Kinetics Database Logo     Home
©NIST, 2023
Accessibility information
Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences

Contact Us to Submit an Article

Citation

Help

Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty

More...

Administrative Links

DOC home page

NIST home page

MML home page

Chemical Sciences Division

Applied Chemicals and Materials Division

Search Results

Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
1 record matched C2H3 + C2H3 → 1,3-Butadiene
1 record matched ·CH2CH=CH2 + ·CH2 → 1,3-Butadiene + H·
1 record matched CH3CH=CH2 + C2H3 → 1,3-Butadiene + ·CH3
2 records matched Cyclohexene → C2H4 + 1,3-Butadiene
1 record matched 1,3-Butadiene + N → Products
2 records matched 1,3-Butadiene + O· → Products
1 record matched 1,3-Butadiene + H· → Products
1 record matched 1,3-Butadiene + NO3 → Products
1 record matched 1,3-Butadiene + Se → Adduct
1 record matched 1,3-Butadiene + S → Thiirane, ethenyl-
1 record matched 1,3-Butadiene + ·OH → Products
1 record matched 1,3-Butadiene + ·CF3 → Products
1 record matched 1,3-Butadiene + ·CH3 → CH2=CHCH(·)CH2CH3
1 record matched C2H2 + 2-C3H7 → 1,3-Butadiene + ·CH3
1 record matched C2H4 + C2H3 → 1,3-Butadiene + H·
1 record matched Cyclobutane, 2-ethenyl-1,1-dimethyl- → 1,3-Butadiene + Isobutene
1 record matched CH2=CHCH2CH2OSO2CH3 → HOSO2CH3 + 1,3-Butadiene
1 record matched Bicyclo[4.2.2]deca-3,7-diene- → 1,3-Butadiene + 1,3-Cyclohexadiene
1 record matched 6-oxa-3-silabicyclo[3.1.0]hexane, 3,3-dimethyl- → 1,3-Butadiene + (CH3)2Si=O
3 records matched ·CH2CH=CHCH2CH3 → 1,3-Butadiene + ·CH3
1 record matched CH2=C=CHCH2COOH → 1,3-Butadiene + CO2
1 record matched Silacyclopent-3-ene, 1,1-difluoro- → 1,3-Butadiene + SiF2
1 record matched Bicyclo[2.2.2]oct-2-ene, 5-ethenyl-,(1α,4α,5α)- → 1,3-Butadiene + 1,3-Cyclohexadiene
1 record matched Bicyclo[2.2.2]oct-2-ene, 5-ethenyl-,(1α,4α,5β)- → 1,3-Butadiene + 1,3-Cyclohexadiene
1 record matched Silacyclopent-3-ene,1,1-dimethyl- → 1,3-Butadiene + (CH3)2Si
1 record matched ·CH2CH=CHCH3 → 1,3-Butadiene + H·
3 records matched 3-Cyclopenten-1-one → 1,3-Butadiene + CO
1 record matched CH3CBr=CHCH3 (Unspecified) → 1,3-Butadiene + HBr
1 record matched Bicyclopropyl → C2H4 + 1,3-Butadiene
1 record matched 2H-Pyran, 3,6-dihydro- → CH2O + 1,3-Butadiene
1 record matched 1-methylcyclopropene → 1,3-Butadiene
2 records matched CH2=CH(CH2)3CH=CH2 → 1,3-Butadiene + CH3CH=CH2
6 records matched C2H3 + C2H3 → 1,3-Butadiene
2 records matched Ethenylcyclobutane → C2H4 + 1,3-Butadiene
1 record matched CH2=CHCH2CH2· + Cyclobutyl → 1,3-Butadiene + Cyclobutane
1 record matched CH3C(O)O(CH2)2CH=CH2 → CH3C(O)OH + 1,3-Butadiene
2 records matched (Z,Z)-1,5-Cyclooctadiene → 1,3-Butadiene + 1,3-Butadiene
3 records matched cyclobutyl chloride → 1,3-Butadiene + HCl
1 record matched (CH2=CH)2Hg + C2H3 → 1,3-Butadiene + C2H3 + Hg
2 records matched ClCH2CH2CH=CH2 → 1,3-Butadiene + HCl
1 record matched Silacyclopent-3-ene,1,1-dichloro- → 1,3-Butadiene + SiCl2
5 records matched Cyclobutene → 1,3-Butadiene
3 records matched 1,2,3,6-Tetrahydropyridine → 1,3-Butadiene + CH2=NH
1 record matched CH2=CHCH(OH)CH3 → 1,3-Butadiene + H2O
1 record matched 1,5-Hexadiene → C2H4 + 1,3-Butadiene
2 records matched Cyclohexene, 4-methyl- → 1,3-Butadiene + CH3CH=CH2
1 record matched 1,2-butadiene → 1,3-Butadiene
2 records matched (Z)-2-C4H8 + ·CH2CH=CHCH3 → 1,3-Butadiene + sec-C4H9
3 records matched (Z)-2-C4H8 → 1,3-Butadiene + H2
1 record matched CH3CHClCH=CH2 → 1,3-Butadiene + HCl
2 records matched 2-Methylfuran + O· → Other Products + 1,3-Butadiene
1 record matched Bicyclo[1.1.0]butane → 1,3-Butadiene
1 record matched CH3CH=CH2 + ·CH → 1,3-Butadiene + H·
16 records matched Cyclohexene → C2H4 + 1,3-Butadiene
1 record matched CH2ClCH2CH2CH2Cl → 1,3-Butadiene + HCl + HCl
1 record matched CH3CH=CHCH3 + ·CH2CH=CHCH3 → 1,3-Butadiene + sec-C4H9
1 record matched 1,3-Butadiene + CH3CH2C(O)OO → Products
1 record matched 1,3-Butadiene + CH3C≡C· → Products
1 record matched 1,3-Butadiene + (CH3)2Ge: → Products
1 record matched 1,3-Butadiene + ·CH2 → Products
1 record matched 1,3-Butadiene + CH≡CC≡C → Products
1 record matched 1,3-Butadiene + CH3C(O)OO(·) → Products
1 record matched 1,3-Butadiene + :GeH2 → Products
1 record matched 1,3-Butadiene + CH3Sn(·)CH3 → Products
4 records matched 1,3-Butadiene + ·Cl → Products
1 record matched 1,3-Butadiene + NCO → Products
4 records matched 1,3-Butadiene + N → Products
7 records matched 1,3-Butadiene + O· → Products
2 records matched 1,3-Butadiene + D → Products
1 record matched 1,3-Butadiene + (Z)-CH3CH=CHCHO → 3-Cyclohexene-1-carboxaldehyde, 6-methyl-
1 record matched 1,3-Butadiene + (Z)-HN=NH → 1-C4H8 + N2
1 record matched 1,3-Butadiene + SiF2 → Silacyclopent-3-ene, 1,1-difluoro-
1 record matched 1,3-Butadiene + SH → Products
2 records matched 1,3-Butadiene + SiH2 → Silacyclopent-3-ene
2 records matched 1,3-Butadiene + SiH2 → Products
2 records matched 1,3-Butadiene + ·NH2 → Products
2 records matched 1,3-Butadiene + ·CHF → Products
1 record matched 1,3-Butadiene + BO → CH2=CHC(B=O)=CH2 + H·
1 record matched 1,3-Butadiene + BO → CH2=CHCH=CHB=O + H·
1 record matched 1,3-Butadiene + H· → H2 + CH2=CHCH=CH·
2 records matched 1,3-Butadiene + H· → Adduct
11 records matched 1,3-Butadiene + H· → Products
1 record matched 1,3-Butadiene + C2O → Products
14 records matched 1,3-Butadiene + NO3 → Products
3 records matched 1,3-Butadiene + NO2 → Products
1 record matched 1,3-Butadiene + Br· → HBr + CH2=CHC(·)=CH2
2 records matched 1,3-Butadiene + Br· → Products
3 records matched 1,3-Butadiene + Br· → H2C=CHC(·)HCH2Br
2 records matched 1,3-Butadiene + O3 → Other Products + ·OH
1 record matched 1,3-Butadiene + O3 → Other Products + Ethenyloxirane
1 record matched 1,3-Butadiene + O3 → Other Products + CH2=CHCHO
6 records matched 1,3-Butadiene + O3 → Products
2 records matched 1,3-Butadiene + Se → Adduct
1 record matched 1,3-Butadiene + S → Thiirane, ethenyl-
2 records matched 1,3-Butadiene + V → Products
2 records matched 1,3-Butadiene + Co → Products
2 records matched 1,3-Butadiene + Cr → Products
3 records matched 1,3-Butadiene + C → Products
2 records matched 1,3-Butadiene + Ti → Products
1 record matched 1,3-Butadiene + Si → Products
2 records matched 1,3-Butadiene + Sc → Products
2 records matched 1,3-Butadiene + Ni → Products
1 record matched 1,3-Butadiene + Fe → Products
2 records matched 1,3-Butadiene + CH3S· → Adduct
1 record matched 1,3-Butadiene + CH2=C=CH → CH2=C=CH2 + CH2=CHCH=CH·
1 record matched 1,3-Butadiene + CH2=C=CH → Products
1 record matched 1,3-Butadiene + (CH3)2Si → Adduct
1 record matched 1,3-Butadiene + CF → Products
12 records matched 1,3-Butadiene + ·OH → Products
1 record matched 1,3-Butadiene + ·OH → CH2=CHCH(·)CH2OH
2 records matched 1,3-Butadiene + ·OH → 1,3-Butadiene-OH adduct
1 record matched 1,3-Butadiene + CH3CO → Products
2 records matched 1,3-Butadiene + ·CH2C≡CH → Products
1 record matched 1,3-Butadiene + C2H3 → 3-Cyclohexenyl
1 record matched 1,3-Butadiene + C2H3 → (Z)-CH2=CHCH=CHCH=CH2 + H·
1 record matched 1,3-Butadiene + C2H3 → 1,3-Cyclohexadiene + H·
1 record matched 1,3-Butadiene + C2H3 → Adduct
2 records matched 1,3-Butadiene + C2H3 → Products
2 records matched 1,3-Butadiene + HCO → Products
1 record matched 1,3-Butadiene + 1-Naphthalenyl → Products
1 record matched 1,3-Butadiene + Phenyl → H· + 1-Phenyl-1,3-butadiene(E)
1 record matched 1,3-Butadiene + Phenyl → 1,4-Dihydronaphthalene + H·
2 records matched 1,3-Butadiene + ·CF3 → Adduct
1 record matched 1,3-Butadiene + ·CH3 → CH4 + CH2=CHCH=CH·
1 record matched 1,3-Butadiene + ·CH3 → Adduct
1 record matched 1,3-Butadiene + ·CF2 → Cyclopropane,2-ethenyl-1,1-difluoro-
1 record matched 1,3-Butadiene + ·C2H → C2H2 + CH2=CHCH=CH·
2 records matched 1,3-Butadiene + ·C2H → Products
1 record matched 1,3-Butadiene + Cyclohexene, 3-ethenyl- → Bi-3-Cyclohexen-1-yl
1 record matched 1,3-Butadiene + 1,3-Cyclohexadiene → Bicyclo[4.2.2]deca-3,7-diene-
1 record matched 1,3-Butadiene + 1,3-Cyclohexadiene → Naphthalene, 1,2,4a,5,8,8a-hexahydro-, cis-
1 record matched 1,3-Butadiene + 1,3-Cyclohexadiene → Bicyclo[2.2.2]oct-2-ene, 5-ethenyl-,(1α,4α,5α)-
1 record matched 1,3-Butadiene + 1,3-Cyclohexadiene → Bicyclo[2.2.2]oct-2-ene, 5-ethenyl-,(1α,4α,5β)-
1 record matched 1,3-Butadiene + CH2=CHCHO → 3-Cyclohexene-1-carboxaldehyde
1 record matched 1,3-Butadiene + 1,3-Butadiene → (Z,Z)-1,5-Cyclooctadiene
1 record matched 1,3-Butadiene + 1,3-Butadiene → Cyclohexene, 3-ethenyl-
3 records matched 1,3-Butadiene + 1,3-Butadiene → 4-Vinylcyclohexene
1 record matched 1,3-Butadiene → H· + CH2=CHCH=CH·
4 records matched 1,3-Butadiene → C2H3 + C2H3
1 record matched 1,3-Butadiene → C2H4 + C2H2
2 records matched 1,3-Butadiene → Products
4 records matched 4-Vinylcyclohexene → 1,3-Butadiene + 1,3-Butadiene
1 record matched C2H4 + C2H3 → 1,3-Butadiene + H·
1 record matched C2H4 + 1,3-Butadiene → Cyclohexene
1 record matched C2H4 + C2H4 → 1,3-Butadiene + H2
3 records matched CN + 1,3-Butadiene → Products
1 record matched ·CH2CH=CHCH2CH2CH=CHCH2· → 1,3-Butadiene + 1,3-Butadiene
1 record matched CH2=CHCHClCH3 → 1,3-Butadiene + HCl
1 record matched C6H5NHCH2CH2CH2CH2OC(O)CH3 → aniline + CH3C(O)OH + 1,3-Butadiene
1 record matched H2C=CHC(·)HCH2Br → 1,3-Butadiene + Br·
1 record matched C4H2* + 1,3-Butadiene → Products
1 record matched 3,4-epoxycyclopentene → 1,3-Butadiene + CO
1 record matched 2,5-Hexadienyl → 1,3-Butadiene + C2H3
1 record matched 1,4-Cyclopentadien-1-ol → 1,3-Butadiene + CO
1 record matched Silacylohex-3-ene, 1-methyl- → 1,3-Butadiene + CH2=SiHCH3
2 records matched CH2=CHCH(·)CH3 → 1,3-Butadiene + H·
1 record matched ·CH2CH=CHCH2CH3 → 1,3-Butadiene + ·CH3
3 records matched CH2=CHCH(CH3)CH2· → 1,3-Butadiene + ·CH3
3 records matched CH2=CHCH(·)CH2CH3 → 1,3-Butadiene + ·CH3
1 record matched Silacyclopent-3-ene,1,1-dimethyl- → 1,3-Butadiene + (CH3)2Si
1 record matched ·CH2C(CH3)=CH2 → 1,3-Butadiene + H·
1 record matched 3-Cyclopenten-1-one → 1,3-Butadiene + CO
1 record matched HCl + CH2=CHCH=CH· → 1,3-Butadiene + ·Cl
1 record matched 4-Ethylcyclohexene → 1-C4H8 + 1,3-Butadiene
2 records matched C2H3 + C2H3 → 1,3-Butadiene
7 records matched CH2=CHCH2CH2· → 1,3-Butadiene + H·
2 records matched Cyclopentadienyl + ·OH → 1,3-Butadiene + CO
1 record matched ·CH2CH=CH2 + ·CH2 → 1,3-Butadiene + H·
2 records matched H2 + CH2=CHCH=CH· → 1,3-Butadiene + H·
2 records matched ClCH2CH2CH=CH2 → 1,3-Butadiene + HCl
3 records matched Cyclobutene → 1,3-Butadiene
1 record matched CH2=CHCH2CH2OH → 1,3-Butadiene + H2O
1 record matched 2-(Z)-C5H10 → CH4 + 1,3-Butadiene
1 record matched 2,5-Dimethylfuran + H· → 1,3-Butadiene + CH3CO
1 record matched 1,2-butadiene + H· → 1,3-Butadiene + H·
5 records matched 1,2-butadiene → 1,3-Butadiene
1 record matched 2-Methylfuran → 1,3-Butadiene + CO
1 record matched 2-butyne → 1,3-Butadiene
1 record matched CH2=C=CH2 + ·CH3 → 1,3-Butadiene + H·
3 records matched Cyclohexene → C2H4 + 1,3-Butadiene
1 record matched 1-butyne → 1,3-Butadiene
1 record matched 1,3-Butadiene + CH3C≡C· → Products
1 record matched 1,3-Butadiene + CH2=CHCH(·)CH3 → Products
1 record matched 1,3-Butadiene + CH2=CHCH(·)CH3 → CH2CHCH(CH3)CH2CH=CHCH2·
1 record matched 1,3-Butadiene + ·CH2 → Vinylcyclopropane
1 record matched 1,3-Butadiene + ·CH2 → CH2=CHCH=CHCH3
1 record matched 1,3-Butadiene + ·CH2 → CH2=C(CH3)CH=CH2
1 record matched 1,3-Butadiene + ·CH2 → Adduct
1 record matched 1,3-Butadiene + CH2OO → Adduct
1 record matched 1,3-Butadiene + CH2=SiHCH3 → Silacylohex-3-ene, 1-methyl-
1 record matched 1,3-Butadiene + ·Cl → Products
1 record matched 1,3-Butadiene + O· → Products
1 record matched 1,3-Butadiene + ·CH2CH=CHCH3 → CH3CH=CHCH2CH2CH=CHCH2·
1 record matched 1,3-Butadiene + ·CH2CH=CHCH3 → CH2CHCH(CH2·)CH2CH=CHCH2
1 record matched 1,3-Butadiene + ·CH2C(CH3)=CH2 → CH2=C(CH3)CH2CH2CH=CHCH2·
1 record matched 1,3-Butadiene + SiH2 → Silacyclopent-3-ene
1 record matched 1,3-Butadiene + ·NH2 → NH2CH2C(·)HCH=CH2
1 record matched 1,3-Butadiene + ·NH2 → ·CH2CH(NH2)CH=CH2
1 record matched 1,3-Butadiene + BO → Products
1 record matched 1,3-Butadiene + H· → CH2=CHCH(·)CH3
1 record matched 1,3-Butadiene + H· → CH2=CHCH(·)CH3
1 record matched 1,3-Butadiene + H· → ·CH2CH=CHCH3
2 records matched 1,3-Butadiene + H· → CH2=CHCH2CH2·
1 record matched 1,3-Butadiene + H· → H2 + CH2=CHC(·)=CH2
3 records matched 1,3-Butadiene + H· → H2 + CH2=CHCH=CH·
1 record matched 1,3-Butadiene + H· → C2H4 + C2H3
1 record matched 1,3-Butadiene + CH2=CHSiH3 → Silacylohex-3-ene, 1-methyl-
1 record matched 1,3-Butadiene + (CH3)2Si → Silacyclopent-3-ene,1,1-dimethyl-
1 record matched 1,3-Butadiene + (CH3)2Si → Adduct
1 record matched 1,3-Butadiene + ·OH → CH2=CHC(·)=CH2
1 record matched 1,3-Butadiene + ·OH → CH2=CHCH=CH·
1 record matched 1,3-Butadiene + ·OH → Adduct
2 records matched 1,3-Butadiene + ·OH → Products
1 record matched 1,3-Butadiene + ·OH → CH2=CHCH(·)CH2OH
1 record matched 1,3-Butadiene + HO2 → H2O2 + CH2=CHC(·)=CH2
2 records matched 1,3-Butadiene + HO2 → H2O2 + CH2=CHCH=CH·
1 record matched 1,3-Butadiene + HO2 → CH2=CHCH2CH2· + O2
2 records matched 1,3-Butadiene + HO2 → Ethenyloxirane + ·OH
1 record matched 1,3-Butadiene + HO2 → CH2=CHCH2CH2OO·
1 record matched 1,3-Butadiene + HO2 → ·CH2CH=CHCH2OOH
1 record matched 1,3-Butadiene + HO2 → CH3CH=CHCH2· + O2
1 record matched 1,3-Butadiene + HO2 → CH2=CHCH(CH3)OO·
1 record matched 1,3-Butadiene + HO2 → CH2=CHCH(CH2·)OOH
1 record matched 1,3-Butadiene + C2H3 → 2,5-Hexadienyl
1 record matched 1,3-Butadiene + C2H3 → Adduct
3 records matched 1,3-Butadiene + C2H3 → Products
1 record matched 1,3-Butadiene + 1-Naphthalenyl → Products
1 record matched 1,3-Butadiene + Phenyl → 1-Phenyl-1,3-butadiene(E)
6 records matched 1,3-Butadiene + Phenyl → H· + 1-Phenyl-1,3-butadiene(E)
1 record matched 1,3-Butadiene + Phenyl → 1,3-Butadienylbenzene + H·
7 records matched 1,3-Butadiene + Phenyl → 1,4-Dihydronaphthalene + H·
1 record matched 1,3-Butadiene + Phenyl → 1,4-Dihydronaphthalene
1 record matched 1,3-Butadiene + Phenyl → Styrene + C2H3
5 records matched 1,3-Butadiene + Phenyl → Indene + ·CH3
1 record matched 1,3-Butadiene + Phenyl → Indene
1 record matched 1,3-Butadiene + Phenyl → 4-Phenylbut-2-enyl
4 records matched 1,3-Butadiene + Phenyl → 1-Phenylbut-3-en-2-yl
3 records matched 1,3-Butadiene + Phenyl → 1-Phenylbut-3-en-2-yl
4 records matched 1,3-Butadiene + Phenyl → 1,4,4a,8a-Tetrahydronaphthalen-4a-yl
4 records matched 1,3-Butadiene + ·CH3 → ·CH2CH=CHCH2CH3
3 records matched 1,3-Butadiene + ·CH3 → CH2=CHCH(CH3)CH2·
1 record matched 1,3-Butadiene + ·CH3 → CH2=CHCH(·)CH2CH3
1 record matched 1,3-Butadiene + CH3O· → CH3OCH2C(·)HCH=CH2
1 record matched 1,3-Butadiene + CH3O· → ·CH2CH(OCH3)CH=CH2
1 record matched 1,3-Butadiene + 1-C3H7 → CH3CH2CH2CH2CH=CHCH2·
1 record matched 1,3-Butadiene + ·C2H5 → CH2=CHCH(C2H5)CH2(·)
1 record matched 1,3-Butadiene + ·C2H5 → CH3CH2CH2CH=CHCH2·
1 record matched 1,3-Butadiene + 2-C3H7 → CH3CH(CH3)CH2CH=CHCH2·
1 record matched 1,3-Butadiene + ·CH2CH=CH2 → Products
1 record matched 1,3-Butadiene + ·CH2CH=CH2 → CH2=CHCH2CH2CH=CHCH2·
1 record matched 1,3-Butadiene + ·CH2CH=CH2 → CH2CHCH(CH2·)CH2CH=CH2
1 record matched 1,3-Butadiene → H· + CH2=CHC(·)=CH2
1 record matched 1,3-Butadiene → H· + CH2=CHCH=CH·
1 record matched 1,3-Butadiene → H· + CH3C≡CCH2·
2 records matched 1,3-Butadiene → C2H3 + C2H3
3 records matched 1,3-Butadiene → ·CH3 + ·CH2C≡CH
1 record matched 1,3-Butadiene → H2 + C2H3CH=C:
1 record matched 1,3-Butadiene → 1,2-butadiene
2 records matched 1,3-Butadiene → 2-butyne
1 record matched 1,3-Butadiene → C2H4 + CH2=C
4 records matched 1,3-Butadiene → C2H4 + C2H2
1 record matched 1,3-Butadiene → Products
1 record matched 1-C4H8 + C2H3 → 1,3-Butadiene + ·C2H5
2 records matched C2H4 + C2H3 → 1,3-Butadiene + H·
4 records matched C2H4 + 1,3-Butadiene → Cyclohexene
1 record matched C2H4 + 1,3-Butadiene → Products
1 record matched CH2O + 1,3-Butadiene → Thiacyclohex-3-ene
1 record matched CH2O + 1,3-Butadiene → 2H-Pyran, 3,6-dihydro-
1 record matched CH2=CHCH2CH(·)CH=CH2 → 1,3-Butadiene + C2H3
2 records matched CH2=CHCH(·)CH2CH2CH3 → 1,3-Butadiene + ·C2H5
1 record matched 4-Phenylbut-2-enyl → 1,3-Butadiene + Phenyl
1 record matched CH2=CHCH2CH2OO· → 1,3-Butadiene + HO2
2 records matched CH2=CHCH(·)CH2CH2CH2CH3 → 1,3-Butadiene + 1-C3H7
1 record matched CH2=CHCH(·)CH2CH(CH3)2 → 1,3-Butadiene + 2-C3H7
1 record matched CH2=CHCH(·)CH2C(O)OCH3 → 1,3-Butadiene + CH3OC(·)(O)
2 records matched 2,5-dihydro-1H-pyrrol-1-ium-1-ylidene) amide → 1,3-Butadiene + N2
1 record matched ·CH2CH2CH2CH(OOH)CH=CH2 → C2H4 + 1,3-Butadiene + HO2
1 record matched 4-Ethyl-5-methylcyclohexene → 1,3-Butadiene + 2-C5H10
1 record matched 4-Ethenyl-1,2-dimethylcyclohexene → 1,3-Butadiene + CH2=C(CH3)C(CH3)=CH2
1 record matched 4-(2-propenyl)cyclohexene → CH2=C(CH3)CH=CH2 + 1,3-Butadiene
1 record matched 1-Methyl-5-vinylcyclohexene → CH2=C(CH3)CH=CH2 + 1,3-Butadiene
1 record matched 4-Methyl-4-vinylcyclohexene → CH2=C(CH3)CH=CH2 + 1,3-Butadiene
1 record matched ·CH2CH2CH2CH2· → 1,3-Butadiene + H2
1 record matched 3-Vinyloxetane → CH2O + 1,3-Butadiene
1 record matched 1-Phenylbut-3-en-2-yl → 1,3-Butadiene + Phenyl
Search returned 491 records.