Kinetics Database Logo     Home
©NIST, 2023
Accessibility information
Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences

Contact Us to Submit an Article

Citation

Help

Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty

More...

Administrative Links

DOC home page

NIST home page

MML home page

Chemical Sciences Division

Applied Chemicals and Materials Division

Search Results

Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
1 record matched O(3P) + Isobutene → Products
1 record matched iso-C4H9 + H· → Isobutene + H2
1 record matched iso-C4H9 + O2 → Isobutene + HO2
1 record matched iso-C4H9 + iso-C4H9 → iso-C4H10 + Isobutene
1 record matched iso-C4H9 → Isobutene + H·
1 record matched (CH3)2C(·)CH2CH3 → Isobutene + ·CH3
1 record matched Neopentyl → Isobutene + ·CH3
1 record matched ·OH + iso-C4H9 → Isobutene + H2O
1 record matched C2H3 + iso-C4H9 → C2H4 + Isobutene
1 record matched (·)CH2OH + iso-C4H9 → CH3OH + Isobutene
1 record matched ·CH3 + iso-C4H9 → CH4 + Isobutene
1 record matched 1-C3H7 + iso-C4H9 → C3H8 + Isobutene
1 record matched ·C2H + iso-C4H9 → C2H2 + Isobutene
1 record matched ·C2H5 + iso-C4H9 → C2H6 + Isobutene
1 record matched 2-C3H7 + iso-C4H9 → C3H8 + Isobutene
1 record matched ·CH2CH=CH2 + iso-C4H9 → CH3CH=CH2 + Isobutene
1 record matched tert-C4H9 + ·CH2 → Isobutene + ·CH3
1 record matched tert-C4H9 + O· → Isobutene + ·OH
1 record matched tert-C4H9 + H· → Isobutene + H2
1 record matched tert-C4H9 + O2 → Isobutene + HO2
1 record matched tert-C4H9 + iso-C4H9 → iso-C4H10 + Isobutene
1 record matched tert-C4H9 + ·OH → Isobutene + H2O
1 record matched tert-C4H9 + C2H3 → C2H4 + Isobutene
1 record matched tert-C4H9 + (·)CH2OH → CH3OH + Isobutene
1 record matched tert-C4H9 + ·CH3 → CH4 + Isobutene
1 record matched tert-C4H9 + 1-C3H7 → C3H8 + Isobutene
1 record matched tert-C4H9 + ·C2H → C2H2 + Isobutene
1 record matched tert-C4H9 + ·C2H5 → C2H6 + Isobutene
1 record matched tert-C4H9 + 2-C3H7 → C3H8 + Isobutene
1 record matched tert-C4H9 + ·CH2CH=CH2 → CH3CH=CH2 + Isobutene
1 record matched tert-C4H9 + tert-C4H9 → iso-C4H10 + Isobutene
2 records matched tert-C4H9 → Isobutene + H·
1 record matched (CH3)3CCH2CH=CH2 → CH3CH=CH2 + Isobutene
1 record matched tert-C4H9I → Isobutene + HI
1 record matched tert-C4H9Br → Isobutene + HBr
1 record matched Isobutene + ·Cl → Products
1 record matched Isobutene + N → Products
3 records matched Isobutene + O· → Products
2 records matched Isobutene + H· → iso-C4H9
2 records matched Isobutene + H· → tert-C4H9
1 record matched Isobutene + NO3 → Products
1 record matched Isobutene + O3 → Other Products + ·OH
2 records matched Isobutene + O3 → Products
1 record matched Isobutene + Se → Adduct
1 record matched Isobutene + S → Thiirane, 2,2-dimethyl-
1 record matched Isobutene + ·CCl → Adduct
1 record matched Isobutene + NF2 → (CH3)2CCH2NF2
2 records matched Isobutene + ·OH → Products
1 record matched Isobutene + HO2 → Products
1 record matched Isobutene + ·CF3 → Products
1 record matched Isobutene + ·CH3 → (CH3)2C(·)CH2CH3
1 record matched Isobutene + ·CH3 → Neopentyl
1 record matched Isobutene + ·CH3 → Products
1 record matched CH2=CHCH2NHSC(CH3)3 → Other Products + Isobutene
1 record matched Disulfide 1,1-dimethylethyl 4-fluorophenyl → Isobutene + Benzenesulfenothioic acid, 4-fluoro-
1 record matched Disulfide 1,1-dimethylethyl 4-nitrophenyl → Isobutene + Benzenesulfenothioic acid, 4-nitro-
1 record matched 3-Furancarboxylic acid 1,1-dimethylethyl ester → Isobutene + 3-Furancarboxylic acid
1 record matched 3-Thiophenecarboxylic acid 1,1-dimethylethyl ester → 3-Thiophenecarboxylic acid + Isobutene
2 records matched CH3C(S)OC(CH3)3 → Isobutene + CH3COSH
2 records matched (CH3)2CCH2NF2 → Isobutene + NF2
1 record matched Cyclobutane, 2-ethenyl-1,1-dimethyl- → 1,3-Butadiene + Isobutene
1 record matched Pyrimidine, 2-(1,1-dimethylethoxy)- → Isobutene + 2(1H)-Pyrimidinone
1 record matched Disulfide 1,1-dimethylethyl 4-chlorophenyl → Isobutene + Benzenesulfenothioic acid, p-chloro-
1 record matched t-C4H9C(N(O)=NOCH3 → Isobutene + CO + NH3 + HNO
1 record matched Pyridine, 2-(1,1-dimethylethoxy)- → Isobutene + 2(1H)-Pyridinone
1 record matched CH3OC(S)SC(CH3)3 → Isobutene + CH3OC(S)SH
2 records matched (CH3)2C(CH2OOH)CH2· → Isobutene + ·CH2OOH
1 record matched 4-Pyridinecarboxylic acid 1,1-dimethylethyl ester → 4-Pyridinecarboxylic acid + Isobutene
1 record matched Pyrazine,(1,1-dimethylethoxy)- → Isobutene + 2(1H)-Pyrazinone
1 record matched CH3C(S)SC(CH3)3 → Isobutene + CH3C(S)SH
1 record matched (CH3)3SiC(O)OC(CH3)3 → Isobutene + (CH3)3SiCOOH
2 records matched (CH3)3CCH2C(O)OC(CH3)3 → Isobutene + (CH3)3CCH2COOH
1 record matched Benzeneacetic acid, 3-chloro-, 1,1-dimethylethyl ester → Isobutene + m-chlorophenylacetic acid
1 record matched Benzeneacetic acid, 4-fluoro-, 1,1-dimethylethyl ester → Isobutene + Benzeneacetic acid, 4-fluoro-
1 record matched 3-Pyridinecarboxylic acid 1,1-dimethylethyl ester → 3-Pyridinecarboxylic acid + Isobutene
1 record matched Benzeneacetic acid 3-methyl-, 1,1-dimethylethyl ester → Isobutene + Benzeneacetic acid, 3-methyl-
1 record matched Carbamic acid, (3-methoxyphenyl)-, 1,1-dimethylethyl ester → Isobutene + CO2 + 3-Methoxybenzenamine
1 record matched t-C4H9OCH2CN → HOCH2CN + Isobutene
2 records matched Benzoic acid, 3-nitro-, 1,1-dimethylethyl ester → Isobutene + 3-Nitrobenzoic acid
2 records matched Benzoic acid, 4-fluoro-, 1,1-dimethylethyl ester → Isobutene + 4-Fluorobenzoic acid
2 records matched Benzoic acid, 3-methoxy-, 1,1-dimethylethyl ester → Isobutene + 3-Methoxybenzoic acid
1 record matched Benzenamine, 4-(1,1-dimethylethoxy)- → Isobutene + Phenol, 4-amino-
1 record matched CH3C(S)OCH2CH(CH3)2 → Isobutene + CH3COSH
1 record matched CH3C≡C(CH2)2CH(CH3)2 → Isobutene + 1,2-butadiene
1 record matched Benzamide, N-(1,1-dimethylethyl)-3-methoxy- → Isobutene + Benzamide, 3-methoxy-
1 record matched t-C4H9SCH2CN → Isobutene + HSCH2CN
1 record matched CHCl2C(O)OC(CH3)3 → CHCl2COOH + Isobutene
1 record matched Benzamide, 4-chloro-N-(1,1-dimethylethyl)- → Isobutene + Benzamide, 4-chloro-
1 record matched Benzamide, N-(1,1-dimethylethyl)-3-methyl- → Isobutene + Benzamide, 3-methyl-
1 record matched Benzamide, N-(1,1-dimethylethyl)-4-nitro- → Other Products + Isobutene
2 records matched (CH3)3CSC(O)OCH3 → Isobutene + CH3OC(O)SH
1 record matched Benzamide, 3-chloro-N-(1,1-dimethylethyl)- → Isobutene + Benzamide, 3-chloro-
3 records matched (t-C4H9O)2C(O) → Isobutene + (CH3)3COC(O)OH
1 record matched Benzeneacetic acid, 4-methoxy-, 1,1-dimethylethyl ester → Benzeneacetic acid, 4-methoxy- + Isobutene
1 record matched benzene acetic acid, 4-methyl-,(1,1-dimethylethyl ester) → Isobutene + p-tolylacetic acid
1 record matched Benzeneacetic acid, 4-chloro-, 1,1-dimethylethyl ester → Isobutene + Benzeneacetic acid, 4-chloro-
1 record matched Cyclobutane, 1,1,2-trimethyl- → CH3CH=CH2 + Isobutene
1 record matched t-C4H9OC(O)OCH3 → Isobutene + CH3OC(O)OH
1 record matched Benzeneacetic acid, 4-nitro-1,1,-dimethylethyl ester → Benzeneacetic acid, 4-nitro- + Isobutene
1 record matched (CH3)3COC(O)SCH3 → Isobutene + CH3OC(O)SH
1 record matched (C2H5)2NSC(CH3)3 → Other Products + Isobutene
1 record matched Cyclobutane, 1,1,3,3-tetramethyl- → Isobutene + Isobutene
1 record matched (CH3)3CC(CH3)2CH2 → Isobutene + tert-C4H9
2 records matched CH3C(S)NHC(CH3)3 → CH3CSNH2 + Isobutene
2 records matched C2H5C(O)OC(CH3)3 → C2H5COOH + Isobutene
2 records matched Benzoic acid, 4-nitro-, 1,1-dimethylethyl ester → 4-Nitrobenzoic acid + Isobutene
1 record matched Benzamide, N-(1,1-dimethylethyl)-4-methoxy- → Isobutene + Benzamide, 4-methoxy-
1 record matched Carbamic acid, (4-methoxyphenyl)-, 1,1-dimethylethyl ester → 4-Methoxybenzeneamine + Isobutene + CO2
1 record matched Carbamic acid, (3-methylphenyl)-, 1,1-dimethylethyl ester → 3-Methylbenzenamine + Isobutene + CO2
1 record matched CH3OCH2C(O)OC(CH3)3 → Isobutene + CH3OCH2COOH
2 records matched Carbamic acid, (1,1-dimethylethyl)-, phenyl ester → Isobutene + Carbamic acid phenyl ester
1 record matched (i-C3H7)O(t-C4H9) → iso-C3H7OH + Isobutene
1 record matched (CH3)3CS· + (CH3)3CS· → Other Products + Isobutene
1 record matched (CH3)2CHCH2C(O)OC(CH3)3 → Isobutene + iso-C4H9COOH
1 record matched C2H5CH(CH3)CH2C(CH3)=CH2 → 1-C4H8 + Isobutene
1 record matched 2-Furancarboxylic acid 1,1-dimethylethyl ester → 2-Furancarboxylic acid + Isobutene
2 records matched Benzoic acid, 3-methyl-, 1,1-dimethylethyl ester → 3-Methylbenzoic acid + Isobutene
2 records matched Benzoic acid, 3-chloro-, 1,1-dimethylethyl ester → Isobutene + Benzoic acid, 3-chloro-
2 records matched Benzeneacetic acid 1,1-dimethylethyl ester → Benzeneacetic acid + Isobutene
2 records matched (CH3)3CC(O)OC(CH3)3 → tert-C4H9COOH + Isobutene
1 record matched CHCl2C(O)NC(CH3)3 → Other Products + Isobutene
1 record matched 1H-Pyrazole, 1-(1,1-dimethylethyl)- → Isobutene + Pyrazole
1 record matched CH2ClC(O)NC(CH3)3 → Other Products + Isobutene
1 record matched Benzenamine, N-(1,1-dimethylethyl)-4-methoxy- → 4-Methoxybenzeneamine + Isobutene
1 record matched Benzene, 1-(1,1-dimethylethoxy)-4-methoxy- → Isobutene + 4-Methoxyphenol
1 record matched Carbamic acid, (4-methylphenyl)-, 1,1-dimethylethyl ester → 4-Methylbenzenamine + Isobutene + CO2
2 records matched Benzoic acid, 4-methyl-, 1,1-dimethylethyl ester → 4-Methylbenzoic acid + Isobutene
1 record matched CH2ClC(CH3)2COOH → Isobutene + CO2 + HCl
1 record matched ClCH2C(CH3)2CH2OH → CH2O + Isobutene + HCl
1 record matched (CH3)2NC(O)OC(CH3)3 → Isobutene + (CH3)2NC(O)OH
1 record matched (CH3)2NC(O)OC(CH3)3 → Isobutene + CO2 + (CH3)2NH
1 record matched Benzene, [[(1,1-dimethylethyl)thio]methyl]- → Benzene methanethiol + Isobutene
1 record matched Benzene,1-(1,1-dimethylethylthio)-4-nitro- → Isobutene + Benzenethiol, 4-nitro-
1 record matched 3,3-dimethyl-oxetane → CH2O + Isobutene
2 records matched Benzene, (1,1-dimethylethoxy)- → Phenol + Isobutene
3 records matched Carbonic acid 1,1-dimethylphenyl ester → Isobutene + Carbonic acid monophenyl ester
1 record matched 2,2-dimethyl-oxetane → CH2O + Isobutene
1 record matched Benzamide, N-(1,1-dimethylethyl)- → Benzamide + Isobutene
1 record matched C6H5CH2OCH2C(CH3)=CH2 → Benzaldehyde + Isobutene
1 record matched BrCH2C(O)OC(CH3)3 → CH2BrCOOH + Isobutene
1 record matched Cyclopropaneacetic acid → Isobutene + CO2
5 records matched iso-C4H9 + O2 → Isobutene + HO2
6 records matched iso-C4H9 + iso-C4H9 → iso-C4H10 + Isobutene
1 record matched iso-C4H9 → Isobutene + H·
1 record matched Cyclobutanone, 2,2,4,4-tetramethyl- → Isobutene + (CH3)2C=C=O
1 record matched tert-C4H9AsH2 → Isobutene + AsH3
1 record matched Benzenamine, N-(1,1-dimethylethyl)-4-nitro- → 4-Nitrobenzenamine + Isobutene
8 records matched Neopentyl → Isobutene + ·CH3
2 records matched Carbamic acid, phenyl-, 1,1-dimethylethyl ester → aniline + Isobutene + CO2
1 record matched Benzene, [(1,1-dimethylethyl)thio]- → Benzenethiol + Isobutene
1 record matched Disulfide 1,1-dimethylethyl phenyl → Isobutene + C6H5SSH
1 record matched CH3C(O)SCH2CH(CH3)2 → Isobutene + CH3COSH
1 record matched CH3CH2CH2C(O)OC(CH3)3 → n-C3H7COOH + Isobutene
1 record matched (CH3)2CH(CH2)2C≡CH → Isobutene + CH2=C=CH2
1 record matched Benzene,1-(1,1-dimethylethoxy)-4-nitro- → 4-Nitrophenol + Isobutene
2 records matched ·C2H5 + iso-C4H9 → C2H6 + Isobutene
1 record matched Cl3CC(O)OC(CH3)3 → CCl3COOH + Isobutene
5 records matched tert-C4H9OCH3 → CH3OH + Isobutene
1 record matched CH2=C(CH3)CH2COOH → Isobutene + CO2
2 records matched t-C4H9NCO → HN=C=O + Isobutene
1 record matched tert-C4H9 + (CH3)3Si· → Isobutene + (CH3)3SiH
1 record matched tert-C4H9 + H· → Isobutene + H2
2 records matched tert-C4H9 + O2 → Isobutene + HO2
1 record matched tert-C4H9 + NF2 → Isobutene + HNF2
1 record matched tert-C4H9 + sec-C4H9 → 1-C4H10 + Isobutene
3 records matched tert-C4H9 + ·CH3 → CH4 + Isobutene
4 records matched tert-C4H9 + ·C2H5 → C2H6 + Isobutene
2 records matched tert-C4H9 + 2-C3H7 → C3H8 + Isobutene
14 records matched tert-C4H9 + tert-C4H9 → iso-C4H10 + Isobutene
4 records matched tert-C4H9 → Isobutene + H·
1 record matched 1-Propyne,3-(1,1-dimethylethylthio)- → Isobutene + Propyne-1-thiol
1 record matched H2 + ·CH2C(CH3)=CH2 → Isobutene + H·
1 record matched Cyclobutanone, 3,3-dimethyl- → Isobutene + H2C=C=O
1 record matched NCCH2C(O)OC(CH3)3 → Isobutene + NCCH2COOH
2 records matched CH3C(O)SC(CH3)3 → Isobutene + CH3COSH
1 record matched 2-Thiophenecarboxylic acid 1,1-dimethylethyl ester → Isobutene + 2-Thiophenecarboxylic acid
1 record matched Benzenamine, N-(1,1-dimethylethyl)- → aniline + Isobutene
3 records matched t-C4H9OCH=CH2 → CH3CHO + Isobutene
2 records matched Benzoic acid, 4-methoxy-, 1,1-dimethylethyl ester → 4-Methoxybenzoic acid + Isobutene
4 records matched Benzoic acid 1,1-dimethylethyl ester → Benzoic acid + Isobutene
1 record matched CH2=C(CH3)CH2CH2OH → CH2O + Isobutene
1 record matched C2H5CH2C(CH3)=CH2 → C2H4 + Isobutene
1 record matched CH3C(O)NHC(CH3)3 → CH3C(O)NH2 + Isobutene
1 record matched CH3C(O)NHC(CH3)3 → Other Products + Isobutene
1 record matched HC(O)OC(CH3)3 → HCOOH + Isobutene
1 record matched (CH3)3CCH2CH=CH2 → CH3CH=CH2 + Isobutene
2 records matched Benzoic acid, 4-chloro-, 1,1-dimethylethyl ester → Benzoic acid, 4-chloro- + Isobutene
4 records matched tert-C4H9OC2H5 → C2H5OH + Isobutene
2 records matched (CH3)3C-CN → HCN + Isobutene
1 record matched 2,2,3,3-Tetramethylbutane → iso-C4H10 + Isobutene
1 record matched (CH3)3CNO2 → Isobutene + HNO2
3 records matched Methylcyclopropane → Isobutene
4 records matched tert-C4H9I → Isobutene + HI
7 records matched CH3C(O)OC(CH3)3 → CH3C(O)OH + Isobutene
3 records matched (CH3)3CONO → Isobutene + HNO2
1 record matched (iso-C4H9O)2C(O) → Isobutene + (CH3)2CHCH2OC(O)OH
1 record matched iso-C4H9Cl → Isobutene + HCl
9 records matched tert-C4H9Cl → Isobutene + HCl
6 records matched tert-C4H9Br → Isobutene + HBr
1 record matched neo-C5H12 → Isobutene + ·CH3 + H·
1 record matched CF3C(O)OC(CH3)3 → CF3COOH + Isobutene
2 records matched (CH3)2CHCH2F → Isobutene + HF
1 record matched CH3COO(CH2)3CH3 → CH3C(O)OH + Isobutene
1 record matched Isobutene + CH3GeH → Products
1 record matched Isobutene + ·CH2 → C2H5C(CH3)=CH2
1 record matched Isobutene + ·CH2 → Products
1 record matched Isobutene + CH2OO → Products
1 record matched Isobutene + CH3C(O)OO(·) → 2,2-Dimethyloxirane + CH3C(O)O·
1 record matched Isobutene + CH3C(O)OO(·) → Products
2 records matched Isobutene + :GeH2 → Products
7 records matched Isobutene + ·Cl → Products
1 record matched Isobutene + CF3O → Other Products + CF3OH
2 records matched Isobutene + CF3O → Adduct
2 records matched Isobutene + SiCl3 → Adduct
4 records matched Isobutene + N → Products
1 record matched Isobutene + O· → ·CH3 + CH3C(·)HCHO
3 records matched Isobutene + O· → 2,2-Dimethyloxirane
13 records matched Isobutene + O· → Products
1 record matched Isobutene + D → (CH3)2CCH2D
2 records matched Isobutene + D → Products
1 record matched Isobutene + ·F → Other Products + HF
1 record matched Isobutene + SiH2 → Adduct
1 record matched Isobutene + SiH2 → c-SiH2CH2C(CH3)2
1 record matched Isobutene + ·NH2 → Products
1 record matched Isobutene + SiCl2 → Adduct
2 records matched Isobutene + ·CHF → Products
8 records matched Isobutene + H· → tert-C4H9
1 record matched Isobutene + H· → H2 + CH2=CHCH(·)CH3
1 record matched Isobutene + H· → H2 + ·CH2C(CH3)=CH2
2 records matched Isobutene + H· → CH3CH=CH2 + ·CH3
6 records matched Isobutene + H· → Adduct
16 records matched Isobutene + H· → Products
3 records matched Isobutene + C3 → Products
2 records matched Isobutene + C2O → Products
1 record matched Isobutene + NO3 → 2,2-Dimethyloxirane + NO2
8 records matched Isobutene + NO3 → Products
1 record matched Isobutene + NO2 → Products
1 record matched Isobutene + HBr → tert-C4H9Br
1 record matched Isobutene + HBr → iso-C4H9Br
1 record matched Isobutene + HI → tert-C4H9I
2 records matched Isobutene + O3 → Other Products + ·OH
16 records matched Isobutene + O3 → Products
2 records matched Isobutene + Se → Adduct
1 record matched Isobutene + O2 → HO2 + ·CH2C(CH3)=CH2
2 records matched Isobutene + S → Thiirane, 2,2-dimethyl-
1 record matched Isobutene + HCl → tert-C4H9Cl
1 record matched Isobutene + Y → Products
2 records matched Isobutene + V → Products
1 record matched Isobutene + Hf → Products
1 record matched Isobutene + Au → Products
2 records matched Isobutene + Ti → Products
1 record matched Isobutene + Ta → Products
1 record matched Isobutene + Si → Products
2 records matched Isobutene + Sc → Products
1 record matched Isobutene + Rh → Products
1 record matched Isobutene + Pt → Products
1 record matched Isobutene + Pd → Products
1 record matched Isobutene + Ni → Ni(iso-C4H8)
2 records matched Isobutene + Ni → Products
1 record matched Isobutene + Ir → Products
1 record matched Isobutene + (CH3)2Si → Products
1 record matched Isobutene + iso-C4H9 → iso-C4H10 + ·CH2C(CH3)=CH2
1 record matched Isobutene + (CH3)2CHO2 → 2,2-Dimethyloxirane + (CH3)2CHO·
1 record matched Isobutene + (CH3)2C(·)CH2CH3 → (CH3)2C(·)CH2C(CH3)2CH2CH3
1 record matched Isobutene + CBr → Products
2 records matched Isobutene + ·CCl → Products
2 records matched Isobutene + CF → Products
3 records matched Isobutene + NF2 → (CH3)2CCH2NF2
1 record matched Isobutene + (CH3)3CO2 → 2,2-Dimethyloxirane + (CH3)3CO·
1 record matched Isobutene + ·OH + NO → Products
2 records matched Isobutene + ·OH → H2O + ·CH2C(CH3)=CH2
2 records matched Isobutene + ·OH → (CH3)2C(·)CH2OH
2 records matched Isobutene + ·OH → (CH3)2C(OH)CH2·
9 records matched Isobutene + ·OH → Products
1 record matched Isobutene + ·OH → (CH3)2C=CH· + H2O
2 records matched Isobutene + (CH3)3CO· → tert-C4H9OH + ·CH2C(CH3)=CH2
2 records matched Isobutene + C2H3 → Products
1 record matched Isobutene + HCO → Products
1 record matched Isobutene + CH3C(O)OONO2 → Products
2 records matched Isobutene + ·CF3 → Adduct
2 records matched Isobutene + ·CF3 → CF3CH2C(·)(CH3)2
2 records matched Isobutene + ·CF3 → (CH3)2C(CF3)CH2·
1 record matched Isobutene + ·CH3 → (CH3)2C(·)CH2CH3
1 record matched Isobutene + ·CH3 → Neopentyl
6 records matched Isobutene + ·CH3 → CH4 + ·CH2C(CH3)=CH2
1 record matched Isobutene + ·CH3 → Other Products + CH4
1 record matched Isobutene + ·CH3 → Adduct
1 record matched Isobutene + ·CF2 → Cyclopropane,1,1-difluoro-2,2-dimethyl-
1 record matched Isobutene + CH3O· → Other Products + CH3OH
1 record matched Isobutene + CH3O2· → 2,2-Dimethyloxirane + CH3O·
1 record matched Isobutene + ·C2H → CH3CH=CHC≡CH + ·CH3
1 record matched Isobutene + ·C2H → (CH3)2C=CH-C≡CH + H·
1 record matched Isobutene + ·C2H → CH2=C(CH3)C≡CH + ·CH3
1 record matched Isobutene + ·C2H → Other Products + C2H2
3 records matched Isobutene + ·C2H → Products
1 record matched Isobutene + CD3 → Other Products + CHD3
1 record matched Isobutene + 2-C3H7 → (CH3)2CHCH2C(·)(CH3)2
1 record matched Isobutene + Isobutene → iso-C4H9 + ·CH2C(CH3)=CH2
1 record matched Isobutene + Isobutene → tert-C4H9 + ·CH2C(CH3)=CH2
4 records matched Isobutene → H· + ·CH2C(CH3)=CH2
1 record matched Isobutene → ·CH3 + CH2=C(·)CH3
1 record matched Isobutene → ·CH2CH=CH2 + ·CH3
2 records matched Isobutene → Products
1 record matched isobutyl acetate → CH3C(O)OH + Isobutene
1 record matched (CH3)2CHCH2CH2COCH3 → Acetone + Isobutene
1 record matched (CH3)2CHCH2OCH=CH2 → CH3CHO + Isobutene
2 records matched ClCH2C(O)OC(CH3)3 → CH2ClCOOH + Isobutene
1 record matched CH3C(O)OOH + Isobutene → CH3C(O)OH + 2,2-Dimethyloxirane
1 record matched iso-C4H9OH → Isobutene + H2O
2 records matched iso-C4H9Br → Isobutene + HBr
1 record matched tert-C4H9SH → Isobutene + H2S
11 records matched tert-C4H9OH → Isobutene + H2O
1 record matched tert-C4H9NH2 → Isobutene + NH3
1 record matched C2H4 + Isobutene → C2H5CH2C(CH3)=CH2
1 record matched CN + Isobutene → (CH3)2C=CHCN + H·
2 records matched CN + Isobutene → Products
2 records matched O(1D) + Isobutene → Products
1 record matched O2(1DELTA) + Isobutene → Products
2 records matched (CH3)3CF → Isobutene + HF
1 record matched (CH3)2NSC(CH3)3 → (CH3)2NSH + Isobutene
1 record matched 2-Propanesulfenamide, 2-methyl-(2,6-dimethylpiperidyl)- → Sulfenamide, (2,6-dimethylpiperidyl)- + Isobutene
1 record matched (CH3)3CNHSC(CH3)3 → (CH3)3CNHSH + Isobutene
1 record matched (·)CH2C(CH3)2OOH → Isobutene + HO2
1 record matched CF2(a~3B1) + Isobutene → Products
1 record matched ·CH2C(CH3)2OH → Isobutene + ·OH
1 record matched (CH3CH2)2NCO(O)C(CH3)3 → (C2H5)2NH + Isobutene + CO2
1 record matched tert-Butyl-1-pyrrole carboxylate → Pyrrole + Isobutene + CO2
1 record matched 1-(tert-Butoxycarbonyl)-2-pyrrolidinone → Isobutene + CO2 + 2-Pyrrolidinone
1 record matched tert-Butyl-1-pyrrolidine carboxylate → Isobutene + Pyrrolidine + CO2
2 records matched (CH3)2C(·)CH2CH2CH3 → Isobutene + ·C2H5
1 record matched 5-tert-butylcyclopenta-1,3-diene → Isobutene + Cyclopentadiene
1 record matched (CH3)2C(CH2OOH)CH2· → Isobutene + HO2
2 records matched (CH3)2C(CH2OOH)CH2· → CH2O + Isobutene + ·OH
1 record matched (CH3)2CHCH2O2 → Isobutene + HO2
1 record matched (CH3)3C-C(·)(CH3)2 → Isobutene + 2-C3H7
1 record matched CH2ClC(CH3)2COOH → Isobutene + CO2 + HCl
1 record matched 2,2-dimethyl-oxetane → CH2O + Isobutene
1 record matched (CH3)2C(·)CH2OH → Isobutene + ·OH
1 record matched iso-C4H9 + O2 → Isobutene + HO2
2 records matched iso-C4H9 → Isobutene + H·
3 records matched (CH3)2C(·)CH2CH3 → Isobutene + ·CH3
2 records matched Neopentyl + O2 → CH2O + Isobutene + ·OH
6 records matched Neopentyl → Isobutene + ·CH3
2 records matched (CH3)3CO2 → Isobutene + HO2
1 record matched HO2 + ·CH2C(CH3)=CH2 → Isobutene + O2
2 records matched tert-C4H9 + O· → Isobutene + ·OH
1 record matched tert-C4H9 + NO → Isobutene + HNO
1 record matched tert-C4H9 + CD3 → Isobutene + CHD3
1 record matched tert-C4H9 + tert-C4H9 → iso-C4H10 + Isobutene
1 record matched tert-C4H9 → Isobutene + H·
2 records matched 2,4-dimethylpenta-1,3-diene + ·CH3 → Isobutene + ·CH2C(CH3)=CH2
1 record matched CH2=C(CH3)CH2CH2OH → CH2O + Isobutene
1 record matched iso-C4H9I → Isobutene + HI
1 record matched Isobutene + CH2OO → Products
2 records matched Isobutene + ·Cl → Products
1 record matched Isobutene + O· → ·OH + ·CH2C(CH3)=CH2
1 record matched Isobutene + O· → Products
2 records matched Isobutene + ·CH2C(CH3)=CH2 → 2,4-dimethylpenta-1,3-diene + ·CH3
2 records matched Isobutene + ·CH2C(CH3)=CH2 → Isobutene + ·CH2C(CH3)=CH2
2 records matched Isobutene + ·CH2C(CH3)=CH2 → Products
1 record matched Isobutene + ·CH2C(CH3)=CH2 → CH2=C(CH3)CH2CH2C(·)(CH3)2
1 record matched Isobutene + ·CH2C(CH3)=CH2 → CH2=C(CH3)CH2C(CH3)2CH2·
2 records matched Isobutene + ·CH2C(CH3)=CH2 → (CH3)2C=CHC(CH3)2CH2·
2 records matched Isobutene + ·CH2C(CH3)=CH2 → ·CH2C(CH3)2CH2C(CH3)=CH2
2 records matched Isobutene + ·CH2C(CH3)=CH2 → (CH3)3CCH(·)C(CH3)=CH2
2 records matched Isobutene + ·CH2C(CH3)=CH2 → (CH3)3CCH2C(CH3)=CH·
2 records matched Isobutene + ·CH2C(CH3)=CH2 → (CH3)3CCH2C(=CH2)CH2·
1 record matched Isobutene + SH → Adduct
1 record matched Isobutene + ·NH2 → NH2CH2C(·)(CH3)2
1 record matched Isobutene + ·NH2 → ·CH2C(CH3)2NH2
2 records matched Isobutene + H· → iso-C4H9
4 records matched Isobutene + H· → tert-C4H9
2 records matched Isobutene + H· → H2 + ·CH2C(CH3)=CH2
1 record matched Isobutene + H· → Products
1 record matched Isobutene + H· → (CH3)2C=CH· + H2
2 records matched Isobutene + NO3 → Products
1 record matched Isobutene + NO2 → HNO2 + ·CH2C(CH3)=CH2
1 record matched Isobutene + NO2 → cis-HONO + ·CH2C(CH3)=CH2
1 record matched Isobutene + NO2 → trans-HONO + ·CH2C(CH3)=CH2
1 record matched Isobutene + N2F4 → Propane, 1,2-bis(difluoroamino)-2-methyl-
1 record matched Isobutene + O3 → Acetone + CH2OO
1 record matched Isobutene + O3 → CH2O + (CH3)2C(·)OO·
2 records matched Isobutene + O2 → HO2 + ·CH2C(CH3)=CH2
1 record matched Isobutene + HF → (CH3)2CHCH2F
1 record matched Isobutene + HF → (CH3)3CF
1 record matched Isobutene + CH3S· → Adduct
4 records matched Isobutene + ·OH → H2O + ·CH2C(CH3)=CH2
2 records matched Isobutene + ·OH → (CH3)2C(·)CH2OH
2 records matched Isobutene + ·OH → Adduct
1 record matched Isobutene + ·OH → Products
4 records matched Isobutene + ·OH → (CH3)2C=CH· + H2O
1 record matched Isobutene + ·OH → ·CH2C(CH3)2OH
1 record matched Isobutene + HO2 → (CH3)2CHCH2O2
1 record matched Isobutene + HO2 → H2O2 + ·CH2C(CH3)=CH2
3 records matched Isobutene + HO2 → (CH3)3CO2
4 records matched Isobutene + HO2 → (·)CH2C(CH3)2OOH
1 record matched Isobutene + HO2 → (CH3)2C=CH· + H2O2
2 records matched Isobutene + HO2 → (CH3)2C(·)CH2OOH
1 record matched Isobutene + C2H3 → (CH3)2C=CHCH=CH2 + H·
1 record matched Isobutene + C2H3 → CH2=C(CH3)CH=CH2 + ·CH3
1 record matched Isobutene + C2H3 → C2H4 + ·CH2C(CH3)=CH2
1 record matched Isobutene + C2H3 → CH2=CHCH2C(·)(CH3)2
2 records matched Isobutene + ·CH3 → (CH3)2C(·)CH2CH3
2 records matched Isobutene + ·CH3 → Neopentyl
4 records matched Isobutene + ·CH3 → CH4 + ·CH2C(CH3)=CH2
1 record matched Isobutene + ·CH3 → Adduct
1 record matched Isobutene + ·CH3 → (CH3)2C=CH· + CH4
1 record matched Isobutene + CH3O· → Adduct
1 record matched Isobutene + CH3O· → CH3OCH2C(·)(CH3)2
1 record matched Isobutene + CH3O· → ·CH2C(CH3)2OCH3
1 record matched Isobutene + ·C2H5 → Adduct
1 record matched CH3CH=CH2 + ·CH2 → Isobutene
1 record matched Toluene + ·CH2C(CH3)=CH2 → Isobutene + Benzyl
2 records matched iso-C4H9OH → Isobutene + H2O
1 record matched iso-C4H9Br → Isobutene + HBr
1 record matched tert-C4H9SH → Isobutene + H2S
1 record matched tert-C4H9OH → Isobutene + H2O
1 record matched C2H4 + tert-C4H9 → Isobutene + ·C2H5
1 record matched Acetone + Isobutene → CH2=C(CH3)CH2C(CH3)2OH
1 record matched CH2O + Isobutene → CH3CH=CHCH2CH2OH
1 record matched (·)CH2C(CH3)2OOH → Isobutene + HO2
1 record matched O(3P) + Isobutene → Products
1 record matched O2(1Delta_g) + Isobutene → CH2=C(CH3)CH2OOH
1 record matched C6H5C(CH3)2CH2· → Isobutene + Phenyl
1 record matched CH2=C(CH3)CH2C(CH3)2OH → Acetone + Isobutene
1 record matched CH3CH2CH2CH2C(·)(CH3)2 → Isobutene + 1-C3H7
1 record matched (CH3)3CS(O)SC(CH3)3 → (CH3)3CSSOH + Isobutene
1 record matched (CH3)3CS(O)SC(CH3)3 → (CH3)3CS(S)OH + Isobutene
1 record matched (CH3)3CSSOH → trans-HSSOH + Isobutene
1 record matched (CH3)3CSSOH → cis-HSSOH + Isobutene
1 record matched (CH3)3CSSOH → SSHOH + Isobutene
1 record matched (CH3)3CS(S)OH → trans-HSSOH + Isobutene
1 record matched (CH3)3CS(S)OH → cis-HSSOH + Isobutene
1 record matched ·CH2C(CH3)2CH2OOH → CH2O + Isobutene + ·OH
1 record matched ·CH2C(CH3)2OH → Isobutene + ·OH
1 record matched ·CH2C(CH3)2CH2C(OOH)(CH3)2 → ·CH2C(CH3)2CH2OOH + Isobutene
1 record matched CH2=C(CH3)CH2CH2C(·)(CH3)2 → Isobutene + ·CH2C(CH3)=CH2
2 records matched (CH3)2C=CHC(CH3)2CH2· → Isobutene + ·CH2C(CH3)=CH2
3 records matched ·CH2C(CH3)2CH2C(CH3)=CH2 → Isobutene + ·CH2C(CH3)=CH2
2 records matched (CH3)3CCH(·)C(CH3)=CH2 → Isobutene + ·CH2C(CH3)=CH2
2 records matched (CH3)3CCH2C(CH3)=CH· → Isobutene + ·CH2C(CH3)=CH2
2 records matched (CH3)3CCH2C(=CH2)CH2· → Isobutene + ·CH2C(CH3)=CH2
1 record matched 1,3,3-trimethylcyclopentyl → Isobutene + ·CH2C(CH3)=CH2
1 record matched (CH3)2C(·)CH2OOH → Isobutene + HO2
1 record matched (CH3)2C(·)CH2CH2OOH → CH2O + Isobutene + ·OH
1 record matched (CH3CH2)2NCO(O)C(CH3)3 → iso-C4H9NH2 + Isobutene + CO2
1 record matched (CH3)2NCOOC(CH3)3 → Isobutene + CO2 + (CH3)2NH
1 record matched O(3P) + Isobutene → Products
Search returned 752 records.