Kinetics Database Logo

Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences


Rate Our Products and Services


Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty


Administrative Links

NIST home page

MML home page

Chemical and Biochemical Reference Data Division

MML home page

Chemical and Biochemical Reference Data Division

  NIST Logo Home
©NIST, 2013
Accessibility information

Search Results

Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
1 record matched C2H4 + O· → CH2O + ·CH2
3 records matched HOCH2OO → CH2O + HO2
1 record matched (CH3)2CHCH2O· → CH2O + iso-C3H7
1 record matched CH3CH2CH2CH2O· → CH2O + 1-C3H7
1 record matched n-C3H7O → CH2O + ·C2H5
1 record matched NO + CH2BrOO → CH2O + Br· + NO2
1 record matched *CH2C(O)H + O2 → CH2O + CO + ·OH
1 record matched ·OH + ·CH2 → CH2O + H·
1 record matched HO2 + iso-C4H9 → CH2O + iso-C3H7 + ·OH
1 record matched C2H3 + O2 → CH2O + HCO
1 record matched HCO + HNO → CH2O + NO
1 record matched HCO + H2O → CH2O + ·OH
1 record matched HCO + H2O2 → CH2O + HO2
2 records matched HCO + HCO → CH2O + CO
1 record matched (·)CH2OH + ·CH2 → CH2O + ·CH3
1 record matched (·)CH2OH + O· → CH2O + ·OH
2 records matched (·)CH2OH + H· → CH2O + H2
7 records matched (·)CH2OH + O2 → CH2O + HO2
1 record matched (·)CH2OH + iso-C4H9 → CH2O + iso-C4H10
1 record matched (·)CH2OH + ·OH → CH2O + H2O
1 record matched (·)CH2OH + HO2 → CH2O + H2O2
1 record matched (·)CH2OH + C2H3 → CH2O + C2H4
1 record matched (·)CH2OH + HCO → CH2O + CH2O
1 record matched (·)CH2OH + (·)CH2OH → CH2O + CH3OH
2 records matched (·)CH2OH → CH2O + H·
6 records matched ·CH3 + O· → CH2O + H·
2 records matched ·CH3 + O2 → CH2O + ·OH
1 record matched ·CH3 + (·)CH2OH → CH2O + CH4
2 records matched CH3CH2O· → CH2O + ·CH3
1 record matched CH3O· + ·CH2 → CH2O + ·CH3
1 record matched CH3O· + O· → CH2O + ·OH
3 records matched CH3O· + H· → CH2O + H2
1 record matched CH3O· + NO2 → CH2O + HNO2
1 record matched CH3O· + NO2 → cis-HONO + CH2O
3 records matched CH3O· + NO → CH2O + HNO
14 records matched CH3O· + O2 → CH2O + HO2
1 record matched CH3O· + iso-C4H9 → CH2O + iso-C4H10
1 record matched CH3O· + ·OH → CH2O + H2O
1 record matched CH3O· + HO2 → CH2O + H2O2
1 record matched CH3O· + CH3CO → CH2O + CH3CHO
1 record matched CH3O· + C2H3 → CH2O + C2H4
1 record matched CH3O· + (·)CH2OH → CH2O + CH3OH
1 record matched CH3O· + ·CH3 → CH2O + CH4
1 record matched CH3O· + CH3O· → CH2O + CH3OH
6 records matched CH3O· → CH2O + H·
1 record matched 1-C3H7 + (·)CH2OH → CH2O + C3H8
1 record matched 1-C3H7 + CH3O· → CH2O + C3H8
1 record matched CH3O2· + CH3C(O)CH2OO· → CH2O + CH3C(O)CH2OH + O2
1 record matched CH3O2· + ·CH2 → CH2O + CH3
3 records matched CH3O2· + CH3C(O)OO(·) → CH2O + CH3C(O)OH + O2
1 record matched CH3O2· + iso-C4H9 → CH2O + iso-C3H7 + CH3
1 record matched CH3O2· + CH3O· → CH2O + CH3OOH
1 record matched CH3O2· + 1-C3H7 → CH2O + ·C2H5 + CH3
1 record matched ·C2H + (·)CH2OH → CH2O + C2H2
1 record matched ·C2H + CH3O· → CH2O + C2H2
1 record matched ·C2H5 + O· → CH2O + ·CH3
1 record matched ·C2H5 + (·)CH2OH → CH2O + C2H6
1 record matched ·C2H5 + CH3O· → CH2O + C2H6
1 record matched iso-C3H7 + (·)CH2OH → CH2O + C3H8
1 record matched iso-C3H7 + CH3O· → CH2O + C3H8
1 record matched ·CH2CH=CH2 + (·)CH2OH → CH2O + CH3CH=CH2
1 record matched ·CH2CH=CH2 + CH3O· → CH2O + CH3CH=CH2
1 record matched tert-C4H9 + (·)CH2OH → CH2O + iso-C4H10
1 record matched tert-C4H9 + CH3O· → CH2O + iso-C4H10
1 record matched H2 + HCO → CH2O + H·
1 record matched CO2 + ·CH2 → CH2O + CO
1 record matched CH3CH=CH2 + HCO → CH2O + ·CH2CH=CH2
1 record matched iso-C4H10 + HCO → CH2O + iso-C4H9
1 record matched iso-C4H10 + HCO → CH2O + tert-C4H9
1 record matched HN=C=O + HCO → CH2O + NCO
1 record matched C3H8 + HCO → CH2O + 1-C3H7
1 record matched C3H8 + HCO → CH2O + iso-C3H7
1 record matched HCN + HCO → CH2O + CN
1 record matched C2H2 + (·)CH2OH → CH2O + C2H3
1 record matched C2H6 + HCO → CH2O + ·C2H5
1 record matched CH4 + HCO → CH2O + ·CH3
1 record matched CH3OH + ·OH → CH2O + H2O + H·
1 record matched CH3OH + HCO → CH2O + (·)CH2OH
1 record matched CH2O + ·CH2 → ·CH3 + HCO
6 records matched CH2O + ·Cl → HCO + HCl
1 record matched CH2O + NCO → HN=C=O + HCO
5 records matched CH2O + O· → HCO + ·OH
3 records matched CH2O + O· → Products
3 records matched CH2O + ClO → Products
1 record matched CH2O + H· → CH3
5 records matched CH2O + H· → H2 + HCO
6 records matched CH2O + NO3 → HCO + HNO3
1 record matched CH2O + NO3 → Products
2 records matched CH2O + NO2 → HCO + HNO2
1 record matched CH2O + NO → HCO + HNO
6 records matched CH2O + Br· → HCO + HBr
2 records matched CH2O + O2 → HCO + HO2
1 record matched CH2O + iso-C4H9 → iso-C4H10 + HCO
11 records matched CH2O + ·OH → HCO + H2O
1 record matched CH2O + ·OH → Products
1 record matched CH2O + ·CH → Products
6 records matched CH2O + HO2 → HOCH2OO
3 records matched CH2O + HO2 → HCO + H2O2
1 record matched CH2O + CH3CO → CH3CHO + HCO
1 record matched CH2O + C2H3 → C2H4 + HCO
1 record matched CH2O + (·)CH2OH → CH3OH + HCO
1 record matched CH2O + ·CH3 → CH3CH2
5 records matched CH2O + ·CH3 → CH4 + HCO
1 record matched CH2O + CH3O· → CH3OH + HCO
1 record matched CH2O + 1-C3H7 → CH3CH2CH2CH2
1 record matched CH2O + 1-C3H7 → C3H8 + HCO
1 record matched CH2O + CH3O2· → HCO + CH3OOH
1 record matched CH2O + ·C2H5 → n-C3H7O
1 record matched CH2O + ·C2H5 → C2H6 + HCO
1 record matched CH2O + iso-C3H7 → (CH3)2CHCH2
1 record matched CH2O + iso-C3H7 → C3H8 + HCO
1 record matched CH2O + ·CH2CH=CH2 → CH3CH=CH2 + HCO
1 record matched CH2O + tert-C4H9 → iso-C4H10 + HCO
1 record matched CH2O + CN → HCN + HCO
3 records matched CH2O → HCO + H·
1 record matched CH2O → Products
2 records matched O(1D) + CH4 → CH2O + H2
1 record matched CHCl2CHClO· → CH2O + ·CCl3
1 record matched CH2OOH → CH2O + ·OH
1 record matched CH2OO + CH2OO → O2(1Delta_g) + CH2O + CH2O
2 records matched (CH3)3CCH2O· → CH2O + iso-C4H9
1 record matched (CH3)3CCH2O· → CH2O + tert-C4H9
1 record matched Benzene, 2-(1-methoxy-2-propenyl)-1,3,5-trimehyl- → CH2O + Benzene, 1,3,5-trimethyl-2-(2-propenyl)-
1 record matched Oxetane, 3-ethyl-3-methyl- → CH2O + C2H5C(CH3)=CH2
1 record matched (CH3)2CHOCH2COOH → CH2O + iso-C3H7OH + CO
1 record matched Oxetane, 2,3-dimethyl-, cis- → CH2O + CH3CH=CHCH3
1 record matched Oxetane, 2,3-dimethyl-, trans- → CH2O + CH3CH=CHCH3
6 records matched HOCH2OO → CH2O + HO2
2 records matched n-C5H11O· → CH2O + 1-C4H9
4 records matched (CH3)2CHCH2O· → CH2O + iso-C3H7
1 record matched CH3OCH(C6H5)CH=CH2 → CH2O + 3-Phenylpropene
1 record matched 4-formylphenoxyacetic acid → CH2O + 4-Hydroxybenzaldehyde + CO
3 records matched CH3OCH2 → CH2O + ·CH3
2 records matched n-C3H7O → CH2O + ·C2H5
1 record matched ClCH2OH → CH2O + HCl
1 record matched Benzeneacetic acid, α-oxo-, methyl ester → CH2O + Benzaldehyde + CO
1 record matched 3-Octyn-1-ol → CH2O + CH2=C=CHCH2CH2CH2CH3
1 record matched I + ICH2OO(·) → CH2O + I + IO
1 record matched I + CH2OO → CH2O + IO
1 record matched CH3COOCH2COOH → CH2O + CH3C(O)OH + CO
1 record matched ClCH2C(CH3)2CH2OH → CH2O + iso-C4H8 + HCl
1 record matched Oxetane, 3,3-diethyl- → CH2O + (C2H5)2C=CH2
3 records matched O2 + ·CH2 → CH2O + O·
1 record matched O2 + CH2=CCl → CH2O + ClCO
1 record matched O2 + CH3OCH2 → CH2O + HCO + H2O
6 records matched O2 + CH3OCH2 → CH2O + CH2O + ·OH
4 records matched O2 + ·CH2I → CH2O + IO
1 record matched Oxetane, 3,3-dimethyl- → CH2O + iso-C4H8
1 record matched ·CH2Cl + O· → CH2O + ·Cl
1 record matched Oxetane, 2,2-dimethyl- → CH2O + iso-C4H8
1 record matched HOCH2CH2C(O)OCH3 → CH2O + CH3C(O)OCH3
1 record matched C6H5C≡CCH2CH2OH → CH2O + Benzene, 1,2-propadienyl-
1 record matched CH3C(NO2)=CH2 → CH2O + CH3CNO
1 record matched HOCH2CH2 → CH2O + ·CH3
1 record matched (CH3)2Si=CH2 + O2 → CH2O + (CH3)2Si=O
1 record matched CH2=C(C6H5)CH2CH2OH → CH2O + 2-Phenylpropene
1 record matched 2H-Pyran, 3,6-dihydro- → CH2O + 1,3-Butadiene
1 record matched C2H5OO· → CH2O + CH3
1 record matched CH3C(O)OCH2· → CH2O + CH3CO
2 records matched C2H3 + NO → CH2O + HCN
7 records matched C2H3 + O2 → CH2O + HCO
1 record matched HCO + H· → CH2O
1 record matched HCO + HBr → CH2O + Br·
1 record matched HCO + HI → CH2O + I
6 records matched HCO + HCO → CH2O + CO
1 record matched (·)CH2OH + ·Cl → CH2O + HCl
2 records matched (·)CH2OH + O· → CH2O + ·OH
1 record matched (·)CH2OH + H· → CH2O + H2
14 records matched (·)CH2OH + O2 → CH2O + HO2
1 record matched (·)CH2OH + HCO → CH2O + CH2O
7 records matched (·)CH2OH → CH2O + H·
1 record matched 1-C4H9 + O· → CH2O + 1-C3H7
1 record matched ·CH3 + NCO → CH2O + HNC
1 record matched ·CH3 + NCO → CH2O + HCN
23 records matched ·CH3 + O· → CH2O + H·
2 records matched ·CH3 + OD → CH2O + HD
22 records matched ·CH3 + O2 → CH2O + ·OH
3 records matched ·CH3 + ·OH → CH2O + H2
2 records matched ·CH3 + (·)CH2OH → CH2O + CH4
4 records matched Oxetane, 2-methyl- → CH2O + CH3CH=CH2
2 records matched Oxetane, 3-methyl- → CH2O + CH3CH=CH2
6 records matched CH3CH2O· → CH2O + ·CH3
2 records matched CH3O· + ·Cl → CH2O + HCl
2 records matched CH3O· + D → CH2O + HD
1 record matched CH3O· + CH3OC(·)(O) → CH2O + HC(O)OCH3
1 record matched CH3O· + ClO → CH2O + HOCl
3 records matched CH3O· + H· → CH2O + H2
1 record matched CH3O· + NO3 → CH2O + HNO3
5 records matched CH3O· + NO2 → CH2O + HNO2
9 records matched CH3O· + NO → CH2O + HNO
25 records matched CH3O· + O2 → CH2O + HO2
1 record matched CH3O· + CH3CO → CH2O + CH3CHO
7 records matched CH3O· + ·CH3 → CH2O + CH4
7 records matched CH3O· + CH3O· → CH2O + CH3OH
13 records matched CH3O· → CH2O + H·
2 records matched CH3O2· + CH3C(O)OO(·) → CH2O + CH3C(O)OH + O2
1 record matched CH3O2· + HO2 → CH2O + H2O + O2
1 record matched CH3O2· + CH3O2· → CH2O + CH3OH + O2
1 record matched ·CH2CH=CH2 + O· → CH2O + C2H3
1 record matched ·CH2CH=CH2 + O· → CH2O + C2H2 + H·
1 record matched ·CH2CH=CH2 + O2 → Other Products + CH2O
1 record matched 4-bromophenoxyacetic acid → CH2O + 4-bromophenol + CO
1 record matched 4-cyanophenoxyacetic acid → CH2O + CO + 4-hydroxybenzonitrile
1 record matched 4-acetylphenoxyacetic acid → CH2O + Ethanone, 1-(4-hydroxyphenyl)- + CO
1 record matched 4-methoxyphenoxyacetic acid → CH2O + 4-Methoxyphenol + CO
1 record matched 4-nitrophenoxyacetic acid → CH2O + 4-Nitrophenol + CO
1 record matched 4-tert-butylphenoxyacetic acid → CH2O + 4-t-Butylphenol + CO
1 record matched 3-Hexyn-1-ol → CH2O + CH2=C=CHCH2CH3
1 record matched 4-methylphenoxyacetic acid → CH2O + 4-Methylphenol + CO
1 record matched (C6H5)CH=CHCH2CH2OH → CH2O + Benzene, 1-propenyl- (unspec.)
1 record matched HC≡CCH2CH2OH → CH2O + CH2=C=CH2
1 record matched CH2=C(CH3)CH2CH2OH → CH2O + iso-C4H8
1 record matched (CH3)2CHCH2CH=CH2 + O3 → (CH3)2CHCH2CH(·)OO· + CH2O
4 records matched CO + CH3O· → CH2O + HCO
3 records matched CH2=CHCH2OCH3 → CH2O + CH3CH=CH2
2 records matched CH2=CHCH2CH2OH → CH2O + CH3CH=CH2
1 record matched C2H5OCH2COOH → CH2O + C2H5OH + CO
1 record matched CH3OCH2COOH → CH2O + CH3OH + CO
5 records matched CH3ONO → CH2O + HNO
2 records matched CH3C(O)CH2CH2OH → CH2O + (CH3)2CO
1 record matched Cyclopropane, methoxy- → CH2O + CH3CH=CH2
1 record matched Methoxymethylbenzene → CH2O + Toluene
2 records matched Oxetane → CH2O + C2H4
2 records matched H2C=C=O + ·OH → CH2O + HCO
1 record matched CH2=C=CH2 + O· → CH2O + C2H2
1 record matched 4-fluorophenoxyacetic acid → CH2O + 4-Fluorophenol + CO
1 record matched OCHCOOH → CH2O + CO2
1 record matched 1,2,4-Trioxolane → CH2O + HCOOH
2 records matched CO2 + ·CH2 → CH2O + CO
1 record matched C6H5OCH2COOH → CH2O + Phenol + CO
6 records matched (CH3)2O → CH2O + CH4
1 record matched CH3CH=CH2 + O· → CH2O + C2H4
1 record matched CH3CH=CH2 + ·OH → CH2O + ·C2H5
6 records matched 1,3,5-Trioxane → CH2O + CH2O + CH2O
1 record matched Tetrahydrofuran → CH2O + CH3CH=CH2
1 record matched HOCH2CH2CN → CH2O + CH3CN
1 record matched CH3CO2CH=CH2 + O3 → Other Products + CH2O
1 record matched HC(O)OCH3 → CH2O + CH2O
1 record matched 2-Pyridineethanol → CH2O + 2-Methylpyridine
1 record matched CH2=CHCOOCH3 + O3 → Other Products + CH2O
2 records matched alpha-pinene + ·OH → Other Products + CH2O
1 record matched HOCH2COOH → CH2O + CO + H2O
1 record matched CH2ClCOOH → CH2O + CO + HCl
1 record matched CH2=CHCOOH + O3 → Other Products + CH2O
1 record matched CH2=CHCOCH3 + O3 → Other Products + CH2O
3 records matched C2H4 + O· → CH2O + ·CH2
2 records matched C2H4 + O3 → CH2O + CH2OO
2 records matched 2-Phenylethanol → CH2O + Toluene
1 record matched CH2O + HOCH2O → CH2(OH)2 + HCO
1 record matched CH2O + CH3C(O)OO(·) → CH3C(O)OOH + HCO
11 records matched CH2O + ·Cl → HCO + HCl
4 records matched CH2O + ·Cl → Products
1 record matched CH2O + NCO → Products
7 records matched CH2O + O· → HCO + ·OH
1 record matched CH2O + O· → CO + ·OH + H·
6 records matched CH2O + O· → Products
2 records matched CH2O + D → HCO + HD
2 records matched CH2O + D → CHDO + H·
1 record matched CH2O + ClO → HCO + HOCl
1 record matched CH2O + ·F → HCO + HF
1 record matched CH2O + I → HCO + HI
19 records matched CH2O + H· → H2 + HCO
3 records matched CH2O + NO3 → HCO + HNO3
6 records matched CH2O + NO3 → Products
4 records matched CH2O + NO2 → HCO + HNO2
2 records matched CH2O + NO2 → Products
4 records matched CH2O + Br· → HCO + HBr
4 records matched CH2O + Br· → Products
1 record matched CH2O + O3 → Products
4 records matched CH2O + O2 → HCO + HO2
1 record matched CH2O + Ar → HCO + Ar + H·
1 record matched CH2O + Ar → CO + H2 + Ar
24 records matched CH2O + ·OH → HCO + H2O
1 record matched CH2O + ·OH → HCOOH + H·
10 records matched CH2O + ·OH → Products
1 record matched CH2O + ·CH → *CH2C(O)H
5 records matched CH2O + HO2 → HOCH2OO
9 records matched CH2O + HO2 → HCO + H2O2
1 record matched CH2O + HO2 → (·)CH2OH + O2
2 records matched CH2O + (CH3)3CO· → tert-C4H9OH + HCO
1 record matched CH2O + Phenyl → Benzene + HCO
1 record matched CH2O + Phenyl → Products
6 records matched CH2O + ·CH3 → CH4 + HCO
1 record matched CH2O + CH3O· → CH3OH + HCO
2 records matched CH2O + CH3O· → Other Products + CH3OH
1 record matched CH2O + 1-C3H7 → CH3CH2CH2CH2
1 record matched CH2O + 1-C3H7 → C3H8 + HCO
1 record matched CH2O + CH3O2· → HCO + CH3OOH
2 records matched CH2O + CH3O2· → Products
1 record matched CH2O + H2 → Products
1 record matched CH2O + CN → HCN + HCO
1 record matched CH2O + CN → Products
1 record matched CH2O + CH2O → Products
14 records matched CH2O → HCO + H·
11 records matched CH2O → CO + H2
2 records matched CH2O → Products
1 record matched O(1D) + CH3F → CH2O + HF
1 record matched O(1D) + CH4 → CH2O + H2
1 record matched O(1D) + CH4 → Other Products + CH2O
1 record matched CH3(CH2)11CHOO + CH2O → Products
1 record matched CFCl2CH2O· → CH2O + ·CCl2F
1 record matched CH2BrO → CH2O + Br·
4 records matched CF3OCH2(.) → CH2O + ·CF3
1 record matched CF2ClCH2O(.) → CH2O + ·CClF2
1 record matched C6H5OCH2COOH → CH2O + Phenol
2 records matched CH3CH2CH2CH2O· → CH2O + 1-C3H7
1 record matched M + CH3CH2O· → CH2O + ·CH3
1 record matched pinonaldehyde + ·OH → Other Products + CH2O
1 record matched O(3P) + CH4 → CH2O + H· + H·
1 record matched 4-ethylphenoxyacetic acid → CH2O + 4-Ethylphenol + CO
1 record matched CH2OCH2OOH → CH2O + CH2O + ·OH
2 records matched CH3CH2CH2O· → CH2O + ·C2H5
1 record matched O2(X3Sigma_g-) + C2H3 → CH2O + HCO
1 record matched CH3SO3 → HOSO + CH2O
2 records matched HOOCH2O → CH2O + HO2
1 record matched CH2(OH)NO → CH2O + HNO
2 records matched (CH3)2C(CH2OOH)CH2· → CH2O + iso-C4H8 + ·OH
1 record matched CH2ClO2 + CH2ClO2 → CH2O + O2 + ·Cl + CH2ClO
1 record matched CH2ClO2 + CH2ClO2 → CH2ClOOOCl + CH2O
1 record matched HOCH2O → CH2O + ·OH
3 records matched CH3CH(OH)CH2O → CH2O + CH3CHOH
1 record matched HOCH2CH2CH2CH2O → CH2O + HOCH2CH2CH2
1 record matched ·CH2C(O)OCH3 → CH2O + CH3CO
1 record matched (CH3)3CCH2O· → CH2O + tert-C4H9
1 record matched Oxiranone → CH2O + CO
1 record matched CH3CH=CHCH2CH2OH → CH2O + 1-C4H8
6 records matched CH2ClCH2O → CH2O + ·CH2Cl
8 records matched HOCH2CH2O → CH2O + (·)CH2OH
2 records matched C6H5CH2O → CH2O + Phenyl
1 record matched n-C5H11O· → CH2O + 1-C4H9
2 records matched (CH3)2CHCH2O· → CH2O + iso-C3H7
3 records matched CH2=CHCH2O → CH2O + C2H3
1 record matched CH3CH2CH2C(·)HOH → CH2O + 1-C3H7
1 record matched HOCH → CH2O
16 records matched CH3CH2CH2CH2O· → CH2O + 1-C3H7
1 record matched C6H5OCH2 → CH2O + Phenyl
1 record matched CH3OCH2 + O· → CH2O + (·)CH2OH
1 record matched CH3OCH2 + O· → CH2O + CH3
4 records matched CH3OCH2 → CH2O + ·CH3
3 records matched n-C3H7O → CH2O + ·C2H5
1 record matched O2 + CH2CHC·CH2 → CH2O + CH2=CHC(·)O
1 record matched O2 + CH2CH2OCH2 → ·OCH2CH2O· + CH2O
1 record matched O2 + ·CH2 → CH2O + O·
1 record matched O2 + CH2OCH2 → ·OCH2O· + CH2O
1 record matched O2 + ·CH2CH2CH2· → ·CH2CH2O· + CH2O
1 record matched O2 + CH3SCH2 → CH2O + CH3SO
1 record matched O2 + CH3SCH2 → CH2O + CH2S + ·OH
1 record matched O2 + ·CH2I → CH2O + IO
1 record matched 1-Naphthylmethyl + O· → CH2O + 1-Naphthalenyl
1 record matched ·CH2Cl + NO2 → ClNO + CH2O
2 records matched 1,2-Dioxetane → CH2O + CH2O
1 record matched Oxetane, 2,2-dimethyl- → CH2O + iso-C4H8
2 records matched i-C3H7O → CH2O + ·C2H5
1 record matched ·CH2F + NO2 → CH2O + NO + ·F
1 record matched ·CH2F + NO2 → CH2O + FNO
2 records matched Neopentyl + O2 → CH2O + iso-C4H8 + ·OH
1 record matched ·OH + CH2OO → CH2O + HO2
1 record matched ·OH + ·CH2Cl → CH2O + HCl
1 record matched ·CH + H2O → CH2O + H·
1 record matched CH2=C(C6H5)CH2CH2OH → CH2O + 2-Phenylpropene
1 record matched HO2 + CH2ClO2 → CH2O + O2 + HOCl
1 record matched HO2 + CH2ClO2 → HO3 + CH2O + ·Cl
1 record matched HO2 + CH2ClO2 → HOOOCl + CH2O
1 record matched NH2CH2OH → CH2O + NH3
1 record matched C6H5CH2OOH → CH2O + Benzyne + H2O
1 record matched CH3C(O)OCH2· → CH2O + CH3CO
3 records matched C2H3 + O2 → CH2O + HCO
1 record matched C2H3 + O2 → CH2O + CO + H·
1 record matched HCO + HNO → CH2O + NO
3 records matched HCO + NHOH → CH2O + HNO
1 record matched HCO + H· → CH2O
3 records matched HCO + HNO2 → CH2O + NO2
1 record matched (·)CH2OH + NO2 → CH2O + HNO2
1 record matched (·)CH2OH + NO2 → cis-HONO + CH2O
1 record matched (·)CH2OH + NO2 → trans-HONO + CH2O
4 records matched (·)CH2OH + O2 → CH2O + HO2
1 record matched (·)CH2OH + HO2 → CH2O + H2O2
1 record matched (·)CH2OH + HO2 → H2OO + CH2O
4 records matched (·)CH2OH → CH2O + H·
2 records matched CH3CHOH + H· → CH2O + CH4
5 records matched CH3CHOH → CH2O + ·CH3
3 records matched ·CH3 + O· → CH2O + H·
1 record matched ·CH3 + NO2 → CH2O + HNO
5 records matched ·CH3 + O2 → CH2O + ·OH
2 records matched ·CH3 + ·OH → CH2O + H2
2 records matched Oxetane, 2-methyl- → CH2O + CH3CH=CH2
1 record matched CH3CH2O· + H· → CH2O + CH4
20 records matched CH3CH2O· → CH2O + ·CH3
1 record matched CH3O· + BrO → CH2O + HOBr
1 record matched CH3O· + ClO → CH2O + HOCl
1 record matched CH3O· + ·F → CH2O + HF
1 record matched CH3O· + H· → CH2O + H2
2 records matched CH3O· + NO2 → CH2O + HNO2
3 records matched CH3O· + NO → CH2O + HNO
6 records matched CH3O· + O2 → CH2O + HO2
1 record matched CH3O· + ·OH → CH2O + H2O
1 record matched CH3O· + HO2 → CH2O + H2O2
1 record matched CH3O· + HO2 → H2OO + CH2O
1 record matched CH3O· + CH3O· → CH2O + CH3OH
9 records matched CH3O· → CH2O + H·
1 record matched CH3O2· + CH3C(O)CH2OO· → CH2O + CH3C(O)CH2OH + O2
1 record matched CH3O2· + CH2OO → CH2O + HCOOH + ·OH
1 record matched CH3O2· + CH2OO → CH2O + CH2O + HO2
1 record matched CH3O2· + BrO → HOOBr + CH2O
1 record matched CH3O2· + ClO → HOOCl + CH2O
1 record matched CH3O2· + Br· → CH2O + HOBr
1 record matched CH3O2· → CH2O + ·OH
1 record matched CH2=NH + NO → CH2O + HN=N
2 records matched ·C2H5 + O· → CH2O + ·CH3
1 record matched ·CH2CH=CH2 + O2 → CH2O + CH2=CHO·
1 record matched ·CH2CH=CH2 + O2 → CH2O + C2H2 + ·OH
1 record matched (C6H5)CH=CHCH2CH2OH → CH2O + 3-Phenylpropene
1 record matched (CH3)2CCHCH2CH2OH → CH2O + (CH3)2CHCH=CH2
1 record matched CH2=C(CH3)CH2CH2OH → CH2O + iso-C4H8
1 record matched CO + CH3CO → CH2O + HCO
1 record matched n-C4H9OCH3 → CH2O + C2H6 + C2H4
1 record matched CH2=CHCH2CH2OH → CH2O + CH3CH=CH2
4 records matched CH3ONO → CH2O + HNO
1 record matched Methyl butanoate → CH2O + CH3CH2CH2CHO
1 record matched CH3NHNO2 → CH2O + NH2NO
2 records matched Oxetane → CH2O + C2H4
1 record matched CH2(OH)2 → CH2O + H2O
1 record matched H2C=C=O + NCO → CNCO + CH2O
1 record matched CH2=C=CH2 + O· → CH2O + C2H2
1 record matched 1,2,4,5-tetroxane → CH2O + CH2O + O2
1 record matched 1,3-dioxetane → CH2O + CH2O
1 record matched beta-pinene + O3 → Bicyclo[3.1.1]heptane, 6,6-dimethyl-2-peroxy- + CH2O
1 record matched beta-pinene + O3 → Bicyclo[3.1.1]heptane, 6,6-dimethyl-(2,2-peroxy-) + CH2O
1 record matched beta-pinene + O3 → 1-methyl-1-(3-cyclohexenyl,4-peroxy) ethyl + CH2O
1 record matched beta-pinene + O3 → 4-oxabicyclo[4.1.1]octan-3-one, 7,7-dimethyl + CH2O
1 record matched beta-pinene + O3 → Bicyclo[3.1.1]heptan-2-one, 6,6-dimethyl, 3-yl + CH2O + ·OH
1 record matched beta-pinene + O3 → Bicyclo[3.1.1]heptan-2-one, 6,6-dimethyl, 1-yl + CH2O + ·OH
1 record matched CO2 + ·CH2 → CH2O + CO
1 record matched CO2 + :GeH2 → CH2O + GeO
1 record matched iso-C4H8 + O3 → CH2O + (CH3)2C(·)OO·
1 record matched (CH3)2O → CH2O + CH4
1 record matched CH3CH=CH2 + O· → CH2O + CH3CH
1 record matched CH3CH=CH2 + O· → CH2O + C2H4
1 record matched CH3CH=CH2 + O3 → CH2O + CH3CH(·)OO·
3 records matched 1,3,5-Trioxane → CH2O + CH2O + CH2O
1 record matched HCOOC2H5 → CH2O + CH3CHO
1 record matched (CHO)2 → CH2O + CO
1 record matched HC≡CCH2OH → CH2O + C2H2
1 record matched Methyl methacrylate + O2 → CH2O + CH3C(O)C(O)OCH3
1 record matched CH2=C(CH3)COOH + O2 → CH2O + CH3COCOOH
1 record matched HOCH2COOH → CH2O + CO + H2O
2 records matched CH3NO2 → CH2O + HNO
1 record matched HN=C=O + C2H3 → CH2O + CH2CN
1 record matched HCN + HCO → CH2O + CN
2 records matched C2H4 + O· → CH2O + ·CH2
1 record matched C2H4 + HCO → CH2O + C2H3
1 record matched C2H6 + HCO → CH2O + ·C2H5
1 record matched CH4 + HCO → CH2O + ·CH3
1 record matched CH3OH → H2(v) + CH2O
1 record matched 2-Phenylethanol → CH2O + 5-Methylene 1,3-cyclohexadiene
2 records matched CH3CH(OH)CH2OH → CH2O + C2H4 + H2O
1 record matched CH2O + HN=N → (·)CH2OH + N2
1 record matched CH2O + CH3CH2CH2CO → ·CH2OC(O)CH2CH2CH3
1 record matched CH2O + ·Cl → CH2ClO
1 record matched CH2O + ·Cl → HCO + HCl
2 records matched CH2O + NCO → HN=C=O + HCO
1 record matched CH2O + HOCH → Products
1 record matched CH2O + O· → HCO + ·OH
1 record matched CH2O + BrO → Products
1 record matched CH2O + ClO → HCO + HOCl
1 record matched CH2O + ClO → Products
1 record matched CH2O + ClO → HC(O)OCl + H·
1 record matched CH2O + ClO → CH2(O)OCl
1 record matched CH2O + NH2 → HCO + NH3
6 records matched CH2O + H· → (·)CH2OH
8 records matched CH2O + H· → CH3
7 records matched CH2O + H· → H2 + HCO
1 record matched CH2O + NO2 → HCO + HNO2
1 record matched CH2O + NO2 → Products
1 record matched CH2O + NO2 → cis-HONO
1 record matched CH2O + O3 → HCOOH + O2
1 record matched CH2O + O3 → Adduct
1 record matched CH2O + O3 → HO3 + HCO
1 record matched CH2O + O2 → HCO + HO2
1 record matched CH2O + H2O → ·CH3 + HO2
1 record matched CH2O + Y → H· + YCHO
1 record matched CH2O + Y → H2 + Y(CO)
1 record matched CH2O + Y → CO + YH2
1 record matched CH2O + ·OH → HOCH2O
1 record matched CH2O + ·OH → H· + CH2OO
11 records matched CH2O + ·OH → HCO + H2O
1 record matched CH2O + ·OH → H2 + COOH
1 record matched CH2O + ·OH → CO + H2O + H·
1 record matched CH2O + ·OH → Products
1 record matched CH2O + ·CH → Oxiranyl
1 record matched CH2O + ·CH → CH2=CHO·
1 record matched CH2O + ·CH → HCO + ·CH2
1 record matched CH2O + ·CH → CO + ·CH3
1 record matched CH2O + ·CH → H2C=C=O + H·
1 record matched CH2O + ·CH → Products
2 records matched CH2O + ·CH → CH2-O-CH
4 records matched CH2O + HO2 → HCO + H2O2
1 record matched CH2O + HO2 → Products
1 record matched CH2O + C2H3 → CH2=CHCH2O
1 record matched CH2O + C2H3 → H· + cyc-(H2COC)=CH2
1 record matched CH2O + C2H3 → Cyclopropanone + H·
1 record matched CH2O + C2H3 → CO + ·C2H5
1 record matched CH2O + C2H3 → H2C=C=O + ·CH3
1 record matched CH2O + C2H3 → CH2=CHCHO + H·
1 record matched CH2O + C2H3 → C2H2 + (·)CH2OH
3 records matched CH2O + C2H3 → C2H4 + HCO
1 record matched CH2O + C2H3 → c-CHCHCH2O + H·
1 record matched CH2O + 1-C4H9 → n-C5H11
1 record matched CH2O + Phenyl → C6H5CH2O
1 record matched CH2O + Phenyl → C6H5OCH2
1 record matched CH2O + ·CH3 → CH3OCH2
3 records matched CH2O + ·CH3 → CH3CH2
7 records matched CH2O + ·CH3 → CH4 + HCO
1 record matched CH2O + CH3O· → CH3OH + HCO
1 record matched CH2O + 1-C3H7 → CH3CH2CH2CH2
1 record matched CH2O + ·C2H → HC≡CCHO + H·
1 record matched CH2O + ·C2H → C2H2 + CO + H·
2 records matched CH2O + ·C2H5 → n-C3H7O
1 record matched CH2O + ·C2H5 → C2H5OCH2(·)
1 record matched CH2O + iso-C3H7 → (CH3)2CHCH2
1 record matched CH2O + tert-C4H9 → (CH3)3CCH2
1 record matched CH2O + CCl2 (X 1A1) → CHCl2CHO
1 record matched CH2O + H2 → CH3OH
1 record matched CH2O + (CH3)2CHC(CH3)=CH2 → (CH3)2C=C(CH3)CH2CH2OH
1 record matched CH2O + (CH3)2CHCH=CH2 → (CH3)2CCHCH2CH2OH
1 record matched CH2O + iso-C4H8 → CH3CH=CHCH2CH2OH
1 record matched CH2O + CH3CH=CH2 → CH2=CHCH2CH2OH
1 record matched CH2O + 1,3-Butadiene → Thiacyclohex-3-ene
1 record matched CH2O + 1,3-Butadiene → 2H-Pyran, 3,6-dihydro-
1 record matched CH2O + 1-C4H8 → CH3CH=CHCH2CH2OH
1 record matched CH2O + CH3OH → Products
1 record matched CH2O + CN → HCN + HCO
1 record matched CH2O + CH2O → (CH2O)2
5 records matched CH2O → HCO + H·
1 record matched CH2O → H2 + O2
3 records matched CH2O → CO + H2
1 record matched CH2O → Products
1 record matched methylene (ground state) + CH2O → ·CH3 + HCO
1 record matched CH3C(O)CH2O· → CH2O + CH3CO
1 record matched CH3SCH2OO· → CH2O + CH3SO
1 record matched ·CH2OSi(OCH3)3 → CH2O + Si(OCH3)3
3 records matched CH2BrO → CH2O + Br·
1 record matched cis-HONO → CH2O + NO2
1 record matched BrCH2CH2O(.) → CH2O + ·CH2Br
1 record matched HC(O)OCH2O → ·OC(O)H + CH2O
4 records matched CH3CH2CH2CH2O· → Propyl Radical + CH2O
1 record matched HOCH2=CH(O2)C(CH3)=CH2 → CH2O + Methacrolein + ·OH
1 record matched OCH2OCH2CH2CH2CH3 → CH3CH2CH2CH2O· + CH2O
1 record matched nitrate + CH2O → Products
2 records matched O(1D) + CH4 → CH2O + H·
1 record matched O(1D) + CH4 → CH2O + H2
1 record matched CH2=CHC(CH3)(Cl)CH2O· → CH2CHCCl(·)CH3 + CH2O
1 record matched CH2=C(CH3)CH(Cl)CH2O· → CH2C(CH3)CHCl(·) + CH2O
1 record matched ·OCH2CH=C(CH3)CH2Cl → ·CH=C(CH3)CH2Cl + CH2O
1 record matched ·OCH2C(CH3)=CHCH2Cl → CH2ClCH=C(·)CH3 + CH2O
1 record matched CH2CHCCl(·)CH3 + CH2O → CH2=CHC(CH3)(Cl)CH2
1 record matched CH2C(CH3)CHCl(·) + CH2O → CH2=C(CH3)CH(Cl)CH2
1 record matched n-C3H7O2 → CH2O + C2H2 + ·OH
1 record matched CH2(X3B_1) + ·OH → CH2O + H·
1 record matched CH2=CHC(CH3)(OO·)CH2OH → CH2O + CH2=CHCOCH3 + ·OH
1 record matched 1-methyl-1-ethenyl-2,3,4-trioxacyclopentane → methyl vinyl dioxirane + CH2O
1 record matched dichlorovinylidene + CH2O → cyc-(H2COC)=CCl2
1 record matched dichlorovinylidene + CH2O → cyc-[-CH2-CCl=CCl-O-]
1 record matched CH3CH2CH(·)CH2OH → CH2O + 1-C3H7
1 record matched CH3CH(·)CH2CH2OH → CH2O + 1-C3H7
6 records matched CH3CH2CH(OH)CH2O → CH2O + C2H5CHOH
2 records matched CH3CH2CH2CH(OH)CH2O → CH2O + CH3CH2CH2C(·)HOH
2 records matched CH3CH2CH2CH2CH(OH)CH2O → CH3CH2CH2CH2CH(.)OH + CH2O
1 record matched OHCH2C(CH3)=CHCH2O· → OHCH2C(CH3)=CH· + CH2O
1 record matched OHCH2CH=C(CH3)CH2O· → OHCH2CH=C(·)CH3 + CH2O
1 record matched OHCH2C(CH3)=CH· + CH2O → OHCH2C(CH3)=CHCH2
1 record matched OHCH2CH=C(·)CH3 + CH2O → OHCH2CH=C(CH3)CH2
1 record matched CH(O)CH2CH(cy-CH2)C(CH3)2CHC(O)CH2O· → CH(O)CH2CH(cy-CH2)C(CH3)2CHC(O)· + CH2O
1 record matched CH3OSO → CH2O + SOH
1 record matched CH3OSO → CH2O + HSO
1 record matched CH2(OH)S(·)=O + CH2O → CH2(·)S(=O)CH2OOH
1 record matched CH3(cy-CCH2O)CH2O· → CH3(cy-C(·)CH2O) + CH2O
1 record matched (CH2O·)(CH2OOH)cy-COCH2 → cy-(C(·)CH2O)CH2OOH + CH2O
1 record matched ·OCH2C(O)OH → CH2O + COOH
1 record matched HOOCH2C(O)O· → CH2O + CO2 + ·OH
1 record matched (CH3)2C(OH)CH(OH)CH2O· → (CH3)2C(OH)CH(·)OH + CH2O
1 record matched ·CH2CH2CH2CH2CH2· + O2 → ·CH2CH2CH2CH2O· + CH2O
1 record matched CBr2 + CH2O → CHBr2C(O)H
1 record matched (CH3)2C=C(CH3)CH2CH2OH → CH2O + (CH3)2CHC(CH3)=CH2
1 record matched CH3OPO → CH2O + HOP
1 record matched CH3OPO → HPO + CH2O
1 record matched 1,1-methyleneperoxy, 3-methyl, 2,4-cyclohexadienyl radical → CH2O + Phenoxy, 2-methyl-
1 record matched HC(O)OCH(CH3)CH2O· → CH3CH(·)OC(O)H + CH2O
1 record matched C2H5OCH2(·) → CH2O + ·C2H5
1 record matched d-limonene 2-exo-molozonide → cyc-CH2CH=C(CH3)CH2CH2CH(C(CH3)OO) + CH2O
1 record matched ·CH2CH(CH3)CH2OOH → CH2O + CH3CH=CH2 + ·OH
1 record matched CH2=CH-O-CH2· → CH2O + C2H3
1 record matched ·CH2CH2CH(CH3)OOH → CH2O + CH3CH=CH2 + ·OH
1 record matched CH3CH(·)CH(CH3)CH2OOH → CH2O + (E)-2-C4H8 + ·OH
1 record matched ·CH2OCH(CH3)2CH2CH3 → CH2O + (CH3)2C(·)CH2CH3
1 record matched ·CH2SCH2OOH → CH2O + CH2S + ·OH
1 record matched ·CH2OCH2CH2CH2· + O2 → ·OCH2CH2CH2O· + CH2O
1 record matched ·CH2CH2OCH2CH2· + O2 → ·CH2OCH2CH2O· + CH2O
1 record matched ·CH2C(CH3)2CH2OOH → CH2O + iso-C4H8 + ·OH
1 record matched CH3Se(O)CH2· → CH3Se + CH2O
1 record matched 2-hydroxy-1,2-dioxolane → CH2O + CH3C(O)OH
1 record matched ·OCH2CH=NH → HC=NH + CH2O
1 record matched ·OCH2CH2NHCH=CH2 → ·CH2NHCH=CH2 + CH2O
1 record matched ·CH2OCH2CH2N=CH2 → ·CH2CH2N=CH2 + CH2O
1 record matched CH2ClCH=C(·)CH3 + CH2O → ·OCH2C(CH3)=CHCH2Cl
1 record matched ·CH=C(CH3)CH2Cl + CH2O → ·OCH2CH=C(CH3)CH2Cl
1 record matched (·)CH2CH2CH2CH2OH → CH2O + 1-C3H7
1 record matched CH3CH2CH(CH3)CH2O· → CH2O + sec-C4H9
1 record matched 1-hexoxy radical → CH2O + 1-C5H11
1 record matched (·)CH2CH2CH2OOH → CH2O + C2H4 + ·OH
1 record matched CH3CH(·)CH2CH2OOH → CH2O + CH3CH=CH2 + ·OH
1 record matched (CH3)2C(·)CH2CH2OOH → CH2O + iso-C4H8 + ·OH
9 records matched CH2=C(CH3)CH(OH)CH2O· → CH2=C(CH3)CH(·)OH + CH2O
1 record matched CH2=CHC(·)(OH)CH3 + CH2O → CH2=CHC(CH3)(OH)CH2
1 record matched CH2=C(CH3)CH(·)OH + CH2O → CH2=C(CH3)CH(OH)CH2
9 records matched CH2=CHC(CH3)(OH)CH2O· → CH2=CHC(·)(OH)CH3 + CH2O
1 record matched CH3CH(CH3)CH2CH2O(·) → CH2O + iso-C4H9
1 record matched CH2CH2CH2CH2 + O2 → CH2O + CH2CH2CH2O
1 record matched ·CH2OC(O)CH2CH2CH3 → CH2O + CH3CH2CH2CO
1 record matched ·CH2CH=CO + CH2O → ·CH2OC(O)CH=CH2
1 record matched ·CH2OC(O)CH=CH2 → ·CH2CH=CO + CH2O
1 record matched CH3CH2CH(·)CH2CH2OOH → CH2O + 1-C4H8 + ·OH
1 record matched (CH3)3COCH2· → CH2O + tert-C4H9
1 record matched iso-CH2(·)S(=O)CH2OOH → CH2SO + CH2O + ·OH
1 record matched CH2(·)S(=O)CH2OOH → CH2(OH)S(·)=O + CH2O
1 record matched 3-Vinyloxetane → CH2O + 1,3-Butadiene
1 record matched CH_2(aA_1) + N2O → CH2O + N2
1 record matched C2H3 + NO → CH2O + HCN
1 record matched CH2O + Y → CO + YH2

Search returned 1266 records.