Kinetics Database Logo

Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences


Rate Our Products and Services


Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty


Administrative Links

NIST home page

MML home page

Chemical Sciences Division

  NIST Logo Home
©NIST, 2020
Accessibility information

Search Results

Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
1 record matched NO2 + C2O → CO2 + NCO
1 record matched 2,3,4-Trihydroxybenzoic acid → Other Products + CO2
1 record matched 2,4-Dihydroxybenzoic acid → Other Products + CO2
1 record matched 2-Hydroxybenzoic acid → Other Products + CO2
1 record matched NO + CH3CH2C(O)OO → CO2 + ·C2H5 + NO2
1 record matched NO + HCCO → HCN + CO2
2 records matched NO + CH3C(O)OO(·) → CO2 + ·CH3 + NO2
2 records matched CH3CO + O· → CO2 + ·CH3
3 records matched HCO + O· → CO2 + H·
1 record matched HCO + NO2 → CO2 + NO + H·
1 record matched 4-Methylene-2-oxetanone → CO2 + CH2=C=CH2
3 records matched CO + O· → CO2
2 records matched CO + CF3O2 → CO2 + CF3O
2 records matched CO + NO2 → CO2 + NO
1 record matched CO + N2O → CO2 + N2
4 records matched CO + O2 → CO2 + O·
8 records matched CO + ·OH → CO2 + H·
5 records matched CO + HO2 → CO2 + ·OH
1 record matched CO + CH3O· → CO2 + ·CH3
1 record matched COS + O· → CO2 + S
1 record matched CO2 + ·CH2 → CH2O + CO
3 records matched CO2 + O· → CO + O2
4 records matched CO2 + NaO → NaCO3
2 records matched CO2 + H· → CO + ·OH
1 record matched CO2 + ·CH → Products
4 records matched CO2 + NaOH → NaHCO3
1 record matched HN=C=O + O· → CO2 + NH
1 record matched HN=C=O + HN=C=O → CO2 + CH2N2
2 records matched O(1D) + COF2 → CO2 + F2
2 records matched O(1D) + CO2 → CO2 + O·
1 record matched O(1D) + CO2 → O(3P) + CO2
2 records matched O2(1DELTA) + CO2 → Products
1 record matched N(2D) + CO2 → CO + NO
1 record matched N(2P) + CO2 → Products
1 record matched N2(A3Sigma_u+) + CO2 → Products
2 records matched DOC(O)· → CO2 + D
1 record matched CD3C(O)OONO2 → CO2 + CD3ONO2
1 record matched FC(O)O· → CO2 + ·F
1 record matched CH2=C(CF3)C(CH3)2COOH → Other Products + CO2
1 record matched Bicyclo[6.1.0]nonane-1-acetic acid, α,α-dimethyl- → Other Products + CO2
1 record matched Bicyclo[5.1.0]octane-1-acetic acid, α,α-dimethyl- → CO2 + Cyclooctane,(1-methylethylidene)-
1 record matched Bicyclo[5.1.0]octane-1-acetic acid, α,α-dimethyl- → Other Products + CO2
1 record matched Bicyclo[4.1.0]heptane-1-acetic acid, α,α-dimethyl- → CO2 + Cyclohexane, 1-methyl-2-(1-methylethylidene)-
1 record matched Bicyclo[4.1.0]heptane-1-acetic acid, α,α-dimethyl- → CO2 + Cycloheptane,(1-methylethylidene)-
1 record matched Bicyclo[4.1.0]heptane-1-acetic acid, α,α-dimethyl- → Other Products + CO2
1 record matched Bicyclo[3.1.0]hexane-1-acetic acid, α,α-dimethyl- → CO2 + Cyclopentane, 1-methyl-2-(1-methylethylidene)-
1 record matched Bicyclo[3.1.0]hexane-1-acetic acid, α,α-dimethyl- → CO2 + Cyclohexane,(1-methylethylidene)-
1 record matched Bicyclo[3.1.0]hexane-1-acetic acid, α,α-dimethyl- → Other Products + CO2
1 record matched Cyclopropaneacetic acid, 1-ethyl-α,α,2-trimethyl- → CO2 + n-C3H7C(C2H5)=C(CH3)2
1 record matched Cyclopropaneacetic acid, 1-ethyl-α,α,2-trimethyl- → Other Products + CO2
1 record matched Cyclopropaneacetic acid, 1-methyl- → CO2 + C2H5C(CH3)=CH2
1 record matched Cyclopropaneacetic acid, α,α,1-trimethyl- → CO2 + C2H5C(CH3)=C(CH3)2
1 record matched Cyclopropaneacetic acid, α,α-dimethyl- → CO2 + (CH3)2C=CHC2H5
1 record matched Cyclopropaneacetic acid, α,α-dimethyl- → CO2 + (CH3)2C=C(CH3)2
1 record matched Cyclopropaneacetic acid, 2,2-dimethyl- → CO2 + (CH3)2CHCH2CH=CH2
1 record matched Cyclopropaneacetic acid, 2,2-dimethyl- → CO2 + (CH3)2CHC(CH3)=CH2
1 record matched Cyclopropaneacetic acid, 2,2-dimethyl- → CO2 + (CH3)3CCH=CH2
1 record matched Carbamic acid, (3-methoxyphenyl)-, 1,1-dimethylethyl ester → iso-C4H8 + CO2 + 3-Methoxybenzenamine
1 record matched CH2=CHCH=CHC(CH3)2COOH → CO2 + CH2=CHCH2CH=C(CH3)2
1 record matched CH2=C=CHCH2COOH → 1,3-Butadiene + CO2
1 record matched CH≡CC(CH3)2COOH → CO2 + CH2=C=C(CH3)2
1 record matched CH2=C(Cl)C(CH3)2COOH → CO2 + CH2=C(Cl)CH(CH3)2
1 record matched Cyclopropaneacetic acid, 2-methyl-, trans- → CO2 + C2H5C(CH3)=CH2
1 record matched Cyclopropaneacetic acid, 2-methyl-, trans- → CO2 + (CH3)2CHCH=CH2
1 record matched Cyclopropaneacetic acid, 2-methyl-, trans- → 1-C5H10 + CO2
1 record matched Ethyl 1-Piperidineglyoxylate → C2H4 + CO2 + 1-Piperidinecarboxaldehyde
1 record matched (CH3)2NC(O)OCH(CH3)2 → CH3CH=CH2 + CO2 + (CH3)2NH
1 record matched 1-Cyclooctene-1-acetic acid, α,α-dimethyl- → CO2 + Cyclooctane,(1-methylethylidene)-
1 record matched CH3C≡CCH2COOH → CO2 + 1,2-butadiene
1 record matched N,N-Dimethylglycine ethyl ester → C2H4 + (CH3)3N + CO2
2 records matched ethyl 1-methyl-2-piperidine carboxylate → C2H4 + CO2 + N-Methylpiperidine
1 record matched Ethyl 1-piperidineaceate → C2H4 + CO2 + N-Methylpiperidine
1 record matched Neopentyl chloroformate → CO2 + t-C4H9CH2Cl
1 record matched Neopentyl chloroformate → methylbutene + CO2 + HCl
1 record matched 1-Piperidinepropanoic acid, ethyl ester → C2H4 + CO2 + Piperidine, 1-ethyl-
1 record matched Carbamic acid, (4-methoxyphenyl)-, 1,1-dimethylethyl ester → 4-Methoxybenzeneamine + iso-C4H8 + CO2
1 record matched Carbamic acid, (3-methylphenyl)-, 1,1-dimethylethyl ester → 3-Methylbenzenamine + iso-C4H8 + CO2
4 records matched O· + HCCO → CO2 + ·CH
1 record matched ClC(O)OCH(CH3)CH2CH3 → sec-C4H9Cl + CO2
1 record matched 1-Cycloheptene-1-acetic acid, .alpha.,.alpha.-dimethyl- → Other Products + CO2
1 record matched 1-Cyclohexene-1-acetic acid, .alpha.,.alpha.-dimethyl- → Other Products + CO2
1 record matched 1-Cyclopentene-1-acetic acid, α,α-dimethyl- → CO2 + Cyclopentene, 1-(1-methylethyl)-
1 record matched CH3CH=C(C2H5)C(CH3)2COOH → CO2 + 2-Pentene, 3-ethyl-4-methyl-, (E)-
1 record matched 3-Pentenoic acid, 2,2-dimethyl- → CO2 + 2-Pentene, 4-methyl-
2 records matched HCOO → CO2 + H·
1 record matched CH3OC(·)(O) → CO2 + ·CH3
1 record matched 2-Oxetanone, 3,3-difluoro-4,4-dimethyl- → CO2 + F2C=C(CH3)2
1 record matched Carbamic acid, (4-methylphenyl)-, 1,1-dimethylethyl ester → 4-Methylbenzenamine + iso-C4H8 + CO2
1 record matched Benzenepropanoic acid, α,α-dimethyl-β-methylene- → CO2 + Benzene,(1,2-dimethyl-1-propenyl)-
1 record matched CH2ClC(CH3)2COOH → iso-C4H8 + CO2 + HCl
2 records matched CH2=CHC(CH3)2COOH → CO2 + (CH3)2CHCH=CH2
1 record matched CH2=CHC(CH3)2COOH → CO2 + (CH3)2C=CHCH3
1 record matched NO2 + FC(O)O· → CO2 + NO2F
1 record matched NO2 + HCCO → CO2 + HC-N=O
1 record matched NO2 + NCO → CO2 + N2O
1 record matched NO2 + CH3CH2CO → CO2 + ·C2H5 + NO
3 records matched NO + FC(O)O· → CO2 + FNO
3 records matched NO + HCCO → HCN + CO2
1 record matched NO + HCCO → Other Products + CO2
2 records matched NO + CH3C(O)OO(·) → CO2 + ·CH3 + NO2
6 records matched NO + NCO → CO2 + N2
1 record matched NO + C2O → CN + CO2
1 record matched O2 + HC(O)CO → CO2 + CO + ·OH
1 record matched O2 + DOC(O)· → CO2 + DO2
1 record matched O2 + CCl2=CCl → CO2 + ·CCl3
2 records matched O2 + ·CH2 → CO2 + H· + H·
2 records matched O2 + HCCO → CO2 + CO + H·
1 record matched O2 + NCO → CO2 + NO
1 record matched O2 + CH3CH2CO → CO2 + CH3CH2
1 record matched (CH3)2NC(O)OC(CH3)3 → iso-C4H8 + CO2 + (CH3)2NH
1 record matched Cyclopropaneacetic acid → iso-C4H8 + CO2
1 record matched Cyclopropaneacetic acid → 1-C4H8 + CO2
1 record matched 3-Pentenoic acid → CH3CH=CHCH3 + CO2
1 record matched Ethyl 1-methylnipecotate → C2H4 + CO2 + N-Methylpiperidine
1 record matched Benzenepropanoic acid, β-methylene- → 2-Phenylpropene + CO2
1 record matched 3-Butenoic acid, 2,2-dimethyl-4-phenyl- → CO2 + 2-Butene, 2-methyl-4-phenyl-
1 record matched 3H-2-Benzopyran-3-one, 1,4-dihydro- → CO2 + Benzocyclobutene
1 record matched CH2=C(CH3)C(CH3)2COOH → CO2 + (CH3)2C=C(CH3)2
2 records matched CH2=C(CH3)C(CH3)2COOH → CO2 + (CH3)2CHC(CH3)=CH2
1 record matched CH2=C=CHC(CH3)2COOH → CO2 + (CH3)2C=CHCH=CH2
1 record matched Ethyl diethylcarbamate → C2H4 + (C2H5)2NH + CO2
2 records matched Carbamic acid, phenyl-, 1,1-dimethylethyl ester → aniline + iso-C4H8 + CO2
1 record matched HO2 + FC(O)O· → CO2 + HF + O2
1 record matched HO2 + CH3C(O)OO(·) → CO2 + ·CH3 + ·OH + O2
1 record matched CH3CO + O· → CO2 + ·CH3
1 record matched CH3CO + NO2 → CO2 + ·CH3 + NO
2 records matched CH3CO + O2 → CO2 + CH3
1 record matched 2-Oxetanone, 4-methyl- → CH3CH=CH2 + CO2
1 record matched CH2C≡CH + O2 → CO2 + C2H3
1 record matched C(O)NH2 + ·OH → CO2 + NH3
1 record matched C2H3 + O2 → CO2 + ·CH3
2 records matched benzoyl + O· → CO2 + Phenyl
1 record matched Carbamic acid, methylphenyl-, ethyl ester → C2H4 + N-Methylbenzenamine + CO2
1 record matched ClCO + NO2 → CO2 + NO + ·Cl
1 record matched HCO + O· → CO2 + H·
3 records matched HCO + NO2 → CO2 + NO + H·
2 records matched HCO + O2 → CO2 + ·OH
2 records matched HOC(·)O + O2 → CO2 + HO2
2 records matched HOC(·)O → CO2 + H·
2 records matched 2-Pyridinecarboxylic acid ethyl ester → C2H4 + Pyridine + CO2
1 record matched CH≡CCH2COOH → CO2 + CH2=C=CH2
2 records matched CH3C(O)OONO2 → CO2 + CH3ONO2
1 record matched CH2=C + O2 → CH_2(aA_1) + CO2
1 record matched ·C2H + O2 → CH(A2Delta, B2Sigma-) + CO2
1 record matched Carbonic acid o-methoxy-α-methylbenzyl methyl ester → CH3OH + CO2 + Benzene, 1-ethenyl-2-methoxy-
1 record matched CH3CHClCH2COOH → CH3CH=CH2 + CO2 + HCl
1 record matched FCO + FC(O)O· → CO2 + COF2
1 record matched Carbonic acid m-chloro-α-methylbenzyl methyl ester → CH3OH + CO2 + Benzene, 1-chloro-3-ethenyl-
1 record matched Carbonic acid p-chloro-α-methylbenzyl methyl ester → CH3OH + CO2 + Benzene, 1-chloro-4-ethenyl-
1 record matched Carbonic acid o-bromo-α-methylbenzyl methyl ester → CH3OH + CO2 + Benzene, 1-bromo-2-ethenyl-
1 record matched Carbonic acid p-bromo-α-methylbenzyl methyl ester → CH3OH + CO2 + Benzene, 1-bromo-4-ethenyl-
1 record matched Carbonic acid methyl α-methyl-m-nitrobenzyl ester → CH3OH + CO2 + Benzene, 1-ethenyl-3-nitro-
1 record matched Carbonic acid p,α-dimethylbenzyl methyl ester → CH3OH + CO2 + 4-Methylstyrene
1 record matched CH3OC(O)OCH2CH2-(C6H5) → CH3OH + Styrene + CO2
1 record matched Carbonic acid methyl α-methylbenzyl ester → CH3OH + Styrene + CO2
1 record matched Carbonic acid p-fluoro-α-methylbenzyl methyl ester → CH3OH + CO2 + Benzene, 1-ethenyl-4-fluoro-
1 record matched Carbonic acid p-fluoro-α-methylbenzyl methyl ester → CH3OH + CO2 + Benzene, 1-ethenyl-2-fluoro-
1 record matched Carbonic acid o-chloro-α-methylbenzyl methyl ester → CH3OH + CO2 + 2-Chlorostyrene
1 record matched Carbonic acid o,α-dimethylbenzyl methyl ester → CH3OH + CO2 + 2-Methylstyrene
1 record matched Carbonic acid p-methoxy-α-methylbenzyl methyl ester → CH3OH + CO2 + Benzene, 1-ethenyl-4-methoxy-
1 record matched CH2=C(CH3)CH2COOH → iso-C4H8 + CO2
1 record matched C6H5COC(O)OC2H5 → C2H4 + Benzaldehyde + CO2
1 record matched FC(O)OCH3 → CO2 + CH3F
1 record matched (CH3)2NCH2CO2H → (CH3)3N + CO2
1 record matched HCOCOOCH2CH3 → Products + CO2
2 records matched C2H5OC(O)N(CH3)2 → C2H4 + CO2 + (CH3)2NH
1 record matched 2-(E)-C5H10 + CH3C(O)OO(·) → CO2 + ·CH3 + trans-2-ethyl-3-methyl-oxirane
1 record matched CO + CF3O → CO2 + ·CF3
41 records matched CO + O· → CO2
1 record matched CO + HNO → CO2 + NH
6 records matched CO + OD → CO2 + D
1 record matched CO + NaO → CO2 + Na
1 record matched CO + OF → CO2 + ·F
4 records matched CO + NO2 → CO2 + NO
1 record matched CO + O3 → CO2 + O2
9 records matched CO + N2O → CO2 + N2
11 records matched CO + O2 → CO2 + O·
1 record matched CO + H2O → Products + CO2
92 records matched CO + ·OH → CO2 + H·
14 records matched CO + HO2 → CO2 + ·OH
1 record matched CO + (CH3)3CO· → CO2 + tert-C4H9
1 record matched CO + HOC(·)O → CO2 + HCO
5 records matched CO + CH3O· → CO2 + ·CH3
1 record matched CO + CH3O2· → CO2 + CH3
1 record matched CO + FeO → CO2 + Fe
1 record matched 2-(Z)-C5H10 + CH3C(O)OO(·) → CO2 + ·CH3 + cis-2-ethyl-3-methyl-oxirane
4 records matched CH2=CHCH2COOH → CH3CH=CH2 + CO2
1 record matched CH3OCOOCH3 → (CH3)2O + CO2
1 record matched Benzeneacetic acid, α-oxo- → Benzaldehyde + CO2
1 record matched C6H5CH(OH)COOH → Benzyl alcohol + CO2
1 record matched 1-C6H12 + CH3C(O)OO(·) → CO2 + Oxirane, butyl- + ·CH3
1 record matched CH3C(O)OCH2CH=CH2 + ·CH3 → 1-C4H8 + CO2 + ·CH3
1 record matched C2H5C(CH3)=CH2 + CH3C(O)OO(·) → CO2 + ·CH3 + 2-ethyl-2-methyl-oxirane
1 record matched (CH3)2CHCH=CH2 + CH3C(O)OO(·) → CO2 + (1-methylethyl)oxirane + ·CH3
1 record matched ClC(O)OCH2CH3 → C2H5Cl + CO2
1 record matched (CH3)2C=CHCH3 + CH3C(O)OO(·) → CO2 + ·CH3 + 2,2,3-trimethyl-oxirane
1 record matched C3O2 + O· → CO2 + C2O
1 record matched C3O2 + ·OH → CO2 + HCCO
1 record matched Benzyl chloroformate → C6H5CH2Cl + CO2
1 record matched 3-Piperidine Carboxylic Acid → Piperidine + CO2
1 record matched ClCOOH → CO2 + HCl
2 records matched COS + O· → CO2 + S
2 records matched COS + ·OH → CO2 + SH
1 record matched H2C=C=O + ·OH → CO2 + ·CH3
1 record matched H2C=C=O + H2C=C=O → CO2 + CH2=C=CH2
1 record matched OCHCOOH → CH2O + CO2
1 record matched HOOCCOOH → HCOOH + CO2
1 record matched CH2(COOH)2 → CH3C(O)OH + CO2
2 records matched CH3COCOOH → CH3CHO + CO2
2 records matched CO2 + ·CH2 → CH2O + CO
1 record matched CO2 + NCO → Products
1 record matched CO2 + BCl → CO + OBCl
3 records matched CO2 + N → CO + NO
2 records matched CO2 + O· → CO3
4 records matched CO2 + O· → CO + O2
1 record matched CO2 + AlO → CO + AlO2
1 record matched CO2 + AlO → Products
1 record matched CO2 + ·N3 → Products
1 record matched CO2 + SiH2 → CO + H2Si=O
1 record matched CO2 + CD → Products
1 record matched CO2 + NH → Products
1 record matched CO2 + BF → CO + OBF
1 record matched CO2 + BH → Products
1 record matched CO2 + AlCl → CO + OAlCl
1 record matched CO2 + AlCl → Products
1 record matched CO2 + Mo2 → Products
10 records matched CO2 + H· → CO + ·OH
1 record matched CO2 + Ag2 → Products
2 records matched CO2 + C2O → Products
1 record matched CO2 + C2 → Products
1 record matched CO2 + VO → Products
1 record matched CO2 + NO → CO + NO2
1 record matched CO2 + O2 + O· → CO2 + O3
1 record matched CO2 + P → Products
1 record matched CO2 + Zr → Products
1 record matched CO2 + Y → Products
1 record matched CO2 + V → Products
1 record matched CO2 + Ho → Products
1 record matched CO2 + Hf → Products
1 record matched CO2 + Gd → Products
1 record matched CO2 + Eu → Products
1 record matched CO2 + Er → Products
2 records matched CO2 + Cr → CO + CrO
1 record matched CO2 + Cr → Products
1 record matched CO2 + Ce → Products
2 records matched CO2 + C → CO + CO
1 record matched CO2 + B → CO + BO
1 record matched CO2 + B → Products
1 record matched CO2 + Ba → CO + BaO
1 record matched CO2 + Ti → Products
1 record matched CO2 + Sn → CO + SnO
1 record matched CO2 + Sn → Products
1 record matched CO2 + Tm → Products
1 record matched CO2 + Tb → Products
1 record matched CO2 + Ta → CO + TaO
2 records matched CO2 + Si → CO + SiO
1 record matched CO2 + Sm → Products
1 record matched CO2 + Pr → Products
1 record matched CO2 + Nd → Products
2 records matched CO2 + Mo → CO + MoO
1 record matched CO2 + Lu → CO + LuO
1 record matched CO2 + La → Products
2 records matched CO2 + Fe → FeCO3
2 records matched CO2 + Fe → CO + FeO
1 record matched CO2 + Dy → Products
7 records matched CO2 + Al → CO + AlO
2 records matched CO2 + Al → Adduct
1 record matched CO2 + CF → Products
5 records matched CO2 + ·CH → Products
1 record matched CO2 + ·HCC≡N → Products
1 record matched CO2 + FeO → FeCO3
1 record matched CO2 + FeO → CO + FeO2
3 records matched CO2 + NaOH → NaHCO3
2 records matched CO2 + MgO → MgCO3
2 records matched CO2 + CaO → CaCO3
23 records matched CO2 → CO + O·
1 record matched CO2 → O(1D) + CO
1 record matched CH3CH=CH2 + CH3C(O)OO(·) → Methyloxirane + CO2 + ·CH3
1 record matched ClC(O)OCH(CH3)2 → iso-C3H7Cl + CO2
1 record matched HC(O)OOH → CO2 + H2O
1 record matched HC(O)OCH3 → CH4 + CO2
1 record matched CH2=CHCHO + CH3C(O)OO(·) → CH3C(O)CHO + CO2 + ·CH3
1 record matched Benzeneacetic acid → Toluene + CO2
1 record matched 2-Pyridinecarboxylic acid → Pyridine + CO2
1 record matched 2-Furancarboxylic acid → Furan + CO2
1 record matched ClC(O)OCH3 → CH3Cl + CO2
1 record matched CH3C(O)OCH3 → CO2 + ·CH3 + ·CH3
1 record matched C2H5COOH → C2H6 + CO2
1 record matched CF3COOH → CHF3 + CO2
1 record matched COCl2 + H2O → Other Products + CO2
2 records matched HN=C=O + O· → CO2 + NH
1 record matched HN=C=O + NO2 → CO2 + HN=NO.
1 record matched HN=C=O + ·OH → CO2 + NH2
1 record matched HN=C=O + HN=C=O → CO2 + CH2N2
1 record matched C2H2 + HOC(·)O → CO2 + C2H3
1 record matched C2H4 + HOC(·)O → CO2 + ·C2H5
1 record matched CH3C(O)OH + ·OH → CO2 + ·CH3 + H2O
7 records matched CH3C(O)OH → CH4 + CO2
7 records matched HCOOH → CO2 + H2
3 records matched 2-Oxetanone → C2H4 + CO2
2 records matched CN + NO2 → CO2 + N2
1 record matched CN + O2 → CO2 + N
4 records matched CN + CO2 → CO + NCO
1 record matched O(1D) + ClNCO → CO2 + NCl
5 records matched O(1D) + CO → CO2
1 record matched O(1D) + COS → CO2 + S
1 record matched O(1D) + COF2 → CO2 + F2
2 records matched O(1D) + CO2 → CO3
5 records matched O(1D) + CO2 → CO + O2
9 records matched O(1D) + CO2 → CO2 + O·
3 records matched O(1D) + CO2 → Products
1 record matched O(1D) + CO2 → O(3P) + CO2
1 record matched O(1D) + HN=C=O → CO2 + NH
6 records matched O2(1DELTA) + CO2 → CO2 + O2
1 record matched 2,5-Cyclohexadiene-1-carboxylic acid 2-propenyl ester → CO2 + ·CH2CH=CH2 + 2,5-Cyclohexadien-1-yl
1 record matched 3-Butenoic acid, 2,2-dimethyl-3-phenyl- → CO2 + Benzene,(1,2-dimethyl-1-propenyl)-
1 record matched Carbonic acid 2-(p-chlorophenyl)ethyl methyl ester → CH3OH + CO2 + Benzene, 1-chloro-4-ethenyl-
1 record matched Carbonic acid 2-(p-methoxyphenyl)ethyl methyl ester → CH3OH + CO2 + Benzene, 1-ethenyl-4-methoxy-
1 record matched CF3OC(O)OOC(O)OCF3 → CO2 + CF3O-OCF3
1 record matched CF3OC(O)OOC(O)OCF3 → CF3OC(O)C(O)OCF3 + CO2
1 record matched CCl2 (a 3B1) + CO2 → CO2 + CCl2 (X 1A1)
1 record matched CCl2 (A 1B1) + CO2 → CO2 + CCl2 (X 1A1)
1 record matched C6H5CHBrCOOH → (Bromomethyl)benzene + CO2
1 record matched NCCO + NO → CO2 + NCN
1 record matched NCCO + O2 → CO2 + NCO
1 record matched methyl formate radical + O2 → CO2 + ·OH + HOCH
3 records matched O(1D) + CO2 → Products
1 record matched O(1S) + CO2 → Products
1 record matched ·CH(OH)C(O)CH3 + O2 → CH3C(O)OH + CO2 + H·
1 record matched ·CH(OH)C(O)CH3 + O2 → HCOOH + CO2 + ·CH3
2 records matched CO(«nu»=0) + ·OH → CO2 + H·
2 records matched CO(«nu»=1) + ·OH → CO2 + H·
2 records matched CO(«nu»=2) + ·OH → CO2 + H·
2 records matched CO(«nu»=3) + ·OH → CO2 + H·
2 records matched CO(«nu»=4) + ·OH → CO2 + H·
2 records matched C(1D) + CO2 → Products
1 record matched HOCO + ·Cl → CO2 + HCl
1 record matched FC(O)OOC(O)OCCl2· → COCl2 + CO2 + CO2 + ·F
1 record matched (CH3CH2)2NCO(O)CH(CH3)2 → (C2H5)2NH + CH3CH=CH2 + CO2
1 record matched (CH3CH2)2NCO(O)C(CH3)3 → (C2H5)2NH + iso-C4H8 + CO2
1 record matched 1-ethylpiperazine carboxylate → C2H4 + Piperazine + CO2
1 record matched tert-Butyl-1-pyrrole carboxylate → Pyrrole + iso-C4H8 + CO2
1 record matched 1-(tert-Butoxycarbonyl)-2-pyrrolidinone → iso-C4H8 + CO2 + 2-Pyrrolidinone
1 record matched tert-Butyl-1-pyrrolidine carboxylate → iso-C4H8 + Pyrrolidine + CO2
1 record matched CH3C(O)C(O)O2 → CO2 + H2C=C=O + ·OH
1 record matched (2-piperdine)-C(O)OCH2CH3 → C2H4 + Piperidine + CO2
1 record matched (N-piperdine)-C(O)OCH2CH3 → C2H4 + Piperidine + CO2
1 record matched O2(X3Sigma_g-) + C2H3 → CO2 + ·CH3
1 record matched O2(b1Sigma_g+) + CO → CO2 + O·
1 record matched O2(b1Sigma_g+) + CO2 → Products
1 record matched ethyl 3-phenyl glycidate → C2H4 + Phenylethanal + CO2
1 record matched ethyl 3-methyl-3-phenyl glycidate → C6H5CH(CH3)CHO + C2H4 + CO2
1 record matched Oxazetone → HCN + CO2
1 record matched FC(O)OH → CO2 + HF
1 record matched ethyl 1-methyl-2-piperidine carboxylate → C2H4 + CO2 + N-Methylpiperidine
2 records matched 1,2-Dioxetane-3,4-dione → CO2 + CO2
2 records matched NCO + HCNO → CO2 + CHN2
7 records matched CH3OC(·)(O) → CO2 + ·CH3
1 record matched CF3C(O)O → CO2 + ·CF3
1 record matched CH3CH2OC(O)· → CO2 + ·C2H5
2 records matched C2H5OC(O)OH → C2H5OH + CO2
2 records matched CH3C(O)O → CO2 + ·CH3
1 record matched CH2ClC(CH3)2COOH → iso-C4H8 + CO2 + HCl
1 record matched NO2 + FC(O)O· → CO2 + NO2F
3 records matched NO2 + NCO → CO2 + N2O
1 record matched NO2 + C2O → CO2 + CNO
2 records matched NO + HCCO → HCN + CO2
1 record matched NO + NCO → CO2 + N2
1 record matched O2 + HC(O)CO → CO2 + CO + ·OH
3 records matched O2 + ·CH2 → CO2 + H· + H·
2 records matched O2 + ·CH2 → CO2 + H2
1 record matched H2O + FC(O)OH → CO2 + HF + H2O
1 record matched CH3OC(O)OH → CH3OH + CO2
1 record matched CO3 → O(3P) + CO2
1 record matched CO3 → O(1D) + CO2
1 record matched Ethyl diethylcarbamate → C2H4 + (C2H5)2NH + CO2
1 record matched ·OH + HOCH → CO2 + H2 + H·
1 record matched ·CH + O2 → CO2 + H·
1 record matched CH3CO + O· → CO2 + ·CH3
1 record matched CH3CO + NO2 → CO2 + ·CH3 + NO
1 record matched CH3CO + O2 → CO2 + CH3
1 record matched CH2C≡CH + O2 → CO2 + C2H3
1 record matched C2H3 + O2 → CO2 + ·CH3
1 record matched HCO + NO2 → CO2 + HNO
1 record matched HCO + NO2 → CO2 + NO + H·
1 record matched HCO + O3 → CO2 + O2 + H·
1 record matched HOC(·)O + O2 → CO2 + HO2
1 record matched HOC(·)O → CO2 + H·
1 record matched 2-Pyridinecarboxylic acid ethyl ester → C2H4 + Pyridine + CO2
1 record matched CH3C(O)OONO2 → CO2 + ·CH3 + NO3
2 records matched ·C2H + O2 → CO2 + ·CH
1 record matched ClCH2CH2N=C=O + ClCH2CH2N=C=O → CH2ClCH2N=C=NCH2CH2Cl + CO2
1 record matched C2H5OC(O)N(CH3)2 → C2H4 + CO2 + (CH3)2NH
1 record matched CO + SF5O → CO2 + SF5
1 record matched CO + CF3O → CO2 + ·CF3
2 records matched CO + O· → CO2
1 record matched CO + ClO → CO2 + ·Cl
1 record matched CO + IO → CO2 + I
3 records matched CO + OD → CO2 + D
1 record matched CO + OF → CO2 + ·F
1 record matched CO + NO2 → CO2 + NO
1 record matched CO + N2O → CO2 + N2
2 records matched CO + O2 → CO2 + O·
2 records matched CO + H2O → CO2 + H2
1 record matched CO + ·OH + H2O → CO2 + H2O + H·
26 records matched CO + ·OH → CO2 + H·
5 records matched CO + HO2 → CO2 + ·OH
1 record matched CO + CH3CO → CO2 + ·CH3
1 record matched CO + (CH3)3CO· → CO2 + tert-C4H9
1 record matched CO + H2 → CO2 + H·
1 record matched CH3OC(O)OCH2CH3 → CH3OH + C2H4 + CO2
1 record matched CH3OCOOCH3 → (CH3)2O + CO2
1 record matched CH3C(O)OCH2CH=CH2 → CO2 + ·CH2CH=CH2 + ·CH3
1 record matched 4-Pentenoic acid → 1-C4H8 + CO2
1 record matched C3O2 + O· → CO2 + C2O
1 record matched C3O2 + O3 → CO2 + CO2 + CO
1 record matched HC≡CCOOH → C2H2 + CO2
2 records matched COS + O· → CO2 + S
1 record matched COS + ·OH → CO2 + SH
1 record matched H2C=C=O + NCO → CO2 + CH2NC
1 record matched H2C=C=O + H2C=C=O → CO2 + CH2=C=CH2
1 record matched C2F5COOH + ·F → CO2 + C2F5 + HF
1 record matched H2CO2 → CO2 + H2
3 records matched HOOCCOOH → CO2 + CO + H2O
4 records matched HOOCCOOH → dihydroxycarbene + CO2
1 record matched CH2(COOH)2 → CH3C(O)OH + CO2
1 record matched CH3COCOOH → CH3C(OH) + CO2
1 record matched CO2 + ·CH2 → CH2O + CO
1 record matched CO2 + :GeH2 → CO + GeH2O
1 record matched CO2 + :GeH2 → CH2O + GeO
1 record matched CO2 + SiH2 → CO + H2Si=O
1 record matched CO2 + NH → CO + HNO
2 records matched CO2 + NH → Products
1 record matched CO2 + NH → O=CON-H
1 record matched CO2 + BH3NH3 → Products
1 record matched CO2 + NO → CO + NO2
1 record matched CO2 + O2 → Products
1 record matched CO2 + V → CO + VO
1 record matched CO2 + Er → Products
1 record matched CO2 + Cu → O=Cu=C=O
1 record matched CO2 + B → OBCO
1 record matched CO2 + B → CO + BO
1 record matched CO2 + Tb → Products
1 record matched CO2 + Sc → CO + ScO
1 record matched CO2 + Sm → Products
1 record matched CO2 + Pr → Products
1 record matched CO2 + Ni → CO + NiO
1 record matched CO2 + Nd → Products
2 records matched CO2 + Mg → Products
1 record matched CO2 + Dy → Products
1 record matched CO2 + HO2 + HO2 → CO2 + H2O2 + O2
3 records matched CO2 + ·CH3 → CH3OC(·)(O)
1 record matched CO2 + H2 → CO + H2O
2 records matched CO2 + CO + ·OH → CO2 + CO2 + H·
1 record matched HC(O)OC2H5 → C2H6 + CO2
2 records matched C2H5OC(O)OC2H5 → C2H5OH + C2H4 + CO2
1 record matched C2H5OC(O)OC2H5 → (C2H5)2O + CO2
1 record matched 2(3H)-Furanone, dihydro- → CH3CH=CH2 + CO2
1 record matched CH3C(O)OCH3 → CO2 + ·CH3 + ·CH3
1 record matched HN=C=O + NO3 → CO2 + NO + HNO
1 record matched HN=C=O + O2 → CO2 + HNO
1 record matched CH3C(O)OH + ·OH → CO2 + ·CH3 + H2O
1 record matched CH3C(O)OH → CH4 + CO2
2 records matched HCOOH → CO2 + H2
1 record matched 2-Oxetanone → C2H4 + CO2
1 record matched CN + CO2 → CO + NCO
1 record matched CH2O + CO2 + HO2 → CO2 + HCO + H2O2
1 record matched O(1D) + COS → CO2 + S
5 records matched (13)CO + ·OH → CO2 + H·
1 record matched NCCO + O2 → CO2 + NCO
1 record matched O(1D) + CO2 → CO3
1 record matched O(1D) + CO2 → Products
1 record matched O(1D) + CO2 → O(3P) + CO2
1 record matched O2(1Delta_g) + CO → O(1D) + CO2
1 record matched HC(O)C(O)O2 → CO2 + HOC(·)O
1 record matched [18]O(1D) + CO2 → Products
1 record matched [18]O(1D) + CO2 → [18]O(3P) + CO2
1 record matched [18]O(1D) + CO2 → OC[18]O + O(3P)
2 records matched HOCO + O· → CO2 + ·OH
1 record matched HOCO + ClO → CO2 + HClO
2 records matched HOCO + ClO → CO2 + HOCl
2 records matched HOCO + ·OH → CO2 + H2O
1 record matched CHFOO → CO2 + HF
1 record matched Ni(3D) + CO2 + H2 → Ni(3D) + CO + H2O
1 record matched CH(O)CH2CH(cy-CH2)C(CH3)2CHC(O)O· → CH(O)CH2CH(cy-CH2)C(CH3)2CH· + CO2
1 record matched HOC(O)OH + ·OH → CO2 + ·OH + H2O
1 record matched HOC(O)OH → CO2 + H2O
1 record matched HOOCH2C(O)O· → CH2O + CO2 + ·OH
1 record matched 1-dibenzofuranylperoxy → C11H7O + CO2
1 record matched ·OC(O)(CH2)4C(O)OH → ·CH2(CH2)3C(O)OH + CO2
1 record matched CH2BrC(O)O· → CO2 + ·CH2Br
1 record matched cis-CHCl=CCl· + O2 → CO2 + ·CCl + HCl
1 record matched cis-CHCl=CCl· + O2 → CO2 + CHCl2
1 record matched CH3OC(O)O· → CO2 + CH3
1 record matched SC(O)OH + O2 → SOOH + CO2
1 record matched C6H5CH2C(O)O· → CO2 + Benzyl
1 record matched ·OCH2CH2CH2CH2CH2C(O)O· → ·OCH2CH2CH2CH2CH2· + CO2
1 record matched ·CH2CH2CH2CH2C(O)O· → CH2CH2CH2CH2 + CO2
1 record matched ·CH2CH2C(O)O· → C2H4 + CO2
1 record matched CH3CH2CH2CH2OC(=O)· → CO2 + 1-C4H9
1 record matched ·C(O)OCCl3 → CO2 + ·CCl3
1 record matched (CH3CH2)2NCO(O)CH(CH3)2 → CH3CH=CH2 + CO2 + sec-C4H9NH2
1 record matched (CH3CH2)2NCO(O)C(CH3)3 → iso-C4H9NH2 + iso-C4H8 + CO2
1 record matched [·OH..OH2] complex + CO → CO2 + H2O + H·
1 record matched (CH3)2NCOOCH(CH3)2 → CH3CH=CH2 + CO2 + (CH3)2NH
1 record matched (CH3)2NCOOC(CH3)3 → iso-C4H8 + CO2 + (CH3)2NH
1 record matched C2(a3PIu) + O2 → C(3Pj) + CO2
1 record matched HN=C=O + NO → CO2 + HN=N

Search returned 935 records.