Kinetics Database Logo

Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences


Rate Our Products and Services


Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty


Administrative Links

NIST home page

MML home page

Chemical and Biochemical Reference Data Division

MML home page

Chemical and Biochemical Reference Data Division

  NIST Logo Home
©NIST, 2013
Accessibility information

Search Results

Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
1 record matched NO2 + HNO → cis-HONO + NO
1 record matched NO2 + C2O → CO2 + NCO
1 record matched (CH3)3CO + NO2 → Products
1 record matched ·CH3 + NO2 → Products
1 record matched cis-HONO + NO → NO2 + HNO
1 record matched n-C8H17OONO2 → NO2 + n-C8H17O2
1 record matched n-C6H13OONO2 → NO2 + n-C6H13O2
1 record matched n-C4H9OONO2 → NO2 + n-C4H9O2
8 records matched CClF2OONO2 → NO2 + CClF2OO
8 records matched CFCl2OONO2 → NO2 + CCl2FO2
8 records matched CCl3OONO2 → NO2 + CCl3O2
6 records matched C2H5OONO2 → C2H5OO· + NO2
4 records matched CF3OONO2 → NO2 + CF3O2
8 records matched CH3O2NO2 → CH3O2· + NO2
2 records matched Peroxide, benzoyl nitro- → NO2 + Benzoyldioxy radical
11 records matched HO2NO2 → HO2 + NO2
8 records matched INO2 + INO2 → I2 + NO2 + NO2
1 record matched HOONO → ·OH + NO2
1 record matched ClONO2 → NO2 + ClO
3 records matched ClNO2 → NO2 + Cl
8 records matched NO3 + Cl → NO2 + ClO
7 records matched NO3 + O· → O2 + NO2
3 records matched NO3 + BrO → NO2 + BrO2
1 record matched NO3 + ClO → NO2 + OClO
1 record matched NO3 + ClO → ClOO + NO2
3 records matched NO3 + NO3 → O2 + NO2 + NO2
4 records matched N2O3 → NO + NO2
5 records matched N2O4 → NO2 + NO2
5 records matched NO2 + CH3SSO → Products
14 records matched NO2 + CClF2OO → CClF2OONO2
14 records matched NO2 + CCl2FO2 → CFCl2OONO2
14 records matched NO2 + CCl3O2 → CCl3OONO2
5 records matched NO2 + HSO → NO + HSO2
3 records matched NO2 + HSO → Products
5 records matched NO2 + CH3SOO → Products
12 records matched NO2 + CH3C(O)OO(·) → CH3C(O)OONO2
5 records matched NO2 + CH3SS → Products
2 records matched NO2 + CH3S(O) → NO + CH3SOO
1 record matched NO2 + CH3S(O) → Products
1 record matched NO2 + CH3SO → NO + CH3SOO
2 records matched NO2 + CH3SO → Products
4 records matched NO2 + Cl → ClNO2
4 records matched NO2 + Cl → ClNO2
3 records matched NO2 + NCO → Products
3 records matched NO2 + N → N2O + O·
16 records matched NO2 + O· → NO3
8 records matched NO2 + O· → O2 + NO
14 records matched NO2 + CF3O2 → CF3OONO2
5 records matched NO2 + ·CH2SH → Products
15 records matched NO2 + BrO → BrONO2
6 records matched NO2 + O2F → Products
18 records matched NO2 + ClO → ClONO2
3 records matched NO2 + ·F → FONO
4 records matched NO2 + ·F → NO2F
14 records matched NO2 + IO → IONO2
1 record matched NO2 + IO → Adduct
15 records matched NO2 + I → INO2
1 record matched NO2 + HNO → HNO2 + NO
8 records matched NO2 + SH → NO + HSO
7 records matched NO2 + SO → SO2 + NO
2 records matched NO2 + NH → Products
8 records matched NO2 + NH2 → Products
4 records matched NO2 + H· → ·OH + NO
7 records matched NO2 + OF → FONO2
14 records matched NO2 + NO3 → N2O5
2 records matched NO2 + NO3 → O2 + NO + NO2
4 records matched NO2 + NO2 → N2O4
1 record matched NO2 + NO2 → NO + NO3
1 record matched NO2 + NO2 → O2 + NO + NO
4 records matched NO2 → NO + O·
2 records matched NO + CF3CF2OO· → NO2 + CF3OCF2(·)
1 record matched NO + CHF2CF2OO → NO2 + CF3CFHO
1 record matched NO + CHF2CF2OO → CHF2OCF2· + NO2
1 record matched NO + CHF2CF2OO → CHF2CF2O + NO2
2 records matched NO + CHF2OO → NO2 + CHF2O(·)
2 records matched NO + CF2ClCH2OO· → CF2ClCH2O(.) + NO2
2 records matched NO + CFCl2CH2OO(·) → CFCl2CH2O· + NO2
1 record matched NO + CF3CFHO2· → NO2 + CF3CFHO
2 records matched NO + CF3CCl2OO(·) → NO2 + CF3CCl2O(·)
1 record matched NO + CH2FO2 → NO2 + CH2FO(.)
1 record matched NO + CH2FO2 → Other Products + NO2
1 record matched NO + CH2BrOO → CH2O + Br· + NO2
2 records matched NO + CH2BrOO → CH2BrO + NO2
7 records matched NO + CClF2OO → NO2 + CF2ClO
1 record matched NO + CClF2OO → COF2 + NO2 + Cl
1 record matched NO + CH3CH2C(O)OO → NO2 + CH3CH2C(O)O
1 record matched NO + CH3CH2C(O)OO → CO2 + ·C2H5 + NO2
4 records matched NO + CH2ClO2 → NO2 + CH2ClO
7 records matched NO + CCl2FO2 → NO2 + CFCl2O
1 record matched NO + CCl2FO2 → COClF + NO2 + Cl
7 records matched NO + CCl3O2 → NO2 + CCl3O
1 record matched NO + CCl3O2 → COCl2 + NO2 + Cl
4 records matched NO + n-C3H7O2 → NO2 + n-C3H7O
2 records matched NO + HOCH2CH2O2· → NO2 + HOCH2CH2O
3 records matched NO + CH3C(O)OO(·) → NO2 + CH3C(O)O
2 records matched NO + CH3C(O)OO(·) → CO2 + ·CH3 + NO2
16 records matched NO + O· → NO2
8 records matched NO + OClO → NO2 + ClO
7 records matched NO + CF3O2 → NO2 + CF3O
8 records matched NO + BrO → Br· + NO2
9 records matched NO + ClO → NO2 + Cl
8 records matched NO + IO → NO2 + I
2 records matched NO + Iodine dioxide → NO2 + IO
2 records matched NO + NaO → Na + NO2
8 records matched NO + OF → NO2 + ·F
2 records matched NO + NaO2 → NO2 + NaO
9 records matched NO + NO3 → NO2 + NO2
4 records matched NO + NO2 → N2O3
8 records matched N2O5 → NO2 + NO3
5 records matched Br· + NO3 → NO2 + BrO
12 records matched Br· + NO2 → BrNO2
8 records matched O3 + NO2 → O2 + NO3
7 records matched O3 + NO → O2 + NO2
1 record matched HNO2 + NCO → HN=C=O + NO2
1 record matched HNO2 + O· → ·OH + NO2
1 record matched HNO2 + H· → H2 + NO2
5 records matched O2 + NO + NO → NO2 + NO2
1 record matched NH3 + NO2 → HNO2 + NH2
2 records matched SO3 + NO2 → Products
2 records matched SO2 + NO2 → Products
9 records matched CH3S· + NO2 → NO + CH3SO
1 record matched CH3CH2C(O)OONO2 → NO2 + CH3CH2C(O)OO
2 records matched CH3S(O)2 + NO2 → Products
4 records matched (CH3)2CHO2 + NO → i-C3H7O + NO2
2 records matched i-C3H7O + NO2 → (CH3)2CHONO2
2 records matched ·OH + ClNO2 → HOCl + NO2
5 records matched ·OH + ClNO2 → HOCl + NO2
5 records matched ·OH + NO3 → HO2 + NO2
5 records matched ·OH + NO2 → HOONO
25 records matched ·OH + NO2 → HNO3
2 records matched ·OH + NO2 → HO2 + NO
7 records matched ·OH + HNO2 → H2O + NO2
15 records matched HO2 + NO2 → HO2NO2
1 record matched HO2 + NO2 → Products
9 records matched HO2 + NO → ·OH + NO2
1 record matched C2H5OO· + NO3 → CH3CH2O· + O2 + NO2
9 records matched C2H5OO· + NO2 → C2H5OONO2
4 records matched C2H5OO· + NO → CH3CH2O· + NO2
6 records matched CS + NO2 → COS + NO
1 record matched HCO + NO2 → CO + HNO2
1 record matched HCO + NO2 → CO2 + NO + H·
8 records matched CH3C(O)OONO2 → NO2 + CH3C(O)OO(·)
1 record matched ·CH3 + NO2 → CH3O· + NO
1 record matched ·CH3 + NO2 → Products
6 records matched CH3CH2O· + NO2 → C2H5ONO2
10 records matched CH3O· + NO2 → CH3ONO2
1 record matched CH3O· + NO2 → CH2O + HNO2
1 record matched CH3O· + NO2 → cis-HONO + CH2O
1 record matched CH3O2· + NO3 → CH3O· + O2 + NO2
15 records matched CH3O2· + NO2 → CH3O2NO2
8 records matched CH3O2· + NO → CH3O· + NO2
1 record matched H2 + NO2 → HNO2 + H·
2 records matched CO + NO2 → CO2 + NO
1 record matched CN + NO2 → NO + NCO
1 record matched CN + NO2 → Products
1 record matched CN + HNO2 → HCN + NO2
2 records matched CH2O + NO2 → HCO + HNO2
1 record matched CH3SCH2OO· + NO2 → CH3SCH2OONO2
6 records matched CH3SCH2OO· + NO → CH3SCH2O· + NO2
2 records matched CH2FCHFO2· + NO → CH2FCHFO· + NO2
2 records matched cis-HONO + ·OH → H2O + NO2
1 record matched C6H5C(O)O2NO2 → C6H5CO(O)2 + NO2
1 record matched M + CClF2OONO2 → M + NO2 + CClF2OO
1 record matched M + CFCl2OONO2 → M + NO2 + CCl2FO2
1 record matched M + CCl3OONO2 → M + NO2 + CCl3O2
1 record matched M + C2H5OONO2 → M + C2H5OO· + NO2
1 record matched M + CF3OONO2 → M + NO2 + CF3O2
1 record matched M + CH3O2NO2 → M + CH3O2· + NO2
2 records matched M + HO2NO2 → M + HO2 + NO2
2 records matched M + N2O3 → M + NO + NO2
2 records matched M + N2O4 → M + NO2 + NO2
1 record matched M + NO2 + CClF2OO → M + CClF2OONO2
1 record matched M + NO2 + CCl2FO2 → M + CFCl2OONO2
1 record matched M + NO2 + CCl3O2 → M + CCl3OONO2
1 record matched M + NO2 + CH3C(O)OO(·) → M + CH3C(O)OONO2
2 records matched M + NO2 + O· → M + NO3
1 record matched M + NO2 + BrO → M + BrONO2
1 record matched M + NO2 + ClO → M + ClONO2
1 record matched M + NO2 + IO → M + IONO2
1 record matched M + NO2 + I → M + INO2
2 records matched M + NO2 + NO3 → M + N2O5
2 records matched M + NO2 + NO2 → M + N2O4
2 records matched M + NO + O· → M + NO2
2 records matched M + NO + NO2 → M + N2O3
2 records matched M + N2O5 → M + NO2 + NO3
1 record matched M + Br· + NO2 → M + BrNO2
2 records matched M + ·OH + NO2 → M + HOONO
2 records matched M + HO2 + NO2 → M + HO2NO2
1 record matched M + C2H5OO· + NO2 → M + C2H5OONO2
1 record matched M + CH3O2· + NO2 → M + CH3O2NO2
2 records matched M + CH3SCH2OO· + NO2 → M + CH3SCH2OONO2
1 record matched N2(A3Sigma_u+) + NO2 → NO(X2Pi) + N2 + O·
1 record matched (18)OH + NO2 → Products
1 record matched n-C6H13C(O)OONO2 → n-C6H13C(O)OO(.) + NO2
1 record matched CH3OCH2OONO2 → NO2 + CH3OCH2O2
1 record matched (CH3)2CHCH2C(O)OONO2 → (CH3)2CHCH2C(O)OO· + NO2
1 record matched n-C4H9C(O)OONO2 → CH3CH2CH2CH2C(O)OO· + NO2
1 record matched CF3CFHOONO2 → NO2 + CF3CFHO2·
1 record matched CF3ONO2 → NO2 + CF3O
1 record matched n-C8H17OONO2 → NO2 + n-C8H17O2
1 record matched n-C6H13OONO2 → NO2 + n-C6H13O2
1 record matched n-C4H9OONO2 → NO2 + n-C4H9O2
1 record matched CH2=C(CH3)C(O)OONO2 → CH2=C(CH3)C(O)OO(.) + NO2
3 records matched FC(O)OONO2 → NO2 + FC(O)OO
1 record matched CH3CH2CH2OONO2 → NO2 + n-C3H7O2
4 records matched CClF2OONO2 → NO2 + CClF2OO
3 records matched CFCl2OONO2 → NO2 + CCl2FO2
4 records matched CCl3OONO2 → NO2 + CCl3O2
1 record matched ClC(O)OONO2 → NO2 + ClC(O)O2
1 record matched n-C3H7N(NO2)2 → Other Products + NO2
1 record matched CH3CH2N(NO2)2 → Other Products + NO2
2 records matched C2H5OONO2 → C2H5OO· + NO2
1 record matched n-C5H11C(O)OONO2 → n-C5H11C(O)OO(.) + NO2
3 records matched CF3OONO2 → NO2 + CF3O2
6 records matched CH3O2NO2 → CH3O2· + NO2
4 records matched Peroxide, benzoyl nitro- → NO2 + Benzoyldioxy radical
2 records matched n-C3H7C(O)OONO2 → CH3CH2CH2C(O)OO· + NO2
17 records matched HO2NO2 → HO2 + NO2
2 records matched CH3N(NO2)2 → Other Products + NO2
1 record matched n-C4H9N(NO2)2 → Other Products + NO2
2 records matched INO2 + INO2 → I2 + NO2 + NO2
1 record matched IONO2 → NO2 + IO
9 records matched ClONO2 → NO2 + ClO
1 record matched I + INO2 → I2 + NO2
1 record matched ClNO2 + Cl → Cl2 + NO2
4 records matched ClNO2 → NO2 + Cl
1 record matched NO3 + CD3O2· → CD3O + O2 + NO2
2 records matched NO3 + CH3C(O)OO(·) → O2 + NO2 + CH3C(O)O
5 records matched NO3 + Cl → NO2 + ClO
2 records matched NO3 + O· → O2 + NO2
1 record matched NO3 + OClO → O2 + NO2 + ClO
3 records matched NO3 + ClO → NO2 + OClO
4 records matched NO3 + ClO → ClOO + NO2
1 record matched NO3 + ClO → O2 + NO2 + Cl
1 record matched NO3 + ·F → NO2 + OF
1 record matched NO3 + I → NO2 + IO
2 records matched NO3 + H· → ·OH + NO2
1 record matched NO3 + OF → NO2 + O2F
4 records matched NO3 + NO3 → O2 + NO2 + NO2
14 records matched N2O4 → NO2 + NO2
1 record matched NO2 + CCl3CH2OO(·) → Adduct
1 record matched NO2 + CF3CFOO(.)CF3 → (CF3)2CFOONO2
1 record matched NO2 + CF3CFClOO(·) → CF3CFClOONO2
1 record matched NO2 + CF3CH2OO(·) → CF3CH2OONO2
1 record matched NO2 + CF3C(O)OO(·) → CF3C(O)O2NO2
1 record matched NO2 + CF3CFHO2· → CF3CFHOONO2
1 record matched NO2 + CH2ClCHClO2 → CH2ClCHClOONO2
1 record matched NO2 + CS2OH → Products
1 record matched NO2 + 1,3,5-Trioxan-2-yldioxy- → Peroxynitric acid 1,3,5-trioxan-2-yl ester
1 record matched NO2 + 1,4-Dioxan-2-yldioxy → 1,4-Dioxan-2-yl peroxynitrate
1 record matched NO2 + FC(O)OO → FC(O)OONO2
1 record matched NO2 + CH2ClO → Products
10 records matched NO2 + CClF2OO → CClF2OONO2
1 record matched NO2 + CCl2=CCl → NO + ·CCl2C(O)Cl
1 record matched NO2 + CCl2=CCl → CO + ·CCl3 + NO
1 record matched NO2 + CCl2=CCl → CCl3C(O)(.) + NO
1 record matched NO2 + CCl2=CCl → ClCNO + COCl2
1 record matched NO2 + FC(O)O· → CO2 + NO2F
1 record matched NO2 + FC(O)O· → Products
1 record matched NO2 + CH3C(O)CH2OO· → Adduct
1 record matched NO2 + CF3CClHOO(.) → CF3CClHOONO2
1 record matched NO2 + CD2OH → Products
2 records matched NO2 + CH3C=C=CH2 → Products
1 record matched NO2 + CH3OCH2O2 → CH3OCH2OONO2
8 records matched NO2 + CCl2FO2 → CFCl2OONO2
2 records matched NO2 + C2H5N(O)=CHCH3 → Other Products + NO
5 records matched NO2 + CCl3O2 → CCl3OONO2
1 record matched NO2 + HOC(CH3)2CH2OO(·) → HOC(CH3)2CH2OONO2
2 records matched NO2 + HSO → NO + HSO2
2 records matched NO2 + ·CH2 → Products
1 record matched NO2 + ·CHBrCl → Products
2 records matched NO2 + CH3SOO → Products
1 record matched NO2 + CH3ICl → Products
1 record matched NO2 + HCCO → CO + HCO + NO
1 record matched NO2 + HCCO → CO2 + HC-N=O
3 records matched NO2 + HCCO → Products
9 records matched NO2 + CH3C(O)OO(·) → CH3C(O)OONO2
1 record matched NO2 + Benzoyldioxy radical → Peroxide, benzoyl nitro-
1 record matched NO2 + CH3SS → Products
1 record matched NO2 + (CH3)2CHS → Products
2 records matched NO2 + CH3S(O) → NO + CH3SOO
1 record matched NO2 + CH3S(O) → Products
1 record matched NO2 + Na2 → Products
1 record matched NO2 + S2 → Products
1 record matched NO2 + Cl → ClNO2
2 records matched NO2 + Cl → ClNO2
5 records matched NO2 + Cl → Products
1 record matched NO2 + NCO → CO + NO + NO
1 record matched NO2 + NCO → CO2 + N2O
4 records matched NO2 + NCO → Products
1 record matched NO2 + CF3O → CF3ONO2
1 record matched NO2 + CF3O → COF2 + NO2F
1 record matched NO2 + CF3O → Products
1 record matched NO2 + Cylopentyldioxy- → Products
1 record matched NO2 + (E)-CH2=CHCH=CHC2H5 → Products
1 record matched NO2 + CH3CCl2· → Products
1 record matched NO2 + N → NO + NO
6 records matched NO2 + N → N2O + O·
1 record matched NO2 + N → N2 + O· + O·
1 record matched NO2 + N → N2 + O2
2 records matched NO2 + N → Products
14 records matched NO2 + O· → NO3
35 records matched NO2 + O· → O2 + NO
1 record matched NO2 + O· → Products
4 records matched NO2 + CF3O2 → CF3OONO2
2 records matched NO2 + ·CH2SH → Products
1 record matched NO2 + D → NO + OD
1 record matched NO2 + CH3CHBr → Products
1 record matched NO2 + CH3CHCl → Products
1 record matched NO2 + CH3OCH2 → Products
1 record matched NO2 + ·CH2I → Products
1 record matched NO2 + ·CH2Br → Products
1 record matched NO2 + n-C3H7O → Products
1 record matched NO2 + SF → NO + SOF
1 record matched NO2 + SCN → Products
1 record matched NO2 + CH3CH2CO → CO2 + ·C2H5 + NO
4 records matched NO2 + BrO → BrONO2
2 records matched NO2 + O2F → Products
1 record matched NO2 + (CH3)2N → (CH3)2NO + NO
1 record matched NO2 + (CH3)2N → (CH3)2NNO2
1 record matched NO2 + (CH3)2N → CH2=NCH3 + HNO2
1 record matched NO2 + (CH3)2N → Products
1 record matched NO2 + SCl → NO + OSCl
16 records matched NO2 + ClO → ClONO2
1 record matched NO2 + ClO → Products
2 records matched NO2 + CH3CH2S → Products
2 records matched NO2 + ·F → NO2F
2 records matched NO2 + ·F → Products
8 records matched NO2 + IO → IONO2
1 record matched NO2 + ClONO2 → Products
36 records matched NO2 + I → INO2
1 record matched NO2 + CHBr2 → Products
1 record matched NO2 + ·N3 → N2O + N2O
1 record matched NO2 + ·N3 → N2 + NO + NO
1 record matched NO2 + ·N3 → Products
1 record matched NO2 + SiF2 → Products
6 records matched NO2 + SH → NO + HSO
1 record matched NO2 + SH → Products
5 records matched NO2 + SO → SO2 + NO
1 record matched NO2 + SD → NO + DSO
2 records matched NO2 + SD → Products
1 record matched NO2 + CD → Products
1 record matched NO2 + NH → NO + HNO
1 record matched NO2 + NH → ·OH + N2O
1 record matched NO2 + NH → Products
2 records matched NO2 + NH2 → NO + NH2O
5 records matched NO2 + NH2 → H2O + N2O
9 records matched NO2 + NH2 → Products
1 record matched NO2 + BF → NO + OBF
1 record matched NO2 + GeH3 → Products
2 records matched NO2 + SiH3 → Products
4 records matched NO2 + OD → DNO3
1 record matched NO2 + 3-Carene → Products
1 record matched NO2 + ·CHF → Products
17 records matched NO2 + H· → ·OH + NO
1 record matched NO2 + Cyclohexadienyl → Benzene + HNO2
1 record matched NO2 + Cyclohexadienyl → Products
2 records matched NO2 + C2O → Products
1 record matched NO2 + OF → NO3 + ·F
1 record matched NO2 + OF → FONO2
17 records matched NO2 + NO3 → N2O5
5 records matched NO2 + NO3 → O2 + NO + NO2
3 records matched NO2 + Cyclohexadienyl, 6-hydroxy- → Products
1 record matched NO2 + (C2H5)2NO → HNO2 + C2H5N(O)=CHCH3
10 records matched NO2 + NO2 → N2O4
4 records matched NO2 + NO2 → NO + NO3
9 records matched NO2 + NO2 → O2 + NO + NO
1 record matched NO2 + NO2 → Products
16 records matched NO2 → NO + O·
1 record matched NO2 → O(1D) + NO
1 record matched NO + CF3CFOO(.)CF3 → NO2 + (CF3)2CFO(·)
1 record matched NO + CF3CFClOO(·) → NO2 + CF3CFClO(.)
1 record matched NO + CF3CF2OO· → NO2 + CF3OCF2(·)
1 record matched NO + CF3CH2OO(·) → CF3OCH2(.) + NO2
2 records matched NO + CF3C(O)OO(·) → NO2 + CF3C(O)O
1 record matched NO + CFCl2CH2OO(·) → CFCl2CH2O· + NO2
3 records matched NO + CF3CFHO2· → NO2 + CF3CFHO
1 record matched NO + CF3CCl2OO(·) → NO2 + CF3CCl2O(·)
1 record matched NO + CH2BrOO → CH2BrO + NO2
1 record matched NO + FC(O)OO → NO2 + FC(O)O·
2 records matched NO + CD3O2· → CD3O + NO2
2 records matched NO + CClF2OO → NO2 + CF2ClO
3 records matched NO + CH3CH2C(O)OO → NO2 + CH3CH2C(O)O
1 record matched NO + CH3C(O)CH2OO· → CH3C(O)CH2O· + NO2
1 record matched NO + CF3CClHOO(.) → NO2 + CF3CClHO(.)
1 record matched NO + CH2ClO2 → NO2 + CH2ClO
1 record matched NO + CH3OCH2O2 → NO2 + CH3OCH2
3 records matched NO + CCl2FO2 → NO2 + CFCl2O
2 records matched NO + CCl3O2 → NO2 + CCl3O
1 record matched NO + SF5O2 → NO2 + SF5O
1 record matched NO + HOC(CH3)2CH2OO(·) → NO2 + n-C4H9O2
1 record matched NO + HN=NO. → NO2 + HN=N
1 record matched NO + CH3(CH2)3CH2OO → 1-pentoxy radical + NO2
1 record matched NO + CCl3CCl2O2 → NO2 + C2Cl5O
8 records matched NO + CH3C(O)OO(·) → NO2 + CH3C(O)O
2 records matched NO + CH3C(O)OO(·) → CO2 + ·CH3 + NO2
2 records matched NO + Benzoyldioxy radical → Methoxy, oxophenyl- + NO2
1 record matched NO + HOCH2OO → NO2 + HOCH2O
2 records matched NO + BrO2 → NO2 + BrO
52 records matched NO + O· → NO2
3 records matched NO + OClO → NO2 + ClO
10 records matched NO + CF3O2 → NO2 + CF3O
1 record matched NO + CF3O2 → ·CF3 + NO2
5 records matched NO + BrO → Br· + NO2
8 records matched NO + ClO → NO2 + Cl
6 records matched NO + IO → NO2 + I
2 records matched NO + DO2 → NO2 + OD
1 record matched NO + BrNO2 → NO2 + NOBr
1 record matched NO + Iodine dioxide → NO2 + IO
2 records matched NO + ClNO2 → NOCl + NO2
1 record matched NO + NaO → Na + NO2
2 records matched NO + OF → NO2 + ·F
12 records matched NO + NO3 → NO2 + NO2
10 records matched NO + NO2 → N2O3
2 records matched NO + NO + HNO → NO2 + HN=NO.
2 records matched NO + NO + HNO → Other Products + NO2
17 records matched N2O5 → NO2 + NO3
2 records matched Br· + BrNO2 → Br2 + NO2
1 record matched Br· + NO3 → NO2 + BrO
4 records matched Br· + NO2 → BrNO2
1 record matched ClOO + NO2 → NO3 + ClO
2 records matched ClOO + NO → NO2 + ClO
1 record matched HBr + NO2 → HNO2 + Br·
2 records matched HI + NO2 → HNO2 + I
12 records matched O3 + NO2 → O2 + NO3
19 records matched O3 + NO → O2 + NO2
5 records matched N2O + NO → N2 + NO2
1 record matched Cl2O + NO2 → ClNO2 + ClO
1 record matched FNO + O· → NO2 + ·F
2 records matched HNO2 + ·F → HF + NO2
1 record matched HNO2 + NH2 → NH3 + NO2
1 record matched HNO2 + NO3 → HNO3 + NO2
1 record matched HNO2 + NO2 → HNO3 + NO
2 records matched HNO2 + HNO2 → H2O + NO + NO2
10 records matched O2 + NO + NO → NO2 + NO2
1 record matched F2 + NO2 → NO2F + ·F
1 record matched H2O + NO2 → ·OH + HNO2
4 records matched H2O + NO + NO2 → HNO2 + HNO2
1 record matched N2 + ClONO2 → N2 + NO2 + ClO
1 record matched P + NO2 → NO + PO
1 record matched H2O2 + NO2 → Products
1 record matched H2O2 + NO → H2O + NO2
2 records matched S + NO2 → NO + SO
1 record matched S + NO2 → Products
1 record matched HNO3 + H· → H2O + NO2
4 records matched HNO3 + NO → HNO2 + NO2
14 records matched HNO3 → ·OH + NO2
2 records matched NH3 + NO2 → HNO2 + NH2
1 record matched HCl + NO2 → HNO2 + Cl
1 record matched SO3 + NO2 → Products
2 records matched SO2 + NO3 → SO3 + NO2
3 records matched SO2 + NO2 → SO3 + NO
1 record matched SO2 + NO2 → Products
4 records matched Ca + NO2 → CaO + NO
1 record matched Zn + NO2 → ZnO + NO
1 record matched Ge + NO2 → NO + GeO
1 record matched Cu + NO2 → Products
2 records matched Cr + NO2 → NO + CrO
1 record matched Cd + NO2 → Cadmium oxide + NO
2 records matched Ba + NO2 → BaO + NO
1 record matched Ti + NO2 → Products
2 records matched Sn + NO2 → NO + SnO
2 records matched Sr + NO2 → SrO + NO
1 record matched Sr + NO2 → Products
1 record matched Hg + NO3 → NO2 + HgO
3 records matched Mg + NO2 → MgO + NO
1 record matched Fe + NO2 → FeO + NO
1 record matched Fe + NO2 → Products
1 record matched CD3O + NO3 → NO2 + CD3O2·
1 record matched CH3S· + NO2 → CH3SNO2
4 records matched CH3S· + NO2 → NO + CH3SO
2 records matched CH3S· + NO2 → Products
1 record matched Piperidine, 1-nitro- → NO2 + 1-Piperidinyl
1 record matched CD2OD + NO2 → Products
1 record matched ·CH2Cl + NO2 → Products
1 record matched d-Limonene + NO2 → Products
1 record matched CH3CH2C(O)OONO2 → NO2 + CH3CH2C(O)OO
1 record matched (E),(E)-CH3CH=CHCH=CHCH3 + NO2 → Products
1 record matched (E),(Z)-CH3CH=CHCH=CHCH3 + NO2 → Products
1 record matched CH3C(NO2)=CH2 → NO2 + CH2=C(·)CH3
1 record matched CH2=CHC(CH3)=CHCH3 + NO2 → Products
1 record matched HOCH2CH2 + NO2 → Products
1 record matched *CH2C(O)H + NO2 → Products
1 record matched (CH3)2CHO2 + NO2 → Products
3 records matched (CH3)2CHO2 + NO → i-C3H7O + NO2
1 record matched (E)-CH3CH=CHCHO + NO2 → Products
5 records matched (CH3)2NNO2 → NO2 + (CH3)2N
1 record matched 1,3-Cycloheptadiene + NO2 → Products
2 records matched i-C3H7O + NO2 → Products
1 record matched CF + NO2 → Products
1 record matched Cyclopentyl + NO2 → Products
1 record matched NF2 + NO2 → FNO + FNO
1 record matched (C2H5)2NOH + NO2 → HNO2 + (C2H5)2NO
1 record matched (C2H5)2NOH + NO2 → Products
1 record matched CHCl2 + NO2 → ClCO + HCl + NO
1 record matched CHCl2 + NO2 → Products
1 record matched CHCl2 + NO2 → ClNO + HC(O)Cl
1 record matched CHCl2 + NO2 → ClNO + CO + HCl
1 record matched (CH3)3CO2 + NO2 → (CH3)3COONO2
2 records matched (CH3)3CO2 + NO → (CH3)3CO + NO2
2 records matched ·OH + ClNO2 → HOCl + NO2
2 records matched ·OH + NO3 → HO2 + NO2
13 records matched ·OH + NO2 → HOONO
72 records matched ·OH + NO2 → HNO3
3 records matched ·OH + NO2 → HO2 + NO
10 records matched ·OH + NO2 → Products
2 records matched ·OH + NO2 → cis, cis-HOONO
2 records matched ·OH + NO2 → trans, perp-HOONO
10 records matched ·OH + HNO2 → H2O + NO2
1 record matched ·OH + HNO3 → H2O2 + NO2
1 record matched ·CH + NO2 → ·OH + CNO
4 records matched ·CH + NO2 → HCO + NO
1 record matched ·CH + NO2 → CO + HNO
1 record matched ·CH + NO2 → Other Products + CO
2 records matched ·CH + NO2 → Products
2 records matched HO2 + NO3 → ·OH + O2 + NO2
24 records matched HO2 + NO2 → HO2NO2
9 records matched HO2 + NO2 → O2 + HNO2
30 records matched HO2 + NO → ·OH + NO2
1 record matched ·CCl3 + NO2 → CCl3NO2
1 record matched ·CCl3 + NO2 → Products
2 records matched CH3CO + NO2 → NO + CH3C(O)O
1 record matched CH3CO + NO2 → CO2 + ·CH3 + NO
1 record matched CH3CO + NO2 → Products
1 record matched C2H5OO· + NO3 → CH3CH2O· + O2 + NO2
4 records matched C2H5OO· + NO2 → C2H5OONO2
2 records matched C2H5OO· + NO2 → Products
5 records matched C2H5OO· + NO → CH3CH2O· + NO2
2 records matched CH3C(O)CH2(·) + NO2 → Products
1 record matched CH3CH2OOH + NO2 → Products
1 record matched CH3OOH + NO2 → Products
1 record matched CS + NO2 → COS + NO
1 record matched CH2CN + NO2 → Products
1 record matched CH2C≡CH + NO2 → Products
1 record matched NOCl + ClONO2 → Cl2 + NO2 + NO2
1 record matched NOCl + NO3 → NO2 + ClNO2
3 records matched NOCl + NO2 → NO + ClNO2
1 record matched C2H3 + NO2 → Products
10 records matched NCN + NO2 → Products
1 record matched (Z)-CH2=CHCH=CHCH=CH2 + NO2 → Products
1 record matched ClCO + NO2 → CO2 + NO + Cl
2 records matched methyl,(3-fluorophenyl-) + NO2 → Products
3 records matched HCO + NO2 → NO + HCOO
2 records matched HCO + NO2 → CO + HNO2
1 record matched HCO + NO2 → CO + ·OH + NO
3 records matched HCO + NO2 → CO2 + NO + H·
7 records matched HCO + NO2 → Products
1 record matched (·)CH2OH + NO2 → HOCH2NO2
1 record matched (·)CH2OH + NO2 → Products
1 record matched n-C4H9 + NO2 → Products
1 record matched Phenyl + NO2 → Products
2 records matched sec-C4H9 + NO2 → Products
1 record matched 2-Methylbenzyl + NO2 → Products
1 record matched 3-Methylbenzyl + NO2 → Products
1 record matched CH3CHOH + NO2 → Products
1 record matched CH3C(O)OONO2 + NO2 → Products
10 records matched CH3C(O)OONO2 → NO2 + CH3C(O)OO(·)
4 records matched ·CF3 + NO2 → NO + CF3O
4 records matched ·CF3 + NO2 → COF2 + FNO
5 records matched ·CF3 + NO2 → Products
8 records matched ·CH3 + NO2 → CH3O· + NO
6 records matched ·CH3 + NO2 → CH3NO2
1 record matched ·CH3 + NO2 → Products
1 record matched ·CH3 + HNO2 → CH4 + NO2
1 record matched ·CH3 + He + NO2 → Products + He
2 records matched 2-C4H9O + NO2 → Products
2 records matched methyl,(4-fluorophenyl-) + NO2 → Products
1 record matched ·CF2 + NO2 → COF2 + NO
1 record matched CH3CH2O· + NO3 → C2H5OO· + NO2
1 record matched CH3CH2O· + NO2 → C2H5ONO2
1 record matched CH3CH2O· + NO2 → CH3CHO + HNO2
2 records matched CH3O· + NO3 → CH3O2· + NO2
9 records matched CH3O· + NO2 → CH3ONO2
5 records matched CH3O· + NO2 → CH2O + HNO2
4 records matched CH3O· + NO2 → Products
1 record matched n-C3H7 + NO2 → NO + n-C3H7O
1 record matched n-C3H7 + NO2 → 1-nitropropane
1 record matched n-C3H7 + NO2 → Products
1 record matched Cyclohexyldioxyl + NO2 → Adduct
4 records matched CH3O2· + NO3 → CH3O· + O2 + NO2
14 records matched CH3O2· + NO2 → CH3O2NO2
3 records matched CH3O2· + NO2 → Products
14 records matched CH3O2· + NO → CH3O· + NO2
3 records matched ·C2H + NO2 → Products
2 records matched C6H5O + NO2 → Products
1 record matched ·CHCl + NO2 → Products
1 record matched ·C2H5 + NO2 → C2H5NO2
3 records matched ·C2H5 + NO2 → Products
2 records matched iso-C3H7 + NO2 → Products
1 record matched (E)-CH2=CHCH=CHCH3 + NO2 → Products
1 record matched ·CH2CH=CH2 + NO2 → NO + CH2=CHCH2O
1 record matched ·CH2CH=CH2 + NO2 → Products
1 record matched (CH3)2CHONO2 → i-C3H7O + NO2
1 record matched 1,3-Cyclooctadiene + NO2 → Products
1 record matched ·CClF2 + NO2 → NO + CF2ClO
2 records matched ·CClF + NO2 → Products
2 records matched tert-C4H9 + NO2 → Products
1 record matched CCl2 (X 1A1) + NO2 → Products
1 record matched (Z)-CH2=CHCH=CHCH3 + NO2 → Products
1 record matched FeO + NO2 → NO + FeO2
2 records matched H2 + NO2 → HNO2 + H·
2 records matched CaO2 + NO2 → NO + CaO3
2 records matched CaO + NO2 → CaO2 + NO
1 record matched (CH3)2C=CHCH=CH2 + NO2 → Products
1 record matched Hexanitroethane → NO2 + C(NO2)3C(NO2)2
1 record matched tert-C4H9NO + NO2 → (CH3)3CNO2 + NO
1 record matched (E)-CH2=CHCH=CHCH=CH2 + NO2 → Products
1 record matched (CH3)2C=CHCH=C(CH3)2 + NO2 → Products
1 record matched CH2CHCCH + NO2 → Products
4 records matched CO + NO2 → CO2 + NO
1 record matched 1,4-Cyclohexadiene + NO2 → Products
2 records matched n-C3H7ONO2 → NO2 + n-C3H7O
5 records matched C2H5ONO2 → CH3CH2O· + NO2
1 record matched (E)-2-C4H8 + NO2 → Adduct
1 record matched (E)-2-C4H8 + NO2 → Products
1 record matched 2-Nitrofuran → Other Products + NO2
1 record matched 1,1-Dinitropropane → (CH3)2CNO2 + NO2
4 records matched CH3ONO2 → CH3O· + NO2
1 record matched (CH3)2C(NO2)2 → (CH3)2CO + NO + NO2
1 record matched 1,3-Cyclohexadiene + NO2 → HNO2 + Cyclohexadienyl
3 records matched 1,3-Cyclohexadiene + NO2 → Products
1 record matched CH3CH=CHCH=CHCH3 + NO2 → Products
1 record matched 1-C6H12 + NO2 → Products
1 record matched CH2=CHCH2CH=CH2 + NO2 → Products
1 record matched (Z)-2-C4H8 + NO3 → cis-2,3-Dimethyloxirane + NO2
1 record matched (Z)-2-C4H8 + NO2 → Adduct
1 record matched (Z)-2-C4H8 + NO2 → Products
1 record matched Nitrosobenzene + NO2 → Nitrobenzene + NO
1 record matched (CH3)2C=C(CH3)2 + NO3 → oxirane, tetramethyl- + NO2
2 records matched (CH3)2C=C(CH3)2 + NO2 → Products
1 record matched 1,3,5-Cycloheptatriene + NO2 → Products
1 record matched Cyclopentadiene + NO2 → Products
2 records matched CH2=C(CH3)C(CH3)=CH2 + NO2 → Products
1 record matched (CH3)2C=CHCH3 + NO3 → oxirane, 2,2,3-trimethyl- + NO2
1 record matched (CH3)2C=CHCH3 + NO2 → Products
1 record matched Methane, tetranitro- → C(NO2)3 + NO2
1 record matched CH3CCCH3 + NO2 → Products
1 record matched beta-pinene + NO2 → Products
1 record matched CO2 + NO → CO + NO2
1 record matched n-C3H7CHO + NO2 → HNO2 + CH3CH2CH2CO
1 record matched C2H5CHO + NO2 → HNO2 + CH3CH2CO
1 record matched Myrcene + NO2 → Products
1 record matched P(OCH3)3 + NO2 → Products
1 record matched Benzene, 1-methyl-2,4-dinitro → Other Products + NO2
1 record matched Indole + NO2 → Products
1 record matched Isoquinoline + NO2 → Products
1 record matched C2F4 + NO2 → Adduct
1 record matched iso-C4H8 + NO3 → 2,2-Dimethyloxirane + NO2
1 record matched iso-C4H8 + NO2 → Products
3 records matched CH3CH=CH2 + NO2 → Products
1 record matched Cyclohexene + NO2 → Products
1 record matched 1-C5H10 + NO2 → Products
2 records matched Toluene + NO2 → Products
3 records matched 1-nitropropane → n-C3H7 + NO2
1 record matched (CHO)2 + NO2 → Products
3 records matched 1,3-Butadiene + NO2 → Products
1 record matched 1-C4H8 + NO2 → Products
1 record matched 2-Vinylpyridine + NO2 → Products
1 record matched Styrene + NO2 → Products
3 records matched Benzene, 1-methyl-4-nitro- → Phenyl, 4-methyl- + NO2
1 record matched α-Terpinene + NO2 → Products
1 record matched γ-Terpinene + NO2 → Products
1 record matched α-Phellandrene(R,S) + NO2 → Products
1 record matched 1,3-Dinitrobenzene → m-Nitrophenyl radical + NO2
3 records matched Nitrobenzene → Phenyl + NO2
1 record matched Quinoline + NO2 → Products
3 records matched Benzene,1-methyl-2-nitro- → NO2 + Phenyl, 2-methyl-
1 record matched alpha-pinene + NO2 → Products
4 records matched 2-nitropropane → iso-C3H7 + NO2
1 record matched CF2=CCl2 + NO2 → Products
6 records matched C2H5NO2 → ·C2H5 + NO2
2 records matched C2HCl3 + NO2 → Products
6 records matched CH2=C(CH3)CH=CH2 + NO2 → Products
1 record matched CF3CHO + NO2 → CF3C(O) + HNO2
14 records matched CH3NO2 → ·CH3 + NO2
1 record matched Oxirane + NO2 → Products
1 record matched (CH3)2S + NO2 → (CH3)2SO + NO
1 record matched HN=C=O + NO2 → CO2 + HN=NO.
6 records matched CH3CHO + NO2 → CH3CO + HNO2
1 record matched CH3CHO + NO2 → Products
1 record matched CH3CCH + NO2 → Products
1 record matched C3H8 + NO2 → iso-C3H7 + HNO2
1 record matched C3H8 + NO2 → Products
1 record matched HCN + NO2 → Products
1 record matched CH3I + NO3 → CH3O· + NO2 + I
1 record matched C2H2 + NO2 → Other Products + NO
1 record matched C2H2 + NO2 → Adduct
1 record matched C2H4 + NO2 → Adduct
4 records matched C2H4 + NO2 → Products
1 record matched CH4 + NO2 → ·CH3 + HNO2
1 record matched Benzene + NO2 → Products
1 record matched (CH3)2CO + NO2 → CH3C(O)CH2(·) + HNO2
2 records matched CH3OH + NO2 → (·)CH2OH + HNO2
1 record matched (CH3)2NNH2 + NO2 → Products
3 records matched CN + NO2 → NO + NCO
2 records matched CN + NO2 → CO + N2O
2 records matched CN + NO2 → CO2 + N2
3 records matched CN + NO2 → Products
4 records matched CH2O + NO2 → HCO + HNO2
2 records matched CH2O + NO2 → Products
2 records matched O(1D) + NO2 → NO2 + O·
4 records matched O(1D) + NO2 → O2 + NO
1 record matched O(1D) + N2O → NO2 + N
1 record matched O2(1DELTA) + NO2 → O2 + NO2
1 record matched O2(1DELTA) + NO → NO2 + O·
2 records matched CH3SCH2OO· + NO2 → Adduct
3 records matched CH3SCH2OO· + NO → CH3SCH2O· + NO2
1 record matched CH2FCHFO2· + NO → CH2FCHFO· + NO2
1 record matched CH3CFClOO· + NO → CH3CFClO + NO2
2 records matched CH2ClOONO2 → NO2 + CH2ClO2
4 records matched CF3C(O)O2NO2 → NO2 + CF3C(O)OO(·)
1 record matched CClF2C(O)OONO2 → CClF2C(O)OO· + NO2
1 record matched CCl2FC(O)O2NO2 → CCl2FC(O)OO· + NO2
3 records matched CCl3C(O)O2NO2 → CCl3C(O)OO· + NO2
1 record matched CClF2CH2OONO2 → NO2 + CF2ClCH2OO·
1 record matched CCl2FCH2OONO2 → NO2 + CFCl2CH2OO(·)
1 record matched CF3CF2CFHOO(.) + NO2 → CF3CF2CFHOONO2
1 record matched CF3CF2CFHOO(.) + NO → CF3CF2CFHO(.) + NO2
1 record matched CH2=C(CH3)C(O)OO(.) + NO → Other Products + NO2
1 record matched CHClFOO(.) + NO → NO2 + CHClFO(.)
1 record matched CH3OC(O)OCH2OO(.) + NO2 → CH3OC(O)OCH2OONO2
1 record matched CF3CF2CF2OO(.) + NO2 → CF3CF2CF2OONO2
1 record matched CCl3CClHO2 + NO2 → CCl3CHClOONO2
1 record matched CF3CH(OO.)OCH2CF3 + NO2 → CF3CH(OONO2)OCH2CF3
1 record matched OH(v=5) + NO2 → Products
1 record matched OH(v=4) + NO2 → Products
1 record matched OH(v=3) + NO2 → Products
1 record matched OH(v=2) + NO2 → Products
1 record matched OH(v=1) + NO2 → Products
1 record matched C6H5C(O)O2 + NO2 → C6H5CO(O)2NO2
1 record matched C6H5C(O)O2 + NO → 2C6H5COO + NO2
1 record matched CF3C(O)OCH(OO)CF3 + NO2 → Products
1 record matched ClS(CH3)2 + NO2 → Products
1 record matched HOCH2=CH(O2)C(CH3)=CH2 + NO → HOCH2CH(O)CCH3=CH2 + NO2
1 record matched M + NO2 + IO → M + IONO2
2 records matched M + ·OH + NO2 → M + HOONO
2 records matched M + ·OH + NO2 → M + HNO3
2 records matched M + ·OH + NO2 → cis, cis-HOONO + M
1 record matched M + CH3O2· + NO2 → M + CH3O2NO2
2 records matched O(3P) + NO2 → NO3
2 records matched O(3P) + NO2 → O2 + NO
1 record matched C5H8OHO2 + NO → C5H8OHO + NO2
1 record matched HC(O)C(O)O2 + NO2 → Products
1 record matched CHBr2OO(·) + NO → CHBr2O(.) + NO2
1 record matched (18)OH + NO2 → Products
1 record matched CH3(Cl)S(O)CH3 + NO2 → Products
1 record matched p-xylene-OH adduct + NO2 → Products
1 record matched aniline-OH adduct + NO2 → Products
1 record matched m-cresol-OH adduct + NO2 → Products
1 record matched CH2C(Cl)CHCl + NO2 → Products
1 record matched C2H5ICl + NO2 → Products
1 record matched CH3CH2CH2CH(OO ·)CH3 + NO → 2-pentoxy radical + NO2
1 record matched (CH3)2C(OO·)CH2CH3 + NO → CH3CH2C(CH3)2O(·) + NO2
2 records matched C6H5OO· + NO2 → C6H5O + NO3
2 records matched cis-BrONO + Br· → Br2 + NO2
2 records matched trans-BrONO + Br· → Br2 + NO2
1 record matched O2(b1Sigma_g+) + N2O → Other Products + NO2
1 record matched Propyldioxy (unspecified) + NO → Propoxy (unspecified) + NO2
1 record matched C4F9OCH2O2 + NO2 → C5F9H2NO5
1 record matched Azetidine, 1,3,3-trinitro- → NO2 + H2C=N + CH2=C(NO2)2
2 records matched Azetidine, 1,3,3-trinitro- → CH2=C=CH2 + NO2 + NO2 + NO dimer
1 record matched Azetidine, 1,3,3-trinitro- → CH2=CNO2 + NO2 + H2C=NNO2
1 record matched Azetidine, 1,3,3-trinitro- → cyc-N(·)CH2C(NO2)2CH2 + NO2
1 record matched Azetidine, 1,3,3-trinitro- → cyc-C(·)(NO2)CH2N(NO2)CH2 + NO2
1 record matched Azetidine, 1,3,3-trinitro- → CH2=NC(:)NO2 + NO2 + NO2
1 record matched CH3CH2CH2OONO2 → NO2 + n-C3H7O2
1 record matched H2C=NNO2 → NO2 + H2C=N
1 record matched BrONO2 → NO2 + BrO
2 records matched CH3SNO2 → CH3S· + NO2
1 record matched O· + BrONO2 → NO2 + BrO2
6 records matched HNO + O· → NO2 + H·
1 record matched NOBr + BrONO2 → Br2 + NO2 + NO2
1 record matched H· + ClONO2 → HOCl + NO2
1 record matched NO3 + H· → ·OH + NO2
1 record matched NO2 + Naphthalenyl, 1, ? -dihydro-1-(nitrooxy)- → Products
1 record matched NO2 + CH3SSO → CH3S(S)O2 + NO
1 record matched NO2 + CCl2=CCl → NO + ·CCl2C(O)Cl
1 record matched NO2 + CCl2=CCl → ClNOCCl2 + CO
1 record matched NO2 + CCl2=CCl → ClNO + Cl2C=C=O
1 record matched NO2 + CCl2=CCl → ClCNO + COCl2
1 record matched NO2 + FC(O)O· → NO + FC(O)OO
1 record matched NO2 + FC(O)O· → FCO + NO2
1 record matched NO2 + FC(O)O· → CO2 + NO2F
2 records matched NO2 + CCl2FO2 → CFCl2OONO2
2 records matched NO2 + CCl3O2 → CCl3OONO2
1 record matched NO2 + HN=NO. → NO3 + HN=N
1 record matched NO2 + HN=NO. → HNO2 + N2O
1 record matched NO2 + CH2OO → Products
2 records matched NO2 + CH3SOO → NO + CH3SO3
1 record matched NO2 + HCCO → Products
4 records matched NO2 + CH3C(O)OO(·) → CH3C(O)OONO2
1 record matched NO2 + Benzoyldioxy radical → Peroxide, benzoyl nitro-
1 record matched NO2 + CH3SS → NO + CH3SSO
1 record matched NO2 + CH3SO → NO + CH3SOO
2 records matched NO2 + Cl → ClNO2
2 records matched NO2 + Cl → ClNO2
2 records matched NO2 + NCO → CO + NO + NO
2 records matched NO2 + NCO → CO2 + N2O
2 records matched NO2 + CF3O → CF3ONO2
1 record matched NO2 + CF3O → COF2 + NO2F
3 records matched NO2 + O· → NO3
1 record matched NO2 + O· → O2 + NO
3 records matched NO2 + CF3O2 → CF3OONO2
1 record matched NO2 + ·CH2SH → CH2S + HNO2
1 record matched NO2 + ·CH2SH → trans-HONO + CH2S
1 record matched NO2 + ·CH2SH → CH2(O)SH + NO
1 record matched NO2 + ·CH2SH → HSCH2NO2
1 record matched NO2 + ·CH2SH → cis-HCSH + HNO2
1 record matched NO2 + ·CH2SH → cis-HCSH + cis-HONO
1 record matched NO2 + ·CH2SH → cis-HCSH + trans-HONO
1 record matched NO2 + ·CH2SH → trans-HCSH + HNO2
1 record matched NO2 + ·CH2SH → trans-HCSH + cis-HONO
1 record matched NO2 + ·CH2SH → trans-HCSH + trans-HONO
1 record matched NO2 + ·CH2SH → (3)HCSH + HNO2
1 record matched NO2 + ·CH2SH → (3)HCSH + cis-HONO
1 record matched NO2 + ·CH2SH → (3)HCSH + trans-HONO
1 record matched NO2 + ·CH2SH → (3)CH2S + HNO2
1 record matched NO2 + ·CH2SH → (3)CH2S + cis-HONO
1 record matched NO2 + ·CH2SH → (3)CH2S + trans-HONO
2 records matched NO2 + n-C3H7O → n-C3H7ONO2
1 record matched NO2 + SCN → NCO + SNO
1 record matched NO2 + SCN → COS + N2O
1 record matched NO2 + SCN → SCNO + NO
1 record matched NO2 + BrO → BrOONO
6 records matched NO2 + BrO → BrONO2
4 records matched NO2 + ClO → ClONO2
1 record matched NO2 + ·F → FONO
1 record matched NO2 + ·F → NO2F
3 records matched NO2 + IO → IONO2
1 record matched NO2 + I → INO2
1 record matched NO2 + ·N3 → N2O + N2O
1 record matched NO2 + ·N3 → N2 + NO + NO
1 record matched NO2 + ·N3 → N2 + N2O + O·
1 record matched NO2 + ·N3 → N2 + N2 + O2
1 record matched NO2 + ·N3 → O(1D) + N2 + N2O
1 record matched NO2 + ·N3 → O2(1DELTA) + N2 + N2
1 record matched NO2 + NH → NO + HNO
1 record matched NO2 + NH → ·OH + N2O
1 record matched NO2 + C2O → CO + CO + NO
1 record matched NO2 + C2O → CO2 + CNO
1 record matched NO2 + C2O → NCCO + O2
1 record matched NO2 + C2O → c-OCC-O + NO
1 record matched NO2 + OF → NO3 + ·F
1 record matched NO2 + OF → NO + O2F
4 records matched NO2 + OF → FONO2
1 record matched NO2 + OF → O2 + FNO
4 records matched NO2 + NO3 → N2O5
2 records matched NO2 + NO3 → O2 + NO + NO2
1 record matched NO2 + NO2 → N2O4 + ONONO2
2 records matched NO2 + NO2 → N2O4
1 record matched NO2 → NO + O·
1 record matched NO + CH3S(O)2OO → NO2 + CH3SO3
1 record matched NO + CH2ClO → ·CH2Cl + NO2
1 record matched NO + HOCH2CH2O2· → NO2 + HOCH2CH2O
2 records matched NO + O· → NO2
2 records matched NO + CF3O2 → NO2 + CF3O
1 record matched NO + O2F → NO2 + OF
1 record matched NO + IO → NO2 + I
3 records matched NO + NO3 → NO2 + NO2
1 record matched NO + NO2 → N2O3
4 records matched N2O5 → NO2 + NO3
1 record matched Br· + NO2 → BrNO2
1 record matched O3 + NO3 → O2 + O2 + NO2
2 records matched O3 + NO2 → O2 + NO3
1 record matched O3 + NO2 → O2 + O2 + NO
1 record matched N2O + NO → N2 + NO2
1 record matched H2S + NO3 → NO2 + H2OS
1 record matched HNO2 + ·CH2SH → CH3SH + NO2
1 record matched HNO2 + H· → H2 + NO2
2 records matched O2 + NO + NO → NO2 + NO2
1 record matched H2O2 + NO2 → ·OH + HNO3
1 record matched S + NO2 → NO + SO
1 record matched HNO3 → ·OH + NO2
2 records matched NH3 + NO2 → HNO2 + NH2
1 record matched NH3 + NO2 → Other Products + NH2
2 records matched NH3 + NO2 → Products
1 record matched NH3 + NO2 → (E)-ONOH + NH2
1 record matched NH3 + NO2 → (Z)-ONOH + NH2
2 records matched NH3 + NO2 → cis-HONO + NH2
2 records matched NH3 + NO2 → trans-HONO + NH2
2 records matched SO2 + NO3 → SO3 + NO2
1 record matched Ca + NO2 → Products
1 record matched C + NO2 → CO + NO
1 record matched W + NO2 → NO + WO
1 record matched W + NO2 → WN + O2
1 record matched Fe + NO2 → FeO + NO
1 record matched CH3S· + NO2 → CH3SNO2
1 record matched CH3S· + NO2 → NO + CH3SO
1 record matched CH3S· + HNO2 → CH3SH + NO2
1 record matched Ethanamine, N-ethyl-N-nitro- → NO2 + (C2H5)2N·
1 record matched ·CH2Cl + NO2 → H2O + ClNCO
1 record matched ·CH2Cl + NO2 → HC(O)Cl + :NOH
1 record matched ·CH2Cl + NO2 → HC(O)Cl + HNO
1 record matched ·CH2Cl + NO2 → ClNO + CH2O
1 record matched ·CH2Cl + NO2 → ClCNO + H2O
3 records matched (CH3)2NNO2 → NO2 + (CH3)2N
1 record matched (CH3)2NNO2 → CH2=NCH3 + HNO2 + NO2
1 record matched ·CH2F + NO2 → NO + CH2FO(.)
1 record matched ·CH2F + NO2 → HFCO + :NOH
1 record matched ·CH2F + NO2 → HFCO + HNO
1 record matched ·CH2F + NO2 → CH2O + NO + ·F
1 record matched ·CH2F + NO2 → CH2O + FNO
1 record matched ·CH2F + NO2 → FNCO + H2O
1 record matched ·CH2F + NO2 → FOCN + H2O
1 record matched ·CH2F + NO2 → HOCNO + HF
1 record matched ·CH2F + NO2 → CH2FNO2
1 record matched ·CH2F + NO2 → FCNO + H2O
1 record matched CH2=CHNO2 → C2H3 + NO2
1 record matched CHCl2 + NO2 → HC(O)Cl + NO + Cl
1 record matched CHCl2 + NO2 → HC(O)Cl + NOCl
1 record matched CHCl2 + NO2 → CCl2 (X 1A1) + HNO2
1 record matched CHCl2 + NO2 → COCl2 + :NOH
1 record matched CHCl2 + NO2 → COCl2 + HNO
1 record matched CHCl2 + NO2 → ClNO + HC(O)Cl
1 record matched (CH3)3CO2 + NO2 → Products
1 record matched ·OH + NO3 → HO2 + NO2
4 records matched ·OH + NO2 → HOONO
6 records matched ·OH + NO2 → HNO3
1 record matched ·OH + NO2 → HO2 + NO
1 record matched ·OH + NO2 → Products
1 record matched ·CH + NO2 → Products
2 records matched HO2 + NO2 → HO2NO2
1 record matched HO2 + NO2 → trans-HONO + O2
1 record matched HO2 + NO2 → O2(1Delta_g) + trans-HONO
3 records matched HO2 + NO → ·OH + NO2
1 record matched HO2 + H2O + NO → ·OH + H2O + NO2
1 record matched ·CCl3 + NO2 → COCl2 + NO + Cl
1 record matched ·CCl3 + NO2 → ClNO + COCl2
1 record matched CH3CO + NO2 → CO2 + ·CH3 + NO
1 record matched (CH3)3CO + NO2 → (CH3)3CONO2
1 record matched 1,3,5,7-Tetrazocine, octahydro-1,3,5,7-tetranitro- → Other Products + NO2
1 record matched 1,3,5,7-Tetrazocine, octahydro-1,3,5,7-tetranitro- → CH2NCH2N(NO2)CH2NNO2 + NO2 + H2C=NNO2
1 record matched 1,3,5,7-Tetrazocine, octahydro-1,3,5,7-tetranitro- → CH2N(NO2)CH2N(NO2)CH2NNO2 + NO2 + H2C=N
3 records matched 1,3,5,7-Tetrazocine, octahydro-1,3,5,7-tetranitro- → octahydro-1,3-trinitro-1,3,5,7-Tetrazocinyl radical + NO2
1 record matched NCN + NO2 → Products
1 record matched NCN + N2 + NO2 → Products + N2
1 record matched NCN + He + NO2 → Products + He
1 record matched ClCO + NO2 → Products
2 records matched HCO + NO2 → NO + HCOO
3 records matched HCO + NO2 → CO + HNO2
1 record matched HCO + NO2 → CO + ·OH + NO
1 record matched HCO + NO2 → CO2 + HNO
1 record matched HCO + NO2 → CO2 + NO + H·
1 record matched HCO + NO2 → cis-HONO + CO
1 record matched HCO + NO2 → trans-HONO + CO
3 records matched HCO + HNO2 → CH2O + NO2
1 record matched (·)CH2OH + NO2 → CH(O)NO + H2O
1 record matched (·)CH2OH + NO2 → HCO + H2O + NO
1 record matched (·)CH2OH + NO2 → HCOOH + HNO
1 record matched (·)CH2OH + NO2 → CH2O + HNO2
1 record matched (·)CH2OH + NO2 → cis-HONO + CH2O
1 record matched (·)CH2OH + NO2 → trans-HONO + CH2O
1 record matched (·)CH2OH + NO2 → HOCNO + H2O
1 record matched (·)CH2OH + NO2 → HONCO + H2O
1 record matched COOH + NO2 → Products
2 records matched Phenyl + NO2 → Products
6 records matched CH3C(O)OONO2 → NO2 + CH3C(O)OO(·)
1 record matched ·CH3 + NO2 → HNO2 + ·CH2
1 record matched ·CH3 + NO2 → CH3O· + NO
1 record matched ·CH3 + NO2 → CH3ONO
2 records matched ·CH3 + NO2 → CH3NO2
1 record matched ·CH3 + NO2 → CH2O + HNO
1 record matched ·CH3 + NO2 → trans-HONO + ·CH2
1 record matched Octahydro-1,3,5,7-tetranitro-1,3,5,7-tetrazocine → octahydro-1,3-trinitro-1,3,5,7-Tetrazocinyl radical + NO2
1 record matched CH3CH2O· + NO2 → C2H5ONO2
1 record matched CH3CH2O· + NO2 → CH3CHO + HNO2
2 records matched CH3O· + NO2 → CH3ONO2
2 records matched CH3O· + NO2 → CH2O + HNO2
1 record matched CH3O· + NO2 → Products
1 record matched CH3O· + NO → CH3O· + NO2
3 records matched CH3O2· + NO2 → CH3O2NO2
1 record matched CH3O2· + NO → CH3O· + NO2
2 records matched ·CHCl + NO2 → Products
1 record matched ·C2H5 + NO2 → CH3CH2O· + NO
2 records matched ·C2H5 + NO2 → C2H5ONO
1 record matched H2 + NO2 → HNO2 + H·
2 records matched H2 + NO2 → H2O + NO
1 record matched (CH3)3CONO2 → (CH3)3CO + NO2
1 record matched C2H5ONO2 → CH3CH2O· + NO2
1 record matched CH3ONO + H· → CH4 + NO2
1 record matched CH3ONO2 → CH3O· + NO2
1 record matched CH3NHNO2 → NO2 + CH3NH
1 record matched (CH3)2C=C(CH3)2 + NO3 → oxirane, tetramethyl- + NO2
1 record matched CH(NO2)3 → CH(NO2)2 + NO2
1 record matched 2-C4F8 (unspecified) + NO2 → Perfluorobutene-2 epoxide + NO
1 record matched Fluoranthene + NO2 → H· + Fluoranthene, 2-nitro-
1 record matched Pyrene + NO2 → Pyrene, 2-nitro- + H·
2 records matched 1,3,5-Triazine, hexahydro-1,3,5-trinitro- → NO2 + 1,3,5-Triazinyl-1(2H)-yl, tetrahydro-3,5-dinitro-
1 record matched Furan + NO3 → Z-(O)CHCH=CHCH(O) + NO2
2 records matched Nitrobenzene + Cl → Chlorobenzene + NO2
2 records matched Nitrobenzene → Phenyl + NO2
3 records matched Benzene,1-methyl-2-nitro- → NO2 + Phenyl, 2-methyl-
1 record matched C2HCl3 + NO2 → Products
2 records matched CH3NO2 → ·CH3 + NO2
1 record matched iso-C4H10 + NO2 → tert-C4H9 + HNO2
1 record matched iso-C4H10 + NO2 → cis-HONO + tert-C4H9
1 record matched iso-C4H10 + NO2 → trans-HONO + tert-C4H9
1 record matched (CH3)2S + NO3 → (CH3)2SO + NO2
1 record matched C3H8 + NO2 → iso-C3H7 + HNO2
1 record matched C3H8 + NO2 → cis-HONO + iso-C3H7
1 record matched C3H8 + NO2 → trans-HONO + iso-C3H7
1 record matched CH3SH + NO2 → HNO2 + ·CH2SH
1 record matched CH3SH + NO2 → CH3S· + HNO2
1 record matched C2H6 + NO2 → ·C2H5 + HNO2
1 record matched C2H6 + NO2 → cis-HONO + ·C2H5
1 record matched C2H6 + NO2 → trans-HONO + ·C2H5
3 records matched CH4 + NO2 → ·CH3 + HNO2
1 record matched CH4 + NO2 → cis-HONO + ·CH3
2 records matched CH4 + NO2 → trans-HONO + ·CH3
1 record matched Benzene + NO2 → Phenyl + HNO2
1 record matched Benzene + NO2 → cis-HONO + Phenyl
1 record matched Benzene + NO2 → trans-HONO + Phenyl
1 record matched (CH3)2SO + NO3 → (CH3)2SO2 + NO2
1 record matched CH3NHNH2 + NO2 → CH3N(·)NH2 + cis-HONO
1 record matched CH3NHNH2 + NO2 → CH3N(·)NH2 + trans-HONO
1 record matched CH3NHNH2 + NO2 → CH3NHNH· + cis-HONO
1 record matched CH3NHNH2 + NO2 → CH3NHNH· + trans-HONO
1 record matched CH3NHNH2 + NO2 → HNOO + CH3N(·)NH2
1 record matched CH3NHNH2 + NO2 → HNOO + CH3NHNH·
1 record matched CN + NO2 → NCNO2
1 record matched CH2O + NO2 → HCO + HNO2
1 record matched CH2O + NO2 → Products
1 record matched CH2O + NO2 → cis-HONO
1 record matched NO3 - isoprene radical adduct → Oxirane + NO2
1 record matched (Z)-ONOH + NH2 → NH3 + NO2
1 record matched cis-HONO + ·F → HF + NO2
2 records matched cis-HONO + NH2 → NH3 + NO2
2 records matched cis-HONO + NO2 → HNO3 + NO
1 record matched cis-HONO → CH2O + NO2
1 record matched cis-HONO + cis-HONO → H2O + NO + NO2
1 record matched trans-HONO + Cl → HCl + NO2
1 record matched trans-HONO + ·F → HF + NO2
1 record matched trans-HONO + NH2 → NH3 + NO2
2 records matched trans-HONO + NO2 → HNO3 + NO
1 record matched trans-HONO + cis-HONO → H2O + NO + NO2
1 record matched trans-HONO + trans-HONO → H2O + NO + NO2
1 record matched N(2D) + NO2 → Products
1 record matched O(3P) + ClONO2 → NO2 + OClO
2 records matched O(3P) + ClONO2 → ClOO + NO2
1 record matched cis-ClONO + NO2 → NO2 + ClNO2
1 record matched cis-ClONO + NO2 → NO + ClONO2
1 record matched trans-ClONO + NO2 → NO2 + ClNO2
1 record matched trans-ClONO + NO2 → NO + ClONO2
1 record matched CBr3OO(·) + NO → CBr3O(·) + NO2
1 record matched [cyclic-CHCHN(NO2)CHN(NO2)]2(N-NO2)2 → 1,5-dihydrodiimidazo[4,5-b:4¢,5¢-e]pyrazine + HNO2 + NO2
1 record matched ·OOCH2C(O)OH + NO → ·OCH2C(O)OH + NO2
1 record matched ·OOC(O)C(O)OH + NO → HC(O)C(O)O2 + NO2
1 record matched HSCH2NO2 → NO2 + ·CH2SH
1 record matched c-N3 + NO2 → N2 + NO + NO
1 record matched c-N3 + NO2 → N-N(O)O + N2
1 record matched CH3S(O)(OH)CH3 + NO2 → (CH3)2SO2 + HNO2
1 record matched NCN3 + NO2 → ONCN + NO
1 record matched Furan·NO3(complex) → NO2 + 2(3H)-Furanone
1 record matched CH2CHC(O)OONO2 → CH2CHC(O)OO + NO2
1 record matched CH(NO2)2 → CH(NO2) + NO2
1 record matched cis-BrONO + NO2 → NO2 + BrNO2
1 record matched cis-BrONO + NO2 → NO + BrONO2
1 record matched trans-BrONO + NO2 → NO2 + BrNO2
1 record matched trans-BrONO + NO2 → NO + BrONO2
1 record matched C2(a3PIu) + NO2 → Products

Search returned 2754 records.