Kinetics Database Logo

Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences


Rate Our Products and Services


Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty


Administrative Links

NIST home page

MML home page

Chemical and Biochemical Reference Data Division

MML home page

Chemical and Biochemical Reference Data Division

  NIST Logo Home
©NIST, 2013
Accessibility information

Search Results

Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
1 record matched CH3C(O)CH(O·)CH3 → CH3CHO + CH3CO
1 record matched CH3(CH2)2CH(CH3)O → CH3CHO + n-C3H7
2 records matched CH3CH2CH(CH3)O· → CH3CHO + ·C2H5
2 records matched i-C3H7O → CH3CHO + ·CH3
1 record matched CH3CO + H2O2 → CH3CHO + HO2
2 records matched C2H5OO· + CF3CCl2OO(·) → CF3CCl2OH + CH3CHO + O2
1 record matched C2H3 + ·OH → CH3CHO
1 record matched HCO + CH3CO → CH3CHO + CO
3 records matched CH3CHOH + O2 → CH3CHO + HO2
1 record matched ·CH3 + HCO → CH3CHO
2 records matched CH3CH2O· + NO → CH3CHO + HNO
9 records matched CH3CH2O· + O2 → CH3CHO + HO2
2 records matched CH3CH2O· → CH3CHO + H·
1 record matched CH3O· + CH3CO → CH2O + CH3CHO
1 record matched ·C2H5 + O· → CH3CHO + H·
1 record matched ·C2H5 + O2 → CH3CHO + ·OH
1 record matched iso-C3H7 + O· → CH3CHO + ·CH3
1 record matched iso-C3H7 + HO2 → CH3CHO + ·CH3 + ·OH
1 record matched iso-C3H7 + CH3O2· → CH3CHO + CH3O· + ·CH3
1 record matched H2 + CH3CO → CH3CHO + H·
1 record matched CH3CH=CH2 + CH3CO → CH3CHO + ·CH2CH=CH2
1 record matched iso-C4H10 + CH3CO → CH3CHO + iso-C4H9
1 record matched iso-C4H10 + CH3CO → CH3CHO + tert-C4H9
4 records matched CH3CHO + Cl → CH3CO + HCl
3 records matched CH3CHO + O· → CH3CO + ·OH
3 records matched CH3CHO + O· → Other Products + ·OH
1 record matched CH3CHO + O· → Products
1 record matched CH3CHO + H· → CH3CH2
1 record matched CH3CHO + H· → H2 + CH3CO
1 record matched CH3CHO + H· → Products
6 records matched CH3CHO + NO3 → CH3CO + HNO3
1 record matched CH3CHO + NO3 → Products
4 records matched CH3CHO + Br· → CH3CO + HBr
1 record matched CH3CHO + O2 → CH3CO + HO2
7 records matched CH3CHO + ·OH → CH3CO + H2O
2 records matched CH3CHO + ·OH → Products
1 record matched CH3CHO + HO2 → CH3CO + H2O2
1 record matched CH3CHO + ·CH3 → i-C3H7O
2 records matched CH3CHO + ·CH3 → CH4 + CH3CO
1 record matched CH3CHO + ·C2H5 → CH3CH2CH(CH3)O·
2 records matched CH3CHO → ·CH3 + HCO
1 record matched C3H8 + CH3CO → CH3CHO + n-C3H7
1 record matched C3H8 + CH3CO → CH3CHO + iso-C3H7
1 record matched C2H4 + HO2 → CH3CHO + ·OH
1 record matched C2H6 + CH3CO → CH3CHO + ·C2H5
1 record matched CH4 + CH3CO → CH3CHO + ·CH3
1 record matched CH3OH + CH3CO → CH3CHO + (·)CH2OH
1 record matched CH2O + CH3CO → CH3CHO + HCO
2 records matched CH3CH(O.)CH2CH2CH3 → CH3CHO + n-C3H7
1 record matched 2H-Pyran, 3,6-dihydro-2,6-dimethyl-, cis- → CH3CHO + (E)-CH2=CHCH=CHCH3
1 record matched Oxetane, 3-ethenyl-2,4-dimethyl-,(2α,3β,4α)- → CH3CHO + (E)-CH2=CHCH=CHCH3
1 record matched CH3(CH2)2CH(CH3)O → CH3CHO + n-C3H7
1 record matched Oxetane, 2,2,3,4-tetramethyl-,(Z)- → CH3CHO + (CH3)2C=CHCH3
1 record matched Oxetane, 2,2,3,4-tetramethyl-,(E)- → CH3CHO + (CH3)2C=CHCH3
1 record matched 1,2,4-Trioxolane, 3-methyl- → HCOOH + CH3CHO
1 record matched Oxetane, 2,3-dimethyl-, cis- → CH3CHO + CH3CH=CH2
1 record matched Benzene, [2-(ethenyloxy)ethyl]- → CH3CHO + Styrene
1 record matched Oxetane, 2,3-dimethyl-, trans- → CH3CHO + CH3CH=CH2
1 record matched CH3CH(OH)CH(CH3)C(O)OC2H5 → CH3CHO + C2H5COOC2H5
12 records matched CH3CH2CH(CH3)O· → CH3CHO + ·C2H5
1 record matched n-C3H7O → CH3CHO + ·C2H5
1 record matched 1-Phenyl-2-propanol → CH3CHO + Toluene
1 record matched O2 + CH3CH2N=NCH(·)CH3 → CH3CHO + ·C2H5 + N2O
1 record matched O2 + ·CH2CH2N=NC2H5 → CH3CHO + ·C2H5 + N2O
1 record matched CH3C(OH)HC(NO2)HCH3 → CH3CHO + C2H5NO2
1 record matched CH3CH=CH + O2 → CH3CHO + HCO
1 record matched CH3C(OH)HC(NO2)HCH2CH3 → CH3CHO + 1-nitropropane
1 record matched CH3CH(OH)CH2C(O)OC2H5 → CH3CHO + CH3COOC2H5
1 record matched (CH3)2C(OH) → CH3CHO + ·CH3
1 record matched HOCH2CH2 → CH3CHO + H·
1 record matched (CH3)2CHO2 → CH3CHO + CH3
2 records matched CH3CH(OH)CH2C(O)CH3 → (CH3)2CO + CH3CHO
12 records matched i-C3H7O → CH3CHO + ·CH3
2 records matched CH3CO + (CH3)2N → CH3CHO + CH2=NCH3
2 records matched CH3CO + HBr → CH3CHO + Br·
1 record matched CH3CO + HI → CH3CHO + I
2 records matched CH3CO + CH3CO → CH3CHO + H2C=C=O
1 record matched C2H5OO· + CF3CCl2OO(·) → CF3CCl2OH + CH3CHO + O2
1 record matched C2H5OO· + CH3C(O)OO(·) → CH3C(O)OH + CH3CHO + O2
1 record matched C2H5OO· + C2H5OO· → C2H5OH + CH3CHO + O2
1 record matched Cyclobutanol → C2H4 + CH3CHO
1 record matched 1,3-Dioxolane, 2,2-dimethyl- → (CH3)2CO + CH3CHO
4 records matched CH3CHOH + O· → CH3CHO + ·OH
2 records matched CH3CHOH + H· → CH3CHO + H2
1 record matched CH3CHOH + O2 → CH3CHO + HO2
1 record matched CH3CHOH + CH3CO → CH3CHO + CH3CHO
6 records matched ·CH3 + HCO → CH3CHO
5 records matched 2-C4H9O → CH3CHO + ·C2H5
3 records matched Oxetane, 2-methyl- → C2H4 + CH3CHO
1 record matched CH3CH2O· + I → CH3CHO + HI
1 record matched CH3CH2O· + NO2 → CH3CHO + HNO2
3 records matched CH3CH2O· + NO → CH3CHO + HNO
5 records matched CH3CH2O· + O2 → CH3CHO + HO2
1 record matched CH3CH2O· + C2H5OO· → CH3CHO + CH3CH2OOH
1 record matched CH3CH2O· + CH3CH2O· → C2H5OH + CH3CHO
1 record matched CH3CH2O· → CH3CHO + H·
1 record matched CH3O· + CH3CO → CH2O + CH3CHO
1 record matched CH3CH(OH)CH2C≡CH → CH3CHO + CH2=C=CH2
1 record matched ·C2H5 + O· → CH3CHO + H·
3 records matched ·C2H5 + O2 → CH3CHO + ·OH
2 records matched ·C2H5 + CH3CH2O· → C2H6 + CH3CHO
1 record matched iso-C3H7 + O· → CH3CHO + ·CH3
1 record matched CH3OCH2CH2OCH=CH2 → CH3CHO + CH2=CHOCH3
1 record matched CH3CH(OH)CH2C(O)OCH3 → CH3CHO + CH3C(O)OCH3
1 record matched CH3CH(C6H5O)COOH → CH3CHO + Phenol + CO
3 records matched CH2=CHOCH(CH3)2 → CH3CHO + CH3CH=CH2
3 records matched t-C4H9OCH=CH2 → CH3CHO + iso-C4H8
1 record matched CH3CH(O2)OCHCH3 → CH3C(O)OH + CH3CHO
1 record matched n-C3H7OCH=CH2 → CH3CHO + CH3CH=CH2
1 record matched tert-C4H9OC2H5 → CH3CHO + iso-C4H10
2 records matched CH2=CHCH2CH(OH)CH3 → CH3CHO + CH3CH=CH2
1 record matched (E)-2-C4H8 + O3 → CH3CHO + CH3CH(·)OO·
2 records matched (E)-2-C4H8 + O3 → Other Products + CH3CHO
1 record matched CH3CHBrCOOH → CH3CHO + CO + HBr
1 record matched (Z)-2-C4H8 + O3 → Other Products + CH3CHO
2 records matched CH3CH2OCH2CH=CH2 → CH3CHO + CH3CH=CH2
1 record matched CH3CH(OH)C(O)OCH3 → CH3OH + CH3CHO + CO
1 record matched C2H5OCH3 → CH4 + CH3CHO
1 record matched CH3COOCH(CH3)COOH → CH3C(O)OH + CH3CHO + CO
1 record matched (CH3)2C=CHCH3 + O3 → Other Products + CH3CHO
1 record matched 1,3-Dioxolane, 2-methyl- → CH3CHO + CH3CHO
1 record matched Cyclopentanone ethylene ketal → CH3CHO + Cyclopentanone
2 records matched CH3COCOOH → CH3CHO + CO2
2 records matched CH3C(O)C(OH)(CH3)2 → (CH3)2CO + CH3CHO
1 record matched CH3CH=CH2 + ·OH → CH3CHO + ·CH3
2 records matched n-C4H9OCH=CH2 → CH3CHO + 1-C4H8
1 record matched Ethene, (2-chloroethoxy)- → CH2=CHCl + CH3CHO
1 record matched C2H5ONO + ·OH → Other Products + CH3CHO
2 records matched C2H5ONO → CH3CHO + HNO
6 records matched CH2=CHOC2H5 → C2H4 + CH3CHO
1 record matched (CH3)2CHCH2OCH=CH2 → CH3CHO + iso-C4H8
1 record matched CH2ClCH2OH → CH3CHO + HCl
6 records matched Oxirane → CH3CHO
1 record matched CH3CHO + CH3CH(·)OO· → CH3CH(O2)OCHCH3
1 record matched CH3CHO + :SiD2 → Adduct
1 record matched CH3CHO + ·CH2 → Products
1 record matched CH3CHO + CH2OO → Products
5 records matched CH3CHO + CH3C(O)OO(·) → CH3C(O)OOH + CH3CO
1 record matched CH3CHO + Cl → HCl + CH3CO
1 record matched CH3CHO + Cl → *CH2C(O)H + HCl
13 records matched CH3CHO + Cl → CH3CO + HCl
2 records matched CH3CHO + Cl → Other Products + HCl
2 records matched CH3CHO + Cl → Products
1 record matched CH3CHO + N → HCN + H2 + HCO
1 record matched CH3CHO + O· → ·OH + CH2=CHO·
5 records matched CH3CHO + O· → CH3CO + ·OH
2 records matched CH3CHO + O· → Other Products + ·OH
1 record matched CH3CHO + D → Products
1 record matched CH3CHO + ·F → *CH2C(O)H + HF
1 record matched CH3CHO + ·F → CH3CO + HF
3 records matched CH3CHO + ·F → Other Products + HF
4 records matched CH3CHO + SiH2 → Adduct
1 record matched CH3CHO + NH → Other Products + NH2
1 record matched CH3CHO + NH2 → Products
1 record matched CH3CHO + H· → H2 + CH3CO
2 records matched CH3CHO + H· → H2 + CH2=CHO·
6 records matched CH3CHO + H· → H2 + CH3CO
2 records matched CH3CHO + H· → CO + H2 + ·CH3
1 record matched CH3CHO + H· → CH4 + HCO
2 records matched CH3CHO + H· → Products
3 records matched CH3CHO + NO3 → CH3CO + HNO3
11 records matched CH3CHO + NO3 → Products
6 records matched CH3CHO + NO2 → CH3CO + HNO2
1 record matched CH3CHO + NO2 → Products
6 records matched CH3CHO + Br· → CH3CO + HBr
1 record matched CH3CHO + Br· → Products
2 records matched CH3CHO + O3 → Products
1 record matched CH3CHO + O2 → HO2 + CH2=CHO·
1 record matched CH3CHO + O2 → CH3CO + HO2
1 record matched CH3CHO + O2 → CH3C(O)OOH
1 record matched CH3CHO + HCl → CH3CO + HCl
1 record matched CH3CHO + CH3S· → CH3SH + CO + ·CH3
1 record matched CH3CHO + (CH3)2C(OH) → iso-C3H7OH + CH3CO
1 record matched CH3CHO + NF2 → CH3CO + HNF2
1 record matched CH3CHO + ·OH → CH2=CHO· + H2O
1 record matched CH3CHO + ·OH → *CH2C(O)H + H2O
4 records matched CH3CHO + ·OH → CH3CO + H2O
1 record matched CH3CHO + ·OH → CH3C(O)OH + H·
1 record matched CH3CHO + ·OH → HCOOH + ·CH3
2 records matched CH3CHO + ·OH → Other Products + H2O
31 records matched CH3CHO + ·OH → Products
1 record matched CH3CHO + ·CH → H· + cyc-(H2COC)=CH2
2 records matched CH3CHO + ·CH → CH3CH=C=O + H·
1 record matched CH3CHO + ·CH → CH3CO + ·CH2
1 record matched CH3CHO + ·CH → CO + ·C2H5
1 record matched CH3CHO + ·CH → H2C=C=O + ·CH3
2 records matched CH3CHO + ·CH → CH2=CHCHO + H·
1 record matched CH3CHO + ·CH → C2H4 + HCO
1 record matched CH3CHO + HO2 → CH2=CHO· + H2O2
1 record matched CH3CHO + CH3CO → (CH3)2CO + HCO
1 record matched CH3CHO + (CH3)3CO· → tert-C4H9OH + *CH2C(O)H
1 record matched CH3CHO + (CH3)3CO· → tert-C4H9OH + CH3CO
1 record matched CH3CHO + Phenyl → Products
1 record matched CH3CHO + CH3C(O)OONO2 → Products
1 record matched CH3CHO + ·CH3 → CH4 + CH3CO
1 record matched CH3CHO + ·CH3 → CH4 + CH2=CHO·
1 record matched CH3CHO + ·CH3 → CH4 + *CH2C(O)H
14 records matched CH3CHO + ·CH3 → CH4 + CH3CO
2 records matched CH3CHO + ·CH3 → (CH3)2CO + H·
5 records matched CH3CHO + CH3O· → CH3OH + CH3CO
1 record matched CH3CHO + CH3O· → Products
1 record matched CH3CHO + ·C2H5 → C2H6 + CH3CO
14 records matched CH3CHO → ·CH3 + HCO
1 record matched CH3CHO → CO + ·CH3 + H·
1 record matched CH3CHO → CH2=CHOH
2 records matched CH3CHO → H2C=C=O + H2
2 records matched CH3CHO → CH4 + CO
1 record matched C2H4 + N2O → CH3CHO + N2
1 record matched n-C3H7OH + ·OH → Other Products + CH3CHO
1 record matched C2H5OH + O· → Other Products + CH3CHO
1 record matched Propanoic acid, 2-hydroxy- → CH3CHO + CO + H2O
2 records matched OH(v=1) + CH3CHO → Products
1 record matched C6H5OCH3CHCOOH → CH3CHO + Phenol
1 record matched CH3((CH3)2CH2O)CHCOOH → (CH3)2CH2OH + CH3CHO
1 record matched CH3(CH3CH2O)CHCOOH → C2H5OH + CH3CHO
1 record matched CH3(CH3O)CHCOOH → CH3OH + CH3CHO
2 records matched HOCH2CH(O)CH3 → CH3CHO + (·)CH2OH
2 records matched OCH(CH3)2 → CH3CHO + ·CH3
1 record matched O(3P) + C3H8 → CH3CHO + ·CH3 + H·
1 record matched O(3P) + C2H6 → CH3CHO + H· + H·
2 records matched CH3CHOCH2CH3 → CH3CHO + ·C2H5
1 record matched CH3CH(OH)CH2CN → CH3CN + CH3CHO
1 record matched 2-(4-nitrophenoxy)propanoic acid → CH3CHO + 4-Nitrophenol + CO
1 record matched 2-(4-chlorophenoxy)propanoic acid → CH3CHO + 4-Chlorophenol + CO
1 record matched 2-(3-chlorophenoxy)propanoic acid → CH3CHO + 3-Chlorophenol + CO
1 record matched 2-(4-methylphenoxy)propanoic acid → CH3CHO + 4-Methylphenol + CO
1 record matched 2-(4-methoxyphenoxy)propanoic acid → CH3CHO + 4-Methoxyphenol + CO
1 record matched 2-(N-phenylamino)propanoic acid → aniline + CH3CHO + CO
1 record matched 2-(phenylthio)propanoic acid → CH3CHO + Benzenethiol + CO
1 record matched CH3CH(OH)O2 → CH3CHO + HO2
1 record matched NCO(X2PI) + ·C2H5 → HCN + CH3CHO
2 records matched CH3CHBrO(·) → CH3CHO + Br·
2 records matched CH3C(O)CH(O·)CH3 → CH3CHO + CH3CO
2 records matched (CH3)2CHCH(CH3)O → CH3CHO + iso-C3H7
1 record matched Oxiranone, methyl- → CH3CHO + CO
3 records matched CH3CH2CH(CH3)O· → CH3CHO + ·C2H5
1 record matched O3 + CH3CH(·)OO· → CH3CHO + O2 + O2
1 record matched CH3C(OH)HC(NO2)HCH2CH3 → CH3CHO + 1-nitropropane
3 records matched i-C3H7O → CH3CHO + ·CH3
1 record matched CH3CO + HBr → CH3CHO + Br·
1 record matched C2H5OO· + BrO → HOOBr + CH3CHO
1 record matched C2H5OO· + HO2 → CH3CHO + H2O + O2
2 records matched C2H5OO· → CH3CHO + ·OH
1 record matched CH3CH2OOH → CH3CHO + H2O
1 record matched 1,3-Dioxolane, 2,2-dimethyl- → (CH3)2CO + CH3CHO
3 records matched CH3CHOH + H· → CH3CHO + H2
2 records matched CH3CHOH + O2 → CH3CHO + HO2
6 records matched CH3CHOH → CH3CHO + H·
1 record matched 2-C4H9O → CH3CHO + ·C2H5
1 record matched Oxetane, 2-methyl- → C2H4 + CH3CHO
2 records matched CH3CH2O· + H· → CH3CHO + H2
1 record matched CH3CH2O· + NO2 → CH3CHO + HNO2
1 record matched CH3CH2O· + NO → CH3CHO + HNO
12 records matched CH3CH2O· → CH3CHO + H·
1 record matched ·C2H5 + O· → CH3CHO + H·
1 record matched iso-C3H7 + O· → CH3CHO + ·CH3
1 record matched CH2=CHCH(CH3)CH(OH)CH3 → CH3CHO + CH3CH=CHCH3
1 record matched Ethylene glycol monovinyl ether + H· → CH3CHO + HOCH2CH2
3 records matched Ethylene glycol monovinyl ether → CH3CHO + CH2=CHOH
1 record matched Benzeneethanol, α-methyl- → CH3CHO + 5-Methylene 1,3-cyclohexadiene
1 record matched CH2=CHCH2CH(OH)CH3 → CH3CHO + CH3CH=CH2
1 record matched CH2=CHOH + HO2 → CH3CHO + HO2
2 records matched CH2=CHOH → CH3CHO
1 record matched 1,3-Dioxolane, 2-methyl- → CH3CHO + CH3CHO
1 record matched Cyclopentanone ethylene ketal → CH3CHO + Cyclopentanone
1 record matched CH3CH=CH2 + O3 → CH3CHO + CH2OO
1 record matched CH3CH=CH2 + ·OH → CH3CHO + ·CH3
1 record matched CH3CH=CH2 + CH3CO → CH3CHO + ·CH2CH=CH2
1 record matched C2H5ONO → CH3CHO + HNO
2 records matched CH2=CHOC2H5 → C2H4 + CH3CHO
2 records matched HOCH2CH2OH → CH3CHO + H2O
1 record matched Oxirane + H· → CH3CHO + H·
2 records matched Oxirane → CH3CHO
1 record matched CH3CHO + CH3C(O)OO(·) → CH3C(O)OOH + CH3CO
1 record matched CH3CHO + HOCH → Products
2 records matched CH3CHO + O· → CH3CO + ·OH
1 record matched CH3CHO + O· → Other Products + ·OH
1 record matched CH3CHO + D → CH3CH(·)OD
1 record matched CH3CHO + D → HD + CH3CO
1 record matched CH3CHO + D → CH2=CHO· + HD
1 record matched CH3CHO + D → CH3CHDO·
2 records matched CH3CHO + H· → CH3CHOH
4 records matched CH3CHO + H· → CH3CH2
1 record matched CH3CHO + H· → H2 + CH3CO
1 record matched CH3CHO + H· → H2 + CH2=CHO·
1 record matched CH3CHO + H· → H2 + CH3CO
1 record matched CH3CHO + NO3 → Products
2 records matched CH3CHO + O3 → HO3 + *CH2C(O)H
2 records matched CH3CHO + O3 → HO3 + CH3CO
1 record matched CH3CHO + O2 → Products
1 record matched CH3CHO + Br2 → CH3COBr + HBr
1 record matched CH3CHO + *CH2C(O)H → CH3CHO + CH3CO
1 record matched CH3CHO + ·OH → H2O + CH3CO
2 records matched CH3CHO + ·OH → *CH2C(O)H + H2O
1 record matched CH3CHO + ·OH → CH3CO + H2O
1 record matched CH3CHO + ·OH → CH3C(O)OH + H·
1 record matched CH3CHO + ·OH → HCOOH + ·CH3
1 record matched CH3CHO + ·OH → Adduct
1 record matched CH3CHO + ·OH → Products
1 record matched CH3CHO + HO2 → CH2=CHO· + H2O2
2 records matched CH3CHO + HO2 → CH3CO + H2O2
1 record matched CH3CHO + HO2 → CH3CHOH + O2
1 record matched CH3CHO + HO2 → CH3CH(O·)OOH
1 record matched CH3CHO + HO2 → [CH3CHO…HO2] complex
1 record matched CH3CHO + HO2 → CH3CH(OH)O2
1 record matched CH3CHO + C2H3 → C2H4 + CH3CO
1 record matched CH3CHO + C2H3 → CH2=CHCH(CH3)O
1 record matched CH3CHO + HCO → CH4 + CO + HCO
1 record matched CH3CHO + Phenyl → Benzaldehyde + ·CH3
1 record matched CH3CHO + Phenyl → 1-Phenylethanone + H·
1 record matched CH3CHO + Phenyl → Benzene + CH3CO
1 record matched CH3CHO + Phenyl → Benzene + CH2=CHO·
2 records matched CH3CHO + ·CH3 → i-C3H7O
3 records matched CH3CHO + ·CH3 → CH4 + CH3CO
1 record matched CH3CHO + CH3CH2O· → 2-C4H9O
1 record matched CH3CHO + n-C3H7 → CH3(CH2)2CH(CH3)O
1 record matched CH3CHO + ·C2H5 → CH3CH2CH(CH3)O·
1 record matched CH3CHO + ·C2H5 → C2H5OCH2CH2
1 record matched CH3CHO + ·C2H5 → CH3CHOCH2CH3
1 record matched CH3CHO + iso-C3H7 → (CH3)2CHCH(CH3)O
1 record matched CH3CHO + ·CH2CH=CH2 → CH3CH=CH2 + CH3CO
1 record matched CH3CHO + (CH3)2CHC(CH3)=CH2 → (CH3)2C=C(CH3)CH2CH(CH3)OH
1 record matched CH3CHO + (CH3)2CHCH=CH2 → (CH3)2C=CHCH2CH(OH)CH3
1 record matched CH3CHO + CH3CH=CH2 → CH2=CHCH2CH(OH)CH3
1 record matched CH3CHO + CH3CH=CHC2H5 → (CH3)CH=CHCH(CH3)CH(CH3)OH
1 record matched CH3CHO + CH3CH=CHCH3 → CH2=CHCH(CH3)CH(OH)CH3
1 record matched CH3CHO + 1-C4H8 → CH3CH=CHCH2CH(OH)CH3
1 record matched CH3CHO + CH3CHO → CH3CHOH + CH3CO
2 records matched CH3CHO → ·CH3 + HCO
1 record matched C2H4 + O· → CH3CHO
4 records matched iso-C3H7OH → CH4 + CH3CHO
1 record matched Propanoic acid, 2-hydroxy- → CH3CHO + CO + H2O
1 record matched CH3CHClO· → CH3CHO + Cl
7 records matched HOCH2CH(O)CH3 → CH3CHO + (·)CH2OH
1 record matched nitrate + CH3CHO → Products
1 record matched O(1D) + C2H5F → CH3CHO + HF
2 records matched CH3CHOCH2CH3 → CH3CHO + ·C2H5
1 record matched H2C=CHOOH → CH3CHO + O·
1 record matched HOC(CH3)2CH2NO2 → CH3CHO + C2H5NO2
5 records matched ClCH2CH(O)CH3 → CH3CHO + ·CH2Cl
1 record matched CH3C(=CH2)CH2CH(CH3)O· → CH3CHO + CH2C(CH3)=CH2
1 record matched CH3CHI + O2 → CH3CHO + IO
1 record matched CH3CH=CHCH2CH(OH)CH3 → CH3CHO + 1-C4H8
1 record matched (CH3)2C=C(CH3)CH2CH(CH3)OH → CH3CHO + (CH3)2CHC(CH3)=CH2
1 record matched (CH3)CH=CHCH(CH3)CH(CH3)OH → CH3CHO + CH3CH=CHC2H5
1 record matched CH3CH(O·)OOH → CH3CHO + HO2
1 record matched [CH3CHO…HO2] complex → CH3CHO + HO2
1 record matched HC(O)OCH(CH3)O· → CH3CHO + HCOO
1 record matched ·CH2CH(CH3)CH(CH3)OOH → CH3CHO + CH3CH=CH2 + ·OH
1 record matched CH3CH(·)CH2CH(CH3)OOH → CH3CHO + CH3CH=CH2 + ·OH
1 record matched CH3OCH(·)CH3 → CH3CHO + ·CH3
1 record matched CH3CH(·)OCH2CH2CH3 → CH3CHO + n-C3H7
1 record matched CH3CH(·)OCH2CH(CH3)2 → CH3CHO + iso-C4H9
1 record matched CH3CH(·)OC(CH3)3 → CH3CHO + tert-C4H9
1 record matched CH3CH(O·)CH2CH2CH2CH3 → CH3CHO + n-C4H9
6 records matched 2-pentoxy radical → CH3CHO + n-C3H7
1 record matched C2H5C(O)CH(O·)CH3 → CH3CHO + CH3CH2CO
1 record matched CH2=CHCH(CH3)O → CH3CHO + C2H3
2 records matched CH3CH(OH)O2 → CH3CHO + HO2
1 record matched (CH3)2C=CHCH2CH(OH)CH3 → CH3CHO + (CH3)2CHCH=CH2
1 record matched CH3CHO + Y → CO + YH(CH3)

Search returned 671 records.