Kinetics Database Logo

Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences


Rate Our Products and Services


Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty


Administrative Links

NIST home page

MML home page

Chemical and Biochemical Reference Data Division

MML home page

Chemical and Biochemical Reference Data Division

  NIST Logo Home
©NIST, 2013
Accessibility information

Search Results

Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
1 record matched H2 + SiHCl → HCl + SiH2
1 record matched (CH3)2CClCH2Cl → CH2=C(CH3)CH2Cl + HCl
1 record matched CH2=C=CH2 + Cl → CH2=C=CH + HCl
1 record matched HCN + SiH3Cl → HCl + SiH3CN
4 records matched Cl + CH3CCl2F → ·CH2CCl2F + HCl
1 record matched HOONO + Cl → HCl + NO3
1 record matched HBr + Cl → HCl + Br·
7 records matched H2S + Cl → HCl + SH
1 record matched Cl2 + H· → HCl + Cl
1 record matched H2O + Cl → ·OH + HCl
8 records matched H2O2 + Cl → HO2 + HCl
4 records matched HNO3 + Cl → HCl + NO3
1 record matched HCl + HO2NO2 → HNO3 + HOCl
1 record matched HCl + HO2NO2 → Products
1 record matched HCl + Cl → Cl2 + H·
5 records matched HCl + O· → ·OH + Cl
1 record matched HCl + ·F → HF + Cl
1 record matched HCl + ClONO2 → HNO3 + Cl2
2 records matched HCl + ClONO2 → Products
2 records matched HCl + NaO → Products
3 records matched HCl + H· → H2 + Cl
2 records matched HCl + NaO2 → Products
5 records matched HCl + NO3 → HNO3 + Cl
1 record matched HCl → H· + Cl
1 record matched ·OH + Cl → HCl + O·
1 record matched ·OH + ClO → HCl + O2
10 records matched ·OH + HCl → H2O + Cl
1 record matched ·OH + HCl → Products
9 records matched HO2 + Cl → HCl + O2
1 record matched HO2 + ClO → HCl + O3
1 record matched C2H5OO· + Cl → HCl + CH3CH(·)OO·
1 record matched C2H5OO· + Cl → Other Products + HCl
2 records matched CH3OOH + Cl → Other Products + HCl
4 records matched CF3CHFCl + Cl → CF3CFCl· + HCl
1 record matched NOCl + H· → HCl + NO
1 record matched C2H3 + HCl → Products
3 records matched HC(O)Cl + Cl → ClCO + HCl
1 record matched Phenyl + HCl → Benzene + Cl
1 record matched ·CF3 + HCl → CHF3 + Cl
2 records matched ·CH3 + HCl → CH4 + Cl
1 record matched CH3O2· + Cl → HCl + CH2OO
2 records matched (CH3)2CHONO2 + Cl → Other Products + HCl
13 records matched H2 + Cl → HCl + H·
2 records matched NaOH + HCl → NaCl + H2O
4 records matched CF3CH2F + Cl → HCl + CF3CHF
2 records matched C2H5ONO2 + Cl → Other Products + HCl
4 records matched CH2FCH2F + Cl → HCl + CH2FCHF
2 records matched CH3ONO2 + Cl → Other Products + HCl
4 records matched CH2FCl + Cl → HCl + ·CClFH
4 records matched CH3F + Cl → ·CH2F + HCl
4 records matched CH2FCHF2 + Cl → HCl + CHF2C(·)HF
4 records matched CH2FCHF2 + Cl → HCl + CH2FC(·)F2
4 records matched CH3CF3 + Cl → CF3CH2 + HCl
4 records matched CHF2CHF2 + Cl → HCl + CHF2CF2
4 records matched C2F5H + Cl → C2F5 + HCl
5 records matched C2H5F + Cl → HCl + CH3C(·)HF
3 records matched C2H5F + Cl → HCl + CH2CH2F
4 records matched CF3CHCl2 + Cl → HCl + CF3CCl2
2 records matched C2H5CHO + Cl → Other Products + HCl
1 record matched CH2ClCH2Cl → CH2=CHCl + HCl
1 record matched n-C4H10 + Cl → n-C4H9 + HCl
2 records matched CF3CH2Cl + Cl → HCl + CF3CHCl
4 records matched CH3CF2Cl + Cl → CF2ClCH2· + HCl
2 records matched CHF3 + Cl → ·CF3 + HCl
4 records matched CHF2Cl + Cl → ·CClF2 + HCl
4 records matched CHFCl2 + Cl → ·CCl2F + HCl
4 records matched CH3CHF2 + Cl → HCl + CH2CHF2
4 records matched CH3CHF2 + Cl → HCl + CH3CF2
4 records matched CH2F2 + Cl → ·CHF2 + HCl
6 records matched CH2Cl2 + Cl → CHCl2 + HCl
4 records matched CH3CHO + Cl → CH3CO + HCl
1 record matched C3H8 + Cl → n-C3H7 + HCl
5 records matched C3H8 + Cl → Other Products + HCl
2 records matched CH2ClBr + Cl → HCl + ·CHBrCl
2 records matched CH2Br2 + Cl → HCl + CHBr2
2 records matched CH3SH + Cl → CH3S· + HCl
7 records matched CH3Cl + Cl → ·CH2Cl + HCl
12 records matched C2H6 + Cl → ·C2H5 + HCl
2 records matched CH3Br + Cl → HCl + ·CH2Br
10 records matched CH4 + Cl → ·CH3 + HCl
6 records matched CH3CCl3 + Cl → HCl + CCl3CH2
1 record matched Benzene + Cl → Phenyl + HCl
2 records matched n-C3H7OH + Cl → Other Products + HCl
2 records matched (CH3)2SO + Cl → CH3SCH2O· + HCl
6 records matched CHCl3 + Cl → ·CCl3 + HCl
3 records matched (CH3)2CO + Cl → CH3C(O)CH2(·) + HCl
2 records matched iso-C3H7OH + Cl → Other Products + HCl
5 records matched CH3OH + Cl → (·)CH2OH + HCl
2 records matched CH3C(O)OH + Cl → Other Products + HCl
2 records matched HCOOH + Cl → Other Products + HCl
2 records matched C2H5OH + Cl → Other Products + HCl
6 records matched CH2O + Cl → HCO + HCl
2 records matched O(1D) + HCl → Products
3 records matched CH2ClO → HCO + HCl
1 record matched Phenol, 2-(2-chloroethyl)- → Phenol, 2-ethenyl- + HCl
1 record matched Phenol, 2-(2-chloroethyl)- → Benzofuran, 2,3-dihydro + HCl
1 record matched Phenol, 2-(2-chloroethyl)- → Other Products + HCl
1 record matched Cyclopentane, 2-chloroethyl- → Cyclopentane, ethenyl- + HCl
1 record matched CH3(CH2)4CHClCHCl(CH2)4CH3 → Other Products + HCl
1 record matched Benzene, 1-(2-chloroethyl)-3-methoxy- → Benzene, 1-ethenyl-3-methoxy- + HCl
1 record matched Benzene, 1-(3-chloropropyl)-2-methoxy- → Benzene, 1-methoxy-2-(2-propenyl)- + HCl
1 record matched 1-Heptene, 2-chloro- → CH2=C=CHCH2CH2CH2CH3 + HCl
1 record matched Heptane, 2,2-dichloro- → Other Products + HCl
1 record matched (CH3)2CHCH2CH2CH2Cl → (CH3)2CHCH2CH=CH2 + HCl
1 record matched C2H5CH(CH3)CH2CH2Cl → C2H5CH(CH3)CH=CH2 + HCl
1 record matched Benzene, 1-(3-chloropropyl)-4-methoxy- → Benzene, 1-methoxy-4-(2-propenyl)- + HCl
1 record matched Sarcosine ethyl ester hydrochloride → Other Products + HCl
1 record matched CH3(CH2)7CCl(CH3)CH2CH3 → Other Products + HCl
1 record matched Benzene, 1-(2-chloroethyl)-2-methoxy- → Benzene, 1-ethenyl-2-methoxy- + HCl
1 record matched CH3(CH2)4CHClCH2CHCl(CH2)3CH3 → Other Products + HCl
1 record matched Cylohexane, 2-chloro-4-methyl-1-(1-methylethyl)-, (1α, 2β, 4β)- → Other Products + HCl
1 record matched CH3CHClCH2C(O)CH3 → CH3CH=CHC(=O)CH3 (unspecified) + HCl
1 record matched CHD2CD2Cl → C2D4 + HCl
2 records matched CH3CCl2F → CH2=CFCl + HCl
2 records matched CH2DCH2Cl → CH2=CHD + HCl
1 record matched C2H5CH(CH2Cl)2 → HCl + CH2=C(CH2Cl)CH2CH3
1 record matched C2H5CCl(CH3)CH2Cl → Other Products + HCl
1 record matched Benzene, 1-(4-chlorobutyl)-4-methoxy- → HCl + Benzene, 1-(3-butenyl)-4-methoxy-
1 record matched Cl + C3F7CF(OC2H5)CF(CF3)2 → Products + HCl
4 records matched Cl + CH3OC4F9 → CH2OC4F9 + HCl
2 records matched Cl + CH2FOOH → HCl + CH2FO2
2 records matched Cl + CHD2CH2Cl → CHD2CHCl(.) + HCl
1 record matched Cl + CD3CHCl2 → Other Products + HCl
2 records matched Cl + CF3CHClOCH2CH3 → Other Products + HCl
2 records matched Cl + 2,2-Dichloroethyl methyl ether → Other Products + HCl
1 record matched Cl + CHF2OCHClCF3 → Other Products + HCl
8 records matched Cl + CH3CCl2F → ·CH2CCl2F + HCl
2 records matched Cl + CH2DCH2Cl → Other Products + HCl
2 records matched Cl + CH2DCH2Cl → CH2DCHCl(.) + HCl
1 record matched (CH3)2CClC(O)OCH3 → CH2=C(CH3)COOCH3 + HCl
1 record matched Benzonitrile, 4-(1-chloroethyl)- → Benzonitrile, 4-ethenyl- + HCl
1 record matched Benzene, 1-bromo-4-(1-chloroethyl)- → Benzene, 1-bromo-4-ethenyl- + HCl
1 record matched Benzene, 1-chloro-4-(1-chloroethyl)- → Benzene, 1-chloro-4-ethenyl- + HCl
1 record matched Benzene, 1-1(1-chloroethyl)-3-methyl- → 3-Methylstyrene + HCl
2 records matched CD3CHO + Cl → HCl + CD3CO
1 record matched HOCH + Cl → HCO + HCl
1 record matched CH3OCH2CH2CH2CH2Cl → CH2=CHCH2CH2OCH3 + HCl
1 record matched (CH3)2CHCCl2CH3 → HCl + CH2=C(Cl)CH(CH3)2
1 record matched CH3CHClC(O)OCH3 → CH2=CHCOOCH3 + HCl
1 record matched CH3CHClSi(C2H5)2Cl → HCl + CH2=CHSi(C2H5)2Cl
1 record matched CH3CHCl + Cl → CH2=CHCl + HCl
1 record matched ·CH2Br + CD2Cl → CD2=CHBr + HCl
1 record matched Benzene,(5-chloropentyl)- → Benzene,(4-pentenyl)- + HCl
2 records matched ClCH2OH + Cl → ClCH(·)OH + HCl
1 record matched ClCH2OH → CH2O + HCl
1 record matched ClCH2(CH2)3C(O)OCH3 → CH2=CHCH2CH2C(O)OCH3 + HCl
2 records matched HD + Cl → HCl + D
2 records matched SH + Cl → HCl + S
1 record matched CHF2OCF2CHFCl + Cl → Other Products + HCl
1 record matched NH2 + Cl → HCl + NH
1 record matched CH2ClC(CH3)2COOH → iso-C4H8 + CO2 + HCl
2 records matched AlHCl2 → HCl + AlCl
2 records matched SiH3Cl + Cl → HCl + SiH2Cl
1 record matched ClCH2C(CH3)2CH2OH → CH2O + iso-C4H8 + HCl
1 record matched 2-Pentanone, 3-chloro- → CH3CH=CHC(=O)CH3 (unspecified) + HCl
1 record matched CH3CHCl(CH2)2CHClCH3 → Other Products + HCl
3 records matched (CH3)3CD + Cl → HCl + (CH3)2CDC(·)H2
1 record matched CH3OCH2I + Cl → Other Products + HCl
1 record matched BrCH2OCH3 + Cl → Other Products + HCl
1 record matched H· + CH2Cl-I → ·CH2Cl + HCl
1 record matched H· + NCl2 → HCl + NCl
1 record matched H· + CF3OCl → HCl + CF3O
1 record matched H· + NFCl2 → HCl + NClF
1 record matched H· + Cl2CrO2 → HCl + CrClO2
1 record matched SCl2 + H· → HCl + SCl
1 record matched CH2=C(CH3)CH2CH2Cl → CH2=C(CH3)CH=CH2 + HCl
1 record matched BCl3 + H· → HCl + BCl2
13 records matched HBr + Cl → HCl + Br·
1 record matched HBr + BrCl → HCl + Br2
9 records matched HI + Cl → HCl + I
1 record matched SiCl4 + H· → HCl + SiCl3
1 record matched NCl3 + H· → HCl + NCl2
3 records matched SiHCl3 + Cl → HCl + SiCl3
2 records matched SiHCl3 → HCl + SiCl2
1 record matched S2Cl2 + H· → HCl + Sulfurchloride
9 records matched SiH4 + Cl → HCl + SiH3
4 records matched PH3 + Cl → HCl + PH2
1 record matched SO2Cl2 + H· → HCl + ClSO2
2 records matched Cl2O + H· → HCl + ClO
2 records matched ICl + H· → HCl + I
1 record matched HOCl + H· → ·OH + HCl
3 records matched ClF + H· → HCl + ·F
1 record matched AsH3 + Cl → HCl + AsH2·
9 records matched H2S + Cl → HCl + SH
8 records matched HN3 + Cl → HCl + ·N3
2 records matched GeH4 + Cl → HCl + GeH3
1 record matched Cl2 + CH2ClCHCl· → HCl + CH2ClCCl2·
14 records matched Cl2 + H· → HCl + Cl
1 record matched Cl2 + H· → HCl + H·
2 records matched Cl2 + HBr → HCl + BrCl
1 record matched VOCl3 + H· → HCl + vanadium oxydichloride
7 records matched H2O2 + Cl → HO2 + HCl
2 records matched PCl3 + H· → HCl + PCl2
1 record matched SOCl2 + H· → HCl + OSCl
2 records matched SOCl2 + H2O → SO2 + HCl + HCl
1 record matched ClCH2CH2CH=C(CH3)2 → Other Products + HCl
1 record matched DCl + H· → HCl + D
7 records matched HNO3 + Cl → HCl + NO3
2 records matched NH3 + Cl → HCl + NH2
1 record matched NH3 + BCl3 → HCl + Cl2B.NH2
1 record matched NaCl + H· → Na + HCl
1 record matched HCl + CH3GeH → Products
1 record matched HCl + ·CH2 → ·CH3 + Cl
1 record matched HCl + CH2=CCl → CH2=CHCl + Cl
1 record matched HCl + CBrF2 → CHBrF2 + Cl
1 record matched HCl + HO2NO2 → HNO3 + HOCl
1 record matched HCl + CH3Sn(·)CH3 → Products
1 record matched HCl + Cl → HCl + Cl
1 record matched HCl + BCl → H· + BCl2
1 record matched HCl + N → Products
9 records matched HCl + O· → ·OH + Cl
3 records matched HCl + D → HD + Cl
3 records matched HCl + D → DCl + H·
1 record matched HCl + D → Products
10 records matched HCl + ·F → HF + Cl
4 records matched HCl + ClONO2 → HNO3 + Cl2
2 records matched HCl + ClONO2 → Products
1 record matched HCl + AlO → Products
1 record matched HCl + SiHCl → Products
1 record matched HCl + SiH2 → SiH3Cl
2 records matched HCl + SiH2 → Products
1 record matched HCl + SiH3 → SiH4 + Cl
1 record matched HCl + AlCl → H· + AlCl2
2 records matched HCl + OD → HDO + Cl
1 record matched HCl + NaO → ·OH + NaCl
13 records matched HCl + H· → H2 + Cl
1 record matched HCl + NaO2 → HO2 + NaCl
3 records matched HCl + NO3 → HNO3 + Cl
1 record matched HCl + NO2 → HNO2 + Cl
1 record matched HCl + NO → HNO + Cl
3 records matched HCl + N2O5 → HNO3 + ClNO2
1 record matched HCl + O3 → O2 + HOCl
1 record matched HCl + FNO → NOCl + HF
1 record matched HCl + D2 → DCl + HD
6 records matched HCl → H· + Cl
1 record matched SnCl4 + H· → HCl + Stannyl, trichloro-
1 record matched CH3CHClCHClCH3 → Other Products + HCl
1 record matched TiCl4 + H· → HCl + titanium(III) chloride
1 record matched Cu + HCl → Products
1 record matched Cr + HCl → Products
1 record matched Cs + HCl → CsCl + H·
2 records matched Cd + HCl → Products
2 records matched Na + HCl → NaCl + H·
2 records matched Si + HCl → H· + SiCl
2 records matched K + HCl → KCl + H·
1 record matched Li + HCl → LiCl + H·
1 record matched Pb + HCl → H· + PbCl
1 record matched Al + HCl → H· + AlCl
1 record matched CH3CHClOCH2CH3 → CH2=CHOC2H5 + HCl
1 record matched ·CH2Cl + N → HNC + HCl
1 record matched ·CH2Cl + N → HCN + HCl
1 record matched ·CH2Cl + O· → CO + HCl + H·
1 record matched ·CH2Cl + ·CH2Br → CH2=CHBr + HCl
1 record matched ·CH2Cl + ·CH2Cl → CH3Cl + HCl
1 record matched 2-Hexene, 4-chloro- → CH3CH=CHCH=CHCH3 + HCl
2 records matched Ethane, 1-bromo-2-methoxy- + Cl → Other Products + HCl
1 record matched CH3CH=CHCH2OH + Cl → CH3CH=CHCH(·)OH + HCl
1 record matched Propanoic acid, 3-chloro-, methyl ester → CH2=CHCOOCH3 + HCl
1 record matched Heptane, 3-chloro-3-methyl- → Other Products + HCl
1 record matched 1-Butene, 3-chloro-2-methyl- → CH2=C(CH3)CH=CH2 + HCl
1 record matched Benzene,(4-chlorobutyl)- → 4-Phenyl-1-butene + HCl
1 record matched Butane, 2,2-dichloro- → Other Products + HCl
1 record matched C2H5CHClCOOH → C2H5CHO + CO + HCl
2 records matched (CH3)2NNO2 + Cl → Other Products + HCl
2 records matched (CH3)2Si=CH2 + HCl → (CH3)3SiCl
2 records matched SiH2Cl2 + Cl → HCl + SiHCl2
1 record matched 2-Butanone, 3-chloro- → CH2=CHCOCH3 + HCl
1 record matched ·CH2F + HCl → CH3F + Cl
1 record matched CH3CD2Cl + Cl → ·CH2CD2Cl + HCl
1 record matched CH3CD2Cl → CH2=CD2 + HCl
2 records matched CH3CHDCl + Cl → ·CH2CHClD + HCl
3 records matched CH3CHDCl + Cl → CH3CDCl· + HCl
1 record matched CHCl2 + O· → CO + HCl + Cl
1 record matched CHCl2 + H· → ·CHCl + HCl
1 record matched CHCl2 + NO2 → ClCO + HCl + NO
1 record matched CHCl2 + NO2 → ClNO + CO + HCl
1 record matched C2F5 + HCl → C2F5H + Cl
7 records matched ·OH + ClO → HCl + O2
17 records matched ·OH + HCl → H2O + Cl
1 record matched ·OH + HCl → Products
1 record matched HC(13)HO + Cl → HCO + HCl
1 record matched L-Phenylalanine ethyl ester hydrochloride → Other Products + HCl
12 records matched HO2 + Cl → HCl + O2
2 records matched HO2 + ClO → HCl + O3
2 records matched ·CCl3 + HCl → CHCl3 + Cl
1 record matched ·CCl3 + HOCH2CH2 → CCl2=CHCH2OH + HCl
1 record matched CH3CO + Cl → H2C=C=O + HCl
1 record matched C2H5OO· + Cl → Other Products + HCl
1 record matched ClCH2(CH2)2C(O)OCH3 → CH2=CHCH2C(O)OCH3 + HCl
2 records matched CH3OOH + Cl → Other Products + HCl
1 record matched CD3CH2CD3 + Cl → Other Products + HCl
2 records matched CH3CD2CH3 + Cl → HCl + CH3CD2CH2
1 record matched Butane, 1-chloro-3,3-dimethyl- → (CH3)3CCH=CH2 + HCl
3 records matched CF3CHFCl + Cl → CF3CFCl· + HCl
1 record matched CF3CHFCl → C2F4 + HCl
6 records matched NOCl + H· → HCl + NO
1 record matched NOCl + H2O → HCl + HNO2
1 record matched C2H3 + Cl → C2H2 + HCl
1 record matched C2H3 + HCl → CH2CH2Cl
4 records matched C2H3 + HCl → C2H4 + Cl
1 record matched (·)CH2OH + Cl → CH2O + HCl
1 record matched (·)CH2OH + HCl → CH3OH + Cl
9 records matched HC(O)Cl + Cl → ClCO + HCl
1 record matched 3-Heptene, 4-chloro- → 3,4-Heptadiene + HCl
1 record matched Benzene, 1-(1-chloroethyl)-4-methyl- → 4-Methylstyrene + HCl
1 record matched CH3(CH2)7CHClCH2CH2CH3 → Other Products + HCl
3 records matched ·CF3 + HCl → CHF3 + Cl
3 records matched C2F5CF2H + Cl → n-C3F7 + HCl
1 record matched CF3CH2CH2OH + Cl → Products + HCl
12 records matched ·CH3 + HCl → CH4 + Cl
1 record matched 3-Methyl-3-chloro-1-butene → CH2=C(CH3)CH=CH2 + HCl
1 record matched Hexane, 1,6-dichloro- → 1-Hexene, 6-chloro- + HCl
1 record matched 1,10-Dichlorodecane → ClCH2(CH2)7CH=CH2 + HCl
1 record matched Hexane, 1,2-dichloro- → Other Products + HCl
5 records matched ·CF2 + HCl → CHF2Cl
2 records matched CH3O· + Cl → CH2O + HCl
3 records matched CH3O2· + Cl → HCl + CH2OO
2 records matched CD3 + HCl → CHD3 + Cl
1 record matched ·CHCl + NO → HCl + NCO
5 records matched ·C2H5 + Cl → C2H4 + HCl
1 record matched CH3CHClCH2COOH → CH3CH=CH2 + CO2 + HCl
1 record matched CF3CH2OCHF2 + Cl → Other Products + HCl
1 record matched CH2=NCH3 + Cl → HCl + CH2=NCH2
2 records matched (CH3)2CHONO2 + Cl → Other Products + HCl
1 record matched ·CCl2F + ·CH2F → CFCl=CHF + HCl
1 record matched ·CClF2 + HCl → CHF2Cl + Cl
1 record matched ·CClF2 + ·CH2Cl → CF2=CHCl + HCl
1 record matched ·CClF + HCl → CHFCl2
6 records matched CHF2-O-CHF2 + Cl → CHF2OCF2· + HCl
2 records matched CF2ClCH2Cl + Cl → Other Products + HCl
2 records matched tert-C4H9OCH3 + Cl → Other Products + HCl
1 record matched CH3CHClCN → CH2CHCN + HCl
4 records matched Ethane, 1-chloro-1-fluoro- + Cl → Other Products + HCl
2 records matched Ethane, 1-chloro-1-fluoro- → CH2=CHF + HCl
1 record matched tert-C4H9 + ·CH2Cl → C2H5C(CH3)=CH2 + HCl
1 record matched tert-C4H9 + ·CH2Cl → (CH3)2C=CHCH3 + HCl
1 record matched Benzene, 1-(2-chloroethyl)-4-ethoxy- → Benzene, 1-ethenyl-4-methoxy- + HCl
1 record matched CH3CH(Cl)OCH3 → CH2=CHOCH3 + HCl
3 records matched CHBrF2 + Cl → HCl + CBrF2
6 records matched HFCO + Cl → FCO + HCl
1 record matched CH3OD + Cl → HCl + CH2OD
16 records matched H2 + Cl → HCl + H·
2 records matched H2 + ClO → ·OH + HCl
1 record matched H2 + DCl → HCl + HD
3 records matched cyclobutyl chloride → 1,3-Butadiene + HCl
1 record matched ClCH2(CH2)3COOH → 2H-Pyran-2-one, tetrahydro- + HCl
1 record matched Cyclohexane, 2-chloroethyl- → Cyclohexane, ethenyl- + HCl
1 record matched Nitric acid, pentyl ester + Cl → Other Products + HCl
5 records matched Cyclopentane, chloro- → Cyclopentene + HCl
1 record matched 1-Hexene, 6-chloro- → CH2=CHCH2CH2CH=CH2 + HCl
1 record matched ClCH2(CH2)2CH2OH → CH2=CHCH2CH2OH + HCl
1 record matched ClCH2(CH2)2CH2OH → Tetrahydrofuran + HCl
1 record matched ClCH2(CH2)2CH2OH → Other Products + HCl
1 record matched 1-Pentene, 5-chloro- → CH2=CHCH2CH=CH2 + HCl
1 record matched n-C4H9ONO2 + Cl → Other Products + HCl
2 records matched ClCH2CH2CH=CH2 → 1,3-Butadiene + HCl
1 record matched C2H5OD + Cl → Products + HCl
1 record matched CH3CH2C(CH3)ClCH2CH3 → CH3CH=C(CH3)C2H5 + HCl
1 record matched Butane, 2-chloro-2,3,3-trimethyl- → (CH3)3CC(CH3)=CH2 + HCl
1 record matched CH3CHClCCl3 → Other Products + HCl
9 records matched CF3CH2F + Cl → HCl + CF3CHF
1 record matched n-C3H7OCH=CH2 + Cl → Products + HCl
3 records matched Ethane, 1-chloro-2-fluoro- → CH2=CHF + HCl
1 record matched ClCH2CH2CH2CHClCH2CH2CH2Cl → Other Products + HCl
4 records matched t-C4H9CH2Cl → Other Products + HCl
1 record matched (n-C5H11)2O + Cl → Other Products + HCl
4 records matched Propane, 1,1,1,3,3,3-hexafluoro- + Cl → HCl + (CF3)2CH·
1 record matched (CH3O)2 + Cl → ·CH2OOCH3 + HCl
2 records matched Propane, 1,1,1,2,2,3-hexafluoro- + Cl → CF3CF2CHF· + HCl
1 record matched CH2D2 + Cl2 → CHD2Cl + HCl
1 record matched Benzene, (1-chloroethyl)- → Styrene + HCl
5 records matched CH2ClCCl3 + Cl → HCl + CCl3CHCl
2 records matched 2,2-dimethylpropanal + Cl → HCl + (CH3)3CC(O)·
1 record matched CH3(CH2)5CHClCH3 → Other Products + HCl
1 record matched 1,4-Cyclohexadiene + Cl → HCl + Cyclohexadienyl
1 record matched n-C4H9OCH3 + Cl → CH3CH2CH2CH(1)OCH3 + HCl
1 record matched n-C4H9OCH3 + Cl → CH3CH2CH(·)CH2OCH3 + HCl
1 record matched n-C4H9OCH3 + Cl → CH3CH(·)CH2CH2OCH3 + HCl
2 records matched 2-Chloroethyl methyl ether + Cl → Other Products + HCl
1 record matched 2-Chloroethyl methyl ether → CH2=CHOCH3 + HCl
1 record matched n-C3H7ONO2 + Cl → Other Products + HCl
1 record matched Cl(CH2)3COOH → 2(3H)-Furanone, dihydro- + HCl
2 records matched CH3CHClCH2CHClCH3 → Other Products + HCl
1 record matched (CH3)2CHCH2CHCl2 → HCl + (CH3)2CHCH=CHCl
3 records matched C2H5ONO2 + Cl → Other Products + HCl
1 record matched n-C3H7CHClCH3 → Other Products + HCl
1 record matched (CH3)2CClCH2CH2Cl → Other Products + HCl
2 records matched (CH3S)2 + Cl → HCl + CH3SSCH2
4 records matched CH2FCH2F + Cl → HCl + CH2FCHF
1 record matched ClCH2CH2CH(CH3)CH2Cl → Other Products + HCl
1 record matched Glycine, ethyl ester, hydrochloride → Other Products + HCl
1 record matched Benzene, (2-chloroethyl)- + H· → HCl + Ethyl, 2-phenyl-
2 records matched Benzene, (2-chloroethyl)- → Styrene + HCl
1 record matched DL-Alanine ethyl ester hydrochloride → Other Products + HCl
2 records matched CH3OCOOCH3 + Cl → HCl + CH3OC(O)OCH2·
2 records matched Pentane, 3-chloro- → CH3CH=CHC2H5 + HCl
1 record matched CH3CHClCOOH → HCl + Oxiranone, methyl-
1 record matched CH3CHClCHCl2 → Other Products + HCl
2 records matched CH3ONO2 + Cl → Other Products + HCl
1 record matched CH2=CHCH(OH)CH3 + Cl → CH2=CHC(·)(OH)CH3 + HCl
2 records matched (CH3)3CC(CH3)3 + Cl → HCl + (CH3)3CC(CH3)2CH2
1 record matched Butane, 2-chloro-2,3-dimethyl- → (CH3)2CHC(CH3)=CH2 + HCl
1 record matched Butane, 2-chloro-2-methyl- → C2H5C(CH3)=CH2 + HCl
1 record matched Butane, 2-chloro-2-methyl- → (CH3)2C=CHCH3 + HCl
1 record matched (CH3)2CCl2 → CH3CH=CHCl + HCl
2 records matched (CH3)2CCl2 → (CH3)CCl=CH2 + HCl
1 record matched CH3OCl + Cl → HCl + (·)CH2OCl
7 records matched CH2FCl + Cl → HCl + ·CClFH
7 records matched CH3F + Cl → ·CH2F + HCl
1 record matched HCOO(CH2)3CH3 + Cl → HCl + HC(O)OCH2CH(·)CH2CH3
1 record matched HCOO(CH2)3CH3 + Cl → HC(O)OCH2CH2CH(·)CH3 + HCl
1 record matched HCOO(CH2)3CH3 + Cl → HC(O)OCH2CH2CH2CH2· + HCl
2 records matched Hexane, 2-methyl- + Cl → Other Products + HCl
1 record matched (CH3)3C(CH2)3CH3 + Cl → HCl + n-C4H9C(CH3)2C(·)H2
1 record matched n-C3H7COC2H5 + Cl → C6H11O + HCl
1 record matched CH3CHClCH=CH2 → 1,3-Butadiene + HCl
1 record matched Cyclobutane, 1-chloro-2,2,3,3-tetrafluoro- → CF2CHCHCF2 + HCl
1 record matched (CH3)CCl=CH2 → CH2=C=CH2 + HCl
2 records matched (CH3)CCl=CH2 → CH3CCH + HCl
1 record matched (CH3)CCl=CH2 → Products + HCl
1 record matched (n-C4H9)2S + Cl → Other Products + HCl
1 record matched n-C6H13Cl → 1-C6H12 + HCl
2 records matched n-C5H11Cl → 1-C5H10 + HCl
1 record matched 2-chloroethyl methyl sulfide → CH2=CHSCH3 + HCl
1 record matched CH2ClCH2CN → CH2CHCN + HCl
7 records matched Chlorocyclohexane → Cyclohexene + HCl
1 record matched Butane, 1,1-dichloro- → 1-Butene, 1-chloro- + HCl
4 records matched (CH3)2CHCH2C(CH3)3 + Cl → Other Products + HCl
1 record matched C2H5OCH3 + Cl → Other Products + HCl
6 records matched n-C3H7Cl + Cl → Other Products + HCl
1 record matched n-C3H7Cl + Cl2 → CH2ClCH2CH2Cl + HCl
1 record matched n-C3H7Cl + Cl2 → C2H5CHCl2 + HCl
1 record matched n-C3H7Cl + Cl2 → CH3CHClCH2Cl + HCl
6 records matched n-C3H7Cl → CH3CH=CH2 + HCl
1 record matched C6H5-C(CH3)2CH2Cl → Other Products + HCl
1 record matched 1,1-Dichloroacetone → CH2COCHCl + HCl
1 record matched 1,1-Dichloroacetone → CH3C(O)CCl: + HCl
1 record matched CH2=C(CH3)CH2OH + Cl → CH2=C(CH3)CH(·)OH + HCl
1 record matched iso-C4H9Cl → iso-C4H8 + HCl
1 record matched CH3CHClCCl(CH3)2 → Other Products + HCl
1 record matched tert-C4H9OCl + H· → (CH3)3CO + HCl
2 records matched tert-C4H9Cl + Cl → HCl + (CH3)2CClCH2
9 records matched tert-C4H9Cl → iso-C4H8 + HCl
1 record matched (CH3)2C=CHCH2Cl → CH2=C(CH3)CH=CH2 + HCl
1 record matched Bornyl chloride → Other Products + HCl
2 records matched Butane, 2,2,3-trimethyl- + Cl → Other Products + HCl
10 records matched neo-C5H12 + Cl → (CH3)3CCH2 + HCl
1 record matched ClCOOH → CO2 + HCl
1 record matched H2C=C=O + Cl → HCl + HCCO
2 records matched CH2=C=CH2 + Cl → CH2=C=CH + HCl
3 records matched CH2FOCH2F + Cl → CHF(·)OCH2F + HCl
2 records matched CF3CH2CHF2 + Cl → CH2FCF2CF2· + HCl
1 record matched CF3CH2OCH3 + Cl → Other Products + HCl
1 record matched CF3CH2OCH3 + Cl → CF3CH2OCH2· + HCl
1 record matched CF3CH2OCH3 + Cl → CF3CH(·)OCH3 + HCl
1 record matched CF3CH2CH2Cl → HCl + CH2=CHCF3
1 record matched Benzene, 1-(1-chloroethyl)-4-fluoro- → Benzene, 1-ethenyl-4-fluoro- + HCl
3 records matched CF3CHFCF3 + Cl → (CF3)2CF + HCl
1 record matched (CH3CO)2 + Cl → (.)CH2C(O)C(O)CH3 + HCl
1 record matched CH2FCHF2 + Cl → HCl + CHF2C(·)HF
1 record matched CH2FCHF2 + Cl → HCl + CH2FC(·)F2
1 record matched CH3OCF2CHF2 + Cl → Products + HCl
1 record matched C2F5CH2OH + Cl → Products + HCl
2 records matched CF3CFClCH3 → CF3CF=CH2 + HCl
3 records matched CF3OCH3 + Cl → CF3OCH2(.) + HCl
2 records matched CH3CF3 + Cl → CF3CH2 + HCl
3 records matched (CH3)2CF2 + Cl → HCl + CH3CF2CH2(·)
1 record matched Pentane, 1,1,1-trifluoro- + Cl → HCl + CF3(CH2)3CH2
2 records matched CF3CH2CF2CH3 + Cl → Other Products + HCl
1 record matched CF3C(O)OC(CH3)3 + Cl → HCl + CF3C(O)OCH2CH(·)CH2CH3
1 record matched CF3CHFCF2CH2OH + Cl → Products + HCl
1 record matched n-C3F7OCH3 + Cl → CF3CF2CF2OCH2 + HCl
1 record matched CF3C(O)O(CH2)3CH3 + Cl → HCl + CF3C(O)OCH2CH2CH2CH2
1 record matched CF3C(O)O(CH2)3CH3 + Cl → HCl + CF3C(O)OCH2CH2CH(·)CH3
1 record matched CF3C(O)O(CH2)3CH3 + Cl → HCl + CF3C(O)OCH(·)CH2CH2CH3
4 records matched CHF2CHF2 + Cl → HCl + CHF2CF2
6 records matched C2F5H + Cl → C2F5 + HCl
3 records matched CF2ClCHFCl → C2F3Cl + HCl
6 records matched C2H5F + Cl → HCl + CH3C(·)HF
4 records matched C2H5F + Cl → HCl + CH2CH2F
1 record matched (C2H5)2S + Cl → Other Products + HCl
3 records matched CF3CH2OCH2CF3 + Cl → CF3CH(.)OCH2CF3 + HCl
7 records matched CF3CHCl2 + Cl → HCl + CF3CCl2
6 records matched Cyclopentane + Cl → Cyclopentyl + HCl
2 records matched Cyclobutane + Cl → Cyclobutyl + HCl
1 record matched Bicyclo[2.1.1]hexane + Cl → Other Products + HCl
1 record matched (E)-CHCl=CHCl → HCCCl + HCl
1 record matched (Z)-CHCl=CHCl → HCCCl + HCl
2 records matched CF3CHClBr + Cl → HCl + CF3CClBr
3 records matched (n-C4H9)2O + Cl → Other Products + HCl
4 records matched n-C7H16 + Cl → Other Products + HCl
2 records matched CH2ClCH2CH2Cl + Cl → Other Products + HCl
1 record matched HOCH2CHO + Cl → HOCH(·)CHO + HCl
2 records matched C2Cl4 + H· → HCl + CCl2=CCl
2 records matched n-C10H22 + Cl → Other Products + HCl
2 records matched 1,4-Dioxane + Cl → 1,4-Dioxan-2-yl + HCl
1 record matched CH3COO(CH2)3CH3 + Cl → HCl + CH3C(O)OCH2CH2CH2CH2·
1 record matched CH3COO(CH2)3CH3 + Cl → HCl + CH3C(O)OCH2CH2CH(·)CH3
1 record matched CH3COO(CH2)3CH3 + Cl → HCl + CH3C(O)OCH2CH(·)CH2CH3
1 record matched CH3COO(CH2)3CH3 + Cl → HCl + CH3C(O)OCH(·)CH2CH2CH3
1 record matched n-C3H7CHO + Cl → HCl + C2H5CHCHO
1 record matched n-C3H7CHO + Cl → HCl + CH3CH2CH2CO
1 record matched n-C3H7CHO + Cl → ·CH2CH2CH2CHO + HCl
1 record matched n-C3H7CHO + Cl → CH3CH(·)CH2CHO + HCl
2 records matched C2H5CHO + Cl → Other Products + HCl
1 record matched Cyclopentanone + Cl → Other Products + HCl
1 record matched iso-C4H8 + HCl → tert-C4H9Cl
9 records matched (CH3)2O + Cl → HCl + CH3OCH2
1 record matched CH3CH=CH2 + CH2ClCHCl· → CH2=CHCl + ·CH2CH=CH2 + HCl
2 records matched CH3CH=CH2 + Cl → ·CH2CH=CH2 + HCl
1 record matched CH3CH=CH2 + Cl2 → CH3CH=CHCl + HCl
1 record matched CH3CH=CH2 + Cl2 → (CH3)CCl=CH2 + HCl
1 record matched CH3CH=CH2 + Cl2 → CH2=CHCH2Cl + HCl
1 record matched Dodecane, 1-chloro- → 1-Dodecene + HCl
1 record matched 1-Octanol + Cl → Other Products + HCl
2 records matched n-C9H20 + Cl → Other Products + HCl
1 record matched n-C7H15OH + Cl → Other Products + HCl
4 records matched n-C8H18 + Cl → Other Products + HCl
1 record matched (n-C3H7)2S + Cl → Other Products + HCl
1 record matched (ClCH2CH2)2O → Other Products + HCl
3 records matched (n-C3H7)2O + Cl → Other Products + HCl
1 record matched n-C6H13OH + Cl → Other Products + HCl
2 records matched Hexane, 1-bromo- + Cl → Other Products + HCl
1 record matched Pyridine + Cl → HCl + 2-pyridinyl
8 records matched Cyclohexane + Cl → Cyclohexyl + HCl
1 record matched CH3OCH2CH2OCH3 + Cl → CH3OCH2CH2OCH2 + HCl
1 record matched CH3OCH2CH2OCH3 + Cl → CH3OCHCH2OCH3 + HCl
1 record matched CH2ClCH2CH2CH2Cl → 1,3-Butadiene + HCl + HCl
1 record matched n-C6H14 + Cl → 2-hexyl radical + HCl
6 records matched n-C6H14 + Cl → Other Products + HCl
2 records matched n-C5H11Br + Cl → Other Products + HCl
1 record matched HCOOC2H5 + Cl → HCl + CH3CH2OCO
1 record matched HCOOC2H5 + Cl → CH3CH(·)OC(O)H + HCl
1 record matched CH2=CHOC2H5 + HCl → CH3CHClOCH2CH3
3 records matched CH3OCH2OCH3 + Cl → Other Products + HCl
1 record matched CH3OCH2OCH3 + Cl → CH3OCH2OCH2 + HCl
1 record matched CH3OCH2OCH3 + Cl → CH3OCHOCH3 + HCl
1 record matched BrCH2CH2CH2Cl → CH2=CHCH2Br + HCl
6 records matched n-C4H9Cl + Cl → Other Products + HCl
3 records matched n-C4H9Cl → 1-C4H8 + HCl
1 record matched n-C5H12 + Cl → CH3CH2CH2CHCH3 + HCl
6 records matched n-C5H12 + Cl → Other Products + HCl
1 record matched n-C5H12 + Cl2 → n-C3H7CHClCH3 + HCl
1 record matched n-C5H12 + Cl2 → Pentane, 3-chloro- + HCl
1 record matched n-C5H12 + Cl2 → n-C5H11Cl + HCl
2 records matched n-C4H9Br + Cl → Other Products + HCl
12 records matched Phenol + Cl → C6H5O + HCl
1 record matched Phenol + Cl2 → 4-Chlorophenol + HCl
1 record matched Phenol + Cl2 → 2-Chlorophenol + HCl
1 record matched Cyclohexanone + Cl → Other Products + HCl
1 record matched Cyclohexanone + Cl → C6H9(·)O + HCl
2 records matched Chlorobenzene + Cl → chlorophenyl radical (unspecified isomer) + HCl
1 record matched Chlorobenzene + H2S → Benzenethiol + HCl
1 record matched Chlorobenzene + Benzenethiol → Diphenylsulfide + HCl
4 records matched Toluene + Cl → Benzyl + HCl
6 records matched Toluene + Cl → Other Products + HCl
2 records matched Cyclohexane, methyl- + Cl → Other Products + HCl
1 record matched 1,3,5-Trimethylhexahydro-1,3,5-triazine + Cl → Methyl, [1-(3,5-dimethyl)hexahydrotriazinyl)]- + HCl
3 records matched (iso-C3H7)2O + Cl → Other Products + HCl
2 records matched Pentane, 2,4-dimethyl- + Cl → Other Products + HCl
1 record matched Ethanamine, 2-chloro-N,N-dimethyl- → CH2=CHN(CH3)2 + HCl
1 record matched ClCH2CH2COOH → CH2=CHCOOH + HCl
1 record matched Butane, 1-chloro-3-methyl- → (CH3)2CHCH=CH2 + HCl
3 records matched (CH3)2CH(CH2)2CH3 + Cl → Other Products + HCl
2 records matched HC(O)OCH3 + Cl → HCl + CH3OC(·)(O)
2 records matched HC(O)OCH3 + Cl → HC(O)OCH2(·) + HCl
1 record matched (CHO)2 + Cl → Other Products + HCl
1 record matched CH2=CHCH2OH + Cl → HCl + CH(OH)CH=CH2
2 records matched CH2=CHCH2OH + Cl → C3H6O(unspecified structure) + HCl
1 record matched CH2ClCH2OH → CH3CHO + HCl
7 records matched CH2ClCH2Cl + Cl → HCl + CH2ClCHCl·
10 records matched CH2ClCH2Cl → CH2=CHCl + HCl
2 records matched CH2=CHCH2Cl → CH2=C=CH2 + HCl
1 record matched n-C3H7SH + Cl → CH3CH2CH2S· + HCl
1 record matched CH2=CHCHO + Cl → HCl + CH2=CHC(·)O
5 records matched n-C4H10 + Cl → n-C4H9 + HCl
6 records matched n-C4H10 + Cl → sec-C4H9 + HCl
13 records matched n-C4H10 + Cl → Other Products + HCl
1 record matched n-C4H10 + Cl → Products + HCl
1 record matched n-C4H10 + Cl2 → n-C4H9Cl + HCl
1 record matched n-C4H10 + Cl2 → sec-C4H9Cl + HCl
2 records matched n-C3H7Br + Cl → Other Products + HCl
1 record matched Benzene,(3-chloropropyl)- → 3-Phenylpropene + HCl
1 record matched 1-Phenylpropane + Cl → HCl + C6H5CH(.)CH2CH3
2 records matched Benzaldehyde + Cl → benzoyl + HCl
1 record matched C6H5CH2Cl + H· → Benzyl + HCl
1 record matched (C2H5)2CO + Cl → C5H9O + HCl
2 records matched (C2H5)2CHCH3 + Cl → Other Products + HCl
2 records matched CHCl2COCl + Cl → HCl + ·CCl2C(O)Cl
5 records matched (CHCl2)2 + Cl → HCl + CHCl2C(·)Cl2
2 records matched (CHCl2)2 → C2HCl3 + HCl
7 records matched (CH3)2CHCH(CH3)2 + Cl → Other Products + HCl
1 record matched CH2ClCOOH → CH2O + CO + HCl
1 record matched C2H5COOH + Cl → ·CH2CH2OC(O)H + HCl
1 record matched CH2ClCOCl + Cl → (.)CHClC(O)Cl + HCl
1 record matched C2HCl3 + O· → CO + CCl2 (X 1A1) + HCl
2 records matched C2HCl3 + H· → HCCCl + HCl + Cl
1 record matched C2HCl3 + C2HCl3 → Other Products + HCl
2 records matched CHCl2CH2Cl + Cl → HCl + CH2ClCCl2·
4 records matched CHCl2CH2Cl + Cl → HCl + CHCl2CHCl
1 record matched CHCl2CH2Cl + Cl → Other Products + HCl
2 records matched CHCl2CH2Cl → (E)-CHCl=CHCl + HCl
2 records matched CHCl2CH2Cl → (Z)-CHCl=CHCl + HCl
1 record matched CHCl2CH2Cl → CH2=CCl2 + HCl
1 record matched CHCl2CH2Cl → Other Products + HCl
2 records matched C2H5CHCl2 → CH3CH=CHCl + HCl
2 records matched CH3C(O)CHO + Cl → Other Products + HCl
1 record matched CH2=CHCOCH3 + Cl → H2C=CHC(O)CH2(·) + HCl
1 record matched C2H5COCH3 + Cl → HCl + CH3C(O)CH(·)CH3
3 records matched CH3CHClCH2Cl + Cl → Other Products + HCl
1 record matched CH3CHClCH2Cl → HCl + (E)-CH3CH=CHCl
1 record matched CH3CHClCH2Cl → HCl + (Z)-CH3CH=CHCl
3 records matched CH3CHClCH2Cl → CH3CH=CHCl + HCl
3 records matched CH3CHClCH2Cl → (CH3)CCl=CH2 + HCl
6 records matched CH3CHClCH2Cl → CH2=CHCH2Cl + HCl
7 records matched CH3CHClCH2Cl → Other Products + HCl
2 records matched CH3CHClCH2Cl → CIS-CH3CH=CHCl + HCl
1 record matched CH3CHClCH2Cl → trans-CHCl=CHCH3 + HCl
4 records matched sec-C4H9Cl + Cl → Other Products + HCl
2 records matched sec-C4H9Cl → (E)-2-C4H8 + HCl
1 record matched sec-C4H9Cl → (Z)-2-C4H8 + HCl
1 record matched sec-C4H9Cl → 1-C4H8 + HCl
4 records matched sec-C4H9Cl → Other Products + HCl
1 record matched Methacrolein + Cl → CH2=C(CH3)CO + HCl
1 record matched (CH3)2CHCHO + Cl → HCl + C2H5CHCHO
1 record matched (CH3)2CHCHO + Cl → HCl + (CH3)2CCHO
2 records matched (CH3)2CHCHO + Cl → HCl + (CH3)2CHC=O
1 record matched CH2=C(CH3)CH=CH2 + Cl → HCl + (.)CH=C(CH3)CH=CH2
1 record matched CH2=C(CH3)CH=CH2 + Cl → H2C=CHC(CH3)=CH· + HCl
1 record matched iso-C5H12 + Cl → (CH3)2CCH2CH3 + HCl
4 records matched iso-C5H12 + Cl → Other Products + HCl
1 record matched iso-C5H12 + Cl2 → Butane, 2-chloro-3-methyl- + HCl
1 record matched iso-C5H12 + Cl2 → CH2ClCH(CH3)CH2CH3 + HCl
1 record matched iso-C5H12 + Cl2 → Butane, 2-chloro-2-methyl- + HCl
1 record matched iso-C5H12 + Cl2 → Butane, 1-chloro-3-methyl- + HCl
1 record matched CF2Cl-CF2Cl + H· → ·CF2CF2Cl + HCl
8 records matched CHCl2CCl3 + Cl → C2Cl5 + HCl
2 records matched CHCl2CCl3 → C2Cl4 + HCl
4 records matched CF3CHO + Cl → CF3C(O) + HCl
4 records matched CF3CH2Cl + Cl → HCl + CF3CHCl
2 records matched CF3CH2Cl → C2HF3 + HCl
4 records matched CCl3CHO + Cl → Other Products + HCl
1 record matched CH3SiCl3 → HCl + CH2=SiCl2
1 record matched (CH3)4Si + Cl → HCl + (CH3)3SiCH2
1 record matched (CH3)4Pb + Cl → HCl + (CH3)3PbCH2
1 record matched CF3Cl + H· → ·CF3 + HCl
11 records matched CH3CF2Cl + Cl → CF2ClCH2· + HCl
8 records matched CH3CF2Cl → CH2=CF2 + HCl
3 records matched tert-C4H9OH + Cl → Other Products + HCl
1 record matched CHF3 + Cl → ·CF3 + HCl
1 record matched CHF3 + Cl2 → CF3Cl + HCl
5 records matched CHF2Cl + Cl → ·CClF2 + HCl
1 record matched CHF2Cl + H· → ·CHF2 + HCl
1 record matched CHF2Cl + ·CF2 → C2F4 + HCl
12 records matched CHF2Cl → ·CF2 + HCl
5 records matched CHFCl2 + Cl → ·CCl2F + HCl
1 record matched CHFCl2 → ·CClF + HCl
6 records matched CH3CHF2 + Cl → HCl + CH2CHF2
8 records matched CH3CHF2 + Cl → HCl + CH3CF2
4 records matched CH3CHF2 + Cl → Other Products + HCl
5 records matched CH3CHCl2 + Cl → HCl + CHCl2CH2·
4 records matched CH3CHCl2 + Cl → HCl + CH3CCl2·
1 record matched CH3CHCl2 + Cl → Other Products + HCl
7 records matched CH3CHCl2 → CH2=CHCl + HCl
1 record matched iso-C3H7SH + Cl → HCl + (CH3)2CHS
4 records matched iso-C3H7Cl + Cl → Other Products + HCl
1 record matched iso-C3H7Cl + Cl2 → (CH3)2CCl2 + HCl
1 record matched iso-C3H7Cl + Cl2 → CH3CHClCH2Cl + HCl
14 records matched iso-C3H7Cl → CH3CH=CH2 + HCl
5 records matched iso-C4H10 + Cl → iso-C4H9 + HCl
7 records matched iso-C4H10 + Cl → tert-C4H9 + HCl
11 records matched iso-C4H10 + Cl → Other Products + HCl
2 records matched iso-C4H10 + Cl → Products + HCl
1 record matched iso-C4H10 + Cl2 → iso-C4H9Cl + HCl
1 record matched iso-C4H10 + Cl2 → CH3CCl(CH3)CH3 + HCl
2 records matched iso-C3H7Br + Cl → Other Products + HCl
8 records matched CHBr3 + Cl → CBr3 + HCl
2 records matched Oxirane + Cl → HCl + Oxiranyl
4 records matched Cyclopropane + Cl → Cyclopropyl + HCl
1 record matched (CH3)2S + Cl → HCl + CH3SCH2
1 record matched (CH3)2S + Cl2 → CH3SCH2Cl + HCl
4 records matched CH2F2 + Cl → ·CHF2 + HCl
15 records matched CH2Cl2 + Cl → CHCl2 + HCl
1 record matched CH2Cl2 + H· → ·CH2Cl + HCl
2 records matched CH2Cl2 → ·CHCl + HCl
1 record matched C2H5SH + Cl → HCl + CH3CH2S
1 record matched CH3CHO + Cl → HCl + CH3CO
1 record matched CH3CHO + Cl → *CH2C(O)H + HCl
13 records matched CH3CHO + Cl → CH3CO + HCl
2 records matched CH3CHO + Cl → Other Products + HCl
1 record matched CH3CHO + HCl → CH3CO + HCl
3 records matched CH3CN + Cl → CH2CN + HCl
2 records matched C2H5I + Cl → Products + HCl
1 record matched CH2=CHCl + Cl → HCl + CHCl=CH
4 records matched CH2=CHCl → C2H2 + HCl
17 records matched C2H5Cl + Cl → HCl + CH3CHCl
16 records matched C2H5Cl + Cl → HCl + CH2CH2Cl
10 records matched C2H5Cl + Cl → Other Products + HCl
1 record matched C2H5Cl + H· → ·C2H5 + HCl
17 records matched C2H5Cl → C2H4 + HCl
2 records matched CH3CCH + Cl → CH2C≡CH + HCl
8 records matched C3H8 + Cl → n-C3H7 + HCl
8 records matched C3H8 + Cl → iso-C3H7 + HCl
17 records matched C3H8 + Cl → Other Products + HCl
2 records matched C3H8 + Cl → Products + HCl
1 record matched C3H8 + Cl2 → n-C3H7Cl + HCl
1 record matched C3H8 + Cl2 → iso-C3H7Cl + HCl
5 records matched CH2ClBr + Cl → HCl + ·CHBrCl
1 record matched C2H5Br + Cl → HCl + CH2BrCH2
2 records matched C2H5Br + Cl → Other Products + HCl
5 records matched CH2Br2 + Cl → HCl + CHBr2
1 record matched CH3SH + Cl → HCl + ·CH2SH
5 records matched CH3SH + Cl → CH3S· + HCl
1 record matched CH3SH + Cl → Other Products + HCl
1 record matched CH3NH2 + Cl → HCl + CH2NH2
5 records matched CH3I + Cl → HCl + ·CH2I
20 records matched CH3Cl + Cl → ·CH2Cl + HCl
4 records matched CH3Cl + H· → ·CH3 + HCl
6 records matched C2H4 + Cl → C2H3 + HCl
40 records matched C2H6 + Cl → ·C2H5 + HCl
9 records matched CH3Br + Cl → HCl + ·CH2Br
64 records matched CH4 + Cl → ·CH3 + HCl
8 records matched CH3CCl3 + Cl → HCl + CCl3CH2
6 records matched CH3CCl3 → CH2=CCl2 + HCl
5 records matched Benzene + Cl → Phenyl + HCl
1 record matched n-C5H11OH + Cl → Other Products + HCl
1 record matched n-C4H9OH + Cl → HCl + n-C3H7CHOH
1 record matched n-C4H9OH + Cl → Other Products + HCl
2 records matched n-C3H7OH + Cl → CH3CHCH2OH + HCl
2 records matched n-C3H7OH + Cl → HOCH2CH2CH2 + HCl
2 records matched n-C3H7OH + Cl → C2H5CHOH + HCl
3 records matched n-C3H7OH + Cl → Other Products + HCl
2 records matched (CH3)2SO + Cl → CH3SCH2O· + HCl
20 records matched CHCl3 + Cl → ·CCl3 + HCl
1 record matched CHCl3 + H· → CHCl2 + HCl
5 records matched CHCl3 → CCl2 (X 1A1) + HCl
1 record matched (CH3)2CO + Cl → CH3C(O)CH2(·) + HCl
1 record matched iso-C3H7OH + Cl → (CH3)2C(OH) + HCl
1 record matched iso-C3H7OH + Cl → Other Products + HCl
13 records matched CH3OH + Cl → (·)CH2OH + HCl
2 records matched CH3OH + Cl → CH3O· + HCl
3 records matched CH3C(O)OH + Cl → Other Products + HCl
1 record matched HCOOH + Cl → COOH + HCl
2 records matched HCOOH + Cl → Other Products + HCl
1 record matched HCOOH + Cl → HOCO + HCl
2 records matched C2H5OH + Cl → HOCH2CH2 + HCl
2 records matched C2H5OH + Cl → CH3CHOH + HCl
6 records matched C2H5OH + Cl → Other Products + HCl
5 records matched (C2H5)2O + Cl → Other Products + HCl
4 records matched CN + HCl → HCN + Cl
1 record matched CCl4 + H· → ·CCl3 + HCl
11 records matched CH2O + Cl → HCO + HCl
1 record matched Cl(2P1/2) + HCl → Cl(2P3/2) + HCl
1 record matched Cl(2P1/2) + C2H6 → ·C2H5 + HCl
1 record matched Cl(2P3/2) + CH3OD → Products + HCl
1 record matched Cl(2P3/2) + (CH3)2O → Products + HCl
1 record matched Cl(2P3/2) + C2H4 → C2H3 + HCl
1 record matched Cl(2P3/2) + CH4 → ·CH3 + HCl
1 record matched Cl(2P3/2) + CH3OH → Products + HCl
1 record matched Cl(2P3/2) + C2H5OH → Products + HCl
4 records matched CF3OC(O)H + Cl → HCl + CF3C(O)O
1 record matched O(1D) + HCl → H· + ClO
1 record matched O(1D) + HCl → HCl + O·
1 record matched O(1D) + HCl → ·OH + Cl
1 record matched O2(1DELTA) + HCl → HCl + O2
2 records matched CD3CH2Cl + Cl → Other Products + HCl
2 records matched CD3CH2Cl + Cl → CD3CHCl(.) + HCl
1 record matched ·CF2CF2Cl + H· → Other Products + HCl + HF
1 record matched ·CHFCF2Cl + H· → Other Products + HCl + HF
1 record matched ·CHFCF2Cl + ·CH3 → CH3CF=CF2 + HCl
1 record matched ·CHFCF2Cl + CD3 → CD3CF=CF2 + HCl
1 record matched CH3CHClO· → CH3CO + HCl
2 records matched Bicyclo[4.4.0]decane, cis- + Cl → Other Products + HCl
2 records matched AlH2Cl → HCl + AlH
1 record matched CH2=C(CH3)CHClCH3 → CH2=C(CH3)CH=CH2 + HCl
1 record matched CH2=CHCHClCH3 → 1,3-Butadiene + HCl
3 records matched CH2CF2 + HCl → CH2CF2 + HCl
1 record matched cis-CH3CHClCH=CHCH3 → CH3CH=CHCH=CH2 + HCl
1 record matched trans-CH3CHClCH=CHCH3 → CH3CH=CHCH=CH2 + HCl
1 record matched O(1S) + HCl → Products
1 record matched NF(a1Delta) + HCl → Products
2 records matched CF3CF2OC(O)H + Cl → CF3CF2OC(O)· + HCl
2 records matched CF3CF2CF2OC(O)H + Cl → CF3CF2CF2OC(O)· + HCl
1 record matched CF3CF2CF2OC(O)H + Cl → n-C3F7OC(O) + HCl
2 records matched CF3CF2CF2CF2CF2OCHO + Cl → CF3CF2CF2CF2CF2OC(O)· + HCl
1 record matched CF3CF(Cl)CH2D → CF3CF=CHD (unspecified isomer) + HCl
1 record matched CF3CF(Cl)CHD2 → CF3CF=CD2 + HCl
1 record matched H2(v) + Cl → HCl + H·
1 record matched HOCO + Cl → CO2 + HCl
4 records matched CF3CF2CF2CF2OCH2CH3 + Cl → C4F9OC2H4(·) + HCl
4 records matched CH2FOC(O)F + Cl → CHFOC(O)F + HCl
3 records matched C3H7CF(OC(O)H)CF(CF3)2 + Cl → C3H7CF(OC(O)(·))CF(CF3)2 + HCl
1 record matched C3H7CF(OC(O)CH3)CF(CF3)2 + Cl → C3H7CF(OC(O)CH2(·))CF(CF3)2 + HCl
5 records matched CH3OCF2CF2OCH3 + Cl → CH3OCF2CF2OCH2 + HCl
2 records matched CH3O(CF2CF2O)2CH3 + Cl → CH3OCF2CF2OCH2 + HCl
3 records matched CH3O(CF2CF2O)2CH3 + Cl → CH3O(CF2CF2O)2CH2 + HCl
2 records matched CH3O(CF2CF2O)3CH3 + Cl → CH3OCF2CF2OCH2 + HCl
3 records matched CH3O(CF2CF2O)3CH3 + Cl → CH3O(CF2CF2O)3CH2 + HCl
1 record matched NBr(a1Δ) + HCl → Products
1 record matched CF3CHClC2H5* → E/Z-1,1,1-trifluorobut-2-ene + HCl
1 record matched CF2ClCHFC2H5* → CH3CH2CF=CF2 + HCl
1 record matched CBrCl(OH) → HCl + BrCO
1 record matched Phenol, 2-(2-chloroethyl)- → Phenol, 2-ethenyl- + HCl
1 record matched Phenol, 2-(2-chloroethyl)- → Benzofuran, 2,3-dihydro + HCl
1 record matched CH2ClO2 + CH2ClO2 → HCl + HC(O)O2 + CH2ClO
1 record matched SiH2Cl → HCl + SiH
1 record matched ClCH2C(O)(.) → HCl + HCCO
1 record matched SiHCl2 → HCl + SiCl
1 record matched Cl3B.NH3 → HCl + Cl2B.NH2
1 record matched Benzene, 1-(2-chloroethyl)-2-methoxy- → Benzene, 1-ethenyl-2-methoxy- + HCl
1 record matched CH2ClCHCl· → Other Products + HCl
1 record matched Cl + SiH2Cl → HCl + SiHCl
1 record matched Cl + SiHCl2 → HCl + SiCl2
1 record matched Cl + ·CH2 → ·CH + HCl
1 record matched Cl + CF3CHFOCHF2 → Other Products + HCl
1 record matched Cl + CF3CHFOCHF2 → CF3C(·)FOCHF2 + HCl
1 record matched Cl + CF3CHFOCHF2 → CF3CHFOC(·)F2 + HCl
1 record matched Cl + CF3CH2OCHO → CF3CH2OC(·)O + HCl
1 record matched Cl + CF3CH2OCHO → CF3C(·)HOCHO + HCl
1 record matched Cl + CHF2OCHClCF3 → Other Products + HCl
1 record matched Cl + CHF2OCHClCF3 → CF3C(·)ClOCHF2 + HCl
1 record matched Cl + CHF2OCHClCF3 → CF3CHClOC(·)F2 + HCl
1 record matched Cl + CH3CCl2F → CF2ClCH2· + HCl
1 record matched Cl + CH3CCl2F → ·CH2CCl2F + HCl
2 records matched CH3SiHCl2 → HCl + CH3SiCl
1 record matched C2D5Cl + Cl → CD3CD(·)Cl + HCl
1 record matched C2D5Cl + Cl → ·CD2CD2Cl + HCl
1 record matched C2D5Cl + Cl → C2D4Cl + HCl
1 record matched CH2CH2Cl + Cl → CH2=CHCl + HCl
1 record matched ClCH2OH + Cl → HCl + CH2ClO
1 record matched ClCH2OH + Cl → ClCH(·)OH + HCl
1 record matched AlH2 + Cl → HCl + AlH
1 record matched HD + Cl → HCl + D
1 record matched AlH + Cl → Al + HCl
2 records matched SH + Cl → HCl + S
1 record matched NH2 + ClO → HCl + HNO
1 record matched BeH + Cl → Be + HCl
1 record matched CH2ClC(CH3)2COOH → iso-C4H8 + CO2 + HCl
1 record matched AlHCl2 + Cl → HCl + AlCl2
1 record matched SiH3Cl + Cl → HCl + SiH2Cl
1 record matched SiH3Cl → HCl + SiH2
1 record matched H· + SiHCl2 → HCl + SiHCl
1 record matched H· + Cl → HCl
1 record matched H· + TiCl → Ti + HCl
1 record matched H· + SiCl3 → HCl + SiCl2
1 record matched H· + ClONO2 → HCl + NO3
1 record matched H· + SiHCl → HCl + SiH
1 record matched H· + SiCl2 → HCl + SiCl
1 record matched H· + AlHCl2 → AlHCl + HCl
1 record matched CH3CHCHCOCl → HCl + CH3CH=C=C=O
1 record matched BCl3 + H· → HCl + BCl2
1 record matched TiCl2 + H· → HCl + TiCl
1 record matched HI + Cl → HCl + I
1 record matched SiCl4 + SiCl3OH → HCl + SiCl3OSiCl3
3 records matched SiCl4 + H· → HCl + SiCl3
2 records matched SiHCl3 + Cl → HCl + SiCl3
1 record matched SiHCl3 + H· → HCl + SiHCl2
4 records matched SiHCl3 → HCl + SiCl2
1 record matched SiH4 + Cl → HCl + SiH3
1 record matched HOCl + Cl → HCl + ClO
1 record matched HOCl + H· → ·OH + HCl
1 record matched ClF + H· → HCl + ·F
1 record matched Beryllium hydride + Cl → HCl + BeH
1 record matched AlH3 + Cl → HCl + AlH2
1 record matched HN3 + Cl → HCl + ·N3
1 record matched Cl2 + H· → HCl + Cl
1 record matched H2O + SiCl3OH → SiCl2(OH)2 + HCl
1 record matched H2O + Cl → ·OH + HCl
1 record matched H2O + SiCl4 → HCl + SiCl3OH
1 record matched H2O + H2O + SiCl4 → HCl + H2O + SiCl3OH
1 record matched H2O + H2O + H2O + SiCl4 → HCl + H2O + H2O + SiCl3OH
1 record matched H2O2 + Cl → HO2 + HCl
1 record matched titanium(III) chloride + H· → HCl + TiCl2
1 record matched DCl + H· → HCl + D
1 record matched NH3 + Cl → HCl + NH2
1 record matched HCl + CH2=CHCH=CH· → 1,3-Butadiene + Cl
1 record matched HCl + CH2=SiHCl → CH3SiHCl2
1 record matched HCl + CH2=SiCl2 → CH3SiCl3
1 record matched HCl + CH3SiCl → CH3SiHCl2
1 record matched HCl + SiH2Cl → SiH3Cl + Cl
1 record matched HCl + SiHCl2 → SiHCl3 + H·
2 records matched HCl + SiHCl2 → SiH2Cl2 + Cl
1 record matched HCl + SiHCl2 → H2 + SiCl3
1 record matched HCl + ·CH2 → ·CH2Cl + H·
1 record matched HCl + ·CH2 → ·CH3 + Cl
1 record matched HCl + CH2=CCl → CH2=CHCl + Cl
1 record matched HCl + CF3CHF → CF3CH2F + Cl
1 record matched HCl + Silyl, dichloromethyl- → CH3SiCl3 + H·
1 record matched HCl + SiH2F → SiH3F + Cl
1 record matched HCl + ·CClFH → CH2FCl + Cl
1 record matched HCl + HF2Si → SiH2F2 + Cl
4 records matched HCl + Cl → Cl2 + H·
2 records matched HCl + Cl → HCl + Cl
1 record matched HCl + Cl3SiCH2· → CH3SiCl3 + Cl
2 records matched HCl + SiCl3 → SiCl4 + H·
2 records matched HCl + SiCl3 → SiHCl3 + Cl
11 records matched HCl + O· → ·OH + Cl
3 records matched HCl + D → HD + Cl
1 record matched HCl + D → DCl + H·
1 record matched HCl + AlCl2 → AlCl3 + H·
1 record matched HCl + CH3CHCl → C2H5Cl + Cl
1 record matched HCl + ·F → ClF + H·
3 records matched HCl + ·F → HF + Cl
1 record matched HCl + ClONO2 → HNO3 + Cl2
1 record matched HCl + AlH2 → AlH2Cl + H·
1 record matched HCl + AlH → AlH2Cl
1 record matched HCl + SiCl → SiHCl2
1 record matched HCl + SiCl → H· + SiCl2
1 record matched HCl + SiHCl → Cl + SiH2Cl
1 record matched HCl + SiHCl → H· + SiHCl2
4 records matched HCl + SiHCl → SiH2Cl2
1 record matched HCl + SiHCl → H2 + SiCl2
1 record matched HCl + SiH2 → SiH3Cl
1 record matched HCl + SiH2 → H2 + SiHCl
1 record matched HCl + SiH2 → SiH2(HCl) Adduct
1 record matched HCl + SiH → SiH2Cl
1 record matched HCl + SiH → H· + SiHCl
1 record matched HCl + SiH → H2 + SiCl
1 record matched HCl + SiH3 → SiH4 + Cl
1 record matched HCl + AlF → H-Al(F)-Cl
1 record matched HCl + AlCl → AlHCl2
2 records matched HCl + AlCl → H· + AlCl2
1 record matched HCl + SiCl2 → Cl + SiHCl2
1 record matched HCl + SiCl2 → H· + SiCl3
2 records matched HCl + SiCl2 → SiHCl3
1 record matched HCl + HOBr → H2O + BrCl
3 records matched HCl + H· → H2 + Cl
2 records matched HCl + SiHCl3 → H2 + SiCl4
1 record matched HCl + H2O + ClONO2 → HNO3 + H2O + Cl2
1 record matched HCl + H2O + HOBr → H2O + H2O + BrCl
1 record matched HCl → H· + Cl
1 record matched HOClO3 + Cl → ClO4 + HCl
1 record matched TiCl4 + H· → HCl + titanium(III) chloride
1 record matched Mercury chloride + H· → Hg + HCl
2 records matched Mercury chloride + HCl → HgCl2 + H·
2 records matched HgCl2 + H· → Mercury chloride + HCl
1 record matched AlCl3 + H· → HCl + AlCl2
1 record matched Cd + HCl → CdHCl
1 record matched Be + HCl → H· + Beryllium chloride
1 record matched Hg + HCl → Mercury chloride + H·
1 record matched Li + HCl → LiCl + H·
3 records matched Al + HCl → H· + AlCl
1 record matched ·CH2Cl + H· → HCl + ·CH2
2 records matched ·CH2Cl + HCl → CH2Cl2 + H·
1 record matched ·CH2Cl + HCl → CH3Cl + Cl
1 record matched Z-CH3CH=CHCH2Cl → CH2=C=CHCH3 + HCl
1 record matched Cl2C=C=O + H· → CClCO + HCl
1 record matched CC≡N + HCl → Products
2 records matched SiH2Cl2 + Cl → HCl + SiHCl2
1 record matched SiH2Cl2 + NH3 → SiH2ClNH2 + HCl
2 records matched SiH2Cl2 + HCl → H2 + SiHCl3
6 records matched SiH2Cl2 → HCl + SiHCl
1 record matched SiH2Cl2 → Si + HCl + HCl
1 record matched ·CH2F + HCl → CH3F + Cl
1 record matched CHCl2 + HCl → CH2Cl2 + Cl
1 record matched CHCl2 + HCl → CHCl3 + H·
5 records matched ·OH + HCl → H2O + Cl
1 record matched ·OH + ·CH2Cl → CH2O + HCl
1 record matched ·CH + Cl → C + HCl
1 record matched HO2 + CH2ClO2 → HCl + O2 + CH2OO
1 record matched HO2 + ClO → HCl + O3
1 record matched HO2 + ClO → O3[triplet] + HCl
2 records matched ·CCl3 + HCl → CHCl3 + Cl
1 record matched ·CCl3 + HCl → CCl4 + H·
1 record matched CH2CN + HCl → CH3CN + Cl
1 record matched CF3CHFCl + Cl → CF3CFCl· + HCl
1 record matched ·CHF2 + HCl → CH2F2 + Cl
1 record matched C2H3 + HCl → CH2=CHCl + H·
2 records matched C2H3 + HCl → C2H4 + Cl
1 record matched HCO + Cl → CO + HCl
1 record matched (·)CH2OH + HCl → CH3OH + Cl
2 records matched HC(O)Cl + H· → HCO + HCl
1 record matched HC(O)Cl → CO + HCl
1 record matched Cyclohexene, 3-chloro- → 1,3-Cyclohexadiene + HCl
1 record matched 1,2,2,2-tetrafluoroethyl trifluoromethyl ether + Cl → CF3CF(.)OCF3 + HCl
1 record matched ·CF3 + HCl → CHF3 + Cl
2 records matched ·CH3 + Cl → HCl + ·CH2
2 records matched ·CH3 + HCl → CH3Cl + H·
18 records matched ·CH3 + HCl → CH4 + Cl
1 record matched ·CH3 + ·CH2Cl → C2H4 + HCl
1 record matched ·CH3 + CHCl2 → CH2=CHCl + HCl
1 record matched ·CH3 + ·CCl3 → CH2=CCl2 + HCl
1 record matched CH3O· + ClO → HCl + CH2OO
1 record matched CH3O· + HCl → CH3OH + Cl
1 record matched ·CHCl + HCl → CH2Cl2
1 record matched ·C2H5 + HCl → C2H5Cl + H·
2 records matched ·C2H5 + HCl → C2H6 + Cl
1 record matched CF3CH2OCHF2 + Cl → Other Products + HCl
1 record matched CF3CH2OCHF2 + Cl → CF3CH(·)OCHF2 + HCl
1 record matched CF3CH2OCHF2 + Cl → CF3CH2OCF2· + HCl
1 record matched ·CCl2F + HCl → CHFCl2 + Cl
1 record matched ·CClF2 + HCl → CHF2Cl + Cl
3 records matched CHBrF2 + Cl → HCl + CBrF2
1 record matched HFCO + Cl → FCO + HCl
13 records matched H2 + Cl → HCl + H·
1 record matched H2 + SiCl3 → HCl + SiHCl2
1 record matched H2 + SiCl → HCl + SiH
1 record matched H2 + SiCl2 → HCl + SiHCl
1 record matched H2 + SiCl4 → HCl + SiHCl3
1 record matched H2 + SiHCl3 → SiH2Cl2 + HCl
1 record matched Cyclohexene, 4-chloro- → 1,3-Cyclohexadiene + HCl
1 record matched CCl3COCH3 + Cl → ·CH2C(O)CCl3 + HCl
1 record matched CH3CHClCCl3 → Other Products + HCl
1 record matched CF3CH2F + Cl → HCl + CF3CHF
2 records matched Ethane, 1-chloro-2-fluoro- → CH2=CHF + HCl
1 record matched ClCH2CHClCH=CH2 → Other Products + HCl
1 record matched Propane, 1,1,1,3,3,3-hexafluoro- + Cl → HCl + (CF3)2CH·
1 record matched (CH3O)2 + Cl → ·CH2OOCH3 + HCl
1 record matched CH2CHCCH + Cl → HCCCHCH· + HCl
1 record matched Propane, 1,1,1,2,2,3-hexafluoro- + Cl → CF3CF2CHF· + HCl
1 record matched CHD3 + Cl → CD3 + HCl
1 record matched CH2ClCCl3 + Cl → HCl + CCl3CHCl
1 record matched CH2FCH2F + Cl → HCl + CH2FCHF
1 record matched (CH3)2CHCH(OH)CH3 + Cl → (CH3)2CHC(·)(OH)CH3 + HCl
1 record matched (CH3)2CHC(OH)(CH3)2 + Cl → (CH3)2C(·)C(OH)(CH3)2 + HCl
4 records matched CH2FCl + Cl → HCl + ·CClFH
4 records matched CH3F + Cl → ·CH2F + HCl
1 record matched CD4 + Cl → CD3 + HCl
1 record matched Chlorocyclohexane → Cyclohexene + HCl
1 record matched ClCN + H· → CN + HCl
2 records matched neo-C5H12 + Cl → (CH3)3CCH2 + HCl
2 records matched H2C=C=O + Cl → HCl + HCCO
1 record matched CF3CH2OCH3 + Cl → Other Products + HCl
1 record matched CF3CH2OCH3 + Cl → CF3CH2OCH2· + HCl
1 record matched CF3CH2OCH3 + Cl → CF3CH(·)OCH3 + HCl
1 record matched CHCl=CHF → HCCF + HCl
1 record matched 1,1,1,2,3,3-Hexafluoropropane + Cl → CF3C(·)FCHF2 + HCl
1 record matched 1,1,1,2,3,3-Hexafluoropropane + Cl → CF3CHFCF2· + HCl
1 record matched CH2FCHF2 + Cl → HCl + CHF2C(·)HF
1 record matched CH2FCHF2 + Cl → HCl + CH2FC(·)F2
2 records matched CH3COCH2F + Cl → CH3C(O)CHF· + HCl
2 records matched CH3COCH2F + Cl → ·CH2C(O)CH2F + HCl
1 record matched CH3COCH2F + Cl → C3H4FO + HCl
1 record matched CH3OCF2CHF2 + Cl → CF2CF2OCH3 + HCl
1 record matched CH3OCF2CHF2 + Cl → CHF2CF2OCH2 + HCl
1 record matched CH3COCF3 + Cl → HCl + CF3COCH2
2 records matched CH3CF3 + Cl → CF3CH2 + HCl
2 records matched CHF2CHF2 + Cl → HCl + CHF2CF2
1 record matched C2F5H + Cl → C2F5 + HCl
1 record matched C2H5F + Cl → HCl + CH3C(·)HF
1 record matched C2H5F + Cl → HCl + CH2CH2F
1 record matched CH2ClCHF2 → CH2=CF2 + HCl
1 record matched CF3CHCl2 + Cl → HCl + CF3CCl2
1 record matched CHClBr2 + Cl → HCl + CClBr2
1 record matched (CH3)2O + Cl → HCl + CH3OCH2
2 records matched Pyridine + Cl → pyridinyl radical (unspecified isomer) + HCl
1 record matched n-C6H14 + Cl → Other Products + HCl
1 record matched n-C6H14 + Cl2 → Other Products + HCl
1 record matched 2-Methylpyridine + Cl → HCl + Methyl, 2-pyridinyl-
1 record matched 3-Methylpyridine + Cl → HCl + 3-Pyridylmethyl radical
1 record matched Chlorobenzene + H· → Phenyl + HCl
1 record matched Chlorobenzene + Phenyl → Other Products + HCl
2 records matched Chlorobenzene + H2 → Benzene + HCl
1 record matched 4-Methylpyridine + Cl → HCl + 4-Pyridylmethyl radical
1 record matched HC(O)OCH3 + Cl → HCl + CH3C(O)O
1 record matched HC(O)OCH3 + Cl → HC(O)OCH2(·) + HCl
1 record matched CH2ClCHO + Cl → HCl + ClCH2C(O)(.)
1 record matched CH2ClCHO + Cl → HCl + ClCH(.)CHO
1 record matched CH2ClCHO + Cl → Other Products + HCl
1 record matched CH2ClCHO → H2C=C=O + HCl
1 record matched CH2ClCH2Cl + Cl → HCl + CH2ClCHCl·
3 records matched CH2ClCH2Cl → CH2=CHCl + HCl
1 record matched n-C4H10 + Cl → n-C4H9 + HCl
1 record matched n-C4H10 + Cl → sec-C4H9 + HCl
1 record matched 1-Phenylpropane + Cl → HCl + C6H5CH(.)CH2CH3
1 record matched 2-Chlorophenol + Cl → 2-chlorophenoxy + HCl
1 record matched 2-Chlorophenol → 1-cyclopenta-2,4-dienylmethanone + HCl
1 record matched Benzene, 1,2-dichloro- + H2 → Chlorobenzene + HCl
1 record matched (CHCl2)2 + Cl → HCl + CHCl2C(·)Cl2
1 record matched CHCl2CH2Cl + Cl → HCl + CH2ClCCl2·
1 record matched CHCl2CH2Cl + Cl → HCl + CHCl2CHCl
1 record matched sec-C4H9OH + Cl → CH3CH2C(·)(OH)CH3 + HCl
1 record matched sec-C4H9OH + Cl → CH3CH(·)CH(OH)CH3 + HCl
2 records matched CHCl2CCl3 + Cl → C2Cl5 + HCl
1 record matched CHCl2CCl3 → C2Cl4 + HCl
1 record matched CCl3CHO + Cl → CCl3C(O)(.) + HCl
1 record matched C2H5C(CH3)2OH + Cl → (CH3)2C(OH)C(·)HCH3 + HCl
1 record matched CH3SiCl3 + Cl → HCl + Cl3SiCH2·
1 record matched CH3SiCl3 + H· → HCl + Silyl, dichloromethyl-
1 record matched CH3SiCl3 → HCl + CH2=SiCl2
1 record matched (CH3)2SiCl2 → Other Products + HCl
1 record matched (CH3)4Si + Cl → HCl + (CH3)3SiCH2
2 records matched CH3CF2Cl → CH2=CF2 + HCl
2 records matched CHF3 + Cl → ·CF3 + HCl
4 records matched CHF2Cl + Cl → ·CClF2 + HCl
1 record matched CHF2Cl + H· → ·CHF2 + HCl
1 record matched CHF2Cl → ·CF2 + HCl
3 records matched CHFCl2 + Cl → ·CCl2F + HCl
1 record matched CHFCl2 + H· → HCl + ·CClFH
2 records matched CH3CHF2 + Cl → HCl + CH2CHF2
2 records matched CH3CHF2 + Cl → HCl + CH3CF2
1 record matched CH3COCl → H2C=C=O + HCl
1 record matched CH3CHCl2 + Cl → HCl + CHCl2CH2·
1 record matched CH3CHCl2 + Cl → HCl + CH3CCl2·
2 records matched CHBrCl2 + Cl → HCl + BrCCl2
2 records matched CHBr3 + Cl → CBr3 + HCl
3 records matched CH2F2 + Cl → ·CHF2 + HCl
4 records matched CH2Cl2 + Cl → CHCl2 + HCl
3 records matched CH2Cl2 + H· → ·CH2Cl + HCl
3 records matched CH3CN + Cl → CH2CN + HCl
1 record matched C2H5I + Cl → CH3CHI + HCl
1 record matched C2H5I + Cl → ·CH2CH2I + HCl
1 record matched CH2=CHCl + Cl → HCl + CHCl=CH
2 records matched CH2=CHCl + H· → C2H3 + HCl
1 record matched CH2=CHCl → HCCCl + HCl
1 record matched CH2=CHCl → C2H2 + HCl
2 records matched C2H5Cl + Cl → HCl + CH3CHCl
2 records matched C2H5Cl + Cl → HCl + CH2CH2Cl
1 record matched C2H5Cl + Cl → C2H4Cl + HCl
3 records matched C2H5Cl + H· → ·C2H5 + HCl
3 records matched C2H5Cl → C2H4 + HCl
3 records matched CH2ClBr + Cl → HCl + ·CHBrCl
2 records matched CH2Br2 + Cl → HCl + CHBr2
1 record matched HCN + Cl → CN + HCl
1 record matched CH3I + Cl → HCl + ·CH2I
4 records matched CH3Cl + Cl → ·CH2Cl + HCl
5 records matched CH3Cl + H· → ·CH3 + HCl
1 record matched CH3Cl + H2 → CH4 + HCl
1 record matched C2H2 + Cl → ·C2H + HCl
1 record matched C2H2 + HCl → CH2=CHCl
2 records matched C2H4 + Cl → C2H3 + HCl
1 record matched C2H4 + HCl → C2H5Cl
5 records matched C2H6 + Cl → ·C2H5 + HCl
3 records matched CH3Br + Cl → HCl + ·CH2Br
22 records matched CH4 + Cl → ·CH3 + HCl
1 record matched CH4 + HCl → CH3Cl + H2
2 records matched CH3CCl3 + Cl → HCl + CCl3CH2
1 record matched Benzene + H2 + HCl → 1,4-Cyclohexadiene + HCl
1 record matched Benzene + H2 + HCl → 1,3-Cyclohexadiene + HCl
1 record matched (CH3)2SO + Cl → CH3SCH2O· + HCl
6 records matched CHCl3 + Cl → ·CCl3 + HCl
3 records matched CHCl3 + H· → CHCl2 + HCl
1 record matched CHCl3 → CCl2 (X 1A1) + HCl
3 records matched (CH3)2CO + Cl → CH3C(O)CH2(·) + HCl
1 record matched iso-C3H7OH + Cl → CH3CH(OH)CH2 + HCl
1 record matched iso-C3H7OH + Cl → (CH3)2C(OH) + HCl
3 records matched CH3OH + Cl → (·)CH2OH + HCl
1 record matched CH3OH + Cl → CH3O· + HCl
1 record matched CH3OH + SiCl4 → SiCl3OCH3 + HCl
2 records matched HCOOH + Cl → COOH + HCl
1 record matched C2H5OH + SiCl4 → SiCl3(OCH2CH3) + HCl
1 record matched CN + HCl → HCN + Cl
5 records matched CCl4 + H· → ·CCl3 + HCl
1 record matched CH2O + Cl → HCO + HCl
1 record matched O(1D) + HCl → H· + ClO
1 record matched O(1D) + HCl → ·OH + Cl
1 record matched SiHCl2NH2 → ClSiNH2 + HCl
1 record matched CH3CHClO· → HCl + CH3CO
2 records matched cis-HONO + HCl → ClNO + H2O
1 record matched trans-HONO + Cl → HCl + NO2
2 records matched trans-HONO + HCl → ClNO + H2O
1 record matched CHBrClO(.) → HCl + BrCO
1 record matched AlHCl + Cl → HCl + AlCl
1 record matched AlHCl + HCl → H· + AlHCl2
1 record matched AlH2Cl + Cl → AlHCl + HCl
1 record matched C2C4H2 → C2HCl3 + HCl
1 record matched C2C5H → C2Cl4 + HCl
1 record matched C2Cl2H4 → CH2=CHCl + HCl
1 record matched C2Cl3H3 → C2Cl2H2 + HCl
1 record matched CHClOHCH2 → CH2=CHO· + HCl
1 record matched SiH2ClNH2 + HCl → SiH2Cl2 + NH3
1 record matched SiCl2(OH)2 + H2O → SiCl(OH)3 + HCl
1 record matched (H2O)2 + HCl + HOBr → H2O + H2O + H2O + BrCl
1 record matched (H2O)3 + HCl + HOBr → H2O + H2O + H2O + H2O + BrCl
1 record matched SiCl(OH)3 + H2O → Si(OH)4 + HCl
2 records matched HOCO + ClO → CO3 + HCl
1 record matched HOOOCl + Cl → cis-ClOOO + HCl
1 record matched [14]CH4 + Cl → [14]CH3 + HCl
1 record matched [13]CH3Cl + Cl → [13]CH2Cl + HCl
1 record matched AlNa + HCl → H-Al(Na)-Cl
1 record matched AlSH + HCl → H-Al(SH)-Cl
1 record matched CH3C(O)CCl2F + Cl → ·CH2C(O)CCl2F + HCl
1 record matched CH3C(O)CCl2Br + Cl → ·CH2C(O)CCl2Br + HCl
1 record matched CCl3CH2CH2OH → CCl2=CHCH2OH + HCl
1 record matched cis-CHCl=CCl· + O2 → CO + ClCO + HCl
1 record matched cis-CHCl=CCl· + O2 → CO2 + ·CCl + HCl
1 record matched CF3CH2OCH2F + Cl → Other Products + HCl
1 record matched CF3CH2OCH2F + Cl → CF3CH2OCHF· + HCl
1 record matched CF3CH2OCH2F + Cl → CF3CH(·)OCH2F + HCl
1 record matched cyc-HC=C=C(BCl2) + Cl → cyc-(·)C=C=C(BCl2) + HCl
1 record matched bicyc-C3BCl + H· → bicyc-C3B + HCl
1 record matched CF2-trip + HCl → ·CHF2 + Cl
2 records matched [13]CH4 + Cl → [13]CH3 + HCl
1 record matched [·OH..OH2] complex + HCl → (H2O)2 + Cl
1 record matched H2S + Cl → HCl + SH
1 record matched CH3OH + Cl → (·)CH2OH + HCl

Search returned 2708 records.