Kinetics Database Logo

Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences


Rate Our Products and Services


Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty


Administrative Links

NIST home page

MML home page

Chemical Sciences Division

  NIST Logo Home
©NIST, 2020
Accessibility information

Search Results

Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
1 record matched Diborane(6) → H2 + B2H4
2 records matched H· + AlOH → H2 + AlO
1 record matched Al + H2O + H2O → Al(OH)2 + H2
1 record matched H2 + SiHCl → HCl + SiH2
1 record matched H2 + SiHBr → HBr + SiH2
1 record matched Cyclopentanone + H· → cyclopentanon-2-yl + H2
1 record matched Cyclopentanone + H· → cyclopentanon-3-yl + H2
1 record matched HCN + SiH3I → SiH2ICN + H2
1 record matched HCN + SiH3Cl → SiH2ClCN + H2
1 record matched HCN + SiH3Br → SiH2BrCN + H2
1 record matched HCN + SiH4 → H2 + SiH3CN
1 record matched C2H2 + Y → H2 + C2Y
1 record matched C(3Pj) + C2H4 → H2 + c-C3H2
1 record matched C2H2(X1Σg+) + C(3Pj) → H2 + C3
1 record matched Cs(9 2P3/2) + H2 → H· + CsH
1 record matched SH + SH → H2 + S2
1 record matched NH2 + O· → H2 + NO
3 records matched H· + ·CH2 → H2 + ·CH
1 record matched H· + HNO → H2 + NO
1 record matched H· + SH → H2 + S
1 record matched H· + NH → H2 + N
2 records matched H· + NH2 → H2 + NH
12 records matched H· + H· → H2
3 records matched HBr + H· → H2 + Br·
1 record matched HI + H· → H2 + I
1 record matched HI + HI → H2 + I2
2 records matched SiH4 + H· → H2 + SiH3
2 records matched PH3 + H· → H2 + PH2
4 records matched H2S + H· → H2 + SH
1 record matched HNO2 + H· → H2 + NO2
3 records matched GeH4 + H· → H2 + GeH3
7 records matched H2O + H· → H2 + ·OH
4 records matched H2O2 + H· → H2 + HO2
2 records matched NH3 + H· → H2 + NH2
1 record matched NH3 → H2 + NH
1 record matched HF + H· → H2 + ·F
3 records matched HCl + H· → H2 + ·Cl
1 record matched iso-C4H9 + H· → iso-C4H8 + H2
4 records matched ·OH + H· → H2 + O·
12 records matched HO2 + H· → H2 + O2
3 records matched C2H3 + H· → C2H2 + H2
4 records matched HCO + H· → CO + H2
2 records matched (·)CH2OH + H· → CH2O + H2
1 record matched ·CH3 + H· → H2 + ·CH2
1 record matched ·CH3 + ·CH3 → C2H4 + H2
3 records matched CH3O· + H· → CH2O + H2
1 record matched 1-C3H7 + H· → CH3CH=CH2 + H2
1 record matched ·C2H + H· → H2 + C2
1 record matched ·C2H5 + H· → C2H4 + H2
1 record matched iso-C3H7 + H· → CH3CH=CH2 + H2
1 record matched ·CH2CH=CH2 + H· → CH2=C=CH2 + H2
1 record matched tert-C4H9 + H· → iso-C4H8 + H2
1 record matched Si2H6 + H· → H2 + Si2H5
1 record matched H2 + ·CH2 → ·CH3 + H·
13 records matched H2 + ·Cl → HCl + H·
1 record matched H2 + NCO → HN=C=O + H·
16 records matched H2 + O· → ·OH + H·
1 record matched H2 + D → H· + HD
2 records matched H2 + ClO → Products
11 records matched H2 + ·F → HF + H·
2 records matched H2 + I → HI + H·
1 record matched H2 + BO → H· + HBO
2 records matched H2 + NaO → NaOH + H·
1 record matched H2 + NO2 → HNO2 + H·
1 record matched H2 + NO → H· + HNO
4 records matched H2 + Br· → HBr + H·
1 record matched H2 + O2 → ·OH + ·OH
1 record matched H2 + O2 → HO2 + H·
1 record matched H2 + S → H· + SH
1 record matched H2 + I2 → HI + HI
1 record matched H2 + iso-C4H9 → iso-C4H10 + H·
24 records matched H2 + ·OH → H2O + H·
1 record matched H2 + ·CH → Products
4 records matched H2 + HO2 → H2O2 + H·
1 record matched H2 + CH3CO → CH3CHO + H·
1 record matched H2 + C2H3 → C2H4 + H·
1 record matched H2 + C2H3 → Products
1 record matched H2 + HCO → CH2O + H·
1 record matched H2 + (·)CH2OH → CH3OH + H·
1 record matched H2 + ·CF3 → CHF3 + H·
6 records matched H2 + ·CH3 → CH4 + H·
1 record matched H2 + CH2=C → C2H3 + H·
1 record matched H2 + 1-C3H7 → C3H8 + H·
1 record matched H2 + CH3O2· → CH3OOH + H·
8 records matched H2 + ·C2H → C2H2 + H·
2 records matched H2 + ·C2H5 → C2H6 + H·
1 record matched H2 + iso-C3H7 → C3H8 + H·
1 record matched H2 + ·CH2CH=CH2 → CH3CH=CH2 + H·
1 record matched H2 + tert-C4H9 → iso-C4H10 + H·
11 records matched H2 → H· + H·
1 record matched (CH3)2SiH2 + H· → H2 + (CH3)2SiH
1 record matched (CH3)3SiH + H· → H2 + (CH3)3Si·
1 record matched CH3SiH3 + H· → H2 + CH3SiH2
1 record matched Cyclopentane + H· → H2 + Cyclopentyl
1 record matched Cyclopentene → Cyclopentadiene + H2
1 record matched CH3CH=CH2 + H· → H2 + CH2=C(·)CH3
1 record matched CH3CH=CH2 + H· → H2 + CH3CH=C(·)H
2 records matched CH3CH=CH2 + H· → H2 + ·CH2CH=CH2
1 record matched 1,2-Dimethoxyethane + H· → CH3OCH2CH2OCH2· + H2
1 record matched Phenol + H· → H2 + C6H5O
6 records matched Toluene + H· → H2 + Benzyl
2 records matched 1-C4H10 + H· → Other Products + H2
2 records matched Ethylbenzene + H· → H2 + 1-phenylethyl
1 record matched iso-C4H10 + H· → H2 + iso-C4H9
1 record matched iso-C4H10 + H· → H2 + tert-C4H9
2 records matched iso-C4H10 + H· → Other Products + H2
1 record matched Oxirane + H· → H2 + Oxiranyl
3 records matched HN=C=O + H· → H2 + NCO
1 record matched CH3CHO + H· → H2 + CH3CO
1 record matched C3H8 + H· → H2 + 1-C3H7
1 record matched C3H8 + H· → H2 + iso-C3H7
2 records matched C3H8 + H· → Other Products + H2
2 records matched HCN + H· → CN + H2
4 records matched C2H2 + H· → H2 + ·C2H
1 record matched C2H2 + H2 → C2H3 + H·
1 record matched C2H2 + H2 → C2H4
3 records matched C2H4 + H· → H2 + C2H3
1 record matched C2H4 + H2 → ·C2H5 + H·
3 records matched C2H4 → C2H2 + H2
7 records matched C2H6 + H· → H2 + ·C2H5
8 records matched CH4 + H· → H2 + ·CH3
1 record matched CH3OH + H· → H2 + CH3
1 record matched C2H5OH + H· → H2 + CH3CH(·)OH
4 records matched CN + H2 → HCN + H·
5 records matched CH2O + H· → H2 + HCO
5 records matched O(1D) + H2 → ·OH + H·
2 records matched O(1D) + CH4 → CH2O + H2
1 record matched N(2D) + H2 → H· + NH
1 record matched N(2P) + H2 → H2 + N
3 records matched O(1D) + H2 → ·OH + H·
1 record matched H2Si(·)OH → H2 + (·)Si(O)H
1 record matched Cyclopentene 4-d → H2 + 1,3-Cyclopentadiene-5-d
1 record matched HSiOH → H2 + SiO
3 records matched ·CH2 + ·CH2 → C2H2 + H2
2 records matched ·CH2 → H2 + C
1 record matched 2H-Pyrrole, 2-ethyl-3,4-dihydro- → Other Products + H2
1 record matched :GeH2 → H2 + Ge
1 record matched H2Si=O + H2Si=O → Other Products + H2
1 record matched 1,4-Cyclohexadiene, 1-ethyl- → Ethylbenzene + H2
1 record matched Tetraborane(10) → H2 + Tetraborane(8)
1 record matched O· + ·CH2 → CO + H2
1 record matched 1,4-Cyclohexadiene, 1,2-dimethyl- → 1,2-Dimethylbenzene + H2
1 record matched SiH2=SiH2 → H2 + HSi=SiH
1 record matched SiH3OH → H2 + HSiOH
1 record matched SiH3OH → H2 + H2Si=O
1 record matched SiH2 + SiH2 → H2 + HSi=SiH
4 records matched SiH2 → H2 + Si
3 records matched SiH2F2 → H2 + SiF2
1 record matched NH2 + O· → H2 + NO
1 record matched NH2 + NH2 → H2 + HN=NH
2 records matched SiH3 → H2 + SiH
1 record matched C2H5C≡CCH=CH2 → Other Products + H2
3 records matched SiH3F → H2 + SiHF
1 record matched SiH3Cl → H2 + SiHCl
2 records matched n-C3H7SiH3 → H2 + CH3CH2CH2SiH
1 record matched H· + H2Si(·)OH → H2 + HSiOH
1 record matched H· + H2Si(·)OH → H2 + H2Si=O
1 record matched H· + H3SiO(·) → H2 + HSiOH
1 record matched H· + H3SiO(·) → H2 + H2Si=O
2 records matched H· + HSO2 → H2 + SO2
13 records matched H· + ·CH2 → H2 + ·CH
1 record matched H· + HSi(O)OH → H2 + (·)Si(O)OH
1 record matched H· + HN=N → H2 + N2
1 record matched H· + H2Si=O → H2 + (·)Si(O)H
1 record matched H· + CH2=C(·)CH3 → CH2=C=CH2 + H2
1 record matched H· + SiH3OH → H2 + H2Si(·)OH
1 record matched H· + SiH3OH → H2 + H3SiO(·)
1 record matched H· + Hyponitrous acid → H2 + NO + HNO
8 records matched H· + HNO → H2 + NO
2 records matched H· + HD → H2 + D
5 records matched H· + SH → H2 + S
1 record matched H· + SiH2F2 → H2 + HF2Si
2 records matched H· + Ge2H6 → Other Products + H2
1 record matched H· + NH → H2 + N
1 record matched H· + NH → N(4S) + H2
5 records matched H· + NH2 → H2 + NH
1 record matched H· + SiH3F → H2 + SiH2F
79 records matched H· + H· → H2
1 record matched CaOH + H· → CaO + H2
1 record matched SrOH + H· → SrO + H2
1 record matched BaOH + H· → BaO + H2
1 record matched Fe(CO)4H2 → H2 + Fe(CO)4
2 records matched CH2D + OD → H2 + CD2O
1 record matched NO + NH2 → H2 + N2O
10 records matched HBr + H· → H2 + Br·
1 record matched HI + HNO → H2 + INO
1 record matched HI + HNO → Other Products + H2
16 records matched HI + H· → H2 + I
2 records matched HI + HI → H2 + I2
2 records matched SiH4 + SiH2 → H2 + H3SiSiH
12 records matched SiH4 + H· → H2 + SiH3
23 records matched SiH4 → H2 + SiH2
3 records matched PH3 + H· → H2 + PH2
1 record matched AsH3 + H· → H2 + AsH2·
1 record matched AlH3 → H2 + AlH
1 record matched H2Se + H· → H2 + SeH
1 record matched H2Se → H2 + Se
24 records matched H2S + H· → H2 + SH
2 records matched H2S → H2 + S
7 records matched GeH4 + H· → H2 + GeH3
6 records matched GeH4 → H2 + :GeH2
1 record matched H2O + H2Si=O → H2 + HSi(O)OH
1 record matched H2O + SiH2 → H2 + HSiOH
1 record matched H2O + SiH2 → H2 + H2Si=O
2 records matched H2O + BF → H2 + OBF
4 records matched H2O + H· → H2 + ·OH
1 record matched H2O2 + SiH3 → H2 + ·OH + H2Si=O
4 records matched H2O2 + H· → H2 + HO2
11 records matched NH3 + H· → H2 + NH2
2 records matched NH3 → H2 + NH
2 records matched HF + H· → H2 + ·F
13 records matched HCl + H· → H2 + ·Cl
1 record matched 1H-Indene, 2,3,4,7-tetrahydro- → 2,3-Dihydroindene + H2
1 record matched CH2=CHSiH3 → H2 + CH2=CHSiH
1 record matched CD3NH2 + H· → H2 + CD3NH·
1 record matched SiH2Cl2 → H2 + SiCl2
1 record matched ·CH + H· → H2 + C
7 records matched HO2 + H· → H2 + O2
1 record matched HO2 + H· → O2(1DELTA) + H2
1 record matched HO2 + HO2 → H2 + O2 + O2
3 records matched HO2 + HO2 → Other Products + H2
2 records matched CH3CO + H· → H2C=C=O + H2
1 record matched CH3OOH + H· → H2 + CH2OOH
1 record matched CH3OOH + H· → H2 + CH3O2·
1 record matched CH2C≡CH → H2 + CCCH
2 records matched C2H5SiH3 + H· → Other Products + H2
2 records matched C2H5SiH3 → H2 + C2H5SiH
1 record matched C2H3 + CH2=CHCH=CH· → Benzene + H2
5 records matched C2H3 + H· → C2H2 + H2
1 record matched Cyclohexane-1,1,2,2,3,3-d6 + H· → Other Products + H2
10 records matched HCO + H· → CO + H2
2 records matched HCO + HCO → CO + CO + H2
1 record matched (·)CH2OH + H· → CH2O + H2
2 records matched CH3CH(·)OH + H· → CH3CHO + H2
1 record matched C2F5CF2H + H· → H2 + n-C3F7
1 record matched ·CH3 + N → H2 + HNC
2 records matched ·CH3 + N → HCN + H2
5 records matched ·CH3 + O· → CO + H2 + H·
2 records matched ·CH3 + OD → H2 + CHDO
1 record matched ·CH3 + Ar → H2 + ·CH + Ar
1 record matched ·CH3 + Si → SiCH + H2
3 records matched ·CH3 + ·OH → H2 + HOCH
3 records matched ·CH3 + ·OH → CH2O + H2
5 records matched ·CH3 + ·CH3 → C2H4 + H2
5 records matched ·CH3 → H2 + ·CH
3 records matched CH3O· + H· → CH2O + H2
1 record matched 1-C3H7 + H· → CH3CH=CH2 + H2
1 record matched ·C2H + H· → H2 + C2
1 record matched ·C2H5 + H· → C2H4 + H2
1 record matched (E)-CH2=CHCH=CHCH3 → H2 + CH2=C=CHCH=CH2
1 record matched Furan, 2,5-dihydro-2-methyl- → 2-Methylfuran + H2
1 record matched 2,5-Dihydrofuran → Furan + H2
1 record matched (E)-CHF=CHF + H· → H2 + Ethenyl, 1,2-difluoro-, (E)-
1 record matched (Z)-CHF=CHF + H· → H2 + Ethenyl, 1,2-difluoro-, (Z)-
1 record matched tert-C4H9 + H· → iso-C4H8 + H2
4 records matched Si2H6 + H· → H2 + Si2H5
5 records matched Si2H6 → H2 + H3SiSiH
1 record matched (Z)-CH2=CHCH=CHCH3 → H2 + CH2=C=CHCH=CH2
2 records matched CH3GeH3 + H· → Other Products + H2
1 record matched CH3GeH3 → H2 + CH3GeH
4 records matched (CH3)2GeH2: + H· → Other Products + H2
3 records matched (CH3)3GeH + H· → Other Products + H2
1 record matched H2 + H2Fe(CO)3 → H4Fe(CO)3
1 record matched H2 + Rhodium carbonyl (5-2,4-cyclopentadien-1-yl)- → Adduct
1 record matched H2 + Fe(CO)3(C2H4) → H2Fe(CO)3(CH2=CH2)
1 record matched H2 + CH3CH=C(·)CH3 → (Z)-2-C4H8 + H·
1 record matched H2 + :SiD2 → Products
1 record matched H2 + CCCN → HCCCN + H·
4 records matched H2 + ·CH2 → ·CH3 + H·
1 record matched H2 + Cr(CO)4 → Cr(CO)4H2
1 record matched H2 + Fe(CO)3 → H2Fe(CO)3
1 record matched H2 + HCCO → Products
1 record matched H2 + CD≡C· → HC≡CD + H·
1 record matched H2 + CBrF2 → CHBrF2 + H·
1 record matched H2 + Cr(CO)5 → Cr(CO)5H2
1 record matched H2 + Na2 → Products
16 records matched H2 + ·Cl → HCl + H·
1 record matched H2 + ·Cl → Products
3 records matched H2 + NCO → HN=C=O + H·
1 record matched H2 + NCO → Products
1 record matched H2 + (CH3)3SiCH2 → (CH3)4Si + H·
3 records matched H2 + N → NH2
2 records matched H2 + N → H· + NH
53 records matched H2 + O· → ·OH + H·
1 record matched H2 + O· → Products
14 records matched H2 + D → H· + HD
1 record matched H2 + H2C=N → Products
1 record matched H2 + Fe(CO)4 → Fe(CO)4H2
1 record matched H2 + ·CH2C(CH3)=CH2 → iso-C4H8 + H·
1 record matched H2 + ClO → HOCl + H·
2 records matched H2 + ClO → ·OH + HCl
33 records matched H2 + ·F → HF + H·
1 record matched H2 + AlO → Products
1 record matched H2 + I + I → HI + HI
5 records matched H2 + I → HI + H·
1 record matched H2 + HNO → H2O + NH
1 record matched H2 + AlH → Products
2 records matched H2 + SiF2 → Products
1 record matched H2 + SiHCl → SiH3Cl
7 records matched H2 + SiH2 → SiH4
1 record matched H2 + CD → Products
1 record matched H2 + SiH → SiH3
2 records matched H2 + NH → H· + NH2
1 record matched H2 + NH → Products
7 records matched H2 + NH2 → NH3 + H·
2 records matched H2 + BH → BH3
2 records matched H2 + OD → H· + HDO
1 record matched H2 + BO → H· + HBO
2 records matched H2 + NaO → NaOH + H·
1 record matched H2 + H· → H2 + H·
1 record matched H2 + Au2 → Au2H2
1 record matched H2 + Ag2 → Products
1 record matched H2 + C3 → Products
2 records matched H2 + C2O → Products
1 record matched H2 + C2 → ·C2H + H·
2 records matched H2 + C2 → Products
2 records matched H2 + OF → Products
1 record matched H2 + ·CHD2 → CH2D2 + H·
2 records matched H2 + NO2 → HNO2 + H·
2 records matched H2 + NO → H· + HNO
1 record matched H2 + Br· + Br· → HBr + HBr
8 records matched H2 + Br· → HBr + H·
1 record matched H2 + Br· → Products
1 record matched H2 + N2O → N2 + H2O
6 records matched H2 + O2 → ·OH + ·OH
2 records matched H2 + O2 → HO2 + H·
1 record matched H2 + F2 → HF + H· + ·F
1 record matched H2 + D2 → HD + HD
2 records matched H2 + Br2 → HBr + HBr
1 record matched H2 + P → Products
1 record matched H2 + H2O2 → H2 + ·OH + ·OH
3 records matched H2 + S → H· + SH
1 record matched H2 + DCl → HCl + HD
4 records matched H2 + I2 → HI + HI
1 record matched H2 + Cr → Products
3 records matched H2 + C → ·CH2
1 record matched H2 + C → ·CH + H·
2 records matched H2 + iso-C4H9 → iso-C4H10 + H·
1 record matched H2 + CBr → Products
1 record matched H2 + ·CCl → Products
1 record matched H2 + CF → Products
1 record matched H2 + NF2 → HF + HNF
1 record matched H2 + NF2 → Products
50 records matched H2 + ·OH → H2O + H·
4 records matched H2 + ·CH → H· + ·CH2
3 records matched H2 + ·CH → ·CH3
9 records matched H2 + ·CH → Products
4 records matched H2 + ·CCl3 → CHCl3 + H·
1 record matched H2 + ·CHF2 → CH2F2 + H·
4 records matched H2 + C2H3 → C2H4 + H·
1 record matched H2 + C2H3 → Products
1 record matched H2 + NCN → Products
1 record matched H2 + ·HCC≡N → Products
2 records matched H2 + Phenyl → Benzene + H·
2 records matched H2 + sec-C4H9 → 1-C4H10 + H·
7 records matched H2 + ·CF3 → CHF3 + H·
16 records matched H2 + ·CH3 → CH4 + H·
2 records matched H2 + ·CF2 → CH2F2
1 record matched H2 + ·CF2 → Products
1 record matched H2 + Benzyl → Toluene + H·
1 record matched H2 + 1-C3H7 → C3H8 + H·
13 records matched H2 + ·C2H → C2H2 + H·
2 records matched H2 + ·C2H → Products
1 record matched H2 + CD3 → CHD3 + H·
1 record matched H2 + ·CHCl → CH3Cl
9 records matched H2 + ·C2H5 → C2H6 + H·
1 record matched H2 + iso-C3H7 → C3H8 + H·
1 record matched H2 + FeO → Products
5 records matched H2 → H· + H·
1 record matched SrO + H2 → SrOH + H·
1 record matched CaO + H2 → CaOH + H·
1 record matched CaO + H2 → Ca + H2O
1 record matched BaO + H2 → BaOH + H·
2 records matched (CH3)2SiH2 + H· → H2 + (CH3)2SiH
5 records matched (CH3)2SiH2 + H· → Other Products + H2
1 record matched (CH3)2SiH2 → H2 + (CH3)2Si
2 records matched (CH3)3SiH + H· → H2 + (CH3)3Si·
4 records matched (CH3)3SiH + H· → Other Products + H2
2 records matched CH3SiH3 + H· → H2 + CH3SiH2
5 records matched CH3SiH3 + H· → Other Products + H2
2 records matched CH3SiH3 → H2 + (CH3)SiH
2 records matched CH3SiH3 → Other Products + H2
1 record matched (Z)-Cyclooctene + H· → Other Products + H2
1 record matched (CH3)3SiSiH(CH3)2 + H· → H2 + (CH3)3SiSi(·)(CH3)2
2 records matched (CH3)3SiSiH(CH3)2 + H· → Other Products + H2
1 record matched Phenylsilane + H· → Other Products + H2
1 record matched Phenylsilane → H2 + Silylene, phenyl-
1 record matched C6H5-CH=CHCH3 + H· → H2 + 3-Phenyl-2-propenyl
2 records matched (C2H5)4Si + H· → Other Products + H2
1 record matched CO + H2 + NO → Products
1 record matched (Z)-Cycloheptene + H· → Other Products + H2
3 records matched 1,4-Cyclohexadiene → Benzene + H2
1 record matched (E)-2-C4H8 + H· → H2 + ·CH2CH=CHCH3
3 records matched (C2H5)3SiH + H· → Other Products + H2
2 records matched (CH3)3CC(CH3)3 + H· → H2 + (CH3)3CC(CH3)2CH2
1 record matched 1,3-Cyclohexadiene + H· → H2 + Cyclohexadienyl
2 records matched 1,3-Cyclohexadiene → Benzene + H2
1 record matched 1,2-butadiene + H· → Other Products + H2
3 records matched (Z)-2-C4H8 + H· → H2 + ·CH2CH=CHCH3
3 records matched (Z)-2-C4H8 → 1,3-Butadiene + H2
2 records matched (C2H5)2SiH2 + H· → Other Products + H2
1 record matched CH3NH-NHCH3 → H2 + (E)-CH3N=NCH3
1 record matched Benzofuran, 2,3-dihydro → Benzofuran + H2
4 records matched neo-C5H12 + H· → H2 + Neopentyl
1 record matched CF3CHFCF3 + H· → H2 + (CF3)2CF
1 record matched (CH3CO)2 + H· → H2C=C=O + H2 + CH3CO
1 record matched C2HF3 + H· → H2 + CF2=CF
1 record matched COF2 + H2 → Products
8 records matched N2H4 + H· → H2 + NH2NH
3 records matched Cyclopentane + H· → H2 + Cyclopentyl
1 record matched 1-C7H16 + H· → Other Products + H2
1 record matched Cyclopentene + H· → Other Products + H2
7 records matched Cyclopentene → Cyclopentadiene + H2
1 record matched 1-C10H22 + H· → Other Products + H2
2 records matched C2H5CHO + H· → H2 + CH3CH2CO
1 record matched iso-C4H8 + H· → H2 + CH2=CHCH(·)CH3
1 record matched iso-C4H8 + H· → H2 + ·CH2C(CH3)=CH2
11 records matched (CH3)2O + H· → H2 + CH3OCH2·
3 records matched CH3CH=CH2 + O· → H2 + CH3CH=C=O
7 records matched CH3CH=CH2 + H· → H2 + ·CH2CH=CH2
1 record matched CH3CH=CH2 + Cl2 → 1-Propene, 3,3-dichloro- + H2
1 record matched CH3CH=CH2 + Cl2 → CH2ClCH=CHCl + H2
1 record matched CH3CH=CH2 + Y → H2 + Y(C3H4)
1 record matched CH3CH=CH2 + Y → Y(C3H2) + H2 + H2
1 record matched CH3CH=CH2 → CH2=C=CH2 + H2
2 records matched n-C8H18 + H· → Other Products + H2
1 record matched (n-C3H7)2O + ·OH → Other Products + H2
1 record matched Cyclohexene + H· → Other Products + H2
1 record matched Cyclohexene → 1,3-Cyclohexadiene + H2
5 records matched Cyclohexane + H· → H2 + Cyclohexyl
1 record matched 1-C6H14 + H· → Other Products + H2
2 records matched n-C4H9SH + H· → H2 + n-C4H9S
2 records matched 1-C5H10 + H· → Other Products + H2
1 record matched n-C5H12 + H· → H2 + (CH3CH2)2CH
1 record matched n-C5H12 + H· → H2 + 1-C5H11
1 record matched n-C5H12 + H· → H2 + CH3CH2CH2CH(·)CH3
1 record matched n-C5H12 + H· → Other Products + H2
1 record matched 2-Methylpyridine + H· → H2 + Methyl, 2-pyridinyl-
2 records matched Phenol + H· → H2 + C6H5O
1 record matched Chlorobenzene + H2 → Products
5 records matched Toluene + H· → H2 + Benzyl
1 record matched Methylcyclohexane + H· → Other Products + H2
1 record matched 1,3,5-Trimethylbenzene + H· → H2 + 3,5-dimethylbenzyl radical
1 record matched (CH3)2CH(CH2)2CH3 + H· → Other Products + H2
1 record matched HC(O)OCH3 + H· → H2 + CH3OC(·)(O)
2 records matched (CHO)2 + H· → CO + H2 + HCO
1 record matched CH2CHCN + H· → (·)CH=CH-C#N + H2
1 record matched CH2CHCN → HCCCN + H2
1 record matched C2H5CN + H· → H2 + N=C-CH2CH2
3 records matched C2H5CN → CH2CHCN + H2
1 record matched n-C3H7SH + H· → H2 + CH3CH2CH2
1 record matched CH3CH=CHCH3 + H· → H2 + ·CH2CH=CHCH3
1 record matched 1,3-Butadiene + H· → H2 + CH2=CHCH=CH·
1 record matched 1-C4H8 + O· → H2 + C2H5CH=C=O
1 record matched 1-C4H8 + H· → H2 + ·CH2CH=CHCH3
2 records matched 1-C4H8 + H· → Other Products + H2
6 records matched 1-C4H10 + H· → H2 + 1-C4H9
6 records matched 1-C4H10 + H· → H2 + sec-C4H9
10 records matched 1-C4H10 + H· → Other Products + H2
1 record matched 1,4-Dimethylbenzene + H· → H2 + 4-Methylbenzyl
1 record matched Ethylbenzene + H· → H2 + 2-phenylethyl
2 records matched Ethylbenzene + H· → H2 + 1-phenylethyl
1 record matched Ethylbenzene → Styrene + H2
1 record matched (C2H5)2CO + H· → H2 + CH3CH2C(O)CH(·)CH3
1 record matched (CH3)2CHCH(CH3)2 + H· → Other Products + H2
1 record matched CH3C(O)OCH3 + H· → H2 + CH3C(O)OCH2·
1 record matched C2HCl3 + H· → H2 + CCl2=CCl
1 record matched C2H5COCH3 + H· → H2 + CH3C(O)CH(·)CH3
1 record matched iso-C5H12 + H· → H2 + ·CH2CH(CH3)CH2CH3
1 record matched iso-C5H12 + H· → H2 + (CH3)2C(·)CH2CH3
1 record matched iso-C5H12 + H· → H2 + (CH3)2CHCH(·)CH3
1 record matched iso-C5H12 + H· → H2 + (CH3)2CHCH2CH2·
2 records matched iso-C5H12 + H· → Other Products + H2
1 record matched (CH3)3CCH2CH3 + H· → Other Products + H2
1 record matched (CH3)4Si + H· → H2 + (CH3)3SiCH2
1 record matched tert-C4H9SH + H· → H2 + (CH3)3CS·
1 record matched tert-C4H9OH + H· → H2 + (CH3)2C(OH)CH2·
1 record matched CF3Br + H2 → Products
1 record matched (CH3)3N + H· → Other Products + H2
2 records matched CHF3 + H· → H2 + ·CF3
1 record matched CH2=CF2 + H· → H2 + CF2=CH·
1 record matched iso-C3H7SH + H· → H2 + (CH3)2CHS
2 records matched iso-C4H10 + H· → H2 + iso-C4H9
4 records matched iso-C4H10 + H· → H2 + tert-C4H9
9 records matched iso-C4H10 + H· → Other Products + H2
1 record matched CHBrCl2 + H· → H2 + BrCCl2
1 record matched Oxirane + H· → H2 + Oxiranyl
1 record matched Cyclopropane + H· → H2 + Cyclopropyl
1 record matched Cyclopropane + H· → H2 + ·CH2CH=CH2
2 records matched HN=C=O + H· → H2 + NCO
1 record matched CH2F2 → H2 + ·CF2
2 records matched C2H5SH + H· → H2 + CH3CH2S
1 record matched CH3CHO + N → HCN + H2 + HCO
1 record matched CH3CHO + H· → H2 + CH3CO
2 records matched CH3CHO + H· → H2 + CH2=CHO·
6 records matched CH3CHO + H· → H2 + CH3CO
2 records matched CH3CHO + H· → CO + H2 + ·CH3
2 records matched CH3CHO → H2C=C=O + H2
1 record matched CH2=CHF + H· → Other Products + H2
1 record matched CH3CCH + O· → C2H2 + CO + H2
1 record matched CH3CCH + H· → H2 + CH2=C=CH
8 records matched C3H8 + H· → H2 + 1-C3H7
4 records matched C3H8 + H· → H2 + iso-C3H7
23 records matched C3H8 + H· → Other Products + H2
7 records matched CH3SH + H· → H2 + CH3
1 record matched CH3NH2 + H· → Other Products + H2
1 record matched C2H2 + CD≡C· → C4D unspecified structure + H2
3 records matched C2H2 + H· → H2 + ·C2H
1 record matched C2H2 + C → H2 + C3
1 record matched C2H2 + ·OH → H2 + HCCO
1 record matched C2H2 → H2 + C2
3 records matched C2H4 + O· → H2C=C=O + H2
12 records matched C2H4 + H· → H2 + C2H3
1 record matched C2H4 + Y → H2 + Y(C2H2)
4 records matched C2H4 + H2 → C2H6
1 record matched C2H4 + C2H4 → 1,3-Butadiene + H2
11 records matched C2H4 → C2H2 + H2
24 records matched C2H6 + H· → H2 + ·C2H5
2 records matched C2H6 + C2H4 → 1-C4H8 + H2
5 records matched C2H6 → C2H4 + H2
4 records matched CH4 + N → HCN + H2 + H·
29 records matched CH4 + H· → H2 + ·CH3
1 record matched CH4 + Si → H2 + SiCH2
2 records matched Benzene + H· → H2 + Phenyl
3 records matched Benzene + Benzene → Biphenyl + H2
1 record matched Benzene → C2H2 + 1,3-Butadiyne + H2
1 record matched n-C4H9OH + H· → H2 + HOCH2CH2CH2CH2
1 record matched n-C3H7OH + H· → H2 + HOCH2CH2CH2·
5 records matched Acetone + H· → H2 + CH3C(O)CH2(·)
1 record matched iso-C3H7OH + H· → H2 + (CH3)2C(OH)
1 record matched iso-C3H7OH → Acetone + H2
6 records matched CH3OH + H· → H2 + (·)CH2OH
1 record matched CH3OH → Other Products + H2
7 records matched HCOOH → CO2 + H2
4 records matched C2H5OH + H· → H2 + CH3CH(·)OH
2 records matched aniline + H· → H2 + Phenyl amidogen
1 record matched CH3NHNH2 → H2 + CH3N=NH
1 record matched (C2H5)2O + H· → H2 + 2-C4H9O
19 records matched CN + H2 → HCN + H·
19 records matched CH2O + H· → H2 + HCO
1 record matched CH2O + Ar → CO + H2 + Ar
1 record matched CH2O + H2 → Products
11 records matched CH2O → CO + H2
1 record matched O(1D) + H2O → H2 + O2
19 records matched O(1D) + H2 → ·OH + H·
1 record matched O(1D) + H2 → H2 + O·
1 record matched O(1D) + H2 → Products
1 record matched O(1D) + CH3F → H2 + HFCO
1 record matched O(1D) + C2H6 → CH2=CHOH + H2
1 record matched O(1D) + CH4 → CH2O + H2
4 records matched O2(1DELTA) + H2 → H2 + O2
2 records matched AlH2Cl → H2 + AlCl
1 record matched CF (A 2Sigma+, v=1) + H2 → H2 + CF
1 record matched CF (A 2Sigma+, v=0) + H2 → H2 + CF
1 record matched CH3CH2CH2CHO → H2 + C2H5CH=C=O
1 record matched M + ·CH3 → M + H2 + ·CH
1 record matched N(2S) + H2 → Products
2 records matched O(1D) + H2 → ·OH + H·
2 records matched O(1D) + H2 → O(3P) + H2
1 record matched O2(1Delta_g) + H2 → O2(X3Sigma_g-) + H2
1 record matched N2(a prime 1sigma u) + H2 → Products
1 record matched H2(v) + H· → H2 + H·
2 records matched S(1D) + H2 → H· + SH
2 records matched S(1D) + C2H4 → H2 + CH2=C=S
1 record matched Rb(5D 3/2) + H2 → H· + RbH
1 record matched Rb(5D 5/2) + H2 → H· + RbH
1 record matched Xe(5d) + H2 → H2 + Xe
1 record matched Zr (4d2_5s2,3F) + CH3CH=CH2 → C3H4Zr + H2
1 record matched Zr (4d2_5s2,3F) + C2H4 → C2H2Zr + H2
2 records matched CH2(1) + H2 → ·CH3 + H·
1 record matched CF2-trip + H2 → Products
1 record matched CH_2(aA_1) + H2 → Products
1 record matched O2(b1Sigma_g+) + H2 → Products
1 record matched C2(a3PIu) + H2 → Products
1 record matched 5,5'-Bicyclopentadienyl → Naphthalene + H2
1 record matched PtH2 → H2 + Pt
2 records matched SiH2Cl → H2 + SiCl
1 record matched HSi(O)OH → H2 + SiO2
1 record matched HSi(O)OH → cy-SiO2 + H2
1 record matched H3SiSiH → H2 + Si(H2)Si
8 records matched H3SiSiH → H2 + SiSiH2
1 record matched H3P=S → H2 + HP=S
1 record matched Al2H2(CH3)4 → H2 + Al2(CH3)4
1 record matched CH2=C(OH)CH3 → H2 + Cyclopropanone
1 record matched CH2=C(OH)CH3 → c-CH2C(OH)=CH + H2
1 record matched CH3CH2N(.) → CH3CN + H2 + N2
2 records matched :GeH2 → H2 + Ge
1 record matched CH3CH=NH → CH3CN + H2
1 record matched SiHCl2SiH2Cl → Other Products + H2
1 record matched H3Si-SiHCl2 → Other Products + H2
1 record matched CH3SiHCl2 → H2 + CH2=SiCl2
1 record matched HOCH → CO + CO + H2
1 record matched HC-N=O + ·OH → CO + H2 + NO
1 record matched CH3OCH2· + O· → H2 + CH3OC(·)(O)
1 record matched SiH2=SiH2 → H2 + Si(H2)Si
1 record matched SiH2=SiH2 → H2 + SiSiH2
1 record matched SiH2=SiH2 → H2 + HSi=SiH
1 record matched InH3 → H2 + InH
1 record matched 2-Silyltetrasilane → SiH3Si(:)SiH(SiH3)2 + H2
1 record matched Pentasilane → SiH3SiH2Si(:)SiH2SiH3 + H2
1 record matched Pentasilane → SiH3SiH2SiH2SiH2SiH: + H2
1 record matched BH2NH2 → H2 + HBNH
1 record matched NiH2 → H2 + Ni
1 record matched Si2H5Cl → Other Products + H2
3 records matched SiH2 + SiH2 → H2 + HSi=SiH
2 records matched SiH2 → Si(1D) + H2
2 records matched BH3NH3 → H2 + BH2NH2
1 record matched NH2 + NH2 → H2 + H2N≡N
1 record matched NH2 + NH2 → H2 + HN=NH
3 records matched SiH3 + SiH → H2 + HSi=SiH
3 records matched SiH3 → H2 + SiH
1 record matched SiH3I → H2 + SiHI
1 record matched GaH3 → H2 + GaH
6 records matched SiH3Cl → H2 + SiHCl
1 record matched SiH3Br → H2 + SiHBr
1 record matched BH3 + BH3NH3 → H2 + BH3 + BH2NH2
1 record matched BH3 → H2 + BH
1 record matched c-Si3H6 → cyclo-SiH2SiH2Si(:) + H2
1 record matched H· + 1,3-Cyclopentadiene, 5-ethynyl- → fulvallenyl + H2
1 record matched H· + SiHCl2 → H2 + SiCl2
2 records matched H· + ·CH2 → H2 + ·CH
1 record matched H· + 1,3-Cyclopentadiene, 5-ethenylidene- → fulvallenyl + H2
1 record matched H· + 2,4-Cyclohexadienone → H2 + C6H5O
1 record matched H· + CH2=C=C=CH· → H2 + 1,2,3-butatrienylidene
1 record matched H· + CH2=C=C=CH· → 1,3-Butadiyne + H2
1 record matched H· + Beryllium hydroxide → BeO + H2
1 record matched H· + AlOH → H2 + AlO
1 record matched H· + HBO → H2 + BO
1 record matched H· + C2H5CH=C=O → ·CH2CH2CHCO + H2
1 record matched H· + C2H5CH=C=O → CH3CH(·)CHCO + H2
1 record matched H· + CH3CH=CHC(O)OCH3 → CH3CH=CHC(O)OCH2· + H2
1 record matched H· + CH3CH=CHC(O)OCH3 → CH3CH=C(·)C(O)OCH3 + H2
1 record matched H· + CH3CH=CHC(O)OCH3 → CH3C(·)=CHC(O)OCH3 + H2
1 record matched H· + CH3CH=CHC(O)OCH3 → ·CH2CH=CHC(O)OCH3 + H2
1 record matched H· + 2,3,4-Trichlorophenol → 2,3,4-trichlorophenoxy radical + H2
1 record matched H· + (E)-HN=NH → H2 + HN=N
1 record matched H· + GeH2Cl2 → GeHCl2 + H2
1 record matched H· + HSS → H2 + S2
1 record matched H· + AlH2 → H2 + AlH
4 records matched H· + HNO → H2 + NO
1 record matched H· + HIO → H2 + IO
2 records matched H· + HOPO → H2 + PO2
3 records matched H· + HD → H2 + D
1 record matched H· + AlH → H2 + Al
1 record matched H· + NHOH → H2 + HNO
1 record matched H· + SH → H2 + S
1 record matched H· + SiHCl → H2 + SiCl
3 records matched H· + SiH2 → H2 + SiH
1 record matched H· + SiH2F2 → H2 + HF2Si
6 records matched H· + Ge2H6 → Ge2H5 + H2
4 records matched H· + SiH → H2 + Si
1 record matched H· + SiH → Si(1D) + H2
1 record matched H· + NH → H2 + N
2 records matched H· + NH → N(4S) + H2
1 record matched H· + BH → H2 + B
2 records matched H· + SiH3 → H2 + SiH2
1 record matched H· + SiH33SiH2 + H2
1 record matched H· + GeH3Cl → H2 + GeH2Cl
1 record matched H· + SiH3F → H2 + SiH2F
1 record matched H· + HOBr → H2 + BrO
1 record matched H· + AlHCl2 → H2 + AlCl2
1 record matched H· + SiH3Cl → H2 + SiH2Cl
1 record matched H· + SiHF3 → H2 + SiF3
1 record matched H· + H2S2 → H2 + HSS
1 record matched H· + (E)-3-C6H12 → CH3CH2CH=CHCH2CH2· + H2
1 record matched H· + (E)-3-C6H12 → CH3CH2CH=CHCH(·)CH3 + H2
1 record matched H· + (E)-3-C6H12 → CH3CH2CH=C(·)CH2CH3 + H2
5 records matched H· + H· → H2
1 record matched SrOH + H· → SrO + H2
1 record matched BaOH + H· → BaO + H2
1 record matched C6H5CH2C2H + H· → 2-propargylphenyl + H2
1 record matched HBr + BH3NH3 → H2 + HBr + BH2NH2
7 records matched HBr + H· → H2 + Br·
1 record matched HI + H· → H2 + I
2 records matched SiHCl3 + H· → H2 + SiCl3
1 record matched SiH4 + Diborane(6) → B2SiH8 + H2
13 records matched SiH4 + H· → H2 + SiH3
14 records matched SiH4 → H2 + SiH2
23 records matched PH3 + H· → H2 + PH2
1 record matched HOCl + H· → H2 + ClO
1 record matched AlH3 + H· → H2 + AlH2
2 records matched AlH3 → H2 + AlH
2 records matched Si3H8 + H· → SiH3SiH2SiH2· + H2
2 records matched Si3H8 + H· → SiH3Si(·)HSiH3 + H2
2 records matched Si3H8 → SiH3SiH2SiH: + H2
1 record matched Si3H8 → SiH3SiH=SiH2 + H2
2 records matched Si3H8 → SiH3Si(:)SiH3 + H2
1 record matched H2Se + BH3NH3 → H2 + H2Se + BH2NH2
1 record matched H2S + BH3NH3 → H2 + H2S + BH2NH2
1 record matched H2S + NH2 → H2NS· + H2
10 records matched H2S + H· → H2 + SH
1 record matched HNO2 + H· → H2 + NO2
11 records matched GeH4 + H· → H2 + GeH3
4 records matched GeH4 → H2 + :GeH2
2 records matched O2 + ·CH2 → CO2 + H2
1 record matched O2 + ·CH2 → O(1D) + CO + H2
1 record matched H2O + O· → H2 + O2
1 record matched H2O + BH3NH3 → H2 + H2O + BH2NH2
4 records matched H2O + H· → H2 + ·OH
1 record matched H2O + C2 → H2 + c-COC
1 record matched H2O + C2 → H2 + C2O
1 record matched H2O + SiH4 → H2 + SiH3OH
1 record matched N2 + NHOH → H2 + N2 + NO
8 records matched H2O2 + H· → H2 + HO2
1 record matched HNO3 + H· → H2 + NO3
1 record matched NH3 + BH3NH3 → H2 + NH3 + BH2NH2
10 records matched NH3 + H· → H2 + NH2
1 record matched NH3 + SiH4 → H2 + H2N-SiH3
1 record matched HF + BH3NH3 → H2 + HF + BH2NH2
1 record matched HF + H· → H2 + ·F
1 record matched HCl + SiHCl2 → H2 + SiCl3
1 record matched HCl + SiHCl → H2 + SiCl2
1 record matched HCl + SiH2 → H2 + SiHCl
1 record matched HCl + SiH → H2 + SiCl
1 record matched HCl + BH3NH3 → H2 + HCl + BH2NH2
3 records matched HCl + H· → H2 + ·Cl
2 records matched HCl + SiHCl3 → H2 + SiCl4
1 record matched Sodium hydride + H· → H2 + Na
1 record matched HOClO3 + H· → ClO4 + H2
1 record matched LiH + H· → H2 + Li
1 record matched Si + ·CH2 → SiC + H2
6 records matched Si + SiH4 → H2 + SiSiH2
1 record matched Al + H2O → H2 + AlO
1 record matched 2,3,4,5-Tetrachlorophenol + H· → 2,3,4,5-tetrachlorophenoxy radical + H2
1 record matched CH3CH=CHCN → H2 + CH3CCCN
1 record matched CH2DOH + H· → H2 + CHDOH
1 record matched CH2DOH + H· → CH2DO + H2
2 records matched SiH2Cl2 + H· → H2 + SiHCl2
1 record matched SiH2Cl2 + NH3 → SiHCl2NH2 + H2
2 records matched SiH2Cl2 + HCl → H2 + SiHCl3
7 records matched SiH2Cl2 → H2 + SiCl2
1 record matched Methylenecyclopropene → H2 + 1,2,3-butatrienylidene
1 record matched Methylenecyclopropene → 1,3-Butadiyne + H2
1 record matched (E)-2-C6H12 + H· → CH3CH=CHCH(·)CH2CH3 + H2
1 record matched (E)-2-C6H12 + H· → trans-CH3CH=CHCH2CH2CH2· + H2
1 record matched (E)-2-C6H12 + H· → trans-CH3CH=CHCH2CH(·)CH3 + H2
1 record matched (E)-2-C6H12 + H· → CH3CH2CH2CH=CHCH2· + H2
1 record matched (E)-2-C6H12 + H· → CH3CH2CH2CH=C(·)CH3 + H2
1 record matched (E)-2-C6H12 + H· → CH3CH2CH2C(·)=CHCH3 + H2
2 records matched ·CH2F → H2 + CF
1 record matched CH2=CHCH2C(O)OCH3 + H· → CH2=CHCH2C(O)OCH2· + H2
1 record matched CH2=CHCH2C(O)OCH3 + H· → CH2=CHCH(·)C(O)OCH3 + H2
1 record matched CH2=CHCH2C(O)OCH3 + H· → CH2=C(·)CH2C(O)OCH3 + H2
1 record matched CH2=CHCH2C(O)OCH3 + H· → ·CH=CHCH2C(O)OCH3 + H2
1 record matched HN=NH + H· → H2 + HN=N
1 record matched ·OH + HOCH → CO2 + H2 + H·
2 records matched ·OH + NH2 → H2 + :NOH
2 records matched ·OH + NH2 → H2 + HNO
1 record matched ·OH + NH2 → (3)HON + H2
1 record matched ·OH + NH2 → (3)HNO + H2
1 record matched ·OH + ·CH2Cl → H2 + HC(O)Cl
2 records matched ·OH + ·OH → H2 + O2
4 records matched ·CH + H· → H2 + C
7 records matched HO2 + H· → H2 + O2
2 records matched HO2 + H· → O2(1DELTA) + H2
2 records matched HO2 + H· → O2(1Delta_g) + H2
1 record matched HO2 + H· → O2(3Delta_u) + H2
1 record matched CH3CH2OOH → H2 + CH3CH(·)OO·
1 record matched CH2C≡CH → C3H + H2
1 record matched CH2=C=C=CH2 → H2 + 1,2,3-butatrienylidene
1 record matched CH2=C=C=CH2 → 1,3-Butadiyne + H2
1 record matched C2H5SiH3 + H· → H2 + C2H5SiH2(·)
1 record matched C2H5SiH3 + H· → H2 + SiH3CH2CH2(·)
1 record matched C2H5SiH3 + H· → Other Products + H2
1 record matched C2H5SiH3 + H· → SiH3CH(·)CH3 + H2
1 record matched ·CHF2 + H· → H2 + ·CF2
2 records matched C2H3 + H· → C2H2 + H2
2 records matched C2H3 + ·OH → H2C=C=O + H2
1 record matched ·HCC≡N + H· → H2 + CC≡N
3 records matched HCO + NHOH → CO + H2 + HNO
3 records matched HCO + H· → CO + H2
2 records matched HC(O)Cl + H· → H2 + ClCO
1 record matched HOC(·)O → CO + H2
1 record matched CH3CH(·)OH + H· → CH2=CHOH + H2
3 records matched CH3CH(·)OH + H· → CH3CHO + H2
1 record matched Benzene, 1,2-propadienyl- + H· → 2-C6H4CHCCH2 + H2
1 record matched C2F5CF2H + H· → H2 + n-C3F7
1 record matched ·CH3 + O· → H2 + HCO
1 record matched ·CH3 + O· → CO + H2 + H·
1 record matched ·CH3 + ·F → H2 + ·CHF
2 records matched ·CH3 + H· → H2 + ·CH2
2 records matched ·CH3 + ·OH → CH2O + H2
2 records matched ·CH3 + ·OH → trans-HCOH + H2
2 records matched ·CH3 + ·OH → cis-HCOH + H2
1 record matched HC≡CD + H· → H2 + CD≡C·
2 records matched CH3CH2O· + H· → CH3CHO + H2
1 record matched CH3O· + H· → CH2O + H2
1 record matched Cyclopentadienyl + ·CH3 → Fulvene + H2
2 records matched ·C2H + H· → H2 + C2
1 record matched ·C2H + H· → H2 + C2H3
1 record matched ·C2H + HO2 → CO + CO + H2
1 record matched CD3 + O· → CO + H2 + H·
2 records matched ·C2H5 + H· → C2H4 + H2
1 record matched Phenyl formate + H· → C6H5OC(=O)· + H2
1 record matched Phenyl formate + H· → 2-Formyloxy phenyl + H2
1 record matched Phenyl formate + H· → 3-Formyloxy phenyl + H2
1 record matched Phenyl formate + H· → 4-Formyloxy phenyl + H2
1 record matched 1-C8H17C(O)OCH3 + H· → CH3CH2CH2CH2CH2CH2CH2CH2C(O)OCH2· + H2
1 record matched 2,5-Dihydrothiophene → Thiophene + H2
1 record matched Furan, 2,5-dihydro-2-methyl- → 2-Methylfuran + H2
2 records matched 2,5-Dihydrofuran → Furan + H2
1 record matched Si2H6 + H· → H2 + Si2H5
3 records matched Si2H6 → H2 + H3SiSiH
3 records matched Si2H6 → H2 + SiH2=SiH2
1 record matched 1,3-Butadienylbenzene + H· → trans-(·)CH=CH-CH=CH-C6H5 + H2
1 record matched 1,3-Butadienylbenzene + H· → phenyl, (E)-2-(buta-1,3-dien-1-yl) + H2
1 record matched CH3OD + H· → H2 + CH2OD
1 record matched CH3GeH3 + H· → H2 + GeH3CH2*
2 records matched CH3GeH3 + H· → H2 + *GeH2CH3
2 records matched (CH3)2GeH2: + H· → H2 + *GeH(CH3)2
1 record matched (CH3)2GeH2: + H· → GeH2(CH3)CH2* + H2
1 record matched (CH3)3GeH + H· → H2 + GeH(CH3)2CH2*
1 record matched (CH3)3GeH + H· → H2 + (CH3)3Ge
2 records matched H2 + CH2=CHCH=CH· → 1,3-Butadiene + H·
1 record matched H2 + CH3SSCH2 → (CH3S)2 + H·
1 record matched H2 + CH2=SiCl2 → CH3SiHCl2
1 record matched H2 + CH3SiCl → Silane, chloromethyl-
1 record matched H2 + SiHCl2 → SiH2Cl2 + H·
2 records matched H2 + ·CH2 → ·CH3 + H·
2 records matched H2 + H3SiSiH → Si2H6
1 record matched H2 + CH2=Al(CH3) → AlH(CH3)2
3 records matched H2 + CD≡C· → HC≡CD + H·
1 record matched H2 + Silyl, dichloromethyl- → Silane, dichloromethyl- + H·
4 records matched H2 + HSi=SiH → SiH2=SiH2
1 record matched H2 + SiHI → HI + SiH2
1 record matched H2 + HC=S → H2CS + H·
13 records matched H2 + ·Cl → HCl + H·
2 records matched H2 + NCO → HN=C=O + H·
1 record matched H2 + Cl3SiCH2· → CH3SiCl3 + H·
1 record matched H2 + SiCl3 → SiHCl3 + H·
1 record matched H2 + SiCl3 → HCl + SiHCl2
1 record matched H2 + N → H· + NH
10 records matched H2 + O· → ·OH + H·
9 records matched H2 + D → H· + HD
1 record matched H2 + AlCl2 → H· + AlHCl2
1 record matched H2 + CH3CHCl → C2H5Cl + H·
1 record matched H2 + ND2 → Other Products + H·
12 records matched H2 + ·F → HF + H·
1 record matched H2 + IO → H· + HIO
1 record matched H2 + I → HI + H·
1 record matched H2 + AlH → AlH3
1 record matched H2 + AlH → H2 + AlH
2 records matched H2 + SiCl → SiH2Cl
1 record matched H2 + SiCl → H· + SiHCl
1 record matched H2 + SiCl → HCl + SiH
1 record matched H2 + SH → H2S + H·
2 records matched H2 + SiHCl → SiH3Cl
6 records matched H2 + SiH2 → SiH4
3 records matched H2 + SiH → SiH3
1 record matched H2 + NH → H· + NH2
5 records matched H2 + NH2 → NH3 + H·
1 record matched H2 + O=BB=O → Products
7 records matched H2 + GeH3 → GeH4 + H·
4 records matched H2 + SiH3 → SiH4 + H·
1 record matched H2 + OD → H· + HDO
1 record matched H2 + SiCl2 → H· + SiHCl2
1 record matched H2 + SiCl2 → HCl + SiHCl
4 records matched H2 + SiCl2 → SiH2Cl2
1 record matched H2 + ·CHF → ·CH2F + H·
3 records matched H2 + BO → H· + HBO
8 records matched H2 + H· → H2 + H·
1 record matched H2 + H· → Products
2 records matched H2 + C2 → ·C2H + H·
1 record matched H2 + 2-Naphthalenyl → Naphthalene + H·
2 records matched H2 + NO2 → HNO2 + H·
2 records matched H2 + NO2 → H2O + NO
1 record matched H2 + NO2 → cis-HONO + H·
1 record matched H2 + NO2 → trans-HONO + H·
1 record matched H2 + NO → Products
2 records matched H2 + Br· → HBr + H·
1 record matched H2 + SiCl4 → HCl + SiHCl3
1 record matched H2 + SiHCl3 → SiH2Cl2 + HCl
1 record matched H2 + N2O → N2 + H2O
1 record matched H2 + O2 + O2 → HO2 + O2 + H·
1 record matched H2 + O2 + O2 → HO2 + HO2
1 record matched H2 + O2 → H2O + O·
2 records matched H2 + O2 → ·OH + ·OH
5 records matched H2 + O2 → HO2 + H·
1 record matched H2 + O2 → Products
2 records matched H2 + Br2 → HBr + HBr
2 records matched H2 + S → H· + SH
1 record matched H2 + SO2 → H· + HSO2
1 record matched H2 + Cs → H· + CsH
1 record matched H2 + C → ·CH2
1 record matched H2 + C → ·CH + H·
1 record matched H2 + K → KH + H·
1 record matched H2 + CD3O → CD3OH + H·
1 record matched H2 + CH2=CHO· → CH2=CHOH + H·
1 record matched H2 + ·CH2Cl → CH3Cl + H·
1 record matched H2 + ·CH2F → CH3F + H·
1 record matched H2 + CHCl2 → CH2Cl2 + H·
24 records matched H2 + ·OH → H2O + H·
2 records matched H2 + ·CH → H· + ·CH2
1 record matched H2 + ·CH → ·CH3
3 records matched H2 + HO2 → H2O2 + H·
1 record matched H2 + ·CCl3 → CHCl3 + H·
1 record matched H2 + ·CHF2 → CH2F2 + H·
19 records matched H2 + C2H3 → C2H4 + H·
1 record matched H2 + (·)CH2OH → CH3OH + H·
2 records matched H2 + 1-Naphthalenyl → Naphthalene + H·
3 records matched H2 + Phenyl → Benzene + H·
1 record matched H2 + Phenyl amidogen → aniline + H·
3 records matched H2 + ·CF3 → CHF3 + H·
16 records matched H2 + ·CH3 → CH4 + H·
2 records matched H2 + ·CF2 → HF + ·CHF
1 record matched H2 + Benzyl → Toluene + H·
1 record matched H2 + CH2=C → C2H3 + H·
1 record matched H2 + CH2=C → C2H4
2 records matched H2 + CH3O· → CH3OH + H·
1 record matched H2 + 1-C3H7 → C3H8 + H·
23 records matched H2 + ·C2H → C2H2 + H·
2 records matched H2 + CD3 → CHD3 + H·
6 records matched H2 + ·C2H5 → C2H6 + H·
1 record matched H2 + ·CH2CH=CH2 → CH3CH=CH2 + H·
1 record matched H2 + tert-C4H9 → iso-C4H10 + H·
1 record matched H2 + FeO + N2 → N2H2FeO
2 records matched H2 → H· + H·
1 record matched NiO + H2 → Ni + H2O
1 record matched NaOH + H· → H2 + NaO
1 record matched BeO + H2 + N2 → N2H2BeO
1 record matched Furan, 2,3-dihydro- → Furan + H2
1 record matched 1,3-Cyclobutadiene → H2 + 1,2,3-butatrienylidene
1 record matched 1,3-Cyclobutadiene → 1,3-Butadiyne + H2
1 record matched 2,5-Dimethyltetrahydrofuran + H· → tetrahydro-2,5-dimethyl-2-furanyl + H2
1 record matched 2,5-Dimethyltetrahydrofuran + H· → tetrahydro-2,5-dimethyl-3-furanyl + H2
1 record matched 2,5-Dimethyltetrahydrofuran + H· → tetrahydro-5-methyl-2-furanylmethyl + H2
1 record matched Silane, chloromethyl- → H2 + CH3SiCl
1 record matched CH3SiH3 → H2 + (CH3)SiH
1 record matched 2,3,5,6-Tetrachlorophenol + H· → 2,3,5,6-tetrachlorophenoxy radical + H2
1 record matched 2,3,5-Trichlorophenol + H· → 2,3,5-trichlorophenoxy radical + H2
1 record matched 2,3,6-Trichlorophenol + H· → 2,3,6-trichlorophenoxy radical + H2
1 record matched (CH3)4Ge + H· → H2 + (CH3)3GeCH2
1 record matched AlH(CH3)2 + AlH(CH3)2 → H2 + Al2(CH3)4
1 record matched AlH(CH3)2 → H2 + CH2=Al(CH3)
1 record matched Vinylacetylene + H· → H2 + CH2C(·)CCCH
1 record matched Vinylacetylene → H2 + 1,2,3-butatrienylidene
2 records matched Vinylacetylene → 1,3-Butadiyne + H2
3 records matched CHD3 + H· → H2 + CD3
1 record matched 2-(E)-C5H10 + H· → H2 + (E)-CH3CH=CHCH2CH2·
1 record matched 2-(E)-C5H10 + H· → H2 + CH3CH(·)CH=CHCH3
1 record matched 2-(E)-C5H10 + H· → (E)-(·)CH2CH=CHCH2CH3 + H2
1 record matched 2-(E)-C5H10 + H· → (E)-CH3C(·)=CHCH2CH3 + H2
1 record matched 2-(E)-C5H10 + H· → (E)-CH3CH=C(·)CH2CH3 + H2
2 records matched CO + H2O → CO2 + H2
1 record matched CO + H2 → HOC(·)O
1 record matched CO + H2 → CO2 + H·
1 record matched CO + H2 → Products
1 record matched 2-Chloroethyl methyl ether → CH3OCH=CHCl + H2
3 records matched 2,5-Dimethylfuran + H· → 2-methylfuran-5-yl methyl radical + H2
2 records matched 2,5-Dimethylfuran + H· → 2,5-dimethylfuran-3-yl radical + H2
1 record matched (CH3S)2 + H· → H2 + CH3SSCH2
1 record matched CH3ONO + H· → ·CH2ONO· + H2
1 record matched (E)-2-C4H8 + H· → H2 + CH3CH=C(·)CH3
1 record matched (E)-2-C4H8 + H· → H2 + (E)-CH3CH=CHCH2
1 record matched Methyl pentanoate + H· → CH3CH2CH2CH2C(O)OCH2· + H2
2 records matched Methyl butanoate + H· → ·CH2OC(O)CH2CH2CH3 + H2
1 record matched Methyl butanoate + H· → CH3OC(O)CH·CH2CH3 + H2
1 record matched Methyl butanoate + H· → CH3OC(O)CH2CH·CH3 + H2
1 record matched Methyl butanoate + H· → CH3OC(O)CH2CH2CH2· + H2
1 record matched CH3OCOOCH3 + H· → H2 + CH3OC(O)OCH2·
1 record matched CH3OCOOCH3 → CH3OC(O)OCH: + H2
1 record matched 3,4,5-Trichlorophenol + H· → 3,4,5-trichlorophenoxy radical + H2
1 record matched (CH3)4Sn + H· → H2 + (CH3)3SnCH2·
3 records matched CH3F + H· → H2 + ·CH2F
1 record matched CH3F → H2 + ·CHF
1 record matched 1,3-Cyclohexadiene + H· → H2 + 2,5-Cyclohexadien-1-yl
1 record matched 1,3-Cyclohexadiene + H· → H2 + Cyclohexadienyl
1 record matched 3-Hexene + H· → CH3CH2CH=CHCH2CH2· + H2
1 record matched 3-Hexene + H· → CH3CH2CH=CHCH(·)CH3 + H2
1 record matched 3-Hexene + H· → CH3CH2CH=C(·)CH2CH3 + H2
1 record matched 1-C6H12 + H· → H2 + ·CH2(CH2)3CH=CH2
1 record matched 1-C6H12 + H· → CH2=CHCH(·)CH2CH2CH3 + H2
1 record matched 1-C6H12 + H· → CH2=C(·)CH2CH2CH2CH3 + H2
1 record matched 1-C6H12 + H· → CH2=CHCH2C(·)HCH2CH3 + H2
1 record matched 1-C6H12 + H· → ·CH=CHCH2CH2CH2CH3 + H2
1 record matched 1-C6H12 + H· → CH2=CHCH2CH2CH(·)CH3 + H2
1 record matched CH2=CHCH2CH=CH2 + H· → H2 + CH2=CHCH2CH=CH·
1 record matched CH2=CHCH2CH=CH2 + H· → H2 + CH2=CHCH=CHCH2·
1 record matched CH2=CHCH2CH=CH2 + H· → CH2=CHCH2C(·)=CH2 + H2
1 record matched 3,5-Dichlorophenol + H· → 3,5-dichlorophenoxy radical + H2
1 record matched 1,2-butadiene → H2 + C2H3CH=C:
1 record matched 2,5-Dichlorophenol + H· → 2,5-dichlorophenoxy radical + H2
2 records matched o-Benzoquinone + H2 → 1,2-Dihydroxybenzene
1 record matched 2,3-Dichlorophenol + H· → 2,3-dichlorophenoxy radical + H2
1 record matched C2H5C(CH3)=CH2 + H· → CH2=C(CH3)CH2CH2· + H2
1 record matched C2H5C(CH3)=CH2 + H· → CH2=C(CH3)CH(·)CH3 + H2
1 record matched C2H5C(CH3)=CH2 + H· → CH2=C(CH2·)CH2CH3 + H2
1 record matched C2H5C(CH3)=CH2 + H· → (C2H5)(CH3)C=CH· + H2
1 record matched (CH3)2CHCH=CH2 + H· → H2 + CH2=CHCH(CH3)CH2·
1 record matched (CH3)2CHCH=CH2 + H· → H2 + (CH3)2C(·)CH=CH2
1 record matched (CH3)2CHCH=CH2 + H· → H2 + (CH3)2CHCH=CH·
1 record matched (CH3)2CHCH=CH2 + H· → (CH3)2CHC·=CH2 + H2
1 record matched CH2=CHOH + H· → H2 + CH2=CHO·
1 record matched CH2=CHOH + H· → CH2C(·)OH + H2
1 record matched CH2=CHOH + H· → (Z)-CH=CHOH + H2
1 record matched CH2=CHOH + H· → (E)-CH=CHOH + H2
1 record matched C2H5C(O)OCH3 + H· → CH3CH(·)C(O)OCH3 + H2
2 records matched C2H5C(O)OCH3 + H· → CH3CH2C(O)OCH2· + H2
1 record matched C2H5C(O)OCH3 + H· → CH3OC(O)CH2CH2· + H2
1 record matched Cyclopentadiene + H· → H2 + Cyclopentadienyl
1 record matched (C2H5)2SiH2 + H· → H2 + (C2H5)2SiH(·)
1 record matched (C2H5)2SiH2 + H· → SiH2(CH2CH3)CH2CH2(·) + H2
1 record matched (C2H5)2SiH2 + H· → SiH2(CH2CH3)CH(·)CH3 + H2
1 record matched Phenylacetylene + H· → 2-ethynylphenyl + H2
1 record matched 2-Methylfuran + H· → furan-2-yl methyl radical + H2
1 record matched 2-Methylfuran + H· → 2-methylfuran-3-yl + H2
1 record matched 2-Methylfuran + H· → 2-methylfuran-4-yl + H2
1 record matched 2-Methylfuran + H· → 2-methylfuran-5-yl + H2
1 record matched (CH3)2C=CHCH3 + H· → H2 + ·CH2C(CH3)=CHCH3
1 record matched (CH3)2C=CHCH3 + H· → (CH3)2C=C(·)CH3 + H2
1 record matched (CH3)2C=CHCH3 + H· → (CH3)2C=CHCH2· + H2
1 record matched Oxetane → Oxacyclobut-2-ene + H2
1 record matched 2-butyne + Y → Y(HCCC)CH3 + H2
1 record matched 2-butyne + Y → Y(H2CCCCH2) + H2
1 record matched 2-butyne → H2 + C2H3CH=C:
1 record matched Fulvene + H2 → 2-Methyl-1,3-cyclopentadiene
1 record matched Fulvene + H2 → 1-Methyl-1,3-cyclopentadiene
1 record matched Fulvene + H2 → 1,3-Cyclopentadiene, 5-methyl-
1 record matched neo-C5H12 + H· → H2 + Neopentyl
1 record matched H2C=C=O + H· → H2 + HCCO
3 records matched CF3CHFCF3 + H· → H2 + (CF3)2CF
1 record matched HO-C≡N + H· → H2 + NCO
1 record matched C2HF3 + H· → H2 + CF2=CF
1 record matched C2F5H + H· → H2 + C2F5
1 record matched 3-Phenylpropene + H· → Other Products + H2
1 record matched c-Si5H10 → cyc-SiH2Si(:)SiH2SiH2SiH2- + H2
1 record matched 3,4-Epoxytetrahydrofuran + H· → 3,4-Epoxytetrahydrofuran-2-yl + H2
1 record matched 3,4-Epoxytetrahydrofuran + H· → 3,4-Epoxytetrahydrofuran-3-yl + H2
1 record matched Acenaphthylene + H· → Other Products + H2
1 record matched Acenaphthylene + H· → C12H7 + H2
1 record matched H2CO2 → CO2 + H2
1 record matched 1-C7H16 + H· → H2 + 3-C7H15
1 record matched 1-C7H16 + H· → H2 + 2-C7H15
1 record matched 1-C7H16 + H· → H2 + 1-C7H15
1 record matched Pentacene + H· → Other Products + H2
1 record matched Dibenzofuran + H2 → [1,1'-Biphenyl]-2-ol
1 record matched Dibenzofuran + H2 → C12H10O
1 record matched Pyrene + H· → Other Products + H2
1 record matched CH2=C(CH3)CN → H2 + CH3CCCN
1 record matched CO2 + H2 → CO + H2O
1 record matched 1,4-Dioxane + H· → H2 + 1,4-Dioxan-2-yl
2 records matched 3-methyl-1-butanol + H· → (CH3)2CHCH2CH(OH)· + H2
2 records matched 3-methyl-1-butanol + H· → (CH3)2CHCH(·)CH2OH + H2
1 record matched 3-methyl-1-butanol + H· → (CH3)2C(·)CH2CH2OH + H2
3 records matched 3-methyl-1-butanol + H· → ·CH2CH(CH3)CH2CH2OH + H2
1 record matched Cyclopentanone + H· → Other Products + H2
1 record matched 2,4-Dichlorophenol + H· → 2,4-diclhorophenoxy radical + H2
2 records matched 1,2-Dihydroxybenzene → o-Benzoquinone + H2
2 records matched 1,2-Dihydroxybenzene → cyc-CH=CH-CH=C(OH)-C(=C=O) + H2
1 record matched Anthracene + H· → Other Products + H2
2 records matched iso-C4H8 + H· → H2 + ·CH2C(CH3)=CH2
1 record matched iso-C4H8 + H· → (CH3)2C=CH· + H2
1 record matched (CH3)2O + H· → H2 + CH3OCH2·
1 record matched CH3CH=CH2 + O· → H2 + CH3CH=C=O
1 record matched CH3CH=CH2 + H· → H2 + CH2=C(·)CH3
1 record matched CH3CH=CH2 + H· → H2 + CH3CH=C(·)H
1 record matched CH3CH=CH2 + H· → H2 + ·CH2CH=CH2
2 records matched CH3CH=CH2 → CH2=C=CH2 + H2
1 record matched 1-C7H15C(O)OCH3 + H· → CH3CH2CH2CH2CH2CH2CH2C(O)OCH2· + H2
2 records matched Cyclohexene + H· → H2 + 3-Cyclohexenyl
1 record matched Cyclohexene + H· → H2 + 2-Cyclohexenyl
1 record matched 1-C9H19C(O)OCH3 + H· → CH3CH2CH2CH2CH2CH2CH2CH2CH2C(O)OCH2· + H2
1 record matched 1H-Pyrrole, 2,5-dihydro- → Pyrrole + H2
1 record matched HC(O)OC2H5 + H· → H2 + CH3CH2OC(O)·
1 record matched HC(O)OC2H5 + H· → CH3CH(·)OC(O)H + H2
1 record matched HC(O)OC2H5 + H· → ·CH2CH2OC(O)H + H2
1 record matched HC(O)OC2H5 → CH2=CHCHO + H2
1 record matched CH3OCH2OCH3 + H· → CH3OCH(·)OCH3 + H2
1 record matched CH3OCH2OCH3 + H· → ·CH2OCH2OCH3 + H2
1 record matched 1-C5H10 + H· → H2 + CH2=CHCH2CH(·)CH3
1 record matched 1-C5H10 + H· → H2 + CH2=CHCH(·)CH2CH3
1 record matched 1-C5H10 + H· → CH3CH2CH2C·=CH2 + H2
1 record matched 1-C5H10 + H· → CH3CH2CH2CHCH· + H2
1 record matched 1-C5H10 + H· → CH2=CHCH2CH2CH2· + H2
1 record matched Benzenethiol → H2 + 5-(Thioxomethylene)-1,3-cyclopentadiene
1 record matched Phenol + H· → H2 + C6H5O
1 record matched Cyclohexanone + H· → cyc-[C(O)CH2CH2CH2CH2C(·)H] + H2
1 record matched Cyclohexanone + H· → 3-cyclohexanone-yl radical + H2
1 record matched Cyclohexanone + H· → 4-cyclohexanone-yl radical + H2
1 record matched Chlorobenzene + H· → Other Products + H2
2 records matched Chlorobenzene + H2 → Benzene + HCl
1 record matched Toluene + H· → H2 + 2-methylphenyl
1 record matched Toluene + H· → H2 + 3-methylphenyl
1 record matched Toluene + H· → H2 + 4-methylphenyl
3 records matched Toluene + H· → H2 + Benzyl
3 records matched Toluene + H· → C6H4CH3 + H2
1 record matched 1,3,5-Trimethylbenzene + H· → H2 + 3,5-dimethylbenzyl radical
1 record matched 3-Chlorophenol + H· → 3-chlorophenoxy + H2
4 records matched HC(O)OCH3 + H· → H2 + CH3OC(·)(O)
4 records matched HC(O)OCH3 + H· → H2 + HC(O)OCH2(·)
1 record matched HC(O)OCH3 + H· → Other Products + H2
1 record matched (CHO)2 → CO + CO + H2
2 records matched HOCH2CH2OH → HOCH2CHO + H2
1 record matched HC≡CCH2OH + H· → HCCCH2O· + H2
2 records matched CH2=CHCHO + H· → ·CH2CH=CO + H2
1 record matched 1,3-Butadiene + H· → H2 + CH2CHC·CH2
3 records matched 1,3-Butadiene + H· → H2 + CH2=CHCH=CH·
1 record matched 1,3-Butadiene → H2 + C2H3CH=C:
1 record matched 1-C4H8 + H· → H2 + CH2=CHCH(·)CH3
1 record matched 1-C4H8 + H· → H2 + CH3CH2C(·)=CH2
1 record matched 1-C4H8 + H· → H2 + CH3CH2CH=CH·
1 record matched 1-C4H8 + H· → H2 + CH2=CHCH2CH2·
2 records matched 1-C4H10 + H· → H2 + 1-C4H9
2 records matched 1-C4H10 + H· → H2 + sec-C4H9
2 records matched 1-C4H10 + H· → Other Products + H2
1 record matched Heptanoic acid, methyl ester + H· → CH3CH2CH2CH2CH2CH2C(O)OCH2· + H2
1 record matched CH3CH2CH2CH2CH2C(O)OCH3 + H· → CH3CH2CH2CH2CH2C(O)OCH2· + H2
1 record matched 4-Chlorophenol + H· → 4-chlorophenoxy + H2
2 records matched Styrene + H· → H2 + 2-(·)C6H4C2H3
1 record matched Styrene + H· → H2 + Ethenyl,2-phenyl-
1 record matched Styrene + H· → phenylethen-2-yl + H2
2 records matched Ethylbenzene + H· → H2 + 2-phenylethyl
2 records matched Ethylbenzene + H· → H2 + 1-phenylethyl
3 records matched Ethylbenzene + H· → C6H4CH2CH3 + H2
1 record matched 2-methyltetrahydrofuran + H· → (2-tetrahydrofuran)-methyl + H2
1 record matched 2-methyltetrahydrofuran + H· → 2-methyl-tetrahydrofuran-2-yl + H2
1 record matched 2-methyltetrahydrofuran + H· → 2-methyl-tetrahydrofuran-3-yl + H2
1 record matched 2-methyltetrahydrofuran + H· → 2-methyl-tetrahydrofuran-4-yl + H2
1 record matched 2-methyltetrahydrofuran + H· → 2-methyl-tetrahydrofuran-5-yl + H2
1 record matched CH2=CHC(O)OCH3 + H· → ·CH2OC(O)CH=CH2 + H2
1 record matched CH2=CHC(O)OCH3 + H· → CH3OC(O)C(·)=CH2 + H2
1 record matched CH2=CHC(O)OCH3 + H· → CH3OC(O)CH=CH· + H2
1 record matched 2,4,5-Trichlorophenol + H· → 2,4,5-trichlorophenoxy radical + H2
1 record matched 3,4-Dichlorophenol + H· → 3,4-dichlorophenoxy radical + H2
1 record matched 1,2,4-Trimethylbenzene + H· → H2 + 3,4-dimethylphenyl-methyl
1 record matched 1,2,4-Trimethylbenzene + ·OH → 3,4-dimethylphenyl-methoxy + H2
2 records matched 2-Chlorophenol + H· → 2-chlorophenoxy + H2
1 record matched Benzene, 1,2-dichloro- + H2 → Chlorobenzene + HCl
2 records matched Indene + H· → H2 + 1H-inden-1-yl
1 record matched Naphthacene + H· → Other Products + H2
1 record matched Naphthalene + H· → H2 + 2-Naphthalenyl
2 records matched Naphthalene + H· → H2 + 1-Naphthalenyl
1 record matched Naphthalene + H· → Other Products + H2
1 record matched 1,2-divinylbenzene + H· → C6H4-(1-C2H3)-2-CH=CH· + H2
1 record matched 2,4,6-trichlorophenol + H· → 2,4,6-trichlorophenoxy radical + H2
1 record matched pentachlorophenol + H· → pentachlorophenoxy radical + H2
1 record matched 2,6-Dichlorophenol + H· → 2,6-dichlorophenoxy radical + H2
1 record matched Phenanthrene + H· → Other Products + H2
1 record matched 3,3',5,5'-Tetrabromobisphenol A + H· → 3,3',5,5'-Tetrabromo-4,4-dihydroxy-2,2-diphenyl-1-propyl radical + H2
1 record matched 3,3',5,5'-Tetrabromobisphenol A + H· → 1,6-dibromo-4-(3,5-dibromo-4-hydroxyphenyl,dimethyl)methylphenoxy radical + H2
3 records matched CH3C(O)OCH3 + H· → H2 + ·CH2C(O)OCH3
5 records matched CH3C(O)OCH3 + H· → H2 + CH3C(O)OCH2·
1 record matched CH3C(O)OCH3 + H· → Other Products + H2
1 record matched C2H5COCH3 + H· → H2 + ·CH2CH2C(O)CH3
1 record matched C2H5COCH3 + H· → H2 + CH3C(O)CH(·)CH3
1 record matched C2H5COCH3 + H· → ·CH2C(O)C2H5 + H2
1 record matched iso-C5H12 + H· → H2 + ·CH2CH(CH3)CH2CH3
1 record matched iso-C5H12 + H· → H2 + (CH3)2C(·)CH2CH3
1 record matched iso-C5H12 + H· → H2 + (CH3)2CHCH(·)CH3
1 record matched iso-C5H12 + H· → H2 + (CH3)2CHCH2CH2·
1 record matched CH3SiCl3 + H· → H2 + Cl3SiCH2·
1 record matched CH3SiCl3 → CHSiCl3 + H2
1 record matched (CH3)2SiCl2 → Other Products + H2
1 record matched (CH3)4Si + H· → H2 + (CH3)3SiCH2
1 record matched Silane, dichloromethyl- + H· → H2 + Silyl, dichloromethyl-
6 records matched CHF3 + H· → H2 + ·CF3
1 record matched CHF2Cl + H· → H2 + ·CClF2
1 record matched CHFCl2 + H· → H2 + ·CCl2F
1 record matched iso-C3H7SH + H· → H2 + (CH3)2CHS
1 record matched iso-C4H10 + H· → H2 + iso-C4H9
1 record matched iso-C4H10 + H· → H2 + tert-C4H9
3 records matched iso-C4H10 + H· → Other Products + H2
1 record matched Oxirane + H· → H2 + Oxiranyl
1 record matched Oxirane → H2C=C=O + H2
1 record matched Cyclopropane + H· → H2 + Cyclopropyl
1 record matched (CH3)2S + H· → H2 + CH3SCH2
1 record matched HN=C=O + H· → H2 + NCO
1 record matched HCONH2 + H· → H2 + C(O)NH2
1 record matched HCONH2 → HN=C=O + H2
1 record matched CH2I2 + H· → H2 + ·CHI2
4 records matched CH2F2 + H· → H2 + ·CHF2
2 records matched CH2F2 → H2 + ·CF2
2 records matched CH2Cl2 + H· → H2 + CHCl2
1 record matched C2H5SH + H· → H2 + CH3CH2S
1 record matched CH3CHO + H· → H2 + CH3CO
1 record matched CH3CHO + H· → H2 + CH2=CHO·
1 record matched CH3CHO + H· → H2 + CH3CO
1 record matched CH2=CHCl + H· → H2 + CHCl=CH
3 records matched C2H5Cl + H· → H2 + CH3CHCl
2 records matched C2H5Cl + H· → H2 + CH2CH2Cl
1 record matched C2H5Cl + H· → Other Products + H2
1 record matched CH3CCH + O· → C2H2 + CO + H2
1 record matched CH3CCH + C2 → H2 + HCCCCCH
1 record matched CH3CCH + C2 → HCC-CH=C=C: + H2
1 record matched CH3CCH + Zr → Zr(HCCCH) + H2
1 record matched CH3CCH + Zr → Zr(CCCH2) + H2
1 record matched CH3CCH + Zr → Zr-CCCH2 + H2
2 records matched C3H8 + H· → H2 + 1-C3H7
2 records matched C3H8 + H· → H2 + iso-C3H7
2 records matched C3H8 + H· → Other Products + H2
1 record matched C3H8 → H2 + (CH3)2C
1 record matched C3H8 → H2 + ·CH2CH2CH2·
1 record matched C3H8 → H2 + CH3CH2CH
2 records matched CH3SH + H· → H2 + ·CH2SH
2 records matched CH3SH + H· → H2 + CH3
2 records matched HCN + H· → CN + H2
1 record matched CH3NH2 + H· → H2 + CH3NH
1 record matched CH3NH2 + H· → H2 + CH2NH2
1 record matched CH3NH2 + H· → Products + H2
2 records matched CH3I + H· → H2 + ·CH2I
3 records matched CH3Cl + H· → H2 + ·CH2Cl
1 record matched CH3Cl + H2 → CH4 + HCl
1 record matched C2H2 + CD≡C· → DCCCC + H2
8 records matched C2H2 + H· → H2 + ·C2H
1 record matched C2H2 + C → H2 + C3
1 record matched C2H2 + CH2=C → H2 + 1,2,3-butatrienylidene
1 record matched C2H2 + CH2=C → 1,3-Butadiyne + H2
2 records matched C2H2 + H2 → C2H3 + H·
1 record matched C2H2 + H2 → C2H4
1 record matched C2H2 + C2H2 → H2 + 1,2,3-butatrienylidene
1 record matched C2H2 + C2H2 → 1,3-Butadiyne + H2
2 records matched C2H4 + O· → H2C=C=O + H2
11 records matched C2H4 + H· → H2 + C2H3
1 record matched C2H4 + H2 → ·C2H5 + H·
2 records matched C2H4 + H2 → C2H6
1 record matched C2H4 → H2 + CH2=C
4 records matched C2H4 → C2H2 + H2
13 records matched C2H6 + H· → H2 + ·C2H5
2 records matched C2H6 → C2H4 + H2
47 records matched CH4 + H· → H2 + ·CH3
1 record matched CH4 + HCl → CH3Cl + H2
1 record matched CH4 + C → H2 + CH2=C
1 record matched CH4 + C → HCCH(B2) + H2
1 record matched CH4 + ·OH → H2 + ·CH3
1 record matched CH4 + ·CH3 → H2 + ·C2H5
6 records matched Benzene + H· → H2 + Phenyl
1 record matched Benzene + H2 + FC(O)OH → 1,4-Cyclohexadiene + FC(O)OH
1 record matched Benzene + H2 + FC(O)OH → 1,3-Cyclohexadiene + FC(O)OH
1 record matched Benzene + H2 + HBr → 1,4-Cyclohexadiene + HBr
1 record matched Benzene + H2 + HBr → 1,3-Cyclohexadiene + HBr
1 record matched Benzene + H2 + H2S → 1,4-Cyclohexadiene + H2S
1 record matched Benzene + H2 + H2S → 1,3-Cyclohexadiene + H2S
1 record matched Benzene + H2 + H2O → 1,4-Cyclohexadiene + H2O
1 record matched Benzene + H2 + H2O → 1,3-Cyclohexadiene + H2O
1 record matched Benzene + H2 + NH3 → 1,4-Cyclohexadiene + NH3
1 record matched Benzene + H2 + HF → 1,4-Cyclohexadiene + HF
1 record matched Benzene + H2 + HF → 1,3-Cyclohexadiene + HF
1 record matched Benzene + H2 + HCl → 1,4-Cyclohexadiene + HCl
1 record matched Benzene + H2 + HCl → 1,3-Cyclohexadiene + HCl
1 record matched Benzene + H2 + CF3OH → 1,3-Cyclohexadiene + CF3OH
1 record matched Benzene + H2 + H2 → 1,3-Cyclohexadiene + H2
2 records matched Benzene + H2 → 1,4-Cyclohexadiene
1 record matched Benzene + H2 → 1,3-Cyclohexadiene
1 record matched Benzene + CH3SH + H2 → CH3SH + 1,4-Cyclohexadiene
1 record matched Benzene + CH3SH + H2 → CH3SH + 1,3-Cyclohexadiene
1 record matched n-C4H9OH + H· → H2 + CH3CH2CH2C(·)HOH
1 record matched n-C4H9OH + H· → H2 + CH3CH2CH2CH2
1 record matched n-C4H9OH + H· → H2 + HOCH2CH2CH2CH2
1 record matched n-C4H9OH + H· → CH3CH2CH(·)CH2OH + H2
1 record matched n-C4H9OH + H· → CH3CH(·)CH2CH2OH + H2
2 records matched CHCl3 + H· → H2 + ·CCl3
1 record matched Acetone + H· → H2 + CH3C(O)CH2(·)
1 record matched Acetone → Oxacyclobut-2-ene + H2
4 records matched iso-C3H7OH → Acetone + H2
6 records matched CH3OH + H· → H2 + (·)CH2OH
5 records matched CH3OH + H· → H2 + CH3
1 record matched CH3OH + Benzene + H2 → CH3OH + 1,4-Cyclohexadiene
1 record matched CH3OH + Benzene + H2 → CH3OH + 1,3-Cyclohexadiene
1 record matched CH3OH → H2 + HOCH
2 records matched CH3OH → trans-HCOH + H2
2 records matched CH3OH → cis-HCOH + H2
1 record matched CH3C(O)OH + Benzene + H2 → CH3C(O)OH + 1,4-Cyclohexadiene
1 record matched CH3C(O)OH + Benzene + H2 → CH3C(O)OH + 1,3-Cyclohexadiene
1 record matched HCOOH + Benzene + H2 → HCOOH + 1,4-Cyclohexadiene
1 record matched HCOOH + Benzene + H2 → HCOOH + 1,3-Cyclohexadiene
2 records matched HCOOH → CO2 + H2
2 records matched C2H5OH + H· → H2 + HOCH2CH2·
2 records matched C2H5OH + H· → H2 + CH3CH(·)OH
3 records matched C2H5OH + H· → H2 + CH3CH2
1 record matched C2H5OH + H· → Other Products + H2
1 record matched aniline + H· → H2 + Phenyl amidogen
1 record matched CH3NHNH2 → CH2=NH=NH + H2
1 record matched CH3NHNH2 → CH3NHN + H2
2 records matched (C2H5)2O + H· → H2 + C2H5OCH2CH2·
1 record matched (C2H5)2O + H· → CH3CHOCH2CH3 + H2
1 record matched (C2H5)2O + H· → CH3CH(·)OCH2CH3 + H2
1 record matched 2,3,4,6-Tetrachlorophenol + H· → 2,3,4,6-tetrachlorophenoxy radical + H2
1 record matched CN + H2 → H2C=N
10 records matched CN + H2 → HCN + H·
1 record matched Benzo[a]pyrene + H· → Other Products + H2
1 record matched Benzo[a]pyrene + H· → benzo[a]pyrenyl armchair radical + H2
1 record matched Benzo[a]pyrene + H· → benzo[a]pyrenyl zigzag radical + H2
7 records matched CH2O + H· → H2 + HCO
1 record matched CH2O + H· → CO + H2 + H·
1 record matched CH2O + Y → H2 + Y(CO)
1 record matched CH2O + ·OH → H2 + HOC(·)O
1 record matched CH2O + H2 → CH3OH
1 record matched CH2O → H2 + O2
6 records matched CH2O → CO + H2
1 record matched O(1D) + NH3 → H2 + :NOH
2 records matched O(1D) + H2 → ·OH + H·
1 record matched O2(1DELTA) + H2S → H2 + SO2
1 record matched O2(1DELTA) + H2 → HO2 + H·
1 record matched SiHCl2NH2 + H2 → SiH2Cl2 + NH3
1 record matched CH2BrO → H2 + BrCO
1 record matched CH2DO + H2 → CH2DOH + H·
1 record matched AlHCl + H· → H2 + AlCl
1 record matched AlH2Cl + H· → AlHCl + H2
11 records matched H2SiLiF + H2 → LiF + SiH4
1 record matched phenylethen-2-yl + H· → Phenylacetylene + H2
1 record matched phenylethen-2-yl + H· → ·C6H4-(2-CH=CH·) + H2
1 record matched N(4S) + H2 → H· + NH
1 record matched O(1D) + H2 → ·OH + H·
1 record matched O(1D) + C2H5F → H2 + CH3FC(O)H
1 record matched O(1D) + C2H5F → CH3COF + H2
1 record matched O(1D) + C2H5F → CH2=CHOF + H2
1 record matched O(1D) + C2H5F → :CHCHFOH + H2
1 record matched O(1D) + C2H5F → CH2=CFOH + H2
1 record matched O(1D) + C2H5F → :CFCH2OH + H2
1 record matched O(1D) + C2H6 → Products + H2
1 record matched O(1D) + CH4 → H2 + HOCH
1 record matched O(1D) + CH4 → CH2O + H2
3 records matched O2(1Delta_g) + H2 → HO2 + H·
1 record matched CH2C(·)OH + H2 → CH2=CHOH + H·
1 record matched H2N-SiH → H2 + SiNH
1 record matched H3N-SiH2 complex → H2 + SiH2NH
1 record matched H3N-SiH2 complex → H2N-SiH + H2
1 record matched CH2(X3B_1) + Ni → NiC + H2
1 record matched C(1D) + H2 → ·CH + H·
1 record matched C(1D) + H2 → CH(X2 Pi) + H·
1 record matched C(1D) + CH4 → H2 + CH2=C
1 record matched C(1D) + CH4 → C2H2 + H2
1 record matched Ga2(a1Sigma_g+) + H2 → Products
1 record matched Ga2(a1Sigma_g+) + H2 → Ga(mu-H)2Ga
1 record matched Ga2(X3Pi_u) + H2 → Products
1 record matched Ga2(X3Pi_u) + H2 → Ga(mu-H)2Ga
1 record matched (3)NH + H· → H2 + N
2 records matched S(1D) + H2 → H· + SH
1 record matched S(1D) + H2 → Products
2 records matched S(1D) + C2H4 → H2 + CH2=C=S
1 record matched CH3NBH → CH2NB + H2
1 record matched CH2NB → CNB + H2
1 record matched BOH + H· → H2 + BO
1 record matched BS + H2 → Products
1 record matched Ni(3D) + CO2 + H2 → Ni(3D) + CO + H2O
1 record matched CH3N(·)NH2 → ·CH2N=NH + H2
1 record matched W(1S) + H2O → WO(1sigma+) + H2
1 record matched W(3P) + H2O → WO(3sigma+) + H2
1 record matched W(5D) + H2O → WO(3sigma+) + H2
1 record matched W(7S) + H2O → WO(3sigma+) + H2
1 record matched ·CH2CH2CH2CH2CH2· → CH2=CHCH2CH=CH2 + H2
1 record matched trans-HCOH + H2 → CH3OH
1 record matched cis-HCOH + H2 → CH3OH
1 record matched 2-propargylphenyl + H2 → C6H5CH2C2H + H·
1 record matched 2-C6H4CHCCH2 + H2 → Benzene, 1,2-propadienyl- + H·
1 record matched Ga(CH3)(NH2)2 + H· → Ga(CH3)(CH2)NH· + H2
1 record matched Ga(NH2)3 + H· → Ga(NH2)2NH· + H2
1 record matched GaNH2 + H· → GaNH· + H2
2 records matched (CH3)(NH2)GaNHGa(CH3)NH2 + H· → (CH3)(NH2)GaNHGa(CH3)NH· + H2
2 records matched cyc-CH=CH-CH=C(OH)-C(=C=O) + H2 → 1,2-Dihydroxybenzene
1 record matched Al13 + H2 → Al13H2
1 record matched SiH3SiH2SiH: + H2 → Si3H8
1 record matched SiH3Si(:)SiH3 + H2 → Si3H8
1 record matched cyclo-SiH2SiH2Si(:) + H2 → c-Si3H6
1 record matched CHSiCl3 + H2 → CH3SiCl3
1 record matched CH2=C(OH)-CH2· + H· → H2 + Cyclopropanone
1 record matched TlH3 → H2 + TlH
1 record matched trans-CF3CHCHBr → CFBr=C=CF2 + H2
1 record matched cis-CF3CHCHBr → CFBr=C=CF2 + H2
1 record matched HNiOCH3 → CH2ONi + H2
1 record matched CH3NiOH → CH2ONi + H2
1 record matched CH2ONi → CO + H2 + Ni
1 record matched cyc-CH2SS + H· → cyc-CH(·)SS + H2
1 record matched cyc-CH(·)SS + H2 → cyc-CH2SS + H·
1 record matched SiH3SiH2Si(:)SiH2SiH3 + H2 → Pentasilane
1 record matched SiH3Si(:)SiH(SiH3)2 + H2 → 2-Silyltetrasilane
1 record matched (SiH3)2SiHSiH2SiH(SiH3)2 → (SiH3)2SiHSi(:)SiH(SiH3)2 + H2
1 record matched (SiH3)2SiHSi(:)SiH(SiH3)2 + H2 → (SiH3)2SiHSiH2SiH(SiH3)2
1 record matched SiH3Si(SiH3)2SiH2SiH(SiH3)2 → SiH3Si(SiH3)2Si(:)SiH(SiH3)2 + H2
1 record matched SiH3Si(SiH3)2Si(:)SiH(SiH3)2 + H2 → SiH3Si(SiH3)2SiH2SiH(SiH3)2
1 record matched cyc-Si4H8 → cyc-SiH2Si(:)SiH2SiH2- + H2
1 record matched cyc-SiH2Si(:)SiH2SiH2- + H2 → cyc-Si4H8
1 record matched cyc-SiH2Si(:)SiH2SiH2SiH2- + H2 → c-Si5H10
1 record matched cyc-Si6H12 → cyc-SiH2Si(:)SiH2SiH2SiH2SiH2- + H2
1 record matched cyc-SiH2Si(:)SiH2SiH2SiH2SiH2- + H2 → cyc-Si6H12
1 record matched cyc-SiH2SiH(SiH3)SiH2- → cyc-SiH2SiH(SiH:)SiH2- + H2
1 record matched cyc-SiH2SiH(SiH:)SiH2- + H2 → cyc-SiH2SiH(SiH3)SiH2-
1 record matched cyc-SiH2SiH(SiH3)SiH2SiH2- → cyc-SiH2SiH(SiH:)SiH2SiH2- + H2
1 record matched cyc-SiH2SiH(SiH:)SiH2SiH2- + H2 → cyc-SiH2SiH(SiH3)SiH2SiH2-
1 record matched cyc-SiH2SiH(SiH3)SiH2SiH2SiH2- → cyc-SiH2SiH(SiH:)SiH2SiH2SiH2- + H2
1 record matched cyc-SiH2SiH(SiH:)SiH2SiH2SiH2- + H2 → cyc-SiH2SiH(SiH3)SiH2SiH2SiH2-
1 record matched cyc-SiH2SiH(SiH3)SiH2SiH2SiH2SiH2- → cyc-SiH2SiH(SiH:)SiH2SiH2SiH2SiH2- + H2
1 record matched cyc-SiH2SiH(SiH:)SiH2SiH2SiH2SiH2- + H2 → cyc-SiH2SiH(SiH3)SiH2SiH2SiH2SiH2-
1 record matched cyc-SiH(SiH3)SiH(SiH3)SiH(SiH3)- → cyc-SiH(SiH3)SiH(SiH:)SiH(SiH3)- + H2
1 record matched cyc-SiH(SiH3)SiH(SiH:)SiH(SiH3)- + H2 → cyc-SiH(SiH3)SiH(SiH3)SiH(SiH3)-
1 record matched cyc-Si(SiH3)2SiH(SiH3)Si(SiH3)2- → cyc-Si(SiH3)2SiH(SiH:)Si(SiH3)2- + H2
1 record matched cyc-Si(SiH3)2SiH(SiH:)Si(SiH3)2- + H2 → cyc-Si(SiH3)2SiH(SiH3)Si(SiH3)2-
1 record matched bicyclo[3.1.0]hexasilane → bicyclo[3.1.0]hexa-6-silylene + H2
1 record matched bicyclo[3.1.0]hexa-6-silylene + H2 → bicyclo[3.1.0]hexasilane
1 record matched cyc-SiH2SiH(SiH3)SiH2SiH(SiH3)- → cyc-SiH2SiH(SiH3)Si(:)SiH(SiH3)- + H2
1 record matched cyc-SiH2SiH(SiH3)Si(:)SiH(SiH3)- + H2 → cyc-SiH2SiH(SiH3)SiH2SiH(SiH3)-
1 record matched (SiH3)2SiHSiH2-cyc-Si5H19 → (SiH3)2SiHSi(:)-cyc-Si5H19 + H2
1 record matched (SiH3)2SiHSi(:)-cyc-Si5H19 + H2 → (SiH3)2SiHSiH2-cyc-Si5H19
1 record matched SiH2(cyc-Si3H5)(cyc-Si6H11) → :Si(cyc-Si3H5)(cyc-Si6H11) + H2
1 record matched :Si(cyc-Si3H5)(cyc-Si6H11) + H2 → SiH2(cyc-Si3H5)(cyc-Si6H11)
1 record matched bicyclo[4,4,0]decasilane → bicyclo[4,4,0]deca-2-silylane + H2
1 record matched bicyclo[4,4,0]deca-2-silylane + H2 → bicyclo[4,4,0]decasilane
1 record matched (SiH3)2SiHSiH(Si2H5)SiH(SiH3)2 → (SiH3)2SiHSiH(Si(:)SiH3)SiH(SiH3)2 + H2
1 record matched (SiH3)2SiHSiH(Si(:)SiH3)SiH(SiH3)2 + H2 → (SiH3)2SiHSiH(Si2H5)SiH(SiH3)2
1 record matched SiH3SiH2SiH2SiH2SiH: + H2 → Pentasilane
1 record matched cyc-HC=C=C(BCl2) + H· → cyc-(·)C=C=C(BCl2) + H2
1 record matched (Z)-CH=CHOH + H2 → CH2=CHOH + H·
1 record matched (E)-CH=CHOH + H2 → CH2=CHOH + H·
1 record matched neo-Si5H12 → :SiHSi(SiH3)3 + H2
1 record matched iso-Si4H10 → (SiH3)2SiHSiH: + H2
1 record matched iso-Si4H10 → (SiH3)2Si=SiH2 + H2
2 records matched 3SiH2 → H2 + Si
1 record matched furan-2-yl methyl radical + H2 → 2-Methylfuran + H·
1 record matched 2-methylfuran-3-yl + H2 → 2-Methylfuran + H·
1 record matched 2-methylfuran-4-yl + H2 → 2-Methylfuran + H·
1 record matched 2-methylfuran-5-yl + H2 → 2-Methylfuran + H·
1 record matched Br(2P_1/2) + H2 → H2 + Br·
1 record matched CHD2O· + H2 → CHD2OH + H·
1 record matched trans-(·)CH=CH-CH=CH-C6H5 + H· → ·C6H4-(2-trans-CH=CHCH=CH·) + H2
1 record matched cis-(·)CH=CH-CH=CH-C6H5 + H· → ·C6H5-2-cis-CH=CH-CH=CH(·) + H2
1 record matched C6H4-(1-C2H3)-2-CH=CH· + H· → C6H4-1,2-(CH=CH·)2 + H2
1 record matched O2(3Delta_u) + H2 → HO2 + H·
1 record matched O2(3Delta_u) + H2 → O2(c1Sigma_u-) + H2
1 record matched O2(3Delta_u) + H2 → O2(b1Sigma_g+) + H2
1 record matched O2(c1Sigma_u-) + H2 → O2(3Delta_u) + H2
1 record matched Aziridine borane + HBr → Ethyneimine borane + H2 + HBr
1 record matched Aziridine borane + H2Se → Ethyneimine borane + H2 + H2Se
1 record matched Aziridine borane + H2S → Ethyneimine borane + H2 + H2S
1 record matched Aziridine borane + H2O → Ethyneimine borane + H2 + H2O
1 record matched Aziridine borane + HF → Ethyneimine borane + H2 + HF
1 record matched Aziridine borane + HCl → Ethyneimine borane + H2 + HCl
1 record matched Aziridine borane → Ethyneimine borane + H2
1 record matched 3-Methyl-1,2-BN-cyclopentane + HBr → 3-Methyl-1,2-BN-cyclopent-1-ene + H2 + HBr
1 record matched 3-Methyl-1,2-BN-cyclopentane + H2Se → 3-Methyl-1,2-BN-cyclopent-1-ene + H2 + H2Se
1 record matched 3-Methyl-1,2-BN-cyclopentane + H2S → 3-Methyl-1,2-BN-cyclopent-1-ene + H2 + H2S
1 record matched 3-Methyl-1,2-BN-cyclopentane + H2O → 3-Methyl-1,2-BN-cyclopent-1-ene + H2 + H2O
1 record matched 3-Methyl-1,2-BN-cyclopentane + HF → 3-Methyl-1,2-BN-cyclopent-1-ene + H2 + HF
1 record matched 3-Methyl-1,2-BN-cyclopentane + HCl → 3-Methyl-1,2-BN-cyclopent-1-ene + H2 + HCl
1 record matched 3-Methyl-1,2-BN-cyclopentane → 3-Methyl-1,2-BN-cyclopent-1-ene + H2
1 record matched benzo[a]pyrenyl armchair radical + H2 → Benzo[a]pyrene + H·
1 record matched benzo[a]pyrenyl zigzag radical + H2 → Benzo[a]pyrene + H·
1 record matched 2,3-Epoxytetrahydrofuran + H· → 2,3-Epoxytetrahydrofuran-2-yl + H2
1 record matched 2,3-Epoxytetrahydrofuran + H· → 2,3-Epoxytetrahydrofuran-3-yl + H2
1 record matched 2,3-Epoxytetrahydrofuran + H· → 2,3-Epoxytetrahydrofuran-4-yl + H2
1 record matched 2,3-Epoxytetrahydrofuran + H· → 2,3-Epoxytetrahydrofuran-5-yl + H2
1 record matched GeHCl3 + H· → H2 + Germanium chloride
1 record matched GaMe2NH2 + H· → Ga(CH3)2NH· + H2
1 record matched CH2CH2CH2CH2 → 1,3-Butadiene + H2
1 record matched H2CS + H· → H2 + HC=S
1 record matched ·CH2OC(O)CH2CH2CH3 + H2 → Methyl butanoate + H·
1 record matched ·CH2CH2CHCO + H2 → H· + C2H5CH=C=O
1 record matched CH3CH(·)CHCO + H2 → H· + C2H5CH=C=O
1 record matched ·CH2OC(O)CH=CH2 + H2 → CH2=CHC(O)OCH3 + H·
1 record matched CH3OC(O)C(·)=CH2 + H2 → CH2=CHC(O)OCH3 + H·
1 record matched CH3OC(O)CH=CH· + H2 → CH2=CHC(O)OCH3 + H·
1 record matched CH3OC(O)CH·CH2CH3 + H2 → Methyl butanoate + H·
1 record matched CH3OC(O)CH2CH·CH3 + H2 → Methyl butanoate + H·
1 record matched CH3OC(O)CH2CH2CH2· + H2 → Methyl butanoate + H·
1 record matched H12B4N4 + H2 → H14B4N4
1 record matched H10B4N4 + H2 → H12B4N4
1 record matched H8B4N4 + H2 → H10B4N4
1 record matched cis-HCSSH → CS2 + H2
1 record matched cis-HC(S·)OH → COS + H2
1 record matched cis-HC(O·)SH → COS + H2
1 record matched CF2-trip + H2 → ·CHF2 + H·
1 record matched methylcyclopentadiene (mixture of isomers) → Fulvene + H2
1 record matched N2H2BeO + H2 → N2H4BeO
1 record matched N2H4BeO + H2 → BeO + NH3 + NH3
1 record matched phenyl, (E)-2-(buta-1,3-dien-1-yl) + H· → ·C6H4-(2-trans-CH=CHCH=CH·) + H2
1 record matched O2(b1Sigma_g+) + H2 → HO2 + H·
1 record matched O2(b1Sigma_g+) + H2 → O2(3Delta_u) + H2
1 record matched BH5 → H2 + BH3
1 record matched H2C=C=C=C=C: → H2 + C5
1 record matched PdH2 → H2 + Pd
1 record matched Pd2H2 → H2 + Pd2
1 record matched SiH2(HCl) Adduct → H2 + SiHCl
1 record matched H· + H2C=N → HCN + H2
1 record matched H· + HD → H2 + D
1 record matched ·CH3 + HN=N → CH2N2 + H2
1 record matched ·CH3 + O· → CO + H2 + H·
1 record matched CD3 + O· → CO + H2 + H·
1 record matched CH2=NH + H· → H2 + H2C=N
4 records matched H2 + O· → ·OH + H·
2 records matched H2 + D → H· + HD
1 record matched H2 + H· → H2 + H·

Search returned 3235 records.