Kinetics Database Logo

Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences

Feedback

Rate Our Products and Services

Help


Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty

More...


Administrative Links

NIST home page

MML home page

Chemical Sciences Division

  NIST Logo Home
©NIST, 2013
Accessibility information

Search Results


Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
1 record matched 5-Formyl-1,3-cyclopentadiene → Other Products + H·
1 record matched 5-Ethyl-1,3-cyclopentadiene → Other Products + H·
2 records matched H· + AlOH → H2 + AlO
1 record matched H· + NH → H· + N + N
1 record matched NO + H· → HNO
1 record matched SO3 + H· → ·OH + SO2
2 records matched Al + H2O → H· + AlOH
1 record matched HN=CHC≡N + H· → NC-CH-NH2
1 record matched 1,4-Cyclohexadiene,3,6-bis(methylene)- → Other Products + H·
1 record matched NCCN + H· → NC-CN-H
1 record matched Cyclopentanone + H· → cyclopentanon-2-yl + H2
1 record matched Cyclopentanone + H· → cyclopentanon-3-yl + H2
1 record matched Ethylbenzene + H· → cyclohexadienyl, 3,6-dimethyl-
1 record matched 1,3-Cyclopentadiene, 5-methyl- → Other Products + H·
1 record matched C2H2 + Y → C2HY + H·
1 record matched C2H4 + O· → CH2=CHO· + H·
1 record matched N(2D) + H2O → H· + :NOH
1 record matched N(2D) + CH4 → H· + ·NCH3
1 record matched NC-CN-H + H· → HN=CHC≡N
1 record matched C(3Pj) + CH3CCH → H· + CH2=C=C=CH·
1 record matched NC-CH-NH2 + H· → NH2-CH2-CN
1 record matched C2H2(X1Σg+) + CN(X2Sigma+) → HCCCN + H·
1 record matched C2H2(X1Σg+) + C(3Pj) → H· + c-C3H
1 record matched Cs(9 2P3/2) + H2 → H· + CsH
1 record matched O· + HCCO → CO + CO + H·
1 record matched n-C3H7O → C2H5CHO + H·
3 records matched HNO → NO + H·
1 record matched HD + ·F → H· + DF
4 records matched SH + O· → H· + SO
1 record matched NH + O· → NO + H·
1 record matched NH2 + O· → H· + HNO
3 records matched H· + ·CH2 → H2 + ·CH
1 record matched H· + HCCO → CO + ·CH2
1 record matched H· + HCCO → Products
1 record matched H· + NCO → CO + NH
1 record matched H· + NCO → HCN + O·
1 record matched H· + NCO → Products
2 records matched H· + O· → ·OH
1 record matched H· + DF → HD + ·F
1 record matched H· + HNO → NH2 + O·
1 record matched H· + HNO → ·OH + NH
1 record matched H· + HNO → H2 + NO
1 record matched H· + SH → H2 + S
1 record matched H· + NH → H2 + N
1 record matched H· + NH2 → NH3
2 records matched H· + NH2 → H2 + NH
1 record matched H· + Si2D6 → Other Products + HD
1 record matched H· + SiD4 → HD + SiD3
12 records matched H· + H· → H2
4 records matched NO2 + H· → ·OH + NO
2 records matched NO + H· → HNO
1 record matched NO + H· → NH + O·
4 records matched NO + H· → ·OH + N
2 records matched Br· + H· → HBr
1 record matched ClOO + H· → ·OH + ClO
3 records matched HBr + H· → H2 + Br·
2 records matched HBr + Br· → Br2 + H·
2 records matched HBr → Br· + H·
1 record matched HI + I → I2 + H·
1 record matched HI + H· → H2 + I
3 records matched O3 + H· → ·OH + O2
7 records matched N2O + H· → ·OH + N2
2 records matched SiH4 + H· → H2 + SiH3
2 records matched PH3 + H· → H2 + PH2
4 records matched H2S + H· → H2 + SH
1 record matched HNO2 + H· → H2 + NO2
3 records matched GeH4 + H· → H2 + GeH3
1 record matched Cl2 + H· → HCl + ·Cl
19 records matched O2 + H· → ·OH + O·
28 records matched O2 + H· → HO2
2 records matched F2 + H· → HF + ·F
1 record matched D2 + H· → HD + D
7 records matched H2O + H· → H2 + ·OH
3 records matched H2O → ·OH + H·
2 records matched Br2 + H· → HBr + Br·
4 records matched H2O2 + H· → ·OH + H2O
4 records matched H2O2 + H· → H2 + HO2
1 record matched S + SH → H· + S2
2 records matched NH3 + H· → H2 + NH2
3 records matched NH3 → H· + NH2
1 record matched HF + ·F → F2 + H·
1 record matched HF + H· → H2 + ·F
1 record matched HF → H· + ·F
1 record matched HCl + ·Cl → Cl2 + H·
3 records matched HCl + H· → H2 + ·Cl
1 record matched HCl → H· + ·Cl
1 record matched I2 + H· → HI + I
1 record matched Kr + H2O → ·OH + H·
1 record matched iso-C4H9 + H· → iso-C4H8 + H2
1 record matched iso-C4H9 + H· → Products
1 record matched iso-C4H9 → iso-C4H8 + H·
2 records matched i-C3H7O → Acetone + H·
1 record matched ·OH + ·CH2 → CH2O + H·
3 records matched ·OH + N → NO + H·
14 records matched ·OH + O· → O2 + H·
4 records matched ·OH + SO → SO2 + H·
1 record matched ·OH + NH → H· + HNO
8 records matched ·OH + H· → H2O
4 records matched ·OH + H· → H2 + O·
2 records matched ·OH + S → H· + SO
1 record matched ·OH → H· + O·
2 records matched ·CH + O· → CO + H·
8 records matched HO2 + H· → H2O + O·
12 records matched HO2 + H· → ·OH + ·OH
12 records matched HO2 + H· → H2 + O2
3 records matched HO2 + H· → Products
2 records matched HO2 → O2 + H·
1 record matched CH3CO + H· → Products
1 record matched NOCl + H· → HCl + NO
1 record matched C2H3 + O· → H2C=C=O + H·
3 records matched C2H3 + H· → C2H2 + H2
1 record matched C2H3 + H· → Products
5 records matched C2H3 → C2H2 + H·
3 records matched HCO + O· → CO2 + H·
4 records matched HCO + H· → CO + H2
1 record matched HCO + NO2 → CO2 + NO + H·
6 records matched HCO → CO + H·
1 record matched (·)CH2OH + H· → ·CH3 + ·OH
2 records matched (·)CH2OH + H· → CH2O + H2
2 records matched (·)CH2OH → CH2O + H·
1 record matched 1-C4H9 → 1-C4H8 + H·
1 record matched Phenyl + H· → Benzene
1 record matched sec-C4H9 → CH3CH=CHCH3 + H·
1 record matched sec-C4H9 → 1-C4H8 + H·
3 records matched ·CH3 + ·CH2 → C2H4 + H·
6 records matched ·CH3 + O· → CH2O + H·
1 record matched ·CH3 + H· → H2 + ·CH2
12 records matched ·CH3 + H· → CH4
2 records matched ·CH3 + ·CH3 → ·C2H5 + H·
2 records matched ·CH3 → H· + ·CH2
2 records matched Benzyl + H· → Toluene
2 records matched CH3CH2O· → CH3CHO + H·
3 records matched CH3O· + H· → CH2O + H2
6 records matched CH3O· → CH2O + H·
1 record matched 1-C3H7 + H· → CH3CH=CH2 + H2
3 records matched 1-C3H7 → CH3CH=CH2 + H·
1 record matched CH3O2· + H· → CH3O· + ·OH
1 record matched ·C2H + H· → H2 + C2
1 record matched ·C2H + H· → C2H2
1 record matched ·C2H + ·CH3 → CH2C≡CH + H·
1 record matched C6H5O + H· → Phenol
1 record matched ·C2H5 + O· → CH3CHO + H·
2 records matched ·C2H5 + H· → ·CH3 + ·CH3
1 record matched ·C2H5 + H· → C2H4 + H2
1 record matched ·C2H5 + H· → Products
7 records matched ·C2H5 → C2H4 + H·
1 record matched iso-C3H7 + O· → Acetone + H·
1 record matched iso-C3H7 + H· → CH3CH=CH2 + H2
1 record matched iso-C3H7 + H· → C3H8
3 records matched iso-C3H7 → CH3CH=CH2 + H·
1 record matched ·CH2CH=CH2 + ·CH2 → 1,3-Butadiene + H·
1 record matched ·CH2CH=CH2 + O· → CH2=CHCHO + H·
1 record matched ·CH2CH=CH2 + H· → CH2=C=CH2 + H2
1 record matched ·CH2CH=CH2 + H· → CH3CH=CH2
1 record matched ·CH2CH=CH2 + H· → Products
1 record matched ·CH2CH=CH2 + CH3O2· → CH2=CHCHO + CH3O· + H·
3 records matched ·CH2CH=CH2 → CH2=C=CH2 + H·
1 record matched (E)-CHF=CHF + H· → CH2FCHF
1 record matched (Z)-CHF=CHF + H· → CH2FCHF
1 record matched tert-C4H9 + H· → iso-C4H8 + H2
1 record matched tert-C4H9 + H· → Products
2 records matched tert-C4H9 → iso-C4H8 + H·
1 record matched Si2H6 + H· → H2 + Si2H5
1 record matched H2 + ·CH2 → ·CH3 + H·
13 records matched H2 + ·Cl → HCl + H·
1 record matched H2 + NCO → HN=C=O + H·
16 records matched H2 + O· → ·OH + H·
1 record matched H2 + D → H· + HD
11 records matched H2 + ·F → HF + H·
2 records matched H2 + I → HI + H·
1 record matched H2 + BO → H· + HBO
2 records matched H2 + NaO → NaOH + H·
1 record matched H2 + NO2 → HNO2 + H·
1 record matched H2 + NO → H· + HNO
4 records matched H2 + Br· → HBr + H·
1 record matched H2 + O2 → HO2 + H·
1 record matched H2 + S → H· + SH
1 record matched H2 + iso-C4H9 → iso-C4H10 + H·
24 records matched H2 + ·OH → H2O + H·
4 records matched H2 + HO2 → H2O2 + H·
1 record matched H2 + CH3CO → CH3CHO + H·
1 record matched H2 + C2H3 → C2H4 + H·
1 record matched H2 + HCO → CH2O + H·
1 record matched H2 + (·)CH2OH → CH3OH + H·
1 record matched H2 + ·CF3 → CHF3 + H·
6 records matched H2 + ·CH3 → CH4 + H·
1 record matched H2 + CH2=C → C2H3 + H·
1 record matched H2 + 1-C3H7 → C3H8 + H·
1 record matched H2 + CH3O2· → CH3OOH + H·
8 records matched H2 + ·C2H → C2H2 + H·
2 records matched H2 + ·C2H5 → C2H6 + H·
1 record matched H2 + iso-C3H7 → C3H8 + H·
1 record matched H2 + ·CH2CH=CH2 → CH3CH=CH2 + H·
1 record matched H2 + tert-C4H9 → iso-C4H10 + H·
11 records matched H2 → H· + H·
1 record matched (CH3)2SiH2 + H· → H2 + (CH3)2SiH
1 record matched Benzene-d6 + H· → Benzene-d5 + D
1 record matched Benzene-d6 + H· → Adduct
1 record matched (CH3)3SiH + H· → H2 + (CH3)3Si·
1 record matched CH3SiH3 + H· → H2 + CH3SiH2
1 record matched 2-(E)-C5H10 + H· → Products
3 records matched CO + H· → HCO
8 records matched CO + ·OH → CO2 + H·
1 record matched 2-(Z)-C5H10 + H· → Products
2 records matched (E)-2-C4H8 + H· → sec-C4H9
1 record matched (CH3)3CC(CH3)=CH2 + H· → (CH3)3CCH(CH3)CH2·
1 record matched CH3F + H· → ·CH3 + HF
2 records matched (Z)-2-C4H8 + H· → sec-C4H9
1 record matched (CH3)2C=C(CH3)2 + H· → (CH3)2CHC(·)(CH3)2
1 record matched Cyclopentadiene → Cyclopentadienyl + H·
1 record matched (CH3)2C=CHCH3 + H· → Products
2 records matched H2C=C=O + H· → Products
1 record matched CH2=C=CH2 + H· → ·CH2CH=CH2
1 record matched 1,3-Butadiyne + H· → Products
1 record matched C2HF3 + H· → Products
1 record matched Cyclopentane + H· → H2 + Cyclopentyl
2 records matched CO2 + H· → CO + ·OH
1 record matched C2H5CHO + H· → n-C3H7O
1 record matched 2,4-Dichlorophenol → 4,6-dichlorophenoxy radical + H·
1 record matched C2F4 + H· → CHF2CF2
2 records matched iso-C4H8 + H· → iso-C4H9
2 records matched iso-C4H8 + H· → tert-C4H9
5 records matched CH3CH=CH2 + H· → 1-C3H7
5 records matched CH3CH=CH2 + H· → iso-C3H7
1 record matched CH3CH=CH2 + H· → H2 + CH2=C(·)CH3
1 record matched CH3CH=CH2 + H· → H2 + CH3CH=C(·)H
2 records matched CH3CH=CH2 + H· → H2 + ·CH2CH=CH2
1 record matched CH3CH=CH2 + C2H3 → CH2=CHCH=CHCH3 + H·
1 record matched CH3CH=CH2 + ·CH2CH=CH2 → 1-Methylcyclopentene + H·
1 record matched CH3CH=CH2 → ·CH2CH=CH2 + H·
1 record matched Cyclohexene + H· → Cyclohexyl
1 record matched 1,2-Dimethoxyethane + H· → CH3OCH2CH2OCH2· + H2
1 record matched 1-C5H10 + H· → Products
1 record matched Phenol + H· → H2 + C6H5O
1 record matched Phenol + H· → Benzene + ·OH
2 records matched Toluene + H· → Cyclohexadienyl, 6-methyl-
6 records matched Toluene + H· → H2 + Benzyl
2 records matched Toluene + H· → Benzene + ·CH3
1 record matched Toluene + H· → Adduct
1 record matched Toluene + H· → Products
2 records matched Toluene → Benzyl + H·
1 record matched 1,3-Butadiene + H· → Products
2 records matched 1-C4H8 + H· → 1-C4H9
1 record matched 1-C4H8 + H· → sec-C4H9
2 records matched 1-C4H8 + H· → Products
2 records matched 1-C4H10 + H· → Other Products + H2
1 record matched 1,4-Dimethylbenzene + H· → Products
1 record matched 1,4-Dimethylbenzene → 4-Methylbenzyl + H·
2 records matched Ethylbenzene + H· → H2 + 1-phenylethyl
1 record matched Ethylbenzene + H· → Benzene + ·C2H5
1 record matched Ethylbenzene + H· → Products
1 record matched 2,4,6-trichlorophenol → 2,4,6-trichlorophenoxy radical + H·
1 record matched C2HCl3 + H· → CH2=CCl2 + ·Cl
1 record matched CF3Br + H· → ·CF3 + HBr
1 record matched CH2=CF2 + H· → Products
1 record matched iso-C4H10 + H· → H2 + iso-C4H9
1 record matched iso-C4H10 + H· → H2 + tert-C4H9
2 records matched iso-C4H10 + H· → Other Products + H2
1 record matched Oxirane + H· → H2 + Oxiranyl
3 records matched HN=C=O + H· → H2 + NCO
1 record matched HN=C=O + H· → CO + NH2
1 record matched CH3CHO + H· → CH3CH2
1 record matched CH3CHO + H· → H2 + CH3CO
1 record matched CH3CHO + H· → Products
1 record matched CH2=CHF + H· → Products
1 record matched CH3CCH + H· → ·CH2CH=CH2
1 record matched CH3CCH + H· → Products
1 record matched C3H8 + H· → H2 + 1-C3H7
1 record matched C3H8 + H· → H2 + iso-C3H7
2 records matched C3H8 + H· → Other Products + H2
2 records matched HCN + O· → H· + NCO
3 records matched HCN + H· → H2C=N
2 records matched HCN + H· → CN + H2
1 record matched HCN + ·OH → HO-C≡N + H·
1 record matched HCN + ·OH → HN=C=O + H·
3 records matched HCN → CN + H·
1 record matched C2H2 + ·CH2 → CH2C≡CH + H·
3 records matched C2H2 + O· → H· + HCCO
5 records matched C2H2 + H· → C2H3
4 records matched C2H2 + H· → H2 + ·C2H
1 record matched C2H2 + C2H3 → Vinylacetylene + H·
6 records matched C2H2 + ·C2H → 1,3-Butadiyne + H·
1 record matched C2H2 + ·CH2CH=CH2 → Cyclopentadiene + H·
1 record matched C2H2 + H2 → C2H3 + H·
1 record matched C2H2 + C2H2 → H· + CH2C(·)CCCH
2 records matched C2H2 → ·C2H + H·
1 record matched C2H4 + ·F → CH2=CHF + H·
9 records matched C2H4 + H· → ·C2H5
3 records matched C2H4 + H· → H2 + C2H3
1 record matched C2H4 + C2H3 → 1,3-Butadiene + H·
1 record matched C2H4 + ·C2H → Vinylacetylene + H·
1 record matched C2H4 + ·CH2CH=CH2 → Cyclopentene + H·
1 record matched C2H4 + H2 → ·C2H5 + H·
2 records matched C2H4 → C2H3 + H·
7 records matched C2H6 + H· → H2 + ·C2H5
1 record matched CH3Br + H· → ·CH3 + HBr
8 records matched CH4 + H· → H2 + ·CH3
13 records matched CH4 → ·CH3 + H·
1 record matched Benzene + H· → 2,4-Cyclohexadien-1-yl
1 record matched Benzene + H· → Cyclohexadienyl
1 record matched Benzene + ·OH → Phenol + H·
1 record matched Benzene + Phenyl → Biphenyl + H·
1 record matched Benzene + Phenyl → Acenaphthylene, 1,2-dihydro- + H·
1 record matched Acetone + H· → i-C3H7O
1 record matched CH3OH + H· → H2 + CH3
1 record matched CH3OH + H· → Products
1 record matched CH3OH + ·OH → CH2O + H2O + H·
1 record matched C2H5OH + H· → H2 + CH3CH(·)OH
3 records matched CN + H· → HCN
2 records matched CN + ·OH → H· + NCO
4 records matched CN + H2 → HCN + H·
2 records matched CN + HCN → NCCN + H·
1 record matched CH2O + H· → CH3
5 records matched CH2O + H· → H2 + HCO
3 records matched CH2O → HCO + H·
5 records matched O(1D) + H2 → ·OH + H·
1 record matched O(1D) + CH4 → Other Products + H·
1 record matched O2(1DELTA) + H· → ·OH + O·
2 records matched M + O2 + H· → M + HO2
2 records matched M + HCO → M + CO + H·
1 record matched N(2D) + H2 → H· + NH
3 records matched O(1D) + H2 → ·OH + H·
1 record matched N2(A3Sigma_u+) + H· → Products
1 record matched N2(A3Sigma_u+) + H2O → ·OH + N2 + H·
1 record matched N2(A3Sigma_u+) + NH3 → N2 + H· + NH2
1 record matched CH3C(·)=NH → H· + CH2=C=NH
1 record matched CH3C(·)=NH → CH3CN + H·
1 record matched (2,4-dichlorocyclohexa-2,4-dienon-5-yl)-(2,4-dichlorocyclohexa-2,4,6-trienenol-5-yl) → (2,4-dichlorocyclohexa-2,4-dienon-5-yl)-(2,4-dichlorocyclohexa-2,4,6-trienenoxy-5-yl) radical + H·
1 record matched C10H7CH2CH2· → 1-Ethenylnaphthalene + H·
1 record matched CHClFO(.) → COClF + H·
1 record matched 1,4-Cyclopentadien-1-ol → hydroxycyclopentadienyl radical + H·
1 record matched (·)Si(O)H → SiO + H·
1 record matched CH2=CHCH=CH· → Vinylacetylene + H·
1 record matched CD2OH → CD2O + H·
1 record matched HOCH2O → HCOOH + H·
1 record matched HN=NO. → N2O + H·
2 records matched HSO2 → SO2 + H·
1 record matched ·CH2 + ·CH2 → C2H2 + H· + H·
2 records matched ·CH2 → ·CH + H·
2 records matched HN=N → N2 + H·
1 record matched CH3CD2 → CH2=CD2 + H·
1 record matched N=C-CH2CH2 → CH2CHCN + H·
2 records matched (CH3)2CHC(·)(CH3)2 → (CH3)2C=C(CH3)2 + H·
4 records matched O· + ·CH2 → CO + H· + H·
1 record matched O· + HN=N → N2O + H·
3 records matched C6H5OCH2 → Benzaldehyde + H·
1 record matched CH3CHCl → CH2=CHCl + H·
1 record matched CH3OCH2· + O· → HC(O)OCH3 + H·
2 records matched HCOO → CO2 + H·
3 records matched 2,4-Cyclohexadien-1-yl → Benzene + H·
1 record matched ·CH2CH=CHCH3 → 1,3-Butadiene + H·
1 record matched CH2=C(·)CH3 → CH2=C=CH2 + H·
1 record matched CH2=C(·)CH3 → CH3CCH + H·
1 record matched CH2=C(CN) → HCCCN + H·
2 records matched AlH2 → H· + AlH
5 records matched HD + ·Cl → DCl + H·
4 records matched HD + D → D2 + H·
1 record matched HD + ·F → H· + DF
1 record matched HgH → Hg + H·
3 records matched SH + O· → H· + SO
1 record matched NH + NH → N2 + H· + H·
2 records matched NH → H· + N
3 records matched NH2 + O· → H· + HNO
1 record matched NH2 + D → Other Products + H·
1 record matched NH2 + NH → HN=NH + H·
1 record matched NH2 + NH2 → H· + NH2NH
1 record matched NH2 → H· + NH
1 record matched H· + CH2Cl-I → ·CH2Cl + HI
1 record matched H· + CH2Cl-I → ·CH2Cl + HCl
1 record matched H· + CH2Cl-I → Products
1 record matched H· + H2Si(·)OH → H2O + SiH2
1 record matched H· + H2Si(·)OH → H2 + HSiOH
1 record matched H· + H2Si(·)OH → H2 + H2Si=O
1 record matched H· + NClF → HF + NCl
1 record matched H· + NClF → Products
1 record matched H· + [5,6]-Fullerene-C60 → Products
1 record matched H· + H3SiO(·) → SiH3OH
1 record matched H· + H3SiO(·) → H2 + HSiOH
1 record matched H· + H3SiO(·) → H2 + H2Si=O
1 record matched H· + 1-Iodonaphthalene → 1-Naphthalenyl + HI
1 record matched H· + 1-Iodonaphthalene → Naphthalene + I
1 record matched H· + CD3ONO → Products
1 record matched H· + CaO3 → Products
2 records matched H· + HSO2 → H2 + SO2
13 records matched H· + ·CH2 → H2 + ·CH
1 record matched H· + ·CH2 → Products
1 record matched H· + HSi(O)OH → H2 + (·)Si(O)OH
1 record matched H· + Methyl, 2-pyridinyl- → 2-Methylpyridine
1 record matched H· + CF2BrCF2 → C2F4 + HBr
1 record matched H· + CF2BrCF2 → Other Products + HF + HBr
1 record matched H· + D2C=N → Products
3 records matched H· + HCCO → CO + ·CH2
3 records matched H· + HCCO → Products
1 record matched H· + HN=N → H2 + N2
2 records matched H· + CH2=CHCF3 → Products
1 record matched H· + C2H5C(CH3)=C(CH3)C2H5 (unspec.) → Products
1 record matched H· + HO2NO2 → Products
1 record matched H· + NCl2 → HCl + NCl
1 record matched H· + N=C-CH2CH2 → C2H5CN
1 record matched H· + Na2 → Products
1 record matched H· + H2Si=O → H2Si(·)OH
1 record matched H· + H2Si=O → H2 + (·)Si(O)H
2 records matched H· + NCO → CO + NH
1 record matched H· + CF3OCl → HCl + CF3O
1 record matched H· + CF3O → COF2 + HF
1 record matched H· + C2H5CH=C=O → Products
1 record matched H· + (E)CH3CH=CHF → Products
1 record matched H· + CD3CHO → CD2CHO + HD
3 records matched H· + (Z)·CH3CH=CHF → Products
1 record matched H· + 3,5-dimethylbenzyl radical → 1,3,5-Trimethylbenzene
1 record matched H· + (CH3)3SiD → Products
1 record matched H· + Disilane, 1,1,1-trichloro-2,2,2-trimethyl- → SiHCl3 + (CH3)3Si·
1 record matched H· + Disilane, 1,1,1-trichloro-2,2,2-trimethyl- → Products
2 records matched H· + N → NH
1 record matched H· + O· → ·OH
1 record matched H· + O· → OH(A2Sigma+)
1 record matched H· + NFCl2 → HCl + NClF
1 record matched H· + NFCl2 → Products
3 records matched H· + OClO → ·OH + ClO
1 record matched H· + CF3O2 → ·OH + CF3O
1 record matched H· + (CH3)3Si· → (CH3)3SiH
1 record matched H· + SF5Br → HBr + SF5
1 record matched H· + CH2=C(·)CH3 → CH2=C=CH2 + H2
1 record matched H· + Cl2CrO2 → HCl + CrClO2
1 record matched H· + SiH3OH → H2 + H2Si(·)OH
1 record matched H· + SiH3OH → H2 + H3SiO(·)
1 record matched H· + Hyponitrous acid → H2 + NO + HNO
1 record matched H· + I → HI
2 records matched H· + ·N3 → N2 + NH
1 record matched H· + DF → HD + ·F
1 record matched H· + DF → HF + D
1 record matched H· + DF → Products
8 records matched H· + HNO → H2 + NO
1 record matched H· + DI → HD + I
2 records matched H· + HD → H2 + D
2 records matched H· + NF → HF + N
1 record matched H· + SiF2 → Products
5 records matched H· + SH → H2 + S
1 record matched H· + Mo(CO)6 → Products
1 record matched H· + BrF → HF + Br·
1 record matched H· + BrF → Products
1 record matched H· + SiH2F2 → H2 + HF2Si
2 records matched H· + Ge2H6 → Other Products + H2
1 record matched H· + (E)-N2F2 → HF + N2 + ·F
1 record matched H· + NH → H2 + N
1 record matched H· + NH → N(4S) + H2
1 record matched H· + XeOF4 → HF + XeF2 + O·
1 record matched H· + XeOF4 → Xe + HF + O·
1 record matched H· + XeOF4 → ·OH + XeF4
1 record matched H· + XeOF4 → ·OH + XeF2 + ·F
1 record matched H· + XeOF4 → Products
1 record matched H· + KrF2 → Products
9 records matched H· + NH2 → NH3
5 records matched H· + NH2 → H2 + NH
2 records matched H· + SiH3 → Products
1 record matched H· + XeF4 → Products
1 record matched H· + XeF2 → Products
1 record matched H· + XeF6 → Products
2 records matched H· + NH2NH → NH2 + NH2
1 record matched H· + SiH3F → H2 + SiH2F
1 record matched H· + Si2D6 → SiHD3 + SiD3
3 records matched H· + Si2D6 → Other Products + HD
4 records matched H· + SiD4 → HD + SiD3
1 record matched H· + GeD4 → HD + GeD3
2 records matched H· + DBr → Br· + HD
1 record matched H· + DBr → HBr + D
1 record matched H· + DBr → Products
1 record matched H· + SiH3Cl → Products
1 record matched H· + Si2Cl6 → Products
1 record matched H· + ·CHF → Products
2 records matched H· + (CH3)3CD → tert-C4H9 + HD
79 records matched H· + H· → H2
1 record matched FeOH + H· → Products
1 record matched CaOH + H· → CaO + H2
3 records matched Cyclohexadienyl → Benzene + H·
1 record matched SrOH + H· → SrO + H2
2 records matched C2O + H· → CO + ·CH
1 record matched C2O + H· → Products
3 records matched OF + H· → HF + O·
1 record matched OF + H· → ·OH + ·F
2 records matched OF + H· → Products
2 records matched NO3 + H· → ·OH + NO2
1 record matched BaOH + H· → BaO + H2
1 record matched FeO3 + H· → O2 + FeOH
1 record matched Cyclohexadienyl, 6-hydroxy- → Phenol + H·
1 record matched SF5 + H· → HF + SF4
1 record matched SCl2 + H· → HCl + SCl
1 record matched ·CHD2 + D → CD3 + H·
1 record matched CH2D + D → ·CHD2 + H·
2 records matched CH2D + H· → ·CH3 + D
1 record matched BCl3 + H· → HCl + BCl2
1 record matched BBr3 + H· → Br· + BHBr2
18 records matched NO2 + H· → ·OH + NO
1 record matched NO + ·CH2 → HN=C=O + H·
1 record matched NO + ·CH2 → -10202 + H·
8 records matched NO + NH → N2O + H·
2 records matched NO + NH2 → ·OH + N2 + H·
24 records matched NO + H· → HNO
7 records matched NO + H· → ·OH + N
1 record matched N2F4 + H· → Other Products + HF
2 records matched HBr + D → H· + DBr
10 records matched HBr + H· → H2 + Br·
2 records matched HBr + Br· → Br2 + H·
4 records matched HBr → Br· + H·
1 record matched HI + D → H· + DI
16 records matched HI + H· → H2 + I
6 records matched O3 + H· → ·OH + O2
1 record matched O3 + H· → HO2 + O·
1 record matched SiCl4 + H· → HCl + SiCl3
1 record matched NCl3 + H· → HCl + NCl2
1 record matched SiHCl3 + H· → Products
1 record matched S2Cl2 + H· → HCl + Sulfurchloride
2 records matched N2O + H· → HN=NO.
1 record matched N2O + H· → O· + HN=N
3 records matched N2O + H· → NO + NH
20 records matched N2O + H· → ·OH + N2
1 record matched SiH4 + D → H· + SiH3D
12 records matched SiH4 + H· → H2 + SiH3
1 record matched SiH4 + H· → Products
3 records matched PH3 + H· → H2 + PH2
1 record matched SO2Cl2 + H· → HCl + ClSO2
2 records matched Cl2O + H· → HCl + ClO
1 record matched Cl2O + H· → Products
1 record matched ICl + H· → HI + ·Cl
2 records matched ICl + H· → HCl + I
4 records matched ICl + H· → Products
1 record matched HOCl + H· → ·OH + HCl
2 records matched HOCl + H· → Products
1 record matched ClF3 + H· → HF + ClF2
1 record matched ClF + H· → HF + ·Cl
3 records matched ClF + H· → HCl + ·F
3 records matched ClF + H· → Products
1 record matched PBr3 + H· → HBr + PBr2
1 record matched PBr3 + H· → Products
5 records matched D2O + H· → OD + HD
1 record matched D2O + H· → ·OH + D2
1 record matched AsH3 + H· → H2 + AsH2·
1 record matched SF4 + H· → HF + SF3
2 records matched OF2 + H· → HF + OF
1 record matched H2Se + H· → H2 + SeH
3 records matched H2S + O· → H· + HSO
24 records matched H2S + H· → H2 + SH
4 records matched H2S → H· + SH
2 records matched HN3 + H· → N2 + NH2
1 record matched GeH4 + GeH3 → H· + Ge2H6
7 records matched GeH4 + H· → H2 + GeH3
1 record matched GeH4 → H· + GeH3
15 records matched Cl2 + H· → HCl + ·Cl
1 record matched O2 + CH=C=CH → CO + H· + HCCO
1 record matched O2 + ·CH2 → HOC(·)O + H·
2 records matched O2 + ·CH2 → CO2 + H· + H·
1 record matched O2 + ·CH2 → Other Products + H·
2 records matched O2 + HCCO → CO2 + CO + H·
2 records matched O2 + SiH3 → H· + :Si(OH)2
47 records matched O2 + H· → ·OH + O·
67 records matched O2 + H· → HO2
10 records matched F2 + H· → HF + ·F
15 records matched D2 + H· → HD + D
1 record matched H2O + SiH2 → H· + H2Si(·)OH
4 records matched H2O + H· → H2 + ·OH
1 record matched H2O + H2O → ·OH + H2O + H·
6 records matched H2O → ·OH + H·
1 record matched VOCl3 + H· → HCl + vanadium oxydichloride
7 records matched Br2 + H· → HBr + Br·
9 records matched H2O2 + H· → ·OH + H2O
4 records matched H2O2 + H· → H2 + HO2
2 records matched H2O2 + H· → Products
2 records matched PCl3 + H· → HCl + PCl2
1 record matched SOCl2 + H· → HCl + OSCl
2 records matched S + SH → H· + S2
3 records matched DCl + H· → HD + ·Cl
1 record matched DCl + H· → HCl + D
1 record matched DCl + H· → Products
1 record matched HNO3 + H· → H2O + NO2
2 records matched HNO3 + H· → Products
1 record matched HNO3 + H· → (Z)-ONOH + ·OH
1 record matched NH3 + D → H· + NH2D
11 records matched NH3 + H· → H2 + NH2
8 records matched NH3 → H· + NH2
1 record matched HF + BF → H· + BF2
2 records matched HF + H· → H2 + ·F
2 records matched HF → H· + ·F
1 record matched NaCl + H· → Na + HCl
1 record matched HCl + BCl → H· + BCl2
3 records matched HCl + D → DCl + H·
1 record matched HCl + AlCl → H· + AlCl2
13 records matched HCl + H· → H2 + ·Cl
6 records matched HCl → H· + ·Cl
1 record matched SnCl4 + H· → HCl + Stannyl, trichloro-
1 record matched SiO2 + H· → (·)Si(O)OH
11 records matched I2 + H· → HI + I
1 record matched TiCl4 + H· → HCl + titanium(III) chloride
6 records matched SO2 + H· → HSO2
2 records matched SO2 + H· → ·OH + SO
2 records matched SO2 + H· → HOSO
1 record matched Cs + HBr → CsBr + H·
1 record matched Cs + HCl → CsCl + H·
1 record matched Ar + O2 + H· → HO2 + Ar
1 record matched Na + HBr → NaBr + H·
1 record matched Na + H2O → NaOH + H·
2 records matched Na + HCl → NaCl + H·
2 records matched Si + HCl → H· + SiCl
1 record matched K + HBr → KBr + H·
1 record matched K + H2O → KOH + H·
2 records matched K + HCl → KCl + H·
1 record matched Li + H2O → LiOH + H·
1 record matched Li + HCl → LiCl + H·
1 record matched Pb + HBr → H· + Lead bromide
1 record matched Pb + HCl → H· + PbCl
1 record matched Kr + H2O → ·OH + H·
1 record matched Al + H· → AlH
1 record matched Al + HCl → H· + AlCl
1 record matched CH2=CHCH2CH2CH2· → Cyclopentene + H·
1 record matched HNC + H· → HCN + H·
1 record matched ·CH2Cl + O· → CO + HCl + H·
2 records matched CH3CH=C(·)H → CH3CCH + H·
1 record matched CH3CH=C=O + H· → Products
1 record matched CD3NH2 + H· → H2 + CD3NH·
1 record matched iso-C4H9 + O· → (CH3)2CHCHO + H·
1 record matched iso-C4H9 → iso-C4H8 + H·
1 record matched Cyclooctyl radical + O· → H· + CH2=CHCH2CH2CH2CH2CH2CHO
1 record matched Cyclooctyl radical + O· → Cyclooctanone + H·
1 record matched HOCH2CH2· + H· → Products
1 record matched HOCH2CH2· → CH2=CHOH + H·
1 record matched HOCH2CH2· → CH3CHO + H·
1 record matched SiH2Cl2 + H· → Products
2 records matched i-C3H7O → Acetone + H·
1 record matched CF + H· → C + HF
1 record matched Cyclopentyl → Cyclopentene + H·
1 record matched ·CH2F + ·F → ·CHF2 + H·
3 records matched NF2 + H· → HF + NF
1 record matched NF2 + H· → Products
1 record matched Si3(CH3)8 + H· → (CH3)3SiSiH(CH3)2 + (CH3)3Si·
1 record matched Si3(CH3)8 + H· → Products
1 record matched CHCl2 + H· → ·CHCl + HCl
8 records matched ·OH + N → NO + H·
22 records matched ·OH + O· → O2 + H·
2 records matched ·OH + D → H· + OD
2 records matched ·OH + HD → H· + HDO
3 records matched ·OH + SO → SO2 + H·
45 records matched ·OH + H· → H2O
1 record matched ·OH + SiO → SiO2 + H·
1 record matched ·OH + H2O + H· → H2O + H2O
1 record matched ·OH + S → H· + SO
1 record matched ·OH + Si → SiO + H·
2 records matched ·OH + ·OH → H2O + H·
1 record matched ·OH → H· + O·
1 record matched ·CH + N → CN + H·
1 record matched ·CH + O· → CO + H·
1 record matched ·CH + H· → H2 + C
1 record matched ·CH + H· → Products
3 records matched ·CH + NO → H· + NCO
1 record matched ·CH + H2O → Products + H·
1 record matched ·CH + N2 → NCN + H·
1 record matched ·CH + NH3 → Other Products + H·
1 record matched ·CH + ·CH → ·C2H + H·
1 record matched ·CH → C + H·
1 record matched C2H5OCH2CH2· → CH2=CHOC2H5 + H·
5 records matched HO2 + H· → H2O + O·
6 records matched HO2 + H· → ·OH + ·OH
7 records matched HO2 + H· → H2 + O2
5 records matched HO2 + H· → Products
1 record matched HO2 + H· → O2(1DELTA) + H2
1 record matched ·CCl3 + HD → CCl3D + H·
1 record matched CH3CO + H· → ·CH3 + HCO
2 records matched CH3CO + H· → H2C=C=O + H2
2 records matched CH3CO + H· → Products
1 record matched Cyclohexyl + O· → CH2=CHCH2CH2CH2CHO + H·
2 records matched Cyclohexyl + O· → Cyclohexanone + H·
1 record matched Cyclohexyl → Cyclohexene + H·
1 record matched CH3C(O)CH2(·) + H· → Products
1 record matched CH3OOH + H· → CH3O· + H2O
1 record matched CH3OOH + H· → H2 + CH2OOH
1 record matched CH3OOH + H· → H2 + CH3O2·
2 records matched CH3OOH + H· → Products
1 record matched CH2C≡CH + O· → HC≡CCHO + H·
1 record matched CH2C≡CH + H· → CH3CCH
2 records matched CH2C≡CH + H· → Products
2 records matched CH2C≡CH + CH2C≡CH → Phenyl + H·
2 records matched CH2C≡CH → H· + c-C3H2
2 records matched C2H5SiH3 + H· → Other Products + H2
6 records matched NOCl + H· → HCl + NO
2 records matched CH2=CHD + H· → Products
1 record matched ·CHF2 + H· → HF + ·CHF
1 record matched C2H3 + CH2=CHCH=CH· → H· + CH2=CHCH=CHCH=CH·
5 records matched C2H3 + H· → C2H2 + H2
2 records matched C2H3 + H· → C2H4
2 records matched C2H3 + H· → Products
1 record matched C2H3 + C → H· + c-C3H2
1 record matched C2H3 + C2H3 → CH2=C=C=CH2 + H· + H·
7 records matched C2H3 → C2H2 + H·
1 record matched NCN + H· → ·CH + N2
2 records matched NCN + H· → HCN + N
1 record matched NCN + H· → Products
2 records matched benzoyl + H· → Benzaldehyde
1 record matched Cyclohexane-1,1,2,2,3,3-d6 + H· → Other Products + H2
1 record matched ·HCC≡N + N → NCCN + H·
1 record matched HCO + O· → CO2 + H·
10 records matched HCO + H· → CO + H2
1 record matched HCO + H· → CH2O
5 records matched HCO + H· → Products
3 records matched HCO + NO2 → CO2 + NO + H·
16 records matched HCO → CO + H·
1 record matched (·)CH2OH + H· → CH2O + H2
2 records matched (·)CH2OH + H· → Products
7 records matched (·)CH2OH → CH2O + H·
2 records matched HOC(·)O → CO2 + H·
1 record matched SF6 + H· → HF + SF5
1 record matched 1-C4H9 + O· → CH3CH2CH2CHO + H·
2 records matched 1-C4H9 → 1-C4H8 + H·
2 records matched Phenyl + H· → Benzene
1 record matched Phenyl + H· → Products
1 record matched Phenyl + O2 → 1,4-Benzoquinone + H·
1 record matched Phenyl → Benzyne + H·
1 record matched Phenyl → Other Products + H·
1 record matched sec-C4H9 → (E)-2-C4H8 + H·
1 record matched sec-C4H9 → (Z)-2-C4H8 + H·
1 record matched sec-C4H9 → CH3CH=CHCH3 + H·
3 records matched sec-C4H9 → 1-C4H8 + H·
2 records matched 4-Methylbenzyl + H· → 1,4-Dimethylbenzene
1 record matched 2-Methylbenzyl + H· → 1,2-Dimethylbenzene
1 record matched 3-Methylbenzyl + H· → 1,3-Dimethylbenzene
2 records matched CH3CH(·)OH + H· → CH3CHO + H2
1 record matched CH3CH(·)OH + H· → Products
1 record matched CF3I + H· → ·CF3 + HI
1 record matched CF3I + H· → Products
4 records matched ·CF3 + H· → ·CF2 + HF
1 record matched C2F5CF2H + H· → H2 + n-C3F7
3 records matched ·CH3 + ·CH2 → C2H4 + H·
2 records matched ·CH3 + N → H· + H2C=N
1 record matched ·CH3 + N → HCN + H· + H·
5 records matched ·CH3 + O· → CO + H2 + H·
23 records matched ·CH3 + O· → CH2O + H·
1 record matched ·CH3 + D → CH2D + H·
21 records matched ·CH3 + H· → CH4
1 record matched ·CH3 + Ar → Ar + H· + ·CH2
2 records matched ·CH3 + ·OH → (·)CH2OH + H·
2 records matched ·CH3 + ·OH → CH3O· + H·
2 records matched ·CH3 + C2H3 → ·CH2CH=CH2 + H·
8 records matched ·CH3 + ·CH3 → ·C2H5 + H·
6 records matched ·CH3 → H· + ·CH2
1 record matched 2-C4H9O → CH2=CHOC2H5 + H·
3 records matched ·CF2 + H· → CF + HF
1 record matched ·CF2 + H· → ·CHF2
1 record matched ·CF2 + H· → Products
2 records matched ·CF2 + ·OH → COF2 + H·
5 records matched Benzyl + H· → Toluene
1 record matched Benzyl → C7H6 + H·
1 record matched C6H5CD2 → Other Products + H·
1 record matched CH3CH2O· → CH3CHO + H·
1 record matched CH3O· + H· → ·CH3 + ·OH
3 records matched CH3O· + H· → CH2O + H2
2 records matched CH3O· + H· → Products
13 records matched CH3O· → CH2O + H·
1 record matched 1-C3H7 + O· → C2H5CHO + H·
1 record matched 1-C3H7 + H· → CH3CH=CH2 + H2
3 records matched 1-C3H7 → CH3CH=CH2 + H·
2 records matched Cyclopentadienyl + H· → Cyclopentadiene
1 record matched ·C2H + H· → H2 + C2
1 record matched ·C2H + CH2=CD2 → Other Products + H·
1 record matched ·C2H + CH2=CD2 → CH≡CCH=CD2 + H·
3 records matched ·C2H → C2 + H·
2 records matched C6H5O + H· → Phenol
2 records matched C6H5O + H· → Products
1 record matched Pyridine, 4-(phenylmethyl)- → Other Products + H·
1 record matched C6D5CD3 + H· → C6D5CD2 + HD
1 record matched C6D5CD3 + H· → Other Products + D
2 records matched ·C2H5 + O· → CH3CHO + H·
8 records matched ·C2H5 + H· → ·CH3 + ·CH3
1 record matched ·C2H5 + H· → C2H4 + H2
2 records matched ·C2H5 + H· → C2H6
2 records matched ·C2H5 + H· → Products
28 records matched ·C2H5 → C2H4 + H·
2 records matched iso-C3H7 + O· → Acetone + H·
1 record matched iso-C3H7 + H· → C3H8
9 records matched iso-C3H7 → CH3CH=CH2 + H·
3 records matched ·CH2CH=CH2 + O· → CH2=CHCHO + H·
1 record matched ·CH2CH=CH2 + O· → C2H4 + CO + H·
1 record matched ·CH2CH=CH2 + O· → CH2O + C2H2 + H·
1 record matched ·CH2CH=CH2 + H· → Products
6 records matched ·CH2CH=CH2 → CH2=C=CH2 + H·
1 record matched CD3OH + H· → Products
1 record matched ·CClF2 + H· → CHF2Cl
1 record matched tert-C4H9OCH3 + H· → Products
3 records matched (E)-CHF=CHF + H· → CH2FCHF
1 record matched (E)-CHF=CHF + H· → H2 + Ethenyl, 1,2-difluoro-, (E)-
2 records matched (Z)-CHF=CHF + H· → CH2FCHF
1 record matched (Z)-CHF=CHF + H· → H2 + Ethenyl, 1,2-difluoro-, (Z)-
1 record matched tert-C4H9 + H· → iso-C4H8 + H2
4 records matched tert-C4H9 → iso-C4H8 + H·
1 record matched C6D5CH3 → H· + C6D5CH2
1 record matched Si2H6 + H· → SiH4 + SiH3
4 records matched Si2H6 + H· → H2 + Si2H5
2 records matched Si2H6 + H· → Products
1 record matched CD3CD=CD2 + H· → HD + CD2CD=CD2
1 record matched CD3CD=CD2 + H· → Adduct
1 record matched CD3CD=CD2 + H· → Products
2 records matched (CH3)6Si2 + H· → (CH3)3SiH + (CH3)3Si·
2 records matched CH3GeH3 + H· → Other Products + H2
4 records matched (CH3)2GeH2: + H· → Other Products + H2
1 record matched (CH3)2GeH2: + H· → Products
3 records matched (CH3)3GeH + H· → Other Products + H2
1 record matched (CH3)3GeH + H· → Products
1 record matched H2 + CH3CH=C(·)CH3 → (Z)-2-C4H8 + H·
1 record matched H2 + CCCN → HCCCN + H·
4 records matched H2 + ·CH2 → ·CH3 + H·
1 record matched H2 + CD≡C· → HC≡CD + H·
1 record matched H2 + CBrF2 → CHBrF2 + H·
16 records matched H2 + ·Cl → HCl + H·
3 records matched H2 + NCO → HN=C=O + H·
1 record matched H2 + (CH3)3SiCH2 → (CH3)4Si + H·
2 records matched H2 + N → H· + NH
53 records matched H2 + O· → ·OH + H·
14 records matched H2 + D → H· + HD
1 record matched H2 + ·CH2C(CH3)=CH2 → iso-C4H8 + H·
1 record matched H2 + ClO → HOCl + H·
33 records matched H2 + ·F → HF + H·
5 records matched H2 + I → HI + H·
2 records matched H2 + NH → H· + NH2
7 records matched H2 + NH2 → NH3 + H·
2 records matched H2 + OD → H· + HDO
1 record matched H2 + BO → H· + HBO
2 records matched H2 + NaO → NaOH + H·
1 record matched H2 + H· → H2 + H·
1 record matched H2 + C2 → ·C2H + H·
1 record matched H2 + ·CHD2 → CH2D2 + H·
2 records matched H2 + NO2 → HNO2 + H·
2 records matched H2 + NO → H· + HNO
8 records matched H2 + Br· → HBr + H·
2 records matched H2 + O2 → HO2 + H·
1 record matched H2 + F2 → HF + H· + ·F
3 records matched H2 + S → H· + SH
1 record matched H2 + C → ·CH + H·
2 records matched H2 + iso-C4H9 → iso-C4H10 + H·
50 records matched H2 + ·OH → H2O + H·
4 records matched H2 + ·CH → H· + ·CH2
4 records matched H2 + ·CCl3 → CHCl3 + H·
1 record matched H2 + ·CHF2 → CH2F2 + H·
4 records matched H2 + C2H3 → C2H4 + H·
2 records matched H2 + Phenyl → Benzene + H·
2 records matched H2 + sec-C4H9 → 1-C4H10 + H·
7 records matched H2 + ·CF3 → CHF3 + H·
16 records matched H2 + ·CH3 → CH4 + H·
1 record matched H2 + Benzyl → Toluene + H·
1 record matched H2 + 1-C3H7 → C3H8 + H·
13 records matched H2 + ·C2H → C2H2 + H·
1 record matched H2 + CD3 → CHD3 + H·
9 records matched H2 + ·C2H5 → C2H6 + H·
1 record matched H2 + iso-C3H7 → C3H8 + H·
5 records matched H2 → H· + H·
1 record matched SrO + H2 → SrOH + H·
3 records matched NaOH + H· → Na + H2O
1 record matched KOH + H· → K + H2O
1 record matched CaO2 + H· → Other Products + Ca
1 record matched CaO + H2 → CaOH + H·
1 record matched Ca(OH)2 + H· → Products
1 record matched BaO + H2 → BaOH + H·
2 records matched CH3CF=CH2 + H· → Products
2 records matched (CH3)2SiH2 + H· → H2 + (CH3)2SiH
5 records matched (CH3)2SiH2 + H· → Other Products + H2
1 record matched Benzene-d6 + H· → Benzene-d5 + D
1 record matched Benzene-d6 + H· → Adduct
2 records matched Benzene-d6 + H· → Products
5 records matched C2D2 + H· → C2HD2
1 record matched C2D2 + H· → HC≡CD + D
1 record matched C2D2 + H· → Adduct
1 record matched HCCCN + H· → Products
2 records matched CH3SiD3 + H· → Products
2 records matched (CH3)3SiH + H· → H2 + (CH3)3Si·
4 records matched (CH3)3SiH + H· → Other Products + H2
1 record matched (CH3)3SiH → H· + (CH3)3Si·
2 records matched CH3SiH3 + H· → H2 + CH3SiH2
5 records matched CH3SiH3 + H· → Other Products + H2
1 record matched (Z)-Cyclooctene + H· → Other Products + H2
1 record matched CH3CH=C(CH3)C2H5 + H· → (C2H5)2(CH3)C
1 record matched CD3I + H· → Products
1 record matched CCl3D + H· → ·CCl3 + HD
2 records matched CH2=CHCH2F + H· → Products
1 record matched (CH3)3SiSiH(CH3)2 + H· → n-C3H7SiH3 + (CH3)2SiH
1 record matched (CH3)3SiSiH(CH3)2 + H· → H2 + (CH3)3SiSi(·)(CH3)2
1 record matched (CH3)3SiSiH(CH3)2 + H· → (CH3)2SiH2 + (CH3)3Si·
1 record matched (CH3)3SiSiH(CH3)2 + H· → (CH3)3SiH + (CH3)2SiH
2 records matched (CH3)3SiSiH(CH3)2 + H· → Other Products + H2
1 record matched CD3OD + H· → Products
1 record matched C2H5CH2C(CH3)=CH2 + H· → n-C3H7C(CH3)2
1 record matched (C2H5)2C=CH2 + H· → Products
1 record matched Phenylsilane + H· → Other Products + H2
1 record matched (CH3O)2 + H· → Products
1 record matched Vinylacetylene + CH2=CHCH=CH· → H· + CH2=CHCH=CHCH=CHC≡CH
2 records matched Vinylacetylene + H· → Products
1 record matched Vinylacetylene + C → H2CCCCCH + H·
1 record matched Vinylacetylene + C → HCCCHCCH + H·
1 record matched Vinylacetylene + 3-methylphenyl → methylnaphthalene + H·
1 record matched Vinylacetylene + 4-methylphenyl → 2-Methylnaphthalene + H·
2 records matched Vinylacetylene → H· + CH2=CHC≡C
2 records matched CF2=CFCF=CF2 + H· → Products
1 record matched (CF3)2CO + H· → CF3CHO + ·CF3
1 record matched C2D4 + H· → CD2=CDH + D
19 records matched C2D4 + H· → C2HD4
1 record matched C2D4 + H· → Products
2 records matched CH3D → CH2D + H·
2 records matched CH2FCH2CH=CH2 + H· → Products
1 record matched (CD3)2CO + H· → ·CD2C(O)CD3 + HD
1 record matched 2-(E)-C5H10 + H· → (CH3CH2)2CH
2 records matched 2-(E)-C5H10 + H· → CH3CH2CH2CH(·)CH3
1 record matched 2-(E)-C5H10 + H· → 3-C5H11
1 record matched C6H5-CH=CHCH3 + H· → H2 + 3-Phenyl-2-propenyl
1 record matched C6H5-CH=CHCH3 + H· → CH3CH=CH2 + Phenyl
1 record matched C6H5-CH=CHCH3 + H· → Styrene + ·CH3
1 record matched C6H5-CH=CHCH3 + H· → Benzene + CH3CH=C(·)H
2 records matched (C2H5)4Si + H· → Other Products + H2
1 record matched CO + SH → COS + H·
19 records matched CO + H· → HCO
92 records matched CO + ·OH → CO2 + H·
1 record matched CO + ·CH → C2O + H·
1 record matched (Z)-Cycloheptene + H· → Other Products + H2
2 records matched 1,4-Cyclohexadiene + H· → Cyclohexenyl (unspecified)
1 record matched HC≡CCH2CH2C≡CH → H· + 3-Butynyl, 1-(ethynyl)-
1 record matched 2-(Z)-C5H10 + H· → (CH3CH2)2CH
1 record matched Benzene,1-chloro-3-fluoro- + H· → Fluorobenzene + ·Cl
2 records matched Benzene,1-chloro-3-fluoro- + H· → Chlorobenzene + ·F
1 record matched 2,5-Dimethylfuran + H· → Products
1 record matched (CH3)2C=CHC2H5 + H· → n-C3H7C(CH3)2
1 record matched (CH3S)2 + H· → CH3SH + CH3
2 records matched CH3ONO + H· → CH3OH + NO
1 record matched CH3ONO + H· → Products
18 records matched (E)-2-C4H8 + H· → sec-C4H9
1 record matched (E)-2-C4H8 + H· → H2 + ·CH2CH=CHCH3
1 record matched (E)-2-C4H8 + H· → Products
1 record matched (E)-2-C4H8 + C → Products + H·
1 record matched Benzene, (2-chloroethyl)- + H· → HCl + 2-phenylethyl
3 records matched (C2H5)3SiH + H· → Other Products + H2
1 record matched (CH3)2C=C=O + H· → Products
2 records matched (CH3)3CC(CH3)3 + H· → H2 + (CH3)3CC(CH3)2CH2
1 record matched CH2=CHBr + H· → Products
3 records matched CH3F + H· → ·CH3 + HF
1 record matched CH3F + H· → Products
4 records matched 1,3-Cyclohexadiene + H· → Cyclohexenyl (unspecified)
1 record matched 1,3-Cyclohexadiene + H· → H2 + Cyclohexadienyl
1 record matched 1,3-Cyclohexadiene → H· + 2,4-Cyclohexadien-1-yl
1 record matched CH2=CHCH2CH2CH=CH2 → Other Products + H·
1 record matched Iodobenzene + H· → Products
1 record matched Iodobenzene → Other Products + H·
1 record matched 1,2-butadiene + H· → C2H4 + C2H3
1 record matched 1,2-butadiene + H· → Other Products + H2
1 record matched 1,2-butadiene + Phenyl → H· + 2-Butynylbenzene
1 record matched 1,2-butadiene + Phenyl → Benzene,1,2-butadienyl- + H·
1 record matched 1,2-butadiene → H· + 2,3-Butanediyl
9 records matched (Z)-2-C4H8 + H· → sec-C4H9
3 records matched (Z)-2-C4H8 + H· → H2 + ·CH2CH=CHCH3
8 records matched (Z)-2-C4H8 + H· → Products
1 record matched (E)-CHBr=CHBr + H· → Products
6 records matched (CH3)2C=C(CH3)2 + H· → (CH3)2CHC(·)(CH3)2
1 record matched (CH3)2C=C(CH3)2 + H· → Products
1 record matched C2H5C(CH3)=CH2 + H· → (CH3)2C(·)CH2CH3
1 record matched C2H5C(CH3)=CH2 + H· → Products
1 record matched (CH3)2CHCH=CH2 + H· → Products
1 record matched tert-C4H9I + H· → Products
1 record matched 1,3,5-Cycloheptatriene + H· → cycloheptadienyl radical
2 records matched Cyclopentadiene → Cyclopentadienyl + H·
2 records matched (C2H5)2SiH2 + H· → Other Products + H2
1 record matched Benzene, 1,3-dichloro- + H· → Chlorobenzene + ·Cl
1 record matched Phenylacetylene + H· → C2H2 + Phenyl
1 record matched Phenylacetylene → Other Products + H·
1 record matched (CH3)2C=CHCH3 + H· → (CH3)2C(·)CH2CH3
2 records matched (CH3)2C=CHCH3 + H· → Adduct
2 records matched (CH3)2C=CHCH3 + H· → Products
1 record matched tert-C4H9OCl + H· → (CH3)3CO· + HCl
1 record matched ICN + H· → HCN + I
1 record matched BrCN + H· → Products
3 records matched C3O2 + H· → CO + HCCO
1 record matched (CH3N)2 + H· → Products
1 record matched 2-butyne + Phenyl → H· + Benzene,1-methyl-1,2-propadienyl-
1 record matched 2-butyne → H· + CH3CCCH2·
1 record matched 2-butyne → H· + CH3C=C=CH2
1 record matched CaCO3 + H· → Products
1 record matched 2,2,3-Trimethylbutane + H· → Products
4 records matched neo-C5H12 + H· → H2 + Neopentyl
2 records matched neo-C5H12 + ·CH → Products + H·
1 record matched neo-C5H12 → iso-C4H8 + ·CH3 + H·
3 records matched COS + H· → CO + SH
2 records matched H2C=C=O + H· → CH3CO
6 records matched H2C=C=O + H· → CO + ·CH3
1 record matched H2C=C=O + H· → Products
1 record matched H2C=C=O → H· + HCCO
1 record matched CH2=C=CH2 + CH2=CHCH=CH· → Toluene + H·
1 record matched CH2=C=CH2 + O· → H· + CH2=CHC(·)O
1 record matched CH2=C=CH2 + O· → CH2C(·)CHO + H·
1 record matched CH2=C=CH2 + BO → CH2=C=CHB=O + H·
1 record matched CH2=C=CH2 + H· → CH2=C(·)CH3
2 records matched CH2=C=CH2 + H· → ·CH2CH=CH2
2 records matched CH2=C=CH2 + H· → Products
1 record matched CH2=C=CH2 + C → Products + H·
2 records matched CH2=C=CH2 + CH2=C=CH → Benzene + H·
1 record matched CH2=C=CH2 + ·CH → CH2=C=C=CH2 + H·
1 record matched CH2=C=CH2 + ·CH → Vinylacetylene + H·
1 record matched CH2=C=CH2 + ·CH → cyc-C4H4 + H·
1 record matched CH2=C=CH2 + Phenyl → Benzene, 1,2-propadienyl- + H·
2 records matched CH2=C=CH2 + ·C2H → H· + CH≡CCH2C≡CH
1 record matched CH2=C=CH2 + ·C2H → H· + CH2=C=C=C=CH2
2 records matched CH2=C=CH2 + ·C2H → CH3C≡CC≡CH + H·
2 records matched CH2=C=CH2 + ·C2H → CH2CCHCCH + H·
2 records matched CH2=C=CH2 → CH2=C=CH + H·
2 records matched Fluorobenzene + H· → Benzene + ·F
1 record matched Fluorobenzene + H· → Products
1 record matched NCCN + H· → CN + HNC
4 records matched NCCN + H· → CN + HCN
1 record matched NCCN + H· → Products
1 record matched 1,3-Butadiyne + CH≡CC≡C → CH≡CC≡CC≡CC≡CH + H·
1 record matched 1,3-Butadiyne + BO → HC≡CC≡CB=O + H·
1 record matched 1,3-Butadiyne + H· → CH2C(·)CCCH
3 records matched 1,3-Butadiyne + H· → Products
1 record matched 1,3-Butadiyne + Phenyl → Phenylbutadiyne + H·
1 record matched 1,3-Butadiyne + ·C2H → HC≡CC≡CC≡CH + H·
1 record matched 1,3-Butadiyne → H· + CH≡CC≡C
1 record matched CF3CHFCF3 + H· → H2 + (CF3)2CF
1 record matched (CH3CO)2 + H· → H2C=C=O + H2 + CH3CO
2 records matched Thiirane + H· → C2H4 + SH
2 records matched 1-Butene, 3,3,4,4,4-pentafluoro- + H· → Products
2 records matched CH3C(CF3)=CH2 + H· → Products
1 record matched CF3OF + H· → HF + CF3O
1 record matched Methane, fluoroiodo- + H· → HF + ·CH2I
1 record matched C2HF3 + H· → CH2FC(·)F2
1 record matched C2HF3 + H· → H2 + CF2=CF
2 records matched C2HF3 + H· → Adduct
5 records matched C2HF3 + H· → Products
1 record matched COF2 + H· → FCO + HF
1 record matched (C2H5)2S + H· → C2H5SH + ·C2H5
2 records matched 3-Fluorotoluene + H· → Fluorobenzene + ·CH3
2 records matched 3-Fluorotoluene + H· → Toluene + ·F
1 record matched 3-Fluorotoluene + H· → 6-fluoro-2-methylcyclohexa-2,4-dienyl
1 record matched Benzene,1-chloro-2-fluoro- + H· → Fluorobenzene + ·Cl
1 record matched Benzene,1-chloro-2-fluoro- + H· → Chlorobenzene + ·F
1 record matched CH2N2 + H· → ·CH3 + N2
8 records matched N2H4 + H· → H2 + NH2NH
1 record matched 3-Phenylpropene + H· → Products
2 records matched Pyrazine → H· + Pyrazinyl
2 records matched Pyrazine → Other Products + H·
2 records matched Pyrimidine → H· + 2-Pyrimidinyl
1 record matched Pyrimidine → Other Products + H·
3 records matched Cyclopentane + H· → H2 + Cyclopentyl
1 record matched (E)-CHCl=CHCl + H· → Products
1 record matched 1-C7H16 + H· → Other Products + H2
6 records matched Cyclopentene + H· → Cyclopentyl
2 records matched Cyclopentene + H· → C2H4 + ·CH2CH=CH2
1 record matched Cyclopentene + H· → Other Products + H2
1 record matched Cyclopentene + H· → Products
2 records matched C2Cl4 + H· → HCl + CCl2=CCl
2 records matched C2Cl4 + H· → C2HCl3 + ·Cl
2 records matched C2Cl4 + H· → Products
1 record matched CF2Br-CF2Br + H· → HBr + CF2BrCF2
10 records matched CO2 + H· → CO + ·OH
1 record matched 1-C10H22 + H· → Other Products + H2
2 records matched C2H5CHO + H· → H2 + CH3CH2CO
1 record matched 2,4-Dichlorophenol + H· → Benzene, 1,3-dichloro- + ·OH
1 record matched 2,4-Dichlorophenol + H· → 4-Chlorophenol + ·Cl
1 record matched 2,4-Dichlorophenol + H· → 2-Chlorophenol + ·Cl
1 record matched 1,2,4-Trichlorobenzene + H· → Benzene, 1,3-dichloro- + ·Cl
1 record matched 1,2,4-Trichlorobenzene + H· → Benzene, 1,4-Dichloro- + ·Cl
1 record matched 1,2,4-Trichlorobenzene + H· → Benzene, 1,2-dichloro- + ·Cl
2 records matched CF3CF=CF2 + H· → Products
1 record matched CF3CF=CF2 + H· → CF3CHFCF2·
9 records matched C2F4 + H· → CHF2CF2
8 records matched iso-C4H8 + H· → tert-C4H9
1 record matched iso-C4H8 + H· → H2 + CH2=CHCH(·)CH3
1 record matched iso-C4H8 + H· → H2 + ·CH2C(CH3)=CH2
2 records matched iso-C4H8 + H· → CH3CH=CH2 + ·CH3
6 records matched iso-C4H8 + H· → Adduct
16 records matched iso-C4H8 + H· → Products
1 record matched iso-C4H8 + ·C2H → (CH3)2C=CH-C≡CH + H·
4 records matched iso-C4H8 → H· + ·CH2C(CH3)=CH2
11 records matched (CH3)2O + H· → H2 + CH3OCH2·
1 record matched CH3CH=CH2 + N → C2H4 + HCN + H·
1 record matched CH3CH=CH2 + O· → H· + CH3C(·)HCHO
1 record matched CH3CH=CH2 + O· → CH3C(O)CH2(·) + H·
1 record matched CH3CH=CH2 + O· → Other Products + H·
1 record matched CH3CH=CH2 + ·F → Other Products + H·
1 record matched CH3CH=CH2 + CD → 1,3-butadiene-d + H·
1 record matched CH3CH=CH2 + CD → 1-butyne-d + H·
1 record matched CH3CH=CH2 + BO → CH2=CHCH2B=O + H·
1 record matched CH3CH=CH2 + BO → CH3CH=CHB=O + H·
6 records matched CH3CH=CH2 + H· → 1-C3H7
6 records matched CH3CH=CH2 + H· → iso-C3H7
7 records matched CH3CH=CH2 + H· → H2 + ·CH2CH=CH2
3 records matched CH3CH=CH2 + H· → C2H4 + ·CH3
8 records matched CH3CH=CH2 + H· → Adduct
15 records matched CH3CH=CH2 + H· → Products
1 record matched CH3CH=CH2 + C → CHCCH(·)CH3 + H·
1 record matched CH3CH=CH2 + C → Products + H·
1 record matched CH3CH=CH2 + ·CH → 1,2-butadiene + H·
1 record matched CH3CH=CH2 + ·CH → 1-butyne + H·
1 record matched CH3CH=CH2 + ·CH → 1,3-Butadiene + H·
1 record matched CH3CH=CH2 + Phenyl → (Z)-1-Phenylpropene + H·
1 record matched CH3CH=CH2 + Phenyl → C6H5-CH=CHCH3 + H·
1 record matched CH3CH=CH2 + Phenyl → 3-Phenylpropene + H·
1 record matched CH3CH=CH2 + Phenyl → 2-Phenylpropene + H·
1 record matched CH3CH=CH2 + Phenyl → C9H10 (unspecified isomer) + H·
1 record matched CH3CH=CH2 → H· + CH2=C(·)CH3
1 record matched CH3CH=CH2 → CH3CH=C(·)H + H·
5 records matched CH3CH=CH2 → ·CH2CH=CH2 + H·
2 records matched n-C8H18 + H· → Other Products + H2
5 records matched Pyridine → H· + 2-pyridinyl
4 records matched Cyclohexene + H· → Cyclohexyl
1 record matched Cyclohexene + H· → Other Products + H2
1 record matched Cyclohexene + H· → Products
1 record matched Cyclohexene → 2-Cyclohexenyl + H·
5 records matched Cyclohexane + H· → H2 + Cyclohexyl
1 record matched (C2H5S)2 + H· → C2H5SH + CH3CH2S
1 record matched 1-C6H14 + H· → Other Products + H2
1 record matched 1-C6H14 + H· → Products
1 record matched 1-C6H14 + ·CH → Products + H·
1 record matched Tetrahydrothiophene + H· → Products
2 records matched n-C4H9SH + H· → 1-C4H9 + H2S
2 records matched n-C4H9SH + H· → H2 + n-C4H9S
1 record matched 1-C5H10 + H· → CH3CH2CH2CH(·)CH3
2 records matched 1-C5H10 + H· → Other Products + H2
1 record matched 1-C5H10 + H· → Adduct
2 records matched 1-C5H10 + H· → Products
1 record matched n-C5H12 + H· → H2 + (CH3CH2)2CH
1 record matched n-C5H12 + H· → H2 + 1-C5H11
1 record matched n-C5H12 + H· → H2 + CH3CH2CH2CH(·)CH3
1 record matched n-C5H12 + H· → Other Products + H2
1 record matched n-C5H12 + ·CH → Products + H·
1 record matched n-C4H9Br + H· → 1-C4H9 + HBr
1 record matched 2-Methylpyridine + H· → H2 + Methyl, 2-pyridinyl-
2 records matched 2-Methylpyridine → H· + Methyl, 2-pyridinyl-
2 records matched Phenol + H· → H2 + C6H5O
4 records matched Phenol + H· → Benzene + ·OH
3 records matched Phenol + H· → Products
1 record matched Phenol → C6H5O + H·
1 record matched Chlorobenzene + ·Cl → Benzene, 1,4-Dichloro- + H·
1 record matched Chlorobenzene + ·Cl → Benzene, 1,2-dichloro- + H·
2 records matched Chlorobenzene + D → chlorobenzene-d (unspecified isomer) + H·
4 records matched Chlorobenzene + H· → Benzene + ·Cl
1 record matched Chlorobenzene + H· → Products
1 record matched Toluene + 9-Anthracenyl → H· + Anthracene, 9-(4-methylphenyl)-
1 record matched Toluene + ·F → 3-Fluorotoluene + H·
1 record matched Toluene + ·F → 2-Fluorotoluene + H·
1 record matched Toluene + ·F → Other Products + H·
3 records matched Toluene + H· → Cyclohexadienyl, 6-methyl-
5 records matched Toluene + H· → H2 + Benzyl
7 records matched Toluene + H· → Benzene + ·CH3
1 record matched Toluene + H· → Adduct
10 records matched Toluene + H· → Products
1 record matched Toluene + 2-Naphthalenyl → H· + Naphthalene, 2-(4-methylphenyl)-
1 record matched Toluene + ·OH → methylphenol (unspecified isomer) + H·
1 record matched Toluene + Phenyl → 1,1'-Biphenyl,4-methyl- + H·
1 record matched Toluene + Phenyl → 1,1'-Biphenyl,2-methyl- + H·
12 records matched Toluene → Benzyl + H·
1 record matched Methylcyclohexane + H· → Other Products + H2
1 record matched 1,3,5-Trimethylbenzene + H· → H2 + 3,5-dimethylbenzyl radical
5 records matched 1,3,5-Trimethylbenzene + H· → 1,3-Dimethylbenzene + ·CH3
2 records matched 1,3,5-Trimethylbenzene + H· → Products
1 record matched 1,3,5-Trimethylbenzene → H· + 3,5-dimethylbenzyl radical
1 record matched 3-Chlorophenol + H· → Phenol + ·Cl
1 record matched 3-Chlorophenol + H· → Chlorobenzene + ·OH
2 records matched 1,3-Dimethylbenzene → 3-Methylbenzyl + H·
1 record matched (CH3)2CH(CH2)2CH3 + H· → Other Products + H2
1 record matched HC(O)OCH3 + H· → H2 + CH3OC(·)(O)
1 record matched HC(O)OCH3 + H· → Products
2 records matched (CHO)2 + H· → CO + H2 + HCO
1 record matched CH2CHCN + H· → HCN + C2H3
1 record matched CH2CHCN + H· → (·)CH=CH-C#N + H2
1 record matched CH2CHCN → H· + CH2=C(CN)
1 record matched C2H5CN + H· → H2 + N=C-CH2CH2
2 records matched n-C3H7I + H· → 1-C3H7 + HI
1 record matched CH2ClCH2Cl + H· → Products
1 record matched n-C3H7SH + H· → H2 + CH3CH2CH2
1 record matched CH2=CHCHO + H· → Products
1 record matched CH3CH=CHCH3 + H· → sec-C4H9
1 record matched CH3CH=CHCH3 + H· → H2 + ·CH2CH=CHCH3
1 record matched CH3CH=CHCH3 → H· + ·CH2CH=CHCH3
1 record matched 1-butyne + Phenyl → Benzene,1,2-butadienyl- + H·
1 record matched 1-butyne + Phenyl → 1-Butynylbenzene + H·
1 record matched 1-butyne + ·C2H → CH≡CC(=CH2)CH=CH2 + H·
1 record matched 1-butyne + ·C2H → 3,4-Dimethylenecyclobut-1-ene + H·
1 record matched 1-butyne + ·C2H → HC≡CC≡CC2H5 + H·
1 record matched 1-butyne + ·C2H → Fulvene + H·
1 record matched 1-butyne + ·C2H → Benzene + H·
1 record matched 1-butyne + ·C2H → CH3-CH=C=CH-C≡CH + H·
1 record matched 1,3-Butadiene + BO → CH2=CHC(B=O)=CH2 + H·
1 record matched 1,3-Butadiene + BO → CH2=CHCH=CHB=O + H·
1 record matched 1,3-Butadiene + H· → H2 + CH2=CHCH=CH·
2 records matched 1,3-Butadiene + H· → Adduct
11 records matched 1,3-Butadiene + H· → Products
1 record matched 1,3-Butadiene + C2H3 → (Z)-CH2=CHCH=CHCH=CH2 + H·
1 record matched 1,3-Butadiene + C2H3 → 1,3-Cyclohexadiene + H·
1 record matched 1,3-Butadiene + Phenyl → H· + 1-Phenyl-1,3-butadiene(E)
1 record matched 1,3-Butadiene + Phenyl → 1,4-Dihydronaphthalene + H·
1 record matched 1,3-Butadiene → H· + CH2=CHCH=CH·
1 record matched 1-C4H8 + O· → Other Products + H·
1 record matched 1-C4H8 + H· → 1-C4H9
2 records matched 1-C4H8 + H· → sec-C4H9
1 record matched 1-C4H8 + H· → H2 + ·CH2CH=CHCH3
3 records matched 1-C4H8 + H· → CH3CH=CH2 + ·CH3
1 record matched 1-C4H8 + H· → C2H4 + ·C2H5
2 records matched 1-C4H8 + H· → Other Products + H2
3 records matched 1-C4H8 + H· → Adduct
8 records matched 1-C4H8 + H· → Products
1 record matched 1-C4H8 + H· → C4H9 (mixture of 2-C4H9 and 1-C4H9)
1 record matched 1-C4H8 → H· + CH2=CHCH(·)CH3
6 records matched 1-C4H10 + H· → H2 + 1-C4H9
6 records matched 1-C4H10 + H· → H2 + sec-C4H9
10 records matched 1-C4H10 + H· → Other Products + H2
1 record matched 1-C4H10 + ·CH → Products + H·
1 record matched 1-C4H10 → 1-C4H9 + H·
1 record matched 1-C4H10 → sec-C4H9 + H·
1 record matched n-C3H7Br + H· → 1-C3H7 + HBr
1 record matched 4-Chlorophenol + H· → Phenol + ·Cl
1 record matched 4-Chlorophenol + H· → Chlorobenzene + ·OH
2 records matched Benzene, 1,4-Dichloro- + H· → Chlorobenzene + ·Cl
1 record matched 1,4-Dimethylbenzene + H· → cyclohexadienyl, 3,6-dimethyl-
1 record matched 1,4-Dimethylbenzene + H· → H2 + 4-Methylbenzyl
8 records matched 1,4-Dimethylbenzene → 4-Methylbenzyl + H·
1 record matched Benzene, (2-bromoethyl)- + H· → HBr + 2-phenylethyl
1 record matched 1,2-Diphenylethane → H· + C6H5CH2CH(·)C6H5
1 record matched Pyridine, 2-(phenylmethyl)- → Other Products + H·
1 record matched Diphenylmethane → Diphenylmethyl + H·
1 record matched Methoxybenzene + H· → Products
1 record matched Benzaldehyde → benzoyl + H·
1 record matched Benzonitrile + H· → HCN + Phenyl
1 record matched Benzonitrile + H· → CN + Benzene
1 record matched Benzonitrile + H· → Other Products + H·
2 records matched Benzonitrile + H· → Products
1 record matched Benzonitrile → Other Products + H·
1 record matched C6H5CH2Cl + H· → Benzyl + HCl
1 record matched C6H5CH2Cl + H· → Products
1 record matched Styrene + H· → Products
1 record matched Ethylbenzene + H· → H2 + 2-phenylethyl
2 records matched Ethylbenzene + H· → H2 + 1-phenylethyl
2 records matched Ethylbenzene + H· → Benzene + ·C2H5
5 records matched Ethylbenzene + H· → Products
2 records matched Ethylbenzene → 1-phenylethyl + H·
1 record matched (Bromomethyl)benzene + H· → Benzyl + HBr
1 record matched Nitrobenzene + H· → Products
4 records matched Trifluoromethylbenzene + H· → Benzene + ·CF3
1 record matched Trifluoromethylbenzene + H· → Products
1 record matched (C2H5)2CO + H· → H2 + CH3CH2C(O)CH(·)CH3
2 records matched 2-Chlorophenol + H· → Phenol + ·Cl
2 records matched 2-Chlorophenol + H· → Chlorobenzene + ·OH
2 records matched 2-Fluorotoluene + H· → Fluorobenzene + ·CH3
2 records matched 2-Fluorotoluene + H· → Toluene + ·F
1 record matched 2-Fluorotoluene + H· → 6-fluoro-1-methylcyclohexa-2,4-dienyl
2 records matched Benzene, 1,2-dichloro- + H· → Chlorobenzene + ·Cl
2 records matched 1,2-Dimethylbenzene → 2-Methylbenzyl + H·
1 record matched Biphenyl + H· → Products
1 record matched Naphthalene + 9-Anthracenyl → Other Products + H·
1 record matched Naphthalene + H· → Products
1 record matched Naphthalene + 2-Naphthalenyl → 1,2'-Binaphthalene + H·
1 record matched Naphthalene + 2-Naphthalenyl → Other Products + H·
1 record matched Naphthalene + 1-Naphthalenyl → 1,1'-Binaphthalene + H·
1 record matched Naphthalene + 1-Naphthalenyl → Other Products + H·
1 record matched Naphthalene + Phenyl → Naphthalene, 1-phenyl- + H·
1 record matched Naphthalene + Phenyl → Other Products + H·
2 records matched Hexamethylbenzene + H· → Products
1 record matched 1,2,3-Trichlorobenzene + H· → Benzene, 1,3-dichloro- + ·Cl
1 record matched 1,2,3-Trichlorobenzene + H· → Benzene, 1,2-dichloro- + ·Cl
1 record matched Methyl methacrylate + H· → Products
1 record matched alpha-pinene + H· → Products
1 record matched (CH3)2CHCH(CH3)2 + H· → Other Products + H2
1 record matched CH3C(O)OCH3 + H· → H2 + CH3C(O)OCH2·
1 record matched C2HCl3 + H· → H2 + CCl2=CCl
2 records matched C2HCl3 + H· → HCCCl + HCl + ·Cl
2 records matched C2HCl3 + H· → CHCl=CHCl (Unspec.) + ·Cl
2 records matched C2HCl3 + H· → CH2=CCl2 + ·Cl
1 record matched C2HCl3 + H· → Products
1 record matched C2H5COCH3 + H· → H2 + CH3C(O)CH(·)CH3
1 record matched iso-C5H12 + H· → H2 + ·CH2CH(CH3)CH2CH3
1 record matched iso-C5H12 + H· → H2 + (CH3)2C(·)CH2CH3
1 record matched iso-C5H12 + H· → H2 + (CH3)2CHCH(·)CH3
1 record matched iso-C5H12 + H· → H2 + (CH3)2CHCH2CH2·
2 records matched iso-C5H12 + H· → Other Products + H2
1 record matched iso-C5H12 + ·CH → Products + H·
1 record matched sec-C4H9Br + H· → sec-C4H9 + HBr
1 record matched CF2Cl-CF2Cl + H· → HF + ·CFClCF2Cl
1 record matched CF2Cl-CF2Cl + H· → ·CF2CF2Cl + HCl
1 record matched (CH3)3CCH2CH3 + H· → Other Products + H2
1 record matched CH3SiCl3 → H· + Cl3SiCH2·
1 record matched (CH3)4Si + H· → H2 + (CH3)3SiCH2
2 records matched (CH3)4Si + H· → Products
3 records matched CF4 + H· → ·CF3 + HF
1 record matched CF3Cl + H· → ·CF3 + HCl
1 record matched CFCl3 + H· → ·CCl3 + HF
1 record matched tert-C4H9SH + H· → tert-C4H9 + H2S
1 record matched tert-C4H9SH + H· → H2 + (CH3)3CS·
2 records matched tert-C4H9OH + H· → tert-C4H9 + H2O
1 record matched tert-C4H9OH + H· → H2 + (CH3)2C(OH)CH2·
7 records matched CF3Br + H· → ·CF3 + HBr
1 record matched CCl3Br + H· → ·CCl3 + HBr
2 records matched CH3NO2 + H· → ·CH3 + HNO2
2 records matched CH3NO2 + H· → Products
1 record matched (CH3)3N + H· → Other Products + H2
1 record matched CHF3 + H· → ·CHF2 + HF
2 records matched CHF3 + H· → H2 + ·CF3
1 record matched CHF3 + H· → Products
1 record matched CHF2Cl + H· → ·CHF2 + HCl
1 record matched CHF2Cl + H· → Products
1 record matched CH2=CF2 + H· → H2 + CF2=CH·
1 record matched CH2=CF2 + H· → Other Products + HF
1 record matched CH2=CF2 + H· → Adduct
5 records matched CH2=CF2 + H· → Products
1 record matched CH2=CCl2 + H· → Products
1 record matched iso-C3H7SH + H· → iso-C3H7 + H2S
1 record matched iso-C3H7SH + H· → H2 + (CH3)2CHS
2 records matched iso-C3H7I + H· → iso-C3H7 + HI
1 record matched iso-C3H7I + H· → Products
2 records matched iso-C4H10 + H· → H2 + iso-C4H9
4 records matched iso-C4H10 + H· → H2 + tert-C4H9
9 records matched iso-C4H10 + H· → Other Products + H2
1 record matched CHBrCl2 + H· → CHCl2 + HBr
1 record matched CHBrCl2 + H· → H2 + BrCCl2
1 record matched iso-C3H7Br + H· → iso-C3H7 + HBr
1 record matched Oxirane + H· → C2H3 + H2O
1 record matched Oxirane + H· → H2 + Oxiranyl
1 record matched Oxirane + H· → C2H4 + ·OH
1 record matched Cyclopropane + H· → H2 + Cyclopropyl
1 record matched Cyclopropane + H· → H2 + ·CH2CH=CH2
1 record matched (CH3)2S + H· → CH3SH + ·CH3
1 record matched (CH3)2S + H· → Products
1 record matched HN=C=O + H· → C(O)NH2
2 records matched HN=C=O + H· → H2 + NCO
2 records matched HN=C=O + H· → CO + NH2
1 record matched HN=C=O + H· → Products
1 record matched HN=C=O → H· + NCO
1 record matched HCONH2 → C(O)NH2 + H·
1 record matched CH2Cl2 + H· → ·CH2Cl + HCl
1 record matched CH2Cl2 + H· → Products
1 record matched C2H5SH + H· → ·C2H5 + H2S
2 records matched C2H5SH + H· → H2 + CH3CH2S
1 record matched C2H5SH + H· → Products
1 record matched CH3CHO + H· → H2 + CH3CO
2 records matched CH3CHO + H· → H2 + CH2=CHO·
6 records matched CH3CHO + H· → H2 + CH3CO
2 records matched CH3CHO + H· → CO + H2 + ·CH3
1 record matched CH3CHO + H· → CH4 + HCO
2 records matched CH3CHO + H· → Products
1 record matched CH3CHO + ·OH → CH3C(O)OH + H·
1 record matched CH3CHO + ·CH → H· + cyc-(H2COC)=CH2
2 records matched CH3CHO + ·CH → CH3CH=C=O + H·
2 records matched CH3CHO + ·CH → CH2=CHCHO + H·
2 records matched CH3CHO + ·CH3 → Acetone + H·
1 record matched CH3CHO → CO + ·CH3 + H·
1 record matched CH3CN + N → HCN + HCN + H·
1 record matched CH3CN + H· → HCN + ·CH3
1 record matched CH3CN + H· → CN + CH4
4 records matched CH3CN → CH2CN + H·
3 records matched C2H5I + H· → ·C2H5 + HI
1 record matched C2H5I + H· → Products
1 record matched CH2=CHF + H· → Other Products + H2
2 records matched CH2=CHF + H· → Adduct
4 records matched CH2=CHF + H· → Products
2 records matched CH2=CHCl + H· → CH3CHCl
1 record matched CH2=CHCl + H· → CH2CH2Cl
1 record matched CH2=CHCl + H· → Products
1 record matched C2H5Cl + H· → ·C2H5 + HCl
1 record matched C2H5Cl + H· → Products
1 record matched CH3CCH + O· → H· + CH2=C=C=O
1 record matched CH3CCH + O· → CH3C(·)=C=O + H·
1 record matched CH3CCH + H· → CH2=C(·)CH3
1 record matched CH3CCH + H· → CH3CH=C(·)H
1 record matched CH3CCH + H· → H2 + CH2=C=CH
2 records matched CH3CCH + H· → CH2=C=CH2 + H·
8 records matched CH3CCH + H· → C2H2 + ·CH3
4 records matched CH3CCH + H· → Products
1 record matched CH3CCH + C2 → H2CCCCCH + H·
1 record matched CH3CCH + C → Products + H·
2 records matched CH3CCH + CH2=C=CH → Benzene + H·
1 record matched CH3CCH + ·CH → CH2=C=C=CH2 + H·
1 record matched CH3CCH + ·CH → Vinylacetylene + H·
1 record matched CH3CCH + Phenyl → 1-Phenylpropyne + H·
2 records matched CH3CCH + ·C2H → CH3C≡CC≡CH + H·
1 record matched CH3CCH + ·C2H → CH2CCHCCH + H·
1 record matched CH3CCH + ·CH2CH=CH2 → 2-Methyl-1,3-cyclopentadiene + H·
1 record matched CH3CCH + ·CH2CH=CH2 → 1-Methyl-1,3-cyclopentadiene + H·
1 record matched CH3CCH → CH2=C=CH + H·
1 record matched CH3CCH → CH2C≡CH + H·
8 records matched C3H8 + H· → H2 + 1-C3H7
4 records matched C3H8 + H· → H2 + iso-C3H7
23 records matched C3H8 + H· → Other Products + H2
1 record matched C3H8 + ·CH → Products + H·
1 record matched C3H8 → 1-C3H7 + H·
1 record matched C3H8 → iso-C3H7 + H·
4 records matched C2H5Br + H· → ·C2H5 + HBr
1 record matched CH3SH + H· → ·CH3 + H2S
7 records matched CH3SH + H· → H2 + CH3
4 records matched CH3SH + H· → Products
7 records matched HCN + O· → H· + NCO
2 records matched HCN + H· → HNC + H·
1 record matched HCN + C2 → H· + CCCN
1 record matched HCN + ·OH → HO-C≡N + H·
1 record matched HCN + C2H3 → CH2CHCN + H·
7 records matched HCN → CN + H·
1 record matched CH3NH2 + H· → Other Products + H2
1 record matched CH3NH2 + H· → Products
5 records matched CH3I + H· → ·CH3 + HI
1 record matched CH3I + H· → Products
4 records matched CH3Cl + H· → ·CH3 + HCl
2 records matched CH3Cl + H· → Products
2 records matched C2H2 + CH2=CHCH=CH· → 1,3-Hexadien-5-yne + H·
3 records matched C2H2 + CH2=CHCH=CH· → Benzene + H·
1 record matched C2H2 + ·CH2 → CH2C≡CH + H·
1 record matched C2H2 + CD≡C· → C4HD unspecified structure + H·
11 records matched C2H2 + O· → H· + HCCO
4 records matched C2H2 + D → HC≡CD + H·
17 records matched C2H2 + H· → C2H3
3 records matched C2H2 + H· → H2 + ·C2H
1 record matched C2H2 + H· → C2H2 + H·
1 record matched C2H2 + NO → HCN + CO + H·
1 record matched C2H2 + C → H· + c-C3H
1 record matched C2H2 + C → H· + CCCH
1 record matched C2H2 + C → Other Products + H·
4 records matched C2H2 + ·OH → H2C=C=O + H·
3 records matched C2H2 + ·CH → H· + c-C3H2
3 records matched C2H2 + ·CH → CH≡CC(·)H + H·
1 record matched C2H2 + ·CH → Products + H·
1 record matched C2H2 + HCCCHCH· → H· + (Z)-HC≡CCH=CHC≡CH
2 records matched C2H2 + HCCCHCH· → Benzyne + H·
3 records matched C2H2 + C2H3 → Vinylacetylene + H·
2 records matched C2H2 + Phenyl → Phenylacetylene + H·
2 records matched C2H2 + ·CH3 → CH2=C=CH2 + H·
4 records matched C2H2 + ·CH3 → CH3CCH + H·
12 records matched C2H2 + ·C2H → 1,3-Butadiyne + H·
3 records matched C2H2 + ·CH2CH=CH2 → Cyclopentadiene + H·
4 records matched C2H2 + C2H2 → Other Products + H·
5 records matched C2H2 → ·C2H + H·
1 record matched C2H4 + O· → CH2=CHO· + H·
8 records matched C2H4 + O· → *CH2C(O)H + H·
1 record matched C2H4 + D → CH2=CHD + H·
5 records matched C2H4 + ·F → CH2=CHF + H·
110 records matched C2H4 + H· → ·C2H5
12 records matched C2H4 + H· → H2 + C2H3
3 records matched C2H4 + H· → Products
1 record matched C2H4 + C2 → H· + CH2C(·)CCCH
1 record matched C2H4 + C → CH2C≡CH + H·
1 record matched C2H4 + ·CH → Cyclopropene + H·
2 records matched C2H4 + ·CH → CH2=C=CH2 + H·
1 record matched C2H4 + ·CH → CH3CCH + H·
1 record matched C2H4 + ·CH → Products + H·
1 record matched C2H4 + C2H3 → 1,3-Butadiene + H·
2 records matched C2H4 + Phenyl → Styrene + H·
1 record matched C2H4 + ·CH3 → CH3CH=CH2 + H·
2 records matched C2H4 + ·C2H → Vinylacetylene + H·
1 record matched C2H4 + ·C2H5 → 1-C4H8 + H·
1 record matched C2H4 + ·CH2CH=CH2 → CH2=CHCH=CHCH3 + H·
1 record matched C2H4 + ·CH2CH=CH2 → Cyclopentene + H·
5 records matched C2H4 → C2H3 + H·
1 record matched C2H6 + O· → CH3CH2O· + H·
24 records matched C2H6 + H· → H2 + ·C2H5
1 record matched C2H6 + H· → CH4 + ·CH3
1 record matched C2H6 + ·CH → CH3CH=CH2 + H·
1 record matched C2H6 + ·CH → Products + H·
2 records matched C2H6 → ·C2H5 + H·
5 records matched CH3Br + H· → ·CH3 + HBr
3 records matched CH3Br + H· → Products
4 records matched CH4 + N → HCN + H2 + H·
1 record matched CH4 + SiF3 → CH3SiF3 + H·
2 records matched CH4 + H· → ·CH3 + H·
29 records matched CH4 + H· → H2 + ·CH3
1 record matched CH4 + Kr → ·CH3 + Kr + H·
3 records matched CH4 + ·CH → C2H4 + H·
1 record matched CH4 + ·CH3 → C2H6 + H·
31 records matched CH4 → ·CH3 + H·
2 records matched CH3CCl3 + H· → Products
1 record matched Benzene + ·Cl → Chlorobenzene + H·
1 record matched Benzene + O· → C6H5O + H·
1 record matched Benzene + O· → CO + Cyclopentadienyl + H·
1 record matched Benzene + ·F → Fluorobenzene + H·
7 records matched Benzene + H· → 2,4-Cyclohexadien-1-yl
5 records matched Benzene + H· → Cyclohexadienyl
2 records matched Benzene + H· → H2 + Phenyl
6 records matched Benzene + H· → Products
1 record matched Benzene + C → 1,2-didehydrocycloheptatrienyl radical + H·
1 record matched Benzene + B → C6H5B + H·
1 record matched Benzene + ·OH → Phenol + H·
1 record matched Benzene + C2H3 → Styrene + H·
1 record matched Benzene + Phenyl → Biphenyl + H·
1 record matched Benzene + Phenyl → Acenaphthylene, 1,2-dihydro- + H·
4 records matched Benzene → Phenyl + H·
1 record matched n-C4H9OH + H· → H2 + HOCH2CH2CH2CH2
1 record matched n-C3H7OH + H· → H2 + HOCH2CH2CH2·
1 record matched CHCl3 + H· → CHCl2 + HCl
2 records matched CHCl3 + H· → Products
5 records matched Acetone + H· → H2 + CH3C(O)CH2(·)
1 record matched Acetone + ·CH → (CH3)2C=C=O + H·
1 record matched Acetone + ·CH → Methacrolein + H·
1 record matched iso-C3H7OH + H· → H2 + (CH3)2C(OH)
6 records matched CH3OH + H· → H2 + (·)CH2OH
5 records matched CH3OH + H· → Products
2 records matched CH3OH + C → Other Products + H·
1 record matched CH3OH + Be → CH3OBe + H·
1 record matched CH3OH + Sc → CH3OSc + H·
5 records matched CH3OH → (·)CH2OH + H·
1 record matched C2H5OH + H· → ·C2H5 + H2O
4 records matched C2H5OH + H· → H2 + CH3CH(·)OH
2 records matched C2H5OH + H· → Products
2 records matched aniline + H· → H2 + Phenyl amidogen
1 record matched aniline + H· → Benzene + NH2
1 record matched aniline + H· → Products
1 record matched CH3NHNH2 + H· → Products
1 record matched (C2H5)2O + H· → H2 + 2-C4H9O
1 record matched (CH3)2NNH2 + H· → Products
1 record matched CN + N2 → NCN + H·
1 record matched CN + NH3 → H2NCN + H·
3 records matched CN + ·OH → H· + NCO
19 records matched CN + H2 → HCN + H·
1 record matched CN + 1,3-Butadiyne → HCCCCCN + H·
1 record matched CN + iso-C4H8 → (CH3)2C=CHCN + H·
1 record matched CN + CH3CH=CH2 → CH3CH=CHCN + H·
1 record matched CN + CH3CH=CH2 → cyanopropene (unidentified isomer) + H·
5 records matched CN + HCN → NCCN + H·
2 records matched CN + C2H2 → HCCCN + H·
1 record matched CN + C2H2 → Products + H·
3 records matched CN + C2H4 → CH2CHCN + H·
1 record matched CN + C2H4 → Products + H·
1 record matched CN + C2H4 → CH2=CH-NC + H·
1 record matched CCl4 + H· → ·CCl3 + HCl
1 record matched CH2O + O· → CO + ·OH + H·
2 records matched CH2O + D → CHDO + H·
19 records matched CH2O + H· → H2 + HCO
1 record matched CH2O + Ar → HCO + Ar + H·
1 record matched CH2O + ·OH → HCOOH + H·
14 records matched CH2O → HCO + H·
2 records matched O(1D) + HD → H· + OD
1 record matched O(1D) + HBr → H· + BrO
1 record matched O(1D) + HCl → H· + ClO
19 records matched O(1D) + H2 → ·OH + H·
1 record matched O(1D) + CH3F → H· + CH2FO(.)
1 record matched O(1D) + CH4 → Other Products + H·
1 record matched CF2BrCFBr· + H· → Other Products + HBr
1 record matched ·CF2CF2Cl + H· → Other Products + HCl + HF
1 record matched ·CHFCF2Cl + H· → Other Products + HCl + HF
2 records matched AlHCl → H· + AlCl
2 records matched AlH2Cl → AlHCl + H·
1 record matched FC(O)SCl + H· → Products
2 records matched (13)CO + ·OH → (13)CO2 + H·
1 record matched C6H5CH2 + Benzene → Diphenylmethane + H·
1 record matched CH2CF2 → H· + CF2=CH·
1 record matched CH3CH2CH2CHO → CO + 1-C3H7 + H·
2 records matched HOSO → SO2 + H·
5 records matched M + NO + H· → M + HNO
10 records matched M + O2 + H· → M + HO2
1 record matched M + ·CH3 → M + H· + ·CH2
1 record matched M + CH4 → M + ·CH3 + H·
1 record matched c-C4H4C(OH)NH → c-C4H4C(O)NH + H·
1 record matched o-C6H4 → C6H3 + H·
1 record matched N(2D) + CH4 → H· + ·NCH3
1 record matched N(2D) + CH4 → CH2=NH + H·
1 record matched O(3P) + ·CH2CH=CH2 → CH2=CHCHO + H·
1 record matched O(3P) + C3H8 → C2H5CHO + H· + H·
1 record matched O(3P) + C3H8 → CH3CHO + ·CH3 + H·
1 record matched O(3P) + C3H8 → Propoxy (unspecified) + H·
1 record matched O(3P) + C2H6 → CH3CH2O· + H·
1 record matched O(3P) + C2H6 → CH3CHO + H· + H·
1 record matched O(3P) + CH4 → CH3O· + H·
1 record matched O(3P) + CH4 → CH2O + H· + H·
1 record matched O(1D) + NH3 → Products + H·
2 records matched O(1D) + H2 → ·OH + H·
1 record matched O(1D) + C2H6 → Products + H·
1 record matched O(1D) + CH4 → Other Products + H·
1 record matched ·CH(OH)C(O)CH3 + O2 → CH3C(O)OH + CO2 + H·
1 record matched 6-fluoro-2-methylcyclohexa-2,4-dienyl → 3-Fluorotoluene + H·
1 record matched CH2=C(·)CH2CH3 → 1,2-butadiene + H·
1 record matched CH2=C(·)CH2CH3 → 1-butyne + H·
1 record matched 6-fluoro-1-methylcyclohexa-2,4-dienyl → 2-Fluorotoluene + H·
1 record matched CH2(X3B_1) + NO → H· + HC-N=O
4 records matched C[17]O + ·OH → OC[17]O + H·
2 records matched CO(«nu»=0) + ·OH → CO2 + H·
2 records matched CO(«nu»=1) + ·OH → CO2 + H·
2 records matched CO(«nu»=2) + ·OH → CO2 + H·
2 records matched CO(«nu»=3) + ·OH → CO2 + H·
2 records matched CO(«nu»=4) + ·OH → CO2 + H·
2 records matched C(1D) + C2H6 → Other Products + H·
1 record matched C(1D) + CH4 → Other Products + H·
1 record matched Diacetylene-d1 → DCCCC + H·
1 record matched H2(v) + ·Cl → HCl + H·
1 record matched H2(v) + H· → H2 + H·
2 records matched H2(v) + F2 → HF + H· + ·F
2 records matched S(1D) + H2 → H· + SH
2 records matched S(1D) + C2H4 → H· + CH2=CHS
1 record matched CH2FOCHFO → CH2FOC(O)F + H·
1 record matched CHDCHD + O· → CHDCDO + H·
1 record matched Rb(5D 3/2) + H2 → H· + RbH
1 record matched Rb(5D 5/2) + H2 → H· + RbH
1 record matched hydroxycyclopentadienyl radical → H· + 2,4-Cyclopentadiene-1-one
1 record matched C3(a3PIu) + C2H2 → H· + 2,4-Pentadiynylidyne
1 record matched ClC(O)SCl + H· → Products
1 record matched CH3OC(O)SCl + H· → Products
1 record matched H2O(|04>-) + H· → Products
1 record matched (CH3)3COCH2· + H· → Products
1 record matched 1-isopropylcyclopenta-1,3-diene → 1-isopropenylcyclopenta-1,3-diene + H·
1 record matched 2-isopropylcyclopenta-1,3-diene → 2-isopropenylcyclopenta-1,3-diene + H·
2 records matched CH2(1) + H2 → ·CH3 + H·
1 record matched (CH3)2CNO2 → CH3C(NO2)=CH2 + H·
1 record matched C2(X1ΣPlg) + C2H4 → H· + CH2C(·)CCCH
1 record matched C2(X1ΣPlg) + Benzene → 2-ethynylphenyl + H·
1 record matched CH_2(aA_1) + CH3CH=CH2 → Other Products + H·
3 records matched CH_2(aA_1) + C2H2 → CH2C≡CH + H·
1 record matched CH_2(aA_1) + C2H4 → ·CH2CH=CH2 + H·
1 record matched CH_2(aA_1) + C2H4 → Other Products + H·
1 record matched O2(X3Sigma_g-) + C2H3 → H· + Oxiranone
1 record matched cyclopentoxy (chemically activated) → CH2=CHCH2CH2CHO + H·
1 record matched cyclopentoxy (chemically activated) → Cyclopentanone + H·
1 record matched cyclopentoxy (chemically activated) → C2H4 + CH2=CHCHO + H·
1 record matched cyclopentoxy (chemically activated) → C2H4 + C2H4 + CO + H·
1 record matched C2(a3PIu) + H· → Products
1 record matched C2(a3PIu) + C2H4 → H· + CH2C(·)CCCH
1 record matched C2(a3PIu) + Benzene → 2-ethynylphenyl + H·
1 record matched (·)CH=CH-C#N → HCCCN + H·
1 record matched CBrCl(OH) → CBrClO + H·
1 record matched CH2=B(OH) → H· + *CH2B=O
1 record matched CH3B*(OH) → H· + CH2=B(OH)
1 record matched CH3B*(OH) → H· + CH3B=O
1 record matched C6H5CH2CH=CH(·) → C6H5CH2C2H + H·
1 record matched C6H5CH2C(·)=CH2 → C6H5CH2C2H + H·
1 record matched C6H5CH2C(·)=CH2 → Benzene, 1,2-propadienyl- + H·
1 record matched CH3CHBrO(·) → CH3COBr + H·
1 record matched (·)C#C-CH=S → H· + CCCS
1 record matched HC(·)=C=C=S → H· + CCCS
1 record matched CH3(cyc-C5H4) → Fulvene + H·
1 record matched CH3(cyc-C5H4) → Benzene + H·
1 record matched 2,5-Hexadienyl → 1,3,5-Hexatriene + H·
1 record matched CH3SO3 → ·CH2SO3 + H·
2 records matched 5,5'-Bicyclopentadienyl → 9H-fulvalenyl + H·
2 records matched 5,5'-Bicyclopentadienyl → 9H-naphthalenyl + H·
2 records matched HCCCCCH → H· + 2,4-Pentadiynylidyne
1 record matched CH2CCHCH2CHCH2 → Fulvene + H· + H·
1 record matched HOOCH2O → HC(O)OOH + H·
1 record matched CH2FO(.) → HFCO + H·
1 record matched ·N(CN)OH → ONCN + H·
1 record matched CH=CHCH=CHC≡CH → H· + (E)-HC≡CCH=CHC≡CH
1 record matched 1,4-Cyclopentadien-1-ol → 2,4-cyclopentadienoxy + H·
2 records matched 1,4-Cyclopentadien-1-ol → hydroxycyclopentadienyl radical + H·
1 record matched 1,4-Cyclopentadien-1-ol → 2,4-cyclopentadien-3-oxy + H·
1 record matched 1,4-Cyclopentadien-1-ol → 2,4-cyclopentadien-2-oxy + H·
1 record matched CH2=CHCH=CH· → Vinylacetylene + H·
1 record matched 2-Azido-N,N-Dimethylethanamine → ·CH2N(CH3)CH2CH2N3 + H·
1 record matched 2-Azido-N,N-Dimethylethanamine → (CH3)2NCH(·)CH2N3 + H·
1 record matched 2-Azido-N,N-Dimethylethanamine → (CH3)2NCH2CH(·)N3 + H·
1 record matched CH3B=O → H· + *CH2B=O
1 record matched CH3C=C=CH2 → CH2=C=C=CH2 + H·
2 records matched CH3OCH2O· → HC(O)OCH3 + H·
1 record matched Cyclohexadienyl, 6-methyl- → Toluene + H·
2 records matched HOCH2O → HCOOH + H·
1 record matched ClCH2C(O)(.) → H· + CHCl=C=O
1 record matched SiHCl2 → H· + SiCl2
2 records matched CH2=CHCH(·)CH3 → 1,2-butadiene + H·
1 record matched CH2=CHCH(·)CH3 → 1-butyne + H·
2 records matched CH2=CHCH(·)CH3 → 1,3-Butadiene + H·
2 records matched CH2C(·)CCCH → 1,3-Butadiyne + H·
1 record matched HSO → H· + SO
2 records matched HSO2 → SO2 + H·
1 record matched ·CH2 + 1H-inden-1-yl → C6H5C3HCH2 + H·
1 record matched ·CH2 + ·CH2 → C2H2 + H· + H·
1 record matched HSi(O)OH → H· + (·)Si(O)OH
1 record matched HSi(O)OH → HSiO2 + H·
1 record matched 5-Formyl-1,3-cyclopentadiene → cy-C5H5(COH) + H·
1 record matched HSiN → Silicon nitride + H·
1 record matched cyclopentyloxy → Cyclopentanone + H·
1 record matched CH≡CC≡C → C4 + H·
1 record matched 1,3-Hexadien-6-yl → 1,3,5-Hexatriene + H·
1 record matched CH2=CHCH2CH(·)CH3 → CH2=CHCH2CH=CH2 + H·
1 record matched CH2=CHCH2CH(·)CH3 → CH2=CHCH=CHCH3 + H·
1 record matched CH3NH → H· + ·NCH3
1 record matched CH3NH → CH2=NH + H·
1 record matched 2-Methoxyphenoxy radical → 2-Hydroxybenzaldehyde + H·
1 record matched ClCHCH=CH2 → CH2=C=CHCl + H·
1 record matched Silyl, dichloromethyl- → H· + CH2=SiCl2
3 records matched HN=N → N2 + H·
1 record matched CCl3OH → H· + CCl3O
1 record matched C6H5C(·)=CH2 → Phenylacetylene + H·
2 records matched Oxiranyl → H2C=C=O + H·
1 record matched CH2ClCH2O → CH2ClCHO + H·
1 record matched CH2=C(OH)CH3 → CH2=C(OH)-CH2· + H·
1 record matched CH2=C(OH)CH3 → ·CH=C(OH)CH3 + H·
1 record matched 3-Methoxyphenoxy radical → 3-Hydroxybenzaldehyde + H·
3 records matched 1,3-Cyclopentadiene, 5-ethenylidene- → fulvallenyl + H·
1 record matched CH3CH2CH(CH3)O· → C2H5COCH3 + H·
3 records matched C6H5CH2O → Benzaldehyde + H·
3 records matched CH2=CHCH2O → CH2=CHCHO + H·
1 record matched :GeH2 → H· + GeH
1 record matched CH3CF2 → CH2=CF2 + H·
1 record matched Ethenyl,2-phenyl- → Phenylacetylene + H·
2 records matched CH3CH2CH2C(·)HOH → H· + CH3CH2CH=CHOH
2 records matched CH3CH2CH2C(·)HOH → CH3CH2CH2CHO + H·
1 record matched 2,5-Cyclohexadien-1-yl → Benzene + H·
1 record matched CH3CCl2· → CH2=CCl2 + H·
2 records matched CH3CH2CH2CH2O· → CH3CH2CH2CHO + H·
1 record matched O· + HSO → SO2 + H·
1 record matched O· + ·CH2 → HCO + H·
1 record matched O· + ·CH2 → CO + H· + H·
1 record matched O· + HN=N → N2O + H·
2 records matched C6H5OCH2 → Benzaldehyde + H·
1 record matched 2-phenylethyl → Styrene + H·
1 record matched 2-Phenyl-2-propyl radical → 3-Phenylpropene + H·
1 record matched HC-N=O + H· → HCN + ·OH
1 record matched HC-N=O + ·OH → ·OH + H· + NCO
3 records matched CH3CHCl → CH2=CHCl + H·
1 record matched CH3OCH2· + O· → HC(O)OCH3 + H·
1 record matched CH2CH2Cl → CH2=CHCl + H·
1 record matched ·CH2Br + N → HBrCN + H·
1 record matched ·CH2Br + N → trans-BrCNH + H·
1 record matched n-C3H7O → C2H5CHO + H·
1 record matched CH3CH2C(·)=CH2 → 1,2-butadiene + H·
1 record matched CH3CH2C(·)=CH2 → 1-butyne + H·
1 record matched ·CH2(CH2)3CH=CH2 → CH2=CHCH2CH2CH=CH2 + H·
1 record matched H2C=N → HCN + H·
1 record matched 2,4-Cyclohexadien-1-yl → Benzene + H·
1 record matched 3-Cyclohexenyl → 1,3-Cyclohexadiene + H·
1 record matched ·CH2C(CH3)=CH2 → 1,2-butadiene + H·
1 record matched ·CH2C(CH3)=CH2 → 1-butyne + H·
1 record matched ·CH2C(CH3)=CH2 → 1,3-Butadiene + H·
1 record matched 1-Hexen-5-yne → Fulvene + H· + H·
1 record matched SiNH → Silicon nitride + H·
6 records matched HNO + O· → NO2 + H·
1 record matched HNO → NO + H·
4 records matched HOPO → PO2 + H·
1 record matched HD + ·Cl → DCl + H·
1 record matched HD + O· → H· + OD
3 records matched HD + D → D2 + H·
3 records matched HD + ·F → H· + DF
2 records matched AlH + ·Cl → H· + AlCl
2 records matched SiH2 → H· + SiH
2 records matched NH + N → N2 + H·
1 record matched NH2 + N → N2 + H· + H·
2 records matched NH2 + O· → H· + HNO
1 record matched NH2 + HNO → H· + NH2NO
1 record matched NH2 + NH → HN=NH + H·
1 record matched BH + ·Cl → H· + BCl
1 record matched BH + ·F → H· + BF
2 records matched SiH3 → H· + SiH2
1 record matched NH2NH + HNO → H· + NH2NHN=O
1 record matched BeH + ·Cl → H· + Beryllium chloride
1 record matched BeH + ·F → H· + BeF
2 records matched ·CHF → CF + H·
1 record matched H· + 1,3-Cyclopentadiene, 5-ethynyl- → fulvallenyl + H2
1 record matched H· + CH3(cyc-C5H4) → 2-Methyl-1,3-cyclopentadiene
1 record matched H· + CH3(cyc-C5H4) → 1-Methyl-1,3-cyclopentadiene
1 record matched H· + CH3(cyc-C5H4) → 1,3-Cyclopentadiene, 5-methyl-
4 records matched H· + HOPO2 → H2O + PO2
1 record matched H· + HOPO2 → O=P(·)(OH)2
1 record matched H· + SiH3OO → O2 + SiH4
1 record matched H· + 2-(·)C6H4C2H3 → Styrene
1 record matched H· + CH3CCCH2· → 2-butyne
2 records matched H· + CH3CCCH2· → Products
1 record matched H· + CH3SSCH2 → (CH3S)2
1 record matched H· + CH2=SiCl2 → Silyl, dichloromethyl-
1 record matched H· + 1H-inden-1-yl → Indene
1 record matched H· + CH=C=CH → CH2=C=CH
1 record matched H· + SiHCl2 → HCl + SiHCl
1 record matched H· + SiHCl2 → SiH2Cl2
1 record matched H· + SiHCl2 → H2 + SiCl2
2 records matched H· + CH2C(·)CCCH → Vinylacetylene
1 record matched H· + ·CH2 → ·CH3
2 records matched H· + ·CH2 → H2 + ·CH
1 record matched H· + SNO → Products
1 record matched H· + HCCO → CH2(X3B_1) + CO
1 record matched H· + HCCO → CH2(1) + CO
1 record matched H· + HC≡COH → Products
1 record matched H· + AlI → Al + HI
2 records matched H· + 1,3-Cyclopentadiene, 5-ethenylidene- → Benzyl
2 records matched H· + 1,3-Cyclopentadiene, 5-ethenylidene- → C2H2 + Cyclopentadienyl
1 record matched H· + 1,3-Cyclopentadiene, 5-ethenylidene- → fulvallenyl + H2
2 records matched H· + 1,3-Cyclopentadiene, 5-ethenylidene- → cyclopentadienyl-ethene radical
2 records matched H· + 1,3-Cyclopentadiene, 5-ethenylidene- → cyclopentenyl-allene radical
1 record matched H· + 1,3-Cyclopentadiene, 5-ethenylidene- → 1-Ethynyl-1,3-cyclopentadiene + H·
1 record matched H· + 2,4-Cyclohexadienone → H2 + C6H5O
1 record matched H· + ·Cl → HCl
3 records matched H· + NCO → CO + NH
1 record matched H· + NCO → HO-C≡N
1 record matched H· + NCO → HN=C=O
1 record matched H· + NCO → HCN + O·
2 records matched H· + NCO → Products
1 record matched H· + NCO → (3)NH + CO
1 record matched H· + AlBr → Al + HBr
1 record matched H· + CH2=C=C=CH· → Methylenecyclopropene
2 records matched H· + CH2=C=C=CH· → CH2=C=C=CH2
1 record matched H· + CH2=C=C=CH· → H2 + 1,2,3-butatrienylidene
1 record matched H· + CH2=C=C=CH· → 1,3-Cyclobutadiene
2 records matched H· + CH2=C=C=CH· → Vinylacetylene
1 record matched H· + CH2=C=C=CH· → 1,3-Butadiyne + H2
1 record matched H· + CH2=C=C=CH· → C2H2 + CH2=C
1 record matched H· + CH2=C=C=CH· → C2H2 + C2H2
1 record matched H· + CH2=C=C=CH· → Products
1 record matched H· + BrO2 → Products
1 record matched H· + Beryllium hydroxide → BeO + H2
1 record matched H· + AlOH → H2 + AlO
1 record matched H· + Paracoumaryl alcohol → Products
1 record matched H· + HBO → H2 + BO
1 record matched H· + HBO → cis-HBOH
1 record matched H· + HBO → OBH2
1 record matched H· + BCl → BH + ·Cl
1 record matched H· + C2H5CH=C=O → ·CH2CH2CHCO + H2
1 record matched H· + C2H5CH=C=O → CH3CH(·)CHCO + H2
1 record matched H· + TiCl → Ti + HCl
1 record matched H· + Cl3SiCH2· → CH3SiCl3
1 record matched H· + SiCl3 → SiHCl3
1 record matched H· + SiCl3 → HCl + SiCl2
1 record matched H· + 3,5-dimethylbenzyl radical → 1,3,5-Trimethylbenzene
1 record matched H· + CH3CH=CHC(O)OCH3 → Products
1 record matched H· + CH3CH=CHC(O)OCH3 → CH3CH=CHC(O)OCH2· + H2
1 record matched H· + CH3CH=CHC(O)OCH3 → CH3CH=C(·)C(O)OCH3 + H2
1 record matched H· + CH3CH=CHC(O)OCH3 → CH3C(·)=CHC(O)OCH3 + H2
1 record matched H· + CH3CH=CHC(O)OCH3 → ·CH2CH=CHC(O)OCH3 + H2
1 record matched H· + 1-Chloro-4-(2-chloroethenyl)benzene → (4-chlorophenyl)-2-vinyl radical + HCl
1 record matched H· + Strontium hydroxide → H2O + SrOH
1 record matched H· + N → NH
1 record matched H· + OClO → Products
1 record matched H· + Ba(OH)2 → H2O + BaOH
1 record matched H· + 1-Phenyl-1,3-butadiene(E) → 1-Phenylbut-3-en-2-yl
1 record matched H· + 2,3,4-Trichlorophenol → 2,3,4-trichlorophenoxy radical + H2
1 record matched H· + H2C=N → CH2=NH
1 record matched H· + (E)-C2H5CH=CHC(O)OCH3 → Products
1 record matched H· + 1-Ethynylnaphthalene → 1-naphthyl-2-vinyl
1 record matched H· + (E)-HN=NH → NH2NH
1 record matched H· + (E)-HN=NH → H2 + HN=N
1 record matched H· + GeH2Cl2 → GeHCl2 + H2
1 record matched H· + ClO → ·OH + ·Cl
1 record matched H· + ClONO2 → HOCl + NO2
1 record matched H· + ClONO2 → HNO2 + ClO
1 record matched H· + ClONO2 → HNO3 + ·Cl
1 record matched H· + ClONO2 → HCl + NO3
1 record matched H· + ClONO2 → CCl(O)NO + ·OH
1 record matched H· + HSS → S + H2S
1 record matched H· + HSS → H2 + S2
1 record matched H· + AlH2 → H2 + AlH
1 record matched H· + I → HI
4 records matched H· + HNO → H2 + NO
1 record matched H· + HIO → H2 + IO
2 records matched H· + HOPO → H2O + PO
2 records matched H· + HOPO → H2 + PO2
3 records matched H· + HD → H· + HD
3 records matched H· + HD → H2 + D
1 record matched H· + NBr → Br· + NH
1 record matched H· + AlH → H2 + Al
1 record matched H· + NHOH → H2 + HNO
1 record matched H· + SH → H2 + S
1 record matched H· + SiHCl → HCl + SiH
1 record matched H· + SiHCl → H2 + SiCl
1 record matched H· + Methyl (2E)-2-hexenoate → Products
1 record matched H· + BrF → HBr + ·F
1 record matched H· + BrF → HF + Br·
2 records matched H· + SiH2 → SiH3
3 records matched H· + SiH2 → H2 + SiH
1 record matched H· + SiH2F2 → H2 + HF2Si
7 records matched H· + Ge2H6 → GeH4 + GeH3
6 records matched H· + Ge2H6 → Ge2H5 + H2
2 records matched H· + SiH → SiH2
4 records matched H· + SiH → H2 + Si
1 record matched H· + SiH → Si(1D) + H2
1 record matched H· + NH → H· + NH
1 record matched H· + NH → H2 + N
2 records matched H· + NH → N(4S) + H2
1 record matched H· + XeOF4 → HF + OF
1 record matched H· + BF → BH + ·F
1 record matched H· + BH → H2 + B
3 records matched H· + SiH3 → SiH4
2 records matched H· + SiH3 → H2 + SiH2
1 record matched H· + SiH33SiH2 + H2
1 record matched H· + GeH3Cl → H2 + GeH2Cl
1 record matched H· + 3-buten-1-vynylbenzene → 4-Phenylbut-3-ene-1-yne + H·
1 record matched H· + 3-buten-1-vynylbenzene → Vinylacetylene + Phenyl
1 record matched H· + 3-buten-1-vynylbenzene → Naphthalene + H·
1 record matched H· + 3-buten-1-vynylbenzene → Products
1 record matched H· + 3-buten-1-vynylbenzene → CH2=CH-CH=C(·)-C6H5
1 record matched H· + 3-buten-1-vynylbenzene → cis-1-phenyl-vinylacetylene + H·
1 record matched H· + 3-buten-1-vynylbenzene → CH2=C=C=CH-C6H5 + H·
1 record matched H· + 3-buten-1-vynylbenzene → 1-phenyl-1,3-butadien-2-yl
1 record matched H· + AlCl → AlH + ·Cl
1 record matched H· + SiCl2 → SiHCl2
1 record matched H· + SiCl2 → HCl + SiCl
1 record matched H· + SiH3F → H2 + SiH2F
1 record matched H· + SiD4 → HD + SiD3
1 record matched H· + SiD4 → SiHD3 + D
2 records matched H· + DBr → Br· + HD
1 record matched H· + HOBr → H2 + BrO
1 record matched H· + AlHCl2 → H2 + AlCl2
1 record matched H· + AlHCl2 → AlHCl + HCl
1 record matched H· + SiH3Cl → H2 + SiH2Cl
1 record matched H· + SiHF3 → H2 + SiF3
2 records matched H· + H2S2 → H2S + SH
1 record matched H· + H2S2 → H2 + HSS
1 record matched H· + (E)-3-C6H12 → CH3CH2CH=CHCH2CH2· + H2
1 record matched H· + (E)-3-C6H12 → CH3CH2CH=CHCH(·)CH3 + H2
1 record matched H· + (E)-3-C6H12 → CH3CH2CH=C(·)CH2CH3 + H2
1 record matched H· + 2,4-Cyclopentadiene-1-one → CO + CH2=CHCH=CH·
1 record matched H· + 2,4-Cyclopentadiene-1-one → C2H2 + CH2=CHC(·)O
1 record matched H· + 2,4-Cyclopentadiene-1-one → Products
1 record matched H· + 2,4-Cyclopentadiene-1-one → hydroxycyclopentadienyl radical
1 record matched H· + 2,4-Cyclopentadiene-1-one → 2,4-cyclopentadien-3-oxy
5 records matched H· + H· → H2
1 record matched Cyclohexadienyl → Benzene + H·
2 records matched PO2 + H· → HOPO
1 record matched SrOH + H· → SrO + H2
1 record matched OF + H· → ·OH + ·F
1 record matched NO3 + H· → ·OH + NO2
1 record matched KO2 + H· → ·OH + KO
1 record matched BaOH + H· → BaO + H2
1 record matched Cyclohexadienyl, 6-hydroxy- → Phenol + H·
1 record matched CH2NH2 → CH2=NH + H·
1 record matched CH2NH2 → CH-NH2 + H·
1 record matched BCl3 + H· → HCl + BCl2
1 record matched 2-Naphthalenyl + H· → Naphthalene
1 record matched 2-Naphthalenyl → Other Products + H·
1 record matched C6H5CH2C2H + H· → 2-propargylphenyl + H2
1 record matched NO2 + H· → ·OH + NO
1 record matched NO + ·CH2 → HN=C=O + H·
1 record matched NO + NH → N2O + H·
1 record matched Br· + NH → H· + NBr
1 record matched TiCl2 + H· → HCl + TiCl
1 record matched HBr + ·F → H· + BrF
7 records matched HBr + H· → H2 + Br·
2 records matched HBr + Br· → Br2 + H·
1 record matched HBr → Br· + H·
1 record matched HI + ·Cl → ICl + H·
3 records matched HI + I → I2 + H·
1 record matched HI + H· → H2 + I
2 records matched O3 + H· → ·OH + O2
1 record matched O3 + H· → HO2 + O·
1 record matched O3 + H· → Products
1 record matched O3 + H· → O2(1DELTA) + ·OH
3 records matched SiCl4 + H· → HCl + SiCl3
1 record matched SiHCl3 + H· → HCl + SiHCl2
2 records matched SiHCl3 + H· → H2 + SiCl3
1 record matched SiHCl3 → H· + SiCl3
1 record matched N2O + H· → NO + NH
3 records matched N2O + H· → ·OH + N2
13 records matched SiH4 + H· → H2 + SiH3
4 records matched SiH4 → H· + SiH3
23 records matched PH3 + H· → H2 + PH2
1 record matched PH3 → H· + PH2
1 record matched ICl + H· → HI + ·Cl
1 record matched HOCl + H· → ·OH + HCl
1 record matched HOCl + H· → H2 + ClO
2 records matched HOCl + H· → Products
1 record matched ClF + H· → HF + ·Cl
1 record matched ClF + H· → HCl + ·F
1 record matched AsH3 → H· + AsH2·
1 record matched AlH3 + H· → H2 + AlH2
4 records matched Si3H8 + H· → SiH4 + Si2H5
2 records matched Si3H8 + H· → Si2H6 + SiH3
2 records matched Si3H8 + H· → Products
2 records matched Si3H8 + H· → SiH3SiH2SiH2· + H2
2 records matched Si3H8 + H· → SiH3Si(·)HSiH3 + H2
10 records matched H2S + H· → H2 + SH
1 record matched H2S → H· + SH
1 record matched HNO2 + H· → H2O + NO
1 record matched HNO2 + H· → ·OH + HNO
1 record matched HNO2 + H· → H2 + NO2
11 records matched GeH4 + H· → H2 + GeH3
1 record matched GeH4 → H· + GeH3
1 record matched Cl2 + H· → HCl + ·Cl
1 record matched O2 + ·CH2 → CO + ·OH + H·
3 records matched O2 + ·CH2 → CO2 + H· + H·
1 record matched O2 + ·CH2 → O(1D) + HCO + H·
1 record matched O2 + SiH3 → H· + HSi(O)OH
1 record matched O2 + H· → H· + O· + O·
16 records matched O2 + H· → ·OH + O·
20 records matched O2 + H· → HO2
1 record matched O2 + SiH4 → H· + SiH3OO
6 records matched D2 + H· → HD + D
3 records matched H2O + C2F → CHFCO + H·
1 record matched H2O + C2F → c-COCHF + H·
2 records matched H2O + O· → HO2 + H·
4 records matched H2O + H· → H2 + ·OH
1 record matched H2O + C2 → H· + c-HCOC(·)
1 record matched H2O + C2 → H· + (·)C#COH
1 record matched H2O → ·OH + H·
2 records matched N2 + H· → HN=N
2 records matched N2 + H· → NH + N
2 records matched Br2 + H· → HBr + Br·
9 records matched H2O2 + H· → ·OH + H2O
8 records matched H2O2 + H· → H2 + HO2
4 records matched H2O2 + H· → Products
1 record matched titanium(III) chloride + H· → HCl + TiCl2
1 record matched S + c-C3H → H· + CCCS
1 record matched S + CCCH → H· + CCCS
1 record matched S + SH → H· + S2
2 records matched DCl + H· → HD + ·Cl
1 record matched DCl + H· → HCl + D
1 record matched HNO3 + H· → H2 + NO3
10 records matched NH3 + H· → H2 + NH2
1 record matched NH3 + H· → Products
3 records matched NH3 → H· + NH2
1 record matched HF + ·Cl → ClF + H·
1 record matched HF + ·F → F2 + H·
1 record matched HF + H· → H2 + ·F
1 record matched HF + Br· → H· + BrF
1 record matched HCl + SiHCl2 → SiHCl3 + H·
1 record matched HCl + ·CH2 → ·CH2Cl + H·
1 record matched HCl + Silyl, dichloromethyl- → CH3SiCl3 + H·
4 records matched HCl + ·Cl → Cl2 + H·
2 records matched HCl + SiCl3 → SiCl4 + H·
1 record matched HCl + D → DCl + H·
1 record matched HCl + AlCl2 → AlCl3 + H·
1 record matched HCl + ·F → ClF + H·
1 record matched HCl + AlH2 → AlH2Cl + H·
1 record matched HCl + SiCl → H· + SiCl2
1 record matched HCl + SiHCl → H· + SiHCl2
1 record matched HCl + SiH → H· + SiHCl
2 records matched HCl + AlCl → H· + AlCl2
1 record matched HCl + SiCl2 → H· + SiCl3
3 records matched HCl + H· → H2 + ·Cl
1 record matched HCl → H· + ·Cl
1 record matched Sodium hydride + H· → H2 + Na
1 record matched HOClO3 + H· → ·OH + HOClO2
1 record matched HOClO3 + H· → ClO4 + H2
1 record matched LiH + H· → H2 + Li
1 record matched I2 + H· → HI + I
1 record matched TiCl4 + H· → HCl + titanium(III) chloride
1 record matched Mercury chloride + H· → Hg + HCl
3 records matched Mercury chloride + HCl → HgCl2 + H·
1 record matched 2-Cyclohexenyl → 1,3-Cyclohexadiene + H·
2 records matched HgCl2 + H· → Mercury chloride + HCl
1 record matched AlCl3 + H· → HCl + AlCl2
2 records matched SO2 + H· → HSO2
3 records matched SO2 + H· → Products
2 records matched SO2 + H· → HOSO
1 record matched Ca + HN3 → Other Products + H·
1 record matched Ca + HF → H· + FCa
1 record matched C + SH → CS + H·
1 record matched C + PH3 → HC=PH + H·
1 record matched C + PH3 → H2C=P· + H·
1 record matched C + HF → CF + H·
1 record matched B + H2O → BOH + H·
1 record matched Be + HCl → H· + Beryllium chloride
1 record matched Ba + H2O → BaOH + H·
1 record matched K + H2O → KOH + H·
2 records matched Hg + HCl → Mercury chloride + H·
1 record matched Li + H2O → LiOH + H·
1 record matched Li + HCl → LiCl + H·
1 record matched Al + HBr → H· + AlBr
1 record matched Al + HI → H· + AlI
1 record matched Al + H2O → H· + AlOH
3 records matched Al + HCl → H· + AlCl
1 record matched C10H7CH2 + H· → 2-Methylnaphthalene
1 record matched HOCH2CH2CH2CH2 → CH2=CHCH2CH2OH + H·
1 record matched CH3CH(·)CH2OH → H· + (Z)-CH3CH=CHOH
1 record matched CH3CH(·)CH2OH → H· + (E)-CH3CH=CHOH
1 record matched CH3CH(·)CH2OH → CH2=CHCH2OH + H·
1 record matched HNC + CCCN → NCCCCN + H·
1 record matched HNC + H· → Products
1 record matched CH2=CHO· + H· → CH2=CHOH
1 record matched CH2=CHO· + H· → CH3CHO
2 records matched CH2=CHO· → H2C=C=O + H·
1 record matched ·CH2Cl + N → HClCN + H·
1 record matched ·CH2Cl + H· → HCl + ·CH2
2 records matched ·CH2Cl + HCl → CH2Cl2 + H·
1 record matched CH2=C=CH + H· → CH2=C=CH2
1 record matched CH2=C=CH + H· → CH3CCH
1 record matched CH2=C=CH + H· → Products
1 record matched HOCH2CH2CH2· → H· + (Z)-CH3CH=CHOH
1 record matched HOCH2CH2CH2· → H· + (E)-CH3CH=CHOH
1 record matched HOCH2CH2CH2· → C2H5CHO + H·
1 record matched 4-Methoxyphenoxy radical → 4-Hydroxybenzaldehyde + H·
1 record matched C2H5CH(·)OH → H· + (E)-CH3CH=CHOH
1 record matched C2H5CH(·)OH → C2H5CHO + H·
1 record matched C2H5CH(·)OH → CH2=CHCH2OH + H·
1 record matched 4-Phenylbut-3-ene-1-yne + H· → H· + 3-buten-1-vynylbenzene
1 record matched 4-Phenylbut-3-ene-1-yne + H· → H· + 1-Buten-3-yn-2-ylbenzene
1 record matched 4-Phenylbut-3-ene-1-yne + H· → Vinylacetylene + Phenyl
1 record matched 4-Phenylbut-3-ene-1-yne + H· → Naphthalene + H·
1 record matched 4-Phenylbut-3-ene-1-yne + H· → Products
1 record matched 4-Phenylbut-3-ene-1-yne + H· → cis-1-phenyl-vinylacetylene + H·
1 record matched 4-Phenylbut-3-ene-1-yne + H· → CH2=C=C=CH-C6H5 + H·
1 record matched 4-Phenylbut-3-ene-1-yne + H· → CH2=C=CH-CH(·)-C6H5
1 record matched 4-Phenylbut-3-ene-1-yne + H· → 4-phenyl-but-1-yn-3-yl + H·
1 record matched 2-Hydroxyphenoxy radical + H· → 1,2-Dihydroxybenzene
1 record matched CBr3OH → CBr3O(·) + H·
1 record matched 2,3,4,5-Tetrachlorophenol + H· → 2,3,4,5-tetrachlorophenoxy radical + H2
1 record matched iso-C4H9 + O· → (CH3)2CHCHO + H·
2 records matched iso-C4H9 → iso-C4H8 + H·
1 record matched 1-C8H17 → 1-C8H16 + H·
1 record matched Cl2C=C=O + H· → CO + CHCl2
1 record matched Cl2C=C=O + H· → CClCO + HCl
1 record matched Cl2C=C=O + H· → CCl2CHO
1 record matched Cyclooctyl radical + O· → H· + CH2=CHCH2CH2CH2CH2CH2CHO
1 record matched Cyclooctyl radical + O· → Cyclooctanone + H·
1 record matched Diphenylmethyl → 9H-Fluorene + H·
1 record matched HOCH2CH2· + O· → HOCH2CHO + H·
3 records matched HOCH2CH2· → CH2=CHO· + H·
1 record matched HOCH2CH2· → CH2=CHOH + H·
2 records matched *CH2C(O)H → H2C=C=O + H·
1 record matched C6H5CH2OO + H· → ·OH + C6H5CH2O
2 records matched C6H5CH2OO + H· → C6H5CH2OOH
1 record matched C6H5CH2OO + H· → C6H5CHOH + ·OH
1 record matched C6H5CH2OO + H· → Benzyl + HO2
1 record matched CH2DOH + H· → H2O + CH2D
1 record matched CH2DOH + H· → (·)CH2OH + HD
1 record matched CH2DOH + H· → H2 + CHDOH
1 record matched CH2DOH + H· → CH2DO + H2
2 records matched SiH2Cl2 + H· → H2 + SiHCl2
1 record matched SiH2Cl2 → H· + SiHCl2
1 record matched Methylenecyclopropene → H· + CH2=C=C=CH·
1 record matched (E)-2-C6H12 + H· → CH3CH=CHCH(·)CH2CH3 + H2
1 record matched (E)-2-C6H12 + H· → trans-CH3CH=CHCH2CH2CH2· + H2
1 record matched (E)-2-C6H12 + H· → trans-CH3CH=CHCH2CH(·)CH3 + H2
1 record matched (E)-2-C6H12 + H· → CH3CH2CH2CH=CHCH2· + H2
1 record matched (E)-2-C6H12 + H· → CH3CH2CH2CH=C(·)CH3 + H2
1 record matched (E)-2-C6H12 + H· → CH3CH2CH2C(·)=CHCH3 + H2
1 record matched i-C3H7O → Acetone + H·
1 record matched ·CCl + H· → ·CH + ·Cl
2 records matched CF + H· → C + HF
1 record matched CF + H· → ·CH + ·F
1 record matched Cyclopentyl → Cyclopentene + H·
1 record matched ·CH2F + N → H· + HFCN
1 record matched ·CH2F + N → trans-FCNH + H·
2 records matched ·CH2F → H· + ·CHF
1 record matched CH2=CHCH2C(O)OCH3 + H· → Products
1 record matched CH2=CHCH2C(O)OCH3 + H· → CH2=CHCH2C(O)OCH2· + H2
1 record matched CH2=CHCH2C(O)OCH3 + H· → CH2=CHCH(·)C(O)OCH3 + H2
1 record matched CH2=CHCH2C(O)OCH3 + H· → CH2=C(·)CH2C(O)OCH3 + H2
1 record matched CH2=CHCH2C(O)OCH3 + H· → ·CH=CHCH2C(O)OCH3 + H2
1 record matched HN=NH + H· → H2 + HN=N
1 record matched Cycloheptatrienyl + H· → 1,3,5-Cycloheptatriene
1 record matched [1,1'-Biphenyl]-2-yl + H· → Biphenyl
1 record matched [1,1'-Biphenyl]-2-yl → Acenaphthylene + H·
1 record matched CHCl2 + HCl → CHCl3 + H·
1 record matched 1-C7H15 → 1-C7H14 + H·
1 record matched ·OH + ·Cl → H· + ClO
5 records matched ·OH + NCO → CO + NO + H·
1 record matched ·OH + HOCH → CO2 + H2 + H·
7 records matched ·OH + N → NO + H·
12 records matched ·OH + O· → O2 + H·
1 record matched ·OH + D → H· + OD
2 records matched ·OH + HD → H· + HDO
2 records matched ·OH + SO → SO2 + H·
1 record matched ·OH + NH → H· + HNO
1 record matched ·OH + NH2 → H· + NH2O
1 record matched ·OH + NH2 → trans-HNOH + H·
1 record matched ·OH + NH2 → cis-HNOH + H·
1 record matched ·OH + KO → KO2 + H·
5 records matched ·OH + H· → H2O
1 record matched ·OH + AsH3 → H· + AsH3O
1 record matched ·OH + AsH3 → H· + H2AsOH
1 record matched ·OH + N2 → N2O + H·
2 records matched ·OH + C → CO + H·
1 record matched ·OH + C → CO(a3Π) + H·
2 records matched ·OH + Si → SiO + H·
1 record matched ·OH + HNC → HN=C=O + H·
3 records matched ·OH + ·OH → HO2 + H·
1 record matched CHCCH(·)CH3 + H· → 1,2-butadiene
1 record matched CHCCH(·)CH3 + H· → 1-butyne
1 record matched CHCCH(·)CH3 + H· → Products
1 record matched ·CH + ·Cl → ·CCl + H·
1 record matched ·CH + O· → CO + H·
1 record matched ·CH + ·F → CF + H·
4 records matched ·CH + H· → H2 + C
1 record matched ·CH + O2 → CO2 + H·
2 records matched ·CH + H2O → CH2O + H·
2 records matched ·CH + N2 → NCN + H·
1 record matched ·CH + NH3 → CH2=NH + H·
1 record matched ·CH + NH3 → CH-NH2 + H·
1 record matched C2H5OCH2CH2· → CH2=CHOC2H5 + H·
1 record matched HO2 + 3,4-dimethylphenyl-methyl → ·OH + 3,4-dimethylbenzaldehyde + H·
1 record matched HO2 + 2,5-dimethylphenyl-methyl → ·OH + 2,5-dimethylbenzaldehyde + H·
1 record matched HO2 + 2,4-dimethylphenyl-methyl → ·OH + H· + 2,4-dimethylbenzaldehyde
6 records matched HO2 + H· → H2O + O·
8 records matched HO2 + H· → ·OH + ·OH
7 records matched HO2 + H· → H2 + O2
2 records matched HO2 + H· → Products
2 records matched HO2 + H· → O(1D) + H2O
2 records matched HO2 + H· → O2(1DELTA) + H2
2 records matched HO2 + H· → O2(1Delta_g) + H2
1 record matched HO2 + H· → H2OO
1 record matched HO2 + H· → O2(3Delta_u) + H2
1 record matched ·CCl3 + HCl → CCl4 + H·
1 record matched CH3CO + H· → CH3CHO
2 records matched CH3CO → H2C=C=O + H·
1 record matched Cyclohexyl + O· → CH2=CHCH2CH2CH2CHO + H·
1 record matched Cyclohexyl + O· → Cyclohexanone + H·
1 record matched Cyclohexyl → Cyclohexene + H·
1 record matched HC≡CC≡CC≡CH + C → CCCCCCCH + H·
1 record matched CH3OOH + H· → Products
1 record matched CH2C≡CH + O· → HC≡CCHO + H·
1 record matched CH2C≡CH + H· → Products
1 record matched CH2C≡CH → H· + CH=C=CH
1 record matched CH2C≡CH → H· + c-C3H2
2 records matched CH2C≡CH → CH≡CC(·)H + H·
1 record matched CH2=C=C=CH2 → H· + CH2=C=C=CH·
1 record matched C2H5SiH3 + H· → H2 + C2H5SiH2(·)
1 record matched C2H5SiH3 + H· → H2 + SiH3CH2CH2(·)
1 record matched C2H5SiH3 + H· → Other Products + H2
1 record matched C2H5SiH3 + H· → SiH3CH(·)CH3 + H2
5 records matched HCCCHCH· → 1,3-Butadiyne + H·
1 record matched 1-hexyl radical → 1-C6H12 + H·
3 records matched 1-C5H11 → 1-C5H10 + H·
1 record matched ·CHF2 + O· → COF2 + H·
1 record matched ·CHF2 + H· → H2 + ·CF2
2 records matched ·CHF2 → ·CF2 + H·
2 records matched C2H3 + N → CH2CN + H·
1 record matched C2H3 + O· → H2C=C=O + H·
2 records matched C2H3 + H· → C2H2 + H2
3 records matched C2H3 + H· → C2H4
1 record matched C2H3 + O2 → CH2O + CO + H·
1 record matched C2H3 + HCl → CH2=CHCl + H·
2 records matched C2H3 + ·OH → CH2=CHO· + H·
2 records matched C2H3 + ·OH → CH3CO + H·
1 record matched C2H3 + ·OH → CO + ·CH3 + H·
9 records matched C2H3 → C2H2 + H·
1 record matched NCN + H· → ·NHC=N
1 record matched NCN + H· → HNC + N
1 record matched NCN + H· → HCN + N
1 record matched CH3CH2CH=CH· → 1-butyne + H·
1 record matched ·HCC≡N + H· → H2 + CC≡N
1 record matched HCO + H· → O· + ·CH2
3 records matched HCO + H· → CO + H2
1 record matched HCO + H· → CH2O
1 record matched HCO + H· → Products
1 record matched HCO + NO2 → CO2 + NO + H·
1 record matched HCO + O3 → CO2 + O2 + H·
2 records matched HCO → CO + H·
1 record matched (·)CH2OH + H· → CH3OH
4 records matched (·)CH2OH → CH2O + H·
2 records matched HC(O)Cl + H· → HCO + HCl
2 records matched HC(O)Cl + H· → H2 + ClCO
1 record matched HC(O)Cl → ClCO + H·
1 record matched HOC(·)O → CO2 + H·
2 records matched 1-Naphthalenyl + H· → Naphthalene
1 record matched 1-Naphthalenyl → Other Products + H·
5 records matched 1-C4H9 → 1-C4H8 + H·
3 records matched CH3CH2CH2CH(·)CH3 → 2-(E)-C5H10 + H·
3 records matched CH3CH2CH2CH(·)CH3 → 2-(Z)-C5H10 + H·
2 records matched CH3CH2CH2CH(·)CH3 → 1-C5H10 + H·
1 record matched 1H-Indene, 1-methylene- + H· → Naphthalene + H·
2 records matched 1H-Indene, 1-methylene- + H· → Products
1 record matched 1H-Indene, 1-methylene- + H· → 2-methyleneindan-3-yl radical
1 record matched 1H-Indene, 1-methylene- + H· → 2-methyleneindan-4-yl radical
1 record matched 1H-Indene, 1-methylene- + H· → 1H-Indene, 1-methyl-1-yl radical
1 record matched 1H-Indene, 1-methylene- + H· → methyl-inden-1-yl radical
1 record matched C6H5CHOH → Benzaldehyde + H·
1 record matched Methyl 5-hexenoate + H· → Products
1 record matched Methyl 4-hexenoate + H· → Products
1 record matched Methyl 3-hexenoate + H· → Products
1 record matched Phenyl + CH2=CHCH=CH· → phenyl, cis-(Z)-2-(buta-1,3-dien-1-yl) + H·
1 record matched Phenyl + HNO → Nitrosobenzene + H·
3 records matched Phenyl + H· → Benzene
1 record matched Phenyl + Phenyl → [1,1'-Biphenyl]-4-yl + H·
1 record matched Phenyl + Phenyl → benzobicyclo-[2,2,2]octatrienyl radical + H·
1 record matched Phenyl → o-C6H4 + H·
1 record matched 4-Methylbenzyl + O· → 4-Methylbenzaldehyde + H·
1 record matched 4-Methylbenzyl → 1,4-Cyclohexadiene,3,6-bis(methylene)- + H·
1 record matched 1-phenylethyl + H· → Ethylbenzene
1 record matched 1-phenylethyl + H· → 5-ethylidene-1,4-cyclohexadiene
1 record matched 1-phenylethyl + H· → 5-ethylidene-1,3-cyclohexadiene
3 records matched 1-phenylethyl → Styrene + H·
1 record matched 2-Methylbenzyl → H· + o-Xylylene
1 record matched 2-Methylbenzyl → Benzocyclobutene + H·
1 record matched 3-Methylbenzyl → 1,4-Cyclohexadiene,3,6-bis(methylene)- + H·
1 record matched 3-Methylbenzyl → m-xylylene + H·
1 record matched 3-Methylbenzyl → 2-methylfulveneallene + H·
1 record matched CH3CH(·)OH + O· → CH3C(O)OH + H·
2 records matched CH3CH(·)OH + H· → CH3CH + H2O
2 records matched CH3CH(·)OH + H· → ·CH3 + (·)CH2OH
1 record matched CH3CH(·)OH + H· → CH3CH2O· + H·
2 records matched CH3CH(·)OH + H· → ·C2H5 + ·OH
1 record matched CH3CH(·)OH + H· → CH2=CHOH + H2
3 records matched CH3CH(·)OH + H· → CH3CHO + H2
2 records matched CH3CH(·)OH + H· → C2H4 + H2O
2 records matched CH3CH(·)OH + H· → CH4 + HOCH
4 records matched CH3CH(·)OH + H· → C2H5OH
2 records matched CH3CH(·)OH + H· → CH2O + CH4
8 records matched CH3CH(·)OH → CH2=CHOH + H·
8 records matched CH3CH(·)OH → CH3CHO + H·
1 record matched Benzene, 1,2-propadienyl- + H· → 2-C6H4CHCCH2 + H2
1 record matched C2F5CF2H + H· → H2 + n-C3F7
1 record matched ·CH3 + ·CH2 → C2H4 + H·
1 record matched ·CH3 + N → H· + H2C=N
1 record matched ·CH3 + N → trans-HCNH + H·
1 record matched ·CH3 + N → H2NC + H·
1 record matched ·CH3 + O· → CO + H2 + H·
3 records matched ·CH3 + O· → CH2O + H·
1 record matched ·CH3 + ·F → ·CH2F + H·
1 record matched ·CH3 + HNO → CH3NO + H·
2 records matched ·CH3 + HD → CH3D + H·
2 records matched ·CH3 + H· → H2 + ·CH2
13 records matched ·CH3 + H· → CH4
1 record matched ·CH3 + H2S → CH3SH + H·
2 records matched ·CH3 + HCl → CH3Cl + H·
4 records matched ·CH3 + ·OH → (·)CH2OH + H·
3 records matched ·CH3 + ·OH → CH3O· + H·
1 record matched ·CH3 + C2H3 → ·CH2CH=CH2 + H·
1 record matched ·CH3 + ·HCC≡N → CH3CN + H·
1 record matched ·CH3 + 1-Naphthalenyl → 1-Naphthylmethyl + H·
1 record matched ·CH3 + Phenyl → Benzyl + H·
2 records matched ·CH3 + ·CH3 → ·C2H5 + H·
3 records matched ·CH3 → H· + ·CH2
1 record matched HC≡CD + H· → ·C2H + HD
1 record matched HC≡CD + H· → H2 + CD≡C·
1 record matched HC≡CD + H· → C2H2 + D
1 record matched Cyclopropylmethyl → Methylenecyclopropane + H·
1 record matched CH2=CHCH2CH2· → 1,2-butadiene + H·
1 record matched CH2=CHCH2CH2· → 1-butyne + H·
7 records matched CH2=CHCH2CH2· → 1,3-Butadiene + H·
2 records matched ·CF2 + H· → CF + HF
1 record matched ·CF2 + ·OH → COF2 + H·
1 record matched ·CF2 + ·CH3 → CH2=CF2 + H·
1 record matched Benzyl + O· → Benzaldehyde + H·
1 record matched Benzyl + H· → 5-Methylene 1,3-cyclohexadiene
1 record matched Benzyl + H· → 3-Methylene-1,4-cyclohexadiene
1 record matched Benzyl + H· → Toluene
1 record matched Benzyl + H· → Products
1 record matched Benzyl + ·OH → C6H5CHOH + H·
1 record matched Benzyl + CH2C≡CH → 2-methyleneindanyl radical (unspecified isomer) + H·
1 record matched Benzyl + Benzyl + H· → Products
5 records matched Benzyl → H· + 1,3-Cyclopentadiene, 5-ethenylidene-
1 record matched CH3CH2O· + H· → CH3CH + H2O
1 record matched CH3CH2O· + H· → ·CH3 + (·)CH2OH
1 record matched CH3CH2O· + H· → ·C2H5 + ·OH
1 record matched CH3CH2O· + H· → CH2=CHOH + H·
2 records matched CH3CH2O· + H· → CH3CHO + H2
2 records matched CH3CH2O· + H· → C2H4 + H2O
1 record matched CH3CH2O· + H· → CH4 + HOCH
3 records matched CH3CH2O· + H· → C2H5OH
1 record matched CH3CH2O· + H· → CH2O + CH4
12 records matched CH3CH2O· → CH3CHO + H·
2 records matched CH3O· + H· → CH3OH
1 record matched CH3O· + H· → CH2O + H2
9 records matched CH3O· → CH2O + H·
1 record matched 1-C3H7 + O· → C2H5CHO + H·
6 records matched 1-C3H7 → CH3CH=CH2 + H·
1 record matched 1-C3H7 → Cyclopropane + H·
1 record matched CH3O2· + H· → CH4 + O2
2 records matched CH3O2· + H· → Products
2 records matched Cyclopentadienyl + O· → H· + 2,4-Cyclopentadiene-1-one
2 records matched Cyclopentadienyl + H· → Cyclopentadiene
1 record matched Cyclopentadienyl + O2 → HC(O)CH=CHCH=C=O + H·
1 record matched Cyclopentadienyl + CH2=C=CH → C5H4C3H3 + H·
1 record matched Cyclopentadienyl + ·OH → 2,4-cyclopentadienoxy + H·
2 records matched Cyclopentadienyl + ·OH → hydroxycyclopentadienyl radical + H·
1 record matched Cyclopentadienyl + ·OH → 2,4-cyclopentadien-3-oxy + H·
1 record matched Cyclopentadienyl + ·OH → 2,4-cyclopentadien-2-oxy + H·
1 record matched Cyclopentadienyl + ·CH3 → H· + CH3(cyc-C5H4)
1 record matched Cyclopentadienyl + ·CH3 → cyc-C(=CH2)-C(·)H-CH=CH-CH2 + H·
1 record matched Cyclopentadienyl + ·CH3 → cyc-C(=CH2)-CH=CH-CH2-CH· + H·
1 record matched Cyclopentadienyl + ·CH3 → cyc-C(-C(·)H2)-CH=CH-CH=CH + H·
1 record matched Cyclopentadienyl + Cyclopentadienyl → 1H-azulenyl + H·
1 record matched Cyclopentadienyl + Cyclopentadienyl → 1H-fulvalenyl + H·
1 record matched Cyclopentadienyl + Cyclopentadienyl → Naphthalen-1-yl, 1,4-dihydro + H·
1 record matched Cyclopentadienyl → H· + CH≡CCH2C≡CH
1 record matched Cyclopentadienyl → CH2CCHCCH + H·
1 record matched ·C2H + O· → C2O + H·
3 records matched ·C2H + HD → HC≡CD + H·
2 records matched ·C2H + H· → H2 + C2
1 record matched ·C2H + H· → H2 + C2H3
1 record matched ·C2H + H· → C2H2
2 records matched ·C2H + O2 → CO + CO + H·
1 record matched ·C2H + NH3 → CHCNH2 + H·
1 record matched ·C2H → C2 + H·
1 record matched CD3 + O· → CO + H2 + H·
1 record matched CD3 + HD → CD4 + H·
1 record matched CH2=NH + H· → CH3NH
1 record matched CH2=NH + H· → CH2NH2
1 record matched ·C2H5 + N → H· + CH2=CHNH
1 record matched ·C2H5 + N → CH3C(·)=NH + H·
2 records matched ·C2H5 + O· → CH3CHO + H·
2 records matched ·C2H5 + H· → C2H4 + H2
3 records matched ·C2H5 + H· → C2H6
1 record matched ·C2H5 + HCl → C2H5Cl + H·
7 records matched ·C2H5 → C2H4 + H·
2 records matched iso-C3H7 + O· → Acetone + H·
1 record matched iso-C3H7 + H· → C3H8
2 records matched iso-C3H7 → CH3CH=CH2 + H·
1 record matched ·CH2CH=CH2 + ·CH2 → 1,3-Butadiene + H·
1 record matched ·CH2CH=CH2 + O· → CH2=CHCHO + H·
2 records matched ·CH2CH=CH2 + H· → CH3CH=CH2
1 record matched ·CH2CH=CH2 + CH2C≡CH → Fulvene + H· + H·
1 record matched ·CH2CH=CH2 + Phenyl → H· + C6H5CH2C(·)=CH2
1 record matched ·CH2CH=CH2 + Cyclopentadienyl → C5H4CH2CHCH2 + H·
2 records matched ·CH2CH=CH2 → CH2=C=CH2 + H·
2 records matched FCO + H· → CO + HF
1 record matched Phenyl formate + H· → C6H5OC(=O)· + H2
1 record matched Phenyl formate + H· → 2-Formyloxy phenyl + H2
1 record matched Phenyl formate + H· → 3-Formyloxy phenyl + H2
1 record matched Phenyl formate + H· → 4-Formyloxy phenyl + H2
1 record matched CD3OH + H· → HD + CD2OH
2 records matched CD3OH + H· → CD3 + H2O
1 record matched 1-C8H17C(O)OCH3 + H· → CH3CH2CH2CH2CH2CH2CH2CH2C(O)OCH2· + H2
1 record matched C2D6 + H· → HD + ·C2D5
1 record matched C2D6 + H· → C2D5 + HD
2 records matched tert-C4H9 + O· → 2,2-Dimethyloxirane + H·
1 record matched tert-C4H9 + H· → iso-C4H10
1 record matched tert-C4H9 → iso-C4H8 + H·
1 record matched Si2H6 + H· → SiH4 + SiH3
1 record matched Si2H6 + H· → H2 + Si2H5
1 record matched Si2H6 + H· → Products
1 record matched 1,3-Butadienylbenzene + H· → trans-(·)CH=CH-CH=CH-C6H5 + H2
1 record matched 1,3-Butadienylbenzene + H· → phenyl, (E)-2-(buta-1,3-dien-1-yl) + H2
1 record matched CH2CBrCF3 + H· → Products
1 record matched CH2CBrCF3 + H· → CF3C(·)=CH2 + HBr
1 record matched CH2CBrCF3 + H· → CF3CHBrCH2·
1 record matched CH3OD + H· → ·CH3 + HDO
1 record matched CH3OD + H· → CH3O· + HD
1 record matched CH3OD + H· → H2 + CH2OD
1 record matched CH3GeH3 + H· → H2 + GeH3CH2*
2 records matched CH3GeH3 + H· → H2 + *GeH2CH3
2 records matched (CH3)2GeH2: + H· → H2 + *GeH(CH3)2
1 record matched (CH3)2GeH2: + H· → GeH2(CH3)CH2* + H2
1 record matched (CH3)3GeH + H· → H2 + GeH(CH3)2CH2*
1 record matched (CH3)3GeH + H· → H2 + (CH3)3Ge
1 record matched (CH3)3Ga + H· → CH4 + ·CH3 + CH3Ga
1 record matched (CH3)3Ga + H· → Ga(CH3)2H + ·CH3
2 records matched H2 + CH2=CHCH=CH· → 1,3-Butadiene + H·
1 record matched H2 + CH3SSCH2 → (CH3S)2 + H·
1 record matched H2 + SiHCl2 → SiH2Cl2 + H·
2 records matched H2 + ·CH2 → ·CH3 + H·
3 records matched H2 + CD≡C· → HC≡CD + H·
1 record matched H2 + Silyl, dichloromethyl- → Silane, dichloromethyl- + H·
1 record matched H2 + HC=S → H2CS + H·
13 records matched H2 + ·Cl → HCl + H·
2 records matched H2 + NCO → HN=C=O + H·
1 record matched H2 + Cl3SiCH2· → CH3SiCl3 + H·
1 record matched H2 + SiCl3 → SiHCl3 + H·
1 record matched H2 + N → H· + NH
10 records matched H2 + O· → ·OH + H·
9 records matched H2 + D → H· + HD
1 record matched H2 + AlCl2 → H· + AlHCl2
1 record matched H2 + CH3CHCl → C2H5Cl + H·
1 record matched H2 + ND2 → Other Products + H·
12 records matched H2 + ·F → HF + H·
1 record matched H2 + IO → H· + HIO
1 record matched H2 + I → HI + H·
1 record matched H2 + SiCl → H· + SiHCl
1 record matched H2 + SH → H2S + H·
1 record matched H2 + NH → H· + NH2
5 records matched H2 + NH2 → NH3 + H·
7 records matched H2 + GeH3 → GeH4 + H·
4 records matched H2 + SiH3 → SiH4 + H·
1 record matched H2 + OD → H· + HDO
1 record matched H2 + SiCl2 → H· + SiHCl2
1 record matched H2 + ·CHF → ·CH2F + H·
3 records matched H2 + BO → H· + HBO
8 records matched H2 + H· → H2 + H·
1 record matched H2 + H· → Products
2 records matched H2 + C2 → ·C2H + H·
1 record matched H2 + 2-Naphthalenyl → Naphthalene + H·
2 records matched H2 + NO2 → HNO2 + H·
1 record matched H2 + NO2 → cis-HONO + H·
1 record matched H2 + NO2 → trans-HONO + H·
2 records matched H2 + Br· → HBr + H·
1 record matched H2 + O2 + O2 → HO2 + O2 + H·
5 records matched H2 + O2 → HO2 + H·
2 records matched H2 + S → H· + SH
1 record matched H2 + SO2 → H· + HSO2
1 record matched H2 + Cs → H· + CsH
1 record matched H2 + C → ·CH + H·
1 record matched H2 + K → KH + H·
1 record matched H2 + CD3O → CD3OH + H·
1 record matched H2 + CH2=CHO· → CH2=CHOH + H·
1 record matched H2 + ·CH2Cl → CH3Cl + H·
1 record matched H2 + ·CH2F → CH3F + H·
1 record matched H2 + CHCl2 → CH2Cl2 + H·
24 records matched H2 + ·OH → H2O + H·
2 records matched H2 + ·CH → H· + ·CH2
3 records matched H2 + HO2 → H2O2 + H·
1 record matched H2 + ·CCl3 → CHCl3 + H·
1 record matched H2 + ·CHF2 → CH2F2 + H·
19 records matched H2 + C2H3 → C2H4 + H·
1 record matched H2 + (·)CH2OH → CH3OH + H·
2 records matched H2 + 1-Naphthalenyl → Naphthalene + H·
3 records matched H2 + Phenyl → Benzene + H·
1 record matched H2 + Phenyl amidogen → aniline + H·
3 records matched H2 + ·CF3 → CHF3 + H·
16 records matched H2 + ·CH3 → CH4 + H·
1 record matched H2 + Benzyl → Toluene + H·
1 record matched H2 + CH2=C → C2H3 + H·
2 records matched H2 + CH3O· → CH3OH + H·
1 record matched H2 + 1-C3H7 → C3H8 + H·
23 records matched H2 + ·C2H → C2H2 + H·
2 records matched H2 + CD3 → CHD3 + H·
6 records matched H2 + ·C2H5 → C2H6 + H·
1 record matched H2 + ·CH2CH=CH2 → CH3CH=CH2 + H·
1 record matched H2 + tert-C4H9 → iso-C4H10 + H·
2 records matched H2 → H· + H·
1 record matched NaOH + H· → Na + H2O
1 record matched NaOH + H· → H2 + NaO
2 records matched NaOH + H· → Adduct
2 records matched LiOH + H· → Li + H2O
1 record matched KOH + H· → K + H2O
1 record matched Ca(OH)2 + H· → H2O + CaOH
1 record matched C6H5CD3 + H· → C6H5CD2 + HD
1 record matched Benzene-d + H· → o-C6H6D
1 record matched Benzene-d + H· → ipso-C6H6D
1 record matched 1,3-Cyclobutadiene → H· + CH2=C=C=CH·
1 record matched (CH3)2SiH2 + SiH3 → H· + H3SiSiH(CH3)2
1 record matched Benzene-d6 + H· → Products
1 record matched HCCCN + H· → CH2=C(CN)
2 records matched HCCCN + H· → Products
1 record matched HCCCN + H· → HC#C-C(·)=NH
1 record matched HCCCN + H· → (·)CH=CH-C#N
1 record matched HCCCN + H· → HC#C-CH=N(·)
2 records matched HCCCN + C → H· + CCCCN
1 record matched 2,5-Dimethyltetrahydrofuran + H· → tetrahydro-2,5-dimethyl-2-furanyl + H2
1 record matched 2,5-Dimethyltetrahydrofuran + H· → tetrahydro-2,5-dimethyl-3-furanyl + H2
1 record matched 2,5-Dimethyltetrahydrofuran + H· → tetrahydro-5-methyl-2-furanylmethyl + H2
1 record matched (CH3)3SiH + SiH3 → H· + Disilane, 1,1,1-trimethyl-
1 record matched (CH3)3SiH → H· + (CH3)3Si·
1 record matched CH3SiH3 + SiH3 → H· + CH3SiH2SiH3
1 record matched 2,3,5,6-Tetrachlorophenol + H· → 2,3,5,6-tetrachlorophenoxy radical + H2
1 record matched 2,3,5-Trichlorophenol + H· → 2,3,5-trichlorophenoxy radical + H2
1 record matched 2,3,6-Trichlorophenol + H· → 2,3,6-trichlorophenoxy radical + H2
1 record matched (CH3)4Ge + H· → H2 + (CH3)3GeCH2
1 record matched CH3NO + H· → ·CH3 + HNO
1 record matched 1-Methylphenanthrene → 1-Phenanthrylmethyl + H·
1 record matched Methyl-3-pentenoate + H· → Products
1 record matched Methyl-4-pentenoate + H· → Products
1 record matched Ethylene glycol monovinyl ether + H· → CH3CHO + HOCH2CH2·
1 record matched (CH3O)2P(O)CH3 + O· → CH3-O-P(O)(-O-CH3)-CH2O· + H·
1 record matched (CH3O)2P(O)CH3 + O· → CH3-O-P(O)(CH3)-O-CH2O· + H·
1 record matched Vinylacetylene + CH2=CHCH=CH· → Styrene + H·
1 record matched Vinylacetylene + H· → H2 + CH2C(·)CCCH
1 record matched Vinylacetylene + C → H2CCCCCH + H·
1 record matched Vinylacetylene + C → HCCCHCCH + H·
1 record matched Vinylacetylene + 4-methylphenyl → 2-Methylnaphthalene + H·
1 record matched Vinylacetylene + Phenyl → H· + 3-buten-1-vynylbenzene
1 record matched Vinylacetylene + Phenyl → H· + 1-Buten-3-yn-2-ylbenzene
1 record matched Vinylacetylene + Phenyl → 4-Phenylbut-3-ene-1-yne + H·
1 record matched Vinylacetylene + Phenyl → Naphthalene + H·
1 record matched Vinylacetylene + Phenyl → cis-1-phenyl-vinylacetylene + H·
1 record matched Vinylacetylene + Phenyl → CH2=C=C=CH-C6H5 + H·
1 record matched Vinylacetylene + Phenyl → C6H5CCCHCH2 + H·
1 record matched Vinylacetylene + Phenyl → C6H5CHCCCH2 + H·
1 record matched Vinylacetylene + Phenyl → 4-phenyl-but-1-yn-3-yl + H·
1 record matched Vinylacetylene → H· + CH2C(·)CCCH
1 record matched Vinylacetylene → H· + CH2=C=C=CH·
1 record matched CF3CHCH2 + ·OH → H· + CF3COCH2
1 record matched CHD3 + H· → ·CHD2 + HD
3 records matched CHD3 + H· → H2 + CD3
1 record matched CH3D + CD3 → CH2DCD3 + H·
1 record matched CF3C≡CH + H· → CF3C(·)=CH2
3 records matched 2-(E)-C5H10 + H· → CH3CH2CH2CH(·)CH3
1 record matched 2-(E)-C5H10 + H· → H2 + (E)-CH3CH=CHCH2CH2·
1 record matched 2-(E)-C5H10 + H· → H2 + CH3CH(·)CH=CHCH3
1 record matched 2-(E)-C5H10 + H· → Products
2 records matched 2-(E)-C5H10 + H· → 3-C5H11
1 record matched 2-(E)-C5H10 + H· → (E)-(·)CH2CH=CHCH2CH3 + H2
1 record matched 2-(E)-C5H10 + H· → (E)-CH3C(·)=CHCH2CH3 + H2
1 record matched 2-(E)-C5H10 + H· → (E)-CH3CH=C(·)CH2CH3 + H2
1 record matched CO + H· → HCO
1 record matched CO + ·OH + H2O → CO2 + H2O + H·
26 records matched CO + ·OH → CO2 + H·
1 record matched CO + H2 → CO2 + H·
1 record matched (n-C4H9S)2 + H· → Products
3 records matched 2-(Z)-C5H10 + H· → CH3CH2CH2CH(·)CH3
2 records matched 2-(Z)-C5H10 + H· → 3-C5H11
2 records matched 2,5-Dimethylfuran + H· → 2-Methylfuran + ·CH3
1 record matched 2,5-Dimethylfuran + H· → 1,3-Butadiene + CH3CO
1 record matched 2,5-Dimethylfuran + H· → Products
1 record matched 2,5-Dimethylfuran + H· → CH3C(O)CH=CHCH(·)CH3
2 records matched 2,5-Dimethylfuran + H· → 1,4-epoxy-1,4-dimethyl-1-buten-3-yl radical
2 records matched 2,5-Dimethylfuran + H· → 1,4-epoxy-1,4-dimethyl-1-buten-4-yl radical
3 records matched 2,5-Dimethylfuran + H· → 2-methylfuran-5-yl methyl radical + H2
2 records matched 2,5-Dimethylfuran + H· → 2,5-dimethylfuran-3-yl radical + H2
1 record matched 2,5-Dimethylfuran + H· → 2,3-dihydro-2,5-dimethylfuran-3-yl radical
1 record matched 2,5-Dimethylfuran → 2-methylfuran-5-yl methyl radical + H·
1 record matched 2,4-Dimethylpyrrole → (4-methylpyrrol-2-yl)methyl + H·
1 record matched 2,4-Dimethylpyrrole → (2-methylpyrrol-4-yl)methyl + H·
1 record matched (CH3S)2 + H· → H2 + CH3SSCH2
2 records matched (CH3S)2 + H· → CH3SH + CH3
1 record matched (CH3S)2 → H· + CH3SSCH2
1 record matched CH3ONO + H· → CH3O· + HNO
1 record matched CH3ONO + H· → CH4 + NO2
1 record matched CH3ONO + H· → CH3OH + NO
1 record matched CH3ONO + H· → cis-HONO + ·CH3
1 record matched CH3ONO + H· → trans-HONO + ·CH3
1 record matched CH3ONO + H· → ·CH2ONO· + H2
1 record matched (E)-2-C4H8 + H· → H2 + CH3CH=C(·)CH3
1 record matched (E)-2-C4H8 + H· → H2 + (E)-CH3CH=CHCH2
1 record matched (E)-2-C4H8 + C → H· + CH3C≡CCHCH3
1 record matched (E)-2-C4H8 + C → CH2=CHC(·)=CHCH3 + H·
1 record matched (E)-2-C4H8 + C → CH3-cCHCC-CH3 + H·
1 record matched (E)-2-C4H8 + C → CH3-CH(·)-CH=C=CH2 + H·
1 record matched Methyl pentanoate + H· → CH3CH2CH2CH2C(O)OCH2· + H2
2 records matched Methyl butanoate + H· → ·CH2OC(O)CH2CH2CH3 + H2
1 record matched Methyl butanoate + H· → CH3OC(O)CH·CH2CH3 + H2
1 record matched Methyl butanoate + H· → CH3OC(O)CH2CH·CH3 + H2
1 record matched Methyl butanoate + H· → CH3OC(O)CH2CH2CH2· + H2
1 record matched CH3OCOOCH3 + H· → H2 + CH3OC(O)OCH2·
1 record matched CH3OCOOCH3 + H· → Adduct
1 record matched CH3OCOOCH3 → ·CH2O(O)COCH3 + H·
1 record matched 1,4-Dihydronaphthalene + H· → 1,4,4a,8a-Tetrahydronaphthalen-4a-yl
1 record matched 3,4,5-Trichlorophenol + H· → 3,4,5-trichlorophenoxy radical + H2
1 record matched (CH3)4Sn + H· → H2 + (CH3)3SnCH2·
1 record matched (CH3)2Hg + H· → CH4 + ·CH3 + Hg
1 record matched CH3F + H· → ·CH3 + HF
3 records matched CH3F + H· → H2 + ·CH2F
1 record matched CH3F + H· → CH4 + ·F
2 records matched CH3F → ·CH2F + H·
1 record matched 1,3-Cyclohexadiene + H· → H2 + 2,5-Cyclohexadien-1-yl
1 record matched 1,3-Cyclohexadiene + H· → H2 + Cyclohexadienyl
1 record matched 3-Hexene + H· → 3-hexyl radical
1 record matched 3-Hexene + H· → CH3CH2CH=CHCH2CH2· + H2
1 record matched 3-Hexene + H· → CH3CH2CH=CHCH(·)CH3 + H2
1 record matched 3-Hexene + H· → CH3CH2CH=C(·)CH2CH3 + H2
1 record matched 1-C6H12 + H· → H2 + ·CH2(CH2)3CH=CH2
1 record matched 1-C6H12 + H· → CH2=CHCH(·)CH2CH2CH3 + H2
1 record matched 1-C6H12 + H· → CH2=C(·)CH2CH2CH2CH3 + H2
1 record matched 1-C6H12 + H· → CH2=CHCH2C(·)HCH2CH3 + H2
1 record matched 1-C6H12 + H· → ·CH=CHCH2CH2CH2CH3 + H2
1 record matched 1-C6H12 + H· → CH2=CHCH2CH2CH(·)CH3 + H2
1 record matched CH2=CHCH2CH=CH2 + H· → H2 + CH2=CHCH2CH=CH·
1 record matched CH2=CHCH2CH=CH2 + H· → H2 + CH2=CHCH=CHCH2·
1 record matched CH2=CHCH2CH=CH2 + H· → CH2=CHCH2C(·)=CH2 + H2
1 record matched 3,5-Dichlorophenol + H· → 3,5-dichlorophenoxy radical + H2
1 record matched 1,2-butadiene + H· → 1,3-Butadiene + H·
2 records matched 1,2-butadiene + Phenyl → H· + 2-Butynylbenzene
2 records matched 1,2-butadiene + Phenyl → Benzene,1,2-butadienyl- + H·
2 records matched 1,2-butadiene + Phenyl → 2-Phenyl-1,3-butadiene + H·
2 records matched 1,2-butadiene + Phenyl → 3-Methylindene + H·
3 records matched 1,2-butadiene + Phenyl → 1-Methylindene + H·
1 record matched 1,2-butadiene → H· + CH2CHC·CH2
1 record matched 1,2-butadiene → H· + CH3CCCH2·
1 record matched (Z)-2-C4H8 → H· + (Z)-CH3CH=CHCH2·
1 record matched (Z)-2-C4H8 → H· + ·CH2CH=CHCH3
1 record matched Nitrosobenzene + H· → Phenyl + HNO
1 record matched 2,5-Dichlorophenol + H· → 2,5-dichlorophenoxy radical + H2
1 record matched 2,3-Dichlorophenol + H· → 2,3-dichlorophenoxy radical + H2
1 record matched C2H5C(CH3)=CH2 + H· → CH2=C(CH3)CH2CH2· + H2
1 record matched C2H5C(CH3)=CH2 + H· → CH2=C(CH3)CH(·)CH3 + H2
1 record matched C2H5C(CH3)=CH2 + H· → CH2=C(CH2·)CH2CH3 + H2
1 record matched C2H5C(CH3)=CH2 + H· → (C2H5)(CH3)C=CH· + H2
1 record matched (CH3)2CHCH=CH2 + H· → H2 + CH2=CHCH(CH3)CH2·
1 record matched (CH3)2CHCH=CH2 + H· → H2 + (CH3)2C(·)CH=CH2
1 record matched (CH3)2CHCH=CH2 + H· → H2 + (CH3)2CHCH=CH·
1 record matched (CH3)2CHCH=CH2 + H· → (CH3)2CHC·=CH2 + H2
1 record matched CBr4 + H· → CBr3 + HBr
2 records matched CH2=CHOH + H· → HOCH2CH2·
2 records matched CH2=CHOH + H· → CH3CH(·)OH
1 record matched CH2=CHOH + H· → H2 + CH2=CHO·
1 record matched CH2=CHOH + H· → CH2C(·)OH + H2
1 record matched CH2=CHOH + H· → (Z)-CH=CHOH + H2
1 record matched CH2=CHOH + H· → (E)-CH=CHOH + H2
1 record matched CH2=CHOH → CH2=CHO· + H·
1 record matched CH2=CHOH → CH2C(·)OH + H·
1 record matched C2H5C(O)OCH3 + H· → CH3CH(·)C(O)OCH3 + H2
2 records matched C2H5C(O)OCH3 + H· → CH3CH2C(O)OCH2· + H2
1 record matched C2H5C(O)OCH3 + H· → CH3OC(O)CH2CH2· + H2
1 record matched 2(1H)-Pyrimidinone, 4-amino-5-methyl- + H· → Products
1 record matched 1,3,5-Cycloheptatriene → Cycloheptatrienyl + H·
1 record matched Cyclopentadiene + H· → H2 + Cyclopentadienyl
4 records matched Cyclopentadiene → Cyclopentadienyl + H·
1 record matched (C2H5)2SiH2 + H· → H2 + (C2H5)2SiH(·)
1 record matched (C2H5)2SiH2 + H· → SiH2(CH2CH3)CH2CH2(·) + H2
1 record matched (C2H5)2SiH2 + H· → SiH2(CH2CH3)CH(·)CH3 + H2
1 record matched Phenylacetylene + H· → 2-ethynylphenyl + H2
1 record matched 2-Methylfuran + H· → furan-2-yl methyl radical + H2
1 record matched 2-Methylfuran + H· → 2,3-dihydro-2-methylfuran-3-yl radical
1 record matched 2-Methylfuran + H· → 2-methylfuran-3-yl + H2
1 record matched 2-Methylfuran + H· → 2-methylfuran-4-yl + H2
1 record matched 2-Methylfuran + H· → 2-methylfuran-5-yl + H2
1 record matched 2-Methylfuran → Vinylacetylene + HCO + H·
1 record matched 2-Methylfuran → furan-2-yl methyl radical + H·
1 record matched (CH3)2C=CHCH3 + H· → H2 + ·CH2C(CH3)=CHCH3
1 record matched (CH3)2C=CHCH3 + H· → (CH3)2C=C(·)CH3 + H2
1 record matched (CH3)2C=CHCH3 + H· → (CH3)2C=CHCH2· + H2
1 record matched ClCN + H· → HCN + ·Cl
1 record matched ClCN + H· → CN + HCl
1 record matched Oxetane → H· + Oxacyclobutan-3-yl
1 record matched Oxetane → H· + Oxacyclobutan-2-yl
1 record matched 2-butyne + B → BC4H5 + H·
1 record matched 2-butyne + Phenyl → H· + Benzene,1-methyl-1,2-propadienyl-
1 record matched 2-butyne → H· + CH2CHC·CH2
1 record matched 2-butyne → H· + CH3CCCH2·
1 record matched 2-butyne → CH2=C=C=CH2 + H· + H·
1 record matched 2,2,3-Trimethylbutane + H· → Products
1 record matched neo-C5H12 + H· → H2 + Neopentyl
1 record matched COS + H· → HCO + S
1 record matched COS + H· → CO + SH
1 record matched H2C=C=O + ·Cl → H· + CHCl=C=O
1 record matched H2C=C=O + ·F → CHFCO + H·
1 record matched H2C=C=O + H· → CH3CO
1 record matched H2C=C=O + H· → *CH2C(O)H
1 record matched H2C=C=O + H· → CH3CO
1 record matched H2C=C=O + H· → H2 + HCCO
4 records matched H2C=C=O + H· → CO + ·CH3
1 record matched H2C=C=O + H· → Products
1 record matched CH2=C=CH2 + O· → CH2C(·)CHO + H·
1 record matched CH2=C=CH2 + BO → CH2=C=CHB=O + H·
1 record matched CH2=C=CH2 + BO → O=BCH2C≡CH + H·
1 record matched CH2=C=CH2 + BO → CH3C≡CB=O + H·
1 record matched CH2=C=CH2 + H· → ·CH2CH=CH2
2 records matched CH2=C=CH2 + CH2=C=CH → Benzene + H·
1 record matched CH2=C=CH2 + ·CH → CH2=C=C=CH2 + H·
1 record matched CH2=C=CH2 + ·CH → Vinylacetylene + H·
1 record matched CH2=C=CH2 + ·CH3 → 1,2-butadiene + H·
1 record matched CH2=C=CH2 + ·CH3 → 1-butyne + H·
1 record matched CH2=C=CH2 + ·CH3 → 1,3-Butadiene + H·
1 record matched CH2=C=CH2 + ·C2H → H· + CH≡CCH2C≡CH
1 record matched CH2=C=CH2 + ·C2H → H· + CH2=C=C=C=CH2
1 record matched CH2=C=CH2 + ·C2H → CH3C≡CC≡CH + H·
1 record matched CH2=C=CH2 + ·C2H → CH2CCHCCH + H·
1 record matched CH2=C=CH2 + ·CH2CH=CH2 → 1,3,5-Hexatriene + H·
1 record matched CH2=C=CH2 + ·CH2CH=CH2 → CH3CCCH2CHCH2 + H·
1 record matched CH2=C=CH2 → CH2=C=CH + H·
1 record matched Fluorobenzene → 2-fluorophenyl + H·
1 record matched Fluorobenzene → 3-fluorophenyl + H·
1 record matched Fluorobenzene → 4-fluorophenyl + H·
1 record matched NCCN + H· + H· + H· + H· → NH2-CH2-CN
1 record matched NCCN + H· → CN + HCN
1 record matched 1,3-Butadiyne + CH2=CHCH=CH· → Phenylacetylene + H·
1 record matched 1,3-Butadiyne + CH≡CC≡C → CH≡CC≡CC≡CC≡CH + H·
1 record matched 1,3-Butadiyne + H· → CH2=C=C=CH·
2 records matched 1,3-Butadiyne + H· → HCCCHCH·
1 record matched 1,3-Butadiyne + H· → Products
2 records matched 1,3-Butadiyne + ·C2H → HC≡CC≡CC≡CH + H·
2 records matched 1,3-Butadiyne → H· + CH≡CC≡C
3 records matched CF3CHFCF3 + H· → H2 + (CF3)2CF
1 record matched CH3CF3 + ·OH → CF3CH2OH + H·
1 record matched HO-C≡N + H· → H2 + NCO
1 record matched HO-C≡N + H· → CN + H2O
1 record matched C2HF3 + H· → CHF2C(·)HF
1 record matched C2HF3 + H· → C2F5
1 record matched C2HF3 + H· → H2 + CF2=CF
1 record matched C2HF3 + H· → Products
1 record matched C2F5H + H· → H2 + C2F5
1 record matched COF2 + H· → CHF2O(·)
2 records matched COF2 + H· → FCO + HF
1 record matched COF2 + H· → (.)CF2OH
1 record matched 3-Phenylpropene + H· → Other Products + H2
1 record matched 2-Pyrrole → H· + 1H-Pyrrol-1-yl
1 record matched 3,4-Epoxytetrahydrofuran + H· → 3,4-Epoxytetrahydrofuran-2-yl + H2
1 record matched 3,4-Epoxytetrahydrofuran + H· → 3,4-Epoxytetrahydrofuran-3-yl + H2
1 record matched Azulene + H· → 9H-azulenyl
1 record matched Azulene + H· → 4H-azulenyl
1 record matched Azulene + H· → 1H-azulenyl
1 record matched 7H-benzo[7]annulene → C11H9· + H·
1 record matched Acenaphthylene + H· → [1,1'-Biphenyl]-2-yl
1 record matched Acenaphthylene + H· → Other Products + H2
1 record matched Acenaphthylene + H· → C12H7 + H2
1 record matched Fluoranthene + NO2 → H· + Fluoranthene, 2-nitro-
1 record matched 1-C7H16 + H· → H2 + 3-C7H15
1 record matched 1-C7H16 + H· → H2 + 2-C7H15
1 record matched 1-C7H16 + H· → H2 + 1-C7H15
1 record matched 1-C7H16 → H· + 4-C7H15
1 record matched 1-C7H16 → H· + 3-C7H15
1 record matched 1-C7H16 → 2-C7H15 + H·
1 record matched 1-C7H16 → 1-C7H15 + H·
1 record matched Cyclopentene + H· → Products
1 record matched Pentacene + H· → Other Products + H2
1 record matched Dibenzofuran + H· → 1H-dibenzofuran-5-ium
1 record matched Dibenzofuran + H· → 3H-dibenzofuran
1 record matched Pyrene + H· → Other Products + H2
1 record matched Pyrene + NO2 → Pyrene, 2-nitro- + H·
2 records matched CO2 + CO + ·OH → CO2 + CO2 + H·
1 record matched 1,4-Dioxane + H· → H2 + 1,4-Dioxan-2-yl
1 record matched CH3CH2CH2CHO + H· → CH3CH2CH2C(·)HOH
1 record matched CH3CH2CH2CHO + H· → CH3CH2CH2CH2
2 records matched 3-methyl-1-butanol + H· → (CH3)2CHCH2CH(OH)· + H2
2 records matched 3-methyl-1-butanol + H· → (CH3)2CHCH(·)CH2OH + H2
1 record matched 3-methyl-1-butanol + H· → (CH3)2C(·)CH2CH2OH + H2
3 records matched 3-methyl-1-butanol + H· → ·CH2CH(CH3)CH2CH2OH + H2
1 record matched 3-methyl-1-butanol + H· → CH3CH(CH3)CH2CH2O(·) + H2O
2 records matched C2H5CHO + H· → n-C3H7O
1 record matched C2H5CHO + H· → C2H5CH(·)OH
1 record matched Cyclopentanone + H· → Other Products + H2
1 record matched 2,4-Dichlorophenol + H· → 2,4-diclhorophenoxy radical + H2
2 records matched 1,2-Dihydroxybenzene → 2-Hydroxyphenoxy radical + H·
1 record matched Anthracene + H· → Other Products + H2
1 record matched iso-C4H8 + H· → iso-C4H9
3 records matched iso-C4H8 + H· → tert-C4H9
2 records matched iso-C4H8 + H· → H2 + ·CH2C(CH3)=CH2
1 record matched iso-C4H8 + H· → Products
1 record matched iso-C4H8 + H· → (CH3)2C=CH· + H2
1 record matched iso-C4H8 + C2H3 → (CH3)2C=CHCH=CH2 + H·
1 record matched (CH3)2O + H· → H2 + CH3OCH2·
1 record matched CH3CH=CH2 + O· → H· + CH3C(·)HCHO
2 records matched CH3CH=CH2 + O· → CH3C(O)CH2(·) + H·
1 record matched CH3CH=CH2 + O· → H2C=C=O + ·CH3 + H·
1 record matched CH3CH=CH2 + BO → CH2=CHCH2B=O + H·
1 record matched CH3CH=CH2 + BO → CH3CH=CHB=O + H·
3 records matched CH3CH=CH2 + H· → 1-C3H7
1 record matched CH3CH=CH2 + H· → iso-C3H7
1 record matched CH3CH=CH2 + H· → H2 + CH2=C(·)CH3
1 record matched CH3CH=CH2 + H· → H2 + CH3CH=C(·)H
1 record matched CH3CH=CH2 + H· → H2 + ·CH2CH=CH2
1 record matched CH3CH=CH2 + H· → C2H4 + ·CH3
1 record matched CH3CH=CH2 + H· → Products
1 record matched CH3CH=CH2 + C → H· + CH3C=C=CH2
1 record matched CH3CH=CH2 + C → CHCCH(·)CH3 + H·
1 record matched CH3CH=CH2 + C → CH3-cCHCCH + H·
1 record matched CH3CH=CH2 + C → CH3-cCCCH2 + H·
1 record matched CH3CH=CH2 + ·OH → H· + CH2=C(OH)CH3
1 record matched CH3CH=CH2 + ·OH → CH2=CHCH2OH + H·
1 record matched CH3CH=CH2 + ·OH → CH3CH=CHOH (unspecified isomer) + H·
1 record matched CH3CH=CH2 + Phenyl → (E)-1-Phenylpropene + H·
1 record matched CH3CH=CH2 + Phenyl → (Z)-1-Phenylpropene + H·
1 record matched CH3CH=CH2 + Phenyl → 2,3-Dihydroindene + H·
1 record matched CH3CH=CH2 + Phenyl → 3-Phenylpropene + H·
1 record matched CH3CH=CH2 + Phenyl → 2-Phenylpropene + H·
1 record matched CH3CH=CH2 → H· + CH2=C(·)CH3
5 records matched CH3CH=CH2 → ·CH2CH=CH2 + H·
1 record matched 1-C7H15C(O)OCH3 + H· → CH3CH2CH2CH2CH2CH2CH2C(O)OCH2· + H2
1 record matched Pyridine → H· + 2-pyridinyl
1 record matched Pyridine → Other Products + H·
2 records matched Cyclohexene + H· → H2 + 3-Cyclohexenyl
1 record matched Cyclohexene + H· → H2 + 2-Cyclohexenyl
1 record matched Cyclohexene + H· → Products
1 record matched Cyclohexane → Cyclohexyl + H·
1 record matched 1-C9H19C(O)OCH3 + H· → CH3CH2CH2CH2CH2CH2CH2CH2CH2C(O)OCH2· + H2
1 record matched Tetrahydrothiophene + H· → Products
2 records matched Pyrrole → H· + 1H-Pyrrol-1-yl
1 record matched Pyrrole → cyc-CH2-CH=CH-C(·)=N + H·
1 record matched Pyrrole → cyc-CH2-CH=CH-N=C(·) + H·
1 record matched HC(O)OC2H5 + H· → H2 + CH3CH2OC(O)·
1 record matched HC(O)OC2H5 + H· → CH3CH(·)OC(O)H + H2
1 record matched HC(O)OC2H5 + H· → ·CH2CH2OC(O)H + H2
1 record matched CH3OCH2OCH3 + H· → CH3OCH(·)OCH3 + H2
1 record matched CH3OCH2OCH3 + H· → ·CH2OCH2OCH3 + H2
2 records matched 1-C5H10 + H· → 1-C5H11
2 records matched 1-C5H10 + H· → CH3CH2CH2CH(·)CH3
1 record matched 1-C5H10 + H· → H2 + CH2=CHCH2CH(·)CH3
1 record matched 1-C5H10 + H· → H2 + CH2=CHCH(·)CH2CH3
1 record matched 1-C5H10 + H· → CH3CH2CH2C·=CH2 + H2
1 record matched 1-C5H10 + H· → CH3CH2CH2CHCH· + H2
1 record matched 1-C5H10 + H· → CH2=CHCH2CH2CH2· + H2
1 record matched Benzenethiol → C6H5S + H·
1 record matched Phenol + H· → H2 + C6H5O
1 record matched Phenol + H· → C6H6-OH
6 records matched Phenol → C6H5O + H·
1 record matched Cyclohexanone + H· → cyc-[C(O)CH2CH2CH2CH2C(·)H] + H2
1 record matched Cyclohexanone + H· → 3-cyclohexanone-yl radical + H2
1 record matched Cyclohexanone + H· → 4-cyclohexanone-yl radical + H2
1 record matched Chlorobenzene + H· → Phenyl + HCl
2 records matched Chlorobenzene + H· → Benzene + ·Cl
1 record matched Chlorobenzene + H· → Other Products + H2
1 record matched Chlorobenzene + Phenyl → H· + 1,1'-Biphenyl, chloro-
1 record matched Toluene + H· → Cyclohexadienyl, 6-methyl-
1 record matched Toluene + H· → H2 + 2-methylphenyl
1 record matched Toluene + H· → H2 + 3-methylphenyl
1 record matched Toluene + H· → H2 + 4-methylphenyl
3 records matched Toluene + H· → H2 + Benzyl
3 records matched Toluene + H· → Products
3 records matched Toluene + H· → C6H4CH3 + H2
1 record matched Toluene + H· → ipso-C7H9
1 record matched Toluene + ·OH → 3-Methylphenol + H·
1 record matched Toluene + ·OH → 4-Methylphenol + H·
1 record matched Toluene + ·OH → 2-Methylphenol + H·
1 record matched Toluene + ·OH → methylphenol (unspecified isomer) + H·
4 records matched Toluene → Benzyl + H·
1 record matched 1,3,5-Trimethylbenzene + H· → H2 + 3,5-dimethylbenzyl radical
1 record matched 1,3,5-Trimethylbenzene → H· + 3,5-dimethylbenzyl radical
1 record matched 3-Chlorophenol + H· → 3-chlorophenoxy + H2
1 record matched Sarin + O· → (CH3)2CH-O-PF(O)CH2O· + H·
1 record matched Sarin + O· → (CH3)2C(O·)-O-PF(O)CH3 + H·
1 record matched Sarin + O· → ·OCH2CH(CH3)-O-PF(O)CH3 + H·
1 record matched HC(O)OCH3 + H· → CH3OCH2
4 records matched HC(O)OCH3 + H· → H2 + CH3OC(·)(O)
4 records matched HC(O)OCH3 + H· → H2 + HC(O)OCH2(·)
1 record matched HC(O)OCH3 + H· → Other Products + H2
1 record matched HC(O)OCH3 + H· → Adduct
1 record matched HC≡CCH2OH + H· → HCCCH2O· + ·OH
1 record matched HC≡CCH2OH + H· → HCCCH2O· + H2
1 record matched CH2CHCN + H· → CH2CHCNH
1 record matched CH2CHCN + H· → N=C-CH2CH2
1 record matched CH2CHCN + H· → H2O + CH2=C(CN)
1 record matched CH2CHCN + H· → CH3CHCN
1 record matched CH2CHCN + H· → HCN + C2H3
1 record matched CH2CHCN + H· → Products
2 records matched CH2CHCN + H· → CH2=CHCH=N·
1 record matched CH2CHCN + H· → trans-(·)CH=CHC≡N + H2O
1 record matched CH2CHCN + H· → cis-(·)CH=CHC≡N + H2O
1 record matched CH2=CHCHO + H· → CH2=CHCH2O
2 records matched CH2=CHCHO + H· → ·CH2CH=CO + H2
1 record matched CH2=CHCHO + ·CH → H· + CH2=C=CHCHO
1 record matched CH2=CHCHO + ·CH → H· + CH2=CHCH=C=O
1 record matched CH2=CHCHO + ·CH → Furan + H·
1 record matched CH3CH=CHCH3 + C2H3 → CH2=CHC(CH3)=CHCH3 + H·
1 record matched 1-butyne + Phenyl → Benzene,1,2-butadienyl- + H·
1 record matched 1-butyne + Phenyl → 1-Butynylbenzene + H·
2 records matched 1-butyne → CHCCH(·)CH3 + H·
1 record matched 1-butyne → CHCCH2CH2· + H·
1 record matched 1,3-Butadiene + H· → CH2=CHCH(·)CH3
1 record matched 1,3-Butadiene + H· → CH2=CHCH(·)CH3
1 record matched 1,3-Butadiene + H· → ·CH2CH=CHCH3
2 records matched 1,3-Butadiene + H· → CH2=CHCH2CH2·
1 record matched 1,3-Butadiene + H· → H2 + CH2CHC·CH2
3 records matched 1,3-Butadiene + H· → H2 + CH2=CHCH=CH·
1 record matched 1,3-Butadiene + H· → C2H4 + C2H3
6 records matched 1,3-Butadiene + Phenyl → H· + 1-Phenyl-1,3-butadiene(E)
1 record matched 1,3-Butadiene + Phenyl → 1,3-Butadienylbenzene + H·
7 records matched 1,3-Butadiene + Phenyl → 1,4-Dihydronaphthalene + H·
1 record matched 1,3-Butadiene → H· + CH2CHC·CH2
1 record matched 1,3-Butadiene → H· + CH2=CHCH=CH·
1 record matched 1,3-Butadiene → H· + CH3CCCH2·
1 record matched 1-C4H8 + H· → H2 + CH2=CHCH(·)CH3
1 record matched 1-C4H8 + H· → H2 + CH3CH2C(·)=CH2
1 record matched 1-C4H8 + H· → H2 + CH3CH2CH=CH·
1 record matched 1-C4H8 + H· → H2 + CH2=CHCH2CH2·
1 record matched 1-C4H8 + C2H3 → H· + (E)-CH2=CHCH=CHC2H5
2 records matched 1-C4H10 + H· → H2 + 1-C4H9
2 records matched 1-C4H10 + H· → H2 + sec-C4H9
2 records matched 1-C4H10 + H· → Other Products + H2
1 record matched n-C3H7Br → H· + CH3CH2CHBr(·)
1 record matched n-C3H7Br → H· + BrCH2CHCH3
1 record matched n-C3H7Br → H· + CH2BrCH2CH2(·)
1 record matched Heptanoic acid, methyl ester + H· → CH3CH2CH2CH2CH2CH2C(O)OCH2· + H2
1 record matched CH3CH2CH2CH2CH2C(O)OCH3 + H· → CH3CH2CH2CH2CH2C(O)OCH2· + H2
1 record matched 4-Chlorophenol + H· → 4-chlorophenoxy + H2
1 record matched 1-Phenylpropane + H· → Products
1 record matched Methoxybenzene + H· → Phenol + ·CH3
1 record matched Benzaldehyde + H· → C6H5CH2O
1 record matched Benzaldehyde + H· → C6H5CHOH
1 record matched Benzaldehyde + H· → 2,5-cyclohexadien-4-formyl-1-yl
1 record matched Styrene + H· → 2-phenylethyl
1 record matched Styrene + H· → 1-phenylethyl
2 records matched Styrene + H· → H2 + 2-(·)C6H4C2H3
1 record matched Styrene + H· → H2 + Ethenyl,2-phenyl-
1 record matched Styrene + H· → Products
1 record matched Styrene + H· → phenylethen-2-yl + H2
2 records matched Ethylbenzene + H· → H2 + 2-phenylethyl
2 records matched Ethylbenzene + H· → H2 + 1-phenylethyl
1 record matched Ethylbenzene + H· → Adduct
2 records matched Ethylbenzene + H· → Products
3 records matched Ethylbenzene + H· → C6H4CH2CH3 + H2
2 records matched Ethylbenzene → 1-phenylethyl + H·
1 record matched Ethylbenzene → C6H5CH2CH2· + H·
1 record matched 2-Phenylpropane + H· → Products
1 record matched 2-methyltetrahydrofuran + H· → (2-tetrahydrofuran)-methyl + H2
1 record matched 2-methyltetrahydrofuran + H· → 2-methyl-tetrahydrofuran-2-yl + H2
1 record matched 2-methyltetrahydrofuran + H· → 2-methyl-tetrahydrofuran-3-yl + H2
1 record matched 2-methyltetrahydrofuran + H· → 2-methyl-tetrahydrofuran-4-yl + H2
1 record matched 2-methyltetrahydrofuran + H· → 2-methyl-tetrahydrofuran-5-yl + H2
1 record matched 2-methyltetrahydrofuran + H· → CH3CH(·)CH2CH2CH2OH
1 record matched CH2=CHC(O)OCH3 + H· → Products
1 record matched CH2=CHC(O)OCH3 + H· → CH3OC(O)CH2CH2·
1 record matched CH2=CHC(O)OCH3 + H· → ·CH2OC(O)CH=CH2 + H2
1 record matched CH2=CHC(O)OCH3 + H· → CH3OC(O)C(·)=CH2 + H2
1 record matched CH2=CHC(O)OCH3 + H· → CH3OC(O)CH=CH· + H2
1 record matched 2,4,5-Trichlorophenol + H· → 2,4,5-trichlorophenoxy radical + H2
1 record matched 3,4-Dichlorophenol + H· → 3,4-dichlorophenoxy radical + H2
1 record matched 1,2,4-Trimethylbenzene + H· → H2 + 3,4-dimethylphenyl-methyl
2 records matched 2-Chlorophenol + H· → 2-chlorophenoxy + H2
1 record matched 2-Chlorophenol → 2-chlorophenoxy + H·
2 records matched Indene + H· → H2 + 1H-inden-1-yl
1 record matched Indene + H· → C2H2 + Benzyl
1 record matched Indene + H· → Benzene + CH2C≡CH
1 record matched Biphenyl + H· → Benzene + Phenyl
2 records matched Biphenyl + Phenyl → 1,1':2',1"-Terphenyl + H·
1 record matched Naphthacene + H· → Other Products + H2
1 record matched 2-Methylnaphthalene → C10H7CH2 + H·
1 record matched Naphthalene + H· → H2 + 2-Naphthalenyl
2 records matched Naphthalene + H· → H2 + 1-Naphthalenyl
1 record matched Naphthalene + H· → Other Products + H2
1 record matched Decalin → 1-decalinyl + H·
1 record matched Decalin → 2-decalinyl + H·
1 record matched 1,2-divinylbenzene + H· → C6H4-(1-C2H3)-2-CH=CH· + H2
1 record matched 1-Methylnaphthalene + H· → Naphthalene + ·CH3
1 record matched 1-Methylnaphthalene → 1-Naphthylmethyl + H·
1 record matched 2,4,6-trichlorophenol + H· → 2,4,6-trichlorophenoxy radical + H2
1 record matched pentachlorophenol + H· → pentachlorophenoxy radical + H2
1 record matched 2,6-Dichlorophenol + H· → 2,6-dichlorophenoxy radical + H2
1 record matched Phenanthrene + H· → Other Products + H2
1 record matched 3,3',5,5'-Tetrabromobisphenol A + H· → 2,6-Dibromo-4-[2-(3-bromo-4-hydroxyphenyl)-2-propanyl]phenol + HBr
1 record matched 3,3',5,5'-Tetrabromobisphenol A + H· → 3,3',5,5'-Tetrabromo-4,4-dihydroxy-1,1-diphenylethyl radical + CH4
1 record matched 3,3',5,5'-Tetrabromobisphenol A + H· → 3,3',5,5'-Tetrabromo-4,4-dihydroxy-2,2-diphenyl-1-propyl radical + H2
1 record matched 3,3',5,5'-Tetrabromobisphenol A + H· → 1,6-dibromo-4-(3,5-dibromo-4-hydroxyphenyl,dimethyl)methylphenoxy radical + H2
1 record matched 3,3',5,5'-Tetrabromobisphenol A + H· → 2-hydroxy-3-bromo-3-(3,5-dibromo-4-hydroxyphenyl,dimethyl)methylphenyl radical + HBr
1 record matched 3,3',5,5'-Tetrabromobisphenol A + H· → 4,6-dibromo-5-hydroxy-2-(3,5-dibromo-4-hydroxyphenyl,dimethyl)-1,3-cyclohexadien-6-yl radical
1 record matched 3,3',5,5'-Tetrabromobisphenol A + H· → 2,4-dibromo-3-hydroxy-6-(3,5-dibromo-4-hydroxyphenyl,dimethyl)-1,3-cyclohexadien-6-yl radical
1 record matched 3,3',5,5'-Tetrabromobisphenol A + H· → 2,4-dibromo-3-hydroxy-6-(3,5-dibromo-4-hydroxyphenyl,dimethyl)-1,3-cyclohexadien-5-yl radical
3 records matched CH3C(O)OCH3 + H· → H2 + ·CH2C(O)OCH3
5 records matched CH3C(O)OCH3 + H· → H2 + CH3C(O)OCH2·
1 record matched CH3C(O)OCH3 + H· → Other Products + H2
1 record matched CH3C(O)OCH3 + H· → Adduct
1 record matched CH2=CHCOCH3 + H· → CH2=CHCH(CH3)O
1 record matched C2H5COCH3 + H· → CH3CH2CH(CH3)O·
1 record matched C2H5COCH3 + H· → H2 + ·CH2CH2C(O)CH3
1 record matched C2H5COCH3 + H· → H2 + CH3C(O)CH(·)CH3
1 record matched C2H5COCH3 + H· → ·CH2C(O)C2H5 + H2
1 record matched iso-C5H12 + H· → H2 + ·CH2CH(CH3)CH2CH3
1 record matched iso-C5H12 + H· → H2 + (CH3)2C(·)CH2CH3
1 record matched iso-C5H12 + H· → H2 + (CH3)2CHCH(·)CH3
1 record matched iso-C5H12 + H· → H2 + (CH3)2CHCH2CH2·
1 record matched CH3SiCl3 + H· → HCl + Silyl, dichloromethyl-
1 record matched CH3SiCl3 + H· → H2 + Cl3SiCH2·
1 record matched CH3SiCl3 + H· → CH4 + SiCl3
1 record matched CH3SiCl3 → H· + Cl3SiCH2·
1 record matched (CH3)4Si + H· → H2 + (CH3)3SiCH2
1 record matched CF4 + H· → ·CF3 + HF
1 record matched CF4 + H· → CHF3 + ·F
1 record matched CF3Br + H· → ·CF3 + HBr
1 record matched Methyloxirane → H· + Methyl, oxyranyl-
1 record matched Silane, dichloromethyl- + H· → H2 + Silyl, dichloromethyl-
1 record matched CH3NO2 → H· + CH2NO2
3 records matched CHF3 + H· → ·CHF2 + HF
6 records matched CHF3 + H· → H2 + ·CF3
1 record matched CHF3 + H· → CH2F2 + ·F
1 record matched CHF3 + H· → Products
1 record matched CHF2Cl + H· → HF + ·CClFH
1 record matched CHF2Cl + H· → ·CHF2 + HCl
1 record matched CHF2Cl + H· → H2 + ·CClF2
1 record matched CHF2Cl + H· → Products
1 record matched CHFCl2 + H· → HCl + ·CClFH
1 record matched CHFCl2 + H· → CHCl2 + HF
1 record matched CHFCl2 + H· → H2 + ·CCl2F
1 record matched CHFCl2 + H· → Products
1 record matched iso-C3H7SH + H· → H2 + (CH3)2CHS
1 record matched iso-C4H10 + H· → H2 + iso-C4H9
1 record matched iso-C4H10 + H· → H2 + tert-C4H9
3 records matched iso-C4H10 + H· → Other Products + H2
1 record matched Oxirane + H· → H2 + Oxiranyl
1 record matched Oxirane + H· → CH3CHO + H·
1 record matched Oxirane → CH2=CHO· + H·
1 record matched Oxirane → CH3CO + H·
1 record matched Cyclopropane + H· → H2 + Cyclopropyl
1 record matched (CH3)2S + H· → H2 + CH3SCH2
2 records matched (CH3)2S + H· → CH3SH + ·CH3
1 record matched (CH3)2S + H· → Products
1 record matched CS2 + H· → S=CH-S·
1 record matched HN=C=O + H· → H2 + NCO
2 records matched HN=C=O + H· → CO + NH2
1 record matched HCONH2 + H· → HCO + NH3
1 record matched HCONH2 + H· → H2 + C(O)NH2
1 record matched HCONH2 + H· → CH(OH)NH2
1 record matched HCONH2 + H· → OCH2NH2
1 record matched CH2I2 + H· → HI + ·CH2I
1 record matched CH2I2 + H· → H2 + ·CHI2
1 record matched CH2I2 + H· → CH3I + I
1 record matched CH2I2 + H· → Products
1 record matched CH2F2 + H· → ·CH2F + HF
4 records matched CH2F2 + H· → H2 + ·CHF2
1 record matched CH2F2 + H· → CH3F + ·F
2 records matched CH2F2 → ·CHF2 + H·
3 records matched CH2Cl2 + H· → ·CH2Cl + HCl
2 records matched CH2Cl2 + H· → H2 + CHCl2
1 record matched CH2Cl2 + H· → Products
1 record matched C2H5SH + H· → H2 + CH3CH2S
1 record matched C2H5SH + H· → Products
2 records matched CH3CHO + H· → CH3CH(·)OH
5 records matched CH3CHO + H· → CH3CH2
1 record matched CH3CHO + H· → H2 + CH3CO
1 record matched CH3CHO + H· → H2 + CH2=CHO·
1 record matched CH3CHO + H· → H2 + CH3CO
1 record matched CH3CHO + ·OH → CH3C(O)OH + H·
1 record matched CH3CHO + Phenyl → 1-Phenylethanone + H·
1 record matched CH3CHO → CO + ·CH3 + H·
1 record matched CH3CN + H· → CH3CH=N(·)
1 record matched CH3CN + H· → CH3C(·)=NH
1 record matched C2H5I + H· → ·C2H5 + HI
1 record matched CH2=CHCl + H· → CH3CHCl
1 record matched CH2=CHCl + H· → CH2CH2Cl
2 records matched CH2=CHCl + H· → C2H3 + HCl
1 record matched CH2=CHCl + H· → H2 + CHCl=CH
3 records matched C2H5Cl + H· → ·C2H5 + HCl
3 records matched C2H5Cl + H· → H2 + CH3CHCl
2 records matched C2H5Cl + H· → H2 + CH2CH2Cl
1 record matched C2H5Cl + H· → Other Products + H2
2 records matched C2H5Cl + H· → Products
1 record matched CH3CCH + CH2=CHCH=CH· → Toluene + H·
1 record matched CH3CCH + O· → H· + CH2=CHC(·)O
1 record matched CH3CCH + O· → CH2C(·)CHO + H·
1 record matched CH3CCH + O· → CH3C(·)=C=O + H·
1 record matched CH3CCH + ·F → CH2CCHF + H·
1 record matched CH3CCH + ·F → H3CCCF + H·
1 record matched CH3CCH + SiH → H3C(cyc-CSiCH) + H·
1 record matched CH3CCH + H· → C2H2 + ·CH3
2 records matched CH3CCH + H· → Products
1 record matched CH3CCH + C2 → H2CCCCCH + H·
1 record matched CH3CCH + C2 → HCCCHCCH + H·
1 record matched CH3CCH + ·CH → Methylenecyclopropene + H·
1 record matched CH3CCH + ·CH → CH2=C=C=CH2 + H·
1 record matched CH3CCH + ·CH → Vinylacetylene + H·
1 record matched CH3CCH + Phenyl → Benzene, 1,2-propadienyl- + H·
1 record matched CH3CCH + Phenyl → 1-Phenylpropyne + H·
1 record matched CH3CCH + ·C2H → H· + CH≡CCH2C≡CH
1 record matched CH3CCH + ·C2H → H· + CH2=C=C=C=CH2
1 record matched CH3CCH + ·C2H → CH3C≡CC≡CH + H·
1 record matched CH3CCH + ·C2H → CH2CCHCCH + H·
1 record matched CH3CCH + ·CH2CH=CH2 → 1,3,5-Hexatriene + H·
1 record matched CH3CCH + ·CH2CH=CH2 → CH3CCCH2CHCH2 + H·
1 record matched CH3CCH → CH2C≡CH + H·
2 records matched C3H8 + H· → H2 + 1-C3H7
2 records matched C3H8 + H· → H2 + iso-C3H7
2 records matched C3H8 + H· → Other Products + H2
1 record matched C2H5Br + H· → Products
1 record matched CH3SH + O· → H· + CH3SO
3 records matched CH3SH + H· → ·CH3 + H2S
2 records matched CH3SH + H· → H2 + ·CH2SH
2 records matched CH3SH + H· → H2 + CH3
1 record matched CH3SH + H· → CH4 + SH
1 record matched CH3SH + H· → Products
1 record matched CH3SH + CH3S· → (CH3S)2 + H·
1 record matched HCN + CCCN → NCCCCN + H·
1 record matched HCN + O· → H· + NCO
1 record matched HCN + H· + H· → CH2=NH
1 record matched HCN + H· → H2C=N
2 records matched HCN + H· → CN + H2
1 record matched HCN + H· → HC=NH
1 record matched HCN + C2 → H· + CCCN
1 record matched HCN + ·OH → HO-C≡N + H·
3 records matched HCN + ·OH → HN=C=O + H·
1 record matched HCN → CN + H·
1 record matched CH3NH2 + H· → H2 + CH3NH
1 record matched CH3NH2 + H· → H2 + CH2NH2
1 record matched CH3NH2 + H· → Products + H2
1 record matched CH3NH2 + B → CH3NBH + H·
1 record matched CH3NH2 + B → CH3BNH + H·
1 record matched CH3NH2 + B → CH2BNH2 + H·
1 record matched CH3I + H· → ·CH3 + HI
2 records matched CH3I + H· → H2 + ·CH2I
1 record matched CH3I + H· → CH4 + I
2 records matched CH3I + H· → Products
5 records matched CH3Cl + H· → ·CH3 + HCl
3 records matched CH3Cl + H· → H2 + ·CH2Cl
1 record matched CH3Cl + H· → Products
1 record matched CH3Cl + ·OH → H· + ClCH2OH
1 record matched CH3Cl + ·OH → CH3OCl + H·
5 records matched C2H2 + CH2CHC·CH2 → H· + HC≡CCH2CH=C=CH2
7 records matched C2H2 + CH2CHC·CH2 → CH≡CC(=CH2)CH=CH2 + H·
7 records matched C2H2 + CH2CHC·CH2 → Fulvene + H·
5 records matched C2H2 + CH2CHC·CH2 → Benzene + H·
1 record matched C2H2 + CH3C≡C → C5H4(all isomers) + H·
7 records matched C2H2 + CH2=CHCH=CH· → 1,3-Hexadien-5-yne + H·
6 records matched C2H2 + CH2=CHCH=CH· → Fulvene + H·
8 records matched C2H2 + CH2=CHCH=CH· → Benzene + H·
1 record matched C2H2 + CD≡C· → Diacetylene-d1 + H·
1 record matched C2H2 + 1,3-Cyclopentadiene, 5-ethenylidene- → H· + 1H-inden-1-yl
1 record matched C2H2 + CH2=C=C=CH· → H· + (Z)-HC≡CCH=CHC≡CH
1 record matched C2H2 + CH2=C=C=CH· → Benzyne + H·
1 record matched C2H2 + CH2=C=C=CH· → HC≡CCH=C=C=CH2 + H·
2 records matched C2H2 + O· → H· + HCCO
7 records matched C2H2 + H· → C2H3
8 records matched C2H2 + H· → H2 + ·C2H
1 record matched C2H2 + 2-Naphthalenyl → 2-Ethynylnaphthalene + H·
1 record matched C2H2 + S → HCCS + H·
1 record matched C2H2 + C → H· + c-C3H
1 record matched C2H2 + C → H· + CCCH
1 record matched C2H2 + ·CH2Cl → CH2=C=CHCl + H·
1 record matched C2H2 + ·OH → H· + HC≡COH
2 records matched C2H2 + ·OH → H2C=C=O + H·
1 record matched C2H2 + ·CH → H· + CH2=C=C:
1 record matched C2H2 + ·CH → H· + c-C3H2
1 record matched C2H2 + ·CH → CH≡CC(·)H + H·
1 record matched C2H2 + C2H3 → CH2=C=C=CH2 + H·
2 records matched C2H2 + C2H3 → Vinylacetylene + H·
1 record matched C2H2 + 1-Naphthalenyl → H· + 1-Ethynylnaphthalene
1 record matched C2H2 + 1-Naphthalenyl → Acenaphthylene + H·
1 record matched C2H2 + Phenyl → Phenylacetylene + H·
3 records matched C2H2 + ·CH3 → CH3CCH + H·
1 record matched C2H2 + Benzyl → Indene + H·
1 record matched C2H2 + CH2=C → H· + CH2=C=C=CH·
1 record matched C2H2 + Cyclopentadienyl → H· + 1,3-Cyclopentadiene, 5-ethenylidene-
1 record matched C2H2 + Cyclopentadienyl → 1-Ethynyl-1,3-cyclopentadiene + H·
3 records matched C2H2 + ·C2H → 1,3-Butadiyne + H·
2 records matched C2H2 + H2 → C2H3 + H·
1 record matched C2H2 + Vinylacetylene → Phenyl + H·
1 record matched C2H2 + C2H2 → H· + CH2C(·)CCCH
1 record matched C2H2 + C2H2 → H· + CH2=C=C=CH·
3 records matched C2H2 + C2H2 → HCCCHCH· + H·
1 record matched C2H2 + C2H2 → Other Products + H·
3 records matched C2H2 → ·C2H + H·
1 record matched C2H4 + COH → Cyclopropanone + H·
1 record matched C2H4 + COH → CH2=CHCHO + H·
2 records matched C2H4 + O· → CH2=CHO· + H·
2 records matched C2H4 + O· → *CH2C(O)H + H·
2 records matched C2H4 + O· → CH3CO + H·
2 records matched C2H4 + ·F → CH2=CHF + H·
7 records matched C2H4 + H· → ·C2H5
11 records matched C2H4 + H· → H2 + C2H3
2 records matched C2H4 + S → H· + CH2=CHS
1 record matched C2H4 + S → CH3CS + H·
1 record matched C2H4 + C → CH2C≡CH + H·
1 record matched C2H4 + ·OH → CH2=CHOH + H·
1 record matched C2H4 + C2H3 → 1,2-butadiene + H·
1 record matched C2H4 + C2H3 → 1-butyne + H·
2 records matched C2H4 + C2H3 → 1,3-Butadiene + H·
1 record matched C2H4 + HCO → CH2=CHCHO + H·
1 record matched C2H4 + Phenyl → Styrene + H·
1 record matched C2H4 + Benzyl → 2,3-Dihydroindene + H·
1 record matched C2H4 + Benzyl → 3-Phenylpropene + H·
1 record matched C2H4 + ·C2H → CH2=C=C=CH2 + H·
1 record matched C2H4 + ·C2H → Vinylacetylene + H·
1 record matched C2H4 + H2 → ·C2H5 + H·
3 records matched C2H4 → C2H3 + H·
1 record matched C2H6 + O· → CH3CH2O· + H·
13 records matched C2H6 + H· → H2 + ·C2H5
1 record matched C2H6 + H· → CH4 + ·CH3
1 record matched C2H6 → ·C2H5 + H·
1 record matched CH3Br + H· → ·CH3 + HBr
1 record matched CH3Br + H· → CH4 + Br·
1 record matched&nbs