Kinetics Database Logo

Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences


Rate Our Products and Services


Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty


Administrative Links

NIST home page

MML home page

Chemical and Biochemical Reference Data Division

MML home page

Chemical and Biochemical Reference Data Division

  NIST Logo Home
©NIST, 2013
Accessibility information

Search Results

Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
9 records matched ·CH3 + ·CH3 → C2H6
2 records matched ·C2H5 + H2O → C2H6 + ·OH
1 record matched ·C2H5 + H2O2 → C2H6 + HO2
1 record matched ·C2H5 + iso-C4H9 → C2H6 + iso-C4H8
1 record matched ·C2H5 + ·OH → C2H6 + O·
1 record matched ·C2H5 + HO2 → C2H6 + O2
1 record matched ·C2H5 + HCO → C2H6 + CO
1 record matched ·C2H5 + (·)CH2OH → CH2O + C2H6
1 record matched ·C2H5 + CH3O· → CH2O + C2H6
1 record matched ·C2H5 + n-C3H7 → C2H6 + CH3CH=CH2
3 records matched ·C2H5 + ·C2H5 → C2H6 + C2H4
1 record matched ·CH2CH=CH2 + ·C2H5 → C2H6 + CH2=C=CH2
1 record matched tert-C4H9 + ·C2H5 → C2H6 + iso-C4H8
2 records matched H2 + ·C2H5 → C2H6 + H·
1 record matched CH3CH=CH2 + ·C2H5 → C2H6 + ·CH2CH=CH2
1 record matched iso-C4H10 + ·C2H5 → C2H6 + iso-C4H9
1 record matched iso-C4H10 + ·C2H5 → C2H6 + tert-C4H9
1 record matched C3H8 + ·C2H5 → C2H6 + n-C3H7
1 record matched C3H8 + ·C2H5 → C2H6 + iso-C3H7
1 record matched C2H2 + ·C2H5 → C2H6 + ·C2H
1 record matched C2H4 + ·C2H5 → C2H6 + C2H3
1 record matched C2H6 + ·CH2 → Products
12 records matched C2H6 + Cl → ·C2H5 + HCl
4 records matched C2H6 + CF3O → CF3OH + ·C2H5
11 records matched C2H6 + O· → ·C2H5 + ·OH
7 records matched C2H6 + H· → H2 + ·C2H5
2 records matched C2H6 + NO3 → ·C2H5 + HNO3
1 record matched C2H6 + Br· → ·C2H5 + HBr
2 records matched C2H6 + O2 → ·C2H5 + HO2
1 record matched C2H6 + iso-C4H9 → iso-C4H10 + ·C2H5
15 records matched C2H6 + ·OH → ·C2H5 + H2O
2 records matched C2H6 + ·OH → Other Products + H2O
1 record matched C2H6 + ·CH → Products
4 records matched C2H6 + HO2 → ·C2H5 + H2O2
1 record matched C2H6 + CH3CO → CH3CHO + ·C2H5
1 record matched C2H6 + C2H3 → C2H4 + ·C2H5
1 record matched C2H6 + HCO → CH2O + ·C2H5
1 record matched C2H6 + (·)CH2OH → CH3OH + ·C2H5
2 records matched C2H6 + ·CF3 → CHF3 + ·C2H5
4 records matched C2H6 + ·CH3 → CH4 + ·C2H5
1 record matched C2H6 + CH2=C → ·C2H5 + C2H3
1 record matched C2H6 + CH3O· → CH3OH + ·C2H5
1 record matched C2H6 + n-C3H7 → C3H8 + ·C2H5
1 record matched C2H6 + CH3O2· → ·C2H5 + CH3OOH
1 record matched C2H6 + ·C2H → C2H2 + ·C2H5
1 record matched C2H6 + ·C2H → Products
1 record matched C2H6 + iso-C3H7 → C3H8 + ·C2H5
1 record matched C2H6 + ·CH2CH=CH2 → CH3CH=CH2 + ·C2H5
1 record matched C2H6 + tert-C4H9 → iso-C4H10 + ·C2H5
13 records matched C2H6 → ·CH3 + ·CH3
1 record matched CH4 + ·C2H5 → C2H6 + ·CH3
1 record matched CH3OH + ·C2H5 → C2H6 + (·)CH2OH
1 record matched CH3OH + ·C2H5 → C2H6 + CH3
1 record matched CH2O + ·C2H5 → C2H6 + HCO
1 record matched N(2D) + C2H6 → Products
1 record matched N(2P) + C2H6 → Products
1 record matched N2(A3Sigma_u+) + C2H6 → Products
1 record matched Propane, 1,1-diethoxy- → C2H6 + C2H5COOC2H5
1 record matched (E)-CH3N=NCH3 → C2H6 + N2
1 record matched Piperidine, 1-(2,2-diethoxyethyl)- → C2H6 + Ethyl 1-piperidineaceate
1 record matched Diethylaminoacetaldehyde diethyl acetal → C2H5OCH=CHN(C2H5)2 + C2H6
1 record matched ·CH3 + CH3CO → C2H6 + CO
74 records matched ·CH3 + ·CH3 → C2H6
1 record matched ·C2H5 + CH3CH2N=NCH(·)CH3 → Other Products + C2H6
1 record matched ·C2H5 + (Z)-CH3CH=CHCH2CH2 → C2H6 + (Z)-CH2=CHCH=CHCH3
1 record matched ·C2H5 + Cyclopentenyl → C2H6 + Cyclopentadiene
1 record matched ·C2H5 + (CH3)2CHC(·)(CH3)2 → C2H6 + (CH3)2C=C(CH3)2
1 record matched ·C2H5 + 2,5-Cyclohexadien-1-yl → Benzene + C2H6
1 record matched ·C2H5 + n-C3H7C(CH3)2 → C2H6 + C2H5CH2C(CH3)=CH2
1 record matched ·C2H5 + (CH3)3CC(·)H(CH3) → Other Products + C2H6
1 record matched ·C2H5 + (C2H5)2(CH3)C → C2H6 + (C2H5)2C=CH2
1 record matched ·C2H5 + (C2H5)2(CH3)C → Other Products + C2H6
1 record matched ·C2H5 + 2,4-Cyclohexadien-1-yl → Benzene + C2H6
1 record matched ·C2H5 + (E)-4-C8H16 → Other Products + C2H6
2 records matched ·C2H5 + H· → C2H6
1 record matched ·C2H5 + Cyclohexadienyl → Benzene + C2H6
8 records matched ·C2H5 + HBr → C2H6 + Br·
3 records matched ·C2H5 + HI → C2H6 + I
1 record matched ·C2H5 + SiHCl3 → C2H6 + SiCl3
1 record matched ·C2H5 + SiH4 → C2H6 + SiH3
2 records matched ·C2H5 + iso-C4H9 → C2H6 + iso-C4H8
1 record matched ·C2H5 + Cyclopentyl → C2H6 + Cyclopentene
2 records matched ·C2H5 + ·CH2F → C2H6 + ·CHF
1 record matched ·C2H5 + (CH3)3CCH2 → Other Products + C2H6
1 record matched ·C2H5 + (C2H5)2NOH → C2H6 + (C2H5)2NO
1 record matched ·C2H5 + 1-C5H11 → C2H6 + 1-C5H10
2 records matched ·C2H5 + ·CHF2 → C2H6 + ·CF2
1 record matched ·C2H5 + C2H3 → C2H6 + C2H2
1 record matched ·C2H5 + 2-hexyl radical → Other Products + C2H6
1 record matched ·C2H5 + n-C4H9 → C2H6 + 1-C4H8
1 record matched ·C2H5 + CH3CH2CH2CHCH3 → Other Products + C2H6
1 record matched ·C2H5 + sec-C4H9 → Other Products + C2H6
2 records matched ·C2H5 + CH3CH2O· → C2H6 + CH3CHO
3 records matched ·C2H5 + n-C3H7 → C2H6 + CH3CH=CH2
32 records matched ·C2H5 + ·C2H5 → C2H6 + C2H4
5 records matched iso-C3H7 + ·C2H5 → C2H6 + CH3CH=CH2
2 records matched ·CH2CH=CH2 + ·C2H5 → C2H6 + CH2=C=CH2
4 records matched tert-C4H9 + ·C2H5 → C2H6 + iso-C4H8
1 record matched Si2H6 + ·C2H5 → C2H6 + Si2H5
9 records matched H2 + ·C2H5 → C2H6 + H·
1 record matched (C2H5)2NN + ·C2H5 → C2H6 + CH3CH2N=NCH(·)CH3
1 record matched (C2H5)2NN + ·C2H5 → Other Products + C2H6
1 record matched Ethanamine, 2,2-diethoxy- → C2H5OOCCH2NH2 + C2H6
1 record matched n-C5H11C≡CH + ·C2H5 → Other Products + C2H6
1 record matched CH3C(O)C(O)C2H5 + ·C2H5 → Other Products + C2H6
1 record matched (CH3)2Hg + ·CH3 → C2H6 + ·CH3 + Hg
1 record matched 1-C7H14 + ·C2H5 → Other Products + C2H6
1 record matched (CH3CO)2 + ·C2H5 → Other Products + C2H6
1 record matched (C2H5)2S + ·C2H5 → C2H6 + C2H5SCHCH3
1 record matched N2H4 + ·C2H5 → C2H6 + NH2NH
2 records matched Cyclopentane + ·C2H5 → C2H6 + Cyclopentyl
1 record matched n-C7H16 + ·C2H5 → Other Products + C2H6
1 record matched (CH3)2NH + ·C2H5 → C2H6 + (CH3)2N
1 record matched (CH3)2NH + ·C2H5 → Other Products + C2H6
1 record matched C2H5CHO + ·C2H5 → C2H6 + ·CH2CH2CHO
1 record matched C2H5CHO + ·C2H5 → C2H6 + CH3C(·)HCHO
7 records matched C2H5CHO + ·C2H5 → C2H6 + CH3CH2CO
1 record matched 1-C8H16 + ·C2H5 → Other Products + C2H6
1 record matched Cyclohexene + ·C2H5 → C2H6 + 3-Cyclohexenyl
2 records matched n-C6H14 + ·C2H5 → Other Products + C2H6
1 record matched HCOOC2H5 + ·C2H5 → C2H6 + CH3CH2OCO
1 record matched n-C5H12 + ·C2H5 → Other Products + C2H6
6 records matched Toluene + ·C2H5 → C2H6 + Benzyl
1 record matched CH2=CHCH2OH + ·C2H5 → C2H6 + CH(OH)CH=CH2
3 records matched (C2H5)2CO + ·C2H5 → Other Products + C2H6
1 record matched C2H5COOH → C2H6 + CO2
1 record matched (CH3)4Si + ·C2H5 → C2H6 + (CH3)3SiCH2
1 record matched (CH3)3N + ·C2H5 → C2H6 + CH2N(CH3)2
1 record matched iso-C4H10 + ·C2H5 → Other Products + C2H6
1 record matched CH3CHO + ·C2H5 → C2H6 + CH3CO
1 record matched C3H8 + ·C2H5 → Other Products + C2H6
1 record matched CH3NH2 + ·C2H5 → C2H6 + CH3NH
1 record matched CH3NH2 + ·C2H5 → Other Products + C2H6
6 records matched C2H4 + ·C2H5 → C2H6 + C2H3
4 records matched C2H4 + H2 → C2H6
1 record matched C2H4 + Cyclopentene → C2H6 + Cyclopentadiene
1 record matched C2H6 + FC(O)O· → ·C2H5 + FC(O)OH
1 record matched C2H6 + FC(O)O· → Products
1 record matched C2H6 + Rhodium carbonyl (5-2,4-cyclopentadien-1-yl)- → Adduct
1 record matched C2H6 + CCCN → HCCCN + ·C2H5
1 record matched C2H6 + ·CH2 → ·C2H5 + ·CH3
5 records matched C2H6 + ·CH2 → C3H8
1 record matched C2H6 + ·CH2 → Products
1 record matched C2H6 + CH≡CC≡C → Products
40 records matched C2H6 + Cl → ·C2H5 + HCl
1 record matched C2H6 + Cl → Products
3 records matched C2H6 + NCO → Products
6 records matched C2H6 + CF3O → CF3OH + ·C2H5
1 record matched C2H6 + CF3O → Products
1 record matched C2H6 + N → (CH3)2N
1 record matched C2H6 + O· → CH3CH2O· + H·
12 records matched C2H6 + O· → ·C2H5 + ·OH
2 records matched C2H6 + O· → Products
1 record matched C2H6 + D → ·C2H5 + HD
1 record matched C2H6 + BrO → Products
1 record matched C2H6 + O2F → Products
18 records matched C2H6 + ·F → ·C2H5 + HF
1 record matched C2H6 + I → ·C2H5 + HI
1 record matched C2H6 + SiH2 → Products
1 record matched C2H6 + NH → ·C2H5 + NH2
1 record matched C2H6 + NH → Products
4 records matched C2H6 + NH2 → ·C2H5 + NH3
1 record matched C2H6 + BH → Products
1 record matched C2H6 + OD → ·C2H5 + HDO
24 records matched C2H6 + H· → H2 + ·C2H5
1 record matched C2H6 + H· → CH4 + ·CH3
1 record matched C2H6 + C3 → Products
1 record matched C2H6 + NO3 → ·C2H5 + HNO3
1 record matched C2H6 + NO3 → Products
10 records matched C2H6 + Br· → ·C2H5 + HBr
1 record matched C2H6 + O3 → Products
2 records matched C2H6 + O2 → ·C2H5 + HO2
1 record matched C2H6 + P → Products
1 record matched C2H6 + S → ·C2H5 + SH
1 record matched C2H6 + Rh → Products
2 records matched C2H6 + Pt → Products
2 records matched C2H6 + Pd → Products
1 record matched C2H6 + CC≡N → Products
1 record matched C2H6 + NF2 → Products
1 record matched C2H6 + C2F5 → C2F5H + ·C2H5
51 records matched C2H6 + ·OH → ·C2H5 + H2O
2 records matched C2H6 + ·OH → Products
1 record matched C2H6 + ·CH → CH3CH=CH2 + H·
1 record matched C2H6 + ·CH → C2H4 + ·CH3
1 record matched C2H6 + ·CH → Products + H·
5 records matched C2H6 + ·CH → Products
7 records matched C2H6 + HO2 → ·C2H5 + H2O2
4 records matched C2H6 + ·CCl3 → CHCl3 + ·C2H5
1 record matched C2H6 + ·CHF2 → CH2F2 + ·C2H5
1 record matched C2H6 + C2H3 → C2H4 + ·C2H5
1 record matched C2H6 + n-C4H9 → n-C4H10 + ·C2H5
1 record matched C2H6 + Phenyl → Benzene + ·C2H5
3 records matched C2H6 + ·CF3 → CHF3 + ·C2H5
9 records matched C2H6 + ·CH3 → CH4 + ·C2H5
4 records matched C2H6 + CH3O· → CH3OH + ·C2H5
6 records matched C2H6 + ·C2H → C2H2 + ·C2H5
1 record matched C2H6 + ·C2H → Products
4 records matched C2H6 + CD3 → CHD3 + ·C2H5
2 records matched C2H6 + iso-C3H7 → C3H8 + ·C2H5
1 record matched C2H6 + CH2=C=CH2 → ·CH2CH=CH2 + ·C2H5
2 records matched C2H6 + C2H4 → 1-C4H8 + H2
48 records matched C2H6 → ·CH3 + ·CH3
2 records matched C2H6 → ·C2H5 + H·
5 records matched C2H6 → C2H4 + H2
9 records matched C2H6 → Products
1 record matched CH4 + ·CH2 → C2H6
1 record matched CH4 + ·CH3 → C2H6 + H·
1 record matched CH4 + ·C2H5 → C2H6 + ·CH3
2 records matched Benzene + ·C2H5 → C2H6 + Phenyl
1 record matched (CH3)2CO + (CH3)2CO → C2H6 + (CH3CO)2
3 records matched (C2H5)2O + ·C2H5 → C2H6 + 2-C4H9O
1 record matched (C2H5)2O + ·C2H5 → Other Products + C2H6
14 records matched CN + C2H6 → HCN + ·C2H5
1 record matched Cl(2P1/2) + C2H6 → ·C2H5 + HCl
1 record matched Cl(2P1/2) + C2H6 → Cl(2P3/2) + C2H6
1 record matched Cl(2P3/2) + C2H6 → Products
2 records matched O(1D) + C2H6 → ·C2H5 + ·OH
1 record matched O(1D) + C2H6 → CH2=CHOH + H2
1 record matched O(1D) + C2H6 → C2H6 + O·
2 records matched O(1D) + C2H6 → C2H5OH
3 records matched O(1D) + C2H6 → Products
1 record matched N(2S) + C2H6 → Products
1 record matched O(3P) + C2H6 → CH3CH2O· + H·
1 record matched O(3P) + C2H6 → CH3O· + ·CH3
1 record matched O(3P) + C2H6 → ·C2H5 + ·OH
1 record matched O(3P) + C2H6 → CH3CHO + H· + H·
1 record matched O(3P) + C2H6 → C2H4 + H2O
1 record matched O(1D) + C2H6 → Products
1 record matched S(1D) + C2H6 → C2H5SH
2 records matched C2(X1ΣPlg) + C2H6 → Products
1 record matched NCO(X2PI) + C2H6 → HN=C=O + ·C2H5
1 record matched HCF (X1Aprime) + C2H6 → Products
4 records matched C2(a3PIu) + C2H6 → Products
1 record matched Diethylaminoacetaldehyde diethyl acetal → C2H6 + (C2H5)2NCH2COOC2H5
37 records matched ·CH3 + ·CH3 → C2H6
1 record matched ·C2H5 + HNO → C2H6 + NO
18 records matched ·C2H5 + NH2 → C2H6 + NH
3 records matched ·C2H5 + H· → C2H6
3 records matched ·C2H5 + HBr → C2H6 + Br·
1 record matched ·C2H5 + HI → C2H6 + I
2 records matched ·C2H5 + HCl → C2H6 + Cl
1 record matched ·C2H5 + C2H3 → C2H6 + C2H2
1 record matched ·C2H5 + ·CH3 → C2H6 + ·CH2
2 records matched ·C2H5 + ·C2H5 → C2H6 + C2H4
2 records matched iso-C3H7 + ·C2H5 → C2H6 + CH3CH=CH2
1 record matched (CH3)3Ga + ·CH3 → C2H6 + ·CH3 + CH3Ga
6 records matched H2 + ·C2H5 → C2H6 + H·
1 record matched AlH(CH3)2 → C2H6 + AlH
1 record matched Ethanamine, 2,2-diethoxy- → C2H6 + H2NCH2COOC2H5
1 record matched n-C4H9OCH3 → CH2O + C2H6 + C2H4
1 record matched CH2=C(CH3)CH2CH2C(CH3)=CH2 + ·C2H5 → Other Products + C2H6
1 record matched (C2H5)2Hg + ·C2H5 → Other Products + C2H6
2 records matched (CH3)4Sn + ·CH3 → C2H6 + (CH3)3Sn
1 record matched 1,3-Cyclohexadiene + ·C2H5 → C2H6 + Cyclohexadienyl
1 record matched n-C4H9COCH3 → C2H6 + CH2=CHCOCH3
1 record matched n-C7H16 + ·C2H5 → C2H6 + 3-C7H15
1 record matched n-C7H16 + ·C2H5 → C2H6 + 2-C7H15
1 record matched n-C7H16 + ·C2H5 → C2H6 + 1-C7H15
1 record matched (CH3)2NH + ·C2H5 → C2H6 + CH2NHCH3
1 record matched CH3CH=CH2 + ·C2H5 → C2H6 + ·CH2CH=CH2
1 record matched 1-C8H16 + ·C2H5 → Other Products + C2H6
1 record matched C2H5I + HI → C2H6 + I2
1 record matched CH3NH2 + ·C2H5 → C2H6 + CH2NH2
1 record matched C2H4 + ·C2H5 → C2H6 + C2H3
2 records matched C2H4 + H2 → C2H6
1 record matched C2H6 + (CH3)2Ge: → (CH3)4Ge
1 record matched C2H6 + ·CH2 → ·C2H5 + ·CH3
1 record matched C2H6 + (CH3)2C → iso-C5H12
1 record matched C2H6 + CH3Sn(·)CH3 → (CH3)4Sn
6 records matched C2H6 + Cl → ·C2H5 + HCl
1 record matched C2H6 + O· → CH3CH2O· + H·
1 record matched C2H6 + O· → CH3O· + ·CH3
4 records matched C2H6 + O· → ·C2H5 + ·OH
9 records matched C2H6 + D → ·C2H5 + HD
1 record matched C2H6 + I → ·C2H5 + HI
1 record matched C2H6 + AlH → AlH(CH3)2
17 records matched C2H6 + NH → ·C2H5 + NH2
2 records matched C2H6 + NH2 → ·C2H5 + NH3
10 records matched C2H6 + H· → H2 + ·C2H5
1 record matched C2H6 + NO3 → ·C2H5 + HNO3
1 record matched C2H6 + NO3 → Products
1 record matched C2H6 + NO2 → ·C2H5 + HNO2
1 record matched C2H6 + NO2 → cis-HONO + ·C2H5
1 record matched C2H6 + NO2 → trans-HONO + ·C2H5
1 record matched C2H6 + NO → ·C2H5 + HNO
1 record matched C2H6 + O2 → ·C2H5 + HO2
1 record matched C2H6 + S → Products
1 record matched C2H6 + (CH3)2Si → (CH3)4Si
8 records matched C2H6 + ·OH → ·C2H5 + H2O
2 records matched C2H6 + ·OH → Products
1 record matched C2H6 + ·CH → n-C3H7
5 records matched C2H6 + HO2 → ·C2H5 + H2O2
2 records matched C2H6 + C2H5OO· → ·C2H5 + CH3CH2OOH
4 records matched C2H6 + C2H3 → C2H4 + ·C2H5
1 record matched C2H6 + HCO → CH2O + ·C2H5
1 record matched C2H6 + ·CH3 → C2H6 + ·CH3
7 records matched C2H6 + ·CH3 → CH4 + ·C2H5
2 records matched C2H6 + CH3O2· → ·C2H5 + CH3OOH
1 record matched C2H6 + ·C2H → Products
1 record matched C2H6 + ·C2H5 → C2H6 + ·C2H5
1 record matched C2H6 + ·CH2CH=CH2 → CH3CH=CH2 + ·C2H5
2 records matched C2H6 + C2H2 → ·C2H5 + C2H3
9 records matched C2H6 → ·CH3 + ·CH3
1 record matched C2H6 → ·C2H5 + H·
2 records matched C2H6 → C2H4 + H2
2 records matched C2H6 → Products
2 records matched CH4 + ·CH3 → C2H6 + H·
1 record matched CH4 + ·C2H5 → C2H6 + ·CH3
2 records matched CN + C2H6 → HCN + ·C2H5
1 record matched O(3P) + C2H6 → ·CH3 + (·)CH2OH
1 record matched O(3P) + C2H6 → ·C2H5 + ·OH
1 record matched O(3P) + C2H6 → ·C2H5 + ·OH
1 record matched O(3P) + C2H6 → Products
1 record matched O(1D) + C2H6 → Products + H·
1 record matched O(1D) + C2H6 → Products + H2O
1 record matched O(1D) + C2H6 → Products + ·OH
1 record matched O(1D) + C2H6 → Products + ·CH3
1 record matched O(1D) + C2H6 → Products + H2
1 record matched (CH3)2Pb + C2H6 → (CH3)4Pb
1 record matched GaMe2NH2 + ·CH3 → GaNH2 + C2H6 + ·CH3
1 record matched [·OH..OH2] complex + C2H6 → Products

Search returned 991 records.