Kinetics Database Logo

Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences


Rate Our Products and Services


Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty


Administrative Links

NIST home page

MML home page

Chemical and Biochemical Reference Data Division

MML home page

Chemical and Biochemical Reference Data Division

  NIST Logo Home
©NIST, 2013
Accessibility information

Search Results

Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
1 record matched C2H4 + O· → CH2=CHO· + H·
1 record matched C2H4 + O· → ·CH3 + HCO
1 record matched C2H4 + O· → CH2O + ·CH2
1 record matched C2H4 + O· → Products
1 record matched C2H4 + Zr → Products
1 record matched C2H4 + Nb → Products
1 record matched C2H4 + CH2C≡CH → Adduct
1 record matched C2H4 + ·CH2CH=CH2 → CH2=CHCH2CH2CH2·
1 record matched O(3P) + C2H4 → Products
1 record matched C(3Pj) + C2H4 → H2 + c-C3H2
1 record matched iso-C4H9 + ·CH2 → C2H4 + iso-C3H7
1 record matched Cyclobutanecarbonitrile → C2H4 + CH2CHCN
1 record matched C2H3 + H2O → C2H4 + ·OH
1 record matched C2H3 + H2O2 → C2H4 + HO2
1 record matched C2H3 + iso-C4H9 → C2H4 + iso-C4H8
2 records matched C2H3 + C2H3 → C2H4 + C2H2
1 record matched HCO + C2H3 → C2H4 + CO
1 record matched (·)CH2OH + ·CH2 → C2H4 + ·OH
1 record matched (·)CH2OH + C2H3 → CH2O + C2H4
2 records matched n-C4H9 → C2H4 + ·C2H5
3 records matched ·CH3 + ·CH2 → C2H4 + H·
1 record matched ·CH3 + ·CH3 → C2H4 + H2
1 record matched CH3O· + C2H3 → CH2O + C2H4
1 record matched n-C3H7 + ·CH2 → C2H4 + ·C2H5
1 record matched n-C3H7 + C2H3 → C2H4 + CH3CH=CH2
7 records matched n-C3H7 → C2H4 + ·CH3
1 record matched ·C2H5 + ·CH2 → C2H4 + ·CH3
1 record matched ·C2H5 + H· → C2H4 + H2
10 records matched ·C2H5 + O2 → C2H4 + HO2
1 record matched ·C2H5 + iso-C4H9 → C2H4 + iso-C4H10
1 record matched ·C2H5 + ·OH → C2H4 + H2O
1 record matched ·C2H5 + HO2 → C2H4 + H2O2
1 record matched ·C2H5 + (·)CH2OH → CH3OH + C2H4
2 records matched ·C2H5 + ·CH3 → CH4 + C2H4
1 record matched ·C2H5 + n-C3H7 → C2H4 + C3H8
1 record matched ·C2H5 + ·C2H → C2H4 + C2H2
3 records matched ·C2H5 + ·C2H5 → C2H6 + C2H4
7 records matched ·C2H5 → C2H4 + H·
1 record matched ·CH2CH=CH2 + C2H3 → C2H4 + CH2=C=CH2
1 record matched ·CH2CH=CH2 + ·C2H5 → C2H4 + CH3CH=CH2
1 record matched tert-C4H9 + C2H3 → C2H4 + iso-C4H8
1 record matched tert-C4H9 + ·C2H5 → C2H4 + iso-C4H10
1 record matched H2 + C2H3 → C2H4 + H·
1 record matched Thiirane + O· → C2H4 + SO
1 record matched Cyclobutane → C2H4 + C2H4
1 record matched CH3CH=CH2 + C2H3 → C2H4 + ·CH2CH=CH2
1 record matched Cyclohexene → C2H4 + 1,3-Butadiene
1 record matched iso-C4H10 + C2H3 → C2H4 + iso-C4H9
1 record matched iso-C4H10 + C2H3 → C2H4 + tert-C4H9
1 record matched C3H8 + C2H3 → C2H4 + n-C3H7
1 record matched C3H8 + C2H3 → C2H4 + iso-C3H7
1 record matched C2H2 + n-C3H7 → Other Products + C2H4
1 record matched C2H2 + H2 → C2H4
2 records matched C2H4 + ·CH2 → Products
1 record matched C2H4 + CBrF2 → Adduct
1 record matched C2H4 + Te → Adduct
9 records matched C2H4 + Cl → CH2CH2Cl
1 record matched C2H4 + N → Products
2 records matched C2H4 + O· → ·CH3 + HCO
5 records matched C2H4 + O· → Products
1 record matched C2H4 + D → CH2DCH2
1 record matched C2H4 + ·F → C2H3 + HF
1 record matched C2H4 + ·F → CH2=CHF + H·
9 records matched C2H4 + H· → ·C2H5
3 records matched C2H4 + H· → H2 + C2H3
5 records matched C2H4 + NO3 → Products
1 record matched C2H4 + SF5 → Adduct
1 record matched C2H4 + Br· → CH2BrCH2
6 records matched C2H4 + O3 → Products
1 record matched C2H4 + Se → Selenirane
1 record matched C2H4 + O2 → C2H3 + HO2
1 record matched C2H4 + S → Thiirane
1 record matched C2H4 + CH3S· → CH3SCH2CH2
1 record matched C2H4 + iso-C4H9 → CH3CH=CH2 + iso-C3H7
1 record matched C2H4 + ·CCl → Cyclopropyl, 1-chloro-
1 record matched C2H4 + ·CH2F → CH2FCH2CH2
1 record matched C2H4 + NF2 → F2NCH2CH2
12 records matched C2H4 + ·OH → HOCH2CH2
3 records matched C2H4 + ·OH → C2H3 + H2O
3 records matched C2H4 + ·OH → Products
1 record matched C2H4 + ·CH → Products
1 record matched C2H4 + HO2 → Oxirane + ·OH
1 record matched C2H4 + HO2 → CH3CHO + ·OH
1 record matched C2H4 + HO2 → Adduct
1 record matched C2H4 + HO2 → Products
2 records matched C2H4 + ·CCl3 → CCl3CH2CH2
1 record matched C2H4 + n-C3F7 → Adduct
1 record matched C2H4 + CF3CH2CH2 → CF3(CH2)3CH2
1 record matched C2H4 + C2H3 → 1,3-Butadiene + H·
1 record matched C2H4 + C2H3 → Products
1 record matched C2H4 + (·)CH2OH → HOCH2CH2CH2
1 record matched C2H4 + n-C4H9 → 1-hexyl radical
1 record matched C2H4 + (CH3)2CHCH2CH2 → (iso-C3H7)(CH2)3CH2
1 record matched C2H4 + ·CF3 → CF3CH2CH2
5 records matched C2H4 + ·CH3 → n-C3H7
3 records matched C2H4 + ·CH3 → CH4 + C2H3
1 record matched C2H4 + CH2=C → C2H3 + C2H3
1 record matched C2H4 + CH3O· → Products
1 record matched C2H4 + n-C3H7 → 1-C5H11
1 record matched C2H4 + ·C2H → CH2CHCCH + H·
1 record matched C2H4 + ·C2H → Products
2 records matched C2H4 + ·C2H5 → n-C4H9
1 record matched C2H4 + ·C2H5 → C2H6 + C2H3
1 record matched C2H4 + iso-C3H7 → (CH3)2CHCH2CH2
1 record matched C2H4 + iso-C3H7 → CH3CH=CH2 + ·C2H5
1 record matched C2H4 + ·CH2CH=CH2 → Cyclopentene + H·
1 record matched C2H4 + tert-C4H9 → (CH3)3CCH2CH2
1 record matched C2H4 + tert-C4H9 → Products
1 record matched C2H4 + H2 → ·C2H5 + H·
1 record matched C2H4 + CO → HCO + C2H3
1 record matched C2H4 + CH3CH=CH2 → n-C3H7 + C2H3
1 record matched C2H4 + CH3CH=CH2 → iso-C3H7 + C2H3
1 record matched C2H4 + CH3CH=CH2 → ·CH2CH=CH2 + ·C2H5
1 record matched C2H4 + CH3CH=CH2 → 1-C5H10
1 record matched C2H4 + C2H2 → C2H3 + C2H3
1 record matched C2H4 + C2H4 → ·C2H5 + C2H3
2 records matched C2H4 → C2H3 + H·
3 records matched C2H4 → C2H2 + H2
1 record matched C2H6 + C2H3 → C2H4 + ·C2H5
1 record matched CH4 + C2H3 → C2H4 + ·CH3
1 record matched CH3OH + C2H3 → C2H4 + (·)CH2OH
1 record matched CH3OH + C2H3 → C2H4 + CH3
7 records matched C2H5OH → C2H4 + H2O
1 record matched CH2O + C2H3 → C2H4 + HCO
1 record matched M + C2H4 + Cl → M + CH2CH2Cl
2 records matched N(2D) + C2H4 → Products
2 records matched N(2P) + C2H4 → Products
1 record matched N2(A3Sigma_u+) + C2H4 → Products
1 record matched Bicyclo[2.2.2]oct-5-ene-2-carbonitrile, 3-methyl-,(1α,2α,3α,4α)-(endo,endo) → Other Products + C2H4
1 record matched Bicyclo[2.2.2]oct-5-ene-2-carbonitrile, 3-methyl-,(1α,2β,3β,4α)-(exo,exo) → Other Products + C2H4
1 record matched Bicyclo[2.2.2]oct-5-ene-2-carbonitrile, 3-methyl-,(1α,2α,3β,4α)-(endo,exo) → Other Products + C2H4
1 record matched Bicyclo[2.2.2]oct-5-ene-2-carbonitrile, 3-methyl-,(1α,2β,3α,4α)-(exo,endo) → Other Products + C2H4
1 record matched Carbonothioic acid O-ethyl S-(4-nitrophenyl) ester → Other Products + C2H4
1 record matched Carbonothioic acid S-(3-chlorophenyl) O-ethyl ester → Other Products + C2H4
1 record matched Carbonothioic acid S-(4-chlorophenyl) O-ethyl ester → Other Products + C2H4
1 record matched Carbonothioic acid O-ethyl S-(2-meyhoxyphenyl) ester → Other Products + C2H4
3 records matched (Z)-Cr(CO)4(C2H4)2 → C2H4 + Cr(CO)4(C2H4)
1 record matched bicyclo[2.2.2]oct-2-ene,5-(1-methylethyl)-,(1α,4α,5α)- → C2H4 + 1,3-Cyclohexadiene, 5-(1-methylethyl)-
1 record matched bicyclo[2.2.2]oct-2-ene, 5-ethyl-,(1α,4α,5α)- → C2H4 + 1,3-Cyclohexadiene. 5-ethyl-
1 record matched bicyclo[2.2.2]oct-2-ene, 5-ethyl-,(1α,4α,5β)- → C2H4 + 1,3-Cyclohexadiene. 5-ethyl-
1 record matched Bicyclo[2.2.2]oct-2-ene, 5-(1-methylethyl)-,(1α,4α,5β)- → C2H4 + 1,3-Cyclohexadiene, 5-(1-methylethyl)-
1 record matched (Z)-Fe(CO)2(C2H4)3 → Other Products + C2H4
1 record matched (E)-Fe(CO)2(C2H4)3 → Other Products + C2H4
1 record matched Pyrimidine, 2-chloro-4-ethoxy- → Other Products + C2H4
1 record matched Pyridine, 2-ethoxy-5-methyl- → C2H4 + 2(1H)-Pyridinone, 5-methyl-
1 record matched Pyridine, 2-ethoxy-4-methyl- → C2H4 + 2(1H)-Pyridinone, 4-methyl-
1 record matched Pyridine, 2-ethoxy-3-methyl- → C2H4 + 2(1H)-Pyridinone, 3-methyl-
1 record matched CH3OC(S)OC2H5 → C2H4 + CH3OC(O)SH
1 record matched C2H5SiH → C2H4 + SiH2
1 record matched Carbonothioic acid O-ethyl S-phenyl ester → Other Products + C2H4
1 record matched Carbonothioic acid O-ethyl S-(4-methylphenyl) ester → Other Products + C2H4
1 record matched Cyclobutane-1,2-d2, trans- (unspecified) → C2H4 + (E)-CHD=CHD
2 records matched Fe(CO)3(C2H4)2 → C2H4 + Fe(CO)3(C2H4)
1 record matched Cyclobutane-1,2-d2, cis- → C2H4 + (Z)-CHD=CHD
1 record matched Carbonothioic acid O-ethyl S-(4-methoxyphenyl) ester → Other Products + C2H4
1 record matched Isoquinoline, 1-ethoxy- → C2H4 + 1(2H)-Isoquinolinone
3 records matched F2NCH2CH2 → C2H4 + NF2
1 record matched Pyridazine, 3-ethoxy- → C2H4 + 3(2H)-Pyridazinone
1 record matched Isoquinoline, 3-ethoxy- → C2H4 + 3(2H)-Isoquinolinone
1 record matched Benzoic acid, 3-iodo-, ethyl ester → C2H4 + Benzoic acid, 3-iodo-
1 record matched (·)CH2CH(OH)C≡N → C2H4 + NCO
1 record matched CH2CH2C(O)CH3 → C2H4 + CH3CO
1 record matched Ethyl 1-Piperidineglyoxylate → C2H4 + CO2 + 1-Piperidinecarboxaldehyde
1 record matched Benzoic acid, 4-iodo-, ethyl ester → C2H4 + Benzoic acid, 4-iodo-
1 record matched 2-Ethoxyquinoline → 2(1H)-Quinolinone + C2H4
2 records matched CH3OC(O)SC2H5 → C2H4 + CH3OC(O)SH
1 record matched Pyrazine, ethoxy- → C2H4 + 2(1H)-Pyrazinone
1 record matched 1,2-Cyclobutanedione → Other Products + C2H4
1 record matched N,N-Dimethylglycine ethyl ester → C2H4 + (CH3)3N + CO2
1 record matched Cyclobutane, 1,1,2-trimethyl- → C2H4 + (CH3)2C=CHCH3
1 record matched Spiropentane, methyl- → C2H4 + CH2=C=CHCH3
2 records matched ethyl 1-methyl-2-piperidine carboxylate → C2H4 + CO2 + N-Methylpiperidine
1 record matched Pyrimidine, 4-ethoxy- → C2H4 + 4(3H)-Pyrimidinone
2 records matched Benzoic acid, 3-bromo-, ethyl ester → C2H4 + Benzoic acid, 3-bromo-
1 record matched Ethyl 1-piperidineaceate → C2H4 + CO2 + N-Methylpiperidine
2 records matched CH2DCH2Br → C2H4 + DBr
1 record matched CH2DCH2Cl → C2H4 + DCl
1 record matched Germacyclobutane, 1,1-dimethyl- → C2H4 + (CH3)2Ge=CH2
1 record matched 1-Piperidinepropanoic acid, ethyl ester → C2H4 + CO2 + Piperidine, 1-ethyl-
1 record matched Pyridine, 2-ethoxy-6-methyl- → C2H4 + 2(1H)-Pyridinone, 6-methyl-
1 record matched (CH3)3SiCH2CH2OCH3 → C2H4 + (CH3)3SiOCH3
1 record matched ClCH2CH2Si(C2H5)Cl2 → C2H4 + C2H5SiCl3
1 record matched 1H-Pyrazole, 1-ethyl-3,5-dimethyl- → 1H-Pyrazole, 3,5-dimethyl- + C2H4
1 record matched (CH3)3SiCH2CH2Cl → C2H4 + (CH3)3SiCl
1 record matched (C2H5)3SiCH2CH2Cl → C2H4 + (C2H5)3SiCl
1 record matched Pyridazine, 3-chloro-6-ethoxy- → C2H4 + 3(2H)-Pyridazinone, 6-chloro-
4 records matched CH2BrCH2 → C2H4 + Br·
1 record matched CH2CH2Cl + CH2CH2Cl → C2H4 + CH2ClCH2Cl
3 records matched CH2CH2Cl → C2H4 + Cl
1 record matched Thiazole, 2-ethoxy- → C2H4 + 2(3H)-Thiazolone
1 record matched Cyclobutane, 1,2-dimethyl-, trans- → C2H4 + CH3CH=CHCH3
1 record matched Cyclobutane, 1,2-dimethyl-, cis- → C2H4 + CH3CH=CHCH3
2 records matched bicyclo[2.2.2]oct-2-ene, 5-methyl-,(1α,4α,5α)- → C2H4 + 1,3-Cyclohexadiene, 5-methyl-
1 record matched C2H5OC(O)SCH3 → C2H4 + CH3OC(O)SH
2 records matched Bicyclo[2.2.2]oct-2-ene, 5-methyl-,(1α,4α,5β)- → C2H4 + 1,3-Cyclohexadiene, 5-methyl-
2 records matched Pyridine, 2-ethoxy- → C2H4 + 2(1H)-Pyridinone
1 record matched 2H-Pyran, 3,4-dihydro-2-methyl- → C2H4 + CH2=CHCOCH3
2 records matched Benzoic acid, 3-methoxy-, ethyl ester → C2H4 + 3-Methoxybenzoic acid
1 record matched O2 + CH3CH2N=NCH(·)CH3 → C2H4 + C2H5OO· + N2
1 record matched O2 + ·CH2CH2N=NC2H5 → C2H4 + C2H5OO· + N2
1 record matched Benzoic acid, 3-hydroxy-, ethyl ester → C2H4 + Benzoic acid, 3-hydroxy-
2 records matched Benzoic acid, 4-chloro-, ethyl ester → Benzoic acid, 4-chloro- + C2H4
2 records matched CH2=CHCH2CH2CH2· → C2H4 + ·CH2CH=CH2
1 record matched CH2=CHSiH3 → C2H4 + SiH2
1 record matched Bicyclo[3.2.0]hept-2-ene → C2H4 + Cyclopentadiene
1 record matched ·CH2Cl + CH2CH2Cl → C2H4 + CH2Cl2
1 record matched 1-Propanone, 1-cyclobutyl- → C2H4 + C2H5COCH=CH2
1 record matched Oxetane, 2,2-dimethyl- → (CH3)2CO + C2H4
1 record matched ClCH2CH2SiCl3 → C2H4 + SiCl4
2 records matched Benzoic acid, 4-bromo-, ethyl ester → C2H4 + 4-Bromobenzoic acid
1 record matched 3-Thiophenecarboxylic acid ethyl ester → C2H4 + 3-Thiophenecarboxylic acid
1 record matched Bicyclopropyl → C2H4 + 1,3-Butadiene
1 record matched t-C4H9CH2C(O)OCH2CH3 → C2H4 + (CH3)3CCH2COOH
1 record matched Ethyl 1-methylnipecotate → C2H4 + CO2 + N-Methylpiperidine
1 record matched Ethyl piperidine-3-carboxylate → C2H4 + 3-Piperidine Carboxylic Acid
1 record matched Cyclobutane, propyl- → C2H4 + 1-C5H10
1 record matched Cyclobutane, ethyl- → C2H4 + 1-C4H8
1 record matched Cyclooctyl radical + O· → C2H4 + ·CH2(CH2)4CHO
2 records matched Cyclobutanecarbonitrile → C2H4 + CH2CHCN
2 records matched HOCH2CH2 → C2H4 + ·OH
1 record matched Cyclobutanemethanol → C2H4 + CH2=CHCH2OH
1 record matched Cyclopentanecarbonitrile → C2H4 + (E)-CH3CH=CHCN
1 record matched ClCH2CH2SiCl(C2H5)2 → C2H4 + Silane, dichlorodiethyl-
1 record matched CH3CH → C2H4
1 record matched Cyclopentyl → C2H4 + ·CH2CH=CH2
1 record matched Carbonic acid ethyl phenyl ester → C2H4 + Carbonic acid monophenyl ester
1 record matched Pyrimidine, 2-ethoxy- → C2H4 + 2(1H)-Pyrimidinone
1 record matched Ethyl diethylcarbamate → C2H4 + (C2H5)2NH + CO2
1 record matched Silacyclobutane, 1-ethenyl-1-methyl- → Other Products + C2H4
1 record matched C2H5OCH2CH2 → C2H4 + CH3CH2
2 records matched C2H5OO· → C2H4 + HO2
1 record matched Cyclohexyl + O· → ·CH2CH2CH2CHO + C2H4
2 records matched Cl(CH2)3C(O)OC2H5 → C2H4 + Cl(CH2)3COOH
1 record matched Ethanone, 1-cyclobutyl)- → C2H4 + CH2=CHCOCH3
2 records matched Cyclobutane,(1-methylethenyl)- → C2H4 + CH2=C(CH3)CH=CH2
1 record matched Bicyclo[2.2.2]oct-5-ene-2-carbonitrile,(1α,2α,4α)- → C2H4 + 2,4-Cyclohexadiene-1-carbonitrile
1 record matched Bicyclo[2.2.2]oct-5-ene-2-carbonitrile,(1α,2β,4α)- → C2H4 + 2,4-Cyclohexadiene-1-carbonitrile
1 record matched Cyclobutanecarboxaldehyde → C2H4 + CH2=CHCHO
1 record matched BrCH2CH2CH2C(O)OC2H5 → C2H4 + BrCH2CH2CH2COOH
1 record matched Cyclobutanol → C2H4 + CH3CHO
1 record matched (CH3)3SiCH2CH2OH → C2H4 + (CH3)3SiOH
1 record matched 1H-Pyrazole, 1-ethyl- → C2H4 + Pyrazole
1 record matched 2-Thiophenecarboxylic acid ethyl ester → C2H4 + 2-Thiophenecarboxylic acid
2 records matched C2H3 + H· → C2H4
1 record matched C2H3 + HI → C2H4 + I
4 records matched C2H3 + HCl → C2H4 + Cl
8 records matched C2H3 + C2H3 → C2H4 + C2H2
1 record matched Carbamic acid, methylphenyl-, ethyl ester → C2H4 + N-Methylbenzenamine + CO2
2 records matched Ethenylcyclobutane → C2H4 + 1,3-Butadiene
2 records matched 2-Pyridinecarboxylic acid ethyl ester → C2H4 + Pyridine + CO2
1 record matched 2-Pyridinecarboxylic acid ethyl ester → C2H4 + 2-Pyridinecarboxylic acid
8 records matched n-C4H9 → C2H4 + ·C2H5
1 record matched Cyclopropyl + O2 → HOCO + C2H4
1 record matched Silacyclobutane, 1,1-dimethyl- + Silacyclobutane, 1,1-dimethyl- → C2H4 + C2H4 + 1,1,3,3-Tetramethyl-1,3-disilacyclobutane
1 record matched Silacyclobutane, 1,1-dimethyl- → C2H4 + (CH3)2Si=CH2
3 records matched ·CH3 + ·CH2 → C2H4 + H·
1 record matched ·CH3 + ·CH2F → C2H4 + HF
5 records matched ·CH3 + ·CH3 → C2H4 + H2
3 records matched Oxetane, 2-methyl- → C2H4 + CH3CHO
10 records matched n-C3H7 → C2H4 + ·CH3
1 record matched ·C2H5 + (Z)-CH3CH=CHCH2CH2 → C2H4 + 2-(Z)-C5H10
5 records matched ·C2H5 + Cl → C2H4 + HCl
1 record matched ·C2H5 + O· → C2H4 + ·OH
1 record matched ·C2H5 + CH2CH2Cl → C2H4 + C2H5Cl
1 record matched ·C2H5 + H· → C2H4 + H2
2 records matched ·C2H5 + Br· → C2H4 + HBr
21 records matched ·C2H5 + O2 → C2H4 + HO2
1 record matched ·C2H5 + iso-C4H9 → C2H4 + iso-C4H10
1 record matched ·C2H5 + Cyclobutyl → C2H4 + Cyclobutane
1 record matched ·C2H5 + Cyclopentyl → C2H4 + Cyclopentane
2 records matched ·C2H5 + ·CH2F → C2H4 + CH3F
1 record matched ·C2H5 + CHCl2 → C2H4 + CH2Cl2
3 records matched ·C2H5 + C2F5 → C2H4 + C2F5H
1 record matched ·C2H5 + HO2 → C2H4 + H2O2
2 records matched ·C2H5 + ·CCl3 → CHCl3 + C2H4
4 records matched ·C2H5 + n-C3F7 → C2H4 + C2F5CF2H
1 record matched ·C2H5 + Cyclohexyl → C2H4 + Cyclohexane
2 records matched ·C2H5 + ·CHF2 → C2H4 + CH2F2
1 record matched ·C2H5 + C2H3 → C2H4 + C2H4
1 record matched ·C2H5 + n-C4H9 → C2H4 + n-C4H10
3 records matched ·C2H5 + ·CF3 → C2H4 + CHF3
8 records matched ·C2H5 + ·CH3 → CH4 + C2H4
2 records matched ·C2H5 + CH3CH2O· → C2H5OH + C2H4
2 records matched ·C2H5 + n-C3H7 → C2H4 + C3H8
1 record matched ·C2H5 + ·C2H5 → C2H4 + ·C2H5
32 records matched ·C2H5 + ·C2H5 → C2H6 + C2H4
28 records matched ·C2H5 → C2H4 + H·
3 records matched iso-C3H7 + ·C2H5 → C2H4 + C3H8
4 records matched iso-C3H7 → C2H4 + ·CH3
1 record matched ·CH2CH=CH2 + O· → C2H4 + HCO
1 record matched ·CH2CH=CH2 + O· → C2H4 + CO + H·
2 records matched ·CH2CH=CH2 + ·C2H5 → C2H4 + CH3CH=CH2
1 record matched Cyclohexene, 1,2-dimethyl- → C2H4 + CH2=C(CH3)C(CH3)=CH2
3 records matched tert-C4H9 + ·C2H5 → C2H4 + iso-C4H10
1 record matched tert-C4H9 → C2H4 + ·C2H5
1 record matched C6H5COC(O)OC2H5 → C2H4 + Benzaldehyde + CO2
1 record matched 4-Pyridinecarboxylic acid ethyl ester → 4-Pyridinecarboxylic acid + C2H4
1 record matched Ethylidenecyclobutane → C2H4 + CH2=C=CHCH3
1 record matched Cyclohexene-3,3,6,6-d4 → C2H4 + CD2=CHCH=CD2
4 records matched H2 + C2H3 → C2H4 + H·
1 record matched Naphthalene, 1,2,3,4,4a,5,6,7-Octahydro- → C2H4 + Cyclohexene, 1-ethenyl-
1 record matched Furan, 2,3-dihydro- → C2H4 + H2C=C=O
3 records matched Cyclobutanone → C2H4 + H2C=C=O
2 records matched Benzoic acid, 3-chloro-, ethyl ester → C2H4 + Benzoic acid, 3-chloro-
3 records matched cyclobutyl chloride → C2H4 + CH2=CHCl
1 record matched Methylenecyclobutane → C2H4 + CH2=C=CH2
2 records matched Bicyclo[2.2.2]oct-2-ene → C2H4 + 1,3-Cyclohexadiene
2 records matched CH3C(S)OCH2CH3 → C2H4 + CH3COSH
2 records matched CH2=C(CH3)OC2H5 → (CH3)2CO + C2H4
1 record matched Isopropylcyclobutane → C2H4 + (CH3)2CHCH=CH2
1 record matched CH3C(S)SC2H5 → C2H4 + CH3C(S)SH
1 record matched Cyclobutanecarboxylic acid methyl ester → C2H4 + CH2=CHCOOCH3
1 record matched Silacyclobutane, 1-methyl- → C2H4 + CH2=SiHCH3
1 record matched Silacyclobutane, 1-methyl- → C2H4 + CH2=CHSiH3
1 record matched C2H5CH2C(CH3)=CH2 → C2H4 + iso-C4H8
2 records matched C2H5OC(O)N(CH3)2 → C2H4 + CO2 + (CH3)2NH
1 record matched tert-C4H9OC2H5 → C2H4 + tert-C4H9OH
1 record matched C3H7C≡CH → C2H4 + CH2=C=CH2
1 record matched CH3COSC2H5 → C2H4 + CH3COSH
1 record matched ClCH2CH2C(O)OC2H5 → C2H4 + ClCH2CH2COOH
1 record matched (E)-CH3CH=CHCOOC2H5 → C2H4 + (E)-CH3CH=CHCOOH
1 record matched CH3SC(S)OC2H5 → C2H4 + CH3OC(S)SH
3 records matched CH3OC(O)OCH2CH3 → C2H4 + CH3OC(O)OH
1 record matched HOCH2COOC2H5 → C2H4 + HOCH2COOH
1 record matched Benzoic acid, 3-nitro-, ethyl ester → C2H4 + 3-Nitrobenzoic acid
1 record matched (C2H5)3As → C2H4 + (C2H5)2AsH
1 record matched 2-Furancarboxylic acid ethyl ester → C2H4 + 2-Furancarboxylic acid
1 record matched 3-Furancarboxylic acid ethyl ester → C2H4 + 3-Furancarboxylic acid
1 record matched 3-Pyridinecarboxylic acid ethyl ester → 3-Pyridinecarboxylic acid + C2H4
3 records matched Methylcyclobutane → C2H4 + CH3CH=CH2
1 record matched CH2=CHCH2CH2CH=CH2 → C2H4 + 1,3-Butadiene
1 record matched CH2=C=CHCH2CH3 → C2H4 + CH3CCH
1 record matched Cyclohexene, 1-methyl- → C2H4 + CH2=C(CH3)CH=CH2
1 record matched CH2=C=CHCH3 + H· → C2H4 + C2H3
1 record matched Benzoic acid, 3-amino-, ethyl ester → C2H4 + 3-Aminobenzoic acid
2 records matched Oxetane → CH2O + C2H4
2 records matched Azetidine → C2H4 + CH2=NH
1 record matched Bicyclo[2.2.2]octa-2,5-diene → Benzene + C2H4
3 records matched Bicyclo[2.2.1]hept-2-ene → C2H4 + Cyclopentadiene
1 record matched Naphthelene, 1,2,3,4,5,6,7,8-Octahydro- → C2H4 + Cyclohexane 1,2-bis(methylene)-
5 records matched H2C=C=O + ·CH2 → C2H4 + CO
5 records matched CH2=C=CH2 + O· → C2H4 + CO
1 record matched CH2=C=CH2 → Other Products + C2H4
1 record matched CH2(OC2H5)2 → C2H4 + CH3CH2OCH2OH
1 record matched CH2FC(O)OC2H5 → C2H4 + CH2FCOOH
1 record matched CHF2COOC2H5 → C2H4 + CHF2COOH
1 record matched C2F5COOC2H5 → C2H4 + C2F5COOH
3 records matched Thiirane + Cl → C2H4 + SCl
1 record matched Thiirane + O· → C2H4 + SO
2 records matched Thiirane + H· → C2H4 + SH
3 records matched Thiirane + S → C2H4 + S2
1 record matched Thiirane + CH3S· → C2H4 + CH3SS
1 record matched Thiirane + ·CH3 → C2H4 + CH3
1 record matched Thiirane + CD3 → C2H4 + CD3S
2 records matched Thiirane → C2H4 + S
1 record matched CF3COOC2H5 → C2H4 + CF3COOH
1 record matched Cyclobutane,1,1,2,2-tetrafluoro- → C2H4 + C2F4
1 record matched CH2FCH2OH → C2H4 + HOF
1 record matched n-C3F7COOC2H5 → C2H4 + n-C3F7COOH
8 records matched C2H5F → C2H4 + HF
1 record matched Cyclopentane → C2H4 + Cyclopropane
1 record matched Silacyclobutane → C2H4 + CH2=SiH2
2 records matched Thietane → C2H4 + CH2S
19 records matched Cyclobutane → C2H4 + C2H4
1 record matched cyclopentene epoxide → C2H4 + CH2=CHCHO
1 record matched Bicyclo[3.2.0]heptane → C2H4 + Cyclopentene
1 record matched Spirohexane → C2H4 + Cyclobutylidene
2 records matched Silacyclopropane → C2H4 + SiH2
1 record matched Cyclopentene + O· → Products + C2H4
20 records matched CH3COOC2H5 → CH3C(O)OH + C2H4
1 record matched (CH3)2C(OC2H5)2 → C2H5OH + (CH3)2CO + C2H4
1 record matched Pyrrolidine → C2H4 + Aziridine
1 record matched Benzoic acid, 4-hydroxy-, ethyl ester → C2H4 + Benzoic acid, 4-hydroxy-
2 records matched Benzoic acid, 3-methyl-, ethyl ester → C2H4 + 3-Methylbenzoic acid
1 record matched 1,2,3,4-Tetrahydronaphthalene → C2H4 + Bicyclo[4.2.0]octa-1,3,5-triene
1 record matched Propane, 1,1,1-triethoxy- → C2H5OH + C2H4 + C2H5COOC2H5
1 record matched CH3CH=CH2 + N → C2H4 + HCN + H·
3 records matched CH3CH=CH2 + H· → C2H4 + ·CH3
6 records matched 3,4-Dihydro-2H-pyran → C2H4 + CH2=CHCHO
15 records matched Cyclohexene → C2H4 + 1,3-Butadiene
1 record matched NCCH2CH2CN → C2H4 + NCCN
1 record matched Tetrahydrofuran → C2H4 + CH2OCH2
1 record matched HCOOC2H5 → HCOOH + C2H4
6 records matched CH2=CHOC2H5 → C2H4 + CH3CHO
1 record matched C2H5NCO → C2H4 + HN=C=O
1 record matched 1-C5H10 → C2H4 + CH3CH=CH2
1 record matched (CH3)2CHCH2C(O)OC2H5 → C2H4 + iso-C4H9COOH
4 records matched C2H5CN → C2H4 + HCN
1 record matched CH2ClCH2Cl → C2H4 + Cl2
1 record matched 1,3-Butadiene → C2H4 + C2H2
5 records matched C2H5OC(O)OC2H5 → C2H4 + C2H5OC(O)OH
1 record matched NCCH2COOC2H5 → C2H4 + NCCH2COOH
1 record matched n-C3H7C(O)OC2H5 → C2H4 + n-C3H7COOH
1 record matched ClCH2C(O)OC2H5 → C2H4 + CH2ClCOOH
1 record matched C2H5COOC2H5 → C2H4 + C2H5COOH
1 record matched CH2BrC(O)OC2H5 → C2H4 + CH2BrCOOH
1 record matched Carbamic acid, phenyl-, ethyl ester → C2H4 + Carbamic acid, phenyl-
1 record matched Benzeneacetic acid ethyl ester → C2H4 + Benzeneacetic acid
1 record matched Ethylbenzene → Benzene + C2H4
1 record matched Benzoic acid, 4-nitro-, ethyl ester → 4-Nitrobenzoic acid + C2H4
1 record matched (C2H5)3B → C2H4 + (C2H5)2BH
1 record matched Benzoic acid, 4-methoxy-, ethyl ester → C2H4 + 4-Methoxybenzoic acid
1 record matched Benzoic acid, 4-amino-, ethyl ester → C2H4 + 4-Aminobenzoic acid
2 records matched Benzoic acid, 4-methyl-, ethyl ester → C2H4 + 4-Methylbenzoic acid
3 records matched Ethyl benzoate → Benzoic acid + C2H4
1 record matched Acenaphthylene, 1,2-dihydro- + C2H3 → C12H9 + C2H4
1 record matched C2H5NO2 → C2H4 + HNO2
1 record matched Ethane, 1,1,1-triethoxy- → C2H5OH + C2H4 + CH3COOC2H5
1 record matched (C2H5O)4Si → C2H4 + HOSi(OCH2CH3)3
1 record matched iso-C4H10 + C2H3 → C2H4 + tert-C4H9
1 record matched Oxirane + H· → C2H4 + ·OH
1 record matched Oxirane + C2O → C2H4 + CO + CO
1 record matched Oxirane + (CH3)2Si → C2H4 + (CH3)2Si=O
1 record matched CH3CHO + ·CH → C2H4 + HCO
5 records matched C2H5I → C2H4 + HI
17 records matched C2H5Cl → C2H4 + HCl
2 records matched C3H8 → CH4 + C2H4
16 records matched C2H5Br → C2H4 + HBr
1 record matched C2H2 + n-C3H7 → Other Products + C2H4
1 record matched C2H2 + 1,3-Cyclohexadiene → Benzene + C2H4
1 record matched C2H4 + W(CO)4 → W(CO)4(eta2-CH2=CH2)
1 record matched C2H4 + Cr(CO)4(C2H4) → (Z)-Cr(CO)4(C2H4)2
1 record matched C2H4 + CH2=CHCH=Si(CH3)2 → Silacyclohex-2-ene, 1,1-dimethyl-
1 record matched C2H4 + W(CO)4(eta2-CH2=CH2) → W(CO)4(eta2-CH2=CH2)2
1 record matched C2H4 + H2Fe(CO)3 → H2Fe(CO)3(CH2=CH2)
1 record matched C2H4 + CF3(CH2)3CH2 → Products
2 records matched C2H4 + Fe(CO)3(C2H4) → Fe(CO)3(C2H4)2
1 record matched C2H4 + C2H5SiH → Adduct
3 records matched C2H4 + CH3GeH → Products
1 record matched C2H4 + (CH3)2Ge: → Products
2 records matched C2H4 + ·CH2 → CH3CH=CH2
1 record matched C2H4 + ·CH2 → Cyclopropane
4 records matched C2H4 + ·CH2 → Products
1 record matched C2H4 + Cr(CO)4 → Products
1 record matched C2H4 + CH≡CC≡C → Products
1 record matched C2H4 + Fe(CO)3 → Fe(CO)3(C2H4)
1 record matched C2H4 + CF2BrCF2 → Adduct
1 record matched C2H4 + CH3C(O)OO(·) → Products
1 record matched C2H4 + Cr(CO)5 → Cr(CO)5(C2H4)
1 record matched C2H4 + CH3Sn(·)CH3 → Products
1 record matched C2H4 + Te → Adduct
11 records matched C2H4 + Cl → CH2CH2Cl
6 records matched C2H4 + Cl → C2H3 + HCl
21 records matched C2H4 + Cl → Products
1 record matched C2H4 + NCO → (·)CH2CH(OH)C≡N
6 records matched C2H4 + NCO → Products
2 records matched C2H4 + CF3O → CF3OH + C2H3
6 records matched C2H4 + CF3O → Adduct
1 record matched C2H4 + SiCl3 → Adduct
11 records matched C2H4 + N → HCN + ·CH3
9 records matched C2H4 + N → Products
1 record matched C2H4 + O· → CH2=CHO· + H·
8 records matched C2H4 + O· → *CH2C(O)H + H·
1 record matched C2H4 + O· → C2H3 + ·OH
12 records matched C2H4 + O· → ·CH3 + HCO
3 records matched C2H4 + O· → H2C=C=O + H2
2 records matched C2H4 + O· → Oxirane
3 records matched C2H4 + O· → CH2O + ·CH2
47 records matched C2H4 + O· → Products
3 records matched C2H4 + D → CH2DCH2
1 record matched C2H4 + D → CH2=CHD + H·
2 records matched C2H4 + D → Products
1 record matched C2H4 + H2C=N → Products
1 record matched C2H4 + BrO → Products
1 record matched C2H4 + Fe(CO)4 → (CH2=CH2)(CO)4Fe
1 record matched C2H4 + ·F → CH2CH2F
4 records matched C2H4 + ·F → C2H3 + HF
4 records matched C2H4 + ·F → CH2=CHF + H·
5 records matched C2H4 + ·F → Products
1 record matched C2H4 + IO → Products
1 record matched C2H4 + AlO → Products
1 record matched C2H4 + AlH → Products
1 record matched C2H4 + SiF2 → Products
1 record matched C2H4 + SH → Products
1 record matched C2H4 + SiHCl → Products
1 record matched C2H4 + SiHCl → chlorosilirane
8 records matched C2H4 + SiH2 → Silacyclopropane
1 record matched C2H4 + CD → Products
2 records matched C2H4 + NH → Products
4 records matched C2H4 + NH2 → Products
6 records matched C2H4 + BH → Products
1 record matched C2H4 + OD → C2H3 + HDO
2 records matched C2H4 + OD → Adduct
1 record matched C2H4 + OD → Products
1 record matched C2H4 + SiCl2 → Adduct
3 records matched C2H4 + ·CHF → Products
1 record matched C2H4 + BH3 → Products
1 record matched C2H4 + W2 → W2-C2H4
110 records matched C2H4 + H· → ·C2H5
12 records matched C2H4 + H· → H2 + C2H3
3 records matched C2H4 + H· → Products
4 records matched C2H4 + Cu2 → Cu2CH2=CH2)
1 record matched C2H4 + Au2 → Adduct
2 records matched C2H4 + TiO → Products
3 records matched C2H4 + C3 → Products
2 records matched C2H4 + C2O → Products
1 record matched C2H4 + C2 → H· + CH2C(·)CCCH
1 record matched C2H4 + C2 → Products
1 record matched C2H4 + MoO → Products
1 record matched C2H4 + ZrO → Products
1 record matched C2H4 + TaO → Products
1 record matched C2H4 + NbO → Products
11 records matched C2H4 + NO3 → Products
1 record matched C2H4 + SF5 → SF5CH2CH2·
1 record matched C2H4 + NO2 → Adduct
4 records matched C2H4 + NO2 → Products
1 record matched C2H4 + Br· → CH3CHBr
4 records matched C2H4 + Br· → CH2BrCH2
5 records matched C2H4 + Br· → Products
1 record matched C2H4 + HI → C2H5I
2 records matched C2H4 + O3 → CH2O + CH2OO
4 records matched C2H4 + O3 → Other Products + ·OH
1 record matched C2H4 + O3 → Other Products + HO2
24 records matched C2H4 + O3 → Products
1 record matched C2H4 + N2O → CH3CHO + N2
1 record matched C2H4 + F2 → ·F + CH3C(·)HF
3 records matched C2H4 + F2 → ·F + CH2CH2F
1 record matched C2H4 + H2O → Products
3 records matched C2H4 + P → Products
4 records matched C2H4 + S → Thiirane
4 records matched C2H4 + Bi → Products
2 records matched C2H4 + Zr → Products
1 record matched C2H4 + Y → Y(C2H4)
1 record matched C2H4 + Y → H2 + Y(C2H2)
2 records matched C2H4 + Y → Products
1 record matched C2H4 + Hf → Products
1 record matched C2H4 + Ge → Products
1 record matched C2H4 + Ga → Adduct
1 record matched C2H4 + Cu → Cu(CH2=CH2)
1 record matched C2H4 + Cr → Products
1 record matched C2H4 + C → CH2C≡CH + H·
5 records matched C2H4 + C → Products
1 record matched C2H4 + B → Products
2 records matched C2H4 + As → Products
3 records matched C2H4 + Sb → Products
1 record matched C2H4 + Sn → Products
2 records matched C2H4 + Ta → Products
3 records matched C2H4 + Si → Products
2 records matched C2H4 + Ru → Products
1 record matched C2H4 + Rh → Products
1 record matched C2H4 + Pt → Products
2 records matched C2H4 + Pd → Products
2 records matched C2H4 + Nb → Products
4 records matched C2H4 + Ni → Ni(CH2=CH2)
3 records matched C2H4 + Ni → Products
1 record matched C2H4 + Mo → Products
1 record matched C2H4 + Mn → Products
7 records matched C2H4 + Pb → Products
4 records matched C2H4 + Fe → Products
1 record matched C2H4 + Ir → Products
2 records matched C2H4 + Al → Adduct
1 record matched C2H4 + CH3S· → Adduct
1 record matched C2H4 + (CH3)2Si → Adduct
1 record matched C2H4 + (CH3)2Si → Products
2 records matched C2H4 + CBr → Products
3 records matched C2H4 + ·CCl → Products
2 records matched C2H4 + CF → Products
1 record matched C2H4 + ·CH2F → CH2FCH2CH2
1 record matched C2H4 + ·CH2F → CH3F + C2H3
3 records matched C2H4 + NF2 → F2NCH2CH2
1 record matched C2H4 + NF2 → Products
1 record matched C2H4 + (CH3)3CO2 → Oxirane + (CH3)3CO·
1 record matched C2H4 + ·OH + NO → Products
15 records matched C2H4 + ·OH → HOCH2CH2
15 records matched C2H4 + ·OH → C2H3 + H2O
41 records matched C2H4 + ·OH → Products
1 record matched C2H4 + ·CH → Cyclopropene + H·
2 records matched C2H4 + ·CH → CH2=C=CH2 + H·
1 record matched C2H4 + ·CH → CH3CCH + H·
1 record matched C2H4 + ·CH → Products + H·
6 records matched C2H4 + ·CH → Products
5 records matched C2H4 + HO2 → Oxirane + ·OH
1 record matched C2H4 + HO2 → Products
4 records matched C2H4 + ·CCl3 → CCl3CH2CH2
3 records matched C2H4 + CF3CH2CH2 → CF3(CH2)3CH2
1 record matched C2H4 + CH2C≡CH → Products
1 record matched C2H4 + ·CHF2 → CH2F2 + C2H3
1 record matched C2H4 + C2H3 → 1,3-Butadiene + H·
3 records matched C2H4 + C2H3 → Products
1 record matched C2H4 + ·HCC≡N → Products
1 record matched C2H4 + HCO → Products
1 record matched C2H4 + COOH → CO2 + ·C2H5
1 record matched C2H4 + 1-Naphthalenyl → C10H7CH2CH2·
2 records matched C2H4 + n-C4H9 → 1-hexyl radical
1 record matched C2H4 + (CH3)2CHCH2CH2 → (iso-C3H7)(CH2)3CH2
2 records matched C2H4 + Phenyl → Styrene + H·
3 records matched C2H4 + Phenyl → Products
4 records matched C2H4 + ·CF3 → CF3CH2CH2
1 record matched C2H4 + ·CF3 → Products
6 records matched C2H4 + ·CH3 → n-C3H7
1 record matched C2H4 + ·CH3 → CH3CH=CH2 + H·
7 records matched C2H4 + ·CH3 → CH4 + C2H3
1 record matched C2H4 + ·CH3 → Products
1 record matched C2H4 + ·CF2 → CH3CH=CF2
1 record matched C2H4 + ·CF2 → Products
1 record matched C2H4 + CH2=C → Products
2 records matched C2H4 + CH3O· → CH3OCH2CH2
1 record matched C2H4 + CH3O· → Products
2 records matched C2H4 + n-C3H7 → 1-C5H11
2 records matched C2H4 + CH3O2· → Oxirane + CH3
2 records matched C2H4 + ·C2H → CH2CHCCH + H·
1 record matched C2H4 + ·C2H → C2H2 + C2H3
4 records matched C2H4 + ·C2H → Products
1 record matched C2H4 + CD3 → CHD3 + C2H3
1 record matched C2H4 + ·CHCl → Products
3 records matched C2H4 + ·C2H5 → n-C4H9
1 record matched C2H4 + ·C2H5 → CH3CH=CH2 + ·CH3
1 record matched C2H4 + ·C2H5 → 1-C4H8 + H·
6 records matched C2H4 + ·C2H5 → C2H6 + C2H3
2 records matched C2H4 + iso-C3H7 → (CH3)2CHCH2CH2
1 record matched C2H4 + ·CH2CH=CH2 → CH2=CHCH2CH2CH2·
1 record matched C2H4 + ·CH2CH=CH2 → CH2=CHCH=CHCH3 + H·
1 record matched C2H4 + ·CH2CH=CH2 → Cyclopentene + H·
1 record matched C2H4 + ·CClF → Products
1 record matched C2H4 + tert-C4H9 → (CH3)3CCH2CH2
2 records matched C2H4 + CCl2 (X 1A1) → Products
4 records matched C2H4 + H2 → C2H6
1 record matched C2H4 + (E)-2-C4H8 → C2H5CH(CH3)CH=CH2
2 records matched C2H4 + (E)-2-C4H8 → Products
1 record matched C2H4 + 1,3-Cyclohexadiene → Bicyclo[2.2.2]oct-2-ene
1 record matched C2H4 + (Z)-2-C4H8 → C2H5CH(CH3)CH=CH2
2 records matched C2H4 + (Z)-2-C4H8 → Products
1 record matched C2H4 + Cyclopentadiene → Bicyclo[2.2.1]hept-2-ene
1 record matched C2H4 + CSe2 → Selenirane + CSe
1 record matched C2H4 + Benzyne → Bicyclo[4.2.0]octa-1,3,5-triene
1 record matched C2H4 + Benzyne → Styrene
1 record matched C2H4 + CF3CN → ·CF3 + N=C-CH2CH2
1 record matched C2H4 + Cyclopentene → ·C2H5 + Cyclopentenyl
1 record matched C2H4 + Cyclopentene → C2H6 + Cyclopentadiene
1 record matched C2H4 + iso-C4H8 → C2H5CH2C(CH3)=CH2
1 record matched C2H4 + CH3CH=CH2 → 1-C5H10
1 record matched C2H4 + 1-C4H8 → CH3CH=CH2 + CH3CH=CH2
1 record matched C2H4 + CH2=C(CH3)CH=CH2 → Cyclohexene, 1-methyl-
1 record matched C2H4 + C3H8 → Products
4 records matched C2H4 + C2H4 → ·C2H5 + C2H3
1 record matched C2H4 + C2H4 → Cyclobutane
1 record matched C2H4 + C2H4 → 1,3-Butadiene + H2
1 record matched C2H4 + C2H4 → 1-C4H8
3 records matched C2H4 + C2H4 → Products
5 records matched C2H4 → C2H3 + H·
11 records matched C2H4 → C2H2 + H2
4 records matched C2H4 → Products
1 record matched C2H6 + ·CH → C2H4 + ·CH3
1 record matched C2H6 + C2H3 → C2H4 + ·C2H5
2 records matched C2H6 + C2H4 → 1-C4H8 + H2
5 records matched C2H6 → C2H4 + H2
3 records matched CH4 + C → C2H4
3 records matched CH4 + ·CH → C2H4 + H·
5 records matched C2H5OH → C2H4 + H2O
1 record matched C2H5OSO2CH3 → C2H4 + HOSO2CH3
3 records matched (C2H5)2O → C2H5OH + C2H4
3 records matched 2-Oxetanone → C2H4 + CO2
3 records matched CN + C2H4 → CH2CHCN + H·
1 record matched CN + C2H4 → HCN + C2H3
1 record matched CN + C2H4 → Other Products + CH2CHCN
1 record matched CN + C2H4 → Products + H·
11 records matched CN + C2H4 → Products
1 record matched CN + C2H4 → CH2=CH-NC + H·
1 record matched Cl(2P3/2) + C2H4 → C2H3 + HCl
1 record matched O(1D) + C2H4 → ·CH3 + HCO
2 records matched O(1D) + C2H4 → Products
2 records matched O2(1DELTA) + C2H4 → C2H4 + O2
1 record matched SF5CH2CH2· → C2H4 + SF5
1 record matched CH2CHCOH → C2H4 + CO
1 record matched CH3CH2CH2CHO → C2H4 + CH2=CHOH
4 records matched Mu + C2H4 → CH2CH2Mu
1 record matched N(D) + C2H4 → Products
1 record matched N(P) + C2H4 → Products
1 record matched NCCO + C2H4 → Products
1 record matched N(2D) + C2H4 → Products
1 record matched O(3P) + C2H6 → C2H4 + H2O
2 records matched S(1D) + C2H4 → H· + CH2=CHS
2 records matched S(1D) + C2H4 → ·CH3 + HC=S
2 records matched S(1D) + C2H4 → H2 + CH2=C=S
3 records matched S(1D) + C2H4 → Products
1 record matched B(2P1/2,3/2) [Mix of states] + C2H4 → Products
1 record matched Propyl Radical + O2 → C2H4 + HO2
1 record matched 1-ethylpiperazine carboxylate → C2H4 + Piperazine + CO2
1 record matched C2H5OCH=CHN(C2H5)2 → CHOCH2N(C2H5)2 + C2H4
1 record matched C2H5OCH=CHNH2 → CHOCH2NH2 + C2H4
2 records matched CH3CH(CH3)CH2CH2CH2· → C2H4 + iso-C4H9
1 record matched Zr (4d2_5s2,3F) + C2H4 → C2H2Zr + H2
1 record matched C2(X1ΣPlg) + C2H4 → H· + CH2C(·)CCCH
2 records matched C2(X1ΣPlg) + C2H4 → Products
1 record matched NCO(X2PI) + ·C2H5 → C2H4 + C#N(OH)
1 record matched NCO(X2PI) + ·C2H5 → C2H4 + HN=C=O
1 record matched (2-piperdine)-C(O)OCH2CH3 → C2H4 + Piperidine + CO2
1 record matched (N-piperdine)-C(O)OCH2CH3 → C2H4 + Piperidine + CO2
1 record matched CH_2(aA_1) + C2H4 → ·CH2CH=CH2 + H·
1 record matched CH_2(aA_1) + C2H4 → Other Products + H·
1 record matched CH_2(aA_1) + C2H4 → Products
1 record matched cyclopentoxy (chemically activated) → C2H4 + CH2=CHCHO + H·
1 record matched cyclopentoxy (chemically activated) → C2H4 + C2H4 + CO + H·
1 record matched C2(a3PIu) + C2H4 → H· + CH2C(·)CCCH
3 records matched C2(a3PIu) + C2H4 → Products
1 record matched ethyl 3-phenyl glycidate → C2H4 + Phenylethanal + CO2
1 record matched ethyl 3-methyl-3-phenyl glycidate → C6H5CH(CH3)CHO + C2H4 + CO2
1 record matched C2H5OCH=CHNH2 → C2H4 + CH3NH2 + CO
1 record matched (CH3)3CCH2CH2 → C2H4 + tert-C4H9
1 record matched C2H5OCH=CHN(C2H5)2 → C2H4 + (C2H5)2(CH3)N + CO
2 records matched CH2CH2SH → C2H4 + SH
1 record matched (iso-C3H7)(CH2)3CH2 → C2H4 + (CH3)2CHCH2CH2
1 record matched 1,3-Hexadien-6-yl → C2H4 + CH2=CHCH=CH·
1 record matched 1-C10H21 → C2H4 + 1-C8H17
1 record matched CH3OC(O)SC2H5 → CH3OC(S)OH + C2H4
1 record matched 1-C9H19 → C2H4 + 1-C7H15
1 record matched ethyl 1-methyl-2-piperidine carboxylate → C2H4 + CO2 + N-Methylpiperidine
1 record matched CH2=CHCH2O → C2H4 + HCO
1 record matched CH2BrCH2 → C2H4 + Br·
2 records matched CH2CH2Cl → C2H4 + Cl
2 records matched ·CH2(CH2)3CH=CH2 → C2H4 + CH2=CHCH2CH2·
1 record matched H2C=N + H2C=N → C2H4 + N2
1 record matched C2H5OC(O)SCH3 → C2H4 + CH3OC(O)SH
2 records matched CH2=CHCH2CH2CH2· → C2H4 + ·CH2CH=CH2
1 record matched Thiirane, 1-oxide- → C2H4 + SO
1 record matched HOCH2CH2CH2CH2 → C2H4 + HOCH2CH2
1 record matched Cyclopropanone → C2H4 + CO
1 record matched iso-C4H9 → C2H4 + ·C2H5
2 records matched 1-C8H17 → C2H4 + 1-hexyl radical
1 record matched Cyclooctyl radical + O· → C2H4 + ·CH2(CH2)4CHO
5 records matched HOCH2CH2 → C2H4 + ·OH
1 record matched Ethyl diethylcarbamate → C2H4 + (C2H5)2NH + CO2
2 records matched 1-C7H15 → C2H4 + 1-C5H11
1 record matched C2H5OCH2CH2 → C2H4 + CH3CH2
1 record matched C2H5OO· → C2H4 + H2O
4 records matched C2H5OO· → C2H4 + HO2
1 record matched Cyclohexyl + O· → ·CH2CH2CH2CHO + C2H4
1 record matched CH3CH2OOH → C2H4 + H2O2
1 record matched CH2C≡CH + ·OH → C2H4 + CO
4 records matched 1-hexyl radical → C2H4 + n-C4H9
8 records matched 1-C5H11 → C2H4 + n-C3H7
3 records matched C2H3 + H· → C2H4
1 record matched C2H3 + H2O → C2H4 + ·OH
2 records matched C2H3 + HCl → C2H4 + Cl
1 record matched C2H3 + C2H3 → C2H4 + C2H2
1 record matched 2-Pyridinecarboxylic acid ethyl ester → C2H4 + Pyridine + CO2
8 records matched n-C4H9 → C2H4 + ·C2H5
1 record matched 1-phenylethyl → C2H4 + Phenyl
2 records matched CH3CHOH + H· → C2H4 + H2O
1 record matched ·CH3 + ·CH2 → C2H4 + H·
1 record matched ·CH3 + ·CH2Cl → C2H4 + HCl
1 record matched Oxetane, 2-methyl- → C2H4 + CH3CHO
4 records matched CH2=CHCH2CH2· → C2H4 + C2H3
2 records matched CH3CH2O· + H· → C2H4 + H2O
10 records matched n-C3H7 → C2H4 + ·CH3
1 record matched ·C2H + NH3 → C2H4 + NH2
1 record matched ·C2H5 + N → (3)NH + C2H4
3 records matched ·C2H5 + O· → C2H4 + ·OH
2 records matched ·C2H5 + H· → C2H4 + H2
7 records matched ·C2H5 + O2 → C2H4 + HO2
1 record matched ·C2H5 + ·OH → C2H4 + H2O
2 records matched ·C2H5 + C2H3 → C2H4 + C2H4
1 record matched ·C2H5 + n-C4H9 → C2H4 + n-C4H10
4 records matched ·C2H5 + ·CH3 → CH4 + C2H4
2 records matched ·C2H5 + ·C2H5 → C2H6 + C2H4
4 records matched ·C2H5 → C2H4 + H·
3 records matched iso-C3H7 + C2H3 → C2H4 + CH3CH=CH2
2 records matched iso-C3H7 + ·C2H5 → C2H4 + C3H8
1 record matched ·CH2CH=CH2 + ·C2H5 → C2H4 + CH3CH=CH2
19 records matched H2 + C2H3 → C2H4 + H·
1 record matched H2 + CH2=C → C2H4
2 records matched Cyclobutanone → C2H4 + H2C=C=O
1 record matched Methylenecyclobutane → C2H4 + CH2=C=CH2
1 record matched Dihydro-3-(2H)-thiophenone → C2H4 + CO + CH2S
1 record matched CH2=C(CH3)OC2H5 → (CH3)2CO + C2H4
1 record matched CH3C(S)SC2H5 → C2H4 + CH3C(S)SH
1 record matched Ethane, 1-chloro-2-fluoro- → C2H4 + ClF
1 record matched C2H5OC(O)N(CH3)2 → C2H4 + CO2 + (CH3)2NH
1 record matched (C2H5O)2P(O)CH3 → C2H4 + PO(OH)(CH3)(OC2H5)
1 record matched n-C4H9OCH3 → CH2O + C2H6 + C2H4
1 record matched CH3COSC2H5 → CH3C(S)OH + C2H4
1 record matched CH3SC(S)OC2H5 → CH3SC(O)SH + C2H4
1 record matched CH3OC(O)OCH2CH3 → C2H4 + CH3OC(O)OH
1 record matched CH3OC(O)OCH2CH3 → CH3OH + C2H4 + CO2
1 record matched (C2H5)2Zn → HZnC2H5 + C2H4
1 record matched 2-Methylfuran → C2H4 + C2H2 + CO
2 records matched Oxetane → CH2O + C2H4
1 record matched H2C=C=O + H2C=C=O → C2H4 + CO + CO
1 record matched CH2=C=CH2 + O· → C2H4 + CO
1 record matched CH2=C=CH2 + CH2=C=CH2 → C2H4 + CH2=C=C=CH2
1 record matched Thiirane + GeHCl → GeHClS + C2H4
1 record matched Thiirane + CH3GeH → CH3GeHS + C2H4
1 record matched Thiirane + (CH3)2Ge: → C2H4 + Ge(CH3)2S
1 record matched Thiirane + :GeH2 → GeH2S + C2H4
1 record matched Thiirane + GeBr2 → GeBr2S + C2H4
1 record matched Thiirane + GeF2 → GeF2S + C2H4
1 record matched Thiirane + GeCl2 → GeCl2S + C2H4
1 record matched C2H5F → C2H4 + HF
1 record matched Cyclopentane → C2H4 + Cyclopropane
1 record matched Thietane → C2H4 + CH2S
3 records matched Cyclobutane → C2H4 + C2H4
1 record matched Spiropentane → C2H4 + CH2=C=CH2
1 record matched (CH3)2C(OC2H5)2 → C2H5OH + (CH3)2CO + C2H4
1 record matched (C2H5O)3P → C2H4 + OPH(OC2H5)2
1 record matched iso-C4H8 + C2H3 → C2H4 + CH2C(CH3)=CH2
1 record matched CH3CH=CH2 + H· → C2H4 + ·CH3
1 record matched CH3CH=CH2 + C2H3 → C2H4 + CH2=C(·)CH3
1 record matched CH3CH=CH2 + C2H3 → C2H4 + CH3CH=CH
1 record matched CH3CH=CH2 + C2H3 → C2H4 + ·CH2CH=CH2
1 record matched Cyclohexene → C2H4 + 1,3-Butadiene
2 records matched CH2=CHOC2H5 → C2H4 + CH3CHO
1 record matched 1-C5H10 → C2H4 + CH3CH=CH2
3 records matched CH2ClCH2Cl → C2H4 + Cl2
1 record matched CH3CH=CHCH3 + C2H3 → C2H4 + CH2=CHCH(·)CH3
1 record matched 1,3-Butadiene + H· → C2H4 + C2H3
2 records matched 1,3-Butadiene → C2H4 + C2H2
1 record matched 1-C4H8 + C2H3 → C2H4 + CH2=CHCH(·)CH3
1 record matched C2H5OC(O)OC2H5 → C2H4 + C2H5OC(O)OH
1 record matched C2H5OC(O)OC2H5 → C2H5OH + C2H4 + CO2
2 records matched C2H5COOC2H5 → C2H4 + C2H5COOH
2 records matched Ethoxybenzene → C2H4 + 2,4-Cyclohexadienone
2 records matched Ethoxybenzene → C2H4 + Phenol
1 record matched 1-Methylnaphthalene + C2H3 → C2H4 + 1-Naphthylmethyl
1 record matched C2H5NO2 → cis-HONO + C2H4
2 records matched C2H5NO2 → trans-HONO + C2H4
1 record matched (C2H5O)3PO → PO(OH)(OC2H5)2 + C2H4
1 record matched Oxirane + GeHCl → GeHClO + C2H4
1 record matched Oxirane + CH3GeH → CH3GeHO + C2H4
1 record matched Oxirane + (CH3)2Ge: → C2H4 + Ge(CH3)2O
1 record matched Oxirane + :GeH2 → C2H4 + GeH2O
1 record matched Oxirane + GeBr2 → GeBr2O + C2H4
1 record matched Oxirane + GeF2 → C2H4 + GeF2O
1 record matched Oxirane + GeCl2 → GeCl2O + C2H4
1 record matched HN=C=O + C2H3 → C2H4 + NCO
1 record matched C2H5SH → C2H4 + H2S
1 record matched CH3CHO + C2H3 → C2H4 + CH3CO
2 records matched C2H5I + O· → C2H4 + HOI
1 record matched C2H5I → C2H4 + HI
7 records matched C2H5Cl → C2H4 + HCl
1 record matched C3H8 + C2H3 → C2H4 + n-C3H7
1 record matched C3H8 + C2H3 → C2H4 + iso-C3H7
1 record matched C2H5Br → C2H4 + HBr
1 record matched C2H2 + H2 → C2H4
1 record matched C2H4 + Germacyclobutylidene → 3-Germaspiro[2.3]hexane
1 record matched C2H4 + CH2I-Cl → Cyclopropane + ICl
1 record matched C2H4 + CH2Cl-I → Cyclopropane + ICl
1 record matched C2H4 + CH2Br-I → Cyclopropane + IBr
1 record matched C2H4 + CH2I-Br → Cyclopropane + IBr
1 record matched C2H4 + CH2Ge → Germacyclobutylidene
1 record matched C2H4 + CH2Ge → 1-Methylenegermacyclopropane
2 records matched C2H4 + HCNCH2 → 2H-Pyrrole, 3,4-dihydro-
1 record matched C2H4 + (CH3)2Ge: → 1,1-dimethylgermacyclopropane
1 record matched C2H4 + COH → ·CH2CH2CHO
1 record matched C2H4 + COH → CH3C(·)HCHO
1 record matched C2H4 + COH → H2O + Cycloprop-1-enyl
1 record matched C2H4 + COH → Cyclopropanone + H·
1 record matched C2H4 + COH → CO + ·C2H5
1 record matched C2H4 + COH → H2C=C=O + ·CH3
1 record matched C2H4 + COH → CH2=CHCHO + H·
1 record matched C2H4 + CH2=CHCH(·)CH3 → CH2=CHCH(CH3)CH2CH2·
1 record matched C2H4 + ·CH2 → Products
1 record matched C2H4 + CH2C(O)OCH3 → CH3OC(O)CH2CH2CH2·
1 record matched C2H4 + HCCO → ·CH2CH2CHCO
1 record matched C2H4 + (CH3)2C → 1,1-Dimethylcyclopropane
2 records matched C2H4 + CBrF2 → Adduct
1 record matched C2H4 + CH3Sn(·)CH3 → 1,1-dimethylstannancyclopropane
2 records matched C2H4 + Cl → CH2CH2Cl
2 records matched C2H4 + Cl → C2H3 + HCl
1 record matched C2H4 + O· → CH2=CHO· + H·
2 records matched C2H4 + O· → *CH2C(O)H + H·
1 record matched C2H4 + O· → CH3CO + H·
2 records matched C2H4 + O· → C2H3 + ·OH
5 records matched C2H4 + O· → ·CH3 + HCO
1 record matched C2H4 + O· → CH2=CHOH
1 record matched C2H4 + O· → H2C=C=O + H2
1 record matched C2H4 + O· → CH3CHO
2 records matched C2H4 + O· → CH2O + ·CH2
1 record matched C2H4 + O· → Products
1 record matched C2H4 + Ethyl, 2-phenyl- → C6H5CH2CH2CH2CH2·
2 records matched C2H4 + HC-N=O → cy-CH=NOCH2CH2
1 record matched C2H4 + CH3OC(·)(O) → CH3OC(O)CH2CH2·
1 record matched C2H4 + CH2=C(·)CH3 → CH2=C(CH3)CH2CH2·
2 records matched C2H4 + ·F → CH2=CHF + H·
1 record matched C2H4 + SH → CH2CH2SH
1 record matched C2H4 + SiHCl → chlorosilirane
1 record matched C2H4 + NH → Adduct
1 record matched C2H4 + SiH3 → SiH3CH2CH2(·)
1 record matched C2H4 + OD → C2H3 + HDO
7 records matched C2H4 + H· → ·C2H5
11 records matched C2H4 + H· → H2 + C2H3
1 record matched C2H4 + C2 → Products
1 record matched C2H4 + NO3 → Oxirane + NO2
3 records matched C2H4 + NO3 → Products
2 records matched C2H4 + NO3 → CH2CH2ONO2
1 record matched C2H4 + NO3 → cyc-CH2CH2ON(O)O
2 records matched C2H4 + O3 → 1,2,3-Trioxolane
1 record matched C2H4 + O3 → Products
2 records matched C2H4 + N2O → cy-N=NOCH2CH2
1 record matched C2H4 + HN3 → 1H-1,2,3-Triazole
2 records matched C2H4 + HN3 → cy-N=NNHCH2CH2
1 record matched C2H4 + O2 → C2H3 + HO2
1 record matched C2H4 + O2 → (3)·CH2CH2OO·
2 records matched C2H4 + F2 → ·F + CH2CH2F
1 record matched C2H4 + F2 → CH2=CHF + HF
2 records matched C2H4 + S → H· + CH2=CHS
1 record matched C2H4 + S → C2H3 + SH
1 record matched C2H4 + S → ·CH3 + HC=S
1 record matched C2H4 + S → CH3CS + H·
1 record matched C2H4 + NH3 → Products
1 record matched C2H4 + HCl → C2H5Cl
1 record matched C2H4 + CH2=CHO· → ·CH2CH2CH2CHO
1 record matched C2H4 + (CH3)2Si → 1,1-dimethylsilacyclopropane
1 record matched C2H4 + iso-C4H9 → (CH3)2CCH2CH2CH2·
1 record matched C2H4 + (CH3)2Si=CH2 → Silacyclobutane, 1,1-dimethyl-
1 record matched C2H4 + (CH3)3CCH2 → (CH3)3C(CH2)2CH2·
6 records matched C2H4 + ·OH → HOCH2CH2
5 records matched C2H4 + ·OH → C2H3 + H2O
1 record matched C2H4 + ·OH → CH2=CHOH + H·
1 record matched C2H4 + ·OH → Products
1 record matched C2H4 + CHCCH(·)CH3 → HC≡CCH(CH3)CH2CH2·
1 record matched C2H4 + HO2 → C2H5OO·
1 record matched C2H4 + HO2 → Oxirane + ·OH
3 records matched C2H4 + HO2 → (·)CH2CH2OOH
1 record matched C2H4 + n-C3F7 → CF3CF2CF2CH2CH2
2 records matched C2H4 + C2H5OO· → Oxirane + CH3CH2
1 record matched C2H4 + CH2C≡CH → HC≡CCH2CH2CH2·
1 record matched C2H4 + Cyclopropene → Cyclopropene, 2-ethyl
1 record matched C2H4 + 1-C5H11 → 1-C7H15
3 records matched C2H4 + C2H3 → CH2=CHCH2CH2·
1 record matched C2H4 + C2H3 → 1,3-Butadiene + H·
1 record matched C2H4 + C2H3 → C2H4 + C2H3
1 record matched C2H4 + HCO → CH(OH)CH=CH2
1 record matched C2H4 + HCO → CO + ·C2H5
1 record matched C2H4 + HCO → H2C=C=O + ·CH3
1 record matched C2H4 + HCO → CH2=CHCHO + H·
1 record matched C2H4 + HCO → CH2O + C2H3
1 record matched C2H4 + HCO → CH2CH2C-O-H
1 record matched C2H4 + HCO → CH3CHC-O-H
1 record matched C2H4 + HCO → CH3(cy-CHC(·)HO)
2 records matched C2H4 + n-C4H9 → 1-hexyl radical
1 record matched C2H4 + Phenyl → Benzene + C2H3
1 record matched C2H4 + Phenyl → Products
1 record matched C2H4 + Phenyl → C6H5CH2CH2·
1 record matched C2H4 + 1-phenylethyl → C6H5C(CH3)CH2CH2·
1 record matched C2H4 + 1,3,5-Hexatriene → 1-(2-Propenyl)cyclopentene
1 record matched C2H4 + 1,3,5-Hexatriene → 1,3-Cyclooctadiene
1 record matched C2H4 + 1,3,5-Hexatriene → Products
1 record matched C2H4 + 1,3,5-Hexatriene → 1,3-butadienylcyclobutane
6 records matched C2H4 + ·CH3 → n-C3H7
3 records matched C2H4 + ·CH3 → CH4 + C2H3
2 records matched C2H4 + ·CH3 → Propyl Radical
1 record matched C2H4 + Benzyl → C6H5CH2CH2CH2·
1 record matched C2H4 + CH2=C → Methylenecyclopropane
1 record matched C2H4 + CH2=C → Cyclobutene
1 record matched C2H4 + CH2=C → Products
7 records matched C2H4 + n-C3H7 → 1-C5H11
1 record matched C2H4 + n-C3H7 → C2H4 + iso-C3H7
1 record matched C2H4 + ·C2H → CH2=C=C=CH2 + H·
1 record matched C2H4 + ·C2H → CH2CHCCH + H·
2 records matched C2H4 + ·C2H → C2H2 + C2H3
9 records matched C2H4 + ·C2H5 → n-C4H9
1 record matched C2H4 + ·C2H5 → C2H6 + C2H3
1 record matched C2H4 + iso-C3H7 → (CH3)2CHCH2CH2
1 record matched C2H4 + iso-C3H7 → 2-methylbutan-1-yl
2 records matched C2H4 + ·CH2CH=CH2 → CH2=CHCH2CH2CH2·
1 record matched C2H4 + tert-C4H9 → (CH3)3CCH2CH2
1 record matched C2H4 + tert-C4H9 → iso-C4H8 + ·C2H5
1 record matched C2H4 + tert-C4H9 → 2,2-methylbutan-1-yl
1 record matched C2H4 + H2 → ·C2H5 + H·
2 records matched C2H4 + H2 → C2H6
1 record matched C2H4 + CH3N3 → Products
1 record matched C2H4 + CH3N3 → 4,5-dehydro-1-methyl-1H-[1,2,3]triazole
1 record matched C2H4 + 1,3-Cyclohexadiene → Bicyclo[2.2.2]oct-2-ene
2 records matched C2H4 + Cyclopentadiene → Bicyclo[2.2.1]hept-2-ene
2 records matched C2H4 + CH2N2 → 3H-Pyrazole, 4,5-dihydro-
1 record matched C2H4 + CH3CH=CH2 → iso-C3H7 + C2H3
1 record matched C2H4 + CH3CH=CH2 → ·CH2CH=CH2 + ·C2H5
1 record matched C2H4 + CH3CH=CH2 → 1-C5H10
4 records matched C2H4 + 1,3-Butadiene → Cyclohexene
1 record matched C2H4 + 1,3-Butadiene → Products
1 record matched C2H4 + C2H5COOH → C2H5COOC2H5
1 record matched C2H4 + C2H2 → C2H3 + C2H3
3 records matched C2H4 + C2H4 → ·C2H5 + C2H3
3 records matched C2H4 → C2H3 + H·
1 record matched C2H4 → H2 + CH2=C
4 records matched C2H4 → C2H2 + H2
1 record matched C2H4 → Products
4 records matched C2H6 + C2H3 → C2H4 + ·C2H5
2 records matched C2H6 → C2H4 + H2
1 record matched CH4 + C → C2H4
4 records matched CH4 + C2H3 → C2H4 + ·CH3
1 record matched Benzene + C2H3 → C2H4 + Phenyl
1 record matched (CH3)2CO + C2H3 → C2H4 + CH3C(O)CH2(·)
6 records matched C2H5OH → C2H4 + H2O
1 record matched C2H5OH → C2H4 + ·OH + H·
5 records matched (C2H5)2O → C2H5OH + C2H4
2 records matched CH3CH(OH)CH2OH → CH2O + C2H4 + H2O
3 records matched CH2O + C2H3 → C2H4 + HCO
1 record matched O2(1DELTA) + C2H4 → C2H2 + H2O2
1 record matched O2(1DELTA) + C2H4 → (1)·CH2CH2OO·
7 records matched Mu + C2H4 → CH2CH2Mu
1 record matched 2-methylbutan-1-yl → C2H4 + iso-C3H7
1 record matched 2,2-methylbutan-1-yl → C2H4 + tert-C4H9
1 record matched CH2=CHCH(CH3)CH2CH2· → C2H4 + CH2=CHCH(·)CH3
1 record matched CH2=CHC(·)(CH3)2 + C2H4 → CH2=CHC(CH3)2CH2CH2·
1 record matched CH2=CHC(CH3)2CH2CH2· → CH2=CHC(·)(CH3)2 + C2H4
1 record matched CH2=CHCH(·)CH=CH2 + C2H4 → CH2=CHCH(CH=CH2)CH2CH2·
1 record matched CH2=CHCH(CH=CH2)CH2CH2· → CH2=CHCH(·)CH=CH2 + C2H4
1 record matched CH2=CHC(CH3)(·)CH=CH2 + C2H4 → CH2=CHC(CH3)(CH=CH2)CH2CH2·
1 record matched CH2=CHC(CH3)(CH=CH2)CH2CH2· → CH2=CHC(CH3)(·)CH=CH2 + C2H4
1 record matched C6H5CH2CH2CH2· → C2H4 + Benzyl
1 record matched C6H5C(CH3)CH2CH2· → C2H4 + 1-phenylethyl
1 record matched C6H5C(·)(CH3)CH3 + C2H4 → C6H5C(CH3)2CH2CH2·
1 record matched C6H5C(CH3)2CH2CH2· → C6H5C(·)(CH3)CH3 + C2H4
1 record matched HC≡CCH2CH2CH2· → C2H4 + CH2C≡CH
1 record matched HC≡CCH(CH3)CH2CH2· → C2H4 + CHCCH(·)CH3
1 record matched HC≡CC(CH3)2CH2CH2· → HC≡CC(·)(CH3)CH3 + C2H4
1 record matched HC≡CC(·)(CH3)CH3 + C2H4 → HC≡CC(CH3)2CH2CH2·
1 record matched CH2=C(CH3)CH2CH2· → C2H4 + CH2=C(·)CH3
1 record matched HC≡CCH2CH2· → C2H4 + ·C2H
1 record matched C6H5CH2CH2· + C2H4 → C6H5(CH2)3CH2·
1 record matched C6H5CH2CH2· → C2H4 + Phenyl
1 record matched C6H5(CH2)3CH2· → C6H5CH2CH2· + C2H4
1 record matched (CH3)2CCH2CH2CH2· → C2H4 + iso-C4H9
1 record matched (CH3)3C(CH2)2CH2· → C2H4 + (CH3)3CCH2
1 record matched CH3CH2C(·)(CH2CH3)CH2CH3 + C2H4 → CH3CH2C(CH2CH3)2CH2CH·
1 record matched CH3CH2C(CH2CH3)2CH2CH· → CH3CH2C(·)(CH2CH3)CH2CH3 + C2H4
1 record matched (CH3)3C-C(CH3)2CH2CH2· + C2H4 → (CH3)3C-C(CH3)2CH2CH2·
1 record matched (CH3)3C-C(CH3)2CH2CH2· → (CH3)3C-C(CH3)2CH2CH2· + C2H4
1 record matched CH2=Sn: + C2H4 → CH2=(cyclic-SnCH2CH2)
1 record matched CH2=Sn: + C2H4 → cyclo-SnHCHCH2CH2
1 record matched CH2-S-C(CH3)2 radical + C2H4 → tetrahydro-2,2-dimethyl-thiophene
1 record matched CH2(X3B_1) + ·CH3 → C2H4 + H·
1 record matched C6H5CH2CH2CH2CH2· → C2H4 + Ethyl, 2-phenyl-
1 record matched (CH3)2Pb + C2H4 → 1,1-dimethyplumbancyclopropane
2 records matched S(1D) + C2H4 → H· + CH2=CHS
2 records matched S(1D) + C2H4 → C2H3 + SH
2 records matched S(1D) + C2H4 → ·CH3 + HC=S
2 records matched S(1D) + C2H4 → H2 + CH2=C=S
2 records matched S(1D) + C2H4 → CH4 + CS
2 records matched S(1D) + C2H4 → CH3CS + H·
2 records matched (·)CH2CH2OOH → C2H4 + HO2
2 records matched HCNNH + C2H4 → 2-Pyrazoline
2 records matched CH2NHO + C2H4 → Isoxazolidine
2 records matched CH2=NH=NH + C2H4 → Pyrazolidine
2 records matched CH2=NH=CH2 + C2H4 → Pyrrolidine
1 record matched CH3CH(OH)CH2CH2· → C2H4 + CH3CHOH
1 record matched ·CH2CH2CH2CH2CH2· → C2H4 + Cyclopropane
1 record matched HNCS + C2H3 → C2H4 + SCN
1 record matched OsO3CH2 + C2H4 → cyc-Os(O)(CH2)OCH2CH2O
1 record matched OsO3CH2 + C2H4 → cyc-Os(O)(O)OCH2CH2CH2
1 record matched OsO3CH2 + C2H4 → cyc-Os(O)(O)(CH2)OCH2CH2
1 record matched OsO3CH2 + C2H4 → cyc-O(OsO2CH2)CH2CH2
1 record matched OsO3CH2 + C2H4 → Os(O)(O)(CH3)OCHCH2
1 record matched OsO3CH2 + C2H4 → Os(O)(O)(CH)OCH2CH3
1 record matched cyc-OsO2-O-CH2 + C2H4 → cyc-Os(O)(O)(CH2)OCH2CH2
1 record matched cyc-OsO2-O-CH2 + C2H4 → cyc-Os(O)(O)(O)CH2CH2CH2
1 record matched cyc-OsO2-O-CH2 + C2H4 → bicyc-Os(-O-CH2-CH2-O)(O-CH2)
1 record matched cyc-OsO2-O-CH2 + C2H4 → bicyc-Os(O)(-O-CH2-CH2)(O-CH2)
1 record matched cyc-OsO2-O-CH2 + C2H4 → bicyc-(OCH2CH2)-(Os(O)OCH2)
1 record matched O2OsOCH2 + C2H4 → cyc-Os(OCH2)OCH2CH2
1 record matched cyc-Os(O)(CH2)-O-O + C2H4 → cyc-Os(O)(O)(CH2)OCH2CH2
1 record matched GeHF + Thiirane → GeHFS + C2H4
1 record matched GeHF + Oxirane → GeHFO + C2H4
1 record matched GeHBr + Thiirane → GeHBrS + C2H4
1 record matched GeHBr + Oxirane → GeHBrO + C2H4
1 record matched PO(C2H5)(OC2H5)(SC2H5) → PS(OH)(C2H5)(OC2H5) + C2H4
1 record matched ·CH2CH2CH(CH3)CH2OOH → CH3CH(·)CH2OOH + C2H4
1 record matched ·CH2CH2CH2CH(CH3)OOH → ·CH2CH(CH3)CH2OOH + C2H4
1 record matched 3·CH2CH2CH2CH2CH2CH2· → 3·CH2CH2CH2CH2· + C2H4
1 record matched 3·CH2CH2CH2CH2· → (3)C2H4 + C2H4
1 record matched thioformaldehyde S-methylide + C2H4 → Tetrahydrothiophene
1 record matched (·)CH2CH2CH2CH2OH → C2H4 + HOCH2CH2
1 record matched (·)CH2CH2CH2CH2OOH → (·)CH2CH2OOH + C2H4
1 record matched (·)CH2CH2CH2OOH → CH2O + C2H4 + ·OH
1 record matched Propyl Radical + C2H4 → CH3CH=CH2 + ·C2H5
2 records matched Propyl Radical → C2H4 + ·CH3
2 records matched CH2CH2CH2CH2 → C2H4 + C2H4
2 records matched CH2CH2CH2CH2CH2CH2 → CH2CH2CH2CH2 + C2H4
1 record matched ·CH2CH2CH2CHO → C2H4 + CH2=CHO·
1 record matched ·CH2CH2CHCO → C2H4 + HCCO
1 record matched CH3OC(O)CH2CH2· → C2H4 + CH3OC(·)(O)
1 record matched CH3OC(O)CH2CH2CH2· → C2H4 + CH2C(O)OCH3
1 record matched CrO(CH3)2(CH2) + C2H4 → Products
1 record matched MoO(CH3)2(CH2) + C2H4 → Products
1 record matched O2(X3Sigma_g-) + C2H4 → H· + CH2=CHO2
1 record matched O2(X3Sigma_g-) + C2H4 → H· + CH3C(O)O
1 record matched O2(X3Sigma_g-) + C2H4 → ·OH + CH2=CHO·
1 record matched O2(X3Sigma_g-) + C2H4 → CH3CO + ·OH
5 records matched O2(X3Sigma_g-) + C2H4 → C2H3 + HO2
1 record matched O2(X3Sigma_g-) + C2H4 → ·CH3 + HCOO
1 record matched O2(X3Sigma_g-) + C2H4 → Products
1 record matched O2(X3Sigma_g-) + C2H4 → O(3P) + Oxirane
1 record matched O2(X3Sigma_g-) + C2H4 → H2C=CHOOH + H·
1 record matched O2(X3Sigma_g-) + C2H4 → trans-CH2CH2O2 peroxy radical(triplet)
1 record matched (·)CH2(CH2)3CHO → C2H4 + ·CH2CH2CHO
1 record matched O(3P) + C2H4 → Products

Search returned 2327 records.