Kinetics Database Resources
Rate Our Products and Services
Other Databases
NIST Standard Reference Data Program
NDRL-NIST Solution Kinetics Database
NIST Computational Chemistry Comparison and Benchmark Database
The NIST Reference on Constants, Units, and Uncertainty
Administrative Links
 |
Home ©NIST, 2013 Accessibility information |
Search Results
Click on a link in the table below to see detail on the selected reaction.
| Records | Reaction | |
|---|---|---|
| 1 record matched | CH3CH=CH2 + Cl → Products | |
| 1 record matched | O(3P) + CH3CH=CH2 → Products | |
| 1 record matched | Cs(9 2P3/2) + CH3CH=CH2 → Other Products + CsH | |
| 3 records matched | iso-C4H9 → CH3CH=CH2 + ·CH3 | |
| 1 record matched | CH3CH2CH2CHCH3 → CH3CH=CH2 + ·C2H5 | |
| 2 records matched | sec-C4H9 → CH3CH=CH2 + ·CH3 | |
| 1 record matched | ·CH3 + C2H3 → CH3CH=CH2 | |
| 1 record matched | n-C3H7 + ·CH2 → CH3CH=CH2 + ·CH3 | |
| 1 record matched | n-C3H7 + H· → CH3CH=CH2 + H2 | |
| 2 records matched | n-C3H7 + O2 → CH3CH=CH2 + HO2 | |
| 1 record matched | n-C3H7 + iso-C4H9 → iso-C4H10 + CH3CH=CH2 | |
| 1 record matched | n-C3H7 + ·OH → CH3CH=CH2 + H2O | |
| 1 record matched | n-C3H7 + C2H3 → C2H4 + CH3CH=CH2 | |
| 1 record matched | n-C3H7 + (·)CH2OH → CH3OH + CH3CH=CH2 | |
| 1 record matched | n-C3H7 + ·CH3 → CH4 + CH3CH=CH2 | |
| 1 record matched | n-C3H7 + n-C3H7 → C3H8 + CH3CH=CH2 | |
| 2 records matched | n-C3H7 → CH3CH=CH2 + H· | |
| 1 record matched | ·C2H + n-C3H7 → C2H2 + CH3CH=CH2 | |
| 1 record matched | ·C2H5 + n-C3H7 → C2H6 + CH3CH=CH2 | |
| 1 record matched | iso-C3H7 + ·CH2 → CH3CH=CH2 + ·CH3 | |
| 1 record matched | iso-C3H7 + H· → CH3CH=CH2 + H2 | |
| 2 records matched | iso-C3H7 + O2 → CH3CH=CH2 + HO2 | |
| 1 record matched | iso-C3H7 + iso-C4H9 → iso-C4H10 + CH3CH=CH2 | |
| 1 record matched | iso-C3H7 + ·OH → CH3CH=CH2 + H2O | |
| 1 record matched | iso-C3H7 + (·)CH2OH → CH3OH + CH3CH=CH2 | |
| 1 record matched | iso-C3H7 + n-C3H7 → C3H8 + CH3CH=CH2 | |
| 1 record matched | iso-C3H7 + ·C2H → C2H2 + CH3CH=CH2 | |
| 2 records matched | iso-C3H7 + iso-C3H7 → C3H8 + CH3CH=CH2 | |
| 3 records matched | iso-C3H7 → CH3CH=CH2 + H· | |
| 2 records matched | ·CH2CH=CH2 + H2O2 → CH3CH=CH2 + HO2 | |
| 1 record matched | ·CH2CH=CH2 + iso-C4H9 → CH3CH=CH2 + iso-C4H8 | |
| 1 record matched | ·CH2CH=CH2 + C2H3 → C2H2 + CH3CH=CH2 | |
| 1 record matched | ·CH2CH=CH2 + HCO → CH3CH=CH2 + CO | |
| 1 record matched | ·CH2CH=CH2 + (·)CH2OH → CH2O + CH3CH=CH2 | |
| 1 record matched | ·CH2CH=CH2 + CH3O· → CH2O + CH3CH=CH2 | |
| 1 record matched | ·CH2CH=CH2 + n-C3H7 → CH3CH=CH2 + CH3CH=CH2 | |
| 1 record matched | ·CH2CH=CH2 + ·C2H5 → C2H4 + CH3CH=CH2 | |
| 1 record matched | ·CH2CH=CH2 + iso-C3H7 → CH3CH=CH2 + CH3CH=CH2 | |
| 1 record matched | ·CH2CH=CH2 + ·CH2CH=CH2 → CH3CH=CH2 + CH2=C=CH2 | |
| 1 record matched | tert-C4H9 + n-C3H7 → iso-C4H10 + CH3CH=CH2 | |
| 1 record matched | tert-C4H9 + iso-C3H7 → iso-C4H10 + CH3CH=CH2 | |
| 1 record matched | tert-C4H9 + ·CH2CH=CH2 → CH3CH=CH2 + iso-C4H8 | |
| 1 record matched | tert-C4H9 → CH3CH=CH2 + ·CH3 | |
| 1 record matched | H2 + ·CH2CH=CH2 → CH3CH=CH2 + H· | |
| 1 record matched | (CH3)3CCH2CH=CH2 → CH3CH=CH2 + iso-C4H8 | |
| 1 record matched | CH3CCCH3 + O· → CH3CH=CH2 + CO | |
| 1 record matched | CH3CH=CH2 + ·CH2 → ·CH2CH=CH2 + ·CH3 | |
| 1 record matched | CH3CH=CH2 + ·CH2 → CH3CH=CHCH3 | |
| 1 record matched | CH3CH=CH2 + Te → Adduct | |
| 1 record matched | CH3CH=CH2 + Cl → Products | |
| 1 record matched | CH3CH=CH2 + N → Products | |
| 1 record matched | CH3CH=CH2 + O· → ·OH + CH2=C(·)CH3 | |
| 1 record matched | CH3CH=CH2 + O· → ·OH + CH3CH=CH | |
| 1 record matched | CH3CH=CH2 + O· → ·CH2CH=CH2 + ·OH | |
| 4 records matched | CH3CH=CH2 + O· → Products | |
| 5 records matched | CH3CH=CH2 + H· → n-C3H7 | |
| 5 records matched | CH3CH=CH2 + H· → iso-C3H7 | |
| 1 record matched | CH3CH=CH2 + H· → H2 + CH2=C(·)CH3 | |
| 1 record matched | CH3CH=CH2 + H· → H2 + CH3CH=CH | |
| 2 records matched | CH3CH=CH2 + H· → H2 + ·CH2CH=CH2 | |
| 5 records matched | CH3CH=CH2 + NO3 → Products | |
| 1 record matched | CH3CH=CH2 + Br· → Products | |
| 6 records matched | CH3CH=CH2 + O3 → Products | |
| 1 record matched | CH3CH=CH2 + Se → Selenirane, methyl- | |
| 2 records matched | CH3CH=CH2 + O2 → ·CH2CH=CH2 + HO2 | |
| 1 record matched | CH3CH=CH2 + S → Methylthiirane | |
| 1 record matched | CH3CH=CH2 + iso-C4H9 → iso-C4H10 + ·CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + iso-C4H9 → Adduct | |
| 1 record matched | CH3CH=CH2 + ·CCl → Cyclopropyl, 1-chloro-2-methyl- | |
| 1 record matched | CH3CH=CH2 + NF2 → CH3CHCH2NF2 | |
| 1 record matched | CH3CH=CH2 + ·OH → H2O + CH2=C(·)CH3 | |
| 4 records matched | CH3CH=CH2 + ·OH → CH3CHCH2OH | |
| 1 record matched | CH3CH=CH2 + ·OH → CH3CH=CH + H2O | |
| 1 record matched | CH3CH=CH2 + ·OH → ·CH2CH=CH2 + H2O | |
| 10 records matched | CH3CH=CH2 + ·OH → Products | |
| 1 record matched | CH3CH=CH2 + HO2 → ·CH2CH=CH2 + H2O2 | |
| 1 record matched | CH3CH=CH2 + HO2 → Methyloxirane + ·OH | |
| 1 record matched | CH3CH=CH2 + ·CCl3 → CCl3CH2CHCH3 | |
| 1 record matched | CH3CH=CH2 + ·CCl3 → Adduct | |
| 1 record matched | CH3CH=CH2 + CH3CO → CH3CHO + ·CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + C2H3 → CH2=CHCH=CHCH3 + H· | |
| 1 record matched | CH3CH=CH2 + C2H3 → 1,3-Butadiene + ·CH3 | |
| 1 record matched | CH3CH=CH2 + C2H3 → C2H4 + ·CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + HCO → CH2O + ·CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + (·)CH2OH → CH3OH + ·CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + sec-C4H9 → Products | |
| 1 record matched | CH3CH=CH2 + ·CF3 → Products | |
| 3 records matched | CH3CH=CH2 + ·CH3 → iso-C4H9 | |
| 3 records matched | CH3CH=CH2 + ·CH3 → sec-C4H9 | |
| 3 records matched | CH3CH=CH2 + ·CH3 → CH4 + ·CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + ·CH3 → Adduct | |
| 2 records matched | CH3CH=CH2 + ·CH3 → Products | |
| 1 record matched | CH3CH=CH2 + CH3O· → CH3OH + ·CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + n-C3H7 → C3H8 + ·CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + CH3O2· → ·CH2CH=CH2 + CH3OOH | |
| 1 record matched | CH3CH=CH2 + CH3O2· → Methyloxirane + CH3O· | |
| 1 record matched | CH3CH=CH2 + ·C2H → C2H5CCH + ·CH | |
| 1 record matched | CH3CH=CH2 + ·C2H → CH3CCH + C2H3 | |
| 1 record matched | CH3CH=CH2 + ·C2H → C2H2 + CH2=C(·)CH3 | |
| 1 record matched | CH3CH=CH2 + ·C2H → C2H2 + CH3CH=CH | |
| 1 record matched | CH3CH=CH2 + ·C2H → C2H2 + ·CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + ·C2H → Products | |
| 1 record matched | CH3CH=CH2 + ·C2H5 → CH3CH2CH2CHCH3 | |
| 1 record matched | CH3CH=CH2 + ·C2H5 → C2H6 + ·CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + ·C2H5 → Products | |
| 1 record matched | CH3CH=CH2 + iso-C3H7 → C3H8 + ·CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + ·CH2CH=CH2 → 1-Methylcyclopentene + H· | |
| 1 record matched | CH3CH=CH2 + tert-C4H9 → (CH3)3CCH2CH(·)CH3 | |
| 1 record matched | CH3CH=CH2 + tert-C4H9 → iso-C4H10 + ·CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + CH3CH=CH2 → ·CH2CH=CH2 + n-C3H7 | |
| 1 record matched | CH3CH=CH2 + CH3CH=CH2 → ·CH2CH=CH2 + iso-C3H7 | |
| 1 record matched | CH3CH=CH2 + CH3CH=CH2 → (CH3)2CHCH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + CH3CH=CH2 → 1-C6H12 | |
| 1 record matched | CH3CH=CH2 → ·CH3 + C2H3 | |
| 1 record matched | CH3CH=CH2 → ·CH2CH=CH2 + H· | |
| 1 record matched | Toluene + ·CH2CH=CH2 → CH3CH=CH2 + Benzyl | |
| 1 record matched | C2H5CCH + O· → CH3CH=CH2 + CO | |
| 1 record matched | iso-C4H10 + ·CH2CH=CH2 → CH3CH=CH2 + iso-C4H9 | |
| 1 record matched | iso-C4H10 + ·CH2CH=CH2 → CH3CH=CH2 + tert-C4H9 | |
| 1 record matched | Cyclopropane → CH3CH=CH2 | |
| 1 record matched | C3H8 + ·CH2CH=CH2 → CH3CH=CH2 + n-C3H7 | |
| 1 record matched | C3H8 + ·CH2CH=CH2 → CH3CH=CH2 + iso-C3H7 | |
| 1 record matched | C2H2 + iso-C4H9 → CH3CH=CH2 + CH3CH=CH | |
| 1 record matched | C2H2 + CH3CH=CH2 → ·CH2CH=CH2 + C2H3 | |
| 1 record matched | C2H4 + iso-C4H9 → CH3CH=CH2 + iso-C3H7 | |
| 1 record matched | C2H4 + iso-C3H7 → CH3CH=CH2 + ·C2H5 | |
| 1 record matched | C2H4 + CH3CH=CH2 → n-C3H7 + C2H3 | |
| 1 record matched | C2H4 + CH3CH=CH2 → iso-C3H7 + C2H3 | |
| 1 record matched | C2H4 + CH3CH=CH2 → ·CH2CH=CH2 + ·C2H5 | |
| 1 record matched | C2H4 + CH3CH=CH2 → 1-C5H10 | |
| 1 record matched | C2H6 + ·CH2CH=CH2 → CH3CH=CH2 + ·C2H5 | |
| 1 record matched | CH4 + ·CH2CH=CH2 → CH3CH=CH2 + ·CH3 | |
| 1 record matched | CH3OH + ·CH2CH=CH2 → CH3CH=CH2 + (·)CH2OH | |
| 1 record matched | CH2O + ·CH2CH=CH2 → CH3CH=CH2 + HCO | |
| 1 record matched | M + CH3CH=CH2 + Cl → M + ClCH2CHCH3 | |
| 1 record matched | CH2=CHCH2NHSC(CH3)3 → Other Products + CH3CH=CH2 | |
| 1 record matched | 3-Furancarboxylic acid 1-methylethyl ester → CH3CH=CH2 + 3-Furancarboxylic acid | |
| 1 record matched | 3-Thiophenecarboxylic acid 1-methylethyl ester → 3-Thiophenecarboxylic acid + CH3CH=CH2 | |
| 1 record matched | 4-Pyridinecarboxylic acid 1-methylethyl ester → 4-Pyridinecarboxylic acid + CH3CH=CH2 | |
| 1 record matched | Benzene, [1-(1-methylethoxy)ethenyl]-3-nitro- → Ethanone, 1-(4-nitrophenyl)- + CH3CH=CH2 | |
| 1 record matched | (E)-CH3CH=CHCH2SCH2CH=CH2 → CH3CH=CH2 + CH3CH=CHCHS | |
| 1 record matched | Benzene, 1-chloro-4-[1-(1-methylethoxy)ethenyl]- → Ethanone, 1-(4-chlorophenyl)- + CH3CH=CH2 | |
| 1 record matched | 2-Thiophenecarboxylic acid 1-methylethyl ester → CH3CH=CH2 + 2-Thiophenecarboxylic acid | |
| 1 record matched | CH2=CHCH2SCH2C(CH3)3 → CH3CH=CH2 + (CH3)3CCHS | |
| 1 record matched | CH2=CHCH2SCH2CN → CH3CH=CH2 + N≡CCHS | |
| 1 record matched | Silacyclopent-3-ene, 1,3,4-trimethyl-1-(2-propenyl)- → CH3CH=CH2 + Silacyclopenta-2,4-diene, 1,3,4-trimethyl- | |
| 1 record matched | CH3CH2CH2SiH → CH3CH=CH2 + SiH2 | |
| 1 record matched | CH3OC(S)OCH(CH3)2 → CH3CH=CH2 + CH3OC(O)SH | |
| 1 record matched | (CH2=CHCH2)2NCH2C≡N → CH2=CHCH=N(CH2CN) + CH3CH=CH2 | |
| 1 record matched | (CH3)2CHOC(O)SCH3 → CH3CH=CH2 + CH3OC(O)SH | |
| 1 record matched | Benzene, [2-(1-methylethoxy)ethenyl]-, (E)- → CH3CH=CH2 + Phenylethanal | |
| 1 record matched | Benzoic acid, 4-(1,1-dimethylethyl)-, 1-methylethyl ester → CH3CH=CH2 + Benzoic acid, 4-(1,1-dimethylethyl)- | |
| 1 record matched | Silacyclopent-3-ene, 1-methyl-1-(2-propenyl)- → CH3CH=CH2 + Silacyclopenta-2,4-diene, 1-methyl- | |
| 3 records matched | CH3CHCH2NF2 → CH3CH=CH2 + NF2 | |
| 1 record matched | Pyrazine,(1-methylethoxy)- → CH3CH=CH2 + 2(1H)-Pyrazinone | |
| 2 records matched | CH2IC(O)OCH(CH3)2 → CH2ICOOH + CH3CH=CH2 | |
| 1 record matched | 2-Propenoic acid, 3-phenyl-, 1-methylethyl ester,(E)- → CH3CH=CH2 + (E)-3-Phenyl-2-propenoic acid | |
| 1 record matched | Benzeneacetic acid, α-phenyl-, 1-methylethyl ester → CH3CH=CH2 + Benzeneacetic acid, α-phenyl- | |
| 1 record matched | (n-C3H7)2CHC(O)OCH(CH3)2 → (n-C3H7)2CHCOOH + CH3CH=CH2 | |
| 2 records matched | tert-C4H9CH2C(O)OCH(CH3)2 → CH3CH=CH2 + (CH3)3CCH2COOH | |
| 1 record matched | Benzoic acid, 3-chloro-, 1-methylethyl ester → CH3CH=CH2 + Benzoic acid, 3-chloro- | |
| 1 record matched | (C6H5)(CH3)P CH2CH=CH2 → CH3CH=CH2 + C6H5P=CH2 | |
| 1 record matched | CH2=CHCH2NHCH2C≡N → CH3CH=CH2 + HN=CHC≡N | |
| 1 record matched | Cyclohexane, (2-propenylthio)- → CH3CH=CH2 + Cyclohexanethione | |
| 1 record matched | (CH3)2CCHO → CH3CH=CH2 + HCO | |
| 1 record matched | CH3OC(O)OCH(CH3)2 → CH3CH=CH2 + CH3OC(O)OH | |
| 1 record matched | CH2=CHCH2SCH2Cl → CH3CH=CH2 + ClCHS | |
| 1 record matched | Benzene, 1,3,5-trimethyl-2-((2-propenyloxy)methyl)- → CH3CH=CH2 + Benzaldehyde, 2,4,6-trimethyl- | |
| 1 record matched | CH2=CHCH2NHCH2C≡CH → CH3CH=CH2 + CH≡CCH=NH | |
| 1 record matched | Benzene, [1-(1-methylethoxy)ethenyl]- → 1-Phenylethanone + CH3CH=CH2 | |
| 1 record matched | CH3CHClC(O)OCH(CH3)2 → CH3CH=CH2 + CH3CHClCOOH | |
| 1 record matched | (CH3)2NC(O)OCH(CH3)2 → CH3CH=CH2 + CO2 + (CH3)2NH | |
| 2 records matched | (CH3)2CHSC(O)OCH3 → CH3CH=CH2 + CH3OC(O)SH | |
| 1 record matched | CH3SC(S)OCH(CH3)2 → CH3CH=CH2 + CH3OC(S)SH | |
| 1 record matched | Benzoic acid, 3-amino-, 1-methylethyl ester → 3-Aminobenzoic acid + CH3CH=CH2 | |
| 1 record matched | (CH3)2CHOCH2COOH → HOCH2COOH + CH3CH=CH2 | |
| 1 record matched | Cyclobutane, 1,1,2-trimethyl- → CH3CH=CH2 + iso-C4H8 | |
| 1 record matched | Oxetane, 2,3-dimethyl-, cis- → CH3CHO + CH3CH=CH2 | |
| 1 record matched | iso-C4H9C(O)OCH(CH3)2 → CH3CH=CH2 + iso-C4H9COOH | |
| 1 record matched | ·CH2CH2CH2· → CH3CH=CH2 | |
| 1 record matched | Spiropentane, methyl- → CH3CH=CH2 + CH2=C=CH2 | |
| 1 record matched | (CH2=CHCH2)2PC6H5 → CH3CH=CH2 + C6H5P=CHCH=CH2 | |
| 1 record matched | Phosphine, phenyl(phenylmethyl)2-propenyl- → CH3CH=CH2 + Phosphine, phenyl(phenylmethylene)- | |
| 2 records matched | BrCH2C(O)OCH(CH3)2 → CH2BrCOOH + CH3CH=CH2 | |
| 1 record matched | Oxetane, 2,3-dimethyl-, trans- → CH3CHO + CH3CH=CH2 | |
| 2 records matched | CH3CH2CH2SCH2CH=CH2 → CH3CH=CH2 + C2H5CHS | |
| 1 record matched | 2-Naphthalenecarboxylic acid 1-methylethyl ester → 2-Naphthalenecarboxylic acid + CH3CH=CH2 | |
| 1 record matched | CHCl2C(O)OCH(CH3)2 → CHCl2COOH + CH3CH=CH2 | |
| 1 record matched | CH3OC(S)SCH(CH3)2 → CH3CH=CH2 + CH3OC(S)SH | |
| 1 record matched | Benzoic acid, 4-chloro-, 1-methylethyl ester → Benzoic acid, 4-chloro- + CH3CH=CH2 | |
| 1 record matched | Benzenepropanoic acid 1-methylethyl ester → CH3CH=CH2 + Benzenepropanoic acid | |
| 1 record matched | Germacyclobutane, 1,1-dimethyl- → CH3CH=CH2 + (CH3)2Ge: | |
| 1 record matched | Benzoic acid, 4-methyl-, 1-methylethyl ester → 4-Methylbenzoic acid + CH3CH=CH2 | |
| 1 record matched | n-C4H9C(O)OCH(CH3)2 → n-C4H9COOH + CH3CH=CH2 | |
| 1 record matched | CH3CH=CHC(O)OCH(CH3)2 → CH3CH=CH2 + CH3CH=CHCOOH | |
| 2 records matched | CH3OCH2C(O)OCH(CH3)2 → CH3CH=CH2 + CH3OCH2COOH | |
| 1 record matched | (i-C3H7)O(t-C4H9) → tert-C4H9OH + CH3CH=CH2 | |
| 1 record matched | Pyridine, 2-(1-methylethoxy)- → CH3CH=CH2 + 2(1H)-Pyridinone | |
| 1 record matched | Cyclobutane, 1,2-dimethyl-, trans- → CH3CH=CH2 + CH3CH=CH2 | |
| 1 record matched | Cyclobutane, 1,2-dimethyl-, cis- → CH3CH=CH2 + CH3CH=CH2 | |
| 2 records matched | bicyclo[2.2.2]oct-2-ene, 5-methyl-,(1α,4α,5α)- → CH3CH=CH2 + 1,3-Cyclohexadiene | |
| 2 records matched | Bicyclo[2.2.2]oct-2-ene, 5-methyl-,(1α,4α,5β)- → CH3CH=CH2 + 1,3-Cyclohexadiene | |
| 2 records matched | C6H5CH2OCH2CH=CH2 → Benzaldehyde + CH3CH=CH2 | |
| 1 record matched | Benzene, [2-(1-methylethoxy)ethenyl]-, (Z)- → CH3CH=CH2 + Phenylethanal | |
| 1 record matched | Cyclohexane, (2-propenyloxy)- → Cyclohexanone + CH3CH=CH2 | |
| 1 record matched | Benzoic acid, 4-nitro-, 1-methylethyl ester → 4-Nitrobenzoic acid + CH3CH=CH2 | |
| 1 record matched | N≡CCH2C(O)OCH(CH3)2 → CH3CH=CH2 + NCCH2COOH | |
| 1 record matched | CH2CH=CH2-N[(CH3)3C]-CH2CH=CH2 → Other Products + CH3CH=CH2 | |
| 1 record matched | CH3SCH2CH=CH2 → CH3CH=CH2 + CH2S | |
| 1 record matched | CH3CH(OH)CH2 → CH3CH=CH2 + ·OH | |
| 1 record matched | (CH3)2CHCH2C≡CH → CH3CH=CH2 + CH2=C=CH2 | |
| 1 record matched | Benzoic acid, 4-methoxy-, 1-methylethyl ester → 4-Methoxybenzoic acid + CH3CH=CH2 | |
| 1 record matched | Benzene, [(2-propenylthio)methyl]- → CH3CH=CH2 + Benzenecarbothioaldehyde | |
| 1 record matched | n-C3H7CH(CH3)C(O)OCH(CH3)2 → n-C3H7CH(CH3)COOH + CH3CH=CH2 | |
| 1 record matched | Cyclohexanamine, N-2-propenyl- → CH3CH=CH2 + Cyclohexanimine | |
| 1 record matched | (CH3)2CH-OC(O)O-CH(CH3)2 → CH3CH=CH2 + (CH3)2CHOC(O)OH | |
| 1 record matched | Benzoic acid, 3-methyl-, 1-methylethyl ester → 3-Methylbenzoic acid + CH3CH=CH2 | |
| 1 record matched | 2-Furancarboxylic acid 1-methylethyl etser → 2-Furancarboxylic acid + CH3CH=CH2 | |
| 1 record matched | Benzoic acid, 3-nitro-, 1-methylethyl ester → CH3CH=CH2 + 3-Nitrobenzoic acid | |
| 2 records matched | (CH3)2CHOCH2CH=CH2 → (CH3)2CO + CH3CH=CH2 | |
| 2 records matched | n-C4H9SCH2CH=CH2 → CH3CH=CH2 + n-C3H7CHS | |
| 1 record matched | (C2H5)2CHC(O)OCH(CH3)2 → (C2H5)2CHCOOH + CH3CH=CH2 | |
| 2 records matched | tert-C4H9C(O)OCH(CH3)2 → tert-C4H9COOH + CH3CH=CH2 | |
| 2 records matched | oxirane, tetramethyl- → (CH3)2CO + CH3CH=CH2 | |
| 3 records matched | Benzeneacetic acid 1-methylethyl ester → Benzeneacetic acid + CH3CH=CH2 | |
| 6 records matched | iso-C4H9 → CH3CH=CH2 + ·CH3 | |
| 1 record matched | Cyclopentanecarbonitrile → CH2CHCN + CH3CH=CH2 | |
| 2 records matched | (CH3)2CHOC(CH3)-CH2 → (CH3)2CO + CH3CH=CH2 | |
| 2 records matched | (E)-CH3CH=CHCHO → CH3CH=CH2 + CO | |
| 1 record matched | CH2=C(CH3)NNCH3 + CH2=C(·)CH3 → Other Products + CH3CH=CH2 | |
| 1 record matched | CCl3C(O)OCH(CH3)2 → CCl3COOH + CH3CH=CH2 | |
| 1 record matched | Pyrimidine, 2-(1-methylethoxy)- → CH3CH=CH2 + 2(1H)-Pyrimidinone | |
| 1 record matched | 1,7-Octadiene → CH3CH=CH2 + CH2=CHCH2CH=CH2 | |
| 2 records matched | CH2=CH(CH2)3CH=CH2 → 1,3-Butadiene + CH3CH=CH2 | |
| 1 record matched | 2-Oxetanone, 4-methyl- → CH3CH=CH2 + CO2 | |
| 1 record matched | Benzoic acid, 4-fluoro-, 1-methylethyl ester → CH3CH=CH2 + 4-Fluorobenzoic acid | |
| 1 record matched | Benzoic acid, 3-fluoro-, 1-methylethyl ester → CH3CH=CH2 + 3-Fluorobenzoic acid | |
| 1 record matched | 2-hexyl radical → CH3CH=CH2 + n-C3H7 | |
| 1 record matched | n-C4H9 → CH3CH=CH2 + ·CH3 | |
| 1 record matched | CH3CH2CH2CHCH3 → CH3CH=CH2 + ·C2H5 | |
| 8 records matched | sec-C4H9 → CH3CH=CH2 + ·CH3 | |
| 1 record matched | n-C5H11C(O)OCH(CH3)2 → CH3CH=CH2 + CH3(CH2)4COOH | |
| 1 record matched | 1,1,3-Trimethyl-1-silacyclobutane → CH3CH=CH2 + (CH3)2Si=CH2 | |
| 2 records matched | ·CH3 + C2H3 → CH3CH=CH2 | |
| 4 records matched | Oxetane, 2-methyl- → CH2O + CH3CH=CH2 | |
| 2 records matched | Oxetane, 3-methyl- → CH2O + CH3CH=CH2 | |
| 1 record matched | n-C3H7 + H· → CH3CH=CH2 + H2 | |
| 10 records matched | n-C3H7 + O2 → CH3CH=CH2 + HO2 | |
| 1 record matched | n-C3H7 + ·CHF2 → CH2F2 + CH3CH=CH2 | |
| 5 records matched | n-C3H7 + ·CH3 → CH4 + CH3CH=CH2 | |
| 11 records matched | n-C3H7 + n-C3H7 → C3H8 + CH3CH=CH2 | |
| 3 records matched | n-C3H7 → CH3CH=CH2 + H· | |
| 1 record matched | ·C2H5 + ·CH2F → CH3CH=CH2 + HF | |
| 3 records matched | ·C2H5 + n-C3H7 → C2H6 + CH3CH=CH2 | |
| 4 records matched | iso-C3H7 + O2 → CH3CH=CH2 + HO2 | |
| 2 records matched | iso-C3H7 + NF2 → CH3CH=CH2 + HNF2 | |
| 1 record matched | iso-C3H7 + (CH3)2CHCH2CH2 → iso-C5H12 + CH3CH=CH2 | |
| 1 record matched | iso-C3H7 + sec-C4H9 → n-C4H10 + CH3CH=CH2 | |
| 1 record matched | iso-C3H7 + ·CF3 → CHF3 + CH3CH=CH2 | |
| 5 records matched | iso-C3H7 + ·CH3 → CH4 + CH3CH=CH2 | |
| 2 records matched | iso-C3H7 + n-C3H7 → C3H8 + CH3CH=CH2 | |
| 5 records matched | iso-C3H7 + ·C2H5 → C2H6 + CH3CH=CH2 | |
| 17 records matched | iso-C3H7 + iso-C3H7 → C3H8 + CH3CH=CH2 | |
| 9 records matched | iso-C3H7 → CH3CH=CH2 + H· | |
| 1 record matched | ·CH2CH=CH2 + HBr → CH3CH=CH2 + Br· | |
| 1 record matched | ·CH2CH=CH2 + HI → CH3CH=CH2 + I | |
| 3 records matched | ·CH2CH=CH2 + HO2 → CH3CH=CH2 + O2 | |
| 2 records matched | ·CH2CH=CH2 + ·C2H5 → C2H4 + CH3CH=CH2 | |
| 1 record matched | ·CH2CH=CH2 + ·CH2CH=CH2 → CH3CH=CH2 + CH2=C=CH2 | |
| 1 record matched | CH3CHClCH2COOH → CH3CH=CH2 + CO2 + HCl | |
| 1 record matched | n-C3H7OSO2CH3 → HOSO2CH3 + CH3CH=CH2 | |
| 2 records matched | (CH3)2CHNCO → HN=C=O + CH3CH=CH2 | |
| 2 records matched | tert-C4H9 + iso-C3H7 → iso-C4H10 + CH3CH=CH2 | |
| 1 record matched | tert-C4H9 → CH3CH=CH2 + ·CH3 | |
| 1 record matched | Ethylidenecyclobutane → CH3CH=CH2 + CH2=C=CH2 | |
| 1 record matched | Cyclobutanone, 3-methyl- → CH3CH=CH2 + H2C=C=O | |
| 1 record matched | (CH3)2Si(CH2CH=CH2)2 → CH3CH=CH2 + Silacyclobut-2-ene, 1,1-dimethyl- | |
| 2 records matched | Methylthiirane + S → CH3CH=CH2 + S2 | |
| 1 record matched | Methylthiirane + ·CH3 → CH3CH=CH2 + CH3S· | |
| 1 record matched | Carbonic acid 1-methylethyl ester → CH3CH=CH2 + Carbonic acid monophenyl ester | |
| 3 records matched | Benzoic acid 1-methylethyl ester → Benzoic acid + CH3CH=CH2 | |
| 1 record matched | CH3C(O)SCH(CH3)2 → CH3CH=CH2 + CH3COSH | |
| 3 records matched | CH2=CHOCH(CH3)2 → CH3CHO + CH3CH=CH2 | |
| 1 record matched | Silacyclobutane, 1-methyl- → CH3CH=CH2 + (CH3)SiH | |
| 1 record matched | n-C3H7OCH=CH2 → CH3CHO + CH3CH=CH2 | |
| 1 record matched | (CH3)3SiCH2CH=CH2 → CH3CH=CH2 + (CH3)2Si=CH2 | |
| 1 record matched | (CH3)3CCH2CH=CH2 → CH3CH=CH2 + iso-C4H8 | |
| 2 records matched | C4H9C≡CH → CH3CH=CH2 + CH2=C=CH2 | |
| 2 records matched | n-C3H7C(O)OCH(CH3)2 → n-C3H7COOH + CH3CH=CH2 | |
| 2 records matched | C2H5C(O)OCH(CH3)2 → C2H5COOH + CH3CH=CH2 | |
| 1 record matched | C6H5-CH=CHCH3 + H· → CH3CH=CH2 + Phenyl | |
| 3 records matched | CH2=CHCH2OCH3 → CH2O + CH3CH=CH2 | |
| 1 record matched | CH2=CHCH2NHCH3 → CH3CH=CH2 + CH2=NH | |
| 2 records matched | CH2=CHCH2CH2OH → CH2O + CH3CH=CH2 | |
| 2 records matched | HCOOCH(CH3)2 → HCOOH + CH3CH=CH2 | |
| 4 records matched | CH2=CHCH2COOH → CH3CH=CH2 + CO2 | |
| 2 records matched | CH2=CHCH2CH(OH)CH3 → CH3CHO + CH3CH=CH2 | |
| 2 records matched | CH2=CHCH2C(CH3)2OH → (CH3)2CO + CH3CH=CH2 | |
| 2 records matched | n-C3H7O(CO)OC3H7-n → CH3CH=CH2 + n-C3H7OC(O)OH | |
| 1 record matched | HOCH2C(O)OCH(CH3)2 → HOCH2COOH + CH3CH=CH2 | |
| 1 record matched | iso-C3H7C(O)OCH(CH3)2 → iso-C3H7COOH + CH3CH=CH2 | |
| 3 records matched | Methylcyclobutane → C2H4 + CH3CH=CH2 | |
| 3 records matched | (CH2=CHCH2)2S → CH3CH=CH2 + CH2=CHCH=S | |
| 2 records matched | 1-C6H12 → CH3CH=CH2 + CH3CH=CH2 | |
| 1 record matched | n-C4H9COCH3 → (CH3)2CO + CH3CH=CH2 | |
| 2 records matched | Cyclohexene, 4-methyl- → 1,3-Butadiene + CH3CH=CH2 | |
| 1 record matched | (Z)-2-C4H8 + iso-C3H7 → CH3CH=CH2 + sec-C4H9 | |
| 2 records matched | (CH2=CHCH2)2O → CH2=CHCHO + CH3CH=CH2 | |
| 2 records matched | CH3CH2OCH2CH=CH2 → CH3CHO + CH3CH=CH2 | |
| 1 record matched | 3-Pyridinecarboxylic acid 1-methylethyl ester → 3-Pyridinecarboxylic acid + CH3CH=CH2 | |
| 1 record matched | Cyclopentadiene + ·CH2CH=CH2 → CH3CH=CH2 + Cyclopentadienyl | |
| 1 record matched | i-C3H7ONO → CH3CH=CH2 + HNO2 | |
| 6 records matched | n-C3H7Cl → CH3CH=CH2 + HCl | |
| 1 record matched | Cyclopropane, methoxy- → CH2O + CH3CH=CH2 | |
| 1 record matched | CH3CCCH3 + O· → CH3CH=CH2 + CO | |
| 2 records matched | n-C3H7F → CH3CH=CH2 + HF | |
| 2 records matched | iso-C3H7F → CH3CH=CH2 + HF | |
| 2 records matched | CH2FC(O)OCH(CH3)2 → CH3CH=CH2 + CH2FCOOH | |
| 1 record matched | CF3C(O)OCH(CH3)2 → CF3COOH + CH3CH=CH2 | |
| 1 record matched | Silacyclobutane → CH3CH=CH2 + SiH2 | |
| 1 record matched | (CH2=CHCH2)2NH → CH3CH=CH2 + (E)-CH2=CHCH=NH | |
| 1 record matched | Pyrrolidine → CH3CH=CH2 + CH2=NH | |
| 1 record matched | Carbamic acid, phenyl-, 1-methylethyl ester → CH3CH=CH2 + Carbamic acid, phenyl- | |
| 2 records matched | iso-C4H8 + H· → CH3CH=CH2 + ·CH3 | |
| 1 record matched | CH3CH=CH2 + CH3CH2C(O)OO → Products | |
| 1 record matched | CH3CH=CH2 + CH3GeH → Products | |
| 1 record matched | CH3CH=CH2 + Fe(CO)3 → Fe(CO)3(η2-CH3CH=CH2) | |
| 1 record matched | CH3CH=CH2 + n-C3H7O2 → Methyloxirane + n-C3H7O | |
| 1 record matched | CH3CH=CH2 + CH3C(O)OO(·) → Methyloxirane + CO2 + ·CH3 | |
| 1 record matched | CH3CH=CH2 + CH3C(O)OO(·) → Products | |
| 1 record matched | CH3CH=CH2 + CH2ClCHCl· → CH2=CHCl + ·CH2CH=CH2 + HCl | |
| 1 record matched | CH3CH=CH2 + Te → Adduct | |
| 2 records matched | CH3CH=CH2 + Cl → ClCH2CHCH3 | |
| 2 records matched | CH3CH=CH2 + Cl → ·CH2CH=CH2 + HCl | |
| 20 records matched | CH3CH=CH2 + Cl → Products | |
| 2 records matched | CH3CH=CH2 + NCO → Products | |
| 6 records matched | CH3CH=CH2 + CF3O → Adduct | |
| 1 record matched | CH3CH=CH2 + SiCl3 → Adduct | |
| 1 record matched | CH3CH=CH2 + CHF2CF: → Adduct | |
| 1 record matched | CH3CH=CH2 + N → C2H4 + HCN + H· | |
| 4 records matched | CH3CH=CH2 + N → Products | |
| 2 records matched | CH3CH=CH2 + O· → ·CH3 + *CH2C(O)H | |
| 1 record matched | CH3CH=CH2 + O· → ·C2H5 + HCO | |
| 4 records matched | CH3CH=CH2 + O· → Methyloxirane | |
| 21 records matched | CH3CH=CH2 + O· → Products | |
| 4 records matched | CH3CH=CH2 + D → Products | |
| 1 record matched | CH3CH=CH2 + ·F → ·CH2CH=CH2 + HF | |
| 2 records matched | CH3CH=CH2 + ·F → CH2=CHF + ·CH3 | |
| 1 record matched | CH3CH=CH2 + ·F → Other Products + H· | |
| 1 record matched | CH3CH=CH2 + ·F → Other Products + HF | |
| 1 record matched | CH3CH=CH2 + IO → Products | |
| 1 record matched | CH3CH=CH2 + I → ·CH2CH=CH2 + HI | |
| 1 record matched | CH3CH=CH2 + SiH2 → Adduct | |
| 1 record matched | CH3CH=CH2 + SiH2 → Products | |
| 1 record matched | CH3CH=CH2 + SiH2 → cyclo-SiH2C2H3CH3 | |
| 1 record matched | CH3CH=CH2 + NH → Other Products + NH2 | |
| 1 record matched | CH3CH=CH2 + NH → Products | |
| 4 records matched | CH3CH=CH2 + NH2 → Products | |
| 1 record matched | CH3CH=CH2 + SiH3 → Products | |
| 1 record matched | CH3CH=CH2 + SiCl2 → Adduct | |
| 1 record matched | CH3CH=CH2 + ·CHF → Products | |
| 6 records matched | CH3CH=CH2 + H· → n-C3H7 | |
| 6 records matched | CH3CH=CH2 + H· → iso-C3H7 | |
| 6 records matched | CH3CH=CH2 + H· → H2 + ·CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + H· → C2H4 + ·CH3 | |
| 8 records matched | CH3CH=CH2 + H· → Adduct | |
| 15 records matched | CH3CH=CH2 + H· → Products | |
| 1 record matched | CH3CH=CH2 + Cu2 → Cu2(CH3CH=CH2) | |
| 3 records matched | CH3CH=CH2 + C3 → Products | |
| 2 records matched | CH3CH=CH2 + C2O → Products | |
| 1 record matched | CH3CH=CH2 + NO3 → ·CH2CH=CH2 + HNO3 | |
| 5 records matched | CH3CH=CH2 + NO3 → Products | |
| 3 records matched | CH3CH=CH2 + NO2 → Products | |
| 1 record matched | CH3CH=CH2 + Br· → BrCH2CHCH3 | |
| 2 records matched | CH3CH=CH2 + Br· → ·CH2CH=CH2 + HBr | |
| 3 records matched | CH3CH=CH2 + Br· → Products | |
| 1 record matched | CH3CH=CH2 + HBr → n-C3H7Br | |
| 2 records matched | CH3CH=CH2 + HI → iso-C3H7I | |
| 4 records matched | CH3CH=CH2 + O3 → Other Products + ·OH | |
| 17 records matched | CH3CH=CH2 + O3 → Products | |
| 1 record matched | CH3CH=CH2 + Cl2 → CH3CH=CHCl + HCl | |
| 1 record matched | CH3CH=CH2 + Cl2 → 1-Propene, 3,3-dichloro- + H2 | |
| 1 record matched | CH3CH=CH2 + Cl2 → (CH3)CCl=CH2 + HCl | |
| 1 record matched | CH3CH=CH2 + Cl2 → CH2=CHCH2Cl + HCl | |
| 1 record matched | CH3CH=CH2 + Cl2 → CH2ClCH=CHCl + H2 | |
| 2 records matched | CH3CH=CH2 + Se → Selenirane, methyl- | |
| 2 records matched | CH3CH=CH2 + O2 → ·CH2CH=CH2 + HO2 | |
| 3 records matched | CH3CH=CH2 + S → Methylthiirane | |
| 1 record matched | CH3CH=CH2 + Zr → Products | |
| 1 record matched | CH3CH=CH2 + Y → Y(C3H6) | |
| 1 record matched | CH3CH=CH2 + Y → H2 + Y(C3H4) | |
| 3 records matched | CH3CH=CH2 + Y → Products | |
| 1 record matched | CH3CH=CH2 + Y → Y(C3H2) + H2 + H2 | |
| 3 records matched | CH3CH=CH2 + V → Products | |
| 1 record matched | CH3CH=CH2 + Hf → Products | |
| 1 record matched | CH3CH=CH2 + Ge → Products | |
| 1 record matched | CH3CH=CH2 + C → CHCCH(·)CH3 + H· | |
| 1 record matched | CH3CH=CH2 + C → Products + H· | |
| 3 records matched | CH3CH=CH2 + C → Products | |
| 3 records matched | CH3CH=CH2 + Ti → Products | |
| 1 record matched | CH3CH=CH2 + Ta → Products | |
| 1 record matched | CH3CH=CH2 + Si → Products | |
| 2 records matched | CH3CH=CH2 + Sc → Products | |
| 1 record matched | CH3CH=CH2 + Rh → Products | |
| 1 record matched | CH3CH=CH2 + Pt → Products | |
| 2 records matched | CH3CH=CH2 + Pd → Products | |
| 1 record matched | CH3CH=CH2 + Nb → Products | |
| 5 records matched | CH3CH=CH2 + Ni → Products | |
| 2 records matched | CH3CH=CH2 + Mo → Products | |
| 1 record matched | CH3CH=CH2 + Ir → Products | |
| 1 record matched | CH3CH=CH2 + CH3S· → Adduct | |
| 1 record matched | CH3CH=CH2 + (CH3)2Si → Products | |
| 1 record matched | CH3CH=CH2 + (CH3)2CHO2 → Methyloxirane + i-C3H7O | |
| 1 record matched | CH3CH=CH2 + CH3CH → 1-C5H10 | |
| 2 records matched | CH3CH=CH2 + CBr → Products | |
| 2 records matched | CH3CH=CH2 + ·CCl → Products | |
| 2 records matched | CH3CH=CH2 + CF → Products | |
| 3 records matched | CH3CH=CH2 + NF2 → CH3CHCH2NF2 | |
| 3 records matched | CH3CH=CH2 + ·OH → CH3CHCH2OH | |
| 2 records matched | CH3CH=CH2 + ·OH → CH3CH=CH + H2O | |
| 1 record matched | CH3CH=CH2 + ·OH → ·CH2CH=CH2 + H2O | |
| 1 record matched | CH3CH=CH2 + ·OH → CH3CHO + ·CH3 | |
| 1 record matched | CH3CH=CH2 + ·OH → CH2O + ·C2H5 | |
| 46 records matched | CH3CH=CH2 + ·OH → Products | |
| 1 record matched | CH3CH=CH2 + ·CH → Products | |
| 1 record matched | CH3CH=CH2 + HO2 → Methyloxirane + ·OH | |
| 1 record matched | CH3CH=CH2 + ·CCl3 → CCl3CH2CHCH3 | |
| 1 record matched | CH3CH=CH2 + ·CCl3 → CHCl3 + ·CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + (CH3)3CO → tert-C4H9OH + ·CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + HCO → Products | |
| 1 record matched | CH3CH=CH2 + Phenyl → Products | |
| 2 records matched | CH3CH=CH2 + ·CF3 → Adduct | |
| 3 records matched | CH3CH=CH2 + ·CH3 → iso-C4H9 | |
| 4 records matched | CH3CH=CH2 + ·CH3 → sec-C4H9 | |
| 3 records matched | CH3CH=CH2 + ·CH3 → CH4 + ·CH2CH=CH2 | |
| 2 records matched | CH3CH=CH2 + ·CH3 → Other Products + CH4 | |
| 2 records matched | CH3CH=CH2 + ·CH3 → Adduct | |
| 1 record matched | CH3CH=CH2 + ·CF2 → Cyclopropane,1,1-difluoro-2-methyl- | |
| 1 record matched | CH3CH=CH2 + ·CF2 → Products | |
| 1 record matched | CH3CH=CH2 + ·C2H → Other Products + C2H2 | |
| 2 records matched | CH3CH=CH2 + ·C2H → Products | |
| 1 record matched | CH3CH=CH2 + CD3 → CHD3 + ·CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + ·CHCl → Products | |
| 1 record matched | CH3CH=CH2 + iso-C3H7 → CH3CH=CH2 + n-C3H7 | |
| 2 records matched | CH3CH=CH2 + iso-C3H7 → C3H8 + ·CH2CH=CH2 | |
| 2 records matched | CH3CH=CH2 + 1,3-Cyclohexadiene → bicyclo[2.2.2]oct-2-ene, 5-methyl-,(1α,4α,5α)- | |
| 2 records matched | CH3CH=CH2 + 1,3-Cyclohexadiene → Bicyclo[2.2.2]oct-2-ene, 5-methyl-,(1α,4α,5β)- | |
| 1 record matched | CH3CH=CH2 + CH3CH=CH2 → ·CH2CH=CH2 + iso-C3H7 | |
| 2 records matched | CH3CH=CH2 + CH3CH=CH2 → (CH3)2CHCH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + CH3CH=CH2 → 1-C6H12 | |
| 1 record matched | CH3CH=CH2 + CH3CH=CH2 → Methylcyclopentane | |
| 1 record matched | CH3CH=CH2 → H· + CH2=C(·)CH3 | |
| 1 record matched | CH3CH=CH2 → CH3CH=CH + H· | |
| 6 records matched | CH3CH=CH2 → ·CH3 + C2H3 | |
| 3 records matched | CH3CH=CH2 → ·CH2CH=CH2 + H· | |
| 1 record matched | CH3CH=CH2 → CH2=C=CH2 + H2 | |
| 5 records matched | CH3CH=CH2 → Products | |
| 1 record matched | HCOOCH2CH2CH3 → HCOOH + CH3CH=CH2 | |
| 1 record matched | Tetrahydrofuran → CH2O + CH3CH=CH2 | |
| 1 record matched | 1-C5H10 → C2H4 + CH3CH=CH2 | |
| 2 records matched | CH3COOCH2CH2CH3 → CH3C(O)OH + CH3CH=CH2 | |
| 3 records matched | Toluene + ·CH2CH=CH2 → CH3CH=CH2 + Benzyl | |
| 1 record matched | ClC(O)OCH(CH3)2 → CH3CH=CH2 + ClCOOH | |
| 8 records matched | CH3COOCH(CH3)2 → CH3C(O)OH + CH3CH=CH2 | |
| 1 record matched | (iso-C3H7)2O → iso-C3H7OH + CH3CH=CH2 | |
| 1 record matched | 1-nitropropane → CH3CH=CH2 + HNO2 | |
| 2 records matched | n-C3H7I → CH3CH=CH2 + HI | |
| 1 record matched | CH3CH=CHCH3 + iso-C3H7 → CH3CH=CH2 + sec-C4H9 | |
| 1 record matched | C2H5CCH + O· → CH3CH=CH2 + CO | |
| 5 records matched | n-C3H7Br → CH3CH=CH2 + HBr | |
| 3 records matched | ClCH2C(O)OCH(CH3)2 → CH2ClCOOH + CH3CH=CH2 | |
| 1 record matched | 2-nitropropane → CH3CH=CH2 + HNO2 | |
| 1 record matched | CH3C(O)OOH + CH3CH=CH2 → CH3C(O)OH + Methyloxirane | |
| 2 records matched | iso-C3H7CN → HCN + CH3CH=CH2 | |
| 1 record matched | CH2BrCHBrCH3 → CH3CH=CH2 + Br2 | |
| 9 records matched | iso-C3H7I → CH3CH=CH2 + HI | |
| 10 records matched | iso-C3H7Cl → CH3CH=CH2 + HCl | |
| 11 records matched | iso-C3H7Br → CH3CH=CH2 + HBr | |
| 34 records matched | Cyclopropane → CH3CH=CH2 | |
| 1 record matched | C3H8 + ·CH2CH=CH2 → CH3CH=CH2 + n-C3H7 | |
| 2 records matched | C2H4 + ·CH2 → CH3CH=CH2 | |
| 1 record matched | C2H4 + ·CH3 → CH3CH=CH2 + H· | |
| 1 record matched | C2H4 + ·C2H5 → CH3CH=CH2 + ·CH3 | |
| 1 record matched | C2H4 + CH3CH=CH2 → 1-C5H10 | |
| 1 record matched | C2H4 + 1-C4H8 → CH3CH=CH2 + CH3CH=CH2 | |
| 1 record matched | C2H6 + ·CH → CH3CH=CH2 + H· | |
| 2 records matched | iso-C3H7OH → CH3CH=CH2 + H2O | |
| 1 record matched | CN + CH3CH=CH2 → CH3CH=CHCN + H· | |
| 7 records matched | CN + CH3CH=CH2 → Products | |
| 2 records matched | O(1D) + CH3CH=CH2 → Products | |
| 1 record matched | O2(1DELTA) + CH3CH=CH2 → CH3CH=CH2 + O2 | |
| 1 record matched | CH2=CHCH2N(CH2CN)CH2C≡CH → CH≡CCH=N(CH2CN) + CH3CH=CH2 | |
| 1 record matched | CH2=CHCH2N(CH2SCH3)CH2C≡CH → CH≡CCH=N(CH2SCH3) + CH3CH=CH2 | |
| 1 record matched | CH2=CHCH2N(SO2CH3)CH2C≡CH → CH≡CCH=N(SO2CH3) + CH3CH=CH2 | |
| 1 record matched | CH2CH=CH2-N[(CH3)CCH2]-CH2CH=CH2 → Other Products + CH3CH=CH2 | |
| 1 record matched | Benzoic acid, 3-methoxy-, 1-methylethyl ester → CH3CH=CH2 + 3-Methoxybenzoic acid | |
| 1 record matched | CN(X2Sigma+) + CH3CH=CH2 → Products | |
| 1 record matched | O(3P) + C3H8 → CH3CH=CH2 + H2O | |
| 1 record matched | CF2(a~3B1) + CH3CH=CH2 → Products | |
| 1 record matched | (CH3CH2)2NCO(O)CH(CH3)2 → (C2H5)2NH + CH3CH=CH2 + CO2 | |
| 2 records matched | CH3CH(·)CH2CH(CH3)2 → CH3CH=CH2 + iso-C3H7 | |
| 2 records matched | CH3CH2CH2CH(CH3)CH2· → CH3CH=CH2 + n-C3H7 | |
| 1 record matched | Zr (4d2_5s2,3F) + CH3CH=CH2 → C3H4Zr + H2 | |
| 1 record matched | C2(X1ΣPlg) + CH3CH=CH2 → Products | |
| 2 records matched | C2(a3PIu) + CH3CH=CH2 → Products | |
| 1 record matched | CH2=CHCH2CHCH3 → CH3CH=CH2 + C2H3 | |
| 1 record matched | n-C3H7O2 → CH3CH=CH2 + HO2 | |
| 1 record matched | ·CH2CH2CH2· → CH3CH=CH2 | |
| 1 record matched | CH3CH2CH2SCH2CH=CH2 → CH3CH2CH=S + CH3CH=CH2 | |
| 1 record matched | (CH3)3CCH(CH3)CH2· → CH3CH=CH2 + tert-C4H9 | |
| 3 records matched | iso-C4H9 → CH3CH=CH2 + ·CH3 | |
| 1 record matched | (CH3)2CHO2 → CH3CH=CH2 + HO2 | |
| 2 records matched | 2-hexyl radical → CH3CH=CH2 + n-C3H7 | |
| 3 records matched | sec-C4H9 → CH3CH=CH2 + ·CH3 | |
| 1 record matched | Oxetane, 2-methyl- → CH2O + CH3CH=CH2 | |
| 1 record matched | n-C3H7 + O2 → CH3CH=CH2 + HO2 | |
| 1 record matched | n-C3H7 + ·CH3 → CH4 + CH3CH=CH2 | |
| 3 records matched | n-C3H7 → CH3CH=CH2 + H· | |
| 1 record matched | iso-C3H7 + O2 → CH3CH=CH2 + HO2 | |
| 3 records matched | iso-C3H7 + C2H3 → C2H4 + CH3CH=CH2 | |
| 1 record matched | iso-C3H7 + (CH3)2CHCH2CH2 → iso-C5H12 + CH3CH=CH2 | |
| 3 records matched | iso-C3H7 + ·CH3 → CH4 + CH3CH=CH2 | |
| 2 records matched | iso-C3H7 + n-C3H7 → C3H8 + CH3CH=CH2 | |
| 2 records matched | iso-C3H7 + ·C2H5 → C2H6 + CH3CH=CH2 | |
| 3 records matched | iso-C3H7 + iso-C3H7 → C3H8 + CH3CH=CH2 | |
| 2 records matched | iso-C3H7 → CH3CH=CH2 + H· | |
| 1 record matched | ·CH2CH=CH2 + H· → CH3CH=CH2 | |
| 1 record matched | ·CH2CH=CH2 + HBr → CH3CH=CH2 + Br· | |
| 1 record matched | ·CH2CH=CH2 + n-C3H7 → CH3CH=CH2 + CH3CH=CH2 | |
| 1 record matched | ·CH2CH=CH2 + ·C2H5 → C2H4 + CH3CH=CH2 | |
| 2 records matched | ·CH2CH=CH2 + iso-C3H7 → CH3CH=CH2 + CH3CH=CH2 | |
| 1 record matched | ·CH2CH=CH2 + ·CH2CH=CH2 → CH3CH=CH2 + CH2=C=CH2 | |
| 1 record matched | tert-C4H9 → CH3CH=CH2 + ·CH3 | |
| 1 record matched | H2 + ·CH2CH=CH2 → CH3CH=CH2 + H· | |
| 2 records matched | Cyclobutanone → CH3CH=CH2 + CO | |
| 1 record matched | CH2=CHCH2CH2OH → CH2O + CH3CH=CH2 | |
| 1 record matched | CH2=CHCH2CH(OH)CH3 → CH3CHO + CH3CH=CH2 | |
| 1 record matched | CH2=CHCH2C(CH3)2OH → (CH3)2CO + CH3CH=CH2 | |
| 1 record matched | (CH2=CHCH2)2S → CH3CH=CH2 + CH2=CHCH=S | |
| 1 record matched | n-C4H9COCH3 → (CH3)2CO + CH3CH=CH2 | |
| 1 record matched | n-C3H7F → CH3CH=CH2 + HF | |
| 1 record matched | iso-C3H7F → CH3CH=CH2 + HF | |
| 1 record matched | CH3CH=CH2 + Cl → Products | |
| 1 record matched | CH3CH=CH2 + CHF2CF: → Adduct | |
| 1 record matched | CH3CH=CH2 + O· → CH3C(·)HCHO | |
| 1 record matched | CH3CH=CH2 + O· → CH3C(O)CH2(·) + H· | |
| 1 record matched | CH3CH=CH2 + O· → ·CH3 + *CH2C(O)H | |
| 1 record matched | CH3CH=CH2 + O· → H2C=C=O + ·CH3 + H· | |
| 1 record matched | CH3CH=CH2 + O· → Products | |
| 1 record matched | CH3CH=CH2 + O· → CH2(O·)CH(·)CH3 | |
| 1 record matched | CH3CH=CH2 + O· → CH2(·)CH(O·)CH3 | |
| 1 record matched | CH3CH=CH2 + CH3OC(·)(O) → CH3OC(O)CH2CH·CH3 | |
| 1 record matched | CH3CH=CH2 + ·F → Products | |
| 1 record matched | CH3CH=CH2 + SiH3 → H3SiCH2C(·)HCH3 | |
| 1 record matched | CH3CH=CH2 + SiH3 → CH3CH(SiH3)CH2· | |
| 1 record matched | CH3CH=CH2 + H· → n-C3H7 | |
| 1 record matched | CH3CH=CH2 + H· → H2 + CH2=C(·)CH3 | |
| 1 record matched | CH3CH=CH2 + H· → H2 + CH3CH=CH | |
| 1 record matched | CH3CH=CH2 + H· → H2 + ·CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + H· → C2H4 + ·CH3 | |
| 3 records matched | CH3CH=CH2 + NO3 → Products | |
| 1 record matched | CH3CH=CH2 + Br· → ·CH2CH=CH2 + HBr | |
| 1 record matched | CH3CH=CH2 + O3 → CH3CHO + CH2OO | |
| 1 record matched | CH3CH=CH2 + O3 → CH2O + CH3CH(·)OO· | |
| 1 record matched | CH3CH=CH2 + O2 → Products | |
| 2 records matched | CH3CH=CH2 + ·OH → H2O + CH2=C(·)CH3 | |
| 1 record matched | CH3CH=CH2 + ·OH → CH3CH(OH)CH2 | |
| 1 record matched | CH3CH=CH2 + ·OH → CH3CHCH2OH | |
| 1 record matched | CH3CH=CH2 + ·OH → CH3CH=CH + H2O | |
| 1 record matched | CH3CH=CH2 + ·OH → Adduct | |
| 2 records matched | CH3CH=CH2 + ·OH → Products | |
| 2 records matched | CH3CH=CH2 + HO2 → Methyloxirane + ·OH | |
| 1 record matched | CH3CH=CH2 + HO2 → CH3CH(·)CH2OOH | |
| 1 record matched | CH3CH=CH2 + HO2 → ·CH2CH(OOH)CH3 | |
| 1 record matched | CH3CH=CH2 + CH3CO → CH3CHO + ·CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + CH3C(O)CH2(·) → (CH3)2CO + ·CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + Cyclopropene → 2-propenyl-cyclopropane | |
| 1 record matched | CH3CH=CH2 + C2H3 → C2H4 + CH2=C(·)CH3 | |
| 1 record matched | CH3CH=CH2 + C2H3 → C2H4 + CH3CH=CH | |
| 1 record matched | CH3CH=CH2 + C2H3 → C2H4 + ·CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + HCO → CH3CH(·)CH2CHO | |
| 1 record matched | CH3CH=CH2 + Phenyl → Benzene + ·CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + Phenyl → CH2CH(C6H5)CH3 | |
| 1 record matched | CH3CH=CH2 + Phenyl → CH3CH(·)CH2C6H5 | |
| 2 records matched | CH3CH=CH2 + ·CH3 → iso-C4H9 | |
| 2 records matched | CH3CH=CH2 + ·CH3 → sec-C4H9 | |
| 1 record matched | CH3CH=CH2 + ·CH3 → CH4 + CH2=C(·)CH3 | |
| 1 record matched | CH3CH=CH2 + ·CH3 → CH4 + CH3CH=CH | |
| 3 records matched | CH3CH=CH2 + ·CH3 → CH4 + ·CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + n-C3H7 → 1-C4H8 + ·C2H5 | |
| 1 record matched | CH3CH=CH2 + n-C3H7 → C3H8 + ·CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + ·C2H5 → C2H6 + ·CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + ·CH2CH=CH2 → CH3CH(.)CH2CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + ·CH2CH=CH2 → CH3CH=CH2 + ·CH2CH=CH2 | |
| 1 record matched | CH3CH=CH2 + C6H5CH=NOH → Products | |
| 1 record matched | CH3CH=CH2 + (NZ)-N-benzylidenehydroxylamine → Products | |
| 2 records matched | CH3CH=CH2 + CH3CH=CH2 → ·CH2CH=CH2 + n-C3H7 | |
| 2 records matched | CH3CH=CH2 + CH3CH=CH2 → ·CH2CH=CH2 + iso-C3H7 | |
| 1 record matched | CH3CH=CH2 → ·CH3 + C2H3 | |
| 2 records matched | CH3CH=CH2 → ·CH2CH=CH2 + H· | |
| 1 record matched | CH3CH=CH2 → CH2=C=CH2 + H2 | |
| 1 record matched | CH3CH=CH2 → CH4 + C2H2 | |
| 3 records matched | CH3CH=CH2 → Products | |
| 1 record matched | 1-C5H10 → C2H4 + CH3CH=CH2 | |
| 1 record matched | n-C3H7I → CH3CH=CH2 + HI | |
| 2 records matched | n-C3H7Br → CH3CH=CH2 + HBr | |
| 1 record matched | 2(3H)-Furanone, dihydro- → CH3CH=CH2 + CO2 | |
| 1 record matched | 2-nitropropane → cis-HONO + CH3CH=CH2 | |
| 1 record matched | 2-nitropropane → trans-HONO + CH3CH=CH2 | |
| 1 record matched | iso-C3H7I + I → CH3CH=CH2 + HI + I | |
| 1 record matched | iso-C3H7I + iso-C3H7 → C3H8 + CH3CH=CH2 + I | |
| 1 record matched | iso-C3H7I → CH3CH=CH2 + HI | |
| 2 records matched | Cyclopropane → CH3CH=CH2 | |
| 1 record matched | CH3CHO + ·CH2CH=CH2 → CH3CH=CH2 + CH3CO | |
| 1 record matched | CH3CHO + CH3CH=CH2 → CH2=CHCH2CH(OH)CH3 | |
| 1 record matched | C3H8 + ·CH2CH=CH2 → CH3CH=CH2 + n-C3H7 | |
| 1 record matched | C3H8 + ·CH2CH=CH2 → CH3CH=CH2 + iso-C3H7 | |
| 1 record matched | C2H4 + CH3CH=CH2 → iso-C3H7 + C2H3 | |
| 1 record matched | C2H4 + CH3CH=CH2 → ·CH2CH=CH2 + ·C2H5 | |
| 1 record matched | C2H4 + CH3CH=CH2 → 1-C5H10 | |
| 1 record matched | C2H6 + ·CH2CH=CH2 → CH3CH=CH2 + ·C2H5 | |
| 1 record matched | CH4 + ·CH2CH=CH2 → CH3CH=CH2 + ·CH3 | |
| 1 record matched | n-C3H7OH → CH3CH=CH2 + H2O | |
| 1 record matched | (CH3)2CO + ·CH2CH=CH2 → CH3CH=CH2 + CH3C(O)CH2(·) | |
| 1 record matched | (CH3)2CO + CH3CH=CH2 → CH2=CHCH2C(CH3)2OH | |
| 5 records matched | iso-C3H7OH → CH3CH=CH2 + H2O | |
| 1 record matched | CH2O + CH3CH=CH2 → CH2=CHCH2CH2OH | |
| 1 record matched | n-C3H7O2 → CH3CH=CH2 + HO2 | |
| 1 record matched | Propyl Radical + C2H4 → CH3CH=CH2 + ·C2H5 | |
| 1 record matched | (CH3CH2)2NCO(O)CH(CH3)2 → CH3CH=CH2 + CO2 + sec-C4H9NH2 | |
| 1 record matched | CH3CH(·)CH2CHO → CH3CH=CH2 + HCO | |
| 1 record matched | CH3OC(O)CH2CH·CH3 → CH3CH=CH2 + CH3OC(·)(O) | |
| 1 record matched | (CH3)2NCOOCH(CH3)2 → CH3CH=CH2 + CO2 + (CH3)2NH | |
| 1 record matched | P(C3H5)3 → CH2CHCH2-P=CHCH=CH2 + CH3CH=CH2 | |
| 1 record matched | CH2CHCH2-P=CHCH=CH2 → CH2=CHC≡P + CH3CH=CH2 | |
| 2 records matched | CH2CHCH2-P=CHCH=CH2 → cyclo-PC3H3 + CH3CH=CH2 | |
| 1 record matched | cyclo-PC3H3 + CH3CH=CH2 → CH2CHCH2-[cyclo-(PCH2CH=CH-)] | |
| 1 record matched | O(3P) + CH3CH=CH2 → Products |
Search returned 1186 records.