Kinetics Database Logo

Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences

Feedback

Rate Our Products and Services

Help


Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty

More...


Administrative Links

NIST home page

MML home page

Chemical and Biochemical Reference Data Division

MML home page

Chemical and Biochemical Reference Data Division

  NIST Logo Home
©NIST, 2013
Accessibility information

Search Results


Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
1 record matched CH3CH=CH2 + Cl → Products
1 record matched O(3P) + CH3CH=CH2 → Products
1 record matched Cs(9 2P3/2) + CH3CH=CH2 → Other Products + CsH
3 records matched iso-C4H9 → CH3CH=CH2 + ·CH3
1 record matched CH3CH2CH2CHCH3 → CH3CH=CH2 + ·C2H5
2 records matched sec-C4H9 → CH3CH=CH2 + ·CH3
1 record matched ·CH3 + C2H3 → CH3CH=CH2
1 record matched n-C3H7 + ·CH2 → CH3CH=CH2 + ·CH3
1 record matched n-C3H7 + H· → CH3CH=CH2 + H2
2 records matched n-C3H7 + O2 → CH3CH=CH2 + HO2
1 record matched n-C3H7 + iso-C4H9 → iso-C4H10 + CH3CH=CH2
1 record matched n-C3H7 + ·OH → CH3CH=CH2 + H2O
1 record matched n-C3H7 + C2H3 → C2H4 + CH3CH=CH2
1 record matched n-C3H7 + (·)CH2OH → CH3OH + CH3CH=CH2
1 record matched n-C3H7 + ·CH3 → CH4 + CH3CH=CH2
1 record matched n-C3H7 + n-C3H7 → C3H8 + CH3CH=CH2
2 records matched n-C3H7 → CH3CH=CH2 + H·
1 record matched ·C2H + n-C3H7 → C2H2 + CH3CH=CH2
1 record matched ·C2H5 + n-C3H7 → C2H6 + CH3CH=CH2
1 record matched iso-C3H7 + ·CH2 → CH3CH=CH2 + ·CH3
1 record matched iso-C3H7 + H· → CH3CH=CH2 + H2
2 records matched iso-C3H7 + O2 → CH3CH=CH2 + HO2
1 record matched iso-C3H7 + iso-C4H9 → iso-C4H10 + CH3CH=CH2
1 record matched iso-C3H7 + ·OH → CH3CH=CH2 + H2O
1 record matched iso-C3H7 + (·)CH2OH → CH3OH + CH3CH=CH2
1 record matched iso-C3H7 + n-C3H7 → C3H8 + CH3CH=CH2
1 record matched iso-C3H7 + ·C2H → C2H2 + CH3CH=CH2
2 records matched iso-C3H7 + iso-C3H7 → C3H8 + CH3CH=CH2
3 records matched iso-C3H7 → CH3CH=CH2 + H·
2 records matched ·CH2CH=CH2 + H2O2 → CH3CH=CH2 + HO2
1 record matched ·CH2CH=CH2 + iso-C4H9 → CH3CH=CH2 + iso-C4H8
1 record matched ·CH2CH=CH2 + C2H3 → C2H2 + CH3CH=CH2
1 record matched ·CH2CH=CH2 + HCO → CH3CH=CH2 + CO
1 record matched ·CH2CH=CH2 + (·)CH2OH → CH2O + CH3CH=CH2
1 record matched ·CH2CH=CH2 + CH3O· → CH2O + CH3CH=CH2
1 record matched ·CH2CH=CH2 + n-C3H7 → CH3CH=CH2 + CH3CH=CH2
1 record matched ·CH2CH=CH2 + ·C2H5 → C2H4 + CH3CH=CH2
1 record matched ·CH2CH=CH2 + iso-C3H7 → CH3CH=CH2 + CH3CH=CH2
1 record matched ·CH2CH=CH2 + ·CH2CH=CH2 → CH3CH=CH2 + CH2=C=CH2
1 record matched tert-C4H9 + n-C3H7 → iso-C4H10 + CH3CH=CH2
1 record matched tert-C4H9 + iso-C3H7 → iso-C4H10 + CH3CH=CH2
1 record matched tert-C4H9 + ·CH2CH=CH2 → CH3CH=CH2 + iso-C4H8
1 record matched tert-C4H9 → CH3CH=CH2 + ·CH3
1 record matched H2 + ·CH2CH=CH2 → CH3CH=CH2 + H·
1 record matched (CH3)3CCH2CH=CH2 → CH3CH=CH2 + iso-C4H8
1 record matched CH3CCCH3 + O· → CH3CH=CH2 + CO
1 record matched CH3CH=CH2 + ·CH2 → ·CH2CH=CH2 + ·CH3
1 record matched CH3CH=CH2 + ·CH2 → CH3CH=CHCH3
1 record matched CH3CH=CH2 + Te → Adduct
1 record matched CH3CH=CH2 + Cl → Products
1 record matched CH3CH=CH2 + N → Products
1 record matched CH3CH=CH2 + O· → ·OH + CH2=C(·)CH3
1 record matched CH3CH=CH2 + O· → ·OH + CH3CH=CH
1 record matched CH3CH=CH2 + O· → ·CH2CH=CH2 + ·OH
4 records matched CH3CH=CH2 + O· → Products
5 records matched CH3CH=CH2 + H· → n-C3H7
5 records matched CH3CH=CH2 + H· → iso-C3H7
1 record matched CH3CH=CH2 + H· → H2 + CH2=C(·)CH3
1 record matched CH3CH=CH2 + H· → H2 + CH3CH=CH
2 records matched CH3CH=CH2 + H· → H2 + ·CH2CH=CH2
5 records matched CH3CH=CH2 + NO3 → Products
1 record matched CH3CH=CH2 + Br· → Products
6 records matched CH3CH=CH2 + O3 → Products
1 record matched CH3CH=CH2 + Se → Selenirane, methyl-
2 records matched CH3CH=CH2 + O2 → ·CH2CH=CH2 + HO2
1 record matched CH3CH=CH2 + S → Methylthiirane
1 record matched CH3CH=CH2 + iso-C4H9 → iso-C4H10 + ·CH2CH=CH2
1 record matched CH3CH=CH2 + iso-C4H9 → Adduct
1 record matched CH3CH=CH2 + ·CCl → Cyclopropyl, 1-chloro-2-methyl-
1 record matched CH3CH=CH2 + NF2 → CH3CHCH2NF2
1 record matched CH3CH=CH2 + ·OH → H2O + CH2=C(·)CH3
4 records matched CH3CH=CH2 + ·OH → CH3CHCH2OH
1 record matched CH3CH=CH2 + ·OH → CH3CH=CH + H2O
1 record matched CH3CH=CH2 + ·OH → ·CH2CH=CH2 + H2O
10 records matched CH3CH=CH2 + ·OH → Products
1 record matched CH3CH=CH2 + HO2 → ·CH2CH=CH2 + H2O2
1 record matched CH3CH=CH2 + HO2 → Methyloxirane + ·OH
1 record matched CH3CH=CH2 + ·CCl3 → CCl3CH2CHCH3
1 record matched CH3CH=CH2 + ·CCl3 → Adduct
1 record matched CH3CH=CH2 + CH3CO → CH3CHO + ·CH2CH=CH2
1 record matched CH3CH=CH2 + C2H3 → CH2=CHCH=CHCH3 + H·
1 record matched CH3CH=CH2 + C2H3 → 1,3-Butadiene + ·CH3
1 record matched CH3CH=CH2 + C2H3 → C2H4 + ·CH2CH=CH2
1 record matched CH3CH=CH2 + HCO → CH2O + ·CH2CH=CH2
1 record matched CH3CH=CH2 + (·)CH2OH → CH3OH + ·CH2CH=CH2
1 record matched CH3CH=CH2 + sec-C4H9 → Products
1 record matched CH3CH=CH2 + ·CF3 → Products
3 records matched CH3CH=CH2 + ·CH3 → iso-C4H9
3 records matched CH3CH=CH2 + ·CH3 → sec-C4H9
3 records matched CH3CH=CH2 + ·CH3 → CH4 + ·CH2CH=CH2
1 record matched CH3CH=CH2 + ·CH3 → Adduct
2 records matched CH3CH=CH2 + ·CH3 → Products
1 record matched CH3CH=CH2 + CH3O· → CH3OH + ·CH2CH=CH2
1 record matched CH3CH=CH2 + n-C3H7 → C3H8 + ·CH2CH=CH2
1 record matched CH3CH=CH2 + CH3O2· → ·CH2CH=CH2 + CH3OOH
1 record matched CH3CH=CH2 + CH3O2· → Methyloxirane + CH3
1 record matched CH3CH=CH2 + ·C2H → C2H5CCH + ·CH
1 record matched CH3CH=CH2 + ·C2H → CH3CCH + C2H3
1 record matched CH3CH=CH2 + ·C2H → C2H2 + CH2=C(·)CH3
1 record matched CH3CH=CH2 + ·C2H → C2H2 + CH3CH=CH
1 record matched CH3CH=CH2 + ·C2H → C2H2 + ·CH2CH=CH2
1 record matched CH3CH=CH2 + ·C2H → Products
1 record matched CH3CH=CH2 + ·C2H5 → CH3CH2CH2CHCH3
1 record matched CH3CH=CH2 + ·C2H5 → C2H6 + ·CH2CH=CH2
1 record matched CH3CH=CH2 + ·C2H5 → Products
1 record matched CH3CH=CH2 + iso-C3H7 → C3H8 + ·CH2CH=CH2
1 record matched CH3CH=CH2 + ·CH2CH=CH2 → 1-Methylcyclopentene + H·
1 record matched CH3CH=CH2 + tert-C4H9 → (CH3)3CCH2CH(·)CH3
1 record matched CH3CH=CH2 + tert-C4H9 → iso-C4H10 + ·CH2CH=CH2
1 record matched CH3CH=CH2 + CH3CH=CH2 → ·CH2CH=CH2 + n-C3H7
1 record matched CH3CH=CH2 + CH3CH=CH2 → ·CH2CH=CH2 + iso-C3H7
1 record matched CH3CH=CH2 + CH3CH=CH2 → (CH3)2CHCH2CH=CH2
1 record matched CH3CH=CH2 + CH3CH=CH2 → 1-C6H12
1 record matched CH3CH=CH2 → ·CH3 + C2H3
1 record matched CH3CH=CH2 → ·CH2CH=CH2 + H·
1 record matched Toluene + ·CH2CH=CH2 → CH3CH=CH2 + Benzyl
1 record matched C2H5CCH + O· → CH3CH=CH2 + CO
1 record matched iso-C4H10 + ·CH2CH=CH2 → CH3CH=CH2 + iso-C4H9
1 record matched iso-C4H10 + ·CH2CH=CH2 → CH3CH=CH2 + tert-C4H9
1 record matched Cyclopropane → CH3CH=CH2
1 record matched C3H8 + ·CH2CH=CH2 → CH3CH=CH2 + n-C3H7
1 record matched C3H8 + ·CH2CH=CH2 → CH3CH=CH2 + iso-C3H7
1 record matched C2H2 + iso-C4H9 → CH3CH=CH2 + CH3CH=CH
1 record matched C2H2 + CH3CH=CH2 → ·CH2CH=CH2 + C2H3
1 record matched C2H4 + iso-C4H9 → CH3CH=CH2 + iso-C3H7
1 record matched C2H4 + iso-C3H7 → CH3CH=CH2 + ·C2H5
1 record matched C2H4 + CH3CH=CH2 → n-C3H7 + C2H3
1 record matched C2H4 + CH3CH=CH2 → iso-C3H7 + C2H3
1 record matched C2H4 + CH3CH=CH2 → ·CH2CH=CH2 + ·C2H5
1 record matched C2H4 + CH3CH=CH2 → 1-C5H10
1 record matched C2H6 + ·CH2CH=CH2 → CH3CH=CH2 + ·C2H5
1 record matched CH4 + ·CH2CH=CH2 → CH3CH=CH2 + ·CH3
1 record matched CH3OH + ·CH2CH=CH2 → CH3CH=CH2 + (·)CH2OH
1 record matched CH2O + ·CH2CH=CH2 → CH3CH=CH2 + HCO
1 record matched M + CH3CH=CH2 + Cl → M + ClCH2CHCH3
1 record matched CH2=CHCH2NHSC(CH3)3 → Other Products + CH3CH=CH2
1 record matched 3-Furancarboxylic acid 1-methylethyl ester → CH3CH=CH2 + 3-Furancarboxylic acid
1 record matched 3-Thiophenecarboxylic acid 1-methylethyl ester → 3-Thiophenecarboxylic acid + CH3CH=CH2
1 record matched 4-Pyridinecarboxylic acid 1-methylethyl ester → 4-Pyridinecarboxylic acid + CH3CH=CH2
1 record matched Benzene, [1-(1-methylethoxy)ethenyl]-3-nitro- → Ethanone, 1-(4-nitrophenyl)- + CH3CH=CH2
1 record matched (E)-CH3CH=CHCH2SCH2CH=CH2 → CH3CH=CH2 + CH3CH=CHCHS
1 record matched Benzene, 1-chloro-4-[1-(1-methylethoxy)ethenyl]- → Ethanone, 1-(4-chlorophenyl)- + CH3CH=CH2
1 record matched 2-Thiophenecarboxylic acid 1-methylethyl ester → CH3CH=CH2 + 2-Thiophenecarboxylic acid
1 record matched CH2=CHCH2SCH2C(CH3)3 → CH3CH=CH2 + (CH3)3CCHS
1 record matched CH2=CHCH2SCH2CN → CH3CH=CH2 + N≡CCHS
1 record matched Silacyclopent-3-ene, 1,3,4-trimethyl-1-(2-propenyl)- → CH3CH=CH2 + Silacyclopenta-2,4-diene, 1,3,4-trimethyl-
1 record matched CH3CH2CH2SiH → CH3CH=CH2 + SiH2
1 record matched CH3OC(S)OCH(CH3)2 → CH3CH=CH2 + CH3OC(O)SH
1 record matched (CH2=CHCH2)2NCH2C≡N → CH2=CHCH=N(CH2CN) + CH3CH=CH2
1 record matched (CH3)2CHOC(O)SCH3 → CH3CH=CH2 + CH3OC(O)SH
1 record matched Benzene, [2-(1-methylethoxy)ethenyl]-, (E)- → CH3CH=CH2 + Phenylethanal
1 record matched Benzoic acid, 4-(1,1-dimethylethyl)-, 1-methylethyl ester → CH3CH=CH2 + Benzoic acid, 4-(1,1-dimethylethyl)-
1 record matched Silacyclopent-3-ene, 1-methyl-1-(2-propenyl)- → CH3CH=CH2 + Silacyclopenta-2,4-diene, 1-methyl-
3 records matched CH3CHCH2NF2 → CH3CH=CH2 + NF2
1 record matched Pyrazine,(1-methylethoxy)- → CH3CH=CH2 + 2(1H)-Pyrazinone
2 records matched CH2IC(O)OCH(CH3)2 → CH2ICOOH + CH3CH=CH2
1 record matched 2-Propenoic acid, 3-phenyl-, 1-methylethyl ester,(E)- → CH3CH=CH2 + (E)-3-Phenyl-2-propenoic acid
1 record matched Benzeneacetic acid, α-phenyl-, 1-methylethyl ester → CH3CH=CH2 + Benzeneacetic acid, α-phenyl-
1 record matched (n-C3H7)2CHC(O)OCH(CH3)2 → (n-C3H7)2CHCOOH + CH3CH=CH2
2 records matched tert-C4H9CH2C(O)OCH(CH3)2 → CH3CH=CH2 + (CH3)3CCH2COOH
1 record matched Benzoic acid, 3-chloro-, 1-methylethyl ester → CH3CH=CH2 + Benzoic acid, 3-chloro-
1 record matched (C6H5)(CH3)P CH2CH=CH2 → CH3CH=CH2 + C6H5P=CH2
1 record matched CH2=CHCH2NHCH2C≡N → CH3CH=CH2 + HN=CHC≡N
1 record matched Cyclohexane, (2-propenylthio)- → CH3CH=CH2 + Cyclohexanethione
1 record matched (CH3)2CCHO → CH3CH=CH2 + HCO
1 record matched CH3OC(O)OCH(CH3)2 → CH3CH=CH2 + CH3OC(O)OH
1 record matched CH2=CHCH2SCH2Cl → CH3CH=CH2 + ClCHS
1 record matched Benzene, 1,3,5-trimethyl-2-((2-propenyloxy)methyl)- → CH3CH=CH2 + Benzaldehyde, 2,4,6-trimethyl-
1 record matched CH2=CHCH2NHCH2C≡CH → CH3CH=CH2 + CH≡CCH=NH
1 record matched Benzene, [1-(1-methylethoxy)ethenyl]- → 1-Phenylethanone + CH3CH=CH2
1 record matched CH3CHClC(O)OCH(CH3)2 → CH3CH=CH2 + CH3CHClCOOH
1 record matched (CH3)2NC(O)OCH(CH3)2 → CH3CH=CH2 + CO2 + (CH3)2NH
2 records matched (CH3)2CHSC(O)OCH3 → CH3CH=CH2 + CH3OC(O)SH
1 record matched CH3SC(S)OCH(CH3)2 → CH3CH=CH2 + CH3OC(S)SH
1 record matched Benzoic acid, 3-amino-, 1-methylethyl ester → 3-Aminobenzoic acid + CH3CH=CH2
1 record matched (CH3)2CHOCH2COOH → HOCH2COOH + CH3CH=CH2
1 record matched Cyclobutane, 1,1,2-trimethyl- → CH3CH=CH2 + iso-C4H8
1 record matched Oxetane, 2,3-dimethyl-, cis- → CH3CHO + CH3CH=CH2
1 record matched iso-C4H9C(O)OCH(CH3)2 → CH3CH=CH2 + iso-C4H9COOH
1 record matched ·CH2CH2CH2· → CH3CH=CH2
1 record matched Spiropentane, methyl- → CH3CH=CH2 + CH2=C=CH2
1 record matched (CH2=CHCH2)2PC6H5 → CH3CH=CH2 + C6H5P=CHCH=CH2
1 record matched Phosphine, phenyl(phenylmethyl)2-propenyl- → CH3CH=CH2 + Phosphine, phenyl(phenylmethylene)-
2 records matched BrCH2C(O)OCH(CH3)2 → CH2BrCOOH + CH3CH=CH2
1 record matched Oxetane, 2,3-dimethyl-, trans- → CH3CHO + CH3CH=CH2
2 records matched CH3CH2CH2SCH2CH=CH2 → CH3CH=CH2 + C2H5CHS
1 record matched 2-Naphthalenecarboxylic acid 1-methylethyl ester → 2-Naphthalenecarboxylic acid + CH3CH=CH2
1 record matched CHCl2C(O)OCH(CH3)2 → CHCl2COOH + CH3CH=CH2
1 record matched CH3OC(S)SCH(CH3)2 → CH3CH=CH2 + CH3OC(S)SH
1 record matched Benzoic acid, 4-chloro-, 1-methylethyl ester → Benzoic acid, 4-chloro- + CH3CH=CH2
1 record matched Benzenepropanoic acid 1-methylethyl ester → CH3CH=CH2 + Benzenepropanoic acid
1 record matched Germacyclobutane, 1,1-dimethyl- → CH3CH=CH2 + (CH3)2Ge:
1 record matched Benzoic acid, 4-methyl-, 1-methylethyl ester → 4-Methylbenzoic acid + CH3CH=CH2
1 record matched n-C4H9C(O)OCH(CH3)2 → n-C4H9COOH + CH3CH=CH2
1 record matched CH3CH=CHC(O)OCH(CH3)2 → CH3CH=CH2 + CH3CH=CHCOOH
2 records matched CH3OCH2C(O)OCH(CH3)2 → CH3CH=CH2 + CH3OCH2COOH
1 record matched (i-C3H7)O(t-C4H9) → tert-C4H9OH + CH3CH=CH2
1 record matched Pyridine, 2-(1-methylethoxy)- → CH3CH=CH2 + 2(1H)-Pyridinone
1 record matched Cyclobutane, 1,2-dimethyl-, trans- → CH3CH=CH2 + CH3CH=CH2
1 record matched Cyclobutane, 1,2-dimethyl-, cis- → CH3CH=CH2 + CH3CH=CH2
2 records matched bicyclo[2.2.2]oct-2-ene, 5-methyl-,(1α,4α,5α)- → CH3CH=CH2 + 1,3-Cyclohexadiene
2 records matched Bicyclo[2.2.2]oct-2-ene, 5-methyl-,(1α,4α,5β)- → CH3CH=CH2 + 1,3-Cyclohexadiene
2 records matched C6H5CH2OCH2CH=CH2 → Benzaldehyde + CH3CH=CH2
1 record matched Benzene, [2-(1-methylethoxy)ethenyl]-, (Z)- → CH3CH=CH2 + Phenylethanal
1 record matched Cyclohexane, (2-propenyloxy)- → Cyclohexanone + CH3CH=CH2
1 record matched Benzoic acid, 4-nitro-, 1-methylethyl ester → 4-Nitrobenzoic acid + CH3CH=CH2
1 record matched N≡CCH2C(O)OCH(CH3)2 → CH3CH=CH2 + NCCH2COOH
1 record matched CH2CH=CH2-N[(CH3)3C]-CH2CH=CH2 → Other Products + CH3CH=CH2
1 record matched CH3SCH2CH=CH2 → CH3CH=CH2 + CH2S
1 record matched CH3CH(OH)CH2 → CH3CH=CH2 + ·OH
1 record matched (CH3)2CHCH2C≡CH → CH3CH=CH2 + CH2=C=CH2
1 record matched Benzoic acid, 4-methoxy-, 1-methylethyl ester → 4-Methoxybenzoic acid + CH3CH=CH2
1 record matched Benzene, [(2-propenylthio)methyl]- → CH3CH=CH2 + Benzenecarbothioaldehyde
1 record matched n-C3H7CH(CH3)C(O)OCH(CH3)2 → n-C3H7CH(CH3)COOH + CH3CH=CH2
1 record matched Cyclohexanamine, N-2-propenyl- → CH3CH=CH2 + Cyclohexanimine
1 record matched (CH3)2CH-OC(O)O-CH(CH3)2 → CH3CH=CH2 + (CH3)2CHOC(O)OH
1 record matched Benzoic acid, 3-methyl-, 1-methylethyl ester → 3-Methylbenzoic acid + CH3CH=CH2
1 record matched 2-Furancarboxylic acid 1-methylethyl etser → 2-Furancarboxylic acid + CH3CH=CH2
1 record matched Benzoic acid, 3-nitro-, 1-methylethyl ester → CH3CH=CH2 + 3-Nitrobenzoic acid
2 records matched (CH3)2CHOCH2CH=CH2 → (CH3)2CO + CH3CH=CH2
2 records matched n-C4H9SCH2CH=CH2 → CH3CH=CH2 + n-C3H7CHS
1 record matched (C2H5)2CHC(O)OCH(CH3)2 → (C2H5)2CHCOOH + CH3CH=CH2
2 records matched tert-C4H9C(O)OCH(CH3)2 → tert-C4H9COOH + CH3CH=CH2
2 records matched oxirane, tetramethyl- → (CH3)2CO + CH3CH=CH2
3 records matched Benzeneacetic acid 1-methylethyl ester → Benzeneacetic acid + CH3CH=CH2
6 records matched iso-C4H9 → CH3CH=CH2 + ·CH3
1 record matched Cyclopentanecarbonitrile → CH2CHCN + CH3CH=CH2
2 records matched (CH3)2CHOC(CH3)-CH2 → (CH3)2CO + CH3CH=CH2
2 records matched (E)-CH3CH=CHCHO → CH3CH=CH2 + CO
1 record matched CH2=C(CH3)NNCH3 + CH2=C(·)CH3 → Other Products + CH3CH=CH2
1 record matched CCl3C(O)OCH(CH3)2 → CCl3COOH + CH3CH=CH2
1 record matched Pyrimidine, 2-(1-methylethoxy)- → CH3CH=CH2 + 2(1H)-Pyrimidinone
1 record matched 1,7-Octadiene → CH3CH=CH2 + CH2=CHCH2CH=CH2
2 records matched CH2=CH(CH2)3CH=CH2 → 1,3-Butadiene + CH3CH=CH2
1 record matched 2-Oxetanone, 4-methyl- → CH3CH=CH2 + CO2
1 record matched Benzoic acid, 4-fluoro-, 1-methylethyl ester → CH3CH=CH2 + 4-Fluorobenzoic acid
1 record matched Benzoic acid, 3-fluoro-, 1-methylethyl ester → CH3CH=CH2 + 3-Fluorobenzoic acid
1 record matched 2-hexyl radical → CH3CH=CH2 + n-C3H7
1 record matched n-C4H9 → CH3CH=CH2 + ·CH3
1 record matched CH3CH2CH2CHCH3 → CH3CH=CH2 + ·C2H5
8 records matched sec-C4H9 → CH3CH=CH2 + ·CH3
1 record matched n-C5H11C(O)OCH(CH3)2 → CH3CH=CH2 + CH3(CH2)4COOH
1 record matched 1,1,3-Trimethyl-1-silacyclobutane → CH3CH=CH2 + (CH3)2Si=CH2
2 records matched ·CH3 + C2H3 → CH3CH=CH2
4 records matched Oxetane, 2-methyl- → CH2O + CH3CH=CH2
2 records matched Oxetane, 3-methyl- → CH2O + CH3CH=CH2
1 record matched n-C3H7 + H· → CH3CH=CH2 + H2
10 records matched n-C3H7 + O2 → CH3CH=CH2 + HO2
1 record matched n-C3H7 + ·CHF2 → CH2F2 + CH3CH=CH2
5 records matched n-C3H7 + ·CH3 → CH4 + CH3CH=CH2
11 records matched n-C3H7 + n-C3H7 → C3H8 + CH3CH=CH2
3 records matched n-C3H7 → CH3CH=CH2 + H·
1 record matched ·C2H5 + ·CH2F → CH3CH=CH2 + HF
3 records matched ·C2H5 + n-C3H7 → C2H6 + CH3CH=CH2
4 records matched iso-C3H7 + O2 → CH3CH=CH2 + HO2
2 records matched iso-C3H7 + NF2 → CH3CH=CH2 + HNF2
1 record matched iso-C3H7 + (CH3)2CHCH2CH2 → iso-C5H12 + CH3CH=CH2
1 record matched iso-C3H7 + sec-C4H9 → n-C4H10 + CH3CH=CH2
1 record matched iso-C3H7 + ·CF3 → CHF3 + CH3CH=CH2
5 records matched iso-C3H7 + ·CH3 → CH4 + CH3CH=CH2
2 records matched iso-C3H7 + n-C3H7 → C3H8 + CH3CH=CH2
5 records matched iso-C3H7 + ·C2H5 → C2H6 + CH3CH=CH2
17 records matched iso-C3H7 + iso-C3H7 → C3H8 + CH3CH=CH2
9 records matched iso-C3H7 → CH3CH=CH2 + H·
1 record matched ·CH2CH=CH2 + HBr → CH3CH=CH2 + Br·
1 record matched ·CH2CH=CH2 + HI → CH3CH=CH2 + I
3 records matched ·CH2CH=CH2 + HO2 → CH3CH=CH2 + O2
2 records matched ·CH2CH=CH2 + ·C2H5 → C2H4 + CH3CH=CH2
1 record matched ·CH2CH=CH2 + ·CH2CH=CH2 → CH3CH=CH2 + CH2=C=CH2
1 record matched CH3CHClCH2COOH → CH3CH=CH2 + CO2 + HCl
1 record matched n-C3H7OSO2CH3 → HOSO2CH3 + CH3CH=CH2
2 records matched (CH3)2CHNCO → HN=C=O + CH3CH=CH2
2 records matched tert-C4H9 + iso-C3H7 → iso-C4H10 + CH3CH=CH2
1 record matched tert-C4H9 → CH3CH=CH2 + ·CH3
1 record matched Ethylidenecyclobutane → CH3CH=CH2 + CH2=C=CH2
1 record matched Cyclobutanone, 3-methyl- → CH3CH=CH2 + H2C=C=O
1 record matched (CH3)2Si(CH2CH=CH2)2 → CH3CH=CH2 + Silacyclobut-2-ene, 1,1-dimethyl-
2 records matched Methylthiirane + S → CH3CH=CH2 + S2
1 record matched Methylthiirane + ·CH3 → CH3CH=CH2 + CH3
1 record matched Carbonic acid 1-methylethyl ester → CH3CH=CH2 + Carbonic acid monophenyl ester
3 records matched Benzoic acid 1-methylethyl ester → Benzoic acid + CH3CH=CH2
1 record matched CH3C(O)SCH(CH3)2 → CH3CH=CH2 + CH3COSH
3 records matched CH2=CHOCH(CH3)2 → CH3CHO + CH3CH=CH2
1 record matched Silacyclobutane, 1-methyl- → CH3CH=CH2 + (CH3)SiH
1 record matched n-C3H7OCH=CH2 → CH3CHO + CH3CH=CH2
1 record matched (CH3)3SiCH2CH=CH2 → CH3CH=CH2 + (CH3)2Si=CH2
1 record matched (CH3)3CCH2CH=CH2 → CH3CH=CH2 + iso-C4H8
2 records matched C4H9C≡CH → CH3CH=CH2 + CH2=C=CH2
2 records matched n-C3H7C(O)OCH(CH3)2 → n-C3H7COOH + CH3CH=CH2
2 records matched C2H5C(O)OCH(CH3)2 → C2H5COOH + CH3CH=CH2
1 record matched C6H5-CH=CHCH3 + H· → CH3CH=CH2 + Phenyl
3 records matched CH2=CHCH2OCH3 → CH2O + CH3CH=CH2
1 record matched CH2=CHCH2NHCH3 → CH3CH=CH2 + CH2=NH
2 records matched CH2=CHCH2CH2OH → CH2O + CH3CH=CH2
2 records matched HCOOCH(CH3)2 → HCOOH + CH3CH=CH2
4 records matched CH2=CHCH2COOH → CH3CH=CH2 + CO2
2 records matched CH2=CHCH2CH(OH)CH3 → CH3CHO + CH3CH=CH2
2 records matched CH2=CHCH2C(CH3)2OH → (CH3)2CO + CH3CH=CH2
2 records matched n-C3H7O(CO)OC3H7-n → CH3CH=CH2 + n-C3H7OC(O)OH
1 record matched HOCH2C(O)OCH(CH3)2 → HOCH2COOH + CH3CH=CH2
1 record matched iso-C3H7C(O)OCH(CH3)2 → iso-C3H7COOH + CH3CH=CH2
3 records matched Methylcyclobutane → C2H4 + CH3CH=CH2
3 records matched (CH2=CHCH2)2S → CH3CH=CH2 + CH2=CHCH=S
2 records matched 1-C6H12 → CH3CH=CH2 + CH3CH=CH2
1 record matched n-C4H9COCH3 → (CH3)2CO + CH3CH=CH2
2 records matched Cyclohexene, 4-methyl- → 1,3-Butadiene + CH3CH=CH2
1 record matched (Z)-2-C4H8 + iso-C3H7 → CH3CH=CH2 + sec-C4H9
2 records matched (CH2=CHCH2)2O → CH2=CHCHO + CH3CH=CH2
2 records matched CH3CH2OCH2CH=CH2 → CH3CHO + CH3CH=CH2
1 record matched 3-Pyridinecarboxylic acid 1-methylethyl ester → 3-Pyridinecarboxylic acid + CH3CH=CH2
1 record matched Cyclopentadiene + ·CH2CH=CH2 → CH3CH=CH2 + Cyclopentadienyl
1 record matched i-C3H7ONO → CH3CH=CH2 + HNO2
6 records matched n-C3H7Cl → CH3CH=CH2 + HCl
1 record matched Cyclopropane, methoxy- → CH2O + CH3CH=CH2
1 record matched CH3CCCH3 + O· → CH3CH=CH2 + CO
2 records matched n-C3H7F → CH3CH=CH2 + HF
2 records matched iso-C3H7F → CH3CH=CH2 + HF
2 records matched CH2FC(O)OCH(CH3)2 → CH3CH=CH2 + CH2FCOOH
1 record matched CF3C(O)OCH(CH3)2 → CF3COOH + CH3CH=CH2
1 record matched Silacyclobutane → CH3CH=CH2 + SiH2
1 record matched (CH2=CHCH2)2NH → CH3CH=CH2 + (E)-CH2=CHCH=NH
1 record matched Pyrrolidine → CH3CH=CH2 + CH2=NH
1 record matched Carbamic acid, phenyl-, 1-methylethyl ester → CH3CH=CH2 + Carbamic acid, phenyl-
2 records matched iso-C4H8 + H· → CH3CH=CH2 + ·CH3
1 record matched CH3CH=CH2 + CH3CH2C(O)OO → Products
1 record matched CH3CH=CH2 + CH3GeH → Products
1 record matched CH3CH=CH2 + Fe(CO)3 → Fe(CO)3(η2-CH3CH=CH2)
1 record matched CH3CH=CH2 + n-C3H7O2 → Methyloxirane + n-C3H7O
1 record matched CH3CH=CH2 + CH3C(O)OO(·) → Methyloxirane + CO2 + ·CH3
1 record matched CH3CH=CH2 + CH3C(O)OO(·) → Products
1 record matched CH3CH=CH2 + CH2ClCHCl· → CH2=CHCl + ·CH2CH=CH2 + HCl
1 record matched CH3CH=CH2 + Te → Adduct
2 records matched CH3CH=CH2 + Cl → ClCH2CHCH3
2 records matched CH3CH=CH2 + Cl → ·CH2CH=CH2 + HCl
20 records matched CH3CH=CH2 + Cl → Products
2 records matched CH3CH=CH2 + NCO → Products
6 records matched CH3CH=CH2 + CF3O → Adduct
1 record matched CH3CH=CH2 + SiCl3 → Adduct
1 record matched CH3CH=CH2 + CHF2CF: → Adduct
1 record matched CH3CH=CH2 + N → C2H4 + HCN + H·
4 records matched CH3CH=CH2 + N → Products
2 records matched CH3CH=CH2 + O· → ·CH3 + *CH2C(O)H
1 record matched CH3CH=CH2 + O· → ·C2H5 + HCO
4 records matched CH3CH=CH2 + O· → Methyloxirane
21 records matched CH3CH=CH2 + O· → Products
4 records matched CH3CH=CH2 + D → Products
1 record matched CH3CH=CH2 + ·F → ·CH2CH=CH2 + HF
2 records matched CH3CH=CH2 + ·F → CH2=CHF + ·CH3
1 record matched CH3CH=CH2 + ·F → Other Products + H·
1 record matched CH3CH=CH2 + ·F → Other Products + HF
1 record matched CH3CH=CH2 + IO → Products
1 record matched CH3CH=CH2 + I → ·CH2CH=CH2 + HI
1 record matched CH3CH=CH2 + SiH2 → Adduct
1 record matched CH3CH=CH2 + SiH2 → Products
1 record matched CH3CH=CH2 + SiH2 → cyclo-SiH2C2H3CH3
1 record matched CH3CH=CH2 + NH → Other Products + NH2
1 record matched CH3CH=CH2 + NH → Products
4 records matched CH3CH=CH2 + NH2 → Products
1 record matched CH3CH=CH2 + SiH3 → Products
1 record matched CH3CH=CH2 + SiCl2 → Adduct
1 record matched CH3CH=CH2 + ·CHF → Products
6 records matched CH3CH=CH2 + H· → n-C3H7
6 records matched CH3CH=CH2 + H· → iso-C3H7
6 records matched CH3CH=CH2 + H· → H2 + ·CH2CH=CH2
1 record matched CH3CH=CH2 + H· → C2H4 + ·CH3
8 records matched CH3CH=CH2 + H· → Adduct
15 records matched CH3CH=CH2 + H· → Products
1 record matched CH3CH=CH2 + Cu2 → Cu2(CH3CH=CH2)
3 records matched CH3CH=CH2 + C3 → Products
2 records matched CH3CH=CH2 + C2O → Products
1 record matched CH3CH=CH2 + NO3 → ·CH2CH=CH2 + HNO3
5 records matched CH3CH=CH2 + NO3 → Products
3 records matched CH3CH=CH2 + NO2 → Products
1 record matched CH3CH=CH2 + Br· → BrCH2CHCH3
2 records matched CH3CH=CH2 + Br· → ·CH2CH=CH2 + HBr
3 records matched CH3CH=CH2 + Br· → Products
1 record matched CH3CH=CH2 + HBr → n-C3H7Br
2 records matched CH3CH=CH2 + HI → iso-C3H7I
4 records matched CH3CH=CH2 + O3 → Other Products + ·OH
17 records matched CH3CH=CH2 + O3 → Products
1 record matched CH3CH=CH2 + Cl2 → CH3CH=CHCl + HCl
1 record matched CH3CH=CH2 + Cl2 → 1-Propene, 3,3-dichloro- + H2
1 record matched CH3CH=CH2 + Cl2 → (CH3)CCl=CH2 + HCl
1 record matched CH3CH=CH2 + Cl2 → CH2=CHCH2Cl + HCl
1 record matched CH3CH=CH2 + Cl2 → CH2ClCH=CHCl + H2
2 records matched CH3CH=CH2 + Se → Selenirane, methyl-
2 records matched CH3CH=CH2 + O2 → ·CH2CH=CH2 + HO2
3 records matched CH3CH=CH2 + S → Methylthiirane
1 record matched CH3CH=CH2 + Zr → Products
1 record matched CH3CH=CH2 + Y → Y(C3H6)
1 record matched CH3CH=CH2 + Y → H2 + Y(C3H4)
3 records matched CH3CH=CH2 + Y → Products
1 record matched CH3CH=CH2 + Y → Y(C3H2) + H2 + H2
3 records matched CH3CH=CH2 + V → Products
1 record matched CH3CH=CH2 + Hf → Products
1 record matched CH3CH=CH2 + Ge → Products
1 record matched CH3CH=CH2 + C → CHCCH(·)CH3 + H·
1 record matched CH3CH=CH2 + C → Products + H·
3 records matched CH3CH=CH2 + C → Products
3 records matched CH3CH=CH2 + Ti → Products
1 record matched CH3CH=CH2 + Ta → Products
1 record matched CH3CH=CH2 + Si → Products
2 records matched CH3CH=CH2 + Sc → Products
1 record matched CH3CH=CH2 + Rh → Products
1 record matched CH3CH=CH2 + Pt → Products
2 records matched CH3CH=CH2 + Pd → Products
1 record matched CH3CH=CH2 + Nb → Products
5 records matched CH3CH=CH2 + Ni → Products
2 records matched CH3CH=CH2 + Mo → Products
1 record matched CH3CH=CH2 + Ir → Products
1 record matched CH3CH=CH2 + CH3S· → Adduct
1 record matched CH3CH=CH2 + (CH3)2Si → Products
1 record matched CH3CH=CH2 + (CH3)2CHO2 → Methyloxirane + i-C3H7O
1 record matched CH3CH=CH2 + CH3CH → 1-C5H10
2 records matched CH3CH=CH2 + CBr → Products
2 records matched CH3CH=CH2 + ·CCl → Products
2 records matched CH3CH=CH2 + CF → Products
3 records matched CH3CH=CH2 + NF2 → CH3CHCH2NF2
3 records matched CH3CH=CH2 + ·OH → CH3CHCH2OH
2 records matched CH3CH=CH2 + ·OH → CH3CH=CH + H2O
1 record matched CH3CH=CH2 + ·OH → ·CH2CH=CH2 + H2O
1 record matched CH3CH=CH2 + ·OH → CH3CHO + ·CH3
1 record matched CH3CH=CH2 + ·OH → CH2O + ·C2H5
46 records matched CH3CH=CH2 + ·OH → Products
1 record matched CH3CH=CH2 + ·CH → Products
1 record matched CH3CH=CH2 + HO2 → Methyloxirane + ·OH
1 record matched CH3CH=CH2 + ·CCl3 → CCl3CH2CHCH3
1 record matched CH3CH=CH2 + ·CCl3 → CHCl3 + ·CH2CH=CH2
1 record matched CH3CH=CH2 + (CH3)3CO → tert-C4H9OH + ·CH2CH=CH2
1 record matched CH3CH=CH2 + HCO → Products
1 record matched CH3CH=CH2 + Phenyl → Products
2 records matched CH3CH=CH2 + ·CF3 → Adduct
3 records matched CH3CH=CH2 + ·CH3 → iso-C4H9
4 records matched CH3CH=CH2 + ·CH3 → sec-C4H9
3 records matched CH3CH=CH2 + ·CH3 → CH4 + ·CH2CH=CH2
2 records matched CH3CH=CH2 + ·CH3 → Other Products + CH4
2 records matched CH3CH=CH2 + ·CH3 → Adduct
1 record matched CH3CH=CH2 + ·CF2 → Cyclopropane,1,1-difluoro-2-methyl-
1 record matched CH3CH=CH2 + ·CF2 → Products
1 record matched CH3CH=CH2 + ·C2H → Other Products + C2H2
2 records matched CH3CH=CH2 + ·C2H → Products
1 record matched CH3CH=CH2 + CD3 → CHD3 + ·CH2CH=CH2
1 record matched CH3CH=CH2 + ·CHCl → Products
1 record matched CH3CH=CH2 + iso-C3H7 → CH3CH=CH2 + n-C3H7
2 records matched CH3CH=CH2 + iso-C3H7 → C3H8 + ·CH2CH=CH2
2 records matched CH3CH=CH2 + 1,3-Cyclohexadiene → bicyclo[2.2.2]oct-2-ene, 5-methyl-,(1α,4α,5α)-
2 records matched CH3CH=CH2 + 1,3-Cyclohexadiene → Bicyclo[2.2.2]oct-2-ene, 5-methyl-,(1α,4α,5β)-
1 record matched CH3CH=CH2 + CH3CH=CH2 → ·CH2CH=CH2 + iso-C3H7
2 records matched CH3CH=CH2 + CH3CH=CH2 → (CH3)2CHCH2CH=CH2
1 record matched CH3CH=CH2 + CH3CH=CH2 → 1-C6H12
1 record matched CH3CH=CH2 + CH3CH=CH2 → Methylcyclopentane
1 record matched CH3CH=CH2 → H· + CH2=C(·)CH3
1 record matched CH3CH=CH2 → CH3CH=CH + H·
6 records matched CH3CH=CH2 → ·CH3 + C2H3
3 records matched CH3CH=CH2 → ·CH2CH=CH2 + H·
1 record matched CH3CH=CH2 → CH2=C=CH2 + H2
5 records matched CH3CH=CH2 → Products
1 record matched HCOOCH2CH2CH3 → HCOOH + CH3CH=CH2
1 record matched Tetrahydrofuran → CH2O + CH3CH=CH2
1 record matched 1-C5H10 → C2H4 + CH3CH=CH2
2 records matched CH3COOCH2CH2CH3 → CH3C(O)OH + CH3CH=CH2
3 records matched Toluene + ·CH2CH=CH2 → CH3CH=CH2 + Benzyl
1 record matched ClC(O)OCH(CH3)2 → CH3CH=CH2 + ClCOOH
8 records matched CH3COOCH(CH3)2 → CH3C(O)OH + CH3CH=CH2
1 record matched (iso-C3H7)2O → iso-C3H7OH + CH3CH=CH2
1 record matched 1-nitropropane → CH3CH=CH2 + HNO2
2 records matched n-C3H7I → CH3CH=CH2 + HI
1 record matched CH3CH=CHCH3 + iso-C3H7 → CH3CH=CH2 + sec-C4H9
1 record matched C2H5CCH + O· → CH3CH=CH2 + CO
5 records matched n-C3H7Br → CH3CH=CH2 + HBr
3 records matched ClCH2C(O)OCH(CH3)2 → CH2ClCOOH + CH3CH=CH2
1 record matched 2-nitropropane → CH3CH=CH2 + HNO2
1 record matched CH3C(O)OOH + CH3CH=CH2 → CH3C(O)OH + Methyloxirane
2 records matched iso-C3H7CN → HCN + CH3CH=CH2
1 record matched CH2BrCHBrCH3 → CH3CH=CH2 + Br2
9 records matched iso-C3H7I → CH3CH=CH2 + HI
10 records matched iso-C3H7Cl → CH3CH=CH2 + HCl
11 records matched iso-C3H7Br → CH3CH=CH2 + HBr
34 records matched Cyclopropane → CH3CH=CH2
1 record matched C3H8 + ·CH2CH=CH2 → CH3CH=CH2 + n-C3H7
2 records matched C2H4 + ·CH2 → CH3CH=CH2
1 record matched C2H4 + ·CH3 → CH3CH=CH2 + H·
1 record matched C2H4 + ·C2H5 → CH3CH=CH2 + ·CH3
1 record matched C2H4 + CH3CH=CH2 → 1-C5H10
1 record matched C2H4 + 1-C4H8 → CH3CH=CH2 + CH3CH=CH2
1 record matched C2H6 + ·CH → CH3CH=CH2 + H·
2 records matched iso-C3H7OH → CH3CH=CH2 + H2O
1 record matched CN + CH3CH=CH2 → CH3CH=CHCN + H·
7 records matched CN + CH3CH=CH2 → Products
2 records matched O(1D) + CH3CH=CH2 → Products
1 record matched O2(1DELTA) + CH3CH=CH2 → CH3CH=CH2 + O2
1 record matched CH2=CHCH2N(CH2CN)CH2C≡CH → CH≡CCH=N(CH2CN) + CH3CH=CH2
1 record matched CH2=CHCH2N(CH2SCH3)CH2C≡CH → CH≡CCH=N(CH2SCH3) + CH3CH=CH2
1 record matched CH2=CHCH2N(SO2CH3)CH2C≡CH → CH≡CCH=N(SO2CH3) + CH3CH=CH2
1 record matched CH2CH=CH2-N[(CH3)CCH2]-CH2CH=CH2 → Other Products + CH3CH=CH2
1 record matched Benzoic acid, 3-methoxy-, 1-methylethyl ester → CH3CH=CH2 + 3-Methoxybenzoic acid
1 record matched CN(X2Sigma+) + CH3CH=CH2 → Products
1 record matched O(3P) + C3H8 → CH3CH=CH2 + H2O
1 record matched CF2(a~3B1) + CH3CH=CH2 → Products
1 record matched (CH3CH2)2NCO(O)CH(CH3)2 → (C2H5)2NH + CH3CH=CH2 + CO2
2 records matched CH3CH(·)CH2CH(CH3)2 → CH3CH=CH2 + iso-C3H7
2 records matched CH3CH2CH2CH(CH3)CH2· → CH3CH=CH2 + n-C3H7
1 record matched Zr (4d2_5s2,3F) + CH3CH=CH2 → C3H4Zr + H2
1 record matched C2(X1ΣPlg) + CH3CH=CH2 → Products
2 records matched C2(a3PIu) + CH3CH=CH2 → Products
1 record matched CH2=CHCH2CHCH3 → CH3CH=CH2 + C2H3
1 record matched n-C3H7O2 → CH3CH=CH2 + HO2
1 record matched ·CH2CH2CH2· → CH3CH=CH2
1 record matched CH3CH2CH2SCH2CH=CH2 → CH3CH2CH=S + CH3CH=CH2
1 record matched (CH3)3CCH(CH3)CH2· → CH3CH=CH2 + tert-C4H9
3 records matched iso-C4H9 → CH3CH=CH2 + ·CH3
1 record matched (CH3)2CHO2 → CH3CH=CH2 + HO2
2 records matched 2-hexyl radical → CH3CH=CH2 + n-C3H7
3 records matched sec-C4H9 → CH3CH=CH2 + ·CH3
1 record matched Oxetane, 2-methyl- → CH2O + CH3CH=CH2
1 record matched n-C3H7 + O2 → CH3CH=CH2 + HO2
1 record matched n-C3H7 + ·CH3 → CH4 + CH3CH=CH2
3 records matched n-C3H7 → CH3CH=CH2 + H·
1 record matched iso-C3H7 + O2 → CH3CH=CH2 + HO2
3 records matched iso-C3H7 + C2H3 → C2H4 + CH3CH=CH2
1 record matched iso-C3H7 + (CH3)2CHCH2CH2 → iso-C5H12 + CH3CH=CH2
3 records matched iso-C3H7 + ·CH3 → CH4 + CH3CH=CH2
2 records matched iso-C3H7 + n-C3H7 → C3H8 + CH3CH=CH2
2 records matched iso-C3H7 + ·C2H5 → C2H6 + CH3CH=CH2
3 records matched iso-C3H7 + iso-C3H7 → C3H8 + CH3CH=CH2
2 records matched iso-C3H7 → CH3CH=CH2 + H·
1 record matched ·CH2CH=CH2 + H· → CH3CH=CH2
1 record matched ·CH2CH=CH2 + HBr → CH3CH=CH2 + Br·
1 record matched ·CH2CH=CH2 + n-C3H7 → CH3CH=CH2 + CH3CH=CH2
1 record matched ·CH2CH=CH2 + ·C2H5 → C2H4 + CH3CH=CH2
2 records matched ·CH2CH=CH2 + iso-C3H7 → CH3CH=CH2 + CH3CH=CH2
1 record matched ·CH2CH=CH2 + ·CH2CH=CH2 → CH3CH=CH2 + CH2=C=CH2
1 record matched tert-C4H9 → CH3CH=CH2 + ·CH3
1 record matched H2 + ·CH2CH=CH2 → CH3CH=CH2 + H·
2 records matched Cyclobutanone → CH3CH=CH2 + CO
1 record matched CH2=CHCH2CH2OH → CH2O + CH3CH=CH2
1 record matched CH2=CHCH2CH(OH)CH3 → CH3CHO + CH3CH=CH2
1 record matched CH2=CHCH2C(CH3)2OH → (CH3)2CO + CH3CH=CH2
1 record matched (CH2=CHCH2)2S → CH3CH=CH2 + CH2=CHCH=S
1 record matched n-C4H9COCH3 → (CH3)2CO + CH3CH=CH2
1 record matched n-C3H7F → CH3CH=CH2 + HF
1 record matched iso-C3H7F → CH3CH=CH2 + HF
1 record matched CH3CH=CH2 + Cl → Products
1 record matched CH3CH=CH2 + CHF2CF: → Adduct
1 record matched CH3CH=CH2 + O· → CH3C(·)HCHO
1 record matched CH3CH=CH2 + O· → CH3C(O)CH2(·) + H·
1 record matched CH3CH=CH2 + O· → ·CH3 + *CH2C(O)H
1 record matched CH3CH=CH2 + O· → H2C=C=O + ·CH3 + H·
1 record matched CH3CH=CH2 + O· → Products
1 record matched CH3CH=CH2 + O· → CH2(O·)CH(·)CH3
1 record matched CH3CH=CH2 + O· → CH2(·)CH(O·)CH3
1 record matched CH3CH=CH2 + CH3OC(·)(O) → CH3OC(O)CH2CH·CH3
1 record matched CH3CH=CH2 + ·F → Products
1 record matched CH3CH=CH2 + SiH3 → H3SiCH2C(·)HCH3
1 record matched CH3CH=CH2 + SiH3 → CH3CH(SiH3)CH2·
1 record matched CH3CH=CH2 + H· → n-C3H7
1 record matched CH3CH=CH2 + H· → H2 + CH2=C(·)CH3
1 record matched CH3CH=CH2 + H· → H2 + CH3CH=CH
1 record matched CH3CH=CH2 + H· → H2 + ·CH2CH=CH2
1 record matched CH3CH=CH2 + H· → C2H4 + ·CH3
3 records matched CH3CH=CH2 + NO3 → Products
1 record matched CH3CH=CH2 + Br· → ·CH2CH=CH2 + HBr
1 record matched CH3CH=CH2 + O3 → CH3CHO + CH2OO
1 record matched CH3CH=CH2 + O3 → CH2O + CH3CH(·)OO·
1 record matched CH3CH=CH2 + O2 → Products
2 records matched CH3CH=CH2 + ·OH → H2O + CH2=C(·)CH3
1 record matched CH3CH=CH2 + ·OH → CH3CH(OH)CH2
1 record matched CH3CH=CH2 + ·OH → CH3CHCH2OH
1 record matched CH3CH=CH2 + ·OH → CH3CH=CH + H2O
1 record matched CH3CH=CH2 + ·OH → Adduct
2 records matched CH3CH=CH2 + ·OH → Products
2 records matched CH3CH=CH2 + HO2 → Methyloxirane + ·OH
1 record matched CH3CH=CH2 + HO2 → CH3CH(·)CH2OOH
1 record matched CH3CH=CH2 + HO2 → ·CH2CH(OOH)CH3
1 record matched CH3CH=CH2 + CH3CO → CH3CHO + ·CH2CH=CH2
1 record matched CH3CH=CH2 + CH3C(O)CH2(·) → (CH3)2CO + ·CH2CH=CH2
1 record matched CH3CH=CH2 + Cyclopropene → 2-propenyl-cyclopropane
1 record matched CH3CH=CH2 + C2H3 → C2H4 + CH2=C(·)CH3
1 record matched CH3CH=CH2 + C2H3 → C2H4 + CH3CH=CH
1 record matched CH3CH=CH2 + C2H3 → C2H4 + ·CH2CH=CH2
1 record matched CH3CH=CH2 + HCO → CH3CH(·)CH2CHO
1 record matched CH3CH=CH2 + Phenyl → Benzene + ·CH2CH=CH2
1 record matched CH3CH=CH2 + Phenyl → CH2CH(C6H5)CH3
1 record matched CH3CH=CH2 + Phenyl → CH3CH(·)CH2C6H5
2 records matched CH3CH=CH2 + ·CH3 → iso-C4H9
2 records matched CH3CH=CH2 + ·CH3 → sec-C4H9
1 record matched CH3CH=CH2 + ·CH3 → CH4 + CH2=C(·)CH3
1 record matched CH3CH=CH2 + ·CH3 → CH4 + CH3CH=CH
3 records matched CH3CH=CH2 + ·CH3 → CH4 + ·CH2CH=CH2
1 record matched CH3CH=CH2 + n-C3H7 → 1-C4H8 + ·C2H5
1 record matched CH3CH=CH2 + n-C3H7 → C3H8 + ·CH2CH=CH2
1 record matched CH3CH=CH2 + ·C2H5 → C2H6 + ·CH2CH=CH2
1 record matched CH3CH=CH2 + ·CH2CH=CH2 → CH3CH(.)CH2CH2CH=CH2
1 record matched CH3CH=CH2 + ·CH2CH=CH2 → CH3CH=CH2 + ·CH2CH=CH2
1 record matched CH3CH=CH2 + C6H5CH=NOH → Products
1 record matched CH3CH=CH2 + (NZ)-N-benzylidenehydroxylamine → Products
2 records matched CH3CH=CH2 + CH3CH=CH2 → ·CH2CH=CH2 + n-C3H7
2 records matched CH3CH=CH2 + CH3CH=CH2 → ·CH2CH=CH2 + iso-C3H7
1 record matched CH3CH=CH2 → ·CH3 + C2H3
2 records matched CH3CH=CH2 → ·CH2CH=CH2 + H·
1 record matched CH3CH=CH2 → CH2=C=CH2 + H2
1 record matched CH3CH=CH2 → CH4 + C2H2
3 records matched CH3CH=CH2 → Products
1 record matched 1-C5H10 → C2H4 + CH3CH=CH2
1 record matched n-C3H7I → CH3CH=CH2 + HI
2 records matched n-C3H7Br → CH3CH=CH2 + HBr
1 record matched 2(3H)-Furanone, dihydro- → CH3CH=CH2 + CO2
1 record matched 2-nitropropane → cis-HONO + CH3CH=CH2
1 record matched 2-nitropropane → trans-HONO + CH3CH=CH2
1 record matched iso-C3H7I + I → CH3CH=CH2 + HI + I
1 record matched iso-C3H7I + iso-C3H7 → C3H8 + CH3CH=CH2 + I
1 record matched iso-C3H7I → CH3CH=CH2 + HI
2 records matched Cyclopropane → CH3CH=CH2
1 record matched CH3CHO + ·CH2CH=CH2 → CH3CH=CH2 + CH3CO
1 record matched CH3CHO + CH3CH=CH2 → CH2=CHCH2CH(OH)CH3
1 record matched C3H8 + ·CH2CH=CH2 → CH3CH=CH2 + n-C3H7
1 record matched C3H8 + ·CH2CH=CH2 → CH3CH=CH2 + iso-C3H7
1 record matched C2H4 + CH3CH=CH2 → iso-C3H7 + C2H3
1 record matched C2H4 + CH3CH=CH2 → ·CH2CH=CH2 + ·C2H5
1 record matched C2H4 + CH3CH=CH2 → 1-C5H10
1 record matched C2H6 + ·CH2CH=CH2 → CH3CH=CH2 + ·C2H5
1 record matched CH4 + ·CH2CH=CH2 → CH3CH=CH2 + ·CH3
1 record matched n-C3H7OH → CH3CH=CH2 + H2O
1 record matched (CH3)2CO + ·CH2CH=CH2 → CH3CH=CH2 + CH3C(O)CH2(·)
1 record matched (CH3)2CO + CH3CH=CH2 → CH2=CHCH2C(CH3)2OH
5 records matched iso-C3H7OH → CH3CH=CH2 + H2O
1 record matched CH2O + CH3CH=CH2 → CH2=CHCH2CH2OH
1 record matched n-C3H7O2 → CH3CH=CH2 + HO2
1 record matched Propyl Radical + C2H4 → CH3CH=CH2 + ·C2H5
1 record matched (CH3CH2)2NCO(O)CH(CH3)2 → CH3CH=CH2 + CO2 + sec-C4H9NH2
1 record matched CH3CH(·)CH2CHO → CH3CH=CH2 + HCO
1 record matched CH3OC(O)CH2CH·CH3 → CH3CH=CH2 + CH3OC(·)(O)
1 record matched (CH3)2NCOOCH(CH3)2 → CH3CH=CH2 + CO2 + (CH3)2NH
1 record matched P(C3H5)3 → CH2CHCH2-P=CHCH=CH2 + CH3CH=CH2
1 record matched CH2CHCH2-P=CHCH=CH2 → CH2=CHC≡P + CH3CH=CH2
2 records matched CH2CHCH2-P=CHCH=CH2 → cyclo-PC3H3 + CH3CH=CH2
1 record matched cyclo-PC3H3 + CH3CH=CH2 → CH2CHCH2-[cyclo-(PCH2CH=CH-)]
1 record matched O(3P) + CH3CH=CH2 → Products

Search returned 1186 records.