Kinetics Database Logo

Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences

Feedback

Rate Our Products and Services

Help


Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty

More...


Administrative Links

NIST home page

MML home page

Chemical and Biochemical Reference Data Division

MML home page

Chemical and Biochemical Reference Data Division

  NIST Logo Home
©NIST, 2013
Accessibility information

Search Results


Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
1 record matched Diborane(6) → H2 + B2H4
2 records matched H· + AlOH → H2 + AlO
1 record matched Al + H2O + H2O → Al(OH)2 + H2
1 record matched Al + H2O → H2 + AlO
1 record matched H2 + SiHCl → HCl + SiH2
1 record matched H2 + SiHBr → HBr + SiH2
1 record matched HCN + SiH3I → SiH2ICN + H2
1 record matched HCN + SiH3Cl → SiH2ClCN + H2
1 record matched HCN + SiH3Br → SiH2BrCN + H2
1 record matched HCN + SiH4 → H2 + SiH3CN
1 record matched C2H2 + Y → H2 + C2Y
1 record matched C(3Pj) + C2H4 → H2 + c-C3H2
1 record matched C2H2(X1Σg+) + C(3Pj) → H2 + C3
1 record matched Cs(9 2P3/2) + H2 → H· + CsH
1 record matched SH + SH → H2 + S2
1 record matched NH2 + O· → H2 + NO
3 records matched H· + ·CH2 → H2 + ·CH
1 record matched H· + HNO → H2 + NO
1 record matched H· + SH → H2 + S
1 record matched H· + NH → H2 + N
2 records matched H· + NH2 → H2 + NH
11 records matched H· + H· → H2
3 records matched HBr + H· → H2 + Br·
1 record matched HI + H· → H2 + I
1 record matched HI + HI → H2 + I2
2 records matched SiH4 + H· → H2 + SiH3
2 records matched PH3 + H· → H2 + PH2
4 records matched H2S + H· → H2 + SH
1 record matched HNO2 + H· → H2 + NO2
3 records matched GeH4 + H· → H2 + GeH3
7 records matched H2O + H· → H2 + ·OH
3 records matched H2O2 + H· → H2 + HO2
2 records matched NH3 + H· → H2 + NH2
1 record matched NH3 → H2 + NH
1 record matched HF + H· → H2 + ·F
3 records matched HCl + H· → H2 + Cl
1 record matched iso-C4H9 + H· → iso-C4H8 + H2
4 records matched ·OH + H· → H2 + O·
11 records matched HO2 + H· → H2 + O2
3 records matched C2H3 + H· → C2H2 + H2
3 records matched HCO + H· → CO + H2
2 records matched (·)CH2OH + H· → CH2O + H2
1 record matched ·CH3 + H· → H2 + ·CH2
1 record matched ·CH3 + ·CH3 → C2H4 + H2
3 records matched CH3O· + H· → CH2O + H2
1 record matched n-C3H7 + H· → CH3CH=CH2 + H2
1 record matched ·C2H + H· → H2 + C2
1 record matched ·C2H5 + H· → C2H4 + H2
1 record matched iso-C3H7 + H· → CH3CH=CH2 + H2
1 record matched ·CH2CH=CH2 + H· → CH2=C=CH2 + H2
1 record matched tert-C4H9 + H· → iso-C4H8 + H2
1 record matched Si2H6 + H· → H2 + Si2H5
1 record matched H2 + ·CH2 → ·CH3 + H·
13 records matched H2 + Cl → HCl + H·
1 record matched H2 + NCO → HN=C=O + H·
15 records matched H2 + O· → ·OH + H·
1 record matched H2 + D → H· + HD
2 records matched H2 + ClO → Products
11 records matched H2 + ·F → HF + H·
2 records matched H2 + I → HI + H·
1 record matched H2 + BO → H· + HBO
2 records matched H2 + NaO → NaOH + H·
1 record matched H2 + NO2 → HNO2 + H·
1 record matched H2 + NO → H· + HNO
4 records matched H2 + Br· → HBr + H·
1 record matched H2 + O2 → ·OH + ·OH
1 record matched H2 + O2 → HO2 + H·
1 record matched H2 + S → H· + SH
1 record matched H2 + I2 → HI + HI
1 record matched H2 + iso-C4H9 → iso-C4H10 + H·
23 records matched H2 + ·OH → H2O + H·
1 record matched H2 + ·CH → Products
4 records matched H2 + HO2 → H2O2 + H·
1 record matched H2 + CH3CO → CH3CHO + H·
1 record matched H2 + C2H3 → C2H4 + H·
1 record matched H2 + C2H3 → Products
1 record matched H2 + HCO → CH2O + H·
1 record matched H2 + (·)CH2OH → CH3OH + H·
1 record matched H2 + ·CF3 → CHF3 + H·
6 records matched H2 + ·CH3 → CH4 + H·
1 record matched H2 + CH2=C → C2H3 + H·
1 record matched H2 + n-C3H7 → C3H8 + H·
1 record matched H2 + CH3O2· → CH3OOH + H·
8 records matched H2 + ·C2H → C2H2 + H·
2 records matched H2 + ·C2H5 → C2H6 + H·
1 record matched H2 + iso-C3H7 → C3H8 + H·
1 record matched H2 + ·CH2CH=CH2 → CH3CH=CH2 + H·
1 record matched H2 + tert-C4H9 → iso-C4H10 + H·
11 records matched H2 → H· + H·
1 record matched (CH3)2SiH2 + H· → H2 + (CH3)2SiH
1 record matched (CH3)3SiH + H· → H2 + (CH3)3Si·
1 record matched CH3SiH3 + H· → H2 + CH3SiH2
1 record matched Cyclopentane + H· → H2 + Cyclopentyl
1 record matched Cyclopentene → Cyclopentadiene + H2
1 record matched CH3CH=CH2 + H· → H2 + CH2=C(·)CH3
1 record matched CH3CH=CH2 + H· → H2 + CH3CH=CH
2 records matched CH3CH=CH2 + H· → H2 + ·CH2CH=CH2
1 record matched Phenol + H· → H2 + C6H5O
6 records matched Toluene + H· → H2 + Benzyl
2 records matched n-C4H10 + H· → Other Products + H2
2 records matched Ethylbenzene + H· → H2 + 1-phenylethyl
1 record matched iso-C4H10 + H· → H2 + iso-C4H9
1 record matched iso-C4H10 + H· → H2 + tert-C4H9
2 records matched iso-C4H10 + H· → Other Products + H2
1 record matched Oxirane + H· → H2 + Oxiranyl
3 records matched HN=C=O + H· → H2 + NCO
1 record matched CH3CHO + H· → H2 + CH3CO
1 record matched C3H8 + H· → H2 + n-C3H7
1 record matched C3H8 + H· → H2 + iso-C3H7
2 records matched C3H8 + H· → Other Products + H2
2 records matched HCN + H· → CN + H2
4 records matched C2H2 + H· → H2 + ·C2H
1 record matched C2H2 + H2 → C2H3 + H·
1 record matched C2H2 + H2 → C2H4
3 records matched C2H4 + H· → H2 + C2H3
1 record matched C2H4 + H2 → ·C2H5 + H·
3 records matched C2H4 → C2H2 + H2
7 records matched C2H6 + H· → H2 + ·C2H5
8 records matched CH4 + H· → H2 + ·CH3
1 record matched CH3OH + H· → H2 + CH3
4 records matched CN + H2 → HCN + H·
5 records matched CH2O + H· → H2 + HCO
5 records matched O(1D) + H2 → ·OH + H·
2 records matched O(1D) + CH4 → CH2O + H2
1 record matched N(2D) + H2 → H· + NH
1 record matched N(2P) + H2 → H2 + N
3 records matched O(1D) + H2 → ·OH + H·
1 record matched H2Si(·)OH → H2 + (·)Si(O)H
1 record matched Cyclopentene 4-d → H2 + 1,3-Cyclopentadiene-5-d
1 record matched HSiOH → H2 + SiO
3 records matched ·CH2 + ·CH2 → C2H2 + H2
2 records matched ·CH2 → H2 + C
1 record matched 2H-Pyrrole, 2-ethyl-3,4-dihydro- → Other Products + H2
1 record matched :GeH2 → H2 + Ge
1 record matched H2Si=O + H2Si=O → Other Products + H2
1 record matched 1,4-Cyclohexadiene, 1-ethyl- → Ethylbenzene + H2
1 record matched Tetraborane(10) → H2 + Tetraborane(8)
1 record matched O· + ·CH2 → CO + H2
1 record matched 1,4-Cyclohexadiene, 1,2-dimethyl- → 1,2-Dimethylbenzene + H2
1 record matched SiH2=SiH2 → H2 + HSi=SiH
1 record matched SiH3OH → H2 + HSiOH
1 record matched SiH3OH → H2 + H2Si=O
1 record matched SiH2 + SiH2 → H2 + HSi=SiH
4 records matched SiH2 → H2 + Si
3 records matched SiH2F2 → H2 + SiF2
1 record matched NH2 + O· → H2 + NO
1 record matched NH2 + NH2 → H2 + HN=NH
2 records matched SiH3 → H2 + SiH
1 record matched C2H5C≡CCH=CH2 → Other Products + H2
3 records matched SiH3F → H2 + SiHF
1 record matched SiH3Cl → H2 + SiHCl
2 records matched n-C3H7SiH3 → H2 + CH3CH2CH2SiH
1 record matched H· + H2Si(·)OH → H2 + HSiOH
1 record matched H· + H2Si(·)OH → H2 + H2Si=O
1 record matched H· + H3SiO(·) → H2 + HSiOH
1 record matched H· + H3SiO(·) → H2 + H2Si=O
2 records matched H· + HSO2 → H2 + SO2
13 records matched H· + ·CH2 → H2 + ·CH
1 record matched H· + HSi(O)OH → H2 + (·)Si(O)OH
1 record matched H· + HN=N → H2 + N2
1 record matched H· + H2Si=O → H2 + (·)Si(O)H
1 record matched H· + CH2=C(·)CH3 → CH2=C=CH2 + H2
1 record matched H· + SiH3OH → H2 + H2Si(·)OH
1 record matched H· + SiH3OH → H2 + H3SiO(·)
1 record matched H· + Hyponitrous acid → H2 + NO + HNO
8 records matched H· + HNO → H2 + NO
2 records matched H· + HD → H2 + D
5 records matched H· + SH → H2 + S
1 record matched H· + SiH2F2 → H2 + HF2Si
2 records matched H· + Ge2H6 → Other Products + H2
1 record matched H· + NH → H2 + N
1 record matched H· + NH → N(4S) + H2
4 records matched H· + NH2 → H2 + NH
1 record matched H· + SiH3F → H2 + SiH2F
79 records matched H· + H· → H2
1 record matched CaOH + H· → CaO + H2
1 record matched SrOH + H· → SrO + H2
1 record matched BaOH + H· → BaO + H2
1 record matched Fe(CO)4H2 → H2 + Fe(CO)4
2 records matched CH2D + OD → H2 + CD2O
1 record matched NO + NH2 → H2 + N2O
10 records matched HBr + H· → H2 + Br·
1 record matched HI + HNO → H2 + INO
1 record matched HI + HNO → Other Products + H2
15 records matched HI + H· → H2 + I
2 records matched HI + HI → H2 + I2
2 records matched SiH4 + SiH2 → H2 + H3SiSiH
12 records matched SiH4 + H· → H2 + SiH3
23 records matched SiH4 → H2 + SiH2
3 records matched PH3 + H· → H2 + PH2
1 record matched AsH3 + H· → H2 + AsH2·
1 record matched AlH3 → H2 + AlH
1 record matched H2Se + H· → H2 + SeH
1 record matched H2Se → H2 + Se
24 records matched H2S + H· → H2 + SH
2 records matched H2S → H2 + S
7 records matched GeH4 + H· → H2 + GeH3
6 records matched GeH4 → H2 + :GeH2
1 record matched H2O + H2Si=O → H2 + HSi(O)OH
1 record matched H2O + SiH2 → H2 + HSiOH
1 record matched H2O + SiH2 → H2 + H2Si=O
2 records matched H2O + BF → H2 + OBF
4 records matched H2O + H· → H2 + ·OH
1 record matched H2O2 + SiH3 → H2 + ·OH + H2Si=O
4 records matched H2O2 + H· → H2 + HO2
11 records matched NH3 + H· → H2 + NH2
2 records matched NH3 → H2 + NH
2 records matched HF + H· → H2 + ·F
13 records matched HCl + H· → H2 + Cl
1 record matched 1H-Indene, 2,3,4,7-tetrahydro- → 2,3-Dihydroindene + H2
1 record matched CH2=CHSiH3 → H2 + CH2=CHSiH
1 record matched CD3NH2 + H· → H2 + CD3NH·
1 record matched SiH2Cl2 → H2 + SiCl2
1 record matched ·CH + H· → H2 + C
7 records matched HO2 + H· → H2 + O2
1 record matched HO2 + H· → O2(1DELTA) + H2
1 record matched HO2 + HO2 → H2 + O2 + O2
3 records matched HO2 + HO2 → Other Products + H2
2 records matched CH3CO + H· → H2C=C=O + H2
1 record matched CH3OOH + H· → H2 + CH2OOH
1 record matched CH3OOH + H· → H2 + CH3O2·
1 record matched CH2C≡CH → H2 + CCCH
2 records matched C2H5SiH3 + H· → Other Products + H2
2 records matched C2H5SiH3 → H2 + C2H5SiH
1 record matched C2H3 + CH2=CHCH=CH· → Benzene + H2
5 records matched C2H3 + H· → C2H2 + H2
1 record matched Cyclohexane-1,1,2,2,3,3-d6 + H· → Other Products + H2
10 records matched HCO + H· → CO + H2
2 records matched HCO + HCO → CO + CO + H2
1 record matched (·)CH2OH + H· → CH2O + H2
2 records matched CH3CHOH + H· → CH3CHO + H2
1 record matched C2F5CF2H + H· → H2 + n-C3F7
1 record matched ·CH3 + N → H2 + HNC
2 records matched ·CH3 + N → HCN + H2
5 records matched ·CH3 + O· → CO + H2 + H·
2 records matched ·CH3 + OD → H2 + CHDO
1 record matched ·CH3 + Ar → H2 + ·CH + Ar
1 record matched ·CH3 + Si → SiCH + H2
3 records matched ·CH3 + ·OH → H2 + HOCH
3 records matched ·CH3 + ·OH → CH2O + H2
5 records matched ·CH3 + ·CH3 → C2H4 + H2
5 records matched ·CH3 → H2 + ·CH
3 records matched CH3O· + H· → CH2O + H2
1 record matched n-C3H7 + H· → CH3CH=CH2 + H2
1 record matched ·C2H + H· → H2 + C2
1 record matched ·C2H5 + H· → C2H4 + H2
1 record matched (E)-CH2=CHCH=CHCH3 → H2 + CH2=C=CHCH=CH2
1 record matched Furan, 2,5-dihydro-2-methyl- → 2-Methylfuran + H2
1 record matched 2,5-Dihydrofuran → Furan + H2
1 record matched (E)-CHF=CHF + H· → H2 + Ethenyl, 1,2-difluoro-, (E)-
1 record matched (Z)-CHF=CHF + H· → H2 + Ethenyl, 1,2-difluoro-, (Z)-
1 record matched tert-C4H9 + H· → iso-C4H8 + H2
4 records matched Si2H6 + H· → H2 + Si2H5
5 records matched Si2H6 → H2 + H3SiSiH
1 record matched (Z)-CH2=CHCH=CHCH3 → H2 + CH2=C=CHCH=CH2
2 records matched CH3GeH3 + H· → Other Products + H2
1 record matched CH3GeH3 → H2 + CH3GeH
4 records matched (CH3)2GeH2: + H· → Other Products + H2
3 records matched (CH3)3GeH + H· → Other Products + H2
1 record matched H2 + H2Fe(CO)3 → H4Fe(CO)3
1 record matched H2 + Rhodium carbonyl (5-2,4-cyclopentadien-1-yl)- → Adduct
1 record matched H2 + Fe(CO)3(C2H4) → H2Fe(CO)3(CH2=CH2)
1 record matched H2 + CH3CH=CCH3 → (Z)-2-C4H8 + H·
1 record matched H2 + :SiD2 → Products
1 record matched H2 + CCCN → HCCCN + H·
4 records matched H2 + ·CH2 → ·CH3 + H·
1 record matched H2 + Cr(CO)4 → Cr(CO)4H2
1 record matched H2 + Fe(CO)3 → H2Fe(CO)3
1 record matched H2 + HCCO → Products
1 record matched H2 + CD≡C· → HC≡CD + H·
1 record matched H2 + CBrF2 → CHBrF2 + H·
1 record matched H2 + Cr(CO)5 → Cr(CO)5H2
1 record matched H2 + Na2 → Products
16 records matched H2 + Cl → HCl + H·
1 record matched H2 + Cl → Products
3 records matched H2 + NCO → HN=C=O + H·
1 record matched H2 + NCO → Products
1 record matched H2 + (CH3)3SiCH2 → (CH3)4Si + H·
3 records matched H2 + N → NH2
2 records matched H2 + N → H· + NH
53 records matched H2 + O· → ·OH + H·
1 record matched H2 + O· → Products
14 records matched H2 + D → H· + HD
1 record matched H2 + H2C=N → Products
1 record matched H2 + Fe(CO)4 → Fe(CO)4H2
1 record matched H2 + CH2C(CH3)=CH2 → iso-C4H8 + H·
1 record matched H2 + ClO → HOCl + H·
2 records matched H2 + ClO → ·OH + HCl
32 records matched H2 + ·F → HF + H·
1 record matched H2 + AlO → Products
1 record matched H2 + I + I → HI + HI
5 records matched H2 + I → HI + H·
1 record matched H2 + HNO → H2O + NH
1 record matched H2 + AlH → Products
2 records matched H2 + SiF2 → Products
1 record matched H2 + SiHCl → SiH3Cl
7 records matched H2 + SiH2 → SiH4
1 record matched H2 + CD → Products
1 record matched H2 + SiH → SiH3
2 records matched H2 + NH → H· + NH2
1 record matched H2 + NH → Products
7 records matched H2 + NH2 → NH3 + H·
2 records matched H2 + BH → BH3
2 records matched H2 + OD → H· + HDO
1 record matched H2 + BO → H· + HBO
1 record matched H2 + NaO → NaOH + H·
1 record matched H2 + H· → H2 + H·
1 record matched H2 + Au2 → Au2H2
1 record matched H2 + Ag2 → Products
1 record matched H2 + C3 → Products
2 records matched H2 + C2O → Products
1 record matched H2 + C2 → ·C2H + H·
2 records matched H2 + C2 → Products
2 records matched H2 + OF → Products
1 record matched H2 + ·CHD2 → CH2D2 + H·
2 records matched H2 + NO2 → HNO2 + H·
2 records matched H2 + NO → H· + HNO
1 record matched H2 + Br· + Br· → HBr + HBr
8 records matched H2 + Br· → HBr + H·
1 record matched H2 + Br· → Products
6 records matched H2 + O2 → ·OH + ·OH
2 records matched H2 + O2 → HO2 + H·
1 record matched H2 + F2 → HF + H· + ·F
1 record matched H2 + D2 → HD + HD
2 records matched H2 + Br2 → HBr + HBr
1 record matched H2 + P → Products
1 record matched H2 + H2O2 → H2 + ·OH + ·OH
2 records matched H2 + S → H· + SH
1 record matched H2 + DCl → HCl + HD
4 records matched H2 + I2 → HI + HI
1 record matched H2 + Cr → Products
3 records matched H2 + C → ·CH2
1 record matched H2 + C → ·CH + H·
2 records matched H2 + iso-C4H9 → iso-C4H10 + H·
1 record matched H2 + CBr → Products
1 record matched H2 + ·CCl → Products
1 record matched H2 + CF → Products
1 record matched H2 + NF2 → HF + HNF
1 record matched H2 + NF2 → Products
49 records matched H2 + ·OH → H2O + H·
4 records matched H2 + ·CH → H· + ·CH2
3 records matched H2 + ·CH → ·CH3
9 records matched H2 + ·CH → Products
4 records matched H2 + ·CCl3 → CHCl3 + H·
1 record matched H2 + ·CHF2 → CH2F2 + H·
4 records matched H2 + C2H3 → C2H4 + H·
1 record matched H2 + C2H3 → Products
1 record matched H2 + ·HCC≡N → Products
2 records matched H2 + Phenyl → Benzene + H·
2 records matched H2 + sec-C4H9 → n-C4H10 + H·
7 records matched H2 + ·CF3 → CHF3 + H·
16 records matched H2 + ·CH3 → CH4 + H·
2 records matched H2 + ·CF2 → CH2F2
1 record matched H2 + ·CF2 → Products
1 record matched H2 + Benzyl → Toluene + H·
1 record matched H2 + n-C3H7 → C3H8 + H·
12 records matched H2 + ·C2H → C2H2 + H·
2 records matched H2 + ·C2H → Products
1 record matched H2 + CD3 → CHD3 + H·
1 record matched H2 + ·CHCl → CH3Cl
9 records matched H2 + ·C2H5 → C2H6 + H·
1 record matched H2 + iso-C3H7 → C3H8 + H·
1 record matched H2 + FeO → Products
5 records matched H2 → H· + H·
1 record matched SrO + H2 → SrOH + H·
1 record matched CaO + H2 → CaOH + H·
1 record matched BaO + H2 → BaOH + H·
2 records matched (CH3)2SiH2 + H· → H2 + (CH3)2SiH
5 records matched (CH3)2SiH2 + H· → Other Products + H2
1 record matched (CH3)2SiH2 → H2 + (CH3)2Si
2 records matched (CH3)3SiH + H· → H2 + (CH3)3Si·
4 records matched (CH3)3SiH + H· → Other Products + H2
2 records matched CH3SiH3 + H· → H2 + CH3SiH2
5 records matched CH3SiH3 + H· → Other Products + H2
2 records matched CH3SiH3 → H2 + (CH3)SiH
2 records matched CH3SiH3 → Other Products + H2
1 record matched (Z)-Cyclooctene + H· → Other Products + H2
1 record matched (CH3)3SiSiH(CH3)2 + H· → H2 + (CH3)3SiSi(·)(CH3)2
2 records matched (CH3)3SiSiH(CH3)2 + H· → Other Products + H2
1 record matched Phenylsilane + H· → Other Products + H2
1 record matched Phenylsilane → H2 + Silylene, phenyl-
1 record matched C6H5-CH=CHCH3 + H· → H2 + 3-Phenyl-2-propenyl
2 records matched (C2H5)4Si + H· → Other Products + H2
1 record matched CO + H2 + NO → Products
1 record matched (Z)-Cycloheptene + H· → Other Products + H2
3 records matched 1,4-Cyclohexadiene → Benzene + H2
1 record matched (E)-2-C4H8 + H· → H2 + CH2CH=CHCH3
3 records matched (C2H5)3SiH + H· → Other Products + H2
2 records matched (CH3)3CC(CH3)3 + H· → H2 + (CH3)3CC(CH3)2CH2
1 record matched 1,3-Cyclohexadiene + H· → H2 + Cyclohexadienyl
2 records matched 1,3-Cyclohexadiene → Benzene + H2
1 record matched CH2=C=CHCH3 + H· → Other Products + H2
3 records matched (Z)-2-C4H8 + H· → H2 + CH2CH=CHCH3
3 records matched (Z)-2-C4H8 → 1,3-Butadiene + H2
2 records matched (C2H5)2SiH2 + H· → Other Products + H2
1 record matched CH3NH-NHCH3 → H2 + (E)-CH3N=NCH3
1 record matched Benzofuran, 2,3-dihydro → Benzofuran + H2
4 records matched neo-C5H12 + H· → H2 + (CH3)3CCH2
1 record matched CF3CHFCF3 + H· → H2 + (CF3)2CF
1 record matched (CH3CO)2 + H· → H2C=C=O + H2 + CH3CO
1 record matched C2HF3 + H· → H2 + CF2=CF
1 record matched COF2 + H2 → Products
8 records matched N2H4 + H· → H2 + NH2NH
3 records matched Cyclopentane + H· → H2 + Cyclopentyl
1 record matched n-C7H16 + H· → Other Products + H2
1 record matched Cyclopentene + H· → Other Products + H2
6 records matched Cyclopentene → Cyclopentadiene + H2
1 record matched n-C10H22 + H· → Other Products + H2
2 records matched C2H5CHO + H· → H2 + CH3CH2CO
1 record matched iso-C4H8 + H· → H2 + CH2=CHCHCH3
1 record matched iso-C4H8 + H· → H2 + CH2C(CH3)=CH2
9 records matched (CH3)2O + H· → H2 + CH3OCH2
6 records matched CH3CH=CH2 + H· → H2 + ·CH2CH=CH2
1 record matched CH3CH=CH2 + Cl2 → 1-Propene, 3,3-dichloro- + H2
1 record matched CH3CH=CH2 + Cl2 → CH2ClCH=CHCl + H2
1 record matched CH3CH=CH2 + Y → H2 + Y(C3H4)
1 record matched CH3CH=CH2 + Y → Y(C3H2) + H2 + H2
1 record matched CH3CH=CH2 → CH2=C=CH2 + H2
2 records matched n-C8H18 + H· → Other Products + H2
1 record matched (n-C3H7)2O + ·OH → Other Products + H2
1 record matched Cyclohexene + H· → Other Products + H2
1 record matched Cyclohexene → 1,3-Cyclohexadiene + H2
4 records matched Cyclohexane + H· → H2 + Cyclohexyl
1 record matched n-C6H14 + H· → Other Products + H2
2 records matched n-C4H9SH + H· → H2 + n-C4H9S
2 records matched 1-C5H10 + H· → Other Products + H2
1 record matched n-C5H12 + H· → H2 + (CH3CH2)2CH
1 record matched n-C5H12 + H· → H2 + 1-C5H11
1 record matched n-C5H12 + H· → H2 + CH3CH2CH2CHCH3
1 record matched n-C5H12 + H· → Other Products + H2
1 record matched 2-Methylpyridine + H· → H2 + Methyl, 2-pyridinyl-
2 records matched Phenol + H· → H2 + C6H5O
1 record matched Chlorobenzene + H2 → Products
5 records matched Toluene + H· → H2 + Benzyl
1 record matched Cyclohexane, methyl- + H· → Other Products + H2
1 record matched 1,3,5-Trimethylbenzene + H· → H2 + Methyl,(3,5-dimethylphenyl)-
1 record matched (CH3)2CH(CH2)2CH3 + H· → Other Products + H2
2 records matched (CHO)2 + H· → CO + H2 + HCO
1 record matched CH2CHCN + H· → (·)CH=CH-C#N + H2
1 record matched CH2CHCN → HCCCN + H2
1 record matched C2H5CN + H· → H2 + N=C-CH2CH2
3 records matched C2H5CN → CH2CHCN + H2
1 record matched n-C3H7SH + H· → H2 + CH3CH2CH2
1 record matched CH3CH=CHCH3 + H· → H2 + CH2CH=CHCH3
1 record matched 1,3-Butadiene + H· → H2 + CH2=CHCH=CH·
1 record matched 1-C4H8 + H· → H2 + CH2CH=CHCH3
2 records matched 1-C4H8 + H· → Other Products + H2
2 records matched n-C4H10 + H· → H2 + n-C4H9
3 records matched n-C4H10 + H· → H2 + sec-C4H9
10 records matched n-C4H10 + H· → Other Products + H2
1 record matched 1,4-Dimethylbenzene + H· → H2 + 4-Methylbenzyl
1 record matched Ethylbenzene + H· → H2 + Ethyl, 2-phenyl-
2 records matched Ethylbenzene + H· → H2 + 1-phenylethyl
1 record matched Ethylbenzene → Styrene + H2
1 record matched (C2H5)2CO + H· → H2 + CH3CH2C(O)CH(·)CH3
1 record matched (CH3)2CHCH(CH3)2 + H· → Other Products + H2
1 record matched C2HCl3 + H· → H2 + CCl2=CCl
1 record matched C2H5COCH3 + H· → H2 + CH3C(O)CH(·)CH3
1 record matched iso-C5H12 + H· → H2 + CH2CH(CH3)CH2CH3
1 record matched iso-C5H12 + H· → H2 + (CH3)2CCH2CH3
1 record matched iso-C5H12 + H· → H2 + (CH3)2CHCHCH3
1 record matched iso-C5H12 + H· → H2 + (CH3)2CHCH2CH2
2 records matched iso-C5H12 + H· → Other Products + H2
1 record matched (CH3)3CCH2CH3 + H· → Other Products + H2
1 record matched (CH3)4Si + H· → H2 + (CH3)3SiCH2
1 record matched tert-C4H9SH + H· → H2 + (CH3)3CS·
1 record matched tert-C4H9OH + H· → H2 + (CH3)2C(OH)CH2
1 record matched CF3Br + H2 → Products
1 record matched (CH3)3N + H· → Other Products + H2
2 records matched CHF3 + H· → H2 + ·CF3
1 record matched CH2=CF2 + H· → H2 + CF2=CH·
1 record matched iso-C3H7SH + H· → H2 + (CH3)2CHS
1 record matched iso-C4H10 + H· → H2 + iso-C4H9
4 records matched iso-C4H10 + H· → H2 + tert-C4H9
9 records matched iso-C4H10 + H· → Other Products + H2
1 record matched CHBrCl2 + H· → H2 + BrCCl2
1 record matched Oxirane + H· → H2 + Oxiranyl
1 record matched Cyclopropane + H· → H2 + Cyclopropyl
1 record matched Cyclopropane + H· → H2 + ·CH2CH=CH2
2 records matched HN=C=O + H· → H2 + NCO
1 record matched CH2F2 → H2 + ·CF2
2 records matched C2H5SH + H· → H2 + CH3CH2S
1 record matched CH3CHO + N → HCN + H2 + HCO
1 record matched CH3CHO + H· → H2 + CH3CO
2 records matched CH3CHO + H· → H2 + CH2=CHO·
6 records matched CH3CHO + H· → H2 + CH3CO
2 records matched CH3CHO + H· → CO + H2 + ·CH3
2 records matched CH3CHO → H2C=C=O + H2
1 record matched CH2=CHF + H· → Other Products + H2
7 records matched C3H8 + H· → H2 + n-C3H7
4 records matched C3H8 + H· → H2 + iso-C3H7
21 records matched C3H8 + H· → Other Products + H2
7 records matched CH3SH + H· → H2 + CH3
1 record matched CH3NH2 + H· → Other Products + H2
1 record matched C2H2 + CD≡C· → C4D unspecified structure + H2
3 records matched C2H2 + H· → H2 + ·C2H
1 record matched C2H2 + ·OH → H2 + HCCO
1 record matched C2H2 → H2 + C2
2 records matched C2H4 + O· → H2C=C=O + H2
12 records matched C2H4 + H· → H2 + C2H3
1 record matched C2H4 + Y → H2 + Y(C2H2)
4 records matched C2H4 + H2 → C2H6
1 record matched C2H4 + C2H4 → 1,3-Butadiene + H2
9 records matched C2H4 → C2H2 + H2
22 records matched C2H6 + H· → H2 + ·C2H5
2 records matched C2H6 + C2H4 → 1-C4H8 + H2
5 records matched C2H6 → C2H4 + H2
4 records matched CH4 + N → HCN + H2 + H·
29 records matched CH4 + H· → H2 + ·CH3
1 record matched CH4 + Si → H2 + SiCH2
2 records matched Benzene + H· → H2 + Phenyl
3 records matched Benzene + Benzene → Biphenyl + H2
1 record matched Benzene → C2H2 + 1,3-Butadiyne + H2
1 record matched n-C4H9OH + H· → H2 + HOCH2CH2CH2CH2
1 record matched n-C3H7OH + H· → H2 + HOCH2CH2CH2
5 records matched (CH3)2CO + H· → H2 + CH3C(O)CH2(·)
1 record matched iso-C3H7OH + H· → H2 + (CH3)2C(OH)
1 record matched iso-C3H7OH → (CH3)2CO + H2
6 records matched CH3OH + H· → H2 + (·)CH2OH
1 record matched CH3OH → Other Products + H2
5 records matched HCOOH → CO2 + H2
4 records matched C2H5OH + H· → H2 + CH3CHOH
2 records matched aniline + H· → H2 + Amidogen, phenyl-
1 record matched CH3NHNH2 → H2 + CH3N=NH
1 record matched (C2H5)2O + H· → H2 + 2-C4H9O
19 records matched CN + H2 → HCN + H·
18 records matched CH2O + H· → H2 + HCO
1 record matched CH2O + Ar → CO + H2 + Ar
1 record matched CH2O + H2 → Products
11 records matched CH2O → CO + H2
1 record matched O(1D) + H2O → H2 + O2
19 records matched O(1D) + H2 → ·OH + H·
1 record matched O(1D) + H2 → H2 + O·
1 record matched O(1D) + CH3F → H2 + HFCO
1 record matched O(1D) + C2H6 → CH2=CHOH + H2
1 record matched O(1D) + CH4 → CH2O + H2
4 records matched O2(1DELTA) + H2 → H2 + O2
2 records matched AlH2Cl → H2 + AlCl
1 record matched CF (A 2Sigma+, v=1) + H2 → H2 + CF
1 record matched CF (A 2Sigma+, v=0) + H2 → H2 + CF
1 record matched M + ·CH3 → M + H2 + ·CH
1 record matched N(2S) + H2 → Products
1 record matched O(1D) + H2 → ·OH + H·
1 record matched N2(a prime 1sigma u) + H2 → Products
1 record matched H2(v) + H· → H2 + H·
1 record matched S(1D) + H2 → H· + SH
1 record matched Xe(5d) + H2 → H2 + Xe
1 record matched Zr (4d2_5s2,3F) + CH3CH=CH2 → C3H4Zr + H2
1 record matched Zr (4d2_5s2,3F) + C2H4 → C2H2Zr + H2
1 record matched CF2-trip + H2 → Products
1 record matched CH_2(aA_1) + H2 → Products
1 record matched O2(b1Sigma_g+) + H2 → Products
1 record matched C2(a3PIu) + H2 → Products
1 record matched PtH2 → H2 + Pt
2 records matched SiH2Cl → H2 + SiCl
1 record matched HSi(O)OH → H2 + SiO2
1 record matched HSi(O)OH → cy-SiO2 + H2
1 record matched H3SiSiH → H2 + Si(H2)Si
8 records matched H3SiSiH → H2 + SiSiH2
1 record matched H3P=S → H2 + HP=S
1 record matched Al2H2(CH3)4 → H2 + Al2(CH3)4
1 record matched CH3CH2N(.) → CH3CN + H2 + N2
1 record matched CH3CH=NH → CH3CN + H2
1 record matched SiHCl2SiH2Cl → Other Products + H2
1 record matched H3Si-SiHCl2 → Other Products + H2
1 record matched CH3OCH2 + O· → H2 + CH3OC(·)(O)
1 record matched SiH2=SiH2 → H2 + Si(H2)Si
1 record matched SiH2=SiH2 → H2 + SiSiH2
1 record matched SiH2=SiH2 → H2 + HSi=SiH
1 record matched BH2NH2 → H2 + HBNH
1 record matched NiH2 → H2 + Ni
1 record matched Si2H5Cl → Other Products + H2
3 records matched SiH2 + SiH2 → H2 + HSi=SiH
1 record matched BH3NH3 → H2 + BH2NH2
3 records matched SiH3 + SiH → H2 + HSi=SiH
1 record matched SiH3 → H2 + SiH
1 record matched SiH3I → H2 + SiHI
5 records matched SiH3Cl → H2 + SiHCl
1 record matched SiH3Br → H2 + SiHBr
1 record matched BH3 + BH3NH3 → H2 + BH3 + BH2NH2
1 record matched H· + ·CH2 → H2 + ·CH
1 record matched H· + Beryllium hydroxide → BeO + H2
1 record matched H· + AlOH → H2 + AlO
1 record matched H· + HBO → H2 + BO
1 record matched H· + C2H5CH=C=O → ·CH2CH2CHCO + H2
1 record matched H· + C2H5CH=C=O → CH3CH(·)CHCO + H2
1 record matched H· + GeH2Cl2 → GeHCl2 + H2
1 record matched H· + HSS → H2 + S2
1 record matched H· + AlH2 → H2 + AlH
4 records matched H· + HNO → H2 + NO
2 records matched H· + HOPO → H2 + PO2
3 records matched H· + HD → H2 + D
1 record matched H· + AlH → H2 + Al
1 record matched H· + NHOH → H2 + HNO
1 record matched H· + SH → H2 + S
1 record matched H· + SiHCl → H2 + SiCl
1 record matched H· + SiH2F2 → H2 + HF2Si
6 records matched H· + Ge2H6 → Ge2H5 + H2
2 records matched H· + NH → N(4S) + H2
1 record matched H· + BH → H2 + B
1 record matched H· + GeH3Cl → H2 + GeH2Cl
1 record matched H· + SiH3F → H2 + SiH2F
1 record matched H· + AlHCl2 → H2 + AlCl2
1 record matched H· + SiH3Cl → H2 + SiH2Cl
1 record matched H· + SiHF3 → H2 + SiF3
1 record matched H· + H2S2 → H2 + HSS
4 records matched H· + H· → H2
1 record matched SrOH + H· → SrO + H2
1 record matched BaOH + H· → BaO + H2
1 record matched C6H5CH2C2H + H· → 2-propargylphenyl + H2
6 records matched HBr + H· → H2 + Br·
1 record matched SiHCl3 + H· → H2 + SiCl3
1 record matched SiH4 + Diborane(6) → B2SiH8 + H2
13 records matched SiH4 + H· → H2 + SiH3
10 records matched SiH4 → H2 + SiH2
23 records matched PH3 + H· → H2 + PH2
1 record matched HOCl + H· → H2 + ClO
1 record matched AlH3 + H· → H2 + AlH2
1 record matched AlH3 → H2 + AlH
7 records matched H2S + H· → H2 + SH
1 record matched HNO2 + H· → H2 + NO2
11 records matched GeH4 + H· → H2 + GeH3
2 records matched GeH4 → H2 + :GeH2
1 record matched O2 + ·CH2 → CO2 + H2
1 record matched H2O + O· → H2 + O2
4 records matched H2O + H· → H2 + ·OH
1 record matched H2O + C2 → H2 + c-COC
1 record matched H2O + C2 → H2 + C2O
1 record matched H2O + SiH4 → H2 + SiH3OH
1 record matched N2 + NHOH → H2 + N2 + NO
6 records matched H2O2 + H· → H2 + HO2
1 record matched HNO3 + H· → H2 + NO3
1 record matched NH3 + BH3NH3 → H2 + NH3 + BH2NH2
9 records matched NH3 + H· → H2 + NH2
1 record matched NH3 + SiH4 → H2 + H2N-SiH3
1 record matched HF + H· → H2 + ·F
1 record matched HCl + SiH2 → H2 + SiHCl
1 record matched HCl + SiH → H2 + SiCl
2 records matched HCl + H· → H2 + Cl
1 record matched HCl + SiHCl3 → H2 + SiCl4
1 record matched Sodium hydride + H· → H2 + Na
1 record matched LiH + H· → H2 + Li
1 record matched Si + ·CH2 → SiC + H2
6 records matched Si + SiH4 → H2 + SiSiH2
1 record matched CH3CH=CHCN → H2 + CH3CCCN
1 record matched CH2DOH + H· → H2 + CHDOH
1 record matched CH2DOH + H· → CH2DO + H2
1 record matched SiH2Cl2 + H· → H2 + SiHCl2
1 record matched SiH2Cl2 + NH3 → SiHCl2NH2 + H2
1 record matched SiH2Cl2 + HCl → H2 + SiHCl3
6 records matched SiH2Cl2 → H2 + SiCl2
1 record matched HN=NH + H· → H2 + HN=N
1 record matched ·OH + HOCH → CO2 + H2 + H·
1 record matched ·OH + ·CH2Cl → H2 + HC(O)Cl
2 records matched ·OH + ·OH → H2 + O2
3 records matched ·CH + H· → H2 + C
7 records matched HO2 + H· → H2 + O2
2 records matched HO2 + H· → O2(1DELTA) + H2
1 record matched CH2C≡CH → C3H + H2
1 record matched C2H5SiH3 + H· → H2 + C2H5SiH2(·)
1 record matched C2H5SiH3 + H· → H2 + SiH3CH2CH2(·)
1 record matched C2H5SiH3 + H· → Other Products + H2
1 record matched C2H5SiH3 + H· → SiH3CH(·)CH3 + H2
1 record matched ·CHF2 + H· → H2 + ·CF2
1 record matched C2H3 + H· → C2H2 + H2
1 record matched C2H3 + ·OH → H2C=C=O + H2
1 record matched ·HCC≡N + H· → H2 + CC≡N
3 records matched HCO + NHOH → CO + H2 + HNO
3 records matched HCO + H· → CO + H2
2 records matched HC(O)Cl + H· → H2 + ClCO
1 record matched Benzene, 1,2-propadienyl- + H· → 2-C6H4CHCCH2 + H2
1 record matched ·CH3 + O· → CO + H2 + H·
1 record matched ·CH3 + ·F → H2 + ·CHF
2 records matched ·CH3 + ·OH → CH2O + H2
2 records matched ·CH3 + ·OH → trans-HCOH + H2
2 records matched ·CH3 + ·OH → cis-HCOH + H2
1 record matched CH3O· + H· → CH2O + H2
1 record matched Cyclopentadienyl + ·CH3 → Fulvene + H2
1 record matched ·C2H + H· → H2 + C2
1 record matched ·C2H + HO2 → CO + CO + H2
1 record matched CD3 + O· → CO + H2 + H·
1 record matched ·C2H5 + H· → C2H4 + H2
1 record matched Furan, 2,5-dihydro-2-methyl- → 2-Methylfuran + H2
1 record matched 2,5-Dihydrofuran → Furan + H2
1 record matched Si2H6 + H· → H2 + Si2H5
1 record matched Si2H6 → H2 + H3SiSiH
2 records matched Si2H6 → H2 + SiH2=SiH2
1 record matched CH3OD + H· → H2 + CH2OD
1 record matched CH3GeH3 + H· → H2 + GeH3CH2*
2 records matched CH3GeH3 + H· → H2 + *GeH2CH3
2 records matched (CH3)2GeH2: + H· → H2 + *GeH(CH3)2
1 record matched (CH3)2GeH2: + H· → GeH2(CH3)CH2* + H2
1 record matched (CH3)3GeH + H· → H2 + GeH(CH3)2CH2*
1 record matched (CH3)3GeH + H· → H2 + (CH3)3Ge
2 records matched H2 + CH2=CHCH=CH· → 1,3-Butadiene + H·
1 record matched H2 + H3SiSiH → Si2H6
1 record matched H2 + CH2=Al(CH3) → AlH(CH3)2
4 records matched H2 + HSi=SiH → SiH2=SiH2
1 record matched H2 + SiHI → HI + SiH2
12 records matched H2 + Cl → HCl + H·
2 records matched H2 + NCO → HN=C=O + H·
9 records matched H2 + O· → ·OH + H·
9 records matched H2 + D → H· + HD
1 record matched H2 + AlCl2 → H· + AlHCl2
1 record matched H2 + CH3CHCl → C2H5Cl + H·
1 record matched H2 + ND2 → Other Products + H·
11 records matched H2 + ·F → HF + H·
1 record matched H2 + AlH → AlH3
1 record matched H2 + AlH → H2 + AlH
2 records matched H2 + SiCl → SiH2Cl
1 record matched H2 + SiCl → H· + SiHCl
1 record matched H2 + SiCl → HCl + SiH
1 record matched H2 + SiHCl → SiH3Cl
3 records matched H2 + SiH2 → SiH4
1 record matched H2 + SiH → SiH3
1 record matched H2 + NH → H· + NH2
5 records matched H2 + NH2 → NH3 + H·
1 record matched H2 + O=BB=O → Products
7 records matched H2 + GeH3 → GeH4 + H·
4 records matched H2 + SiH3 → SiH4 + H·
3 records matched H2 + SiCl2 → SiH2Cl2
3 records matched H2 + BO → H· + HBO
8 records matched H2 + H· → H2 + H·
1 record matched H2 + H· → Products
2 records matched H2 + C2 → ·C2H + H·
1 record matched H2 + NO2 → HNO2 + H·
2 records matched H2 + NO2 → H2O + NO
1 record matched H2 + NO → Products
2 records matched H2 + Br· → HBr + H·
1 record matched H2 + N2O → N2 + H2O
1 record matched H2 + O2 → H2O + O·
2 records matched H2 + O2 → ·OH + ·OH
5 records matched H2 + O2 → HO2 + H·
2 records matched H2 + Br2 → HBr + HBr
1 record matched H2 + S → H· + SH
1 record matched H2 + SO2 → H· + HSO2
1 record matched H2 + Cs → H· + CsH
1 record matched H2 + C → ·CH2
1 record matched H2 + C → ·CH + H·
1 record matched H2 + ·CH2Cl → CH3Cl + H·
1 record matched H2 + ·CH2F → CH3F + H·
1 record matched H2 + CHCl2 → CH2Cl2 + H·
17 records matched H2 + ·OH → H2O + H·
1 record matched H2 + ·CH → H· + ·CH2
3 records matched H2 + HO2 → H2O2 + H·
1 record matched H2 + ·CCl3 → CHCl3 + H·
1 record matched H2 + ·CHF2 → CH2F2 + H·
17 records matched H2 + C2H3 → C2H4 + H·
1 record matched H2 + (·)CH2OH → CH3OH + H·
1 record matched H2 + Phenyl → Benzene + H·
3 records matched H2 + ·CF3 → CHF3 + H·
13 records matched H2 + ·CH3 → CH4 + H·
1 record matched H2 + Benzyl → Toluene + H·
1 record matched H2 + CH2=C → C2H3 + H·
1 record matched H2 + CH3O· → CH3OH + H·
1 record matched H2 + n-C3H7 → C3H8 + H·
17 records matched H2 + ·C2H → C2H2 + H·
2 records matched H2 + CD3 → CHD3 + H·
5 records matched H2 + ·C2H5 → C2H6 + H·
1 record matched H2 + ·CH2CH=CH2 → CH3CH=CH2 + H·
1 record matched H2 + tert-C4H9 → iso-C4H10 + H·
1 record matched H2 + FeO + N2 → N2H2FeO
1 record matched H2 → H· + H·
1 record matched NiO + H2 → Ni + H2O
1 record matched NaOH + H· → H2 + NaO
1 record matched BeO + H2 + N2 → N2H2BeO
1 record matched Furan, 2,3-dihydro- → Furan + H2
1 record matched CH3SiH3 → H2 + (CH3)SiH
1 record matched (CH3)4Ge + H· → H2 + (CH3)3GeCH2
1 record matched AlH(CH3)2 + AlH(CH3)2 → H2 + Al2(CH3)4
1 record matched AlH(CH3)2 → H2 + CH2=Al(CH3)
1 record matched CH2CHCCH + H· → H2 + CH2C(·)CCCH
1 record matched CH2CHCCH → 1,3-Butadiyne + H2
2 records matched CO + H2O → CO2 + H2
1 record matched CO + H2 → Products
1 record matched n-C3H7COOCH3 + H· → ·CH2OC(O)CH2CH2CH3 + H2
1 record matched n-C3H7COOCH3 + H· → CH3OC(O)CH·CH2CH3 + H2
1 record matched n-C3H7COOCH3 + H· → CH3OC(O)CH2CH·CH3 + H2
1 record matched n-C3H7COOCH3 + H· → CH3OC(O)CH2CH2CH2· + H2
1 record matched (CH3)4Sn + H· → H2 + (CH3)3SnCH2·
2 records matched CH3F + H· → H2 + ·CH2F
1 record matched CH3F → H2 + ·CHF
1 record matched 3,5-Cyclohexadiene-1,2-dione + H2 → 1,2-Dihydroxybenzene
1 record matched (C2H5)2SiH2 + H· → H2 + (C2H5)2SiH(·)
1 record matched (C2H5)2SiH2 + H· → SiH2(CH2CH3)CH2CH2(·) + H2
1 record matched (C2H5)2SiH2 + H· → SiH2(CH2CH3)CH(·)CH3 + H2
1 record matched Oxetane → Oxacyclobut-2-ene + H2
1 record matched Fulvene + H2 → 2-Methyl-1,3-cyclopentadiene
1 record matched Fulvene + H2 → 1-Methyl-1,3-cyclopentadiene
1 record matched Fulvene + H2 → 1,3-Cyclopentadiene, 5-methyl-
1 record matched neo-C5H12 + H· → H2 + (CH3)3CCH2
1 record matched H2C=C=O + H· → H2 + HCCO
1 record matched CF3CHFCF3 + H· → H2 + (CF3)2CF
1 record matched HO-C≡N + H· → H2 + NCO
1 record matched C2HF3 + H· → H2 + CF2=CF
1 record matched Acenaphthylene + H· → C12H7 + H2
1 record matched H2CO2 → CO2 + H2
1 record matched Dibenzofuran + H2 → [1,1'-Biphenyl]-2-ol
1 record matched Dibenzofuran + H2 → C12H10O
1 record matched CH2=C(CH3)CN → H2 + CH3CCCN
1 record matched CO2 + H2 → CO + H2O
1 record matched 1,2-Dihydroxybenzene → 3,5-Cyclohexadiene-1,2-dione + H2
1 record matched 1,2-Dihydroxybenzene → cyc-CH=CH-CH=C(OH)-C(=C=O) + H2
1 record matched iso-C4H8 + H· → H2 + CH2C(CH3)=CH2
1 record matched (CH3)2O + H· → H2 + CH3OCH2
1 record matched CH3CH=CH2 + H· → H2 + CH2=C(·)CH3
1 record matched CH3CH=CH2 + H· → H2 + CH3CH=CH
1 record matched CH3CH=CH2 + H· → H2 + ·CH2CH=CH2
1 record matched CH3CH=CH2 → CH2=C=CH2 + H2
1 record matched Chlorobenzene + H· → Other Products + H2
2 records matched Chlorobenzene + H2 → Benzene + HCl
2 records matched Toluene + H· → H2 + Benzyl
3 records matched Toluene + H· → C6H4CH3 + H2
1 record matched HC(O)OCH3 + H· → H2 + CH3OC(·)(O)
1 record matched HC(O)OCH3 + H· → H2 + HC(O)OCH2(·)
1 record matched 1,3-Butadiene + H· → H2 + CH2=CHCH=CH·
1 record matched n-C4H10 + H· → H2 + n-C4H9
1 record matched n-C4H10 + H· → H2 + sec-C4H9
1 record matched n-C4H10 + H· → Other Products + H2
1 record matched Styrene + H· → H2 + 2-(·)C6H4C2H3
1 record matched Styrene + H· → H2 + Ethenyl,2-phenyl-
2 records matched Ethylbenzene + H· → H2 + Ethyl, 2-phenyl-
2 records matched Ethylbenzene + H· → H2 + 1-phenylethyl
3 records matched Ethylbenzene + H· → C6H4CH2CH3 + H2
1 record matched CH2=CHCOOCH3 + H· → ·CH2OC(O)CH=CH2 + H2
1 record matched CH2=CHCOOCH3 + H· → CH3OC(O)C(·)=CH2 + H2
1 record matched CH2=CHCOOCH3 + H· → CH3OC(O)CH=CH· + H2
1 record matched 2-Chlorophenol + H· → C6H4ClO· + H2
1 record matched Benzene, 1,2-dichloro- + H2 → Chlorobenzene + HCl
2 records matched Indene + H· → H2 + 1H-inden-1-yl
1 record matched (CH3)2SiCl2 → Other Products + H2
5 records matched CHF3 + H· → H2 + ·CF3
1 record matched CHF2Cl + H· → H2 + ·CClF2
1 record matched CHFCl2 + H· → H2 + ·CCl2F
1 record matched iso-C3H7SH + H· → H2 + (CH3)2CHS
2 records matched iso-C4H10 + H· → Other Products + H2
1 record matched Oxirane + H· → H2 + Oxiranyl
1 record matched Oxirane → H2C=C=O + H2
1 record matched (CH3)2S + H· → H2 + CH3SCH2
1 record matched HN=C=O + H· → H2 + NCO
1 record matched HCONH2 + H· → H2 + C(O)NH2
2 records matched CH2F2 + H· → H2 + ·CHF2
2 records matched CH2Cl2 + H· → H2 + CHCl2
1 record matched C2H5SH + H· → H2 + CH3CH2S
1 record matched CH3CHO + H· → H2 + CH3CO
1 record matched CH3CHO + H· → H2 + CH2=CHO·
1 record matched CH3CHO + H· → H2 + CH3CO
1 record matched CH2=CHCl + H· → H2 + CHCl=CH
3 records matched C2H5Cl + H· → H2 + CH3CHCl
2 records matched C2H5Cl + H· → H2 + CH2CH2Cl
1 record matched C2H5Cl + H· → Other Products + H2
1 record matched CH3CCH + C2 → H2 + HCCCCCH
1 record matched CH3CCH + C2 → HCC-CH=C=C: + H2
1 record matched C3H8 + H· → H2 + n-C3H7
1 record matched C3H8 + H· → H2 + iso-C3H7
2 records matched C3H8 + H· → Other Products + H2
1 record matched C3H8 → H2 + (CH3)2C
1 record matched C3H8 → H2 + ·CH2CH2CH2·
1 record matched C3H8 → H2 + CH3CH2CH
2 records matched HCN + H· → CN + H2
1 record matched CH3NH2 + H· → H2 + CH3NH
1 record matched CH3NH2 + H· → H2 + CH2NH2
1 record matched CH3NH2 + H· → Products + H2
1 record matched CH3I + H· → H2 + ·CH2I
2 records matched CH3Cl + H· → H2 + ·CH2Cl
1 record matched C2H2 + CD≡C· → DCCCC + H2
5 records matched C2H2 + H· → H2 + ·C2H
1 record matched C2H2 + C → H2 + C3
1 record matched C2H2 + H2 → C2H3 + H·
1 record matched C2H4 + O· → H2C=C=O + H2
10 records matched C2H4 + H· → H2 + C2H3
2 records matched C2H4 → C2H2 + H2
8 records matched C2H6 + H· → H2 + ·C2H5
1 record matched C2H6 → C2H4 + H2
39 records matched CH4 + H· → H2 + ·CH3
1 record matched CH4 + C → H2 + CH2=C
1 record matched CH4 + C → HCCH(B2) + H2
1 record matched CH4 + ·CH3 → H2 + ·C2H5
3 records matched Benzene + H· → H2 + Phenyl
1 record matched Benzene + H2 + FC(O)OH → 1,4-Cyclohexadiene + FC(O)OH
1 record matched Benzene + H2 + FC(O)OH → 1,3-Cyclohexadiene + FC(O)OH
1 record matched Benzene + H2 + HBr → 1,4-Cyclohexadiene + HBr
1 record matched Benzene + H2 + HBr → 1,3-Cyclohexadiene + HBr
1 record matched Benzene + H2 + H2S → 1,4-Cyclohexadiene + H2S
1 record matched Benzene + H2 + H2S → 1,3-Cyclohexadiene + H2S
1 record matched Benzene + H2 + H2O → 1,4-Cyclohexadiene + H2O
1 record matched Benzene + H2 + H2O → 1,3-Cyclohexadiene + H2O
1 record matched Benzene + H2 + NH3 → 1,4-Cyclohexadiene + NH3
1 record matched Benzene + H2 + HF → 1,4-Cyclohexadiene + HF
1 record matched Benzene + H2 + HF → 1,3-Cyclohexadiene + HF
1 record matched Benzene + H2 + HCl → 1,4-Cyclohexadiene + HCl
1 record matched Benzene + H2 + HCl → 1,3-Cyclohexadiene + HCl
1 record matched Benzene + H2 + CF3OH → 1,3-Cyclohexadiene + CF3OH
1 record matched Benzene + H2 + H2 → 1,3-Cyclohexadiene + H2
2 records matched Benzene + H2 → 1,4-Cyclohexadiene
1 record matched Benzene + H2 → 1,3-Cyclohexadiene
1 record matched Benzene + CH3SH + H2 → CH3SH + 1,4-Cyclohexadiene
1 record matched Benzene + CH3SH + H2 → CH3SH + 1,3-Cyclohexadiene
2 records matched CHCl3 + H· → H2 + ·CCl3
1 record matched (CH3)2CO + H· → H2 + CH3C(O)CH2(·)
4 records matched iso-C3H7OH → (CH3)2CO + H2
3 records matched CH3OH + H· → H2 + (·)CH2OH
2 records matched CH3OH + H· → H2 + CH3
1 record matched CH3OH + Benzene + H2 → CH3OH + 1,4-Cyclohexadiene
1 record matched CH3OH + Benzene + H2 → CH3OH + 1,3-Cyclohexadiene
1 record matched CH3OH → H2 + HOCH
2 records matched CH3OH → trans-HCOH + H2
2 records matched CH3OH → cis-HCOH + H2
1 record matched CH3C(O)OH + Benzene + H2 → CH3C(O)OH + 1,4-Cyclohexadiene
1 record matched CH3C(O)OH + Benzene + H2 → CH3C(O)OH + 1,3-Cyclohexadiene
1 record matched HCOOH + Benzene + H2 → HCOOH + 1,4-Cyclohexadiene
1 record matched HCOOH + Benzene + H2 → HCOOH + 1,3-Cyclohexadiene
2 records matched HCOOH → CO2 + H2
1 record matched C2H5OH + H· → H2 + HOCH2CH2
1 record matched C2H5OH + H· → H2 + CH3CHOH
2 records matched C2H5OH + H· → H2 + CH3CH2
1 record matched C2H5OH + H· → Other Products + H2
9 records matched CN + H2 → HCN + H·
5 records matched CH2O + H· → H2 + HCO
1 record matched CH2O + Y → H2 + Y(CO)
1 record matched CH2O + ·OH → H2 + COOH
1 record matched CH2O + H2 → CH3OH
1 record matched CH2O → H2 + O2
3 records matched CH2O → CO + H2
1 record matched O(1D) + NH3 → H2 + :NOH
2 records matched O(1D) + H2 → ·OH + H·
1 record matched O2(1DELTA) + H2S → H2 + SO2
1 record matched O2(1DELTA) + H2 → HO2 + H·
1 record matched SiHCl2NH2 + H2 → SiH2Cl2 + NH3
1 record matched CH2BrO → H2 + BrCO
1 record matched AlHCl + H· → H2 + AlCl
1 record matched AlH2Cl + H· → AlHCl + H2
11 records matched H2SiLiF + H2 → LiF + SiH4
1 record matched -10202 + ·OH → CO + H2 + NO
1 record matched N(4S) + H2 → H· + NH
1 record matched O(1D) + C2H6 → Products + H2
1 record matched O(1D) + CH4 → H2 + HOCH
1 record matched O(1D) + CH4 → CH2O + H2
1 record matched H2N-SiH → H2 + SiNH
1 record matched H3N-SiH2 complex → H2 + SiH2NH
1 record matched H3N-SiH2 complex → H2N-SiH + H2
1 record matched CH2(X3B_1) + Ni → NiC + H2
1 record matched C(1D) + H2 → CH(X2 Pi) + H·
1 record matched Ga2(a1Sigma_g+) + H2 → Products
1 record matched Ga2(a1Sigma_g+) + H2 → Ga(mu-H)2Ga
1 record matched Ga2(X3Pi_u) + H2 → Products
1 record matched Ga2(X3Pi_u) + H2 → Ga(mu-H)2Ga
1 record matched S(1D) + H2 → H· + SH
1 record matched S(1D) + H2 → Products
1 record matched CH3NBH → CH2NB + H2
1 record matched CH2NB → CNB + H2
1 record matched BOH + H· → H2 + BO
1 record matched BS + H2 → Products
1 record matched Ni(3D) + CO2 + H2 → Ni(3D) + CO + H2O
1 record matched W(1S) + H2O → WO(1sigma+) + H2
1 record matched W(3P) + H2O → WO(3sigma+) + H2
1 record matched W(5D) + H2O → WO(3sigma+) + H2
1 record matched W(7S) + H2O → WO(3sigma+) + H2
1 record matched ·CH2CH2CH2CH2CH2· → CH2=CHCH2CH=CH2 + H2
1 record matched trans-HCOH + H2 → CH3OH
1 record matched cis-HCOH + H2 → CH3OH
1 record matched 2-propargylphenyl + H2 → C6H5CH2C2H + H·
1 record matched 2-C6H4CHCCH2 + H2 → Benzene, 1,2-propadienyl- + H·
1 record matched Ga(CH3)(NH2)2 + H· → Ga(CH3)(CH2)NH· + H2
1 record matched Ga(NH2)3 + H· → Ga(NH2)2NH· + H2
1 record matched GaNH2 + H· → GaNH· + H2
2 records matched (CH3)(NH2)GaNHGa(CH3)NH2 + H· → (CH3)(NH2)GaNHGa(CH3)NH· + H2
1 record matched cyc-CH=CH-CH=C(OH)-C(=C=O) + H2 → 1,2-Dihydroxybenzene
1 record matched GeHCl3 + H· → H2 + Germanium chloride
1 record matched GaMe2NH2 + H· → Ga(CH3)2NH· + H2
1 record matched CH2CH2CH2CH2 → 1,3-Butadiene + H2
1 record matched ·CH2OC(O)CH2CH2CH3 + H2 → n-C3H7COOCH3 + H·
1 record matched ·CH2CH2CHCO + H2 → H· + C2H5CH=C=O
1 record matched CH3CH(·)CHCO + H2 → H· + C2H5CH=C=O
1 record matched ·CH2OC(O)CH=CH2 + H2 → CH2=CHCOOCH3 + H·
1 record matched CH3OC(O)C(·)=CH2 + H2 → CH2=CHCOOCH3 + H·
1 record matched CH3OC(O)CH=CH· + H2 → CH2=CHCOOCH3 + H·
1 record matched CH3OC(O)CH·CH2CH3 + H2 → n-C3H7COOCH3 + H·
1 record matched CH3OC(O)CH2CH·CH3 + H2 → n-C3H7COOCH3 + H·
1 record matched CH3OC(O)CH2CH2CH2· + H2 → n-C3H7COOCH3 + H·
1 record matched H12B4N4 + H2 → H14B4N4
1 record matched H10B4N4 + H2 → H12B4N4
1 record matched H8B4N4 + H2 → H10B4N4
1 record matched cis-HCSSH → CS2 + H2
1 record matched cis-HC(S·)OH → COS + H2
1 record matched cis-HC(O·)SH → COS + H2
1 record matched CF2-trip + H2 → ·CHF2 + H·
1 record matched methylcyclopentadiene (mixture of isomers) → Fulvene + H2
1 record matched N2H2BeO + H2 → N2H4BeO
1 record matched N2H4BeO + H2 → BeO + NH3 + NH3
1 record matched BH5 → H2 + BH3
1 record matched H2C=C=C=C=C: → H2 + C5
1 record matched PdH2 → H2 + Pd
1 record matched Pd2H2 → H2 + Pd2
1 record matched SiH2(HCl) Adduct → H2 + SiHCl
1 record matched H· + H2C=N → HCN + H2
1 record matched H· + HD → H2 + D
1 record matched ·CH3 + HN=N → CH2N2 + H2
1 record matched ·CH3 + O· → CO + H2 + H·
1 record matched CD3 + O· → CO + H2 + H·
1 record matched CH2=NH + H· → H2 + H2C=N
4 records matched H2 + O· → ·OH + H·
2 records matched H2 + D → H· + HD
1 record matched H2 + H· → H2 + H·

Search returned 2514 records.