 |
Home ©NIST, 2023 Accessibility information |
Contact Us to Submit an Article
Other Databases
NIST Standard Reference Data Program
NDRL-NIST Solution Kinetics Database
NIST Computational Chemistry Comparison and Benchmark Database
The NIST Reference on Constants, Units, and Uncertainty
Administrative Links
Search Results
Click on a link in the table below to see detail on the selected reaction.
| Records | Reaction | |
|---|---|---|
| 1 record matched | C6H5CH=NOH → Benzonitrile + H2O | |
| 1 record matched | Benzonitrile + O· → Products | |
| 1 record matched | Benzonitrile + H· → HCN + Phenyl | |
| 1 record matched | Benzonitrile + H· → CN + Benzene | |
| 1 record matched | Benzonitrile + H· → Other Products + H· | |
| 2 records matched | Benzonitrile + H· → Products | |
| 1 record matched | Benzonitrile + ·OH → Other Products + H2O | |
| 1 record matched | Benzonitrile → Other Products + H· | |
| 2 records matched | Benzonitrile → Products | |
| 1 record matched | 4-benzylideneimino-2-cyanoethyl-1,2,4-triazol-3(2H)-one → 2-cyanoethyl-1,2,4-triazol-3(2H)-one + Benzonitrile | |
| 1 record matched | 4-benzylideneimino-2-cyanoethyl-1,2,4-triazol-3(2H)-thione → 2-cyanoethyl-1,2,4-triazol-3(2H)-thione + Benzonitrile | |
| 1 record matched | 4-benzylideneimino-2-N-tetra-O-acetyl-D-glucosyl-1,2,4-triazol-3(2H)-thione → tetra-O-acetyl-D-glucosyl-1,2,4-triazol-3(2H)-thione + Benzonitrile | |
| 1 record matched | C6H5C(O)NHN=CHC6H5 → Benzamide + Benzonitrile | |
| 1 record matched | p-CH3-C6H4-C(O)NHN=CHC6H5 → Benzonitrile + Benzamide, 4-methyl- | |
| 1 record matched | p-CH3O-C6H4-C(O)NHN=CHC6H5 → Benzonitrile + Benzamide, 4-methoxy- | |
| 1 record matched | ClC6H4C(O)NHN=CHC6H5 → Benzonitrile + Benzamide, 4-chloro- | |
| 1 record matched | NO2C6H4C(O)NHN=CHC6H5 → Benzonitrile + Benzamide, 4-nitro- | |
| 1 record matched | C6H5C(O)N(CH3)N=CHC6H5 → Benzonitrile + Benzamide, N-methyl- | |
| 1 record matched | p-CH3-C6H4-C(O)N(CH3)N=CHC6H5 → p-CH3-C6H4-C(O)NHCH3 + Benzonitrile | |
| 1 record matched | p-CH3O-C6H4-C(O)N(CH3)N=CHC6H5 → p-CH3O-C6H4-C(O)NHCH3 + Benzonitrile | |
| 1 record matched | ClC6H4C(O)N(CH3)N=CHC6H5 → p-Cl-C6H4-C(O)NHCH3 + Benzonitrile | |
| 1 record matched | NO2C6H4C(O)N(CH3)N=CHC6H5 → p-NO2-C6H4-C(O)NHCH3 + Benzonitrile | |
| 1 record matched | C6H5C(S)N(CH3)N=CHC6H5 → C6H5C(S)NHCH3 + Benzonitrile | |
| 1 record matched | C6H5C(O)N(C6H5)N=CHC6H5 → Benzamide, N-phenyl- + Benzonitrile | |
| 1 record matched | C6H5C(O)N(CH2C6H5)N=CHC6H5 → Benzonitrile + N-Benzylbenzamide | |
| 1 record matched | C6H5C(O)N(CH2CH=CH2)N=CHC6H5 → Benzonitrile + Benzamide, n-allyl- | |
| 1 record matched | 4-benzylideneimino-1,2,4-triazol-3(2H)-one → 3-hydroxy-(2H)-1,2,4-triazole + Benzonitrile | |
| 1 record matched | 4-p-chlorobenzylideneimino-1,2,4-triazol-3(2H)-thione → 3-mercapto-(2H)-1,2,4-triazole + Benzonitrile | |
| 1 record matched | ICNO + Benzonitrile → cyc-O-N=C(I)-N=C(C6H5) | |
| 1 record matched | ICNO + Benzonitrile → cyc-O-N=C(I)-C(C6H5)=N |
Search returned 32 records.