Kinetics Database Logo

Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences


Rate Our Products and Services


Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty


Administrative Links

NIST home page

MML home page

Chemical and Biochemical Reference Data Division

MML home page

Chemical and Biochemical Reference Data Division

  NIST Logo Home
©NIST, 2013
Accessibility information

Search Results

Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
1 record matched NO + NH2 → ·OH + HN=N
1 record matched SO3 + H· → ·OH + SO2
1 record matched ·OH + SO3 → HO2 + SO2
1 record matched ·OH + Cysteine → Products
1 record matched HO2 + Cl → ·OH + ClO
3 records matched (CD3)2CO + ·OH → ·CD2C(O)CD3 + HDO
1 record matched CF3CHFCF2CH2OH + ·OH → Products
1 record matched (n-C3H7)2O + ·OH → Products
2 records matched CH2=C(CH3)CH=CH2 + ·OH → Products
1 record matched C2H2 + ·OH → Products
3 records matched (CH3)2CO + ·OH → CH3C(O)CH2(·) + H2O
1 record matched (CH3)2CO + ·OH → CH3C(O)OH + ·CH3
3 records matched O(3P) + H2O2 → HO2 + ·OH
6 records matched CS2OH → CS2 + ·OH
2 records matched O· + n-C7H15Cl → Other Products + ·OH
1 record matched HOONO → ·OH + NO2
1 record matched HNO + O· → ·OH + NO
1 record matched SH + O· → ·OH + S
1 record matched NH + O· → ·OH + N
1 record matched NH2 + O· → ·OH + NH
5 records matched HOBr + O· → ·OH + BrO
2 records matched H· + O· → ·OH
1 record matched H· + HNO → ·OH + NH
4 records matched NO2 + H· → ·OH + NO
2 records matched NO + HNO → ·OH + N2O
1 record matched NO + NH2 → ·OH + HN=N
4 records matched NO + H· → ·OH + N
1 record matched ClOO + H· → ·OH + ClO
4 records matched HBr + O· → ·OH + Br·
3 records matched O3 + H· → ·OH + O2
7 records matched N2O + H· → ·OH + N2
2 records matched SiH4 + O· → ·OH + SiH3
6 records matched HOCl + O· → ·OH + ClO
4 records matched H2S + O· → ·OH + SH
1 record matched HNO2 + O· → ·OH + NO2
3 records matched HNO2 → ·OH + NO
2 records matched GeH4 + O· → ·OH + GeH3
5 records matched O2 + SH → ·OH + SO
18 records matched O2 + H· → ·OH + O·
1 record matched H2O + ·CH2 → ·CH3 + ·OH
1 record matched H2O + Cl → ·OH + HCl
1 record matched H2O + NCO → HN=C=O + ·OH
4 records matched H2O + CF3O → CF3OH + ·OH
1 record matched H2O + N → ·OH + NH
5 records matched H2O + O· → ·OH + ·OH
8 records matched H2O + ·F → ·OH + HF
1 record matched H2O + NH → ·OH + NH2
1 record matched H2O + NH2 → ·OH + NH3
2 records matched H2O + NaO → NaOH + ·OH
7 records matched H2O + H· → H2 + ·OH
1 record matched H2O + Br· → ·OH + HBr
3 records matched H2O → ·OH + H·
11 records matched H2O2 + O· → HO2 + ·OH
4 records matched H2O2 + H· → ·OH + H2O
8 records matched H2O2 → ·OH + ·OH
2 records matched HNO3 + O· → ·OH + NO3
5 records matched NH3 + O· → ·OH + NH2
5 records matched HCl + O· → ·OH + Cl
1 record matched Kr + H2O → ·OH + H·
1 record matched Cyclobutyl + H2O → Cyclobutane + ·OH
1 record matched *CH2C(O)H + O2 → CH2O + CO + ·OH
1 record matched ·OH + CF3CF2CH2CH2F → Other Products + H2O
2 records matched ·OH + CHClFCHO → Products
2 records matched ·OH + CF3CHFCHFCF2CF3 → Other Products + H2O
1 record matched ·OH + CF3CH2CF2CH2CF3 → CF3CH2CF2CH(.)CF3 + H2O
1 record matched ·OH + CF3CF2CH2CH2CF2CF3 → CF3CF2CH2CH(.)CF2CF3 + H2O
1 record matched ·OH + CH2=C(CH3)C(O)OONO2 → Products
1 record matched ·OH + CH3CH2CH2OONO2 → Products
2 records matched ·OH + ClNO2 → HOCl + NO2
1 record matched ·OH + CCl2FCHO → Other Products + H2O
1 record matched ·OH + CCl2FCHO → CFCl2C(O)(.) + H2O
1 record matched ·OH + ·CH2 → CH2O + H·
1 record matched ·OH + CHF2OCHClCF3 → Other Products + H2O
2 records matched ·OH + CHF2OCHClCF3 → Products
8 records matched ·OH + HO2NO2 → Products
6 records matched ·OH + CH3CCl2F → ·CH2CCl2F + H2O
1 record matched ·OH + CHF2CHFCHF2 → Other Products + H2O
1 record matched ·OH + Cl → HCl + O·
1 record matched ·OH + NCO → HN=C=O + O·
3 records matched ·OH + NCO → Adduct
1 record matched ·OH + N → NH + O·
3 records matched ·OH + N → NO + H·
14 records matched ·OH + O· → O2 + H·
8 records matched ·OH + OClO → O2 + HOCl
5 records matched ·OH + BrO → Products
1 record matched ·OH + ClO → HCl + O2
1 record matched ·OH + ClO → HO2 + Cl
8 records matched ·OH + ClO → Products
8 records matched ·OH + ClONO2 → Products
1 record matched ·OH + HNO → H2O + NO
1 record matched ·OH + HNO → Products
2 records matched ·OH + HD → Products
2 records matched ·OH + CHF2OCF2CHFCl → Other Products + H2O
1 record matched ·OH + CHF2OCF2CHFCl → Products
4 records matched ·OH + SO → SO2 + H·
1 record matched ·OH + NH → NH2 + O·
1 record matched ·OH + NH → H· + HNO
1 record matched ·OH + NH → H2O + N
1 record matched ·OH + NH → Products
1 record matched ·OH + NH2 → H2O + NH
2 records matched ·OH + NH2 → NH3 + O·
5 records matched ·OH + ClNO2 → HOCl + NO2
7 records matched ·OH + H· → H2O
4 records matched ·OH + H· → H2 + O·
1 record matched ·OH + C2 → CO + ·CH
5 records matched ·OH + NO3 → HO2 + NO2
2 records matched ·OH + NO3 → Products
5 records matched ·OH + NO2 → HOONO
25 records matched ·OH + NO2 → HNO3
2 records matched ·OH + NO2 → HO2 + NO
16 records matched ·OH + NO → HNO2
2 records matched ·OH + NO → cis-HONO
1 record matched ·OH + Br· → HBr + O·
12 records matched ·OH + HBr → H2O + Br·
9 records matched ·OH + HI → H2O + I
8 records matched ·OH + O3 → HO2 + O2
1 record matched ·OH + N2O → HO2 + N2
7 records matched ·OH + HOCl → H2O + ClO
9 records matched ·OH + H2S → H2O + SH
7 records matched ·OH + HNO2 → H2O + NO2
6 records matched ·OH + Cl2 → HOCl + Cl
1 record matched ·OH + O2 → HO2 + O·
9 records matched ·OH + Br2 → Br· + HOBr
14 records matched ·OH + H2O2 → HO2 + H2O
2 records matched ·OH + S → H· + SO
1 record matched ·OH + DCl → HDO + Cl
5 records matched ·OH + HNO3 → H2O + NO3
13 records matched ·OH + NH3 → H2O + NH2
10 records matched ·OH + HCl → H2O + Cl
1 record matched ·OH + HCl → Products
8 records matched ·OH + I2 → HOI + I
15 records matched ·OH + SO2 → HOSO2
4 records matched ·OH + CH3CF2CCl2F → Other Products + H2O
1 record matched ·OH + CH3CF2CCl2F → CH2CF2CFCl2 + H2O
2 records matched ·OH + CH3C(O)CH2(ONO2) → Products
1 record matched ·OH + iso-C4H9 → iso-C4H8 + H2O
1 record matched ·OH + iso-C4H9 → iso-C4H9OH
1 record matched ·OH + (E)-CH3CH=CHCHO → Products
2 records matched ·OH + Pentafluorodimethyl ether → H2O + CF3OCF2(·)
19 records matched ·OH + ·OH → H2O + O·
19 records matched ·OH + ·OH → H2O2
1 record matched ·OH → H· + O·
8 records matched HO2 + Cl → ·OH + ClO
12 records matched HO2 + O· → ·OH + O2
11 records matched HO2 + H· → ·OH + ·OH
9 records matched HO2 + NO → ·OH + NO2
8 records matched HO2 + O3 → ·OH + O2 + O2
1 record matched HO2 + O3 → Other Products + ·OH
1 record matched HO2 + H2O → ·OH + H2O2
1 record matched HO2 + SO2 → ·OH + SO3
1 record matched HO2 + iso-C4H9 → CH2O + iso-C3H7 + ·OH
15 records matched HO2 + ·OH → H2O + O2
1 record matched CH3CO + ·OH → H2C=C=O + H2O
1 record matched CH3CO + ·OH → Products
1 record matched CH3CH2OOH + O· → Other Products + ·OH
2 records matched CH3CH2OOH → CH3CH2O· + ·OH
5 records matched CH3OOH + ·OH → H2O + CH2OOH
5 records matched CH3OOH + ·OH → CH3O2· + H2O
2 records matched CH3OOH + ·OH → Products
2 records matched CH3OOH → CH3O· + ·OH
9 records matched CF3CHFCl + ·OH → CF3CFCl· + H2O
1 record matched C2H3 + H2O → C2H4 + ·OH
1 record matched C2H3 + ·OH → CH3CHO
1 record matched C2H3 + ·OH → C2H2 + H2O
3 records matched HCO + O· → CO + ·OH
1 record matched HCO + H2O → CH2O + ·OH
3 records matched HCO + ·OH → CO + H2O
1 record matched (·)CH2OH + ·CH2 → C2H4 + ·OH
1 record matched (·)CH2OH + O· → CH2O + ·OH
1 record matched (·)CH2OH + H· → ·CH3 + ·OH
1 record matched (·)CH2OH + ·OH → CH2O + H2O
1 record matched (·)CH2OH + C2H3 → ·CH2CH=CH2 + ·OH
3 records matched HC(O)Cl + ·OH → ClCO + H2O
2 records matched CF3I + ·OH → ·CF3 + HOI
2 records matched CF3I + ·OH → Products
6 records matched CH3C(O)OONO2 + ·OH → Products
2 records matched ·CH3 + O2 → CH2O + ·OH
2 records matched ·CH3 + H2O → CH4 + ·OH
1 record matched ·CH3 + ·OH → H2O + ·CH2
1 record matched ·CH3 + ·OH → CH4 + O·
3 records matched ·CH3 + ·OH → CH3OH
3 records matched ·CH3 + ·OH → Products
2 records matched ·CH3 + HO2 → CH3O· + ·OH
1 record matched S=C(CH3)SCH3 + ·OH → Products
1 record matched Benzyl + HO2 → ·OH + C6H5CH2O
1 record matched CH3O· + O· → CH2O + ·OH
1 record matched CH3O· + ·OH → CH2O + H2O
1 record matched n-C3H7 + ·OH → CH3CH=CH2 + H2O
1 record matched n-C3H7 + ·OH → n-C3H7OH
1 record matched n-C3H7 + HO2 → ·OH + n-C3H7O
1 record matched CH3O2· + H· → CH3O· + ·OH
1 record matched CH3O2· + ·OH → CH3OH + O2
1 record matched ·C2H + ·OH → CO + ·CH2
1 record matched ·C2H + ·OH → C2H2 + O·
1 record matched ·C2H + HO2 → ·OH + HCCO
1 record matched ·C2H + (·)CH2OH → CH2C≡CH + ·OH
2 records matched C6D5CD3 + ·OH → Products
1 record matched ·C2H5 + O2 → CH3CHO + ·OH
2 records matched ·C2H5 + H2O → C2H6 + ·OH
1 record matched ·C2H5 + ·OH → C2H4 + H2O
1 record matched ·C2H5 + ·OH → C2H6 + O·
1 record matched iso-C3H7 + ·OH → CH3CH=CH2 + H2O
1 record matched iso-C3H7 + HO2 → CH3CHO + ·CH3 + ·OH
1 record matched ·CH2CH=CH2 + ·OH → CH2=C=CH2 + H2O
1 record matched ·CH2CH=CH2 + ·OH → Products
1 record matched ·CH2CH=CH2 + HO2 → ·OH + CH2=CHCH2O
1 record matched CF3CH2OCHF2 + ·OH → Products
3 records matched (CH3)2CHONO2 + ·OH → Products
1 record matched CHF2-O-CHF2 + ·OH → Products
4 records matched CHF2-O-CHF2 + ·OH → CHF2OCF2· + H2O
7 records matched CF2ClCH2Cl + ·OH → ·CHClCClF2 + H2O
1 record matched tert-C4H9OCH3 + ·OH → Other Products + H2O
1 record matched tert-C4H9 + O· → iso-C4H8 + ·OH
1 record matched tert-C4H9 + ·OH → iso-C4H8 + H2O
1 record matched tert-C4H9 + HO2 → (CH3)2CO + ·CH3 + ·OH
5 records matched CHBrF2 + ·OH → H2O + CBrF2
1 record matched CF3OH + ·OH → H2O + CF3O
2 records matched HFCO + ·OH → FCO + H2O
15 records matched H2 + O· → ·OH + H·
1 record matched H2 + O2 → ·OH + ·OH
23 records matched H2 + ·OH → H2O + H·
1 record matched n-C11H24 + ·OH → Other Products + H2O
2 records matched Benzene-d6 + ·OH → Products
1 record matched Pentane, 3,3-diethyl- + ·OH → Other Products + H2O
1 record matched (CH3)3SiH + O· → ·OH + (CH3)3Si·
9 records matched CF3CH2F + ·OH → H2O + CF3CHF
1 record matched Acetaldehyde, chlorodifluoro- + ·OH → Other Products + H2O
1 record matched Acetaldehyde, chlorodifluoro- + ·OH → CF2ClC(O)(.) + H2O
2 records matched t-C4H9CH2Cl + O· → Other Products + ·OH
4 records matched Propane, 1,1,1,3,3,3-hexafluoro- + ·OH → H2O + (CF3)2CH·
3 records matched Propane, 1,1,2,2,3-pentafluoro- + ·OH → Other Products + H2O
1 record matched Propane, 1,1,2,2,3-pentafluoro- + ·OH → Products
4 records matched Propane, 1,1,1,2,2,3-hexafluoro- + ·OH → CF3CF2CHF· + H2O
2 records matched CHD3 + ·OH → Other Products + H2O
2 records matched CH2D2 + ·OH → Other Products + H2O
2 records matched CH3D + ·OH → Other Products + H2O
2 records matched CH3D + ·OH → Products
7 records matched CO + ·OH → CO2 + H·
2 records matched CO + ·OH → Products
4 records matched CO + HO2 → CO2 + ·OH
1 record matched CH3(CH2)11CH3 + ·OH → Other Products + H2O
2 records matched n-C3H7ONO2 + ·OH → Products
4 records matched C2H5ONO2 + ·OH → Products
8 records matched (CH3S)2 + ·OH → Products
5 records matched CH2FCH2F + ·OH → H2O + CH2FCHF
1 record matched CH2FCH2F + ·OH → Products
2 records matched (E)-2-C4H8 + ·OH → Products
4 records matched CH3ONO2 + ·OH → Products
3 records matched (CH3)3CC(CH3)3 + O· → ·OH + (CH3)3CC(CH3)2CH2
6 records matched (CH3)3CC(CH3)3 + ·OH → H2O + (CH3)3CC(CH3)2CH2
1 record matched (CH3)3CC(CH3)3 + ·OH → Products
1 record matched CH3OCl + ·OH → Products
1 record matched CH2FCl + O· → ·OH + ·CClFH
9 records matched CH2FCl + ·OH → H2O + ·CClFH
7 records matched CH3F + ·OH → ·CH2F + H2O
2 records matched Pentane, 2,2-dimethyl- + O· → Other Products + ·OH
2 records matched (Z)-2-C4H8 + ·OH → Products
2 records matched (CH3)2CHCH(CH3)CH(CH3)2 + O· → Other Products + ·OH
1 record matched (CH3)2C=C(CH3)2 + ·OH → Products
1 record matched (CH3)2CHCH=CH2 + ·OH → Products
2 records matched CD4 + ·OH → Other Products + H2O
2 records matched (CH3)2CHCH2ONO2 + ·OH → Products
2 records matched (CH3)2CHCH2C(CH3)3 + O· → Other Products + ·OH
4 records matched (CH3)2CHCH2C(CH3)3 + ·OH → Other Products + H2O
1 record matched C2H5OCH3 + ·OH → Products
2 records matched iso-C4H9Cl + O· → Other Products + ·OH
1 record matched (CH3)2C=CHCH3 + ·OH → Products
4 records matched CF2ClCF2CHClF + ·OH → Other Products + H2O
1 record matched CF2ClCF2CHClF + ·OH → CFClCF2CF2Cl + H2O
2 records matched tert-C4H9Cl + O· → ·OH + (CH3)2CClCH2
2 records matched Butane, 2,2,3-trimethyl- + ·OH → H2O + (CH3)3C-C(·)(CH3)2
6 records matched Butane, 2,2,3-trimethyl- + ·OH → Other Products + H2O
5 records matched neo-C5H12 + O· → ·OH + (CH3)3CCH2
6 records matched neo-C5H12 + ·OH → (CH3)3CCH2 + H2O
8 records matched COS + ·OH → Products
2 records matched H2C=C=O + ·OH → Products
2 records matched CH2=C=CH2 + ·OH → Products
1 record matched CF3CH2CHF2 + ·OH → Other Products + H2O
1 record matched 1,3-Butadiyne + ·OH → Products
4 records matched CF3CHFCF3 + ·OH → (CF3)2CF + H2O
3 records matched 1,1,1,2,3,3-Hexafluoropropane + ·OH → Other Products + H2O
1 record matched 1,1,1,2,3,3-Hexafluoropropane + ·OH → Products
1 record matched CF3CHFCH2F + ·OH → Other Products + H2O
2 records matched CHF2CHO + ·OH → Products
5 records matched CH2FCHF2 + ·OH → Other Products + H2O
4 records matched CF3CF2CHCl2 + ·OH → Other Products + H2O
1 record matched CF3CF2CHCl2 + ·OH → (.)CCl2CF2CF3 + H2O
1 record matched CF3OCH3 + ·OH → CF3OCH2(.) + H2O
1 record matched CH3CH2CF3 + ·OH → Other Products + H2O
3 records matched CF3CBrH2 + ·OH → CF3CHBr· + H2O
6 records matched CH3CF3 + ·OH → CF3CH2 + H2O
2 records matched CF3CH2CH2CF3 + ·OH → CF3CH2CH(·)CF3 + H2O
1 record matched CF3CH2CF2CH3 + ·OH → Other Products + H2O
2 records matched CHF2CF2CF2CHF2 + ·OH → CHF2CF2CF2CF2· + H2O
6 records matched CHF2CHF2 + ·OH → H2O + CHF2CF2
6 records matched C2F5H + ·OH → C2F5 + H2O
3 records matched CF2ClCHFCl + ·OH → H2O + ·CFClCF2Cl
3 records matched Ethane, 1,2,2-trichloro-1,1-difluoro- + ·OH → H2O + CCl2CF2Cl
3 records matched CCl2FCHClF + ·OH → H2O + CFCl2CFCl
1 record matched CF2BrCHFCl + ·OH → CF2BrCFCl· + H2O
5 records matched CF2BrCl + ·OH → Products
5 records matched C2H5F + ·OH → Other Products + H2O
2 records matched C2H5F + ·OH → Products
9 records matched CF3CHCl2 + ·OH → H2O + CF3CCl2
2 records matched Cycloheptane + O· → ·OH + Cycloheptyl
3 records matched Cyclopentane + O· → ·OH + Cyclopentyl
6 records matched Cyclopentane + ·OH → Cyclopentyl + H2O
2 records matched Cyclobutane + O· → ·OH + Cyclobutyl
4 records matched Cyclobutane + ·OH → Cyclobutyl + H2O
2 records matched Spiropentane + O· → ·OH + Spiropentyl
4 records matched CF3CHClBr + ·OH → H2O + CF3CClBr
2 records matched n-C7H16 + O· → ·OH + 2-C7H15
2 records matched n-C7H16 + O· → ·OH + 1-C7H15
3 records matched n-C7H16 + O· → Other Products + ·OH
5 records matched n-C7H16 + ·OH → Other Products + H2O
1 record matched n-C7H16 + ·OH → Products
1 record matched Tetrahydro-2H-pyran + O· → Other Products + ·OH
1 record matched CH3COOC2H5 + O· → Other Products + ·OH
4 records matched HOCH2CHO + ·OH → H2O + HOCH2C(·)O
4 records matched HOCH2CHO + ·OH → HOCH(·)CHO + H2O
1 record matched beta-pinene + ·OH → Products
7 records matched C2Cl4 + ·OH → Products
5 records matched CF2Br-CF2Br + ·OH → Products
4 records matched CF3CHBrF + ·OH → CF3CFBr· + H2O
2 records matched CO2 + H· → CO + ·OH
4 records matched n-C10H22 + ·OH → Other Products + H2O
1 record matched CH3COO(CH2)3CH3 + ·OH → Products
1 record matched n-C3H7CHO + O· → Other Products + ·OH
1 record matched n-C3H7CHO + ·OH → Products
1 record matched C2H5CHO + O· → Other Products + ·OH
5 records matched C2H5CHO + ·OH → Products
1 record matched Cyclopentanone + O· → Other Products + ·OH
1 record matched Anthracene + ·OH → Products
3 records matched CH3C(O)CH2OH + ·OH → Products
2 records matched iso-C4H8 + ·OH → Products
2 records matched (CH3)2O + O· → ·OH + CH3OCH2
4 records matched (CH3)2O + ·OH → H2O + CH3OCH2
1 record matched CH3CH=CH2 + O· → ·OH + CH2=C(·)CH3
1 record matched CH3CH=CH2 + O· → ·OH + CH3CH=CH
1 record matched CH3CH=CH2 + O· → ·CH2CH=CH2 + ·OH
1 record matched CH3CH=CH2 + ·OH → H2O + CH2=C(·)CH3
4 records matched CH3CH=CH2 + ·OH → CH3CHCH2OH
1 record matched CH3CH=CH2 + ·OH → CH3CH=CH + H2O
1 record matched CH3CH=CH2 + ·OH → ·CH2CH=CH2 + H2O
10 records matched CH3CH=CH2 + ·OH → Products
1 record matched CH3CH=CH2 + HO2 → Methyloxirane + ·OH
1 record matched CH3(CH2)10CH3 + ·OH → Other Products + H2O
4 records matched n-C9H20 + ·OH → Other Products + H2O
2 records matched n-C8H18 + O· → ·OH + 1-C8H17
2 records matched n-C8H18 + O· → 2-C8H17 + ·OH
3 records matched n-C8H18 + O· → Other Products + ·OH
5 records matched n-C8H18 + ·OH → Other Products + H2O
1 record matched Cyclohexene + ·OH → Products
3 records matched Cyclohexane + O· → Cyclohexyl + ·OH
6 records matched Cyclohexane + ·OH → Cyclohexyl + H2O
2 records matched n-C6H14 + O· → 1-hexyl radical + ·OH
2 records matched n-C6H14 + O· → 2-hexyl radical + ·OH
3 records matched n-C6H14 + O· → Other Products + ·OH
4 records matched n-C6H14 + ·OH → Other Products + H2O
1 record matched n-C6H14 + ·OH → Products
1 record matched Thiophene + ·OH → Products
1 record matched Furan + ·OH → Products
1 record matched Tetrahydrofuran + O· → Other Products + ·OH
1 record matched Tetrahydrofuran + ·OH → Products
1 record matched HCOOC2H5 + O· → Other Products + ·OH
2 records matched n-C5H12 + O· → 1-C5H11 + ·OH
2 records matched n-C5H12 + O· → CH3CH2CH2CHCH3 + ·OH
4 records matched n-C5H12 + O· → Other Products + ·OH
1 record matched n-C5H12 + ·OH → H2O + (CH3CH2)2CH
4 records matched n-C5H12 + ·OH → Other Products + H2O
1 record matched n-C5H12 + ·OH → Products
2 records matched n-C4H9Br + O· → Other Products + ·OH
1 record matched CH3COOCH2CH2CH3 + O· → Other Products + ·OH
1 record matched CH3COOCH2CH2CH3 + ·OH → Products
1 record matched Phenol + H· → Benzene + ·OH
1 record matched Phenol + ·OH → Adduct
1 record matched Phenol + ·OH → Products
1 record matched Cyclohexanone + O· → Other Products + ·OH
2 records matched Toluene + ·OH → Benzyl + H2O
1 record matched Toluene + ·OH → Adduct
4 records matched Toluene + ·OH → Products
1 record matched Cyclohexane, methyl- + ·OH → Products
1 record matched (iso-C4H9)2CO + ·OH → Products
1 record matched 3-Methylphenol + ·OH → Products
3 records matched 1,3-Dimethylbenzene + ·OH → Products
1 record matched CH3COOCH(CH3)2 + ·OH → Products
1 record matched iso-C4H9COCH3 + ·OH → Products
2 records matched Pentane, 2,4-dimethyl- + O· → Other Products + ·OH
1 record matched Pentane, 2,4-dimethyl- + ·OH → Other Products + H2O
3 records matched (CH3)2CH(CH2)2CH3 + ·OH → Other Products + H2O
1 record matched HC(O)OCH3 + O· → HC(O)OCH2(·) + ·OH
1 record matched (CHO)2 + ·OH → H2O + HC(O)CO
1 record matched (CHO)2 + ·OH → Other Products + H2O
2 records matched (CHO)2 + ·OH → Products
3 records matched CH2ClCHO + ·OH → Products
1 record matched CH2ClCH2Cl + O· → ·OH + CH2ClCHCl·
1 record matched CH2=CHCHO + ·OH → Products
1 record matched 1,3-Butadiene + ·OH → Products
1 record matched 1-C4H8 + O· → Other Products + ·OH
3 records matched 1-C4H8 + ·OH → Products
2 records matched n-C4H10 + O· → n-C4H9 + ·OH
2 records matched n-C4H10 + O· → sec-C4H9 + ·OH
5 records matched n-C4H10 + O· → Other Products + ·OH
1 record matched n-C4H10 + ·OH → sec-C4H9 + H2O
8 records matched n-C4H10 + ·OH → Other Products + H2O
2 records matched n-C3H7Br + ·OH → Products
1 record matched CH2BrCH2Br + ·OH → Other Products + H2O
1 record matched 4-Methylphenol + ·OH → Products
2 records matched 1,4-Dimethylbenzene + ·OH → 4-Methylbenzyl + H2O
1 record matched 1,4-Dimethylbenzene + ·OH → Adduct
2 records matched 1,4-Dimethylbenzene + ·OH → Products
1 record matched 1-Phenylpropane + ·OH → Products
1 record matched Benzaldehyde + O· → benzoyl + ·OH
2 records matched Benzaldehyde + ·OH → Products
1 record matched Ethylbenzene + ·OH → Adduct
2 records matched Ethylbenzene + ·OH → Products
1 record matched (C2H5)2CO + O· → Other Products + ·OH
1 record matched (C2H5)2CHCH3 + ·OH → H2O + (C2H5)2(CH3)C
3 records matched (C2H5)2CHCH3 + ·OH → Other Products + H2O
1 record matched 2-Methylphenol + ·OH → Products
2 records matched 1,2-Dimethylbenzene + ·OH → Products
1 record matched Biphenyl + ·OH → Products
2 records matched Naphthalene + ·OH → Products
1 record matched alpha-pinene + ·OH → Products
2 records matched (CH3)2CHCH(CH3)2 + O· → ·OH + (CH3)2CHC(·)(CH3)2
3 records matched (CH3)2CHCH(CH3)2 + O· → Other Products + ·OH
1 record matched (CH3)2CHCH(CH3)2 + ·OH → H2O + (CH3)2CHC(·)(CH3)2
6 records matched (CH3)2CHCH(CH3)2 + ·OH → Other Products + H2O
1 record matched (CH3)2CHCH(CH3)2 + ·OH → Products
1 record matched CH3C(O)OCH3 + O· → Other Products + ·OH
2 records matched C2H5COOH + ·OH → Products
3 records matched CHCl2CHO + ·OH → Products
7 records matched C2HCl3 + ·OH → Products
3 records matched CHCl2CH2Cl + ·OH → Other Products + H2O
3 records matched CH3C(O)CHO + ·OH → CH3C(O)C(O)· + H2O
1 record matched CH2=CHCOCH3 + ·OH → Products
1 record matched C2H5COCH3 + O· → Other Products + ·OH
2 records matched C2H5COCH3 + ·OH → Products
1 record matched sec-C4H9OH + O· → Other Products + ·OH
1 record matched sec-C4H9OH + ·OH → Products
2 records matched sec-C4H9Cl + O· → Other Products + ·OH
1 record matched Methacrolein + ·OH → Products
1 record matched (CH3)2CHCHO + O· → Other Products + ·OH
1 record matched iso-C4H9OH + O· → Other Products + ·OH
1 record matched CH2=C(CH3)CH=CH2 + ·OH → Products
2 records matched iso-C5H12 + O· → Other Products + ·OH
1 record matched iso-C5H12 + ·OH → (CH3)2CCH2CH3 + H2O
1 record matched iso-C5H12 + ·OH → (CH3)2CHCHCH3 + H2O
3 records matched iso-C5H12 + ·OH → Other Products + H2O
1 record matched iso-C4H9Br + O· → Other Products + ·OH
2 records matched CF3COOH + ·OH → Products
3 records matched CF3CHO + ·OH → CF3C(O) + H2O
1 record matched CF3CH2Cl + O· → ·OH + CF3CHCl
7 records matched CF3CH2Cl + ·OH → H2O + CF3CHCl
2 records matched CCl3CHO + ·OH → Other Products + H2O
3 records matched CCl3CHO + ·OH → CCl3C(O)(.) + H2O
3 records matched (CH3)3CCH2CH3 + ·OH → Other Products + H2O
2 records matched CF4 + ·OH → ·CF3 + HOF
4 records matched CF2Cl2 + ·OH → ·CClF2 + HOCl
2 records matched CF2Cl2 + ·OH → Products
4 records matched CFCl3 + ·OH → ·CCl2F + HOCl
2 records matched CFCl3 + ·OH → Products
1 record matched CH3CF2Cl + O· → Other Products + ·OH
9 records matched CH3CF2Cl + ·OH → CF2ClCH2· + H2O
1 record matched tert-C4H9OH + O· → Other Products + ·OH
5 records matched CF3Br + ·OH → Products
5 records matched CF2Br2 + ·OH → Products
1 record matched CHF3 + O· → ·CF3 + ·OH
9 records matched CHF3 + ·OH → ·CF3 + H2O
1 record matched CHF2Cl + O· → ·CClF2 + ·OH
9 records matched CHF2Cl + ·OH → ·CClF2 + H2O
3 records matched COCl2 + ·OH → Products
1 record matched CHFCl2 + O· → ·CCl2F + ·OH
9 records matched CHFCl2 + ·OH → ·CCl2F + H2O
8 records matched CH3CHF2 + ·OH → Other Products + H2O
2 records matched CH3CHF2 + ·OH → Products
3 records matched CH3COCl + ·OH → H2O + CH2C(O)Cl
1 record matched CH3CHCl2 + O· → Other Products + ·OH
1 record matched CH3CHCl2 + ·OH → Other Products + H2O
2 records matched iso-C3H7Cl + O· → ·OH + (CH3)2CCl
2 records matched iso-C4H10 + O· → ·OH + iso-C4H9
2 records matched iso-C4H10 + O· → tert-C4H9 + ·OH
5 records matched iso-C4H10 + O· → Other Products + ·OH
1 record matched iso-C4H10 + ·OH → iso-C4H9 + H2O
2 records matched iso-C4H10 + ·OH → tert-C4H9 + H2O
7 records matched iso-C4H10 + ·OH → Other Products + H2O
2 records matched iso-C3H7Br + O· → ·OH + (CH3)2CBr
3 records matched iso-C3H7Br + ·OH → Products
1 record matched CHBr3 + ·OH → CBr3 + H2O
2 records matched Oxirane + O· → ·OH + Oxiranyl
1 record matched Oxirane + ·OH → H2O + Oxiranyl
2 records matched Cyclopropane + O· → Cyclopropyl + ·OH
2 records matched Cyclopropane + ·OH → Cyclopropyl + H2O
2 records matched (CH3)2S + ·OH → (CH3)2S.OH
10 records matched (CH3)2S + ·OH → H2O + CH3SCH2
1 record matched (CH3)2S + ·OH → Adduct
6 records matched CS2 + ·OH → CS2OH
4 records matched CS2 + ·OH → COS + SH
2 records matched CS2 + ·OH → Products
1 record matched HN=C=O + O· → ·OH + NCO
1 record matched HN=C=O + ·OH → H2O + NCO
7 records matched CH2F2 + ·OH → ·CHF2 + H2O
2 records matched CH2Cl2 + O· → ·OH + CHCl2
9 records matched CH2Cl2 + ·OH → CHCl2 + H2O
1 record matched C2H5SH + ·OH → Products
3 records matched CH3CHO + O· → CH3CO + ·OH
3 records matched CH3CHO + O· → Other Products + ·OH
7 records matched CH3CHO + ·OH → CH3CO + H2O
2 records matched CH3CHO + ·OH → Products
7 records matched CH3CN + ·OH → Products
1 record matched CH2=CHCl + ·OH → Products
2 records matched C2H5Cl + O· → Other Products + ·OH
2 records matched C2H5Cl + ·OH → Other Products + H2O
1 record matched CH3CCH + ·OH → Products
2 records matched C3H8 + O· → n-C3H7 + ·OH
2 records matched C3H8 + O· → iso-C3H7 + ·OH
7 records matched C3H8 + O· → Other Products + ·OH
2 records matched C3H8 + ·OH → iso-C3H7 + H2O
12 records matched C3H8 + ·OH → Other Products + H2O
1 record matched C3H8 + ·OH → Products
1 record matched CH2ClBr + ·OH → H2O + ·CHBrCl
2 records matched C2H5Br + O· → Other Products + ·OH
4 records matched CH2Br2 + ·OH → H2O + CHBr2
1 record matched CH3SH + ·OH → CH3S· + H2O
9 records matched CH3SH + ·OH → Products
1 record matched HCN + O· → CN + ·OH
1 record matched HCN + ·OH → HO-C≡N + H·
1 record matched HCN + ·OH → HN=C=O + H·
2 records matched HCN + ·OH → CN + H2O
6 records matched HCN + ·OH → Products
5 records matched CH3I + ·OH → H2O + ·CH2I
3 records matched CH3Cl + O· → ·OH + ·CH2Cl
10 records matched CH3Cl + ·OH → ·CH2Cl + H2O
14 records matched C2H2 + ·OH → HOCH=CH
2 records matched C2H2 + ·OH → ·C2H + H2O
9 records matched C2H2 + ·OH → Products
1 record matched C2H2 + HO2 → H2C=C=O + ·OH
12 records matched C2H4 + ·OH → HOCH2CH2
3 records matched C2H4 + ·OH → C2H3 + H2O
3 records matched C2H4 + ·OH → Products
1 record matched C2H4 + HO2 → Oxirane + ·OH
1 record matched C2H4 + HO2 → CH3CHO + ·OH
11 records matched C2H6 + O· → ·C2H5 + ·OH
15 records matched C2H6 + ·OH → ·C2H5 + H2O
2 records matched C2H6 + ·OH → Other Products + H2O
3 records matched CH3Br + O· → ·OH + ·CH2Br
11 records matched CH3Br + ·OH → H2O + ·CH2Br
13 records matched CH4 + O· → ·CH3 + ·OH
21 records matched CH4 + ·OH → ·CH3 + H2O
2 records matched CH4 + ·OH → Other Products + H2O
9 records matched CH3CCl3 + ·OH → H2O + CCl3CH2
1 record matched Benzene + ·OH → Cyclohexadienyl, 6-hydroxy-
2 records matched Benzene + ·OH → Phenyl + H2O
1 record matched Benzene + ·OH → Phenol + H·
2 records matched Benzene + ·OH → Products
1 record matched n-C4H9OH + O· → Other Products + ·OH
1 record matched n-C4H9OH + ·OH → Products
1 record matched n-C3H7OH + O· → Other Products + ·OH
2 records matched n-C3H7OH + ·OH → Other Products + H2O
3 records matched n-C3H7OH + ·OH → Products
2 records matched CHCl3 + O· → ·CCl3 + ·OH
9 records matched CHCl3 + ·OH → ·CCl3 + H2O
1 record matched (CH3)2CO + O· → CH3C(O)CH2(·) + ·OH
4 records matched (CH3)2CO + ·OH → CH3C(O)CH2(·) + H2O
2 records matched (CH3)2CO + ·OH → Products
2 records matched iso-C3H7OH + O· → Other Products + ·OH
2 records matched iso-C3H7OH + ·OH → Other Products + H2O
1 record matched iso-C3H7OH + ·OH → Products
1 record matched CH3OH + O· → CH3O· + ·OH
3 records matched CH3OH + O· → Other Products + ·OH
1 record matched CH3OH + ·OH → (·)CH2OH + H2O
2 records matched CH3OH + ·OH → CH3O· + H2O
1 record matched CH3OH + ·OH → CH2O + H2O + H·
4 records matched CH3OH + ·OH → Other Products + H2O
3 records matched CH3OH + ·OH → Products
5 records matched CH3OH → ·CH3 + ·OH
4 records matched CH3C(O)OH + ·OH → Other Products + H2O
3 records matched CH3C(O)OH + ·OH → Products
6 records matched HCOOH + ·OH → Products
2 records matched C2H5OH + O· → Other Products + ·OH
1 record matched C2H5OH + ·OH → HOCH2CH2 + H2O
1 record matched C2H5OH + ·OH → CH3CHOH + H2O
1 record matched C2H5OH + ·OH → CH3CH2O· + H2O
5 records matched C2H5OH + ·OH → Other Products + H2O
2 records matched C2H5OH + ·OH → Products
1 record matched (C2H5)2O + O· → Other Products + ·OH
1 record matched CN + H2O → HCN + ·OH
2 records matched CN + ·OH → H· + NCO
1 record matched CN + ·OH → HCN + O·
4 records matched CCl4 + ·OH → ·CCl3 + HOCl
2 records matched CCl4 + ·OH → Products
5 records matched CH2O + O· → HCO + ·OH
11 records matched CH2O + ·OH → HCO + H2O
1 record matched CH2O + ·OH → Products
6 records matched O(1D) + H2O → ·OH + ·OH
2 records matched O(1D) + NH3 → ·OH + NH2
3 records matched O(1D) + HF → ·OH + ·F
5 records matched O(1D) + H2 → ·OH + H·
1 record matched O(1D) + n-C4H10 → n-C4H9 + ·OH
2 records matched O(1D) + CH4 → ·CH3 + ·OH
1 record matched O2(1DELTA) + H· → ·OH + O·
1 record matched CH3CH2C(O)CH2(ONO2) + ·OH → Products
2 records matched cis-HONO + ·OH → H2O + NO2
3 records matched M + CS2OH → M + CS2 + ·OH
2 records matched M + ·OH + NO2 → M + HOONO
2 records matched M + ·OH + NO → M + HNO2
3 records matched M + ·OH + SO2 → M + HOSO2
2 records matched M + ·OH + ·OH → M + H2O2
3 records matched M + CS2 + ·OH → M + CS2OH
1 record matched O(3P) + CHF3 → ·CF3 + ·OH
3 records matched O(1D) + H2O → ·OH + ·OH
3 records matched O(1D) + H2 → ·OH + H·
1 record matched N2(A3Sigma_u+) + NH2OH → ·OH + N2 + NH2
1 record matched N2(A3Sigma_u+) + H2O → ·OH + N2 + H·
1 record matched N2(A3Sigma_u+) + ·OH → OH(A2Sigma+) + N2
3 records matched CS2OH → CS2 + ·OH
1 record matched HOCH=CH → C2H2 + ·OH
1 record matched CD3S(OH)CD3 → (CD3)2S + ·OH
2 records matched (CH3)2C(CH2OOH)CH2· → ·OH + Oxetane, 3,3-dimethyl-
1 record matched CH2OOH → CH2O + ·OH
1 record matched O· + ·CH2 → ·CH + ·OH
1 record matched O· + HN=N → ·OH + N2
1 record matched O· + (CD3)2CHCl → ·OH + (CD3)2CCl
1 record matched O· + Diborane(6) → ·OH + B2H5
2 records matched HCOO → CO + ·OH
2 records matched HNO + O· → ·OH + NO
1 record matched HD + O· → ·OH + D
1 record matched NH + O· → ·OH + N
2 records matched NH2 + O· → ·OH + NH
1 record matched HOBr + Cl → ·OH + BrCl
3 records matched HOBr + O· → ·OH + BrO
1 record matched SiH3Cl + O· → ·OH + SiH2Cl
1 record matched SiHF3 + O· → ·OH + SiF3
1 record matched H· + O· → ·OH
3 records matched H· + OClO → ·OH + ClO
1 record matched H· + CF3O2 → ·OH + CF3O
1 record matched H· + XeOF4 → ·OH + XeF4
1 record matched H· + XeOF4 → ·OH + XeF2 + ·F
1 record matched OF + H· → ·OH + ·F
2 records matched NO3 + H· → ·OH + NO2
2 records matched Cyclohexadienyl, 6-hydroxy- → Benzene + ·OH
1 record matched NO2 + NH → ·OH + N2O
17 records matched NO2 + H· → ·OH + NO
2 records matched NO + ·CH2 → HCN + ·OH
1 record matched NO + HNO → ·OH + N2O
6 records matched NO + NH → ·OH + N2
17 records matched NO + NH2 → ·OH + HN=N
2 records matched NO + NH2 → ·OH + N2 + H·
2 records matched NO + NH2 → Other Products + ·OH
7 records matched NO + H· → ·OH + N
5 records matched HBr + O· → ·OH + Br·
1 record matched HI + O· → ·OH + I
6 records matched O3 + H· → ·OH + O2
1 record matched SiHCl3 + O· → ·OH + SiCl3
20 records matched N2O + H· → ·OH + N2
9 records matched SiH4 + O· → ·OH + SiH3
1 record matched NH2OH → ·OH + NH2
3 records matched HOCl + Cl → ·OH + Cl2
1 record matched HOCl + ·F → ·OH + ClF
1 record matched HOCl + H· → ·OH + HCl
1 record matched D2O + H· → ·OH + D2
1 record matched H2Se + O· → ·OH + SeH
10 records matched H2S + O· → ·OH + SH
1 record matched HN3 + O· → ·OH + ·N3
1 record matched HNO2 → ·OH + NO
2 records matched GeH4 + O· → ·OH + GeH3
1 record matched O2 + HC(O)CO → CO2 + CO + ·OH
1 record matched O2 + HOCH=CH → Other Products + ·OH
1 record matched O2 + HSO → ·OH + SO2
1 record matched O2 + HCCO → CO + CO + ·OH
1 record matched O2 + (CH3)3CC(O)· → Other Products + ·OH
1 record matched O2 + HN=N → ·OH + N2O
6 records matched O2 + CH3OCH2 → CH2O + CH2O + ·OH
1 record matched O2 + 2-pyridinyl → pyridin-2-olate + ·OH
2 records matched O2 + CH3CH2CO → Products + ·OH
2 records matched O2 + CH3CO → Products + ·OH
5 records matched O2 + SH → ·OH + SO
4 records matched O2 + NH → ·OH + NO
5 records matched O2 + NH2 → ·OH + HNO
3 records matched O2 + SiH3 → ·OH + H2Si=O
46 records matched O2 + H· → ·OH + O·
1 record matched O2 + Cyclohexadienyl, 6-hydroxy- → Other Products + ·OH
4 records matched H2O + CF3O → CF3OH + ·OH
3 records matched H2O + O· → ·OH + ·OH
5 records matched H2O + ·F → ·OH + HF
1 record matched H2O + NH2 → ·OH + NH3
2 records matched H2O + OD → ·OH + HDO
2 records matched H2O + NaO → NaOH + ·OH
4 records matched H2O + H· → H2 + ·OH
1 record matched H2O + NO2 → ·OH + HNO2
1 record matched H2O + H2O → ·OH + H2O + H·
6 records matched H2O → ·OH + H·
1 record matched H2O2 + SiH3 → H2 + ·OH + H2Si=O
1 record matched H2O2 + OD → ·OH + HOOD
9 records matched H2O2 + H· → ·OH + H2O
1 record matched H2O2 + NO → ·OH + HNO2
13 records matched H2O2 → ·OH + ·OH
5 records matched HNO3 + O· → ·OH + NO3
1 record matched HNO3 + H· → (Z)-ONOH + ·OH
14 records matched HNO3 → ·OH + NO2
14 records matched NH3 + O· → ·OH + NH2
9 records matched HCl + O· → ·OH + Cl
1 record matched HCl + NaO → ·OH + NaCl
2 records matched SO2 + H· → ·OH + SO
1 record matched Na + H2O2 → NaOH + ·OH
1 record matched Kr + H2O → ·OH + H·
1 record matched CH3CH(OH)CH2 → CH3CH=CH2 + ·OH
1 record matched (iso-C3H7)3SiH + O· → ·OH + (iso-C3H7)3Si(·)
1 record matched C2H5D + O· → Other Products + ·OH
1 record matched iso-C4H9 + O2 → (CH3)2CHCHO + ·OH
2 records matched HOCH2CH2 → C2H4 + ·OH
1 record matched CH3CH2C(O)OOH → ·OH + CH3CH2C(O)O
2 records matched SiH2Cl2 + O· → ·OH + SiHCl2
1 record matched Cyclopentyl + O· → Products + ·OH
1 record matched (CH3)3CCH2 + O2 → ·OH + Oxetane, 3,3-dimethyl-
2 records matched ·OH + CH3C(O)CH2CH2CH(OH)CH2CH2CH3 → Products
2 records matched ·OH + 3-methyl-3-hexene-2,5-dione → Products
1 record matched ·OH + HCF2OCF2CF2OCF2H → Products
1 record matched ·OH + HCF2OCF2OCF2CF2OCF2H → Products
1 record matched ·OH + 2,4-dibromodiphenylether → Products
1 record matched ·OH + i-C4F9OCH3 → Products
1 record matched ·OH + CH3OC4F9 → Products
1 record matched ·OH + CH3OC4F9 → CH2OC4F9 + H2O
2 records matched ·OH + n-C4F9OC2H5 → Products
1 record matched ·OH + CF3CF2CH2CH2F → Other Products + H2O
1 record matched ·OH + erythro-CF3CHFCHFC2F5 → Products
1 record matched ·OH + threo-CF3CHFCHFC2F5 → Products
2 records matched ·OH + CHClFCHO → Products
2 records matched ·OH + CF3CHFCHFCF2CF3 → Other Products + H2O
1 record matched ·OH + Benzene, 1-propenyl- (unspec.) → Products
2 records matched ·OH + C2H5CH(CH3)CH2ONO2 → Products
4 records matched ·OH + CH3CH(ONO2)C(O)CH3 → Products
2 records matched ·OH + (CH3)2CHCH(CH3)ONO2 → Products
1 record matched ·OH + (CH3)2CHCH(CH3)ONO2 → CH3C(·)(ONO2)CH(CH3)2 + H2O
1 record matched ·OH + (CH3)2CHCH(CH3)ONO2 → CH3CH(ONO2)C(·)(CH3)2 + H2O
1 record matched ·OH + (CH3)2CHCH(CH3)ONO2 → CH3CH(ONO2)CH(CH3)CH2· + H2O
1 record matched ·OH + C2H5CH(CH3)CH(CH3)ONO2 → CH3C(·)(ONO2)CH(CH3)CH2CH3 + H2O
1 record matched ·OH + C2H5CH(CH3)CH(CH3)ONO2 → CH3CH(ONO2)C(·)(CH3)CH2CH3 + H2O
1 record matched ·OH + C2H5CH(CH3)CH(CH3)ONO2 → CH3CH(ONO2)CH(CH3)CH(·)CH3 + H2O
2 records matched ·OH + CH3CH2C(O)CH2CH2CH(OH)CH2CH3 → Products
5 records matched ·OH + (E)-CF3CH=CHCl → Products
1 record matched ·OH + (E)-CF3CH=CHCl → CF3CH(OH)CHCl·
1 record matched ·OH + (E)-CF3CH=CHCl → CF3CH(·)CHClOH
1 record matched ·OH + CF3CH2CF2CH2CF3 → CF3CH2CF2CH(.)CF3 + H2O
1 record matched ·OH + [5,6]-Fullerene-C60 → Products
2 records matched ·OH + CH3CH2C(O)CH2CH2CH2OH → Products
1 record matched ·OH + CF3CF2CH2CH2CF2CF3 → CF3CF2CH2CH(.)CF2CF3 + H2O
1 record matched ·OH + fluoranthene-d10 → Products
1 record matched ·OH + Bicyclo[2.2.1]heptan-2-ol, 1,7,7-trimethyl, acetate → Products
2 records matched ·OH + CH2=C(CH3)C(O)OONO2 → Products
4 records matched ·OH + CHF2CHFOCF3 → Products
2 records matched ·OH + n-C5H11CH(C2H5)NO3 → Products
2 records matched ·OH + n-C4H9CH(C2H5)NO3 → Products
2 records matched ·OH + n-C3H7CH(C2H5)NO3 → Products
2 records matched ·OH + (C2H5)2CHNO3 → Products
2 records matched ·OH + 2,4-Hexadienal → Products
1 record matched ·OH + HCF2OCF2OCF2H → Products
2 records matched ·OH + (CH3)2CHCH2OCH(CH3)2 → Other Products + H2O
2 records matched ·OH + CH3CH2C(O)CH2CH2CH(OH)CH3 → Products
6 records matched ·OH + CH2CBrCF2CF3 → Products
1 record matched ·OH + HN=NO. → NO + NHOH
1 record matched ·OH + CF3CHFCF2OCH2CF2CHF2 → Products
2 records matched ·OH + CF3CH2CCl2F → Products
1 record matched ·OH + CD3ONO → Products
2 records matched ·OH + CCl2FCHO → Products
1 record matched ·OH + E-2-Formylcinnamaldehyde → Products
2 records matched ·OH + HSO2 → SO2 + H2O
2 records matched ·OH + CH3CH2CH2C(O)CH2CH2CH(OH)CH3 → Products
4 records matched ·OH + CF3CHFOCHF2 → Products
2 records matched ·OH + CH3C(O)CH2CH2CH(OH)CH3 → Products
2 records matched ·OH + C6F13CH2CHO → Products
2 records matched ·OH + CH3OC(CH3)2CH2CH2OH → Products
2 records matched ·OH + (CH3)3SiOSi(CH3)2OH → Products
5 records matched ·OH + CF3CF2CF2CF2H → Products
2 records matched ·OH + OTNE → Products
2 records matched ·OH + 2-Ethoxyethyl isobutyrate → Products
2 records matched ·OH + Butanoic acid, 2-methyl-, methyl ester → Products
1 record matched ·OH + (O)CHCH=CHCH=CHCH(O)-(E,Z) → Products
2 records matched ·OH + Benzene, pentafluoropropyl- → Products
1 record matched ·OH + 2,2'-dibromodiphenylether → Products
1 record matched ·OH + CF3CHClOCH2CH3 → Other Products + H2O
2 records matched ·OH + HOCH2CH2CH2C(O)CH2CH2CH3 → Products
1 record matched ·OH + C2H5CH(CH3)CH(NO2)CH3 → Products
2 records matched ·OH + 7-Tetradecene, (E)- → Products
1 record matched ·OH + Dibenzo[b,e][1,4]dioxin, 2-chloro- → Products
2 records matched ·OH + Dibenzo[b,e][1,4]dioxin, 1-chloro- → Products
1 record matched ·OH + CH3C(O)OCH(CH3)CH2CH3 → Other Products + H2O
2 records matched ·OH + CH3C(O)OCH(CH3)CH2CH3 → Products
1 record matched ·OH + Dibenzo[b,e][1,4]dioxin, 2,8-dichloro- → Products
2 records matched ·OH + CH2(ONO2)CH=CHCl2(ONO2) → Products
2 records matched ·OH + CH3C(O)CH2CH2CH(OH)CH2CH3 → Products
1 record matched ·OH + HN=N → N2 + H2O
2 records matched ·OH + 1,1'-Biphenyl, 3,5-dichloro- → Products
2 records matched ·OH + 2,2-Dichloroethyl methyl ether → Other Products + H2O
5 records matched ·OH + Methyl 6-(trifluoromethyl)-2-pyridinyl ether → Products
4 records matched ·OH + C4F9SO2N(CH3)CH2CH2OH → Products
2 records matched ·OH + Dibenzo[b,e][1,4]dioxin, 2,7-dichloro- → Products
1 record matched ·OH + 1,1'-Biphenyl, 2,4-dichloro- → Products
1 record matched ·OH + 2,3-DIMETHYLPENTANAL → Products
4 records matched ·OH + CH2=CHCF3 → Products
2 records matched ·OH + acetyl cedrene → Products
6 records matched ·OH + CF3CH2OCHO → Products
1 record matched ·OH + 4-methylcyclohex-3-en-1-one → Products
3 records matched ·OH + (CH3O)2P(S)NHCH3 → Products
1 record matched ·OH + Dibenzo[b,e][1,4]dioxin, 1,2,3,4-tetrachloro- → Products
1 record matched ·OH + Dibenzo[b,e][1,4]dioxin, 2,3-dichloro- → Products
3 records matched ·OH + 4-hydroxy-2-butenal → Products
1 record matched ·OH + trans-CHF=CHCF3 → Products
1 record matched ·OH + CH3CD2CD3 → Products
2 records matched ·OH + CH2FOCH(CF3)2 → Other Products + H2O
6 records matched ·OH + CH2FOCH(CF3)2 → Products
2 records matched ·OH + (CH3O)2P(S)N(CH3)2 → Products
3 records matched ·OH + CHF2OCHClCF3 → Other Products + H2O
3 records matched ·OH + CHF2OCHClCF3 → Products
1 record matched ·OH + HO2NO2 → H2O2 + NO3
1 record matched ·OH + HO2NO2 → HO2 + HNO3
7 records matched ·OH + HO2NO2 → Products
2 records matched ·OH + HC(O)CH2CH2CH2OH → Products
1 record matched ·OH + Na2 → Products
4 records matched ·OH + CH2=CHC6F13 → Products
10 records matched ·OH + CH3CCl2F → ·CH2CCl2F + H2O
1 record matched ·OH + Bicyclo[3.1.1]heptan-2-one, 6,6-dimethyl- → Products + (CH3)2CO
2 records matched ·OH + Bicyclo[3.1.1]heptan-2-one, 6,6-dimethyl- → Products
1 record matched ·OH + CHF2CHFCHF2 → Other Products + H2O
1 record matched ·OH + CHF2CHFCHF2 → Products
1 record matched ·OH + C9H8O2 → Products
1 record matched ·OH + trans-1,1,2,2,3,4-hexafluorocyclobutane → Products
3 records matched ·OH + cis-cyclo-CF2CF2CHFCHF- → Products
2 records matched ·OH + CH2(ONO2)CH(ONO2)CH=CH2 → Products
2 records matched ·OH + n-C4H9CH(CH3)NO3 → Products
2 records matched ·OH + n-C3H7CH(CH3)NO3 → Products
3 records matched ·OH + C8F17CH=CH2 → Products
2 records matched ·OH + 2(3H)-Furanone → Products
2 records matched ·OH + CH3CH2CH(ONO2)CH2(ONO2) → Products
1 record matched ·OH + C2H5CH=C=O → Products
1 record matched ·OH + (E)-CH2=CHCH=CHC2H5 → Products
4 records matched ·OH + CH2=CHC4F9 → Products
2 records matched ·OH + 1,3-diethylhexane → Products
1 record matched ·OH + Diborane(6) → H2O + B2H5
1 record matched ·OH + (CD3)3CD → Products
5 records matched ·OH + trans-2-Nonenal → Products
2 records matched ·OH + (E)-2-Hepten-1-al → Products
6 records matched ·OH + (E)-β-Famesene → Products
1 record matched ·OH + CH3CH=CHC(O)OCH3 → Products
1 record matched ·OH + CH2CHCF2CF2Br → Products
1 record matched ·OH + 7-Octen-2-ol, 2,6-dimethyl- → Products
1 record matched ·OH + (O)CHCH=CHCH=CH(O)-(E,E) → Products
2 records matched ·OH + 1-Tridecene, 2-methyl- → Products
8 records matched ·OH + N → NO + H·
22 records matched ·OH + O· → O2 + H·
1 record matched ·OH + CH3S(O)OH → Other Products + SO2
1 record matched ·OH + CH3S(O)OH → Products
5 records matched ·OH + (Z)-CH3COCH=CHCOCH3 → Products
3 records matched ·OH + OClO → Products
2 records matched ·OH + (CH3O)2P(S)NH2 → Products
2 records matched ·OH + (CD3)2O → CD3OCD2· + HDO
1 record matched ·OH + CF3O2 → HO2 + CF3O
2 records matched ·OH + CH3O(CH2)3OCH3 → Products
1 record matched ·OH + CH3SD → Other Products + HDO
1 record matched ·OH + CH3SD → Products
1 record matched ·OH + CH3SD → CH2SD + H2O
2 records matched ·OH + D → H· + OD
1 record matched ·OH + 3-Pentenenitrile, (3E)- → Products
1 record matched ·OH + 1,4-Oxathiane → Products
2 records matched ·OH + C2H5CH(CH3)CH2CHO → Products
1 record matched ·OH + H2C=N → Products
6 records matched ·OH + Benzaldehyde, 2,4-dimethyl- → Products
1 record matched ·OH + CH3CO → Products
1 record matched ·OH + BrO → O2 + HBr
4 records matched ·OH + BrO → Products
7 records matched ·OH + ClO → HCl + O2
4 records matched ·OH + ClO → HO2 + Cl
12 records matched ·OH + ClO → Products
2 records matched ·OH + 2,3-Dimethylfuran → Products
4 records matched ·OH + (E)-4-C8H16 → Products
4 records matched ·OH + (E)-2-C7H14 → Products
2 records matched ·OH + ClONO2 → Products
5 records matched ·OH + HNO → H2O + NO
1 record matched ·OH + HOI → Products
1 record matched ·OH + CH3OCH2CH2CH(OCH3)2 → Products
2 records matched ·OH + HD → H· + HDO
1 record matched ·OH + HD → Products
2 records matched ·OH + β-Ocimene → Products
1 record matched ·OH + BrCl → HOCl + Br·
2 records matched ·OH + BrCl → Products
3 records matched ·OH + CHF2OCF2CHFCl → Other Products + H2O
3 records matched ·OH + SO → SO2 + H·
1 record matched ·OH + NH2 → NH2OH
1 record matched ·OH + NH2 → H2O + NH
2 records matched ·OH + NH2 → Products
1 record matched ·OH + OD → HDO + O·
3 records matched ·OH + DBr → Br· + HDO
1 record matched ·OH + HOBr → Products
1 record matched ·OH + 3-Carene → Products
2 records matched ·OH + ClNO2 → HOCl + NO2
1 record matched ·OH + NH2O → H2O + HNO
1 record matched ·OH + (CD3)3CH → Products
2 records matched ·OH + Bicyclo[2.2.1]heptan-2-one,3,3-dimethyl- → Products
1 record matched ·OH + (CH3)3CD → Products
2 records matched ·OH + CH3O(CH2)4OCH3 → Products
5 records matched ·OH + (CF3)2CHOCH3 → Products
2 records matched ·OH + C7H7NO3 → Products
2 records matched ·OH + CD3NO2 → Products
3 records matched ·OH + 1,1'-Biphenyl, 2,2'-dichloro- → Products
45 records matched ·OH + H· → H2O
2 records matched ·OH + Cl2O2 → HOCl + ClOO
1 record matched ·OH + C2 → CO + ·CH
2 records matched ·OH + NO3 → HO2 + NO2
2 records matched ·OH + NO3 → Products
4 records matched ·OH + C2H5C(CH3)=C(CH3)2 → Products
1 record matched ·OH + Ethyl crotonate → Products
1 record matched ·OH + BCl3 → Other Products + Cl
1 record matched ·OH + BBr3 → Other Products + Br·
3 records matched ·OH + CH3C(O)C(OH)=C(OH)C(O)CH3 → Products
13 records matched ·OH + NO2 → HOONO
72 records matched ·OH + NO2 → HNO3
3 records matched ·OH + NO2 → HO2 + NO
10 records matched ·OH + NO2 → Products
2 records matched ·OH + NO2 → cis, cis-HOONO
2 records matched ·OH + NO2 → trans, perp-HOONO
43 records matched ·OH + NO → HNO2
1 record matched ·OH + NO → Products
2 records matched ·OH + N2O5 → Products
1 record matched ·OH + SiO → (·)Si(O)OH
1 record matched ·OH + SiO → SiO2 + H·
1 record matched ·OH + SiO → Products
3 records matched ·OH + (E)-ClCH2CH=CHCl → Products
3 records matched ·OH + (Z)-ClCH2CH=CHCl → Products
23 records matched ·OH + HBr → H2O + Br·
7 records matched ·OH + HI → H2O + I
12 records matched ·OH + O3 → HO2 + O2
2 records matched ·OH + POCl3 → Products
3 records matched ·OH + N2O → HO2 + N2
2 records matched ·OH + N2O → Products
4 records matched ·OH + hymexazol → Products
2 records matched ·OH + SiH4 → H2O + SiH3
1 record matched ·OH + SiH4 → Products
1 record matched ·OH + PH3 → H2O + PH2
1 record matched ·OH + NH2OH → H2O + NHOH
1 record matched ·OH + Cl2O → HOCl + ClO
3 records matched ·OH + Cl2O → Products
1 record matched ·OH + ICl → HOCl + I
1 record matched ·OH + ICl → Products
1 record matched ·OH + HOCl → H2O + ClO
1 record matched ·OH + PBr3 → Products
1 record matched ·OH + IBr → HOBr + I
1 record matched ·OH + IBr → Br· + HOI
1 record matched ·OH + IBr → Products
1 record matched ·OH + NF3 → Products
16 records matched ·OH + H2S → H2O + SH
2 records matched ·OH + HN3 → H2O + ·N3
1 record matched ·OH + HN3 → Products
10 records matched ·OH + HNO2 → H2O + NO2
3 records matched ·OH + GeH4 → H2O + GeH3
3 records matched ·OH + Cl2 → HOCl + Cl
2 records matched ·OH + Cl2 → Products
1 record matched ·OH + O2 → HO2 + O·
2 records matched ·OH + O2 → HO3
9 records matched ·OH + D2 → HDO + D
2 records matched ·OH + CH3CH(OCH3)CH2OCH3 → Products
1 record matched ·OH + H2O + H· → H2O + H2O
1 record matched ·OH + H2O → ·OH + H2O
5 records matched ·OH + Br2 → Br· + HOBr
1 record matched ·OH + Br2 → HBr + BrO
1 record matched ·OH + Br2 → Products
34 records matched ·OH + H2O2 → HO2 + H2O
1 record matched ·OH + PCl3 → Products
1 record matched ·OH + S → H· + SO
6 records matched ·OH + DCl → HDO + Cl
17 records matched ·OH + HNO3 → H2O + NO3
1 record matched ·OH + HNO3 → H2O2 + NO2
12 records matched ·OH + HNO3 → Products
23 records matched ·OH + NH3 → H2O + NH2
17 records matched ·OH + HCl → H2O + Cl
1 record matched ·OH + HCl → Products
2 records matched ·OH + n-C4D10 → Products
5 records matched ·OH + I2 → HOI + I
28 records matched ·OH + SO2 → HOSO2
4 records matched ·OH + SO2 → Products
1 record matched ·OH + Cs → CsOH
3 records matched ·OH + Na → NaOH
1 record matched ·OH + Si → SiO + H·
1 record matched ·OH + Rb → RbOH
3 records matched ·OH + K → KOH
9 records matched ·OH + Hg → Products
1 record matched ·OH + Li → LiOH
1 record matched ·OH + Cyclopentane-d10 → HDO + Cyclopentyl-d9
2 records matched ·OH + (E)-CH2=CHCH2CH=CHCH3 → Products
1 record matched ·OH + CD3SH → Products
1 record matched ·OH + CH3CF2CCl2F → Other Products + H2O
1 record matched ·OH + 2-bromodiphenyl ether → Products
2 records matched ·OH + Diethyl methylphosphonothioate → Products
1 record matched ·OH + D2O2 → DO2 + HDO
1 record matched ·OH + 3,3'-dibromodiphenylether → Products
1 record matched ·OH + 3-bromodiphenyl ether → Products
7 records matched ·OH + cis-3-Hexenal → Products
3 records matched ·OH + Humulene → Products
4 records matched ·OH + CH3C(O)CH2(ONO2) → Products
8 records matched ·OH + CH3CH2CH2CHCHCHO → Products
2 records matched ·OH + CH3NHC(O)OCH3 → Products
2 records matched ·OH + Ethane, 1-bromo-2-methoxy- → Other Products + H2O
2 records matched ·OH + 2,3-Butanediol, dinitrate → Products
2 records matched ·OH + 1,2-Propanediol, dinitrate → Products
1 record matched ·OH + CD2=CDCD2CD3 → Products
2 records matched ·OH + Chlordimeform → Products
9 records matched ·OH + (CH3O)2P(O)C2H5 → Products
3 records matched ·OH + (tert-C4H9)2O → Products
1 record matched ·OH + CD3ONO2 → Products
7 records matched ·OH + CH3CH=CHCH2OH → Products
8 records matched ·OH + n-C3H7CH(OH)CH3 → Products
1 record matched ·OH + CH3CH=C=O → Products
2 records matched ·OH + d-Limonene → Other Products + H2O
4 records matched ·OH + d-Limonene → Products
6 records matched ·OH + Benzaldehyde, 3,4-dimethyl- → Products
1 record matched ·OH + CH3COCH2OCH3 → Products
1 record matched ·OH + (E)-Ethyl tiglate → Products
3 records matched ·OH + Benzaldehyde, 3,5-dimethyl- → Products
6 records matched ·OH + Benzaldehyde, 2,5-dimethyl- → Products
3 records matched ·OH + Benzaldehyde, 2,3-dimethyl- → Products
3 records matched ·OH + 2,4,5-Trimethylbenzaldehyde → Products
2 records matched ·OH + CH3C(O)CH=CHCH(O) → Products
6 records matched ·OH + Chloropyriphos-methyl → Products
5 records matched ·OH + Z-CF3CFCHF → Products
1 record matched ·OH + (CD3)4C → HDO + (CD3)3CCD2
1 record matched ·OH + C2H5OCH2CH2OCH3 → Products
2 records matched ·OH + C4H9OCH2CH(OH)CH3 → Products
3 records matched ·OH + C2H5C(O)CH2OH → Products
2 records matched ·OH + C2H5CH(OH)C(O)C2H5 → Products
2 records matched ·OH + C7H7NO3 → Products
1 record matched ·OH + 1H-Indene,octahydro-cis- → Products
5 records matched ·OH + C3H6O3 → Products
1 record matched ·OH + α-Phellandrene (R) → Products
1 record matched ·OH + (E)-CH3CH=CHCHO → Other Products + H2O
1 record matched ·OH + (E)-CH3CH=CHCHO → Adduct
4 records matched ·OH + (E)-CH3CH=CHCHO → Products
1 record matched ·OH + (CH3)2NNO2 → Products
1 record matched ·OH + (E)-CH3N=NCH3 → Products
2 records matched ·OH + Cycloheptane, methyl- → Products
1 record matched ·OH + CH3CDO → Products
2 records matched ·OH + N,N-Diisopropylaniline → Products
1 record matched ·OH + 1,3-Cycloheptadiene → Products
1 record matched ·OH + CH2=C(CH3)CH2CH2CH=CH2 → Products
1 record matched ·OH + Copaene → Products
3 records matched ·OH + Pentafluorodimethyl ether → H2O + CF3OCF2(·)
1 record matched ·OH + Pentafluorodimethyl ether → Products
1 record matched ·OH + NF2 → HF + FNO
1 record matched ·OH + CH2=CHCH2C(O)OCH3 → Products
1 record matched ·OH + (C2H5)2NOH → Products
2 records matched ·OH + CH3C(O)OCH2CH2CH=CHCH2CH3-(Z) → Products
2 records matched ·OH + E-(O)CHCH=CHCH(O) → Products
2 records matched ·OH + Z-(O)CHCH=CHCH(O) → Products
1 record matched ·OH + CH2=CHNO2 → Products
2 records matched ·OH + Cyclopropane,(1-methylethyl)- → Products
3 records matched ·OH + Sabinene → Products
25 records matched ·OH + ·OH → H2O + O·
2 records matched ·OH + ·OH → H2O + H·
25 records matched ·OH + ·OH → H2O2
1 record matched ·OH → H· + O·
2 records matched CF3CF2CF2OCHFCF3 + ·OH → Products
1 record matched ·CH + NO2 → ·OH + CNO
2 records matched ·CH + NO → CN + ·OH
4 records matched ·CH + O2 → CO + ·OH
1 record matched 1H-Indene,octahydro-trans- + ·OH → Products
1 record matched Dibenzo[b,e][1,4]dioxin, octachloro- + ·OH → Products
1 record matched HC(13)HO + ·OH → Products
2 records matched (CH3)3SiCH2OH + ·OH → Products
2 records matched 2-Ethylfuran + ·OH → Products
1 record matched HO2 + CH3CH2C(O)OO → ·OH + O2 + CH3CH2C(O)O
3 records matched HO2 + CH3C(O)CH2OO· → CH3C(O)CH2O· + ·OH + O2
1 record matched HO2 + CH3OCH2O2 → ·OH + O2 + CH3OCH2
2 records matched HO2 + CH3C(O)OO(·) → ·OH + O2 + CH3C(O)O
1 record matched HO2 + CH3C(O)OO(·) → CH3C(O)O(·) + ·OH + O2
1 record matched HO2 + HOCH2OO → ·OH + O2 + HOCH2O
8 records matched HO2 + Cl → ·OH + ClO
15 records matched HO2 + O· → ·OH + O2
2 records matched HO2 + NH2 → ·OH + NH2O
6 records matched HO2 + H· → ·OH + ·OH
2 records matched HO2 + NO3 → ·OH + O2 + NO2
2 records matched HO2 + NO3 → Other Products + ·OH
30 records matched HO2 + NO → ·OH + NO2
1 record matched HO2 + O3 → ·OH + O2 + O2
8 records matched HO2 + O3 → Other Products + ·OH
2 records matched HO2 + (Z)-2-C6H12 → ·OH + Oxirane, 2-methyl-3-propyl-, cis-
5 records matched HO2 + SO2 → ·OH + SO3
2 records matched HO2 + (E)-2-C6H12 → ·OH + Oxirane, 2-methyl-3-propyl-, trans-
36 records matched HO2 + ·OH → H2O + O2
1 record matched CH3CO + O· → H2C=C=O + ·OH
3 records matched CH3CO + O2 → Other Products + ·OH
1 record matched CH3CO + O2 → Products + ·OH
1 record matched Cyclohexyl + O· → Cyclohexene + ·OH
1 record matched Cyclohexyl + O2 → Products + ·OH
1 record matched (CH3)2CHOOH → ·OH + i-C3H7O
1 record matched CH3CH2OOH + ·OH → Products
1 record matched CH3CH2OOH → CH3CH2O· + ·OH
3 records matched CH3OOH + ·OH → H2O + CH2OOH
2 records matched CH3OOH + ·OH → CH3O2· + H2O
3 records matched CH3OOH + ·OH → Products
3 records matched CH3OOH → CH3O· + ·OH
2 records matched (CH3)2NC(O)SCH3 + ·OH → Products
1 record matched Cyclobutanecarboxaldehyde + ·OH → Products
4 records matched neo-C5H11CHO + ·OH → Products
1 record matched CH2C≡CH + ·OH → HCO + C2H3
1 record matched CH3CH2CD3 + ·OH → Products
1 record matched CD3CH2CD3 + ·OH → Products
1 record matched CH3CD2CH3 + ·OH → Products
1 record matched CD3CD2CD3 + ·OH → Products
6 records matched CF3CHFCl + ·OH → CF3CFCl· + H2O
1 record matched C2H5SiH3 + O· → ·OH + C2H5SiH2(·)
3 records matched CH3CH2CH2OCH2CH2OH + ·OH → Products
1 record matched Cyclobutene, 3,3,4,4-tetrafluoro- + ·OH → Products
7 records matched Cyclobutaneacetaldehyde, 3-acetyl-2,2-dimethyl- + ·OH → Products
1 record matched SO2F2 + ·OH → Products
3 records matched NOCl + ·OH → HOCl + NO
2 records matched NOCl + ·OH → HNO2 + Cl
2 records matched NOCl + ·OH → Products
1 record matched C2H3 + O· → C2H2 + ·OH
1 record matched CH3CH(NO2)CH(CH3)2 + ·OH → Products
1 record matched (Z)-CH2=CHCH=CHCH=CH2 + ·OH → Products
4 records matched HCO + O· → CO + ·OH
1 record matched HCO + NO2 → CO + ·OH + NO
2 records matched HCO + O2 → CO2 + ·OH
2 records matched HCO + ·OH → CO + H2O
2 records matched (·)CH2OH + O· → CH2O + ·OH
1 record matched CH2(n-C4H9O)2 + ·OH → Products
1 record matched HC(O)Cl + ·OH → Products
2 records matched COOH → CO + ·OH
1 record matched cyclohexene,1-nitro- + ·OH → Products
5 records matched trans-CH3(CH2)4CH=CHCHO + ·OH → Products
1 record matched 2-Methylphenanthrene + ·OH → Products
2 records matched (CH3O)2P(S)Cl + ·OH → Products
1 record matched CH3OCH(CH3)CH2CH2OH + ·OH → Products
5 records matched (E)-CH3CH=CHC(=O)C2H5 + ·OH → Products
1 record matched n-C4H9 + O· → 1-C4H8 + ·OH
2 records matched 1-C13H26 + ·OH → Products
1 record matched Cyclopropyl + O2 → ·OH + Cyclopropanone
7 records matched Phenol, 2,3,6-trimethyl- + ·OH → Products
1 record matched Phenyl + H2O → Benzene + ·OH
1 record matched (CF3)3COH + ·OH → Products
1 record matched CH3SCH2Cl + ·OH → Products
2 records matched 2-Ethoxyethyl methacrylate + ·OH → Products
5 records matched 1,2,2,2-tetrafluoroethyl trifluoromethyl ether + ·OH → Products
4 records matched CF3OCF2CHF2 + ·OH → Products
1 record matched sec-C4H9 + O2 → ·OH + trans-2,3-Dimethyloxirane
1 record matched sec-C4H9 + O2 → cis-2,3-Dimethyloxirane + ·OH
1 record matched sec-C4H9 + O2 → Tetrahydrofuran + ·OH
1 record matched sec-C4H9 + O2 → Ethyloxirane + ·OH
2 records matched sec-C4H9 + O2 → C2H5COCH3 + ·OH
4 records matched CH3CHOH + O· → CH3CHO + ·OH
3 records matched CF3I + ·OH → ·CF3 + HOI
1 record matched CF3I + ·OH → Products
1 record matched 4-Methoxyphenyl isothiocyanate + ·OH → Products
4 records matched CH3C(O)OONO2 + ·OH → Products
1 record matched ·CF3 + ·OH → COF2 + HF
1 record matched C2F5CF2H + O· → n-C3F7 + ·OH
11 records matched CF3CH2CH2OH + ·OH → Products
2 records matched ·CH3 + NO → ·OH + H2C=N
22 records matched ·CH3 + O2 → CH2O + ·OH
3 records matched ·CH3 + ·OH → H2O + ·CH2
2 records matched ·CH3 + ·OH → (·)CH2OH + H·
2 records matched ·CH3 + ·OH → CH3O· + H·
3 records matched ·CH3 + ·OH → H2 + HOCH
13 records matched ·CH3 + ·OH → CH3OH
3 records matched ·CH3 + ·OH → CH2O + H2
11 records matched ·CH3 + ·OH → Products
2 records matched ·CH3 + ·OH → CH2(1) + H2O
1 record matched ·CH3 + HO2 → CH3O· + ·OH
1 record matched CD3CN + ·OH → Products
2 records matched ·CF2 + ·OH → COF2 + H·
1 record matched ·CF2 + ·OH → Products
1 record matched Benzyl + ·OH → Benzyl alcohol
1 record matched Benzyl + HO2 → ·OH + C6H5CH2O
1 record matched CH3O· + H· → ·CH3 + ·OH
1 record matched n-C3H7 + O2 → C2H5CHO + ·OH
1 record matched n-C3H7 + O2 → Methyloxirane + ·OH
5 records matched 3-Hydroxypropanal + ·OH → Products
1 record matched cyclohexylnitrate + ·OH → Products
1 record matched 1,1'-Biphenyl, 4-chloro- + ·OH → Products
1 record matched 1,1'-Biphenyl, 3-chloro- + ·OH → Products
1 record matched 1,1'-Biphenyl, 2-chloro- + ·OH → Products
1 record matched 1,1'-Biphenyl, 4,4'-dichloro- + ·OH → Products
2 records matched 1,1'-Biphenyl, 3,3'-dichloro- + ·OH → Products
1 record matched 4,4'-dibromodiphenylether + ·OH → Products
1 record matched Cyclohexane-1-carboxaldehyde + ·OH → Products
5 records matched n-C4F9CH2CH2I + ·OH → Products
5 records matched F(CF2CF2)2CH2CH2OH + ·OH → Products
1 record matched C6D5CD3 + ·OH → C6D5CD2 + HDO
4 records matched C6D5CD3 + ·OH → Products
1 record matched CH3CD3 + ·OH → Products
1 record matched ·C2H5 + O· → C2H4 + ·OH
2 records matched ·C2H5 + O2 → Oxirane + ·OH
3 records matched ·C2H5 + O2 → CH3CHO + ·OH
2 records matched ·C2H5 + ·OH → C2H5OH
1 record matched ·C2H5 + ·OH → Products
1 record matched ·C2H5 + HO2 → CH3CH2O· + ·OH
1 record matched iso-C3H7 + O· → ·OH + CH3CH=CH
1 record matched (E)-CH2=CHCH=CHCH3 + O3 → Other Products + ·OH
1 record matched (E)-CH2=CHCH=CHCH3 + ·OH → Products
1 record matched ·CH2CH=CH2 + O· → CH2=C=CH2 + ·OH
1 record matched ·CH2CH=CH2 + O· → CH3CCH + ·OH
4 records matched Propachlor + ·OH → Products
5 records matched CF3CH2OCHF2 + ·OH → Products
2 records matched CH3CH2CH(CH3)CH2SH + ·OH → Products
3 records matched (CH2Cl)2C=CH2 + ·OH → Products
1 record matched CH3CD2OH + ·OH → Products
1 record matched C2D5OH + ·OH → Products
1 record matched CD3OH + ·OH → Products
1 record matched Naphthalene, 1,4-dichloro- + ·OH → Products
1 record matched CF3CF2CH3 + ·OH → Products
1 record matched Cyclohexane-d12 + ·OH → HDO + Cyclohexyl-d11
1 record matched Silane, dichlorodiethyl- + O· → Other Products + ·OH
6 records matched (CH3)2CHONO2 + ·OH → Products
1 record matched (CH3)2CHONO2 + ·OH → (CH3)2C(·)ONO2 + H2O
1 record matched CHF2-O-CHF2 + ·OH → Products
5 records matched CHF2-O-CHF2 + ·OH → CHF2OCF2· + H2O
2 records matched n-Butylcyclohexane + ·OH → Products
2 records matched Propylcyclohexane + ·OH → Products
1 record matched CHDO + ·OH → Products
3 records matched CF2ClCH2Cl + ·OH → ·CHClCClF2 + H2O
3 records matched C3H2F4 + ·OH → Products
13 records matched tert-C4H9OCH3 + ·OH → Other Products + H2O
1 record matched tert-C4H9OCH3 + ·OH → Products
1 record matched C2D6 + ·OH → HDO + ·C2D5
1 record matched CD3CDO + ·OH → Products
1 record matched Fenchol + ·OH → Products
1 record matched C2H5COCH=CH2 + ·OH → Products
1 record matched C6D5CH3 + ·OH → H2O + C6D5CH2
2 records matched C6D5CH3 + ·OH → Products
1 record matched Cyclohexene-d10 + O3 → Other Products + ·OH
1 record matched Si2H6 + O· → ·OH + Si2H5
1 record matched (CF3)2C=CFC2F5 + ·OH → Products
1 record matched 2-Penten-1-ol, (E)- + ·OH → Products
2 records matched C2H5CH=CHCH2OH-(Z) + ·OH → Products
2 records matched CH3CH2CHCHCHO + ·OH → Products
2 records matched CH3C(O)O(CH2)3CH=CH2 + ·OH → Products
1 record matched (Z)-CH2=CHCH=CHCH3 + O3 → Other Products + ·OH
2 records matched (Z)-CH2=CHCH=CHCH3 + ·OH → Products
7 records matched 6-Methyl-5-hepten-2-ol + ·OH → Products
1 record matched FC(O)OCH3 + ·OH → Products
1 record matched CD3CD=CD2 + O3 → Other Products + ·OH
1 record matched CD3CD=CD2 + ·OH → HDO + CD2CD=CD2
3 records matched CD3CD=CD2 + ·OH → Products
1 record matched CD3CH=CH2 + ·OH → Products
1 record matched CH3CD=CD2 + ·OH → Products
1 record matched Phenanthrene-d10 + ·OH → Products
1 record matched (Z)-2-C4F8 + ·OH → Products
1 record matched (E)-2-C4F8 + ·OH → Products
1 record matched C2D5OD + ·OH → Products
1 record matched (CF3)2C(OH)CH3 + ·OH → Products
1 record matched CF2ClC(O)OCH3 + ·OH → Products
8 records matched CH2CBrCF3 + ·OH → Products
5 records matched CHBrF2 + ·OH → H2O + CBrF2
2 records matched Cyclodecanone + ·OH → Products
2 records matched HFCO + ·OH → FCO + H2O
1 record matched Cyclopropanecarboxaldehyde + ·OH → Products
1 record matched Benzene oxide + ·OH → Products
1 record matched Furan, 2-ethenyl- + ·OH → Products
1 record matched Furan, 2,3-dihydro-5-methyl- + ·OH → Products
1 record matched CH2=CH-CH2-N=C=O + ·OH → Products
2 records matched CD2=CDCD=CD2 + ·OH → Products
1 record matched CH2=CHCH2OCF2CF2H + ·OH → Products
53 records matched H2 + O· → ·OH + H·
2 records matched H2 + ClO → ·OH + HCl
6 records matched H2 + O2 → ·OH + ·OH
1 record matched H2 + H2O2 → H2 + ·OH + ·OH
50 records matched H2 + ·OH → H2O + H·
1 record matched NaOH → ·OH + Na
1 record matched KOH → ·OH + K
2 records matched HHCB + ·OH → Products
1 record matched Bicyclo[2.2.1]heptane-2-one,1,3,3-trimethyl + ·OH → Products
1 record matched 3-methyl-2-cyclohexen-1-one + ·OH → Products
1 record matched Cyclobutanone + ·OH → Products
6 records matched CF3OCF=CF2 + ·OH → Products
1 record matched CH3CH2C(O)NHCH3 + ·OH → Products
4 records matched CD3COOD + ·OH → Products
1 record matched Naphthalene d8 + ·OH → Products
2 records matched Isolongipholene + ·OH → Products
2 records matched Carbonothioic acid, cyclohexylethyl-, S-ethyl ester + ·OH → Products
1 record matched 1-ethylnaphthalene + ·OH → Products
1 record matched C6H5CD3 + ·OH → C6H5CD2 + HDO
2 records matched C6H5CD3 + ·OH → Products
3 records matched Benzaldehyde, 2,6-dimethyl- + ·OH → Products
1 record matched 2,5-Pyrrolidinedione, 1-methyl- + ·OH → Products
1 record matched 4-Methyl-1,3-dioxane + ·OH → Products
2 records matched 1-Tetradecene + ·OH → Products
1 record matched n-C11H24 + ·OH → Other Products + H2O
5 records matched CH3OC(O)CH2CH2CH2C(O)OCH3 + ·OH → Products
2 records matched CH3CH(CH3)C2H4CHO + ·OH → Products
1 record matched (CH3)3CCH2OCH3 + O· → Other Products + ·OH
2 records matched Vinyl sulfoxide + ·OH → Products
4 records matched CD3COOH + ·OH → Products
1 record matched (CH3)2SiH2 + O· → ·OH + (CH3)2SiH
1 record matched (CH3)2SiH2 + ·OH → Products
1 record matched Benzene-d6 + ·OH → HDO + Phenyl-d5 radical
1 record matched Benzene-d6 + ·OH → Products
2 records matched HC(O)CH2CH2CH2CH2C(O)H + ·OH → Products
4 records matched 5-Hydroxy-2-pentanone + ·OH → Products
1 record matched C2D2 + ·OH → Adduct
2 records matched Pentane, 3,3-diethyl- + ·OH → Other Products + H2O
2 records matched Nitric acid, pentyl ester + ·OH → Products
2 records matched Ethyl 3-ethoxyacrylate + ·OH → Products
1 record matched CF3CHFCF2OCH2CF2CF3 + ·OH → Products
1 record matched (C2H5)3SiCl + O· → Other Products + ·OH
4 records matched C2H5C(CH3)2OCH3 + ·OH → Other Products + H2O
2 records matched CF3CHFCF2OCH2CF3 + ·OH → Products
2 records matched (CH3)3SiH + O· → ·OH + (CH3)3Si·
1 record matched (CH3)3SiH + ·OH → Products
1 record matched CH3SiH3 + O· → ·OH + CH3SiH2
1 record matched CH3SiH3 + ·OH → Products
1 record matched 2-Ethylnaphthalene + ·OH → Products
2 records matched cis-Cyclodecene + ·OH → Products
2 records matched cis-Cyclooctene + ·OH → Products
1 record matched Bicyclo[2.2.2]oct-2-ene + ·OH → Products
14 records matched 3-Methylfuran + ·OH → Products
1 record matched 3-Hexen-1-ol, (E)- + ·OH → Products
4 records matched 3-Hexen-1-ol, (Z)- + ·OH → Products
2 records matched 2-Hexen-1-ol, (E)- + ·OH → Products
5 records matched n-C4H9ONO2 + ·OH → Products
1 record matched (CH3)2C=CHCH=CH2 + ·OH → Products
1 record matched 1-Propanol, 2,2-dimethyl-, nitrate + ·OH → Products
4 records matched (CD3)2S + ·OH → CD3S(OH)CD3
3 records matched (CD3)2S + ·OH → Products
2 records matched (CD3)2S + ·OH → CD3SCD2· + HDO
3 records matched t-C4H9OCH=CH2 + ·OH → Products
4 records matched C2H5CH(CH3)ONO2 + ·OH → Products
1 record matched (CH3)2CCHC(O)OCH3 + ·OH → Products
1 record matched CH3CH2CH(CH3)ONO + ·OH → Products
3 records matched CF3CH(OH)CF3 + ·OH → Products
5 records matched 3-Methyl-1-penten-3-ol + ·OH → Products
2 records matched CCl3COCH3 + ·OH → Products
2 records matched DCOOH + ·OH → Products
1 record matched 9-Methylphenanthrene + ·OH → Products
1 record matched (E)-1-Phenylpropene + ·OH → Products
2 records matched C5H9CHO + ·OH → Products
3 records matched 2-Pyrrolidone, 1-methyl- + ·OH → Products
3 records matched 1-C10H20 + ·OH → Products
5 records matched (CH3O)2PHO + ·OH → Products
1 record matched 3-Methylphenanthrene + ·OH → Products
1 record matched 1-Methylphenanthrene + ·OH → Products
1 record matched 1,3-Benzenediamine, 2-methyl- + ·OH → Products
3 records matched 1-Undecene + ·OH → Products
1 record matched n-C7H15COCH3 + ·OH → Products
1 record matched (E)-CH2=CHCH=CHCH=CH2 + ·OH → Products
5 records matched (E)-CH3COCH=CHCOCH3 + ·OH → Products
1 record matched CH2=CHCH2F + ·OH → Products
2 records matched 3-methyl-2,4-pentanedione + ·OH → Products
2 records matched CD3OD + ·OH → Products
13 records matched CF3CH2F + ·OH → H2O + CF3CHF
2 records matched Acetaldehyde, chlorodifluoro- + ·OH → Products
2 records matched Benzene,(2-methyl-1-propenyl)- + ·OH → Products
1 record matched Glycidaldehyde + ·OH → Products
5 records matched Diethylene glycol divinyl ether + ·OH → Products
5 records matched CH2=CHOCH2CH2OCH=CH2 + ·OH → Products
2 records matched Ethylene glycol monovinyl ether + ·OH → Products
9 records matched n-C3H7OCH=CH2 + ·OH → Products
1 record matched (CH3)2C=CHCH=C(CH3)2 + ·OH → Products
1 record matched CH3CH2OCH2CH2C(O)OCH2CH3 + ·OH → Products
7 records matched CH2=C(CH3)CH2CH2OH + ·OH → Products
1 record matched CH2=C(CH3)CH2CH=CH2 + ·OH → Products
2 records matched C2H5CH2C(CH3)=CH2 + ·OH → Products
1 record matched HC(O)OC(CH3)3 + ·OH → Other Products + H2O
2 records matched HC(O)OC(CH3)3 + ·OH → Products
5 records matched (CH3)3CCH2CH=CH2 + ·OH → Products
3 records matched (n-C3H7)2NC(O)SC2H5 + ·OH → Products
1 record matched CH3CH2C(O)N(CH3)2 + ·OH → Products
2 records matched Acetic acid-d + ·OH → Products
7 records matched (CH3O)2P(O)CH3 + ·OH → Products
2 records matched C2F5C(O)CF(CF3)2 + ·OH → Products
8 records matched CF3CF=CH2 + ·OH → Products
1 record matched CF3CH2NH2 + ·OH → Products
1 record matched t-C4H9CH2Cl + O· → Other Products + ·OH
1 record matched C10H10O2 + ·OH → Products
3 records matched C7H7NO3 + ·OH → Products
1 record matched Benzene, 1,2,3,4,5-pentamethyl- + ·OH → Products
7 records matched Phenol, 2,3,5-trimethyl- + ·OH → Products
3 records matched cyclo-CF2CFClCCl2CH2- + ·OH → Products
3 records matched Cyclobutene, hexafluoro- + ·OH → Products
2 records matched Isopropylcyclohexane + ·OH → Products
1 record matched Pentalene, octahydro- + ·OH → Products
1 record matched (n-C5H11)2O + O· → Other Products + ·OH
6 records matched (n-C5H11)2O + ·OH → Other Products + H2O
1 record matched n-C8H17COCH3 + ·OH → Products
1 record matched C4H9C≡CH + ·OH → Products
3 records matched (Z)-CF3CH=CHCF3 + ·OH → Products
8 records matched Propane, 1,1,1,3,3,3-hexafluoro- + ·OH → H2O + (CF3)2CH·
2 records matched CH3CH2OCF3 + ·OH → Products
2 records matched (E)-(CH3)3CCH=CHCH3 + ·OH → Products
6 records matched CF2=CFCF=CF2 + ·OH → Products
2 records matched C2D4 + ·OH → HDO + CD2CD
1 record matched C2D4 + ·OH → Adduct
1 record matched C2D4 + ·OH → Products
8 records matched (C2H5O)2P(O)CH3 + ·OH → Products
3 records matched Propane, 1,1,2,2,3-pentafluoro- + ·OH → Other Products + H2O
5 records matched F(CF2CF2)4CH2CH2OH + ·OH → Products
1 record matched Propane, 1,1,1,2,2,3-hexafluoro- + ·OH → CF3CF2CHF· + H2O
2 records matched CH3POCl2 + ·OH → Products
2 records matched CHD3 + ·OH → Products
2 records matched CH2D2 + ·OH → Products
5 records matched CH3D + ·OH → Products
2 records matched (E)-(CH3)2CHCH=CHCH3 + ·OH → Products
1 record matched CF3CH=CHCH2OH + ·OH → Products
4 records matched (CD3)2CO + ·OH → Products
8 records matched C6F13CH2CH2OH + ·OH → Products
3 records matched 1,3-Dioxolane + ·OH → Products
1 record matched 2-(E)-C5H10 + ·OH → Products
1 record matched C8O2 + ·OH → Products
1 record matched tert-C4H9OC2H5 + O· → Other Products + ·OH
7 records matched tert-C4H9OC2H5 + ·OH → Other Products + H2O
4 records matched tert-C4H9OC2H5 + ·OH → Products
1 record matched (C2H5)4Si + O· → Other Products + ·OH
2 records matched (C2H5)4Si + ·OH → Other Products + H2O
1 record matched CH2ClCCl3 + ·OH → H2O + CCl3CHCl
10 records matched 2,2-dimethylpropanal + ·OH → Products
91 records matched CO + ·OH → CO2 + H·
7 records matched CO + ·OH → Products
1 record matched CO + ·OH → HOCO
14 records matched CO + HO2 → CO2 + ·OH
1 record matched CH3(CH2)13CH3 + ·OH → Other Products + H2O
1 record matched CH3(CH2)12CH3 + ·OH → Other Products + H2O
1 record matched CH3(CH2)11CH3 + ·OH → Other Products + H2O
2 records matched C2H5OCH2CH2OC2H5 + ·OH → Products
1 record matched (Z)-Cycloheptene + O3 → Other Products + ·OH
1 record matched (Z)-Cycloheptene + ·OH → Products
8 records matched n-C4H9OC2H5 + ·OH → Other Products + H2O
4 records matched n-C4H9OC2H5 + ·OH → Products
1 record matched n-C5H11OCH3 + ·OH → Other Products + H2O
3 records matched Acetic acid, pentyl ester + ·OH → Products
2 records matched (iso-C4H9)2O + ·OH → Products
2 records matched 1,4-Cyclohexadiene + ·OH → Products
5 records matched CH3CH2OCH2CH2Cl + ·OH → Products
5 records matched n-C4H9OCH3 + ·OH → Other Products + H2O
3 records matched n-C5H11NO2 + ·OH → Products
5 records matched CH3OC(O)(CH2)4C(O)OCH3 + ·OH → Products
1 record matched CH2=C(CH3)CH2CH2C(CH3)=CH2 + ·OH → Products
2 records matched 2-Chloroethyl methyl ether + ·OH → Other Products + H2O
5 records matched 2-Chloroethyl methyl ether + ·OH → Products
10 records matched CH2=CHCH2CH2OH + ·OH → Products
4 records matched 2-(Z)-C5H10 + ·OH → Products
1 record matched C3H7C≡CH + ·OH → Products
4 records matched n-C3H7ONO2 + ·OH → Products
5 records matched n-C4H9NO2 + ·OH → Products
2 records matched CH3C(O)CH2CH2CHO + ·OH → Products
1 record matched n-C4H9CH(OH)CH3 + ·OH → Products
4 records matched 2,5-Dimethylfuran + ·OH → Products
4 records matched C2H5ONO2 + ·OH → Products
2 records matched HCOOCH(CH3)2 + ·OH → Other Products + H2O
3 records matched HCOOCH(CH3)2 + ·OH → Products
1 record matched CH2=CHCH2NO2 + ·OH → Products
5 records matched CH3CH=CHC(=O)CH3 (unspecified) + ·OH → Products
4 records matched (CH3)2C=CHC2H5 + ·OH → Products
1 record matched (CH3S)2 + ·OH → CH3S· + CH3SOH
1 record matched (CH3S)2 + ·OH → CH3SH + CH3SO
7 records matched (CH3S)2 + ·OH → Products
9 records matched CH3ONO + ·OH → Products
4 records matched C2H5SCH3 + ·OH → Products
2 records matched C2H5SCH3 + ·OH → CH3S(OH)C2H5
1 record matched C2H5NC + ·OH → CH3CHCN + H2O
1 record matched CH2FCH2F + O· → ·OH + CH2FCHF
1 record matched CH2FCH2F + ·OH → H2O + CH2FCHF
5 records matched CH2FCH2F + ·OH → Products
2 records matched (E)-2-C4H8 + O3 → Other Products + ·OH
1 record matched (E)-2-C4H8 + ·OH → H2O + (E)-CH3CH=CHCH2
11 records matched (E)-2-C4H8 + ·OH → Products
2 records matched (E)-2-C4H8 + HO2 → Oxirane, 2,3-dimethyl- + ·OH
3 records matched CH3(CH2)3COOCH3 + ·OH → Products
5 records matched n-C3H7COOCH3 + ·OH → Products
4 records matched Benzene, 1-ethyl-4-methyl- + ·OH → Products
1 record matched 3-Methylbenzaldehyde + ·OH → Products
4 records matched Benzene, 1-ethyl-3-methyl- + ·OH → Products
2 records matched 2-Furancarbocaldehyde, 5-methyl- + ·OH → Products
1 record matched (C2H5)3SiH + O· → ·OH + (C2H5)3Si(·)
2 records matched iso-C3H7C(O)OCH(CH3)2 + ·OH → Other Products + H2O
1 record matched CH3OCOOCH3 + O· → ·OH + CH3OC(O)OCH2·
1 record matched CH3OCOOCH3 + ·OH → H2O + CH3OC(O)OCH2·
2 records matched CH2=CHCH(OH)CH2CH3 + ·OH → Products
1 record matched C7H7NCS + ·OH → Products
2 records matched Anthracene, 9,10-dihydro- + ·OH → Products
4 records matched Benzene, 1-ethyl-2-methyl- + ·OH → Products
8 records matched CH3C(O)C(O)C2H5 + ·OH → Products
1 record matched CH3O(O)CC(CH3)3 + ·OH → Products
5 records matched (CH3)2CHCH(OH)CH3 + ·OH → Products
1 record matched C2BrF3 + ·OH → Products
7 records matched CH3ONO2 + ·OH → Products
1 record matched CH3CH(OH)CHO + ·OH → Products
1 record matched CH2=CHCH(OH)CH3 + ·OH → Products
1 record matched (CH3)2C=C=O + ·OH → Products
1 record matched CH2=C=C(CH3)2 + ·OH → Products
1 record matched Triethylsilanol + O· → Other Products + ·OH
1 record matched n-C3H7C(CH3)2NO2 + ·OH → Products
2 records matched (CH3O)2P(O)N(CH3)2 + ·OH → Products
1 record matched (CH3)3CC(CH3)3 + O· → ·OH + (CH3)3CC(CH3)2CH2
3 records matched (CH3)3CC(CH3)3 + ·OH → H2O + (CH3)3CC(CH3)2CH2
1 record matched (CH3)3CC(CH3)3 + ·OH → Products
1 record matched (CH3)2CHC(OH)(CH3)2 + ·OH → Products
2 records matched (CH3)2Se + ·OH → Products
1 record matched CH3OCl + ·OH → Products
1 record matched (CH3)2Hg + ·OH → Mercury, hydroxymethyl- + ·CH3
1 record matched CH2FCl + O· → ·OH + ·CClFH
7 records matched CH2FCl + ·OH → H2O + ·CClFH
2 records matched CH2=CHBr + ·OH → Products
3 records matched CH3F + O· → ·OH + ·CH2F
12 records matched CH3F + ·OH → ·CH2F + H2O
4 records matched Oxepane + ·OH → Products
2 records matched HCOO(CH2)3CH3 + ·OH → Products
5 records matched 1-C7H14 + ·OH → Products
3 records matched 1,3-Cyclohexadiene + ·OH → Products
1 record matched CH2=CHCH2CH2C≡N + ·OH → Products
6 records matched CH3CH=CHCH=CHCH3 + ·OH → Products
2 records matched CH2=CHCH2CH2CH=CH2 + ·OH → Products
2 records matched 1-C6H12 + ·OH → Products
2 records matched 1-C6H12 + HO2 → Oxirane, butyl- + ·OH
1 record matched CH2=C=CHCH2CH3 + ·OH → Products
1 record matched CH2=CHCH2CH=CH2 + ·OH → Products
2 records matched CH3C(O)OCH2CH=CH2 + ·OH → Other Products + H2O
1 record matched CH3C(O)OCH2CH=CH2 + ·OH → Products
13 records matched n-C4H9COCH3 + ·OH → Products
2 records matched Hexane, 2-methyl- + ·OH → Products
1 record matched Iodobenzene + ·OH → Products
1 record matched Cyclohexene, 1-methyl- + O3 → Other Products + ·OH
4 records matched Cyclohexene, 1-methyl- + ·OH → Products
1 record matched 3,5-Dimethylpyridine + ·OH → Products
2 records matched 2(3H)-Furanone, 5-methyl- + ·OH → Products
5 records matched CH3C(O)CH2CH2OH + ·OH → Products
10 records matched iso-C4H9CHO + ·OH → Products
1 record matched (CH3)3C(CH2)3CH3 + ·OH → Products
2 records matched 2-Pentanol, 2-methyl- + ·OH → Products
1 record matched Pentane, 2,2-dimethyl- + O· → Other Products + ·OH
1 record matched CH2=C=CHCH3 + ·OH → Products
1 record matched (Z)-2-C4H8 + O3 → Other Products + ·OH
1 record matched (Z)-2-C4H8 + ·OH + NO → Products
13 records matched (Z)-2-C4H8 + ·OH → Products
3 records matched n-Butyl propanoate + ·OH → Products
1 record matched 2,5-Dimethylpyridine + ·OH → Products
1 record matched Heptane, 3-methyl- + O· → Other Products + ·OH
2 records matched n-C3H7COC2H5 + ·OH → Products
2 records matched CH3(CH2)2CH(CH3)CH2CH3 + ·OH → Products
2 records matched Terpinolene + ·OH → Products
2 records matched Benzene, 2,4-diisocyanato-1-methyl- + ·OH → Products
12 records matched (C2H5)2CHOH + ·OH → Products
1 record matched 2,3-Dimethylpyridine + ·OH → Products
1 record matched 3,4-Dimethylpyridine + ·OH → Products
1 record matched Naphthalene, 2,7-dimethyl- + ·OH → Products
2 records matched 2-Nitronaphthalene + ·OH → Products
1 record matched 2,6-dimethylnaphthalene + ·OH → Products
2 records matched Naphthalene, 2,3-dimethyl- + ·OH → Products
2 records matched N-methylacetanilide + ·OH → Products
4 records matched 2,6-Dimethylphenol + ·OH → Products
1 record matched 1,6-dimethylnaphthalene + ·OH → Products
1 record matched Naphthalene, 1,3-dimethyl- + ·OH → Products
1 record matched 1,7-dimethylnaphthalene + ·OH → Products
1 record matched 1,2-dimethylnaphthalene + ·OH → Products
1 record matched Naphthalene, 1,5-dimethyl- + ·OH → Products
1 record matched Naphthalene, 1,4-dimethyl- + ·OH → Products
1 record matched Naphthalene, 1,8-dimethyl- + ·OH → Products
2 records matched (iso-C3H7)2CO + ·OH → Products
1 record matched (CH3)2CHCH(CH3)CH(CH3)2 + O· → Other Products + ·OH
1 record matched (CH3)2CHCH(CH3)CH(CH3)2 + ·OH → Other Products + H2O
2 records matched (CH3)2CHCH(CH3)CH(CH3)2 + ·OH → Products
1 record matched sec-C4H9COCH3 + ·OH → Products
1 record matched Pentane, 2,3-dimethyl- + ·OH → Products
1 record matched iso-C3H7C(O)CH3 + ·OH → Products
3 records matched (CH3)2C=C(CH3)2 + O3 → Other Products + ·OH
1 record matched (CH3)2C=C(CH3)2 + ·OH + NO → Products
16 records matched (CH3)2C=C(CH3)2 + ·OH → Products
1 record matched (CH3)2C=C(CH3)2 + HO2 → ·OH + oxirane, tetramethyl-
4 records matched C2H5C(CH3)=CH2 + ·OH → Products
2 records matched (CH3)2CHCH=CH2 + ·OH → Products
2 records matched Cyclopentene, octafluoro- + ·OH → Products
1 record matched Cyclobutane, 1-chloro-2,2,3,3-tetrafluoro- + ·OH → Products
1 record matched (CH3)3CCH=CH2 + ·OH → Products
3 records matched CD4 + ·OH → CD3 + HDO
1 record matched (CH2=CHCH2)2O + ·OH → Products
1 record matched CH3CH2OCH2CH=CH2 + ·OH → Products
3 records matched (CH3)2C=CHCH2OH + ·OH → Products
2 records matched Cyclotetrasiloxane, octamethyl- + ·OH → Other Products + H2O
1 record matched CH3NCS + ·OH → Products
1 record matched CH2CHCH2I + ·OH → Products
2 records matched β-Phellandrene + ·OH → Products
2 records matched 2-Carene + ·OH → Products
9 records matched C2H5COOCH3 + ·OH → Products
4 records matched 2,5-Cyclohexadiene-1,4-dione, 2-methyl- + ·OH → Products
1 record matched (CH3)2CHC(O)OCH3 + ·OH → Other Products + (CH3)2CO
3 records matched (CH3)2CHC(O)OCH3 + ·OH → Products
1 record matched (CH3)2CHC(O)OCH3 + ·OH → CH3C(=O)C(=O)OCH3 + Other Products
1 record matched CH3(CH2)14CH3 + ·OH → Other Products + H2O
1 record matched (n-C4H9)2S + ·OH → Products + H2O
1 record matched (n-C4H9)2S + ·OH → Products
1 record matched (n-C4H9)2S + ·OH → CH3CH2CH2CH2S(OH)CH2CH2CH2CH3
1 record matched 1,3,5-Cycloheptatriene + ·OH → Products
4 records matched n-C4H9ONO + ·OH → Products
2 records matched n-C6H13Cl + ·OH → Other Products + H2O
2 records matched (CH3)2CHCH2CH2ONO2 + ·OH → Products
1 record matched n-C3H7ONO + ·OH → Other Products + C2H5CHO
4 records matched n-C3H7ONO + ·OH → Products
2 records matched n-C5H11Cl + ·OH → Other Products + H2O
2 records matched (CH3)2CHCH2ONO2 + ·OH → Products
1 record matched (C2H5)2SiH2 + O· → ·OH + (CH3)3SiCH2
1 record matched C2H5NCS + ·OH → Products
1 record matched (CH3)2CHCH2ONO + ·OH → HNO2 + (CH3)2CHCH2
1 record matched (CH3)2CHCH2ONO + ·OH → Products
1 record matched n-C4H9OC(O)OC4H9-n + ·OH → Products
2 records matched Benzene, 1,3-dichloro- + ·OH → Products
2 records matched Cyclotrisiloxane, hexamethyl- + ·OH → Other Products + H2O
2 records matched Cyclopentasiloxane, decamethyl- + ·OH → Other Products + H2O
4 records matched CH3C(O)OC(CH3)3 + ·OH → Other Products + H2O
2 records matched CH3C(O)OC(CH3)3 + ·OH → Products
3 records matched (CH3)2CHCH2C(CH3)3 + O· → Other Products + ·OH
3 records matched (CH3)2CHCH2C(CH3)3 + ·OH → Other Products + H2O
1 record matched (CH3)3CONO + ·OH → Products
1 record matched C2H5OCH3 + ·OH → Other Products + H2O
4 records matched n-C3H7Cl + ·OH → Other Products + H2O
1 record matched n-C3H7Cl + ·OH → Products
1 record matched 2,4,6-Cycloheptatriene-1-one + ·OH → Products
1 record matched Pyridine, 3-ethyl- + ·OH → Products
1 record matched Pyridine, 4-ethyl- + ·OH → Products
4 records matched 2-Methylfuran + ·OH → Products
1 record matched CH3CH(OCH3)2 + ·OH → Products
1 record matched Benzoyl isothiocyanate + ·OH → Products
1 record matched 2-Methylbenzaldehyde + ·OH → Products
5 records matched Phenol, 2,4,6-trimethyl- + ·OH → Products
5 records matched Phenol, 3,4,5-trimethyl- + ·OH → Products
4 records matched 2,3-Dimethylphenol + ·OH → Products
10 records matched 1,2,3-Trimethylbenzene + ·OH → Products
2 records matched 1,1-Dichloroacetone + ·OH → Products
3 records matched CH3CH(OH)C(O)CH3 + ·OH → Products
1 record matched CH2=C(CH3)C(CH3)=CH2 + O3 → Other Products + ·OH
3 records matched CH2=C(CH3)C(CH3)=CH2 + ·OH → Products
3 records matched sec-C4H9SH + ·OH → Products
3 records matched iso-C4H9SH + ·OH → Products
4 records matched CH2=C(CH3)CH2OH + ·OH → Products
1 record matched iso-C4H9Cl + O· → Other Products + ·OH
1 record matched iso-C4H9Cl + ·OH → Other Products + H2O
2 records matched (CH3)2C=CHCH3 + O3 → Other Products + ·OH
1 record matched (CH3)2C=CHCH3 + O3 → Products + ·OH
1 record matched (CH3)2C=CHCH3 + ·OH + NO → Products
8 records matched (CH3)2C=CHCH3 + ·OH → Products
2 records matched C9H14O + ·OH → Products
1 record matched (CH3O)3PO + ·OH → Products
2 records matched CH3CH2OCF2CF2H + ·OH → Products
2 records matched Tricyclo[,6]heptane, 1,7,7-trimethyl- + ·OH → Products
1 record matched Borneol + ·OH → Products
2 records matched CF2ClCF2CHClF + ·OH → Other Products + H2O
1 record matched tert-C4H9Cl + O· → ·OH + (CH3)2CClCH2
2 records matched tert-C4H9Cl + ·OH → H2O + (CH3)2CClCH2
1 record matched tert-C4H9Cl + ·OH → Other Products + H2O
1 record matched C#N(OH) + ·OH → Products
1 record matched CH2(n-C3H7O)2 + ·OH → Products
1 record matched 1,3-Dioxepane + ·OH → Products
2 records matched (E)-n-C3H7CH=CHCHO + ·OH → Products
1 record matched 1,4-Dithiane + ·OH → Products
6 records matched 1,3-Dioxane + ·OH → Products
1 record matched C3O2 + ·OH → CO2 + HCCO
1 record matched Oxetane + ·OH → Products
1 record matched CH3CCCH3 + ·OH + O2 → Products
3 records matched CH3CCCH3 + ·OH → Products
1 record matched α-Farnesene + ·OH → Products
2 records matched Cyclooctanone + ·OH → Products
2 records matched Cycloheptanone + ·OH → Products
1 record matched Bicyclo[2.2.1]hept-2-ene + ·OH → Products
2 records matched 3-Furancarboxaldehyde + ·OH → Products
1 record matched CH3CH=C(CH3)CHO + ·OH → Products
7 records matched Phenol, 2,4,5-trimethyl- + ·OH → Products
2 records matched Benzofuran, 2,3-dihydro + ·OH → Products
4 records matched 2,3-Dihydroindene + ·OH → Products
2 records matched 1,4-Benzodioxin, 2,3-dihydro- + ·OH → Products
2 records matched Isochroman + ·OH → Products
1 record matched trans-Decalin + ·OH → Products
1 record matched cis-Decalin + ·OH → Products
4 records matched 1,2-Dihydroxy-3-methylbenzene + ·OH → Products
1 record matched Longifolene + ·OH → Products
2 records matched Bicyclo[3.1.1]heptane, 2,6,6-trimethyl- + ·OH → Products
2 records matched Cineole + ·OH → Products
3 records matched α-Cedrene + ·OH → Products
1 record matched Butane, 2,2,3-trimethyl- + ·OH → H2O + (CH3)3CCH(CH3)CH2·
1 record matched Butane, 2,2,3-trimethyl- + ·OH → H2O + (CH3)3C-C(·)(CH3)2
6 records matched Butane, 2,2,3-trimethyl- + ·OH → Other Products + H2O
4 records matched neo-C5H12 + O· → ·OH + (CH3)3CCH2
16 records matched neo-C5H12 + ·OH → (CH3)3CCH2 + H2O
2 records matched COS + ·OH → CO2 + SH
6 records matched COS + ·OH → Products
1 record matched H2C=C=O + ·OH → H2O + HCCO
1 record matched H2C=C=O + ·OH → CO + (·)CH2OH
1 record matched H2C=C=O + ·OH → CO2 + ·CH3
2 records matched H2C=C=O + ·OH → CH2O + HCO
4 records matched H2C=C=O + ·OH → Products
1 record matched CH2=C=CH2 + ·OH → H2C=C=O + ·CH3
6 records matched CH2=C=CH2 + ·OH → Products
2 records matched n-C5H11ONO + ·OH → Products
1 record matched CH2(OC2H5)2 + O· → Other Products + ·OH
2 records matched CH2(OC2H5)2 + ·OH → Products
1 record matched Fluorobenzene + ·OH → Other Products + H2O
3 records matched Fluorobenzene + ·OH → Products
2 records matched CF3CH2CH2CH2OH + ·OH → Products
2 records matched CF3CH2CHF2 + ·OH → Other Products + H2O
9 records matched CF3CH2OCH3 + ·OH → Products
1 record matched CF3CH2OCH3 + ·OH → CF3CH2OCH2· + H2O
1 record matched CF3CH2OCH3 + ·OH → CF3CH(·)OCH3 + H2O
5 records matched CF3CH2C(O)H + ·OH → Products
2 records matched NCCN + ·OH → Products
3 records matched 1,3-Butadiyne + ·OH → Products
4 records matched 1,2-Dihydroxy-4-methylbenzene + ·OH → Products
1 record matched CF2HC(O)OCH3 + ·OH → Products
2 records matched CF3CHFCF3 + O· → (CF3)2CF + ·OH
5 records matched CF3CHFCF3 + ·OH → (CF3)2CF + H2O
3 records matched CF3CHFCF3 + ·OH → Products
5 records matched 1,1,1,2,3,3-Hexafluoropropane + ·OH → Other Products + H2O
5 records matched CCl2=CClCF3 + ·OH → Products
2 records matched CF3C(O)OCH3 + ·OH → Products
1 record matched CF3CHFCH2F + ·OH → Other Products + H2O
1 record matched CF3CHFCH2F + ·OH → Products
1 record matched (CH3CO)2 + ·OH → Products
4 records matched CHF2CHO + ·OH → Products
4 records matched CH2FCHF2 + ·OH → Other Products + H2O
2 records matched CH3COCH2F + ·OH → Products
2 records matched CH3OCF2CHF2 + ·OH → Products
1 record matched CH3OCF2CHFCl + ·OH → Products
1 record matched Oxetane, hexafluoro- + ·OH → Products
3 records matched C2F5COOH + ·OH → Products
2 records matched CF3CF2CHCl2 + ·OH → Other Products + H2O
1 record matched CF3CF2CHCl2 + ·OH → Products
4 records matched Propanal, pentafluoro- + ·OH → Products
5 records matched C2F5CH2OH + ·OH → Products
3 records matched CF3CH(OH)2 + ·OH → Products
5 records matched CH3COCF3 + ·OH → Products
1 record matched CF3OCH3 + ·OH → Products
4 records matched CF3OCH3 + ·OH → CF3OCH2(.) + H2O
1 record matched CH3CH2CF3 + ·OH → Other Products + H2O
1 record matched CH3CH2CF3 + ·OH → Products
2 records matched CF3CBrH2 + ·OH → CF3CHBr· + H2O
6 records matched CH3CF3 + ·OH → CF3CH2 + H2O
1 record matched iso-C3H7F + ·OH → Other Products + H2O
2 records matched CF3CH2CH2CF3 + ·OH → CF3CH2CH(·)CF3 + H2O
1 record matched CF3C(O)OCH2CF3 + ·OH → Products
1 record matched CF3CH2CH2CHO + ·OH → Products
4 records matched CF3CH2OCF2CF2H + ·OH → Products
3 records matched CF3CH2CF2CH3 + ·OH → Other Products + H2O
1 record matched CF3CH2CF2CH3 + ·OH → Products
4 records matched Hexafluorobenzene + ·OH → Products
1 record matched CF3COOC2H5 + ·OH → Products
1 record matched CF2ClC(O)OCH2CH3 + ·OH → Products
2 records matched CF3CHFCF2CH2OH + ·OH → Products
3 records matched CF3CHFCF2OCH2CH3 + ·OH → Products
2 records matched CHF2CF2CF2CHF2 + ·OH → CHF2CF2CF2CF2· + H2O
3 records matched n-C3F7COOH + ·OH → Products
1 record matched n-C3F7OCH3 + ·OH → Products
1 record matched n-C3F7OCH3 + ·OH → CF3CF2CF2OCH2 + H2O
2 records matched Butanal, heptafluoro- + ·OH → Products
2 records matched CF3CF2CF2CH2OH + ·OH → Products
3 records matched 1-Butene, 3,3,4,4,4-pentafluoro- + ·OH → Products
5 records matched CH2FCH2OH + ·OH → Products
1 record matched CH2FCH2OH → ·OH + CH2CH2F
1 record matched CH3CH2CH2C(O)OCH2CF3 + ·OH → Products
11 records matched 2-C4F8 (unspecified) + ·OH → Products
4 records matched CHF2CHF2 + ·OH → H2O + CHF2CF2
4 records matched CHF2CH2OH + ·OH → Products
1 record matched C2HF3 + ·OH → Products
1 record matched CF2=CHBr + ·OH → Products
5 records matched CF2=CFCF2CF3 + ·OH → Products
1 record matched Cyclobutane, 1,2-dichloro-1,2,3,3,4,4-hexafluoro- + ·OH → Products
3 records matched CF3CF2CF2CF2CF2CHF2 + ·OH → Products
6 records matched C2F5H + ·OH → C2F5 + H2O
2 records matched C2F5H + ·OH → Products
1 record matched CF2ClCHFCl + ·OH → H2O + ·CFClCF2Cl
4 records matched Ethane, 1,2,2-trichloro-1,1-difluoro- + ·OH → H2O + CCl2CF2Cl
2 records matched CCl2FCHClF + ·OH → H2O + CFCl2CFCl
2 records matched CF2BrCHFCl + ·OH → CF2BrCFCl· + H2O
1 record matched CF2BrCl + ·OH → Products
1 record matched C2H5F + O· → Other Products + ·OH
4 records matched C2H5F + ·OH → Other Products + H2O
1 record matched C2H5F + ·OH → Products
4 records matched (C2H5)2S + ·OH → Products
2 records matched (C2H5)2S + ·OH → C2H5S(OH)C2H5
1 record matched CF3CF2CF2CF2CF2CF2CF2CF2H + ·OH → Products
6 records matched CF3CH2OCH2CF3 + ·OH → Products
11 records matched CF3CHCl2 + ·OH → H2O + CF3CCl2
4 records matched N2H4 + ·OH → Products
2 records matched Cyclodecane + ·OH → Products
1 record matched Cyclooctane + ·OH → Cyclooctyl radical + H2O
4 records matched Cyclooctane + ·OH → Products
1 record matched oxepin + ·OH → Products
1 record matched Cycloheptane + O· → ·OH + Cycloheptyl
2 records matched Cycloheptane + ·OH → Cycloheptyl + H2O
5 records matched Cycloheptane + ·OH → Products
2 records matched 1,3,5-Triazine + ·OH → Products
2 records matched Isooxazole + ·OH → Products
3 records matched Cyclopentane + O· → ·OH + Cyclopentyl
10 records matched Cyclopentane + ·OH → Cyclopentyl + H2O
5 records matched Cyclopentane + ·OH → Products
2 records matched Cyclobutane + O· → ·OH + Cyclobutyl
4 records matched Cyclobutane + ·OH → Cyclobutyl + H2O
1 record matched adamantane + ·OH → Products
1 record matched Bicyclo[2.2.2]octane + ·OH → Products
1 record matched Bicyclo[2.2.1]heptane + ·OH → Products
2 records matched Tetracyclo[,7.04,6]heptane + ·OH → Products
2 records matched Azulene + ·OH → Products
2 records matched Benzofuran + ·OH → Products
4 records matched Dibenzodioxin + ·OH → Products
5 records matched Acenaphthylene + ·OH → Products
1 record matched Fluoranthene + ·OH → Products
1 record matched Spiropentane + O· → ·OH + Spiropentyl
1 record matched (E)-CHCl=CHCl + ·OH → Products + Cl
6 records matched (E)-CHCl=CHCl + ·OH → Products
4 records matched (Z)-CHCl=CHCl + ·OH → Products
2 records matched (CH3O)3PS + ·OH → Products
3 records matched CF3CHClBr + ·OH → H2O + CF3CClBr
5 records matched 4-Methoxyphenol + ·OH → Products
5 records matched 3-Methoxyphenol + ·OH → Products
1 record matched CH(OCH3)3 + ·OH → Trimethoxymethane radical + H2O
2 records matched (n-C4H9)2O + O· → Other Products + ·OH
14 records matched (n-C4H9)2O + ·OH → Other Products + H2O
3 records matched (n-C4H9)2O + ·OH → Products
3 records matched n-C7H16 + O· → Other Products + ·OH
7 records matched n-C7H16 + ·OH → Other Products + H2O
10 records matched n-C7H16 + ·OH → Products
1 record matched Tetrahydro-2H-pyran + O· → Other Products + ·OH
4 records matched Tetrahydro-2H-pyran + ·OH → Products
1 record matched Cyclopentene + O3 → Other Products + ·OH
5 records matched Cyclopentene + ·OH → Products
2 records matched CH2ClCH2CH2Cl + ·OH → Other Products + H2O
2 records matched CH3COOC2H5 + O· → Other Products + ·OH
13 records matched CH3COOC2H5 + ·OH → Products
1 record matched CH3COOC2H5 + ·OH → CH3C(O)OCH2CH2· + H2O
1 record matched CH3COOC2H5 + ·OH → CH3C(O)OCH(·)CH3 + H2O
1 record matched CH3COOC2H5 + ·OH → C(·)H2C(O)OCH2CH3 + H2O
2 records matched [(CH3)3SiOSi(CH3)2]2O + ·OH → Products
1 record matched HOCH2CHO + ·OH → HOCH(·)CHO + H2O
13 records matched HOCH2CHO + ·OH → Products
3 records matched NH2CH2CH2OH + ·OH → Products
1 record matched n-Butyl acrylate + ·OH → Products
6 records matched CH2=CHCOOC2H5 + ·OH → Products
5 records matched Benzene, 1-methoxy-4-(2-propenyl)- + ·OH → Products
1 record matched Limonene + ·OH → Products
3 records matched Dibenzofuran + ·OH → Products
2 records matched 1,4-Naphthalenedione + ·OH → Products
1 record matched Pyrene + ·OH → Products
13 records matched beta-pinene + ·OH → Products
1 record matched beta-pinene + ·OH → pinonaldehyde + Products + (CH3)2CO
5 records matched CH3CON(CH3)2 + ·OH → Products
9 records matched C2Cl4 + ·OH → Products
1 record matched CH3COCOOH + ·OH → Products
1 record matched (CH3)2C(OC2H5)2 + ·OH → Products
2 records matched (C2H5O)3PS + ·OH → Products
1 record matched CF2Br-CF2Br + ·OH → Products
2 records matched CF3CHBrF + ·OH → CF3CFBr· + H2O
1 record matched CHClBr2 + ·OH → H2O + CClBr2
1 record matched (CH3)2NH + ·OH → H2O + (CH3)2N
3 records matched (CH3)2NH + ·OH → Products
10 records matched CO2 + H· → CO + ·OH
2 records matched nonanal + ·OH → Other Products + H2O
1 record matched nonanal + ·OH → CH3(CH2)7CO + H2O
4 records matched n-C10H22 + ·OH → Other Products + H2O
1 record matched n-C10H22 + ·OH → Products + H2O
3 records matched n-C10H22 + ·OH → Products
2 records matched n-C10H22 + ·OH → C10H21(·) + H2O
3 records matched 1-C9H18 + ·OH → Products
1 record matched 1,4-Dioxane + O· → Other Products + ·OH
6 records matched 1,4-Dioxane + ·OH → Products
6 records matched CH3COO(CH2)3CH3 + ·OH → Other Products + H2O
2 records matched CH3COO(CH2)3CH3 + ·OH → Products
2 records matched CH3CH=CHCHO + ·OH → Products
1 record matched n-C3H7CHO + O· → Other Products + ·OH
11 records matched n-C3H7CHO + ·OH → Products
5 records matched CH3COCH2COCH3 + ·OH → Products
1 record matched 1-Butanol, 3-methyl- + ·OH → Other Products + H2O
7 records matched 1-Butanol, 3-methyl- + ·OH → Products
7 records matched (CH3)2C(OH)CH2C(O)CH3 + ·OH → Products
4 records matched HCONHCH3 + ·OH → Products
2 records matched C2H5CHO + O· → Other Products + ·OH
2 records matched C2H5CHO + ·OH → H2O + CH3CH2CO
1 record matched C2H5CHO + ·OH → Other Products + H2O
18 records matched C2H5CHO + ·OH → Products
3 records matched Myrcene + ·OH → Products
2 records matched n-C3H7CH(CH3)CHO + ·OH → Products
10 records matched (C2H5O)3P + ·OH → Products
2 records matched Ethanone, 1-(4-methylphenyl) + ·OH → Products
2 records matched N,N-Dimethylbenzenamine + ·OH → Products
1 record matched 2,5-Norbornadiene + ·OH → Products
2 records matched P(OCH3)3 + ·OH → Products
1 record matched Cyclopentanone + O· → Other Products + ·OH
1 record matched Cyclopentanone + ·OH → Products
1 record matched 2,4-Dichlorophenol + H· → Benzene, 1,3-dichloro- + ·OH
2 records matched 1,2,4-Trichlorobenzene + ·OH → Products
4 records matched 1,2-Dihydroxybenzene + ·OH → Products
2 records matched Indole + ·OH → Products
7 records matched Anthracene + ·OH → Products
2 records matched Isoquinoline + ·OH → Products
2 records matched 1,2,3,4-Tetrahydronaphthalene + ·OH → Products
3 records matched C7H7NO3 + ·OH → Products
8 records matched CF3CF=CF2 + ·OH → Products
4 records matched C2F4 + ·OH → Products
8 records matched CH3C(O)CH2OH + ·OH → Products
2 records matched CH3C(O)C(OH)(CH3)2 + ·OH → Products
1 record matched C2H5SiCl3 + O· → Other Products + ·OH
1 record matched CCl3CH2OH + ·OH → Products
18 records matched CH2=CHC(CH3)2OH + ·OH → Products
2 records matched iso-C4H8 + O3 → Other Products + ·OH
1 record matched iso-C4H8 + ·OH + NO → Products
1 record matched iso-C4H8 + ·OH → H2O + CH2C(CH3)=CH2
2 records matched iso-C4H8 + ·OH → (CH3)2C(·)CH2OH
2 records matched iso-C4H8 + ·OH → (CH3)2C(OH)CH2·
8 records matched iso-C4H8 + ·OH → Products
8 records matched (CH3)2O + O· → ·OH + CH3OCH2
14 records matched (CH3)2O + ·OH → H2O + CH3OCH2
1 record matched (CH3)2O + ·OH → Products
4 records matched CH3CH=CH2 + O3 → Other Products + ·OH
1 record matched CH3CH=CH2 + ·OH → CH3CH(OH)CH2
5 records matched CH3CH=CH2 + ·OH → CH3CHCH2OH
2 records matched CH3CH=CH2 + ·OH → CH3CH=CH + H2O
4 records matched CH3CH=CH2 + ·OH → ·CH2CH=CH2 + H2O
1 record matched CH3CH=CH2 + ·OH → CH3CHO + ·CH3
1 record matched CH3CH=CH2 + ·OH → CH2O + ·C2H5
49 records matched CH3CH=CH2 + ·OH → Products
1 record matched CH3CH=CH2 + ·OH → OH-propene adduct (unspecified)
1 record matched CH3CH=CH2 + HO2 → Methyloxirane + ·OH
2 records matched 1-Dodecene + ·OH → Products
1 record matched CH3(CH2)10CH3 + ·OH → Other Products + H2O
2 records matched C4H9OCH2CH2OCH2CH2OH + ·OH → Products
2 records matched C2H5OCH2CH2OCH2CH2OH + ·OH → Products
1 record matched 1-Octanol + ·OH → Other Products + H2O
7 records matched n-C9H20 + ·OH → Other Products + H2O
1 record matched n-C9H20 + ·OH → Products + H2O
4 records matched n-C9H20 + ·OH → Products
1 record matched n-C4H9OCH2CH2OH + ·OH + NO → Products
7 records matched n-C4H9OCH2CH2OH + ·OH → Products
1 record matched n-C6H13CHO + ·OH → Products
1 record matched n-C7H15OH + ·OH → Other Products + H2O
1 record matched n-C7H15OH + ·OH → Products
4 records matched 1-C8H16 + ·OH → Products
1 record matched n-C8H18 + O· → Other Products + ·OH
1 record matched n-C8H18 + ·OH → H2O + 3-C8H17
1 record matched n-C8H18 + ·OH → H2O + 4-C8H17
1 record matched n-C8H18 + ·OH → 1-C8H17 + H2O
1 record matched n-C8H18 + ·OH → 2-C8H17 + H2O
5 records matched n-C8H18 + ·OH → Other Products + H2O
1 record matched n-C8H18 + ·OH → Products + H2O
6 records matched n-C8H18 + ·OH → Products
1 record matched n-C8H18 + ·OH → C8H17 + H2O
3 records matched CH3C(O)OCH2CH2OC(O)CH3 + ·OH → Products
1 record matched (n-C3H7)2S + ·OH → Products + H2O
2 records matched (n-C3H7)2S + ·OH → Products
1 record matched (n-C3H7)2S + ·OH → CH3CH2CH2S(OH)CH2CH2CH3
5 records matched (ClCH2CH2)2O + ·OH → Products
2 records matched (n-C3H7)2O + O· → Other Products + ·OH
12 records matched (n-C3H7)2O + ·OH → Other Products + H2O
1 record matched (n-C3H7)2O + ·OH → Other Products + H2
1 record matched C2H5O(CH2)3OH + ·OH → Products
2 records matched n-C4H9OCH=CH2 + ·OH → Products
4 records matched CH2(CH2CHO)2 + ·OH → Products
1 record matched n-C6H13OH + ·OH → Other Products + H2O
5 records matched n-C6H13OH + ·OH → Products
2 records matched Hexane, 1-bromo- + ·OH → Other Products + H2O
7 records matched 2-Ethoxyethyl acetate + ·OH → Products
1 record matched n-C6H13COCH3 + ·OH → Products
1 record matched Morpholine + ·OH → Products
1 record matched 1,3,5-Trioxane + ·OH → H2O + 1,3,5-Trioxan-2-yl
6 records matched 1,3,5-Trioxane + ·OH → Products
1 record matched Pyridine + O· → ·OH + 2-pyridinyl
3 records matched Pyridine + ·OH → Products
3 records matched Cyclohexene + O3 → Other Products + ·OH
14 records matched Cyclohexene + ·OH → Products
7 records matched Cyclohexane + O· → Cyclohexyl + ·OH
21 records matched Cyclohexane + ·OH → Cyclohexyl + H2O
6 records matched Cyclohexane + ·OH → Products
4 records matched HOCH2CH2OC2H5 + ·OH → Products
1 record matched Ethene, (2-chloroethoxy)- + ·OH → Products
2 records matched HCOOCH2CH2CH3 + ·OH → Products
1 record matched CH3OCH2CH2OCH3 + ·OH → Products
2 records matched 1,4-Butanediol + ·OH → Products
11 records matched n-C4H9CHO + ·OH → Products
3 records matched n-C6H14 + O· → Other Products + ·OH
15 records matched n-C6H14 + ·OH → Other Products + H2O
7 records matched n-C6H14 + ·OH → Products
2 records matched n-C5H11Br + ·OH → Other Products + H2O
5 records matched CH3C(O)O(CH2)2OCH3 + ·OH → Products
4 records matched n-C5H11COCH3 + ·OH → Products
3 records matched isobutyl acetate + ·OH → Other Products + H2O
1 record matched isobutyl acetate + ·OH → Products
1 record matched 2,5-Hexanedione + ·OH → Products
1 record matched (CH3)2CHCH2CH2COCH3 + ·OH → Products
13 records matched Thiophene + ·OH → Products
2 records matched Tetrahydrothiophene + ·OH → Products
7 records matched Furan + ·OH → Products
2 records matched Tetrahydrofuran + O· → Other Products + ·OH
7 records matched Tetrahydrofuran + ·OH → Products
8 records matched Pyrrole + ·OH → Products
1 record matched C2H5ONO + ·OH → Other Products + CH3CHO
2 records matched C2H5ONO + ·OH → Products
2 records matched HCOOC2H5 + O· → Other Products + ·OH
3 records matched HCOOC2H5 + ·OH → Products
9 records matched CH2=CHOC2H5 + ·OH → Products
2 records matched (C2H5)2NH + ·OH → Products
4 records matched CH3OCH2OCH3 + ·OH → Other Products + H2O
2 records matched CH3OCH2OCH3 + ·OH → Products
4 records matched HOCH2CH2OCH3 + ·OH → Products
3 records matched n-C4H9SH + ·OH → Products
3 records matched n-C4H9Cl + ·OH → Other Products + H2O
6 records matched 1-C5H10 + ·OH → Products
2 records matched 1-C5H10 + HO2 → Oxirane, propyl- + ·OH
3 records matched n-C5H12 + O· → Other Products + ·OH
1 record matched n-C5H12 + ·OH → H2O + (CH3CH2)2CH
1 record matched n-C5H12 + ·OH → 1-C5H11 + H2O
1 record matched n-C5H12 + ·OH → CH3CH2CH2CHCH3 + H2O
14 records matched n-C5H12 + ·OH → Other Products + H2O
5 records matched n-C5H12 + ·OH → Products
1 record matched n-C4H9Br + O· → Other Products + ·OH
2 records matched n-C4H9Br + ·OH → Other Products + H2O
2 records matched CH3COOCH2CH2CH3 + O· → Other Products + ·OH
8 records matched CH3COOCH2CH2CH3 + ·OH → Other Products + H2O
2 records matched CH3COOCH2CH2CH3 + ·OH → Products
1 record matched (CH3)2CHOCH2CH2OH + ·OH → Products
3 records matched (CH3)2CHCH2OCH=CH2 + ·OH → Products
12 records matched 5-Hexen-2-one + ·OH → Products
4 records matched n-C3H7C(O)O(CH2)3CH3 + ·OH → Products
1 record matched 2-Methylpyridine + ·OH → Products
1 record matched 3-Methylpyridine + ·OH → Products
2 records matched Benzenethiol + ·OH → Products
4 records matched Phenol + H· → Benzene + ·OH
3 records matched Phenol + ·OH → C6H5O + H2O
1 record matched Phenol + ·OH → Adduct
8 records matched Phenol + ·OH → Products
1 record matched Cyclohexanone + O· → Other Products + ·OH
3 records matched Cyclohexanone + ·OH → Products
4 records matched Cyclohexanol + ·OH → Products
1 record matched Chlorobenzene + ·OH → Other Products + H2O
7 records matched Chlorobenzene + ·OH → Products
1 record matched 4-Methylpyridine + ·OH → Products
1 record matched Toluene + O· → Benzyl + ·OH
7 records matched Toluene + ·OH → Benzyl + H2O
1 record matched Toluene + ·OH → Phenol + ·CH3
2 records matched Toluene + ·OH → Adduct
30 records matched Toluene + ·OH → Products
1 record matched Toluene + ·OH → OH-toluene adduct
1 record matched Toluene + ·OH → methylphenol (unspecified isomer) + H·
4 records matched Cyclohexane, methyl- + ·OH → Products
4 records matched Bromobenzene + ·OH → Products
4 records matched (iso-C4H9)2CO + ·OH → Products
4 records matched Phenol, 3,5-dimethyl- + ·OH → Products
2 records matched 1,3,5-Trimethylbenzene + ·OH → H2O + Methyl,(3,5-dimethylphenyl)-
21 records matched 1,3,5-Trimethylbenzene + ·OH → Products
1 record matched 2,6-Dimethylpyridine + ·OH → Products
1 record matched 2,4-Dimethylpyridine + ·OH → Products
1 record matched 3-Chlorophenol + H· → Chlorobenzene + ·OH
8 records matched 3-Methylphenol + ·OH → Products
2 records matched 1,3-Dimethylbenzene + ·OH → 3-Methylbenzyl + H2O
1 record matched 1,3-Dimethylbenzene + ·OH → 3-Methylphenol + ·CH3
1 record matched 1,3-Dimethylbenzene + ·OH → 4-Methylphenol + ·CH3
1 record matched 1,3-Dimethylbenzene + ·OH → 2-Methylphenol + ·CH3
33 records matched 1,3-Dimethylbenzene + ·OH → Products
1 record matched 1,3-Dimethylbenzene + ·OH → methylphenol (unspecified isomer) + ·CH3
2 records matched 2,5-Furandione + ·OH → Products
1 record matched CH3COOCH(CH3)2 + O· → Other Products + ·OH
5 records matched CH3COOCH(CH3)2 + ·OH → Other Products + H2O
3 records matched CH3COOCH(CH3)2 + ·OH → Products
5 records matched (iso-C3H7)2O + ·OH → Other Products + H2O
2 records matched 2-Pentanol, 4-methyl- + ·OH → Products
12 records matched iso-C4H9COCH3 + ·OH → Products
1 record matched Pentane, 2,4-dimethyl- + O· → Other Products + ·OH
1 record matched Pentane, 2,4-dimethyl- + ·OH → Other Products + H2O
1 record matched Pentane, 2,4-dimethyl- + ·OH → Products
3 records matched CH3CO2CH=CH2 + ·OH → Products
3 records matched 1-nitropropane + ·OH → Products
1 record matched (CH3)2NCH2CH2OH + ·OH → Other Products + H2O
1 record matched CH3OCH2CH(CH3)OH + ·OH + NO → Products
5 records matched CH3OCH2CH(CH3)OH + ·OH → Products
1 record matched n-C3H7COOH + ·OH → Products
1 record matched CH3CH(OH)CH2CHO + ·OH → Products
9 records matched n-C3H7C(O)CH3 + ·OH → Products
3 records matched (CH3)2C=CHCHO + ·OH → Products
5 records matched (CH3)2CH(CH2)2CH3 + ·OH → Other Products + H2O
1 record matched (CH3)2CH(CH2)2CH3 + ·OH → Products
1 record matched HCCC(OH)(CH3)CH2CH(CH3)2 + ·OH → Products
2 records matched [(CH3)3SiO]2Si(CH3)2 + ·OH → Products
2 records matched ((CH3)3Si)2O + ·OH → Other Products + H2O
2 records matched ((CH3)3Si)2O + ·OH → Products
5 records matched hexylene glycol + ·OH → Products
1 record matched HC(O)OCH3 + O· → ·OH + CH3OC(·)(O)
1 record matched HC(O)OCH3 + O· → HC(O)OCH2(·) + ·OH
1 record matched HC(O)OCH3 + O· → Other Products + ·OH
6 records matched HC(O)OCH3 + ·OH → Products
1 record matched HC(O)OCH3 + ·OH → CH3OCO + H2O
1 record matched CH3CH=NOH (unspecified) + ·OH → Other Products + H2O
1 record matched CH3CH=NOH (unspecified) → ·OH + CH3CH=N(·)
1 record matched CH2=CHOCH3 + ·OH → Products
6 records matched (CHO)2 + ·OH → Products
4 records matched HOCH2CH2OH + ·OH → Products
2 records matched CH2ClCHO + ·OH → Products
1 record matched HC≡CCH2OH + ·OH → Products
17 records matched CH2=CHCH2OH + ·OH → Products
1 record matched CH2CHCN + ·OH → Products
1 record matched C2H5CN + ·OH → H2O + N=C-CH2CH2
1 record matched C2H5CN + ·OH → HO-C≡N + ·C2H5
3 records matched C2H5CN + ·OH → HN=C=O + ·C2H5
3 records matched C2H5CN + ·OH → Products
2 records matched n-C3H7I + ·OH → Products
1 record matched CH2ClCH2OH + ·OH → Products
1 record matched CH2ClCH2Cl + O· → ·OH + CH2ClCHCl·
6 records matched CH2ClCH2Cl + ·OH → H2O + CH2ClCHCl·
4 records matched CH2=CHCH2Cl + ·OH → Products
3 records matched n-C3H7SH + ·OH → Products
1 record matched CH2=CHCHO + ·OH → H2O + CH2=CHC(·)O
1 record matched CH2=CHCHO + ·OH → Other Products + H2O
1 record matched CH2=CHCHO + ·OH → Adduct
6 records matched CH2=CHCHO + ·OH → Products
4 records matched C2H5CCH + ·OH → Products
2 records matched 1,3-Butadiene + O3 → Other Products + ·OH
12 records matched 1,3-Butadiene + ·OH → Products
1 record matched 1,3-Butadiene + ·OH → CH2=CHCH(·)CH2OH
2 records matched 1,3-Butadiene + ·OH → 1,3-Butadiene-OH adduct
1 record matched 1-C4H8 + O· → Other Products + ·OH
1 record matched 1-C4H8 + ·OH + O2 → C2H5CH(OO·)CH2OH
1 record matched 1-C4H8 + ·OH → H2O + CH2=CHCHCH3
18 records matched 1-C4H8 + ·OH → Products
1 record matched 1-C4H8 + ·OH → CH3CH2CH(·)CH2OH
1 record matched 1-C4H8 + ·OH → CH3CH2CH(OH)CH2·
1 record matched n-C4H10 + O· → sec-C4H9 + ·OH
13 records matched n-C4H10 + O· → Other Products + ·OH
3 records matched n-C4H10 + ·OH → n-C4H9 + H2O
3 records matched n-C4H10 + ·OH → sec-C4H9 + H2O
29 records matched n-C4H10 + ·OH → Other Products + H2O
2 records matched n-C4H10 + ·OH → Products
1 record matched CH2=CHCH2Br + ·OH → Products
1 record matched n-C3H7Br + ·OH → H2O + CH3CH2CHBr(·)
1 record matched n-C3H7Br + ·OH → H2O + BrCH2CHCH3
1 record matched n-C3H7Br + ·OH → H2O + CH2BrCH2CH2(·)
4 records matched n-C3H7Br + ·OH → Other Products + H2O
3 records matched n-C3H7Br + ·OH → Products
1 record matched n-C3H7Br + ·OH → C3H6Br + H2O
5 records matched CH2BrCH2Br + ·OH → Other Products + H2O
2 records matched 2-(Chloromethyl)oxirane + ·OH → Products
1 record matched Ethyloxirane + ·OH → Products
5 records matched CH3OC(O)CH2CH2C(O)OCH3 + ·OH → Products
4 records matched 1,4-Benzoquinone + ·OH → Products
1 record matched 4-Chlorophenol + H· → Chlorobenzene + ·OH
3 records matched 4-Chlorobenzenamine + ·OH → Products
5 records matched Benzene, 1,4-Dichloro- + ·OH → Products
8 records matched 4-Methylphenol + ·OH → Products
3 records matched 1,4-Dimethylbenzene + ·OH → 4-Methylbenzyl + H2O
20 records matched 1,4-Dimethylbenzene + ·OH → Products
1 record matched 1,4-Dimethylbenzene + ·OH → methylphenol (unspecified isomer) + ·CH3
5 records matched C2H5C(O)OCH2CH2CH3 + ·OH → Products
1 record matched 2,6-Octadien-1-ol, 3,7-dimethyl-, (E)- + ·OH → Products
1 record matched 6-Octenal, 3,7-dimethyl- + ·OH → Products
1 record matched Citronellol + ·OH → Products
4 records matched 2,4-Dimethylphenol + ·OH → Products
4 records matched n-C3H7C(O)OCH2CH2CH3 + ·OH → Products
3 records matched n-C3H7C(O)OC2H5 + ·OH → Other Products + H2O
2 records matched n-C3H7C(O)OC2H5 + ·OH → Products
3 records matched CH3COOCH(CH3)C2H5 + ·OH → Products
1 record matched CH2=CHOC(O)CH2CH3 + ·OH → Products
9 records matched C2H5COOC2H5 + ·OH → Products
1 record matched 4-Methylbenzaldehyde + ·OH → Products
1 record matched C6H5NCS + ·OH → Products
5 records matched 1-Phenylpropane + ·OH → Products
3 records matched Diphenyl ether + ·OH → Products
1 record matched Benzenamine, 4,4'-methylenebis- + ·OH → Products
1 record matched 4-bromodiphenyl ether + ·OH → Products
1 record matched 2-Ethylpyridine + ·OH → Products
2 records matched 2-Vinylpyridine + ·OH → Products
1 record matched Methoxybenzene + ·OH → H2O + C6H5OCH2
1 record matched Methoxybenzene + ·OH → Adduct
7 records matched Methoxybenzene + ·OH → Products
14 records matched Benzaldehyde + ·OH → Products
3 records matched Benzyl alcohol + ·OH → Products
1 record matched Benzonitrile + ·OH → Other Products + H2O
3 records matched C6H5CH2Cl + ·OH → Products
5 records matched Styrene + ·OH → Products
8 records matched Ethylbenzene + ·OH → Products
1 record matched p-Cimene + ·OH → 3-Methylphenol + iso-C3H7
2 records matched p-Cimene + ·OH → 4-Methylphenol + iso-C3H7
1 record matched p-Cimene + ·OH → 2-Methylphenol + iso-C3H7
1 record matched p-Cimene + ·OH → Other Products + 4-Methylbenzaldehyde
5 records matched p-Cimene + ·OH → Products
1 record matched p-Cimene + ·OH → 1-methyl-2-hydroxy-4-isopropyl-cyclohexa-2,4-dienyl
1 record matched p-Cimene + ·OH → 1-isopropyl-2-hydroxy-4-methyl-cyclohexa-2,4-dienyl
2 records matched p-Cimene + ·OH → 3-methyl-6-isopropyl-6-hydroxy-cyclohexa-2,4-dienyl
1 record matched p-Cimene + ·OH → 3-isopropyl-6-methyl-6-hydroxy-cyclohexa-2,4-dienyl
1 record matched α-Terpinene + ·OH → Products
2 records matched γ-Terpinene + ·OH → Other Products + H2O
1 record matched γ-Terpinene + ·OH → γ-Terpenenyl (radical on the ring) + H2O
1 record matched β-Terpinene + ·OH → Products
5 records matched Nitrobenzene + ·OH → Products
2 records matched 2-Phenylpropene + ·OH → Products
5 records matched 2-Phenylpropane + ·OH → Products
1 record matched Trifluoromethylbenzene + ·OH → Other Products + H2O
1 record matched t-Butylbenzene + ·OH → Products
2 records matched 2-Furancarboxaldehyde + ·OH → Products
2 records matched (C2H5)2CHCHO + ·OH → Products
2 records matched Butyl methacrylate + ·OH → Products
1 record matched CH2=C(CH3)C(O)OCH2CH3 + ·OH → Products
1 record matched Cyclopentanol + ·OH → Products
3 records matched Methylcyclopentane + ·OH → Products
1 record matched CH2=CHCOOCH3 + ·OH → Other Products + H2O
6 records matched CH2=CHCOOCH3 + ·OH → Products
1 record matched (C2H5)2CO + O· → Other Products + ·OH
1 record matched (C2H5)2CO + ·OH → CH3CH2C(O)CH(·)CH3 + H2O
6 records matched (C2H5)2CO + ·OH → Products
1 record matched CH2ClCHClCH2Cl + ·OH → Products
2 records matched sec-C4H9CHO + ·OH → Products
3 records matched (C2H5)2CHCH3 + ·OH → Other Products + H2O
1 record matched (C2H5)2CHCH3 + ·OH → Products
1 record matched ClCH2CHBrCH2Br + ·OH → Products
2 records matched 1,2,4,5-Tetramethylbenzene + ·OH → Products
4 records matched Phenol, 2,5-dimethyl- + ·OH → Products
1 record matched 1,3-Benzenediamine, 4-methyl- + ·OH → Products
4 records matched 3,4-Dimethylphenol + ·OH → Products
10 records matched 1,2,4-Trimethylbenzene + ·OH → Products
2 records matched 2-Chlorophenol + H· → Chlorobenzene + ·OH
2 records matched Benzene, 1,2-dichloro- + ·OH → Products
1 record matched 2-Methylphenol + ·OH → Other Products + H2O
1 record matched 2-Methylphenol + ·OH → Adduct
8 records matched 2-Methylphenol + ·OH → Products
2 records matched 1,2-Dimethylbenzene + ·OH → 2-Methylbenzyl + H2O
19 records matched 1,2-Dimethylbenzene + ·OH → Products
1 record matched 1,2-Dimethylbenzene + ·OH → methylphenol (unspecified isomer) + ·CH3
3 records matched Indene + ·OH → Products
2 records matched Butyl (2,4-dichlorophenoxy)acetate + ·OH → Products
1 record matched (2-Methyl-4-chlorophenoxy)acetic acid + ·OH → Products
5 records matched Phenol, 2-methoxy-4-methyl- + ·OH → Products
5 records matched Biphenyl + ·OH → Products
2 records matched 2-Methylnaphthalene + ·OH → Products
2 records matched Quinoline + ·OH → Products
8 records matched Naphthalene + ·OH → Products
3 records matched 1,2-Dimethoxybenzene + ·OH → Products
2 records matched 1-Methylnaphthalene + ·OH → Products
5 records matched 2-Methoxyphenol + ·OH → Products
1 record matched Menthol + ·OH → Products
2 records matched Hexamethylbenzene + ·OH → Products
3 records matched Hexamethylbenzene + ·OH → pentamethylbenzyl radical + H2O
3 records matched Caryophyllene + ·OH → Products
1 record matched 1(3H)-Isobenzofuranone + ·OH → Products
4 records matched 9H-Fluorene + ·OH → Products
2 records matched 1-Nitronaphthalene + ·OH → Products
8 records matched Phenanthrene + ·OH → Products
5 records matched Acenaphthylene, 1,2-dihydro- + ·OH → Products
1 record matched CH2=C(CH3)COOCH3 + ·OH → Other Products + H2O
5 records matched CH2=C(CH3)COOCH3 + ·OH → Products
4 records matched alpha-pinene + O3 → Other Products + ·OH
1 record matched alpha-pinene + O3 → Products + ·OH
1 record matched alpha-pinene + ·OH → Other Products + NO3
2 records matched alpha-pinene + ·OH → Other Products + (CH3)2CO
2 records matched alpha-pinene + ·OH → Other Products + CH2O
10 records matched alpha-pinene + ·OH → Products
2 records matched alpha-pinene + ·OH → pinonaldehyde + Other Products
1 record matched alpha-pinene + ·OH → pinonaldehyde + Products + (CH3)2CO
2 records matched Camphene + ·OH → Products
1 record matched 2-nitropropane + ·OH → Products
2 records matched C2F3Cl + ·OH → Products
2 records matched CF2=CCl2 + ·OH → Products
3 records matched (CHCl2)2 + ·OH → H2O + CHCl2C(·)Cl2
1 record matched iso-C3H7COOH + ·OH → Products
1 record matched (CH3)2CHCH(CH3)2 + O· → ·OH + (CH3)2CHC(·)(CH3)2
1 record matched (CH3)2CHCH(CH3)2 + ·OH → H2O + (CH3)2CHC(·)(CH3)2
11 records matched (CH3)2CHCH(CH3)2 + ·OH → Other Products + H2O
2 records matched (CH3)2CHCH(CH3)2 + ·OH → Products
3 records matched C2H5NO2 + ·OH → Products
1 record matched ClC(O)OCH3 + ·OH → Products
1 record matched CH3C(O)OOH → ·OH + CH3C(O)O
3 records matched CH3C(O)OCH3 + O· → Other Products + ·OH
6 records matched CH3C(O)OCH3 + ·OH → Products
1 record matched CH3CONHCH3 + ·OH → Products
3 records matched C2H5COOH + ·OH → Products
2 records matched CHCl2CHO + ·OH → Products
5 records matched C2HCl3 + ·OH → H2O + CCl2=CCl
5 records matched C2HCl3 + ·OH → Products
1 record matched C2HCl3 + ·OH → CCl2CHOH + Cl
3 records matched CHCl2CH2Cl + ·OH → Other Products + H2O
3 records matched CH3C(O)CHO + ·OH → Products
2 records matched CH3C(O)CHO + ·OH → CH3C(O)C(O)· + H2O
2 records matched CH3COCH2Cl + ·OH → Products
1 record matched CH2=CHCOCH3 + O3 → Products + ·OH
15 records matched CH2=CHCOCH3 + ·OH → Products
1 record matched C2H5COCH3 + O· → Other Products + ·OH
1 record matched C2H5COCH3 + ·OH → H2O + CH3C(O)CH(·)CH3
14 records matched C2H5COCH3 + ·OH → Products
1 record matched sec-C4H9OH + ·OH → H2O + CH3CH2CH(CH3)O·
7 records matched sec-C4H9OH + ·OH → Products
1 record matched sec-C4H9OH + ·OH → CH3CH2C(·)(OH)CH3 + H2O
1 record matched sec-C4H9OH + ·OH → CH3CH(·)CH(OH)CH3 + H2O
1 record matched CH3CHClCH2Cl + ·OH → Products
1 record matched sec-C4H9Cl + O· → Other Products + ·OH
1 record matched sec-C4H9Cl + ·OH → Other Products + H2O
1 record matched Methacrolein + ·OH → Other Products + H2O
1 record matched Methacrolein + ·OH → Adduct
12 records matched Methacrolein + ·OH → Products
1 record matched Methacrolein + ·OH → CH2(OH)C(CH3)CHO
2 records matched Methacrolein + ·OH → CH2=C(CH3)CO + H2O
1 record matched (CH3)2CHCHO + O· → Other Products + ·OH
1 record matched (CH3)2CHCHO + ·OH → H2O + (CH3)2CCHO
8 records matched (CH3)2CHCHO + ·OH → Other Products + H2O
3 records matched (CH3)2CHCHO + ·OH → Products
1 record matched iso-C4H9OH + ·OH → H2O + (CH3)2CHCH2
1 record matched iso-C4H9OH + ·OH → (CH3)2C(·)CH2OH + H2O
9 records matched iso-C4H9OH + ·OH → Products
1 record matched iso-C4H9OH + ·OH → ·CH2CH(CH3)CH2OH + H2O
1 record matched iso-C4H9OH + ·OH → (CH3)2CHC(·)HOH + H2O
3 records matched CH2=C(CH3)CH=CH2 + O3 → Other Products + ·OH
1 record matched CH2=C(CH3)CH=CH2 + O3 → Products + ·OH
23 records matched CH2=C(CH3)CH=CH2 + ·OH → Products
5 records matched CH2=C(CH3)CH=CH2 + ·OH → OHC5H8
1 record matched iso-C5H12 + O· → Other Products + ·OH
1 record matched iso-C5H12 + ·OH → CH2CH(CH3)CH2CH3 + H2O
1 record matched iso-C5H12 + ·OH → (CH3)2CCH2CH3 + H2O
1 record matched iso-C5H12 + ·OH → (CH3)2CHCHCH3 + H2O
1 record matched iso-C5H12 + ·OH → (CH3)2CHCH2CH2 + H2O
6 records matched iso-C5H12 + ·OH → Other Products + H2O
2 records matched iso-C5H12 + ·OH → Products
1 record matched iso-C4H9Br + O· → Other Products + ·OH
7 records matched (CH3)2C=CHCH2CH2C(CH3)(OH)CH=CH2 + ·OH → Products
1 record matched 2-Cyclohexen-1-one,3,5,5-trimethyl- + ·OH → Products
15 records matched (C2H5O)3PO + ·OH → Products
7 records matched (C2H5)4Pb + ·OH → Products
2 records matched (CH3)2C(OCH3)2 + ·OH → Products
2 records matched CHF2CF2CH2OH + ·OH → Products
3 records matched Bicyclo[2.2.1]heptan-2-one,1,7,7-trimethyl- + ·OH → Products
1 record matched CF2Cl-CF2Cl + ·OH → Products
2 records matched CFCl2CF2Cl + ·OH → Products
3 records matched CF3COOH + ·OH → H2O + CF3C(O)O
5 records matched CF3COOH + ·OH → Products
1 record matched CHCl2CCl3 + ·OH → C2Cl5 + H2O
1 record matched tert-C4H9COCH3 + ·OH → Products
3 records matched tert-C4H9OOH + ·OH → Products
7 records matched tert-C4H9OOH → (CH3)3CO· + ·OH
2 records matched CF3CHO + ·OH → CF3C(O) + H2O
3 records matched CF3CHO + ·OH → Products
9 records matched CF3CH2OH + ·OH → Products
1 record matched CF3CH2Cl + O· → ·OH + CF3CHCl
5 records matched CF3CH2Cl + ·OH → H2O + CF3CHCl
1 record matched CF3CH2Cl + ·OH → Products
7 records matched CCl3CHO + ·OH → Other Products + H2O
1 record matched C2H5C(CH3)2OH + ·OH → Products
1 record matched (CH3)3CCH2OH + ·OH → H2O + (CH3)3CCH(·)OH
1 record matched (CH3)3CCH2OH + ·OH → Products
2 records matched (CH3)3CCH2CH3 + ·OH → Other Products + H2O
1 record matched (CH3)3SiCl + O· → ·OH + (CH3)2SiClCH2
2 records matched (CH3)4Si + O· → ·OH + (CH3)3SiCH2
2 records matched (CH3)4Si + ·OH → H2O + (CH3)3SiCH2
1 record matched (CH3)4Si + ·OH → Products
6 records matched (CH3)4Pb + ·OH → Products
1 record matched CF4 + ·OH → Products
1 record matched CF3Cl + ·OH → Products
2 records matched CF2Cl2 + ·OH → Products
3 records matched CFCl3 + ·OH → Products
1 record matched CH3CF2Cl + O· → Other Products + ·OH
12 records matched CH3CF2Cl + ·OH → CF2ClCH2· + H2O
3 records matched tert-C4H9SH + ·OH → Products
1 record matched tert-C4H9OH + ·OH → (CH3)2C(OH)CH2· + H2O
1 record matched tert-C4H9OH + ·OH → (CH3)3CO· + H2O
6 records matched tert-C4H9OH + ·OH → Other Products + H2O
2 records matched tert-C4H9OH + ·OH → Products
1 record matched tert-C4H9NH2 + ·OH → Products
2 records matched CF3Br + ·OH → Products
1 record matched CF2Br2 + ·OH → Products
2 records matched Methyloxirane + ·OH → Other Products + H2O
5 records matched Methyloxirane + ·OH → Products
3 records matched CH3NO2 + ·OH → Products
3 records matched (CH3)3N + ·OH → Products
5 records matched CHF3 + O· → ·CF3 + ·OH
12 records matched CHF3 + ·OH → ·CF3 + H2O
2 records matched CHF2Cl + O· → ·CClF2 + ·OH
15 records matched CHF2Cl + ·OH → ·CClF2 + H2O
1 record matched COCl2 + ·OH → Products
1 record matched CHFCl2 + O· → ·CCl2F + ·OH
11 records matched CHFCl2 + ·OH → ·CCl2F + H2O
3 records matched CH2=CF2 + ·OH → Products
1 record matched CH3CHF2 + O· → Other Products + ·OH
10 records matched CH3CHF2 + ·OH → Other Products + H2O
8 records matched CH3CHF2 + ·OH → Products
2 records matched CH3COCl + ·OH → H2O + CH2C(O)Cl
1 record matched CH3COCl + ·OH → Products
1 record matched CH2=CCl2 + ·OH → Products + Cl
9 records matched CH2=CCl2 + ·OH → Products
1 record matched CH3CHCl2 + O· → Other Products + ·OH
2 records matched CH3CHCl2 + ·OH → Other Products + H2O
3 records matched iso-C3H7SH + ·OH → Products
2 records matched iso-C3H7I + ·OH → Products
1 record matched iso-C3H7Cl + O· → ·OH + (CH3)2CCl
3 records matched iso-C3H7Cl + ·OH → Other Products + H2O
1 record matched iso-C3H7Cl + ·OH → Products
4 records matched iso-C4H10 + O· → Other Products + ·OH
3 records matched iso-C4H10 + ·OH → iso-C4H9 + H2O
6 records matched iso-C4H10 + ·OH → tert-C4H9 + H2O
23 records matched iso-C4H10 + ·OH → Other Products + H2O
3 records matched iso-C4H10 + ·OH → Products
1 record matched CHBrCl2 + ·OH → H2O + BrCCl2
2 records matched CHBrCl2 + ·OH → Products
1 record matched iso-C3H7Br + O· → ·OH + (CH3)2CBr
3 records matched iso-C3H7Br + ·OH → Other Products + H2O
2 records matched iso-C3H7Br + ·OH → Products
1 record matched iso-C3H7Br + ·OH → C3H6Br + H2O
4 records matched CHBr3 + ·OH → CBr3 + H2O
4 records matched Oxirane + O· → ·OH + Oxiranyl
1 record matched Oxirane + H· → C2H4 + ·OH
3 records matched Oxirane + ·OH → H2O + Oxiranyl
3 records matched Cyclopropane + O· → Cyclopropyl + ·OH
7 records matched Cyclopropane + ·OH → Cyclopropyl + H2O
4 records matched (CH3)2S + ·OH → (CH3)2S.OH
16 records matched (CH3)2S + ·OH → H2O + CH3SCH2
1 record matched (CH3)2S + ·OH → CH3OH + CH3
18 records matched (CH3)2S + ·OH → Products
1 record matched CH2=NOH + ·OH → Other Products + H2O
1 record matched CH2=NOH + ·OH → Products
3 records matched CS2 + ·OH → CS2OH
5 records matched CS2 + ·OH → COS + SH
1 record matched CS2 + ·OH → Adduct
12 records matched CS2 + ·OH → Products
2 records matched HN=C=O + O· → ·OH + NCO
1 record matched HN=C=O + ·OH → H2O + NCO
1 record matched HN=C=O + ·OH → CO2 + NH2
3 records matched HN=C=O + ·OH → Products
1 record matched CH2I2 + ·OH → Products
2 records matched CH2F2 + O· → ·CHF2 + ·OH
10 records matched CH2F2 + ·OH → ·CHF2 + H2O
3 records matched CH2Cl2 + O· → ·OH + CHCl2
14 records matched CH2Cl2 + ·OH → CHCl2 + H2O
7 records matched C2H5SH + ·OH → Products
1 record matched CH3CHO + O· → ·OH + CH2=CHO·
5 records matched CH3CHO + O· → CH3CO + ·OH
2 records matched CH3CHO + O· → Other Products + ·OH
1 record matched CH3CHO + ·OH → CH2=CHO· + H2O
1 record matched CH3CHO + ·OH → *CH2C(O)H + H2O
4 records matched CH3CHO + ·OH → CH3CO + H2O
1 record matched CH3CHO + ·OH → CH3C(O)OH + H·
1 record matched CH3CHO + ·OH → HCOOH + ·CH3
2 records matched CH3CHO + ·OH → Other Products + H2O
31 records matched CH3CHO + ·OH → Products
1 record matched CH3CN + ·OH → CH2CN + H2O
5 records matched CH3CN + ·OH → Products
3 records matched C2H5NH2 + ·OH → Products
2 records matched C2H5I + ·OH → Products
3 records matched CH2=CHF + ·OH → Products
1 record matched CH2=CHCl + ·OH → Products + Cl
3 records matched CH2=CHCl + ·OH → Products
1 record matched C2H5Cl + O· → Other Products + ·OH
5 records matched C2H5Cl + ·OH → Other Products + H2O
1 record matched C2H5Cl + ·OH → C2H4Cl + H2O
1 record matched CH3CCH + ·OH + O2 → Products
8 records matched CH3CCH + ·OH → Products
1 record matched C3H8 + O· → n-C3H7 + ·OH
7 records matched C3H8 + O· → Other Products + ·OH
3 records matched C3H8 + ·OH → n-C3H7 + H2O
5 records matched C3H8 + ·OH → iso-C3H7 + H2O
42 records matched C3H8 + ·OH → Other Products + H2O
2 records matched C3H8 + ·OH → Products
3 records matched CH2ClBr + ·OH → H2O + ·CHBrCl
2 records matched CH2ClBr + ·OH → Products
1 record matched C2H5Br + O· → Other Products + ·OH
4 records matched C2H5Br + ·OH → Other Products + H2O
1 record matched C2H5Br + ·OH → C2H4Br + H2O
5 records matched CH2Br2 + ·OH → H2O + CHBr2
1 record matched CH3SH + ·OH → H2O + ·CH2SH
1 record matched CH3SH + ·OH → Other Products + H2O
15 records matched CH3SH + ·OH → Products
3 records matched HCN + O· → CN + ·OH
1 record matched HCN + ·OH → HO-C≡N + H·
2 records matched HCN + ·OH → CN + H2O
2 records matched HCN + ·OH → Products
3 records matched CH3NH2 + ·OH → Products
1 record matched CH3I + O· → ·OH + ·CH2I
1 record matched CH3I + ·OH → H2O + ·CH2I
1 record matched CH3I + ·OH → Products
6 records matched CH3Cl + O· → ·OH + ·CH2Cl
14 records matched CH3Cl + ·OH → ·CH2Cl + H2O
2 records matched CH3Cl + ·OH → Products
1 record matched C2H2 + ·OH + O2 → Products
4 records matched C2H2 + ·OH → HOCH=CH
4 records matched C2H2 + ·OH → ·C2H + H2O
1 record matched C2H2 + ·OH → H2 + HCCO
1 record matched C2H2 + ·OH → CO + ·CH3
3 records matched C2H2 + ·OH → H2C=C=O + H·
34 records matched C2H2 + ·OH → Products
1 record matched C2H4 + O· → C2H3 + ·OH
4 records matched C2H4 + O3 → Other Products + ·OH
1 record matched C2H4 + ·OH + NO → Products
15 records matched C2H4 + ·OH → HOCH2CH2
15 records matched C2H4 + ·OH → C2H3 + H2O
41 records matched C2H4 + ·OH → Products
5 records matched C2H4 + HO2 → Oxirane + ·OH
12 records matched C2H6 + O· → ·C2H5 + ·OH
51 records matched C2H6 + ·OH → ·C2H5 + H2O
2 records matched C2H6 + ·OH → Products
2 records matched CH3Br + O· → ·OH + ·CH2Br
8 records matched CH3Br + ·OH → H2O + ·CH2Br
24 records matched CH4 + O· → ·CH3 + ·OH
60 records matched CH4 + ·OH → ·CH3 + H2O
19 records matched CH3CCl3 + ·OH → H2O + CCl3CH2
7 records matched Benzene + ·OH → Cyclohexadienyl, 6-hydroxy-
6 records matched Benzene + ·OH → Phenyl + H2O
1 record matched Benzene + ·OH → Phenol + H·
2 records matched Benzene + ·OH → Other Products + CO
2 records matched Benzene + ·OH → Other Products + Phenol
2 records matched Benzene + ·OH → Other Products + 1,4-Benzoquinone
2 records matched Benzene + ·OH → Other Products + HCOOH
1 record matched Benzene + ·OH → Adduct
29 records matched Benzene + ·OH → Products
2 records matched Benzene + ·OH → Carbonyls + Other Products
2 records matched Benzene + ·OH → C6H6-OH
1 record matched n-C5H11OH + ·OH → Other Products + H2O
11 records matched n-C5H11OH + ·OH → Products
1 record matched n-C4H9OH + ·OH → H2O + CH3CH2CH2C(·)HOH
1 record matched n-C4H9OH + ·OH → H2O + CH3CH2CH2CH2
2 records matched n-C4H9OH + ·OH → Other Products + H2O
14 records matched n-C4H9OH + ·OH → Products
1 record matched n-C4H9OH + ·OH → CH3CH2CH(·)CH2OH + H2O
1 record matched n-C4H9OH + ·OH → CH3CH(·)CH2CH2OH + H2O
1 record matched n-C4H9OH + ·OH → CH3CH2CH2CH(·)OH + H2O
1 record matched n-C4H9OH + ·OH → (·)CH2CH2CH2CH2OH + H2O
1 record matched n-C3H7OH + O· → Other Products + ·OH
4 records matched n-C3H7OH + ·OH → Other Products + H2O
1 record matched n-C3H7OH + ·OH → Other Products + C2H5CHO
1 record matched n-C3H7OH + ·OH → Other Products + CH3CHO
6 records matched n-C3H7OH + ·OH → Products
7 records matched HCON(CH3)2 + ·OH → Products
1 record matched (CH3)2SO2 + ·OH → Products
1 record matched (CH3)2SO + ·OH → ·CH3 + CH3S(O)OH
6 records matched (CH3)2SO + ·OH → Products
4 records matched CHCl3 + O· → ·CCl3 + ·OH
10 records matched CHCl3 + ·OH → ·CCl3 + H2O
7 records matched (CH3)2CO + O· → CH3C(O)CH2(·) + ·OH
11 records matched (CH3)2CO + ·OH → CH3C(O)CH2(·) + H2O
3 records matched (CH3)2CO + ·OH → CH3C(O)OH + ·CH3
12 records matched (CH3)2CO + ·OH → Products
1 record matched iso-C3H7OH + N → Other Products + ·OH
1 record matched iso-C3H7OH + O· → Other Products + ·OH
7 records matched iso-C3H7OH + ·OH → Other Products + H2O
4 records matched iso-C3H7OH + ·OH → Products
6 records matched CH3OH + O· → (·)CH2OH + ·OH
1 record matched CH3OH + O· → CH3O· + ·OH
5 records matched CH3OH + O· → Other Products + ·OH
1 record matched CH3OH + Kr → ·CH3 + ·OH + Kr
7 records matched CH3OH + ·OH → (·)CH2OH + H2O
4 records matched CH3OH + ·OH → CH3O· + H2O
14 records matched CH3OH + ·OH → Other Products + H2O
16 records matched CH3OH + ·OH → Products
11 records matched CH3OH → ·CH3 + ·OH
6 records matched n-C5H11CHO + ·OH → Products
1 record matched CH3C(O)OH + ·OH → CO2 + ·CH3 + H2O
3 records matched CH3C(O)OH + ·OH → Other Products + H2O
7 records matched CH3C(O)OH + ·OH → Products
4 records matched HCOOH + ·OH → Products
1 record matched C2H5OH + N → Other Products + ·OH
1 record matched C2H5OH + O· → ·OH + HOCH2CH2
2 records matched C2H5OH + O· → CH3CHOH + ·OH
5 records matched C2H5OH + O· → Other Products + ·OH
3 records matched C2H5OH + ·OH → HOCH2CH2 + H2O
4 records matched C2H5OH + ·OH → CH3CHOH + H2O
3 records matched C2H5OH + ·OH → CH3CH2O· + H2O
13 records matched C2H5OH + ·OH → Other Products + H2O
23 records matched C2H5OH + ·OH → Products
2 records matched C2H5OH → ·C2H5 + ·OH
2 records matched Carbaril + ·OH → Products
1 record matched (CH3)2NNO + ·OH → Products
6 records matched Dichlorvos + ·OH → Products
6 records matched aniline + ·OH → Products
2 records matched CH3NHNH2 + ·OH → Products
1 record matched (C2H5)2O + O· → 2-C4H9O + ·OH
4 records matched (C2H5)2O + O· → Other Products + ·OH
11 records matched (C2H5)2O + ·OH → Other Products + H2O
4 records matched CH3CH(OH)CH2OH + ·OH → Products
1 record matched (CH3)2NNH2 + ·OH → Products
3 records matched CN + H2O → HCN + ·OH
3 records matched CN + ·OH → H· + NCO
2 records matched CN + ·OH → Products
1 record matched C3H5NCS + ·OH → Products
3 records matched CCl4 + ·OH → Products
7 records matched CH2O + O· → HCO + ·OH
1 record matched CH2O + O· → CO + ·OH + H·
24 records matched CH2O + ·OH → HCO + H2O
1 record matched CH2O + ·OH → HCOOH + H·
7 records matched CH2O + ·OH → Products
1 record matched CH2FCF2OCHF2 + ·OH → Products
2 records matched CH3C(O)CH(CH3)CH2OH + ·OH → Products
3 records matched CF3OC(O)H + ·OH → Products
1 record matched O(1D) + HD → ·OH + D
21 records matched O(1D) + H2O → ·OH + ·OH
4 records matched O(1D) + NH3 → ·OH + NH2
2 records matched O(1D) + HF → ·OH + ·F
1 record matched O(1D) + HCl → ·OH + Cl
1 record matched O(1D) + CD3OH → ·OH + CD3O
1 record matched O(1D) + CH3OD → ·OH + CH2OD
19 records matched O(1D) + H2 → ·OH + H·
1 record matched O(1D) + neo-C5H12 → ·OH + (CH3)3CCH2
1 record matched O(1D) + n-C6H14 → Products + ·OH
1 record matched O(1D) + n-C5H12 → Products + ·OH
1 record matched O(1D) + n-C4H10 → n-C4H9 + ·OH
1 record matched O(1D) + C3H8 → Other Products + ·OH
1 record matched O(1D) + CH3Cl → ·OH + ·CH2Cl
2 records matched O(1D) + C2H6 → ·C2H5 + ·OH
6 records matched O(1D) + CH4 → ·CH3 + ·OH
1 record matched O(3P) + C2H5OH → CH3CHOH + ·OH
1 record matched C2F5C(O)O2 + HO2 → C2F5C(O)O + ·OH + O2
2 records matched Cyclohexene, 4-acetyl-1-methyl- + ·OH → Products
1 record matched CH3CF2OO· + HO2 → CH3CF2O(·) + ·OH + O2
1 record matched CH3CH2CH2C(O)OO· + HO2 → ·OH + O2 + n-C3H7C(O)O
1 record matched Oxetane, 2,2,3,4,4-pentafluoro- + ·OH → Products
2 records matched CH3CH2C(O)CH2(ONO2) + ·OH → Products
1 record matched CD2=C(CD3)CD=CD2 + ·OH → OHC5D8
2 records matched Nitric acid cyclopentyl ester, 2-hydroxy-, (E)- + ·OH → Products
2 records matched Nitric acid cyclohexyl ester, 2-oxo- + ·OH → Products
2 records matched Cyclohexyl 1,2 dinitrate, 1-methyl-, (E)- + ·OH → Products
2 records matched (CH3)2CHOCH2C(CH3)2ONO2 + ·OH → Other Products + H2O
2 records matched CH3C(O)OCH2C(OH)(CH3)2 + ·OH → Other Products + H2O
2 records matched 4-hydroxy-x-methyl-2-butenal (x = 2 or 3) + ·OH → Products
1 record matched OH(v=1) + DNO3 → ·OH + DNO3
1 record matched OH(v=1) + HNO3 → ·OH + HNO3
1 record matched OH(v=1) + (CD3)2CO → Products + ·OH
1 record matched OH(v=1) + (CH3)2CO → Products + ·OH
2 records matched (13)CO + ·OH → (13)CO2 + H·
1 record matched (CH3)2CHCH2OCH2OCH2CH(CH3)2 + ·OH → Products
1 record matched (CH3)2CHOCH2OCH(CH3)2 + ·OH → Products
1 record matched C6H5C(O)O2 + HO2 → C6H5C(O)O· + ·OH + O2
1 record matched CD3CH2OH + ·OH → Products
1 record matched CH2=CHC(CH3)=CH2 + ·OH → Products
1 record matched CH2=CHC(CH3)=CH2 + ·OH → HOCH2CHCCH3=CH2
1 record matched CH2FOCF2CHFCl + ·OH → Products
1 record matched CH3CH2CH(CH3)OCH2OCH(CH3)CH2CH3 + ·OH → Products
1 record matched CH3CH2CH2CH2OCH2OCH2CH2CH2CH3 + ·OH → Products
1 record matched CH3CH2OCH2OCH2CH3 + ·OH → Products
1 record matched CH3OCF(CF3)2 + ·OH → Products
1 record matched CH3OCF2CF2CF3 + ·OH → Products
1 record matched CH3OCF2CF3 + ·OH → Products
1 record matched CH3OCF2CHFCl + ·OH → Products
2 records matched M + ·OH + NO2 → M + HOONO
2 records matched M + ·OH + NO2 → M + HNO3
2 records matched M + ·OH + NO2 → cis, cis-HOONO + M
1 record matched M + ·OH + SO2 → M + HOSO2
1 record matched bornyl acetate + ·OH → Products
1 record matched di-i-propoxymethane + ·OH → Products
1 record matched di-sec-butoxymethane + ·OH → Products
1 record matched ethylene glycol diformate + ·OH → Products
1 record matched pinonaldehyde + ·OH → Other Products + (CH3)2CO
1 record matched pinonaldehyde + ·OH → Other Products + CH2O
1 record matched pinonaldehyde + ·OH → Products + (CH3)2CO
5 records matched CF3CCl=CClCF3 (unspecified isomer) + ·OH → Products
1 record matched methyl formate radical + O2 → CO2 + ·OH + HOCH
1 record matched hv(193 nm) + HC≡CCOOH → HCCCO + ·OH
1 record matched O(3P) + CH2C≡CH → ·OH + c-C3H2
1 record matched O(3P) + ·CH2CH=CH2 → CH2=C=CH2 + ·OH
1 record matched O(3P) + CHF3 → ·CF3 + ·OH
1 record matched O(3P) + C3H8 → Propyl Radical + ·OH
1 record matched O(3P) + C2H6 → ·C2H5 + ·OH
1 record matched O(3P) + CH4 → ·CH3 + ·OH
1 record matched O(1D) + NH3 → ·OH + NH2
1 record matched O(1D) + HF → ·OH + ·F
1 record matched O(1D) + H2 → ·OH + H·
2 records matched O(1D) + CF3CH2F → ·OH + CF3CHF
2 records matched O(1D) + CH2FCHF2 → Products + ·OH
2 records matched O(1D) + CH3CF3 → CF3CH2 + ·OH
2 records matched O(1D) + CHF2CHF2 → ·OH + CHF2CF2
2 records matched O(1D) + C2F5H → ·OH + C2F5
1 record matched O(1D) + n-C4H10 → Products + ·OH
2 records matched O(1D) + CH3CHF2 → Products + ·OH
1 record matched O(1D) + CH4 → ·CH3 + ·OH
1 record matched O(1D) + CH4 → Products + ·OH
1 record matched CHF2OCH2CF2CHF2 + ·OH → Products
1 record matched 2-nitrooxy-1-propanol + ·OH → Products
1 record matched 1-nitrooxy-2-propanol + ·OH → Products
1 record matched 2-nitrooxy-1-butanol + ·OH → Products
1 record matched 1-nitrooxy-2-butanol + ·OH → Products
1 record matched 3-nitrooxy-1-butanol + ·OH → Products
1 record matched 4-nitrooxy-2-butanol + ·OH → Products
1 record matched 4-nitrooxy-1-butanol + ·OH → Products
1 record matched 1-nitrooxy-2-pentanol + ·OH → Products
1 record matched 4-nitrooxy-1-pentanol + ·OH → Products
1 record matched 5-nitrooxy-2-pentanol + ·OH → Products
1 record matched 6-nitrooxy-1-hexanol + ·OH → Products
1 record matched 1,4-butyl dinitrate + ·OH → Products
1 record matched CHF2OCH2CF2CF3 + ·OH → Products
5 records matched methoxy methylacetate + ·OH → Products
5 records matched ethoxy methylformate + ·OH → Products
5 records matched ethoxy methylacetate + ·OH → Products
5 records matched methoxy ethylformate + ·OH → Products
5 records matched ethoxy ethylformate + ·OH → Products
1 record matched ·CH(OH)C(O)CH3 + O2 → CH3C(O)OH + CO + ·OH
1 record matched ·CH(OH)C(O)CH3 + O2 → HCOOH + H2C=C=O + ·OH
1 record matched COCH2OH → ·OH + CH2=C=C=O
1 record matched toluene-1,2-oxide 3/2-methyloxepin + ·OH → Products
1 record matched CF3CF=CClCF3(unspecified isomer) + ·OH → Products
3 records matched CF3CF2CF2CF2C(O)OH + ·OH → Products
1 record matched CH3CH2CH(OH)CHO + ·OH → Products
2 records matched CF3CF2CF2CH2OH + ·OH → Products
2 records matched CF3CF2CF2CF2CH2OH + ·OH → Products
2 records matched CF3CF2CF2CF2C(O)H + ·OH → Products
1 record matched CH2(X3B_1) + NO → HCN + ·OH
4 records matched C[17]O + ·OH → OC[17]O + H·
1 record matched CH2ClCH(OO)C(O)CH3 + HO2 → CH2ClCH(O·)C(O)CH3 + ·OH + O2
1 record matched CF3CH2OCClF2 + ·OH → Products
2 records matched CO(«nu»=0) + ·OH → CO2 + H·
2 records matched CO(«nu»=1) + ·OH → CO2 + H·
2 records matched CO(«nu»=2) + ·OH → CO2 + H·
2 records matched CO(«nu»=3) + ·OH → CO2 + H·
2 records matched CO(«nu»=4) + ·OH → CO2 + H·
1 record matched CF3CF2OC(O)H + ·OH → Products
1 record matched CF3CF2CF2OC(O)H + ·OH → Products
2 records matched (CD3O)2P(O)CD3 + ·OH → Products
4 records matched CHF2CF2CH2OCH3 + ·OH → Products
7 records matched CF3CF2CH2OCH3 + ·OH → Products
1 record matched CF3CF2CH2OCH3 + ·OH → C2F5CH(·)OCH3 + H2O
1 record matched CF3CF2CH2OCH3 + ·OH → C2F5CH2OCH2· + H2O
3 records matched C3H7CF(OC2H5)CF(CF3)2 + ·OH → Products
1 record matched CD3CH2CH2Br + ·OH → Products
1 record matched CD3CH2CD2Br + ·OH → Products
1 record matched CH3CD2CD2Br + ·OH → Products
1 record matched CD3CD2CD2Br + ·OH → Products
1 record matched CD3CD2CD2Br + ·OH → CD2CD2CD2Br + H2O
1 record matched CD3CD2CD2Br + ·OH → CD3CDCD2Br + H2O
1 record matched CD3CD2CD2Br + ·OH → CD3CD2CDBr + H2O
4 records matched CF3CFHCF2OCF3 + ·OH → Products
6 records matched CF3CFHCF2OCF2H + ·OH → Products
2 records matched (CH3)2C(OH)CHO + ·OH → Products
2 records matched C4F9SO2N(H)CH2CH3 + ·OH → Products
2 records matched CF3OCF(CF3)CF2OCF2OCF3 + ·OH → Products
2 records matched CHF2OCF2CHF2 + ·OH → Products
1 record matched (CF3)2CHOCHF2 + ·OH → Products
1 record matched CHF2CF2OCHFCF3 + ·OH → Products
1 record matched (CH3)CH(OO·)COCH3 + HO2 → ·OH + O2 + CH3C(O)CH(O·)CH3
2 records matched 2-ethoxy-3,3,4,4,5-pentafluorotetra-hydro-2,5-bis[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]-furan + ·OH → Products
1 record matched 6-hydroxy-1,2,3,4,5,6-hexamethylcyclohexa-2,4-dien-1-yl → Hexamethylbenzene + ·OH
4 records matched CD2=CD-CD2OD + ·OH → Products
1 record matched CH2IC(CH3)(OH)CH=CH2 + ·OH → IHOC5H8OH
1 record matched cyclo-CF2CF2CHFCH2 + ·OH → Products
1 record matched trans-cyclo-CF2CF2CHClCHF + ·OH → Products
1 record matched cyclo-CF2CFClCH2CH2 + ·OH → Products
1 record matched trans-cyclo-CF2CFClCHClCH2 + ·OH → Products
1 record matched cis-cyclo-CF2CFClCHClCH2 + ·OH → Products
1 record matched OH-propene adduct (unspecified) → CH3CH=CH2 + ·OH
1 record matched HFE-7200 + ·OH → Products
1 record matched HFE-7100 + ·OH → Products
1 record matched CH2ClC(CH3)(OO·)CHO + HO2 → CH2ClC(CH3)(O·)CHO + ·OH + O2
2 records matched CH3C(O)C(CH3)2(ONO2) + ·OH → Products
1 record matched CH3CH2CH(OOH)CH=CHCH=O + ·OH → Products
1 record matched ·CD2CD2OH → C2D4 + ·OH
5 records matched N-ethylperfluorobutyramide + ·OH → Products
1 record matched n-C4F9OC(O)H + ·OH → Products
1 record matched i-C4F9OC(O)H + ·OH → Products
1 record matched 1-methyl-2-hydroxy-4-isopropyl-cyclohexa-2,4-dienyl → p-Cimene + ·OH
1 record matched 1-isopropyl-2-hydroxy-4-methyl-cyclohexa-2,4-dienyl → p-Cimene + ·OH
1 record matched H13CN + ·OH → Products
1 record matched HC15N + ·OH → Products
1 record matched 1-(2-methyloxiran-2-yl)ethane-1,2-diol + ·OH → Products
1 record matched trans-2-methyl-2,3-epoxybutane-1,4-diol + ·OH → Products
1 record matched 1,3,3,4,4-Pentafluorocyclobutene + ·OH → Products
3 records matched (E)-HC(O)CH=CHCHO + ·OH → Products
1 record matched 2-butyne-OH adduct + O2 → (CH3CO)2 + ·OH
1 record matched Propyl Radical + O2 → Other Products + ·OH
1 record matched CF3CHFOC(O)H + ·OH → Products
5 records matched CH3OCF2CF2OCH3 + ·OH → Products
5 records matched CH3O(CF2CF2O)2CH3 + ·OH → Products
5 records matched CH3O(CF2CF2O)3CH3 + ·OH → Products
5 records matched CH3OCHFCF3 + ·OH → Products
2 records matched C8F17CH2CHO + ·OH → Products
1 record matched CH3C(O)C(O)O2 → CO2 + H2C=C=O + ·OH
1 record matched N-formyl pyrrolidinone + ·OH → Products
1 record matched CH2OCH2OOH → CH2O + CH2O + ·OH
2 records matched C4F9O(CH2)3OC4F9 + ·OH → Products
2 records matched CF3CFHCF2O(CH2)3OCF3CFHCF2 + ·OH → Products
2 records matched i-C4F9OC2H5 + ·OH → Products
3 records matched trans-cyclo-CF2CF2CHClCHCl- + ·OH → Products
3 records matched cis-cyclo-CF2CF2CHClCHCl- + ·OH → Products
5 records matched (Z)-1,3,3,3-tetrafluoroprop-1-ene + ·OH → Products
3 records matched E-CF3CFCHF + ·OH → Products
1 record matched 4-nitrooxy-1-butanol-2-ene + ·OH → Products
1 record matched 1-nitrooxy-2-butanol-3-ene + ·OH → Products
1 record matched C4H9OCH2OCHO + ·OH → Products
1 record matched NH(a1Δ) + ·OH → Products
2 records matched CF3OC(CF3)2H + ·OH → Products
1 record matched CH3C(CH3)2CH=CHCH=CH2 + O3 → Other Products + ·OH
1 record matched CH2CHC(CH2)CH2CH2CHO + ·OH → Products
1 record matched CH2CHC(CH3)CHCH2CHO + ·OH → Products
1 record matched (3E)-4-methylhexa-3,5-dienal + ·OH → Products
1 record matched O2(X3Sigma_g-) + C2H3 → H2C=C=O + ·OH
1 record matched CBrCl(OH) → ·OH + CBrCl
1 record matched CH2ClOOH → ·OH + CH2ClO
4 records matched HOPO2 → ·OH + PO2
1 record matched CD3S(OH)CD3 → (CD3)2S + ·OH
2 records matched (CH3)2C(CH2OOH)CH2· → ·OH + Oxetane, 3,3-dimethyl-
1 record matched (CH3)2C(CH2OOH)CH2· → 2,2-Dimethyloxirane + ·OH
2 records matched (CH3)2C(CH2OOH)CH2· → CH2O + iso-C4H8 + ·OH
1 record matched CH2OOH → ·OH + HOCH
1 record matched HOCH2O → CH2O + ·OH
1 record matched HN=NO. → ·OH + N2
1 record matched HSO2 → ·OH + SO
1 record matched CH2OO → HCO + ·OH
2 records matched CH3(CH2)3CH2OO → n-C4H9CHO + ·OH
1 record matched (C2H5)2CHO2 → (C2H5)2CO + ·OH
1 record matched n-C3H7CH(CH3)O2 → n-C3H7C(O)CH3 + ·OH
1 record matched CCl3OH → ·CCl3 + ·OH
2 records matched HOSO2 → ·OH + SO2
3 records matched (CH3)3CCH2OO → 2,2-dimethylpropanal + ·OH
1 record matched (CH3)2CHCH2O2 → (CH3)2CHCHO + ·OH
1 record matched n-C4H9O2 → n-C3H7CHO + ·OH
1 record matched n-C4H9O2 → CH3CH2CH2CHO + ·OH
1 record matched C2H5CH(CH3)O2 → C2H5COCH3 + ·OH
1 record matched Strontium hydroxide → ·OH + SrOH
2 records matched O· + HN=N → ·OH + N2
1 record matched Ba(OH)2 → ·OH + BaOH
1 record matched HC-N=O + O· → ·OH + NCO
1 record matched HC-N=O + H· → HCN + ·OH
1 record matched HC-N=O + ·OH → NO + HOCH
1 record matched HC-N=O + ·OH → H2O + NCO
1 record matched HC-N=O + ·OH → ·OH + H· + NCO
1 record matched HC-N=O + ·OH → HCO + HNO
1 record matched HC-N=O + ·OH → CO + H2 + NO
7 records matched HNO + O· → ·OH + NO
1 record matched HOI + O· → ·OH + IO
1 record matched HD + O· → ·OH + D
1 record matched NH2 + O· → ·OH + NH
1 record matched HOBr + Cl → ·OH + BrCl
1 record matched HOBr + O· → ·OH + BrO
1 record matched HOBr + ·F → ·OH + BrF
1 record matched HOBr → ·OH + Br·
1 record matched H· + ClO → ·OH + Cl
1 record matched H· + ClONO2 → CCl(O)NO + ·OH
1 record matched OF + H· → ·OH + ·F
1 record matched NO3 + H· → ·OH + NO2
2 records matched Cyclohexadienyl, 6-hydroxy- → Benzene + ·OH
1 record matched NO2 + NH → ·OH + N2O
2 records matched NO2 + NH2 → trans-HNNO + ·OH
2 records matched NO2 + NH2 → cis-HNNO + ·OH
1 record matched NO + ·CH2 → HCN + ·OH
1 record matched NO + SiH2NH → SiH2NN + ·OH
2 records matched NO + NH → ·OH + N2
2 records matched NO + NH2 → ·OH + HN=N
1 record matched NO + NH2 → Other Products + ·OH
1 record matched Br· + HOBr → ·OH + Br2
2 records matched HI + O· → ·OH + I
2 records matched O3 + H· → ·OH + O2
1 record matched O3 + H· → O2(1DELTA) + ·OH
3 records matched N2O + H· → ·OH + N2
1 record matched SiH4 + O· → ·OH + SiH3
2 records matched NH2OH → ·OH + NH2
3 records matched HOCl + Cl → ·OH + Cl2
1 record matched HOCl + O· → ·OH + ClO
1 record matched HOCl + ClO → ·OH + Cl2O
1 record matched HOCl + ·F → ·OH + ClF
1 record matched HOCl + ClO3 → ClOClO2 + ·OH
1 record matched HOCl + H· → ·OH + HCl
2 records matched H2S + O· → ·OH + SH
1 record matched HNO2 + H· → ·OH + HNO
1 record matched HNO2 → ·OH + NO
1 record matched O2 + HC(O)CO → CO2 + CO + ·OH
1 record matched O2 + ·CH2 → Other Products + ·OH
1 record matched O2 + CH3SCH2 → CH2O + CH2S + ·OH
1 record matched O2 + CH3SCH2 → CH3SC(O)H + ·OH
1 record matched O2 + CH3SCH2 → 1,3-oxathietane + ·OH
5 records matched O2 + NH → ·OH + NO
1 record matched O2 + NH2 → ·OH + HNO
1 record matched O2 + SiH3 → ·OH + H2Si=O
15 records matched O2 + H· → ·OH + O·
1 record matched H2O + (CH3)2C(·)OO· → Other Products + ·OH
1 record matched H2O + CH3CH(·)OO· → Other Products + ·OH
1 record matched H2O + Cl → ·OH + HCl
2 records matched H2O + C2F → HCCF + ·OH
2 records matched H2O + CF3O → CF3OH + ·OH
3 records matched H2O + O· → ·OH + ·OH
1 record matched H2O + ·F → ·OH + HF
1 record matched H2O + IO → ·OH + HOI
1 record matched H2O + I → ·OH + HI
1 record matched H2O + NH → ·OH + NH2
1 record matched H2O + NH2 → ·OH + NH3
1 record matched H2O + OD → ·OH + HDO
4 records matched H2O + H· → H2 + ·OH
1 record matched H2O + C2 → ·C2H + ·OH
1 record matched H2O + O2 → HO2 + ·OH
1 record matched H2O → ·OH + H·
1 record matched HC(O)Br → ·OH + CBr3
1 record matched H2O2 + Cl → ·OH + HOCl
8 records matched H2O2 + H· → ·OH + H2O
1 record matched H2O2 + NO2 → ·OH + HNO3
7 records matched H2O2 → ·OH + ·OH
1 record matched HNO3 + O· → ·OH + NO3
1 record matched HNO3 → ·OH + NO2
1 record matched NH3 + O· → ·OH + NH2
11 records matched HCl + O· → ·OH + Cl
1 record matched HOClO3 + H· → ·OH + HOClO2
1 record matched C + H2O → ·CH + ·OH
1 record matched Hg + HOCl → ·OH + Mercury chloride
2 records matched CH2=CHCH2OOH → ·OH + CH2=CHCH2O
5 records matched HOCH2CH2 → C2H4 + ·OH
1 record matched C6H5CH2OO + H· → ·OH + C6H5CH2O
1 record matched C6H5CH2OO + H· → C6H5CHOH + ·OH
1 record matched (CH3)2CHO2 → Methyloxirane + ·OH
2 records matched (CH3)2CHO2 → (CH3)2CO + ·OH
2 records matched (CH3)3CCH2 + O2 → ·OH + Oxetane, 3,3-dimethyl-
2 records matched (CH3)3CCH2 + O2 → 2,2-dimethylpropanal + ·OH
2 records matched (CH3)3CCH2 + O2 → CH2O + iso-C4H8 + ·OH
2 records matched ·OH + HCF2OCF2CF2OCF2H → CHF2OCF2CF2OCF2 + H2O
1 record matched ·OH + 1,3-Cyclopentadiene, 5-ethynyl- → fulvallenyl + H2O
2 records matched ·OH + CF3CF2CH2CH2F → Other Products + H2O
2 records matched ·OH + CF3CHFCHFCF2CF3 → Other Products + H2O
1 record matched ·OH + CF3CHFCHFCF2CF3 → Products
1 record matched ·OH + HN(CN)OH → H2O + ·N(CN)OH
1 record matched ·OH + (E)-CF3CH=CHCl → CF3CH(OH)CHCl·
1 record matched ·OH + (E)-CF3CH=CHCl → CF3CH(·)CHClOH
2 records matched ·OH + CF3CH2CF2CH2CF3 → CF3CH2CF2CH(.)CF3 + H2O
1 record matched ·OH + (Z)-CF3CH=CHCl → CF3CH(OH)CHCl·
1 record matched ·OH + (Z)-CF3CH=CHCl → CF3CH(·)CHClOH
2 records matched ·OH + CF3CF2CH2CH2CF2CF3 → CF3CF2CH2CH(.)CF2CF3 + H2O
1 record matched ·OH + CHCl2CH2· → Ethanol, 2,2-dichloro-
1 record matched ·OH + (E)-6-hydroxy-4-methyl-hex-4-enal → Products
1 record matched ·OH + CF3CHFCF2OCH2CF2CHF2 → Other Products + H2O
1 record matched ·OH + CCl2FCHO → CFCl2C(O)(.) + H2O
1 record matched ·OH + (Z)-CH3CH=CHOH → H2O + CH(OH)CH=CH2
2 records matched ·OH + (Z)-CH3CH=CHOH → Products
1 record matched ·OH + (Z)-CH3CH=CHOH → CH3CHC-O-H + H2O
1 record matched ·OH + (Z)-CH3CH=CHOH → CH3C(·)=CHOH + H2O
1 record matched ·OH + (Z)-CH3CH=CHOH → 2-methylvinoxy radical + H2O
1 record matched ·OH + (E)-CH3CH=CHOH → H2O + CH(OH)CH=CH2
2 records matched ·OH + (E)-CH3CH=CHOH → Products
1 record matched ·OH + (E)-CH3CH=CHOH → CH3CHC-O-H + H2O
1 record matched ·OH + (E)-CH3CH=CHOH → CH3C(·)=CHOH + H2O
1 record matched ·OH + (E)-CH3CH=CHOH → 2-methylvinoxy radical + H2O
1 record matched ·OH + CF3CHFOCHF2 → Other Products + H2O
1 record matched ·OH + CF3CHFOCHF2 → CF3C(·)FOCHF2 + H2O
1 record matched ·OH + CF3CHFOCHF2 → CF3CHFOC(·)F2 + H2O
1 record matched ·OH + CH2OO → H2O + HCOO
1 record matched ·OH + CH2OO → HCO + ·OH + ·OH
1 record matched ·OH + CH2OO → CH2O + HO2
1 record matched ·OH + C2H5CH2C(C2H5)=C(C2H5)2 → Products
1 record matched ·OH + ClCHCH=CH2 → Products
1 record matched ·OH + 1,4,6,9-Tetrachloro-p-dioxin → Products
1 record matched ·OH + 1,1'-Biphenyl, 3,4',5-trichloro- → Products
1 record matched ·OH + 1,1'-Biphenyl, 3,3',5-trichloro- → Products
1 record matched ·OH + 1,1'-Biphenyl, 2',3,5-trichloro- → Products
1 record matched ·OH + HN=N → Products
1 record matched ·OH + 1,1'-Biphenyhl, 2,4'-dichloro- → Products
1 record matched ·OH + 1,1'-Biphenyl, 3,5-dichloro- → Products
1 record matched ·OH + 1,1'-Biphenyl, 2,5-dichloro- → Products
1 record matched ·OH + 1,1'-Biphenyl, 2,4-dichloro- → Products
1 record matched ·OH + (tert-C4H9)CH2C(CH3)=C(CH3)2 → Products
1 record matched ·OH + 1,1'-Biphenyl, 2,6-dichloro- → Products
1 record matched ·OH + CH3OCH(OH)CH3 → Other Products + H2O
1 record matched ·OH + CH2=CHCF3 → CF3CH(OH)CH2·
1 record matched ·OH + CH2=CHCF3 → CF3CH(·)CH2OH
1 record matched ·OH + ClSO2 → HO(Cl)SO2
1 record matched ·OH + CH2=C(OH)CH3 → CH3C(O)CH2(·) + H2O
2 records matched ·OH + CH2=C(OH)CH3 → Products
1 record matched ·OH + CH2=C(OH)CH3 → CH2=C(OH)-CH2· + H2O
1 record matched ·OH + CH2=C(OH)CH3 → ·CH=C(OH)CH3 + H2O
1 record matched ·OH + trans-CHF=CHCF3 → Products
1 record matched ·OH + CH3CD2CD3 → Other Products + HDO
2 records matched ·OH + CH3CD2CD3 → CD3CD2CH2(.) + H2O
1 record matched ·OH + CH3CD2CD3 → CH3CD2CD2(.) + HDO
1 record matched ·OH + CH3CD2CD3 → CD3CD(.)CH3 + HDO
3 records matched ·OH + H2NCH2CH2COOH → Products
1 record matched ·OH + 1,1'-Biphenyl, chloro- → Products
1 record matched ·OH + 1,3-Cyclopentadiene, 5-ethenylidene- → fulvallenyl + H2O
1 record matched ·OH + 1,1'-Biphenyl, tetrachloro- → Products
1 record matched ·OH + CHF2OCHClCF3 → Other Products + H2O
1 record matched ·OH + CHF2OCHClCF3 → CF3C(·)ClOCHF2 + H2O
1 record matched ·OH + CHF2OCHClCF3 → CF3CHClOC(·)F2 + H2O
2 records matched ·OH + HO2NO2 → Products
1 record matched ·OH + CH2=CHCH2O → CH2=CHCH2OOH
1 record matched ·OH + 1,1'-Biphenyl 2,3'-dichloro- → Products
1 record matched ·OH + 1,1'-Biphenyl, dichloro- → Products
1 record matched ·OH + 1,1'-Biphenyl-, pentachloro- → Products
1 record matched ·OH + 1,1'-Biphenyl, trichloro- → Products
1 record matched ·OH + CH3CCl2F → ·CH2CCl2F + H2O
1 record matched ·OH + Bicyclo[3.1.1]heptan-2-one, 6,6-dimethyl- → 1-nopinonyl + H2O
1 record matched ·OH + Bicyclo[3.1.1]heptan-2-one, 6,6-dimethyl- → 3-nopinonyl + H2O
1 record matched ·OH + Bicyclo[3.1.1]heptan-2-one, 6,6-dimethyl- → 4-nopinonyl + H2O
1 record matched ·OH + Bicyclo[3.1.1]heptan-2-one, 6,6-dimethyl- → 5-nopinonyl + H2O
1 record matched ·OH + Bicyclo[3.1.1]heptan-2-one, 6,6-dimethyl- → 7-nopinonyl + H2O
1 record matched ·OH + Bicyclo[3.1.1]heptan-2-one, 6,6-dimethyl- → 8-nopinonyl + H2O
1 record matched ·OH + Bicyclo[3.1.1]heptan-2-one, 6,6-dimethyl- → 9-nopinonyl + H2O
1 record matched ·OH + Bicyclo[3.1.1]heptan-2-one, 6,6-dimethyl- → nopinonyl + H2O
3 records matched ·OH + CHF2CHFCHF2 → Other Products + H2O
1 record matched ·OH + CHF2CHFCHF2 → Products
1 record matched ·OH + CHF2CHFCHF2 → ·CF2CHFCHF2 + H2O
1 record matched ·OH + CHF2CHFCHF2 → CHF2C(·)FCHF2 + H2O
1 record matched ·OH + CH2ClCCl2· → Adduct
1 record matched ·OH + Cl → H· + ClO
3 records matched ·OH + NCO → HCO + NO
5 records matched ·OH + NCO → CO + NO + H·
1 record matched ·OH + NCO → Products
1 record matched ·OH + NCO → O(3P) + HO-C≡N
1 record matched ·OH + NCO → O(3P) + HN=C=O
1 record matched ·OH + BrO2 → O3 + HBr
1 record matched ·OH + BrO2 → O2 + HOBr
1 record matched ·OH + BrO2 → HO2 + BrO
1 record matched ·OH + BrO2 → HOBrO2
1 record matched ·OH + (E)-CH2=CHCH=CHC2H5 → Adduct
1 record matched ·OH + (E)-CH2=CHCH=CHC2H5 → Products
1 record matched ·OH + n-C5H11C(CH3)=C(CH3)2 → Products
1 record matched ·OH + (C2H5)2C=C(CH3)2 → Products
1 record matched ·OH + C4H9C(C2H5)=C(CH3)2 → Products
1 record matched ·OH + CH3CH=C(C2H5)CHO → Products
1 record matched ·OH + HOCH → CO2 + H2 + H·
1 record matched ·OH + (E)-C2H5C(CH3)=C(CH3)C2H5 → Products
1 record matched ·OH + (Z)-C2H5C(CH3)=C(CH3)C2H5 → Products
1 record matched ·OH + CH3CCl2· → CH3CCl2OH
5 records matched ·OH + N → NO + H·
12 records matched ·OH + O· → O2 + H·
1 record matched ·OH + CH3S(O)OH → CH3S(O)2 + H2O
1 record matched ·OH + CH3S(O)OH → Products
3 records matched ·OH + OClO → HOClO2
1 record matched ·OH + OClO → O2 + HOCl
1 record matched ·OH + OClO → HO2 + ClO
1 record matched ·OH + OClO → Products
1 record matched ·OH + (CD3)2O → CD3OCD2· + HDO
1 record matched ·OH + CF3O2 → HO2 + CF3O
1 record matched ·OH + CF3O2 → CF3OH + O2
1 record matched ·OH + CF3O2 → COF2 + HF + O2
1 record matched ·OH + CF3O2 → CHF3 + O3
1 record matched ·OH + CF3O2 → O2(1DELTA) + CF3OH
1 record matched ·OH + CF3O2 → O2(1DELTA) + COF2 + HF
1 record matched ·OH + Acetaldehyde, bromo- → BrCH2C(O)(.) + H2O
1 record matched ·OH + Acetaldehyde, bromo- → ·CHBrCHO + H2O
1 record matched ·OH + D → H· + OD
1 record matched ·OH + (C2H5)2C=CHC2H5 → Products
1 record matched ·OH + 2,3-dichloro-1,1'-Biphenyl → Products
1 record matched ·OH + Cyclopropanol → Other Products + H2O
1 record matched ·OH + Cyclopropanol → trans-cyclopropanol-2-yl radical + H2O
1 record matched ·OH + Cyclopropanol → cyclopropoxy radical + H2O
1 record matched ·OH + Cyclopropanol → cis-cyclopropanol-2-yl radical + H2O
1 record matched ·OH + 2,3,4-Trichlorophenol → 2,3,4-trichlorophenoxy radical + H2O
1 record matched ·OH + SCN → NO + HC=S
1 record matched ·OH + SCN → HNC + SO
1 record matched ·OH + HOCH2OOH → H2O + HOOCH2O
1 record matched ·OH + HOCH2OOH → H2O + HOCH2OO
1 record matched ·OH + HOCH2OOH → HOC(·)HOOH + H2O
1 record matched ·OH + (E)-4-C8H16 → Adduct
1 record matched ·OH + (Z)-3-C8H16 → Products
1 record matched ·OH + IO → HOI + O·
1 record matched ·OH + (E)-2-C7H14 → Products
1 record matched ·OH + I → HI + O·
3 records matched ·OH + HNO → H2O + NO
1 record matched ·OH + HNO → Adduct
1 record matched ·OH + HOI → H2O + IO
2 records matched ·OH + HOPO → H2O + PO2
1 record matched ·OH + HOF → Products
2 records matched ·OH + HD → H· + HDO
1 record matched ·OH + HD → H2O + D
1 record matched ·OH + HD → Products
1 record matched ·OH + NHOH → H2O + HNO
2 records matched ·OH + SO → SO2 + H·
2 records matched ·OH + SO → HOSO
1 record matched ·OH + NH → H· + HNO
1 record matched ·OH + NH → H2O + N
1 record matched ·OH + NH2 → H· + NH2O
2 records matched ·OH + NH2 → NH2OH
3 records matched ·OH + NH2 → H2O + NH
3 records matched ·OH + NH2 → NH3 + O·
1 record matched ·OH + NH2 → H2 + :NOH
1 record matched ·OH + NH2 → H2 + HNO
1 record matched ·OH + NH2 → O(1D) + NH3
1 record matched ·OH + NH2 → (3)NH + H2O
1 record matched ·OH + NH2 → NH3O
1 record matched ·OH + NH2 → trans-HNOH + H·
1 record matched ·OH + NH2 → cis-HNOH + H·
2 records matched ·OH + NH2 → NH(a1Δ) + H2O
1 record matched ·OH + HOBr → Products
3 records matched ·OH + Iodine dioxide → HOIO2
1 record matched ·OH + 3-Carene → Adduct
1 record matched ·OH + 3-Carene → Products
1 record matched ·OH + (Z)-(CH3)2CHCH2CH=CHCH3 → Products
1 record matched ·OH + 1,1'-Biphenyl, 2,2'-dichloro- → Products
5 records matched ·OH + H· → H2O
1 record matched ·OH + ·NHC=N → HN(CN)OH
2 records matched ·OH + ·NHC=N → NH2 + NCO
1 record matched ·OH + ·NHC=N → HNC + HNO
1 record matched ·OH + ·NHC=N → NCN + H2O
1 record matched ·OH + ·NHC=N → C#N(OH) + NH
1 record matched ·OH + ·NHC=N → HCN + HNO
2 records matched ·OH + ·NHC=N → Products
1 record matched ·OH + ·NHC=N → HONHCN
1 record matched ·OH + ·NHC=N → HONCNH
1 record matched ·OH + ·NHC=N → NCN(singlet) + H2O
1 record matched ·OH + CaOH → Ca(OH)2
2 records matched ·OH + PO2 → HOPO2
1 record matched ·OH + SrOH → Strontium hydroxide
1 record matched ·OH + NO3 → HO2 + NO2
1 record matched ·OH + NO3 → trans-HONO + O2
1 record matched ·OH + NO3 → O2(1Delta_g) + trans-HONO
1 record matched ·OH + BaOH → Ba(OH)2
1 record matched ·OH + C2H5C(CH3)=C(CH3)2 → Adduct
1 record matched ·OH + (Z)-(CH3)2CHCH=CHCH(CH3)2 → Products
1 record matched ·OH + CH3CH2OCH2OH → Other Products + H2O
1 record matched ·OH + CH3SCH2CH=CH2 → Products
4 records matched ·OH + NO2 → HOONO
6 records matched ·OH + NO2 → HNO3
1 record matched ·OH + NO2 → HO2 + NO
1 record matched ·OH + NO2 → Products
1 record matched ·OH + NO → HNO2
1 record matched ·OH + NO → Products
1 record matched ·OH + HI → H2O + I
1 record matched ·OH + (E)-CH3OCH=CHCH=CH2 → Products
3 records matched ·OH + O3 → HO2 + O2
1 record matched ·OH + N2O → NO + HNO
2 records matched ·OH + N2O → HO2 + N2
1 record matched ·OH + SiH4 → H2O + SiH3
2 records matched ·OH + NH2OH → H2O + NHOH
1 record matched ·OH + NH2OH → H2O + NH2O
1 record matched ·OH + Cl2O → HOCl + ClO
2 records matched ·OH + HOCl → H2O + ClO
1 record matched ·OH + HOCl → Products
1 record matched ·OH + D2O → OD + HDO
1 record matched ·OH + NF3 → Products
1 record matched ·OH + OF2 → OF + HOF
2 records matched ·OH + H2S → H2O + SH
1 record matched ·OH + HN3 → H2O + ·N3
1 record matched ·OH + HN3 → N2 + NHOH
1 record matched ·OH + HN3 → O(3P) + N2 + NH2
2 records matched ·OH + Cl2 → HOCl + Cl
1 record matched ·OH + D2 → HDO + D
4 records matched ·OH + H2O → ·OH + H2O
1 record matched ·OH + N2 → NO + NH
1 record matched ·OH + N2 → N2O + H·
12 records matched ·OH + H2O2 → HO2 + H2O
2 records matched ·OH + HNO3 → H2O + NO3
1 record matched ·OH + (Z)-2-C6H12 → Products
2 records matched ·OH + H2SO4 → HOSO3 + H2O
7 records matched ·OH + NH3 → H2O + NH2
1 record matched ·OH + HF → H2O + ·F
5 records matched ·OH + HCl → H2O + Cl
1 record matched ·OH + (Z)-4-C8H16 → Products
1 record matched ·OH + (Z)-3-C6H12 → Products
2 records matched ·OH + HOClO3 → ClO4 + H2O
1 record matched ·OH + Mercury chloride → Hg + HOCl
8 records matched ·OH + SO2 → HOSO2
1 record matched ·OH + Cs → CsOH
1 record matched ·OH + C → CO + H·
1 record matched ·OH + C → CO(a3Π) + H·
2 records matched ·OH + Na → NaOH
1 record matched ·OH + Rb → RbOH
2 records matched ·OH + K → KOH
1 record matched ·OH + Hg → HgOH
1 record matched ·OH + Li → LiOH
1 record matched ·OH + (Z)-5-C10H20 → Products
1 record matched ·OH + (E)-CH2=CHCH2CH=CHCH3 → Adduct
1 record matched ·OH + C2H5CH2C(CH3)=C(CH3)2 → Products
1 record matched ·OH + HNC → HN=C=O + H·
1 record matched ·OH + ·CH2Cl → ·CHCl + H2O
1 record matched ·OH + ·CH2Cl → H2 + HC(O)Cl
1 record matched ·OH + ·CH2Cl → CH2O + HCl
1 record matched ·OH + Humulene → Adduct
2 records matched ·OH + CH3NHC(O)OCH3 → Products
1 record matched ·OH + CH3NHC(O)OCH3 → CH3NHC(OH)(O·)OCH3 + H2O
1 record matched ·OH + CH3NHC(O)OCH3 → CH3NHC(OH)(O·)OCH3
2 records matched ·OH + CH3NHC(O)OCH3 → CH3N(·)C(O)OCH3 + H2O
2 records matched ·OH + CH3NHC(O)OCH3 → ·CH2NHC(O)OCH3 + H2O
2 records matched ·OH + CH3NHC(O)OCH3 → CH3NHC(O)OCH2· + H2O
1 record matched ·OH + (Z)-2-C7H14 → Products
1 record matched ·OH + n-C4H9C(CH3)=CH2 → Products
1 record matched ·OH + d-Limonene → Adduct
2 records matched ·OH + d-Limonene → Products
1 record matched ·OH + Z-CF3CFCHF → Products
1 record matched ·OH + CH3SCH2CH2OH → Products
1 record matched ·OH + (E),(E)-CH3CH=CHCH=CHCH3 → Products
1 record matched ·OH + (E),(Z)-CH3CH=CHCH=CHCH3 → Products
1 record matched ·OH + C4H9OCH2CH(OH)CH3 → CH3CH(OH)CH2OCH2CH2CH2CH2·
1 record matched ·OH + C4H9OCH2CH(OH)CH3 → CH3CH(OH)CH2OCH2CH2CH(·)CH3
1 record matched ·OH + C4H9OCH2CH(OH)CH3 → CH3CH(OH)CH2OCH2CH(·)CH2CH3
1 record matched ·OH + C4H9OCH2CH(OH)CH3 → CH3CH(OH)CH2OCH(·)CH2CH2CH3
1 record matched ·OH + C4H9OCH2CH(OH)CH3 → CH3CH(OH)CH(·)OCH2CH2CH2CH3
1 record matched ·OH + C4H9OCH2CH(OH)CH3 → CH3C(·)(OH)CH2OCH2CH2CH2CH3
1 record matched ·OH + C4H9OCH2CH(OH)CH3 → CH2(·)CH(OH)CH2OCH2CH2CH2CH3
1 record matched ·OH + C4H9OCH2CH(OH)CH3 → CH3CH(O·)CH2OCH2CH2CH2CH3
1 record matched ·OH + CHD2Cl → Products
1 record matched ·OH + CH2DCl → Products
1 record matched ·OH + 2,3,4,5-Tetrachlorophenol → 2,3,4,5-tetrachlorophenoxy radical + H2O
1 record matched ·OH + (1-Methylbutyl)cyclopentane → (1-Methylbutyl)cyclopent-1-yl radical + H2O
1 record matched ·OH + (1-Methylbutyl)cyclopentane → 2-cyclopentyl-pent-2-yl radical + H2O
1 record matched ·OH + CH2=CHC(CH3)=CHCH3 → Products
1 record matched ·OH + CH3OCH2OH → Other Products + H2O
1 record matched ·OH + 1,5,5-Trimethylcyclopentadiene → Products
1 record matched ·OH + (E)-CH3CH=CHCHO → Products
1 record matched ·OH + 1,3-Cyclopentadiene, 5,5-dimethyl- → Products
1 record matched ·OH + 1,3-Cycloheptadiene → Adduct
1 record matched ·OH + 1,3-Cycloheptadiene → Products
1 record matched ·OH + (E)-2-C6H12 → Adduct
1 record matched ·OH + CH2=C(CH3)CH2CH2CH=CH2 → Adduct
1 record matched ·OH + (C2H5)2CHCH=CH2 → Products
1 record matched ·OH + Copaene → Adduct
1 record matched ·OH + 1,2,3-Trimethylcyclopentadiene → Products
2 records matched ·OH + Pentafluorodimethyl ether → H2O + CF3OCF2(·)
1 record matched ·OH + Pentafluorodimethyl ether → Products
1 record matched ·OH + NF2 → HF + FNO
1 record matched ·OH + n-Pentylcyclopentane → pentyl cyclopent-1-yl radical + H2O
1 record matched ·OH + 2-Methyl-1,3-cyclopentadiene → Products
1 record matched ·OH + (E)-C2H5CH(CH3)CH=CHCH3 → Adduct
1 record matched ·OH + Cyclopropane,(1-methylethyl)- → Products + H2O
1 record matched ·OH + Cyclopropane,(1-methylethyl)- → cy-CH2CH2C(·)-CH(CH3)2 + H2O
1 record matched ·OH + Cyclopropane,(1-methylethyl)- → cy-CH2CH(·)CH-CH(CH3)2 + H2O
1 record matched ·OH + Cyclopropane,(1-methylethyl)- → cy-CH2CH2CH-C(·)(CH3)2 + H2O
1 record matched ·OH + Cyclopropane,(1-methylethyl)- → cy-CH2CH2CH-CH(CH3)(CH2·) + H2O
1 record matched ·OH + HN=NH → H2O + HN=N
1 record matched ·OH + C2H5CH(CH3)C(CH3)=CH2 → Products
1 record matched ·OH + C2H5C(=CH2)CH=CH2 → Products
1 record matched ·OH + Sabinene → Adduct
4 records matched ·OH + ·OH → H2O + O·
6 records matched ·OH + ·OH → H2O2
3 records matched ·OH + ·OH → HO2 + H·
2 records matched ·OH + ·OH → H2 + O2
1 record matched ·OH + ·OH → Products
2 records matched ·CH + O· → ·OH + C
1 record matched ·CH + O2 → CO + ·OH
1 record matched Dibenzo[b,e][1,4]dioxin, octachloro- + ·OH → Products
1 record matched 2H-Pyran, 3,6-dihydro- + ·OH → Products
1 record matched HO2 + CF3CFHO2· → CF3COF + HO2 + ·OH
2 records matched HO2 + CH2BrOO → CH2BrO + ·OH + O2
2 records matched HO2 + CH3C(O)CH2OO· → CH3C(O)CH2O· + ·OH + O2
1 record matched HO2 + CH2ClO2 → HC(O)Cl + HO2 + ·OH
1 record matched HO2 + Methyldioxy, dichloro- → COCl2 + HO2 + ·OH
1 record matched HO2 + 1H-inden-1-yl → indenoxy radical + ·OH
1 record matched HO2 + OSCl → ·OH + ClSO2
1 record matched HO2 + OSCl → ·OH + SO2 + Cl
3 records matched HO2 + CH3C(O)OO(·) → ·OH + O2 + CH3C(O)O
4 records matched HO2 + O· → ·OH + O2
1 record matched HO2 + ClO → ·OH + OClO
1 record matched HO2 + ClO → ·OH + ClOO
1 record matched HO2 + SH → ·OH + HSO
1 record matched HO2 + SO → ·OH + SO2
8 records matched HO2 + H· → ·OH + ·OH
3 records matched HO2 + NO → ·OH + NO2
1 record matched HO2 + O3 → ·OH + O2 + O2
1 record matched HO2 + O3 → Other Products + ·OH
1 record matched HO2 + H2O + NO → ·OH + H2O + NO2
1 record matched HO2 + H2O → ·OH + H2O2
1 record matched HO2 + H2O2 → ·OH + H2O + O2
2 records matched HO2 + SO2 → ·OH + SO3
1 record matched HO2 + CH3S· → ·OH + CH3SO
6 records matched HO2 + ·OH → H2O + O2
1 record matched CH3CO + O· → H2C=C=O + ·OH
1 record matched C2H5OO· + HO2 → CH3CH2O· + ·OH + O2
2 records matched C2H5OO· → CH3CHO + ·OH