Kinetics Database Logo

Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences

Feedback

Rate Our Products and Services

Help


Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty

More...


Administrative Links

NIST home page

MML home page

Chemical and Biochemical Reference Data Division

MML home page

Chemical and Biochemical Reference Data Division

  NIST Logo Home
©NIST, 2013
Accessibility information

Search Results


Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
3 records matched (CH3)2CO + ·OH → CH3C(O)CH2(·) + H2O
1 record matched (CH3)2CO + ·OH → CH3C(O)OH + ·CH3
1 record matched C2H5C(CH3)2O(·) → (CH3)2CO + ·C2H5
2 records matched (CH3)2CHO2 + (CH3)2CHO2 → iso-C3H7OH + (CH3)2CO + O2
2 records matched i-C3H7O + NO → (CH3)2CO + HNO
6 records matched i-C3H7O + O2 → (CH3)2CO + HO2
2 records matched i-C3H7O → (CH3)2CO + H·
2 records matched (CH3)3CO → (CH3)2CO + ·CH3
1 record matched ·CH3 + CH3CO → (CH3)2CO
1 record matched iso-C3H7 + O· → (CH3)2CO + H·
1 record matched tert-C4H9 + HO2 → (CH3)2CO + ·CH3 + ·OH
1 record matched tert-C4H9 + CH3O2· → (CH3)2CO + CH3O· + ·CH3
3 records matched (CH3)2CO + Cl → CH3C(O)CH2(·) + HCl
1 record matched (CH3)2CO + O· → CH3C(O)CH2(·) + ·OH
1 record matched (CH3)2CO + H· → i-C3H7O
2 records matched (CH3)2CO + NO3 → CH3C(O)CH2(·) + HNO3
4 records matched (CH3)2CO + ·OH → CH3C(O)CH2(·) + H2O
2 records matched (CH3)2CO + ·OH → Products
1 record matched (CH3)2CO + ·CH3 → (CH3)3CO
2 records matched (CH3)2CO + ·CH3 → CH4 + CH3C(O)CH2(·)
1 record matched N2(A3Sigma_u+) + (CH3)2CO → Products
1 record matched (CH3)2C(CH2OOH)CH2· → Other Products + (CH3)2CO
1 record matched HC≡CC(CH3)2C(CH3)2OH → (CH3)2CO + CH2=C=C(CH3)2
1 record matched 1,2,4-Trioxolane, 3,3-dimethyl- → HCOOH + (CH3)2CO
2 records matched (CH3)2C(OH)CH2C(O)OC2H5 → (CH3)2CO + CH3COOC2H5
3 records matched C2H5C(CH3)2O(·) → (CH3)2CO + ·C2H5
2 records matched O2 + (CH3)2C(CH2OOH)CH2· → Other Products + (CH3)2CO
1 record matched Oxetane, 2,2-dimethyl- → (CH3)2CO + C2H4
2 records matched (CH3)2C(OH)CH2C(O)OCH3 → (CH3)2CO + CH3C(O)OCH3
2 records matched (CH3)2CHOCH2CH=CH2 → (CH3)2CO + CH3CH=CH2
1 record matched C2H5CHOH + NO → (CH3)2CO + HNO
1 record matched (CH3)2C(OH) + O2 → (CH3)2CO + HO2
2 records matched oxirane, tetramethyl- → (CH3)2CO + CH3CH=CH2
1 record matched (CH3)2CHO2 + (CH3)2CHC(OO)(CH3)2 → (CH3)2CO + (CH3)2CHC(OH)(CH3)2 + O2
2 records matched (CH3)2CHO2 + (CH3)2CHO2 → iso-C3H7OH + (CH3)2CO + O2
2 records matched (CH3)2CHOC(CH3)-CH2 → (CH3)2CO + CH3CH=CH2
2 records matched CH3CH(OH)CH2C(O)CH3 → (CH3)2CO + CH3CHO
4 records matched i-C3H7O + NO → (CH3)2CO + HNO
1 record matched i-C3H7O + O2 → (CH3)2CO + HO2
2 records matched i-C3H7O → (CH3)2CO + H·
1 record matched ·OH + Bicyclo[3.1.1]heptan-2-one, 6,6-dimethyl- → Products + (CH3)2CO
21 records matched (CH3)3CO → (CH3)2CO + ·CH3
2 records matched CH3C(O)CH2(·) + HBr → (CH3)2CO + Br·
6 records matched ·CH3 + CH3CO → (CH3)2CO
1 record matched iso-C3H7 + O· → (CH3)2CO + H·
1 record matched (CH3)3COCH2CH=CH2 → (CH3)2CO + 1-C4H8
1 record matched 1,2,4,5-Tetroxane, 3,3,6,6-tetramethyl- → (CH3)2CO + (CH3)2CO + O2
1 record matched CH2=C(CH3)OC2H5 → (CH3)2CO + C2H4
2 records matched CH2=CHCH2C(CH3)2OH → (CH3)2CO + CH3CH=CH2
1 record matched (CH3)2C(NO2)2 → (CH3)2CO + NO + NO2
1 record matched (CH3)2COHCOOH → (CH3)2CO + CO + H2O
1 record matched n-C4H9COCH3 → (CH3)2CO + CH3CH=CH2
2 records matched CH3C(O)CH2CH2OH → CH2O + (CH3)2CO
1 record matched HC≡CCH2C(CH3)2OH → (CH3)2CO + CH2=C=CH2
1 record matched (CH3)2CHC(O)OCH3 + ·OH → Other Products + (CH3)2CO
2 records matched i-C3H7ONO → (CH3)2CO + HNO
1 record matched (CH3)2C=CHCH3 + O3 → Other Products + (CH3)2CO
3 records matched (CH3CO)2 + ·CH3 → (CH3)2CO + CH3CO
1 record matched beta-pinene + ·OH → pinonaldehyde + Products + (CH3)2CO
1 record matched CH3COCH2COCH3 → (CH3)2CO + H2C=C=O
4 records matched (CH3)2C(OH)CH2C(O)CH3 → (CH3)2CO + (CH3)2CO
2 records matched CH3C(O)C(OH)(CH3)2 → (CH3)2CO + CH3CHO
1 record matched (CH3)2CHCH2CH2COCH3 → (CH3)2CO + iso-C4H8
1 record matched 2-methyl-1-phenyl-2-propanol → (CH3)2CO + Toluene
2 records matched alpha-pinene + ·OH → Other Products + (CH3)2CO
1 record matched alpha-pinene + ·OH → pinonaldehyde + Products + (CH3)2CO
2 records matched Methyloxirane → (CH3)2CO
1 record matched CH3CHO + CH3CO → (CH3)2CO + HCO
2 records matched CH3CHO + ·CH3 → (CH3)2CO + H·
1 record matched (CH3)2CO + ·CH2 → Products
1 record matched (CH3)2CO + Cl → CH3C(O)CH2(·) + HCl
16 records matched (CH3)2CO + Cl → Products
7 records matched (CH3)2CO + O· → CH3C(O)CH2(·) + ·OH
1 record matched (CH3)2CO + ·F → CH3C(O)CH2(·) + HF
1 record matched (CH3)2CO + I → CH3C(O)CH2(·) + HI
1 record matched (CH3)2CO + SiH2 → Products
1 record matched (CH3)2CO + OD → Products
5 records matched (CH3)2CO + H· → H2 + CH3C(O)CH2(·)
1 record matched (CH3)2CO + NO3 → Products
1 record matched (CH3)2CO + NO2 → CH3C(O)CH2(·) + HNO2
1 record matched (CH3)2CO + Br· → CH3C(O)CH2(·) + HBr
1 record matched (CH3)2CO + SiHCl3 → (CH3)2CHO-SiCl3
1 record matched (CH3)2CO + NF2 → CH3C(O)CH2(·) + HNF2
11 records matched (CH3)2CO + ·OH → CH3C(O)CH2(·) + H2O
3 records matched (CH3)2CO + ·OH → CH3C(O)OH + ·CH3
10 records matched (CH3)2CO + ·OH → Products
1 record matched (CH3)2CO + HO2
1 record matched (CH3)2CO + (CH3)3CO → tert-C4H9OH + CH3C(O)CH2(·)
1 record matched (CH3)2CO + Phenyl → Benzene + CH3C(O)CH2(·)
1 record matched (CH3)2CO + ·CF3 → CHF3 + CH3C(O)CH2(·)
2 records matched (CH3)2CO + ·CH3 → (CH3)3CO
26 records matched (CH3)2CO + ·CH3 → CH4 + CH3C(O)CH2(·)
1 record matched (CH3)2CO + (C2H5)3B → Other Products + ·C2H5
1 record matched (CH3)2CO + (CH3)2CO → C2H6 + (CH3CO)2
6 records matched (CH3)2CO → ·CH3 + CH3CO
2 records matched iso-C3H7OH + NO3 → Other Products + (CH3)2CO
1 record matched iso-C3H7OH → (CH3)2CO + H2
1 record matched O2(1DELTA) + (CH3)2CO → Products
1 record matched OH(v=1) + (CH3)2CO → Products + ·OH
1 record matched pinonaldehyde + ·OH → Other Products + (CH3)2CO
1 record matched pinonaldehyde + ·OH → Products + (CH3)2CO
3 records matched CH3CH2C(CH3)2O(·) → (CH3)2CO + ·C2H5
1 record matched (18)OH + (CH3)2CO → Products
1 record matched (CH3)2C(OOCCH3)COOH → CH3C(O)OH + (CH3)2CO + CO
1 record matched CH3C(CH3)(OH)CH2CN → (CH3)2CO + CH3CN
1 record matched HOC(CH3)2CH2NO2 → (CH3)2CO + CH3NO2
1 record matched (CH3)2C(O·)CH2CH2CH3 → (CH3)2CO + n-C3H7
1 record matched (CH3)2CNO2 → (CH3)2CO + NO
1 record matched (CH3)2C(OH)C(O)OCH3 → CH3OH + (CH3)2CO + CO
2 records matched (CH3)2CHC(O)(CH3)2 → (CH3)2CO + iso-C3H7
1 record matched Oxiranone, dimethyl- → (CH3)2CO + CO
2 records matched C2H5C(CH3)2O(·) → (CH3)2CO + ·C2H5
1 record matched (CH3)2CHO2 → (CH3)2CO + ·OH
2 records matched i-C3H7O + NO → (CH3)2CO + HNO
1 record matched i-C3H7O → (CH3)2CO + H·
8 records matched (CH3)3CO → (CH3)2CO + ·CH3
1 record matched iso-C3H7 + O· → (CH3)2CO + H·
1 record matched tert-C4H9 + O· → (CH3)2CO + ·CH3
1 record matched CH2=CHCH2C(CH3)2OH → (CH3)2CO + CH3CH=CH2
1 record matched n-C4H9COCH3 → (CH3)2CO + CH3CH=CH2
1 record matched i-C3H7ONO → (CH3)2CO + HNO
1 record matched iso-C4H8 + O3 → (CH3)2CO + CH2OO
1 record matched CH3CH=CH2 + CH3C(O)CH2(·) → (CH3)2CO + ·CH2CH=CH2
1 record matched (iso-C3H7)2O → (CH3)2CO + C3H8
1 record matched Methyloxirane → (CH3)2CO
3 records matched (CH3)2CO + Cl → CH3C(O)CH2(·) + HCl
2 records matched (CH3)2CO + Cl → Products
1 record matched (CH3)2CO + O· → CH3C(O)CH2(·) + ·OH
1 record matched (CH3)2CO + O· → ·CH3 + CH3C(O)O
1 record matched (CH3)2CO + ·F → Products
1 record matched (CH3)2CO + H· → (CH3)2C(OH)
3 records matched (CH3)2CO + H· → i-C3H7O
1 record matched (CH3)2CO + H· → H2 + CH3C(O)CH2(·)
3 records matched (CH3)2CO + ·OH → CH3C(O)CH2(·) + H2O
1 record matched (CH3)2CO + ·OH → CH3C(O)OH + ·CH3
1 record matched (CH3)2CO + ·OH → Products
1 record matched (CH3)2CO + HO2 → CH3C(O)CH2(·) + H2O2
2 records matched (CH3)2CO + HO2 → (CH3)2C(OH)OO
1 record matched (CH3)2CO + C2H3 → C2H4 + CH3C(O)CH2(·)
1 record matched (CH3)2CO + Phenyl → Benzene + CH3C(O)CH2(·)
1 record matched (CH3)2CO + Phenyl → C6H5OC*(CH3)2
1 record matched (CH3)2CO + Phenyl → C6H5C(O*)(CH3)2
3 records matched (CH3)2CO + ·CH3 → (CH3)3CO
2 records matched (CH3)2CO + ·CH3 → CH4 + CH3C(O)CH2(·)
1 record matched (CH3)2CO + ·CH3 → Products
1 record matched (CH3)2CO + ·CH3 → (CH3)2C(·)OCH3
1 record matched (CH3)2CO + CH3CH2O· → CH3CH2C(CH3)2O(·)
1 record matched (CH3)2CO + CH3O2· → CH3OOH + CH3C(O)CH2(·)
1 record matched (CH3)2CO + ·CH2CH=CH2 → CH3CH=CH2 + CH3C(O)CH2(·)
1 record matched (CH3)2CO + iso-C4H8 → CH2=C(CH3)CH2C(CH3)2OH
1 record matched (CH3)2CO + CH3CH=CH2 → CH2=CHCH2C(CH3)2OH
1 record matched (CH3)2CO + 1-C4H8 → CH3CH=CHCH2C(CH3)2OH
4 records matched iso-C3H7OH → (CH3)2CO + H2
1 record matched (CH3)2C(O)OCH2CH2OH → (CH3)2CO + HOCH2CH2O
3 records matched (CH3)2C(OH)OO → (CH3)2CO + HO2
1 record matched CH3CH2C(CH3)2O(·) → (CH3)2CO + ·C2H5
1 record matched CH3CH3COOCH3 → (CH3)2CO + (·)CH2OH
1 record matched HOC(CH3)2CH2NO2 → (CH3)2CO + CH3NO2
1 record matched CH3C(O)CH=CHCH(CH3)C(CH3)2O· → CH3C(O)CH=CHCH(·)CH3 + (CH3)2CO
1 record matched (CH3)3CC(CH3)2O· → (CH3)2CO + tert-C4H9
1 record matched (CH3)3CCH2C(CH3)2O· → (CH3)2CO + (CH3)3CCH2
1 record matched (CH3)2C(O·)CH(OH)CH2OH → HOCH2CH(·)OH + (CH3)2CO
1 record matched CH2=C(CH3)CH2C(CH3)2OH → (CH3)2CO + iso-C4H8
1 record matched CH3CH=CHCH2C(CH3)2OH → (CH3)2CO + 1-C4H8
1 record matched CH3C(O)C(O·)C(CH3)CH3 → (CH3)2CO + CH3CO
1 record matched (CH3)2CO + Y → CO + Y(CH3)2

Search returned 343 records.