + N2O → NO + HNO
1 record matched ·OH + N2 → NO + NH
3 records matched HO2 + NO → HOONO
3 records matched HO2 + NO → HNO3
2 records matched HO2 + NO → ·OH + NO2
1 record matched ·CCl3 + NO2 → COCl2 + NO + Cl
1 record matched CH3CO + NO2 → CO2 + ·CH3 + NO
1 record matched CH3CO + NO → CH3C(O)NO
1 record matched C2H5OO· + NO → C2H5ONO2
2 records matched (CH3)3CO + NO → (CH3)3CONO
1 record matched 1-C5H11 + NO → Products
1 record matched C2H3 + NO → CO + CH2=NH
1 record matched C2H3 + NO → Products
2 records matched NCN + O· → CN + NO
8 records matched NCN + NO → NCNNO
1 record matched NCN + O2 → NO + CNO
1 record matched NCN + O2 → NO + NCO
1 record matched HCO + HNO → CH2O + NO
2 records matched HCO + NO2 → NO + HCOO
1 record matched HCO + NO2 → CO + ·OH + NO
1 record matched HCO + NO2 → CO2 + NO + H·
5 records matched HCO + NO → CH(O)NO
2 records matched HCO + NO → CO + HNO
2 records matched HCO + HNO2 → CO + H2O + NO
1 record matched (·)CH2OH + NO2 → HCO + H2O + NO
1 record matched Phenyl + HNO → Benzene + NO
1 record matched ·CF3 + NO → CF3NO
2 records matched ·CH3 + HNO → CH4 + NO
1 record matched ·CH3 + NO2 → CH3O· + NO
4 records matched ·CH3 + NO → CH3NO
1 record matched ·CH3 + NO → Products
4 records matched CH3CH2O· + NO → C2H5ONO
1 record matched CH3CH2O· + NO → CH3CHO + HNO
1 record matched CH3O· + NO → CH3O· + NO2
3 records matched CH3O· + NO → CH3ONO
3 records matched CH3O· + NO → CH2O + HNO
1 record matched n-C3H7 + NO → Propane, 1-nitroso-
1 record matched n-C3H7 + NO → Products
1 record matched CH3O2· + NO → CH3O· + NO2
1 record matched CH3O2· + NO → CH3ONO2
2 records matched CH3O2· + NO → Products
2 records matched C6H5O + NO → Products
1 record matched CH2=NH + NO → (·)CH2OH + N2
1 record matched CH2=NH + NO → CH2N2 + ·OH
1 record matched CH2=NH + NO → 3H-Diazirine + ·OH
1 record matched CH2=NH + NO → CH2O + HN=N
1 record matched ·C2H5 + HNO → C2H6 + NO
1 record matched ·C2H5 + NO2 → CH3CH2O· + NO
1 record matched iso-C3H7 + HNO → C3H8 + NO
2 records matched ·CH2CH=CH2 + NO → Products
7 records matched FCO + NO → CF(O)NO
1 record matched FCO + NO → CO + FNO
1 record matched FCO + NO → FON + CO
1 record matched tert-C4H9 + NO → iso-C4H8 + HNO
2 records matched H2 + NO2 → H2O + NO
1 record matched H2 + NO → Products
2 records matched CH3ONO → CH3O· + NO
1 record matched CH3NHNO2 → CH3NHO· + NO
1 record matched Nitrosobenzene + Phenyl → Biphenyl + NO
1 record matched Nitrosobenzene → Phenyl + NO
1 record matched 2-C4F8 (unspecified) + NO2 → Perfluorobutene-2 epoxide + NO
1 record matched CH3CH=NOH (unspecified) + ·C2H5 → n-C4H10 + NO
2 records matched Nitrobenzene → C6H5O + NO
1 record matched Benzene, 1hydroxy-2-amine- → NO + Cyclohexadienyl
2 records matched Benzene,1-methyl-2-nitro- → Phenoxy, 2-methyl- + NO
1 record matched CH3NO2 → CH3O· + NO
1 record matched HN=C=O + NO3 → CO2 + NO + HNO
1 record matched C3H8 + NO → Other Products + HNO
1 record matched C2H6 + NO → ·C2H5 + HNO
2 records matched CH4 + NO → ·CH3 + HNO
1 record matched (C2H5)2O + NO → C2H5OCH2CH2 + HNO
1 record matched (C2H5)2O + NO → 2-C4H9O + HNO
1 record matched CN + O· → C + NO
1 record matched CN + N2O → CNN + NO
1 record matched CN + H2C=C=O → NO + CH=C=CH
1 record matched O(1D) + HNO → ·OH + NO
1 record matched O(1D) + NO → NO + O·
2 records matched O(1D) + N2O → NO + NO
1 record matched cis-HONO + ·F → NO + HOF
2 records matched cis-HONO + NO2 → HNO3 + NO
1 record matched cis-HONO + cis-HONO → H2O + NO + NO2
1 record matched trans-HONO + Cl → HOCl + NO
1 record matched trans-HONO + ·F → NO + HOF
2 records matched trans-HONO + NO2 → HNO3 + NO
1 record matched trans-HONO + cis-HONO → H2O + NO + NO2
1 record matched trans-HONO + trans-HONO → H2O + NO + NO2
1 record matched -10202 + ·OH → NO + HOCH
1 record matched -10202 + ·OH → CO + H2 + NO
2 records matched N(2D) + O2 → NO + O·
1 record matched N(2D) + O2 → O(1D) + NO
2 records matched O(1D) + N2O → NO + NO
1 record matched NBO → B + NO
1 record matched BON → B + NO
1 record matched B(NO) → B + NO
1 record matched cis-ClONO + NO2 → NO + ClONO2
1 record matched trans-ClONO + NO2 → NO + ClONO2
1 record matched AlON → Al + NO
1 record matched NAlO → Al + NO
1 record matched GaNO → Ga + NO
1 record matched GaON → Ga + NO
1 record matched CBr3OO(·) + NO → CBr3O(·) + NO2
1 record matched CCl2OHCCl2OO + NO → Products
1 record matched CCl3CCl2OO + NO → Products
1 record matched CCl2(ONO2)CCl2OO + NO → Products
1 record matched CH2OHCH2OO + NO → Products
1 record matched CH2ClCH2OO + NO → Products
1 record matched CH2(ONO2)CH2OO + NO → Products
1 record matched CH2OHCH(OO)OO + NO → Products
1 record matched CH2ClCH(OO)OO + NO → Products
1 record matched CH2(ONO2)CH(OO)OO + NO → Products
1 record matched CH2OHCH2CH(OO)CHCH2 + NO → Products
1 record matched CH2ClCH2CH(OO)CHCH2 + NO → Products
1 record matched CH2(ONO2)CH2CH(OO)CHCH2 + NO → Products
1 record matched CH2OHCH2CHCHCH2CH2OO + NO → Products
1 record matched CH2ClCH2CHCHCH2CH2OO + NO → Products
1 record matched CH2(ONO2)CH2CHCHCH2CH2OO + NO → Products
1 record matched C(CH3)(CH2OH)2C(CH3)(OO)C(CH3)C(CH3)2 + NO → Products
1 record matched C(CH3)(CH2Cl)2C(CH3)(OO)C(CH3)C(CH3)2 + NO → Products
1 record matched C(CH3)(CH2(ONO2))2C(CH3)(OO)C(CH3)C(CH3)2 + NO → Products
1 record matched C(OH)(CH3)2C(CH3)C(CH3)C(CH3)2OO + NO → Products
1 record matched CCl(CH3)2C(CH3)C(CH3)C(CH3)2OO + NO → Products
1 record matched C(ONO2)(CH3)2C(CH3)C(CH3)C(CH3)2OO + NO → Products
1 record matched CH2OHCH(OO)C(O)CH3 + NO → Products
1 record matched CH2ClCH(OO)C(O)CH3 + NO → Products
1 record matched CH2(ONO2)CH(OO)C(O)CH3 + NO → Products
1 record matched C(OH)(CH3)2C(CH3)(OO)C(O)CH3 + NO → Products
1 record matched CCl(CH3)2C(CH3)(OO)C(O)CH3 + NO → Products
1 record matched C(ONO2)(CH3)2C(CH3)(OO)C(O)CH3 + NO → Products
1 record matched CCl2(OH)CCl(OO)CClCCl2 + NO → Products
1 record matched CCl3CCl(OO)CClCCl2 + NO → Products
1 record matched CCl2(ONO2)CCl(OO)CClCCl2 + NO → Products
1 record matched CCl2(OH)CClCClCCl2OO + NO → Products
1 record matched CCl3CClCClCCl2OO + NO → Products
1 record matched CCl2(ONO2)CClCClCCl2OO + NO → Products
1 record matched HOCO + NO → Products
1 record matched CF2(a~3B1) + NO → singlet-CF2(X1A) + NO
1 record matched ·OOCH2C(O)OH + NO → ·OCH2C(O)OH + NO2
1 record matched ·OOC(O)C(O)OH + NO → HC(O)C(O)O2 + NO2
1 record matched NCONO → NO + CNO
1 record matched NCONO → NO + NCO
1 record matched NCN3 + NO2 → ONCN + NO
1 record matched CH_2(aA_1) + N2O → HCN + NO + H·
1 record matched cis-BrONO + NO2 → NO + BrONO2
1 record matched trans-BrONO + NO2 → NO + BrONO2
1 record matched C2(a3PIu) + NO → Products
1 record matched C2(a3PIu) + NO → CCNO
1 record matched ·CH + N2O → HCN + NO
1 record matched C2H3 + NO → CH2O + HCN
1 record matched ·CH3 + N2O → CH2=NH + NO
1 record matched CH2N2 + O· → NO + H2C=N
1 record matched HN=C=O + NO → CO2 + HN=N

Search returned 2723 records.