Kinetics Database Logo

Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences

Feedback

Rate Our Products and Services

Help


Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty

More...


Administrative Links

NIST home page

MML home page

Chemical Sciences Division

  NIST Logo Home
©NIST, 2020
Accessibility information

Search Results


Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
2 records matched CH3CH2CH(CH3)O· → CH3CHO + ·C2H5
1 record matched n-C3H7O → CH2O + ·C2H5
1 record matched C2H5C(CH3)2O(·) → Acetone + ·C2H5
1 record matched NO + CH3CH2C(O)OO → CO2 + ·C2H5 + NO2
2 records matched 1-C4H9 → C2H4 + ·C2H5
1 record matched CH3CH2CH2CH(·)CH3 → CH3CH=CH2 + ·C2H5
2 records matched ·CH3 + ·CH3 → ·C2H5 + H·
1 record matched 1-C3H7 + ·CH2 → C2H4 + ·C2H5
1 record matched CH3O2· + 1-C3H7 → CH2O + ·C2H5 + CH3
1 record matched ·C2H + 1-C3H7 → ·C2H5 + CH2C≡CH
1 record matched ·C2H5 + ·CH2 → C2H4 + ·CH3
1 record matched ·C2H5 + O· → CH3CHO + H·
1 record matched ·C2H5 + O· → CH2O + ·CH3
3 records matched ·C2H5 + O· → Products
2 records matched ·C2H5 + H· → ·CH3 + ·CH3
1 record matched ·C2H5 + H· → C2H4 + H2
1 record matched ·C2H5 + H· → Products
1 record matched ·C2H5 + HBr → C2H6 + Br·
11 records matched ·C2H5 + O2 → C2H5OO·
1 record matched ·C2H5 + O2 → CH3CHO + ·OH
10 records matched ·C2H5 + O2 → C2H4 + HO2
1 record matched ·C2H5 + D2 → C2H5D + D
2 records matched ·C2H5 + H2O → C2H6 + ·OH
1 record matched ·C2H5 + H2O2 → C2H6 + HO2
1 record matched ·C2H5 + iso-C4H9 → (CH3)2CH(CH2)2CH3
1 record matched ·C2H5 + iso-C4H9 → C2H4 + iso-C4H10
1 record matched ·C2H5 + iso-C4H9 → C2H6 + iso-C4H8
1 record matched ·C2H5 + ·OH → C2H4 + H2O
1 record matched ·C2H5 + ·OH → C2H6 + O·
1 record matched ·C2H5 + HO2 → C2H4 + H2O2
1 record matched ·C2H5 + HO2 → C2H6 + O2
1 record matched ·C2H5 + CH3CO → C2H5COCH3
1 record matched ·C2H5 + C2H3 → 1-C4H8
2 records matched ·C2H5 + C2H3 → Products
1 record matched ·C2H5 + HCO → C2H5CHO
1 record matched ·C2H5 + HCO → C2H6 + CO
1 record matched ·C2H5 + (·)CH2OH → n-C3H7OH
1 record matched ·C2H5 + (·)CH2OH → CH3OH + C2H4
1 record matched ·C2H5 + (·)CH2OH → CH2O + C2H6
1 record matched ·C2H5 + C2H5C(O)OCH2CH=CH2 → Products
4 records matched ·C2H5 + ·CH3 → C3H8
2 records matched ·C2H5 + ·CH3 → CH4 + C2H4
1 record matched ·C2H5 + CH3O· → CH2O + C2H6
1 record matched ·C2H5 + 1-C3H7 → n-C5H12
1 record matched ·C2H5 + 1-C3H7 → C2H4 + C3H8
1 record matched ·C2H5 + 1-C3H7 → C2H6 + CH3CH=CH2
1 record matched ·C2H5 + CH3O2· → CH3O· + CH3CH2
1 record matched ·C2H5 + ·C2H → ·CH3 + CH2C≡CH
1 record matched ·C2H5 + ·C2H → C2H4 + C2H2
3 records matched ·C2H5 + ·C2H5 → 1-C4H10
3 records matched ·C2H5 + ·C2H5 → C2H6 + C2H4
7 records matched ·C2H5 → C2H4 + H·
1 record matched iso-C3H7 + ·C2H5 → iso-C5H12
1 record matched ·CH2CH=CH2 + ·C2H5 → C2H4 + CH3CH=CH2
1 record matched ·CH2CH=CH2 + ·C2H5 → C2H6 + CH2=C=CH2
1 record matched tert-C4H9 + ·C2H5 → (CH3)3CCH2CH3
1 record matched tert-C4H9 + ·C2H5 → C2H4 + iso-C4H10
1 record matched tert-C4H9 + ·C2H5 → C2H6 + iso-C4H8
2 records matched H2 + ·C2H5 → C2H6 + H·
1 record matched (Z)-CH3CH=CHCN + ·C2H5 → Products
1 record matched (C2H5)2NN → ·C2H5 + ·C2H5 + N2
1 record matched (CH3)2C=CHCH=C(CH3)2 + ·C2H5 → Products
1 record matched CO + ·C2H5 → CH3CH2CO
1 record matched 1,3,5,7-Cyclooctatetraene + ·C2H5 → Adduct
1 record matched n-C5H11C≡CH + ·C2H5 → Adduct
1 record matched (E)-CH3CH=CHCN + ·C2H5 → Products
1 record matched (CH3)3CC(CH3)=CH2 + ·C2H5 → Products
1 record matched 1-C7H14 + ·C2H5 → Adduct
1 record matched 1,3-Cyclohexadiene + ·C2H5 → Products
1 record matched 1-C6H12 + ·C2H5 → Adduct
1 record matched CH3C(O)OCH2CH=CH2 + ·C2H5 → Products
1 record matched 1,3,5-Cycloheptatriene + ·C2H5 → Adduct
1 record matched CH2=C(CH3)C(CH3)=CH2 + ·C2H5 → Products
1 record matched CH2=C(CH3)CN + ·C2H5 → Products
1 record matched 2,5-Norbornadiene + ·C2H5 → Adduct
1 record matched CH3CH=CH2 + ·C2H5 → CH3CH2CH2CH(·)CH3
1 record matched CH3CH=CH2 + ·C2H5 → C2H6 + ·CH2CH=CH2
1 record matched CH3CH=CH2 + ·C2H5 → Products
1 record matched 1-C8H16 + ·C2H5 → Adduct
1 record matched n-C4H9OCH=CH2 + ·C2H5 → Products
1 record matched CH3CO2CH=CH2 + ·C2H5 → Products
1 record matched (tert-C4H9)CH2C(CH3)=CH2 + ·C2H5 → Products
1 record matched CH2=CHCH2OH + ·C2H5 → Products
1 record matched CH2CHCN + ·C2H5 → Products
2 records matched 1-C4H10 → ·C2H5 + ·C2H5
1 record matched Styrene + ·C2H5 → Products
1 record matched Ethylbenzene + H· → Benzene + ·C2H5
1 record matched iso-C4H10 + ·C2H5 → C2H6 + iso-C4H9
1 record matched iso-C4H10 + ·C2H5 → C2H6 + tert-C4H9
1 record matched CH3CHO + ·C2H5 → CH3CH2CH(CH3)O·
1 record matched C2H5I + I → ·C2H5 + I2
1 record matched C3H8 + ·C2H5 → C2H6 + 1-C3H7
1 record matched C3H8 + ·C2H5 → C2H6 + iso-C3H7
5 records matched C3H8 → ·C2H5 + ·CH3
1 record matched C2H2 + ·C2H5 → CH3CH2CH=CH·
1 record matched C2H2 + ·C2H5 → C2H6 + ·C2H
9 records matched C2H4 + H· → ·C2H5
2 records matched C2H4 + ·C2H5 → 1-C4H9
1 record matched C2H4 + ·C2H5 → C2H6 + C2H3
1 record matched C2H4 + iso-C3H7 → CH3CH=CH2 + ·C2H5
1 record matched C2H4 + H2 → ·C2H5 + H·
1 record matched C2H4 + CH3CH=CH2 → ·CH2CH=CH2 + ·C2H5
1 record matched C2H4 + C2H4 → ·C2H5 + C2H3
12 records matched C2H6 + ·Cl → ·C2H5 + HCl
4 records matched C2H6 + CF3O → CF3OH + ·C2H5
11 records matched C2H6 + O· → ·C2H5 + ·OH
7 records matched C2H6 + H· → H2 + ·C2H5
2 records matched C2H6 + NO3 → ·C2H5 + HNO3
1 record matched C2H6 + Br· → ·C2H5 + HBr
2 records matched C2H6 + O2 → ·C2H5 + HO2
1 record matched C2H6 + iso-C4H9 → iso-C4H10 + ·C2H5
15 records matched C2H6 + ·OH → ·C2H5 + H2O
4 records matched C2H6 + HO2 → ·C2H5 + H2O2
1 record matched C2H6 + CH3CO → CH3CHO + ·C2H5
1 record matched C2H6 + C2H3 → C2H4 + ·C2H5
1 record matched C2H6 + HCO → CH2O + ·C2H5
1 record matched C2H6 + (·)CH2OH → CH3OH + ·C2H5
2 records matched C2H6 + ·CF3 → CHF3 + ·C2H5
4 records matched C2H6 + ·CH3 → CH4 + ·C2H5
1 record matched C2H6 + CH2=C → ·C2H5 + C2H3
1 record matched C2H6 + CH3O· → CH3OH + ·C2H5
1 record matched C2H6 + 1-C3H7 → C3H8 + ·C2H5
1 record matched C2H6 + CH3O2· → ·C2H5 + CH3OOH
1 record matched C2H6 + ·C2H → C2H2 + ·C2H5
1 record matched C2H6 + iso-C3H7 → C3H8 + ·C2H5
1 record matched C2H6 + ·CH2CH=CH2 → CH3CH=CH2 + ·C2H5
1 record matched C2H6 + tert-C4H9 → iso-C4H10 + ·C2H5
1 record matched CH4 + ·C2H5 → C2H6 + ·CH3
1 record matched CH3OH + ·C2H5 → C2H6 + (·)CH2OH
1 record matched CH3OH + ·C2H5 → C2H6 + CH3
1 record matched CH2O + ·C2H5 → n-C3H7O
1 record matched CH2O + ·C2H5 → C2H6 + HCO
2 records matched CH3CH2Te → ·C2H5 + Te
2 records matched Methyl, ethoxymethoxyphenyl- → Methylbenzoate + ·C2H5
12 records matched CH3CH2CH(CH3)O· → CH3CHO + ·C2H5
1 record matched C2H5CH(CH3)O2 → CH3C(O)OH + ·C2H5
2 records matched 3-hexyl radical → 1-C4H8 + ·C2H5
1 record matched n-C3H7O → CH3CHO + ·C2H5
2 records matched n-C3H7O → CH2O + ·C2H5
6 records matched CH3CH2CO → CO + ·C2H5
3 records matched C2H5C(CH3)2O(·) → Acetone + ·C2H5
1 record matched NO2 + CH3CH2CO → CO2 + ·C2H5 + NO
1 record matched O2 + CH3CH2N=NCH(·)CH3 → CH3CHO + ·C2H5 + N2O
1 record matched O2 + ·CH2CH2N=NC2H5 → CH3CHO + ·C2H5 + N2O
1 record matched C2H5SO2 → ·C2H5 + SO2
1 record matched Cyclooctyl radical + O· → CH2=CHCH2CH2CH2CHO + ·C2H5
2 records matched C2H5OO· → ·C2H5 + O2
1 record matched Cyclohexyl + O· → ·C2H5 + CH2=CHCH2CHO
8 records matched 1-C4H9 → C2H4 + ·C2H5
1 record matched CH3CH2CH2CH(·)CH3 → CH3CH=CH2 + ·C2H5
8 records matched ·CH3 + ·CH3 → ·C2H5 + H·
5 records matched 2-C4H9O → CH3CHO + ·C2H5
1 record matched ·C2H5 + FC(O)O· → Products
1 record matched ·C2H5 + CH3CH2N=NCH(·)CH3 → Other Products + C2H6
1 record matched ·C2H5 + ·CH2CH=CHCH2CH3 → (E)-3-heptene
1 record matched ·C2H5 + ·CH2CH=CHCH2CH3 → 3-C7H14 (Unspecified)
1 record matched ·C2H5 + ·CH2C(CH3)=CHCH3 → n-C3H7C(CH3)=CHCH3
1 record matched ·C2H5 + (Z)-CH3CH=CHCH2CH2· → C2H4 + 2-(Z)-C5H10
1 record matched ·C2H5 + (Z)-CH3CH=CHCH2CH2· → C2H6 + (Z)-CH2=CHCH=CHCH3
1 record matched ·C2H5 + Cyclopentenyl → C2H6 + Cyclopentadiene
1 record matched ·C2H5 + CH2C(CH3)=C(CH3)2 → C2H5CH2C(CH3)=C(CH3)2
1 record matched ·C2H5 + (CH3)2CHC(·)(CH3)2 → C2H6 + (CH3)2C=C(CH3)2
1 record matched ·C2H5 + ·Cl → C2H5Cl
5 records matched ·C2H5 + ·Cl → C2H4 + HCl
1 record matched ·C2H5 + 2,5-Cyclohexadien-1-yl → Benzene + C2H6
1 record matched ·C2H5 + n-C3H7C(CH3)2 → C2H6 + C2H5CH2C(CH3)=CH2
1 record matched ·C2H5 + (CH3)3CC(·)H(CH3) → Other Products + C2H6
1 record matched ·C2H5 + (C2H5)2(CH3)C → C2H6 + (C2H5)2C=CH2
1 record matched ·C2H5 + (C2H5)2(CH3)C → Other Products + C2H6
1 record matched ·C2H5 + N → Products
2 records matched ·C2H5 + O· → CH3CHO + H·
1 record matched ·C2H5 + O· → C2H4 + ·OH
1 record matched ·C2H5 + O· → Other Products + CO
2 records matched ·C2H5 + O· → Products
1 record matched ·C2H5 + CH2CH2Cl → C2H4 + C2H5Cl
1 record matched ·C2H5 + 2,4-Cyclohexadien-1-yl → Benzene + C2H6
1 record matched ·C2H5 + ·CH2CH=CHCH3 → (E)-2-C6H12
1 record matched ·C2H5 + ·CH2CH=CHCH3 → 2-C6H12 (Unspecified)
1 record matched ·C2H5 + (E)-4-C8H16 → Other Products + C2H6
1 record matched ·C2H5 + I → C2H5I
1 record matched ·C2H5 + ClNCO → NCO(X2PI) + C2H5Cl
2 records matched ·C2H5 + NH2 → Products
1 record matched ·C2H5 + Si2D6 → Other Products + C2H5D
1 record matched ·C2H5 + SiD4 → C2H5D + SiD3
1 record matched ·C2H5 + DBr → C2H5D + Br·
8 records matched ·C2H5 + H· → ·CH3 + ·CH3
1 record matched ·C2H5 + H· → C2H4 + H2
2 records matched ·C2H5 + H· → C2H6
2 records matched ·C2H5 + H· → Products
1 record matched ·C2H5 + Cyclohexadienyl → 1,4-Cyclohexadiene, 3-ethyl-
1 record matched ·C2H5 + Cyclohexadienyl → 1,3-Cyclohexadiene. 5-ethyl-
1 record matched ·C2H5 + Cyclohexadienyl → Benzene + C2H6
1 record matched ·C2H5 + NO3 → Products
1 record matched ·C2H5 + NO2 → C2H5NO2
3 records matched ·C2H5 + NO2 → Products
3 records matched ·C2H5 + NO → C2H5NO
1 record matched ·C2H5 + NO → Products
2 records matched ·C2H5 + Br· → C2H4 + HBr
8 records matched ·C2H5 + HBr → C2H6 + Br·
3 records matched ·C2H5 + HI → C2H6 + I
1 record matched ·C2H5 + O3 → Products
1 record matched ·C2H5 + SiHCl3 → C2H6 + SiCl3
2 records matched ·C2H5 + N2O → CH3CH2O· + N2
1 record matched ·C2H5 + SiH4 → C2H6 + SiH3
1 record matched ·C2H5 + UF6 → C2H5F + UF5
1 record matched ·C2H5 + NF3 → Ethanamine, N,N-difluoro- + ·F
8 records matched ·C2H5 + Cl2 → C2H5Cl + ·Cl
22 records matched ·C2H5 + O2 → C2H5OO·
1 record matched ·C2H5 + O2 → CH3CH2O· + O·
2 records matched ·C2H5 + O2 → Oxirane + ·OH
3 records matched ·C2H5 + O2 → CH3CHO + ·OH
21 records matched ·C2H5 + O2 → C2H4 + HO2
4 records matched ·C2H5 + O2 → Products
1 record matched ·C2H5 + F2 → C2H5F + ·F
2 records matched ·C2H5 + D2 → C2H5D + D
2 records matched ·C2H5 + Br2 → C2H5Br + Br·
8 records matched ·C2H5 + I2 → C2H5I + I
2 records matched ·C2H5 + SO2 → C2H5SO2
1 record matched ·C2H5 + iso-C4H9 → C2H4 + iso-C4H10
2 records matched ·C2H5 + iso-C4H9 → C2H6 + iso-C4H8
1 record matched ·C2H5 + Cyclobutyl → C2H4 + Cyclobutane
1 record matched ·C2H5 + Cyclopentyl → C2H4 + Cyclopentane
1 record matched ·C2H5 + Cyclopentyl → C2H6 + Cyclopentene
1 record matched ·C2H5 + ·CH2F → CH3CH=CH2 + HF
2 records matched ·C2H5 + ·CH2F → C2H4 + CH3F
2 records matched ·C2H5 + ·CH2F → C2H6 + ·CHF
1 record matched ·C2H5 + Neopentyl → Other Products + C2H6
1 record matched ·C2H5 + (C2H5)2NOH → C2H6 + (C2H5)2NO
1 record matched ·C2H5 + CHCl2 → C2H4 + CH2Cl2
3 records matched ·C2H5 + C2F5 → C2H4 + C2F5H
2 records matched ·C2H5 + ·OH → C2H5OH
1 record matched ·C2H5 + ·OH → Products
1 record matched ·C2H5 + HO2 → CH3CH2O· + ·OH
1 record matched ·C2H5 + HO2 → C2H4 + H2O2
1 record matched ·C2H5 + HO2 → Products
1 record matched ·C2H5 + ·CCl3 → CH3CH=CCl2 + HCl
2 records matched ·C2H5 + ·CCl3 → CHCl3 + C2H4
4 records matched ·C2H5 + n-C3F7 → C2H4 + C2F5CF2H
1 record matched ·C2H5 + Cyclohexyl → C2H4 + Cyclohexane
1 record matched ·C2H5 + 1-C5H11 → C2H6 + 1-C5H10
2 records matched ·C2H5 + ·CHF2 → C2H4 + CH2F2
2 records matched ·C2H5 + ·CHF2 → C2H6 + ·CF2
1 record matched ·C2H5 + C2H3 → 1-C4H8
1 record matched ·C2H5 + C2H3 → C2H4 + C2H4
1 record matched ·C2H5 + C2H3 → C2H6 + C2H2
1 record matched ·C2H5 + C2H3 → Products
1 record matched ·C2H5 + HCO → C2H5CHO
1 record matched ·C2H5 + HCO → Products
1 record matched ·C2H5 + 2-hexyl radical → Other Products + C2H6
1 record matched ·C2H5 + 1-C4H9 → C2H4 + 1-C4H10
1 record matched ·C2H5 + 1-C4H9 → C2H6 + 1-C4H8
1 record matched ·C2H5 + 1-C4H9 → Products
1 record matched ·C2H5 + CH3CH2CH2CH(·)CH3 → Other Products + C2H6
1 record matched ·C2H5 + C2H5C(O)OCH2CH=CH2 → Adduct
1 record matched ·C2H5 + sec-C4H9 → Other Products + C2H6
3 records matched ·C2H5 + ·CF3 → C2H4 + CHF3
10 records matched ·C2H5 + ·CH3 → C3H8
8 records matched ·C2H5 + ·CH3 → CH4 + C2H4
4 records matched ·C2H5 + ·CH3 → Products
2 records matched ·C2H5 + CH3CH2O· → C2H6 + CH3CHO
2 records matched ·C2H5 + CH3CH2O· → C2H5OH + C2H4
2 records matched ·C2H5 + 1-C3H7 → C2H4 + C3H8
3 records matched ·C2H5 + 1-C3H7 → C2H6 + CH3CH=CH2
1 record matched ·C2H5 + C6H5O → Ethoxybenzene
19 records matched ·C2H5 + ·C2H5 → 1-C4H10
1 record matched ·C2H5 + ·C2H5 → C2H4 + ·C2H5
32 records matched ·C2H5 + ·C2H5 → C2H6 + C2H4
8 records matched ·C2H5 + ·C2H5 → Products
28 records matched ·C2H5 → C2H4 + H·
3 records matched iso-C3H7 + ·C2H5 → C2H4 + C3H8
5 records matched iso-C3H7 + ·C2H5 → C2H6 + CH3CH=CH2
2 records matched ·CH2CH=CH2 + ·C2H5 → 1-C5H10
2 records matched ·CH2CH=CH2 + ·C2H5 → C2H4 + CH3CH=CH2
2 records matched ·CH2CH=CH2 + ·C2H5 → C2H6 + CH2=C=CH2
1 record matched ·CH2CH=CH2 + ·C2H5 → Products
3 records matched tert-C4H9 + ·C2H5 → C2H4 + iso-C4H10
4 records matched tert-C4H9 + ·C2H5 → C2H6 + iso-C4H8
1 record matched tert-C4H9 → C2H4 + ·C2H5
1 record matched Si2H6 + ·C2H5 → C2H6 + Si2H5
9 records matched H2 + ·C2H5 → C2H6 + H·
1 record matched Gallium, triethyl- → ·C2H5 + (C2H5)2 Ga
1 record matched C2H5NO + NO + NO → ·C2H5 + N2 + NO3
1 record matched C2H5NO + ·C2H5 → (C2H5)2NO
1 record matched (C2H5)2NN + ·C2H5 → C2H6 + CH3CH2N=NCH(·)CH3
1 record matched (C2H5)2NN + ·C2H5 → Other Products + C2H6
5 records matched (C2H5)2NN → ·C2H5 + ·C2H5 + N2
1 record matched (CF3)2CO + ·C2H5 → 2-Butanone, 1,1,1-trifluoro- + ·CF3
1 record matched tert-C4H9OC2H5 → ·C2H5 + (CH3)3CO·
1 record matched CO + ·C2H5 → CH3CH2CO
1 record matched n-C5H11C≡CH + ·C2H5 → Other Products + C2H6
1 record matched Ethane, 1,1'-tellurobis- → ·C2H5 + CH3CH2Te
1 record matched Ethane, 1,1'-tellurobis- → Other Products + ·C2H5
1 record matched (C2H5)2Hg + ·C2H5 → Other Products + Hg
2 records matched (C2H5)2Hg → ·C2H5 + C2H5Hg·
1 record matched (E)-2-C4H8 + O· → ·C2H5 + CH3CO
1 record matched CH3C(O)C(O)C2H5 + ·C2H5 → Other Products + C2H6
1 record matched (C2H5)4Sn → ·C2H5 + (C2H5)3Sn
1 record matched tert-C5H11NH2 → ·C2H5 + (CH3)2CNH2
1 record matched 1-C7H14 + ·C2H5 → Other Products + C2H6
1 record matched 1-C7H14 + ·C2H5 → CH3CH2CH2CH(·)(CH2)4CH3
2 records matched CH2=CHCH2CH2CH=CH2 + ·C2H5 → CH2=CHCH2CH2CH(·)CH2CH2CH3
1 record matched (C2H5)2C(CH32 → ·C2H5 + (CH3)2C(·)CH2CH3
2 records matched (C2H5)2Zn → Other Products + ·C2H5
1 record matched CH2=C=CH2 + ·C2H5 → Adduct
1 record matched CH2(OC2H5)2 → CH3CH2OCH2O(.) + ·C2H5
1 record matched (CH3CO)2 + ·C2H5 → CH3C(O)C(O)C2H5 + ·CH3
1 record matched (CH3CO)2 + ·C2H5 → C2H5COCH3 + CH3CO
1 record matched (CH3CO)2 + ·C2H5 → Other Products + C2H6
1 record matched C2H5F + K → ·C2H5 + KF
1 record matched (C2H5)2S + H· → C2H5SH + ·C2H5
1 record matched (C2H5)2S + ·C2H5 → C2H6 + C2H5SCHCH3
1 record matched N2H4 + ·C2H5 → C2H6 + NH2NH
2 records matched Cyclopentane + ·C2H5 → C2H6 + Cyclopentyl
1 record matched 1-C7H16 + ·C2H5 → Other Products + C2H6
1 record matched (CH3)2NH + ·C2H5 → C2H6 + (CH3)2N
1 record matched (CH3)2NH + ·C2H5 → Other Products + C2H6
1 record matched C2H5CHO + ·C2H5 → C2H6 + ·CH2CH2CHO
1 record matched C2H5CHO + ·C2H5 → C2H6 + CH3C(·)HCHO
7 records matched C2H5CHO + ·C2H5 → C2H6 + CH3CH2CO
4 records matched CH3CH=CH2 + O· → ·C2H5 + HCO
1 record matched CH3CH=CH2 + ·OH → CH2O + ·C2H5
1 record matched 1-C8H16 + ·C2H5 → Other Products + C2H6
1 record matched Cyclohexene + ·C2H5 → C2H6 + 3-Cyclohexenyl
2 records matched 1-C6H14 + ·C2H5 → Other Products + C2H6
1 record matched HC(O)OC2H5 + ·C2H5 → C2H6 + CH3CH2OC(O)·
2 records matched CH2=CHOC2H5 → ·C2H5 + *CH2C(O)H
1 record matched n-C3H7CN → ·C2H5 + CH2CN
1 record matched 1-C5H10 → ·CH2CH=CH2 + ·C2H5
1 record matched n-C5H12 + ·C2H5 → Other Products + C2H6
6 records matched Toluene + ·C2H5 → C2H6 + Benzyl
1 record matched CH2=CHCH2OH + ·C2H5 → C2H6 + CH(OH)CH=CH2
1 record matched CH2=CHCH2OH + ·C2H5 → CH3CH2CH2CH(·)CH2OH
1 record matched C2H5CN + ·OH → HO-C≡N + ·C2H5
3 records matched C2H5CN + ·OH → HN=C=O + ·C2H5
1 record matched 1-C4H8 + O· → ·C2H5 + CH3CO
1 record matched 1-C4H8 + H· → C2H4 + ·C2H5
1 record matched 1-C4H8 + ·C2H → Vinylacetylene + ·C2H5
3 records matched 1-C4H10 + ·C2H5 → Products
11 records matched 1-C4H10 → ·C2H5 + ·C2H5
1 record matched 1-butylbenzene → ·C2H5 + 2-phenylethyl
2 records matched Ethoxybenzene → ·C2H5 + C6H5O
3 records matched 1-Phenylpropane → ·C2H5 + Benzyl
2 records matched Ethylbenzene + H· → Benzene + ·C2H5
1 record matched (C2H5)3B + (CH3)3CO· → Other Products + ·C2H5
1 record matched (C2H5)3B + ·CH3 → Borane, diethylmethyl- + ·C2H5
3 records matched (C2H5)2CO + ·C2H5 → Other Products + C2H6
1 record matched 2-Ethoxyphenol → ·C2H5 + 2-Hydroxyphenoxy radical
6 records matched C2H5NO2 → ·C2H5 + NO2
1 record matched C2H5COCH3 + ·CF3 → CHF3 + H2C=C=O + ·C2H5
1 record matched C2H5COCH3 → ·C2H5 + CH3CO
1 record matched sec-C4H9OH → ·C2H5 + CH3CH(·)OH
1 record matched (CH3)3CCH2CH3 → tert-C4H9 + ·C2H5
1 record matched (CH3)4Si + ·C2H5 → C2H6 + (CH3)3SiCH2
1 record matched Methyloxirane → ·C2H5 + HCO
1 record matched (CH3)3N + ·C2H5 → C2H6 + CH2N(CH3)2
1 record matched iso-C4H10 + ·C2H5 → Other Products + C2H6
1 record matched C2H5SH + H· → ·C2H5 + H2S
1 record matched CH3CHO + ·CH → CO + ·C2H5
1 record matched CH3CHO + ·C2H5 → C2H6 + CH3CO
1 record matched C2H5I + I → ·C2H5 + I2
3 records matched C2H5I + H· → ·C2H5 + HI
1 record matched C2H5I + Na → ·C2H5 + NaI
6 records matched C2H5I + K → ·C2H5 + KI
1 record matched C2H5I + ·CH3 → CH3I + ·C2H5
12 records matched C2H5I → ·C2H5 + I
1 record matched C2H5Cl + ·CH2 → ·C2H5 + ·CH2Cl
1 record matched C2H5Cl + SiCl3 → ·C2H5 + SiCl4
1 record matched C2H5Cl + (CH3)3Si· → (CH3)3SiCl + ·C2H5
1 record matched C2H5Cl + H· → ·C2H5 + HCl
2 records matched C2H5Cl + Cs → ·C2H5 + CsCl
2 records matched C2H5Cl + Na → ·C2H5 + NaCl
2 records matched C2H5Cl + K → ·C2H5 + KCl
1 record matched C2H5Cl + Pb → ·C2H5 + PbCl
1 record matched C3H8 + ·C2H5 → Other Products + C2H6
20 records matched C3H8 → ·C2H5 + ·CH3
2 records matched C2H5Br + SiCl3 → ·C2H5 + Silane, bromotrichloro-
4 records matched C2H5Br + H· → ·C2H5 + HBr
1 record matched C2H5Br + Cs → ·C2H5 + CsBr
3 records matched C2H5Br + Na → ·C2H5 + NaBr
2 records matched C2H5Br + Rb → ·C2H5 + RbBr
1 record matched C2H5Br + Pb → ·C2H5 + Lead bromide
1 record matched C2H5Br + ·CF3 → CF3Br + ·C2H5
1 record matched CH3NH2 + ·C2H5 → C2H6 + CH3NH
1 record matched CH3NH2 + ·C2H5 → Other Products + C2H6
1 record matched C2H2 + ·C2H5 → CH3CH2CH=CH·
110 records matched C2H4 + H· → ·C2H5
1 record matched C2H4 + HOC(·)O → CO2 + ·C2H5
3 records matched C2H4 + ·C2H5 → 1-C4H9
1 record matched C2H4 + ·C2H5 → CH3CH=CH2 + ·CH3
1 record matched C2H4 + ·C2H5 → 1-C4H8 + H·
6 records matched C2H4 + ·C2H5 → C2H6 + C2H3
1 record matched C2H4 + Cyclopentene → ·C2H5 + Cyclopentenyl
4 records matched C2H4 + C2H4 → ·C2H5 + C2H3
1 record matched C2H6 + FC(O)O· → ·C2H5 + FC(O)OH
1 record matched C2H6 + CCCN → HCCCN + ·C2H5
1 record matched C2H6 + ·CH2 → ·C2H5 + ·CH3
40 records matched C2H6 + ·Cl → ·C2H5 + HCl
6 records matched C2H6 + CF3O → CF3OH + ·C2H5
12 records matched C2H6 + O· → ·C2H5 + ·OH
1 record matched C2H6 + D → ·C2H5 + HD
18 records matched C2H6 + ·F → ·C2H5 + HF
1 record matched C2H6 + I → ·C2H5 + HI
1 record matched C2H6 + NH → ·C2H5 + NH2
4 records matched C2H6 + NH2 → ·C2H5 + NH3
1 record matched C2H6 + OD → ·C2H5 + HDO
24 records matched C2H6 + H· → H2 + ·C2H5
1 record matched C2H6 + NO3 → ·C2H5 + HNO3
10 records matched C2H6 + Br· → ·C2H5 + HBr
2 records matched C2H6 + O2 → ·C2H5 + HO2
1 record matched C2H6 + S → ·C2H5 + SH
1 record matched C2H6 + C2F5 → C2F5H + ·C2H5
53 records matched C2H6 + ·OH → ·C2H5 + H2O
7 records matched C2H6 + HO2 → ·C2H5 + H2O2
4 records matched C2H6 + ·CCl3 → CHCl3 + ·C2H5
1 record matched C2H6 + ·CHF2 → CH2F2 + ·C2H5
1 record matched C2H6 + C2H3 → C2H4 + ·C2H5
1 record matched C2H6 + 1-C4H9 → 1-C4H10 + ·C2H5
1 record matched C2H6 + Phenyl → Benzene + ·C2H5
3 records matched C2H6 + ·CF3 → CHF3 + ·C2H5
9 records matched C2H6 + ·CH3 → CH4 + ·C2H5
4 records matched C2H6 + CH3O· → CH3OH + ·C2H5
6 records matched C2H6 + ·C2H → C2H2 + ·C2H5
4 records matched C2H6 + CD3 → CHD3 + ·C2H5
2 records matched C2H6 + iso-C3H7 → C3H8 + ·C2H5
1 record matched C2H6 + CH2=C=CH2 → ·CH2CH=CH2 + ·C2H5
2 records matched C2H6 → ·C2H5 + H·
1 record matched CH4 + ·C2H5 → C2H6 + ·CH3
2 records matched Benzene + ·C2H5 → C2H6 + Phenyl
1 record matched n-C4H9OH → ·C2H5 + HOCH2CH2·
1 record matched Acetone + (C2H5)3B → Other Products + ·C2H5
1 record matched C2H5OH + N → ·C2H5 + HNO
1 record matched C2H5OH + H· → ·C2H5 + H2O
2 records matched C2H5OH → ·C2H5 + ·OH
3 records matched (C2H5)2O + ·C2H5 → C2H6 + 2-C4H9O
1 record matched (C2H5)2O + ·C2H5 → Other Products + C2H6
6 records matched (C2H5)2O → ·C2H5 + CH3CH2
15 records matched CN + C2H6 → HCN + ·C2H5
2 records matched CCl4 + ·C2H5 → C2H5Cl + ·CCl3
1 record matched Cl(2P1/2) + C2H6 → ·C2H5 + HCl
2 records matched O(1D) + C2H6 → ·C2H5 + ·OH
4 records matched CH3CH2CH(O.)CH2CH3 → C2H5CHO + ·C2H5
3 records matched 3-pentoxy radical → C2H5CHO + ·C2H5
1 record matched CH3CH2CH2CHO → ·C2H5 + CH2=CHO·
1 record matched O(3P) + C3H8 → ·C2H5 + CH3
1 record matched O(3P) + C2H6 → ·C2H5 + ·OH
2 records matched CH3CHOCH2CH3 → CH3CHO + ·C2H5
3 records matched CH3CH2C(CH3)2O(·) → Acetone + ·C2H5
2 records matched CH3CH2CH2CH(·)CH(CH3)2 → (CH3)2CHCH=CH2 + ·C2H5
2 records matched (CH3)2C(·)CH2CH2CH3 → iso-C4H8 + ·C2H5
2 records matched CH3CH2CH2O· → CH2O + ·C2H5
1 record matched NCO(X2PI) + ·C2H5 → C2H5NCO
1 record matched NCO(X2PI) + ·C2H5 → HCN + CH3CHO
1 record matched NCO(X2PI) + ·C2H5 → C2H4 + C#N(OH)
1 record matched NCO(X2PI) + ·C2H5 → C2H4 + HN=C=O
1 record matched NCO(X2PI) + ·C2H5 → Products
1 record matched NCO(X2PI) + C2H6 → HN=C=O + ·C2H5
1 record matched 3-C8H17 → 1-C6H12 + ·C2H5
2 records matched 1-phenylbutyl → Styrene + ·C2H5
1 record matched CH3CH2CH2CO → H2C=C=O + ·C2H5
3 records matched CH3CH2CH(CH3)O· → CH3CHO + ·C2H5
2 records matched 4-C7H15 → 1-C5H10 + ·C2H5
3 records matched CH3CH2CH2C(·)HOH → CH2=CHOH + ·C2H5
1 record matched 3-C7H15 → 1-C5H10 + ·C2H5
2 records matched 4-C8H17 → 1-C6H12 + ·C2H5
3 records matched 3-hexyl radical → 1-C4H8 + ·C2H5
3 records matched n-C3H7O → CH2O + ·C2H5
4 records matched CH3CH2CO → CO + ·C2H5
1 record matched CH3CH2OC(O)· → CO2 + ·C2H5
2 records matched C2H5C(CH3)2O(·) → Acetone + ·C2H5
1 record matched ·CH2CH(CH3)CH2CH3 → CH3CH=CH2 + ·C2H5
1 record matched iso-C4H9 → C2H4 + ·C2H5
1 record matched 1-C8H17 → 1-C6H12 + ·C2H5
1 record matched Cyclooctyl radical + O· → CH2=CHCH2CH2CH2CHO + ·C2H5
2 records matched i-C3H7O → CH2O + ·C2H5
1 record matched 2-C7H15 → 1-C5H10 + ·C2H5
1 record matched 1-C7H15 → 1-C5H10 + ·C2H5
1 record matched 2-C8H17 → 1-C6H12 + ·C2H5
1 record matched C2H5OO· → ·C2H5 + O2
1 record matched Cyclohexyl + O· → ·C2H5 + CH2=CHCH2CHO
1 record matched CH3CH2OOH → ·C2H5 + HO2
1 record matched 1-hexyl radical → 1-C4H8 + ·C2H5
1 record matched 1-C5H11 → CH3CH=CH2 + ·C2H5
1 record matched CH3CH2CH=CH· → C2H2 + ·C2H5
1 record matched 2-hexyl radical → 1-C4H8 + ·C2H5
11 records matched 1-C4H9 → C2H4 + ·C2H5
5 records matched CH3CH2CH2CH(·)CH3 → CH3CH=CH2 + ·C2H5
2 records matched CH3CH(·)OH + H· → ·C2H5 + ·OH
1 record matched ·CH3 + ·CH2 → ·C2H5
1 record matched ·CH3 + ·CH2Cl → ·C2H5 + ·Cl
2 records matched ·CH3 + ·CH3 → ·C2H5 + H·
1 record matched 2-C4H9O → CH3CHO + ·C2H5
1 record matched CH3CH2O· + H· → ·C2H5 + ·OH
1 record matched ·C2H5 + NCO → C2H5OC≡N
1 record matched ·C2H5 + NCO → C2H5NCO
1 record matched ·C2H5 + NCO → C2H4 + HO-C≡N
1 record matched ·C2H5 + NCO → C2H4 + HN=C=O
1 record matched ·C2H5 + N → H· + CH2=CHNH
1 record matched ·C2H5 + N → ·CH3 + H2C=N
1 record matched ·C2H5 + N → CH3C(·)=NH + H·
1 record matched ·C2H5 + N → (3)NH + C2H4
1 record matched ·C2H5 + O· → CH3CH2
2 records matched ·C2H5 + O· → CH3CHO + H·
3 records matched ·C2H5 + O· → C2H4 + ·OH
2 records matched ·C2H5 + O· → CH2O + ·CH3
1 record matched ·C2H5 + ·F → C2H5F
1 record matched ·C2H5 + HNO → C2H6 + NO
18 records matched ·C2H5 + NH2 → C2H6 + NH
1 record matched ·C2H5 + DBr → C2H5D + Br·
2 records matched ·C2H5 + H· → C2H4 + H2
3 records matched ·C2H5 + H· → C2H6
1 record matched ·C2H5 + NO2 → CH3CH2O· + NO
2 records matched ·C2H5 + NO2 → C2H5ONO
4 records matched ·C2H5 + HBr → C2H6 + Br·
1 record matched ·C2H5 + HI → C2H6 + I
1 record matched ·C2H5 + O3 → CH3CH2O· + O2
1 record matched ·C2H5 + H2S → C2H6 + SH
5 records matched ·C2H5 + O2 → C2H5OO·
7 records matched ·C2H5 + O2 → C2H4 + HO2
1 record matched ·C2H5 + D2 → C2H5D + D
1 record matched ·C2H5 + HCl → C2H5Cl + H·
2 records matched ·C2H5 + HCl → C2H6 + ·Cl
1 record matched ·C2H5 + I2 → C2H5I + I
1 record matched ·C2H5 + CH3CH(·)CH2OH → CH3CH2CH(CH3)CH2OH
1 record matched ·C2H5 + HNC → Products
1 record matched ·C2H5 + HOCH2CH2CH2· → n-C5H11OH
1 record matched ·C2H5 + (CH3)2CS → Adduct
1 record matched ·C2H5 + ·OH → CH3CH + H2O
1 record matched ·C2H5 + ·OH → ·C2H5 + H2O
1 record matched ·C2H5 + ·OH → C2H4 + H2O
1 record matched ·C2H5 + ·OH → C2H5OH
1 record matched ·C2H5 + HO2 → CH3CH2OOH
1 record matched ·C2H5 + HO2 → CH3CH2O· + ·OH
1 record matched ·C2H5 + HO2 → CH3CHO + H2O
1 record matched ·C2H5 + HO2 → C2H4 + H2O2
1 record matched ·C2H5 + HO2 → C2H6 + O2
2 records matched ·C2H5 + C2H3 → C2H4 + C2H4
1 record matched ·C2H5 + C2H3 → C2H6 + C2H2
1 record matched ·C2H5 + C2H3 → Products
1 record matched ·C2H5 + HCO → C2H5CHO
1 record matched ·C2H5 + 1-C4H9 → C2H4 + 1-C4H10
1 record matched ·C2H5 + ·CH3 → 1-C3H7
4 records matched ·C2H5 + ·CH3 → C3H8
1 record matched ·C2H5 + ·CH3 → C2H6 + ·CH2
4 records matched ·C2H5 + ·CH3 → CH4 + C2H4
1 record matched ·C2H5 + CH3CH2O· → (C2H5)2O
7 records matched ·C2H5 + ·C2H5 → 1-C4H10
2 records matched ·C2H5 + ·C2H5 → C2H6 + C2H4
1 record matched ·C2H5 → ·CH3 + ·CH2
1 record matched ·C2H5 → ·C2H5
7 records matched ·C2H5 → C2H4 + H·
1 record matched iso-C3H7 + ·C2H5 → iso-C5H12
2 records matched iso-C3H7 + ·C2H5 → C2H4 + C3H8
2 records matched iso-C3H7 + ·C2H5 → C2H6 + CH3CH=CH2
1 record matched ·CH2CH=CH2 + ·C2H5 → C2H4 + CH3CH=CH2
1 record matched tert-C4H9 + ·C2H5 → (CH3)3CCH2CH3
6 records matched H2 + ·C2H5 → C2H6 + H·
1 record matched (Z)-CH3CH=CHCN + ·C2H5 → Adduct
1 record matched CH2S + ·C2H5 → Adduct
1 record matched (C2H5)2NN → ·C2H5 + ·C2H5 + N2
1 record matched C2H5CH2C(CH3)=CH2 + ·C2H5 → Adduct
1 record matched CH3CH2Si(CH3)2H → ·C2H5 + (CH3)2SiH
1 record matched CO + ·C2H5 → CH3CH2CO
1 record matched CH2=C(CH3)CH2CH2C(CH3)=CH2 + ·C2H5 → Other Products + C2H6
1 record matched CH2=C(CH3)CH2CH2C(CH3)=CH2 + ·C2H5 → Adduct
1 record matched (C2H5)2Hg + ·C2H5 → Other Products + C2H6
1 record matched (C2H5)2Hg → ·C2H5 + C2H5Hg·
1 record matched (C2H5)2Hg → ·C2H5 + ·C2H5 + Hg
1 record matched (E)-CH3CH=CHCN + ·C2H5 → Adduct
1 record matched C2H5SCH3 + ·OH → ·C2H5 + CH3SOH
1 record matched Methyl butanoate → ·C2H5 + ·CH2C(O)OCH3
1 record matched 1,3-Cyclohexadiene + ·C2H5 → C2H6 + Cyclohexadienyl
1 record matched 1,3-Cyclohexadiene + ·C2H5 → Adduct
1 record matched CH3C(O)OCH2CH=CH2 + ·C2H5 → Adduct
1 record matched CH2=CHOH + ·C2H5 → CH3CH2CH2C(·)HOH
1 record matched CH2=CHOH + ·C2H5 → CH3CH2CH(OH)CH2·
1 record matched 1,3,5-Cycloheptatriene + ·C2H5 → Adduct
1 record matched CH2=C(CH3)C(CH3)=CH2 + ·C2H5 → Adduct
2 records matched H2C=C=O + ·CH3 → CO + ·C2H5
1 record matched H2C=C=O + ·C2H5 → CH3CH2CH2CO
1 record matched H2C=C=O + ·C2H5 → ·CH2C(O)C2H5
1 record matched CF3OF + ·C2H5 → C2H5F + CF3O
1 record matched Cyclobutane → ·C2H5 + C2H3
1 record matched 1-C7H16 + ·C2H5 → C2H6 + 3-C7H15
1 record matched 1-C7H16 + ·C2H5 → C2H6 + 2-C7H15
1 record matched 1-C7H16 + ·C2H5 → C2H6 + 1-C7H15
2 records matched 1-C7H16 → ·C2H5 + 1-C5H11
1 record matched CH3C(O)OC2H5 → ·C2H5 + CH3C(O)O
1 record matched CH3CH2CH(CH3)CH2OH → ·C2H5 + CH3CH(·)CH2OH
1 record matched sec-Butylbenzene → ·C2H5 + 1-phenylethyl
1 record matched CH2=C(CH3)CN + ·C2H5 → Adduct
1 record matched (CH3)2NH + ·C2H5 → C2H6 + CH2NHCH3
1 record matched 1-C10H22 → ·C2H5 + 1-C8H17
1 record matched C2H5CHO → ·C2H5 + HCO
1 record matched 2,5-Norbornadiene + ·C2H5 → Adduct
1 record matched iso-C4H8 + ·C2H5 → Adduct
1 record matched CH3CH=CH2 + O· → ·C2H5 + HCO
1 record matched CH3CH=CH2 + C → ·C2H5 + ·C2H
1 record matched CH3CH=CH2 + 1-C3H7 → 1-C4H8 + ·C2H5
3 records matched CH3CH=CH2 + ·C2H5 → CH3CH2CH2CH(·)CH3
1 record matched CH3CH=CH2 + ·C2H5 → C2H6 + ·CH2CH=CH2
1 record matched CH3(CH2)10CH3 → ·C2H5 + 1-C10H21
1 record matched 1-C8H16 + ·C2H5 → Other Products + C2H6
2 records matched 1-C8H16 + ·C2H5 → Adduct
1 record matched n-C4H9OCH=CH2 + ·C2H5 → Adduct
2 records matched HC(O)OC2H5 → ·OC(O)H + ·C2H5
1 record matched 1-C5H10 → ·CH2CH=CH2 + ·C2H5
1 record matched CH3CO2CH=CH2 + ·C2H5 → Adduct
1 record matched CH3CH=NOH (unspecified) + ·C2H5 → 1-C4H10 + NO
2 records matched CH2CHCN + ·C2H5 → Adduct
1 record matched 1-butyne + Phenyl → Phenylacetylene + ·C2H5
1 record matched 1,3-Butadiene + ·C2H5 → CH2=CHCH(C2H5)CH2(·)
1 record matched 1,3-Butadiene + ·C2H5 → CH3CH2CH2CH=CHCH2·
1 record matched 1-C4H8 + C2H3 → 1,3-Butadiene + ·C2H5
1 record matched 1-C4H8 + ·C2H5 → 3-hexyl radical
1 record matched 1-C4H10 + ·C2H5 → Products
2 records matched 1-C4H10 → ·C2H5 + ·C2H5
1 record matched C2H5C(O)OC2H5 → ·C2H5 + CH3CH2C(O)O·
1 record matched C2H5C(O)OC2H5 → ·C2H5 + CH3CH2OC(O)·
1 record matched 1-butylbenzene → ·C2H5 + 2-phenylethyl
1 record matched Ethoxybenzene → ·C2H5 + C6H5O
1 record matched Styrene + ·C2H5 → Adduct
1 record matched Ethylbenzene → ·C2H5 + Phenyl
1 record matched C2H5COCH3 → ·C2H5 + CH3CO
1 record matched sec-C4H9OH → ·C2H5 + CH3CH(·)OH
1 record matched CH3CHO + ·C2H5 → CH3CH2CH(CH3)O·
1 record matched CH3CHO + ·C2H5 → C2H5OCH2CH2·
1 record matched CH3CHO + ·C2H5 → CH3CHOCH2CH3
1 record matched C2H5I + H· → ·C2H5 + HI
1 record matched C2H5I + CH3CO → CH3C(O)I + ·C2H5
1 record matched C2H5I → ·C2H5 + I
3 records matched C2H5Cl + H· → ·C2H5 + HCl
1 record matched C2H5Cl + Na → ·C2H5 + NaCl
1 record matched C2H5Cl + CH3CO → CH3COCl + ·C2H5
1 record matched C2H5Cl → ·C2H5 + ·Cl
8 records matched C3H8 → ·C2H5 + ·CH3
1 record matched C2H5Br + CH3CO → CH3COBr + ·C2H5
1 record matched CH3NH2 + ·C2H5 → C2H6 + CH2NH2
1 record matched C2H4 + COH → CO + ·C2H5
7 records matched C2H4 + H· → ·C2H5
1 record matched C2H4 + HCO → CO + ·C2H5
9 records matched C2H4 + ·C2H5 → 1-C4H9
1 record matched C2H4 + ·C2H5 → C2H6 + C2H3
1 record matched C2H4 + ·C2H5 → Adduct
1 record matched C2H4 + tert-C4H9 → iso-C4H8 + ·C2H5
1 record matched C2H4 + H2 → ·C2H5 + H·
1 record matched C2H4 + CH3CH=CH2 → ·CH2CH=CH2 + ·C2H5
3 records matched C2H4 + C2H4 → ·C2H5 + C2H3
1 record matched C2H6 + ·CH2 → ·C2H5 + ·CH3
3 records matched C2H6 + CH≡CC≡C → 1,3-Butadiyne + ·C2H5
8 records matched C2H6 + ·Cl → ·C2H5 + HCl
4 records matched C2H6 + O· → ·C2H5 + ·OH
10 records matched C2H6 + D → ·C2H5 + HD
1 record matched C2H6 + ·F → ·C2H5 + HF
1 record matched C2H6 + I → ·C2H5 + HI
1 record matched C2H6 + SH → ·C2H5 + H2S
17 records matched C2H6 + NH → ·C2H5 + NH2
3 records matched C2H6 + NH2 → ·C2H5 + NH3
13 records matched C2H6 + H· → H2 + ·C2H5
1 record matched C2H6 + NO3 → ·C2H5 + HNO3
2 records matched C2H6 + NO2 → ·C2H5 + HNO2
2 records matched C2H6 + NO2 → cis-HONO + ·C2H5
2 records matched C2H6 + NO2 → trans-HONO + ·C2H5
1 record matched C2H6 + NO → ·C2H5 + HNO
2 records matched C2H6 + O2 → ·C2H5 + HO2
10 records matched C2H6 + ·OH → ·C2H5 + H2O
5 records matched C2H6 + HO2 → ·C2H5 + H2O2
2 records matched C2H6 + C2H5OO· → ·C2H5 + CH3CH2OOH
4 records matched C2H6 + C2H3 → C2H4 + ·C2H5
1 record matched C2H6 + HCO → CH2O + ·C2H5
7 records matched C2H6 + ·CH3 → CH4 + ·C2H5
2 records matched C2H6 + CH3O2· → ·C2H5 + CH3OOH
1 record matched C2H6 + ·C2H → C2H2 + ·C2H5
1 record matched C2H6 + ·C2H5 → C2H6 + ·C2H5
1 record matched C2H6 + ·CH2CH=CH2 → CH3CH=CH2 + ·C2H5
2 records matched C2H6 + C2H2 → ·C2H5 + C2H3
1 record matched C2H6 → ·C2H5 + H·
1 record matched CH4 + ·CH3 → H2 + ·C2H5
1 record matched CH4 + ·C2H5 → C2H6 + ·CH3
1 record matched CH4 + ·C2H5 → CH4 + ·C2H5
1 record matched n-C5H11OH → ·C2H5 + HOCH2CH2CH2·
1 record matched n-C4H9OH → ·C2H5 + HOCH2CH2·
1 record matched n-C3H7OH → ·C2H5 + (·)CH2OH
1 record matched Acetone + ·C2H5 → Adduct
1 record matched C2H5OH + H· → ·C2H5 + H2O
1 record matched C2H5OH + ·CH3 → CH3OH + ·C2H5
6 records matched C2H5OH → ·C2H5 + ·OH
2 records matched (C2H5)2O → ·C2H5 + CH3CH2
2 records matched CN + C2H6 → HCN + ·C2H5
1 record matched CH2O + C2H3 → CO + ·C2H5
2 records matched CH2O + ·C2H5 → n-C3H7O
1 record matched CH2O + ·C2H5 → Adduct
1 record matched CH2O + ·C2H5 → C2H5OCH2(·)
1 record matched O(3P) + C2H6 → ·C2H5 + ·OH
2 records matched CH2=CHCH(·)CH2CH2CH3 → 1,3-Butadiene + ·C2H5
5 records matched 3-pentoxy radical → C2H5CHO + ·C2H5
1 record matched CH3CH2CH(O)CH2OCH3 → CH3OCH2CHO + ·C2H5
1 record matched O(3P) + C2H6 → ·C2H5 + ·OH
1 record matched O2(1Delta_g) + ·C2H5 → C2H4 + HO2
4 records matched CH3CHOCH2CH3 → CH3CHO + ·C2H5
1 record matched CH3CH2C(CH3)2O(·) → Acetone + ·C2H5
1 record matched CH3CH2CH(OH)CH2· → CH2=CHOH + ·C2H5
1 record matched CH3SiH2C2H5 + CH3CO → CH3SiH2C(O)CH3 + ·C2H5
1 record matched CH3GeH2C2H5 + CH3CO → CH3GeH2COCH3 + ·C2H5
1 record matched CH3SnH2C2H5 + CH3CO → CH3SnH2COCH3 + ·C2H5
1 record matched CH3CH2CH2CH(·)CH(CH3)2 → (CH3)2CHCH=CH2 + ·C2H5
2 records matched C2H5OCH2(·) → CH2O + ·C2H5
1 record matched CH3CH2CH(OOH)CH2· → ·C2H5 + CH2=CHOOH
1 record matched CH3CH2C(CH3)(OOH)CH2· → CH2=C(CH3)OOH + ·C2H5
1 record matched CH3CH2CH(CH2·)CH2OOH → ·C2H5 + CH2=CHOOH
1 record matched ·CH2C(O)C2H5 → H2C=C=O + ·C2H5
1 record matched O=C(·)OCH2CH2SCH2CH3 → ·C2H5 + 1,3-Oxathiolan-2-one
1 record matched O=C(·)OCH2CH2CH2SCH2CH3 → 1,3-Oxathian-2-one + ·C2H5
1 record matched CH3CH=CHCH(·)CH2CH2CH3 → CH2=CHCH=CHCH3 + ·C2H5
1 record matched CH2=C(CH3)CH(·)CH2CH2CH3 → CH2=C(CH3)CH=CH2 + ·C2H5
1 record matched CH2=CHC(CH3)(·)CH2CH2CH3 → CH2=C(CH3)CH=CH2 + ·C2H5
1 record matched CH2=CHCH(·)CH(CH3)CH2CH3 → CH2=CHCH=CHCH3 + ·C2H5
2 records matched CH3CH(·)OCH2CH3 → CH3CHO + ·C2H5
1 record matched CH3CH2CH=C(·)C(O)OCH3 → HC≡CCOOCH3 + ·C2H5
1 record matched 4-C10H21 → 1-C8H16 + ·C2H5
1 record matched CH3CH2CH2CH(·)OC(O)H → Vinyl formate + ·C2H5
1 record matched CH3CH2CH2CH(·)C(O)OCH3 → CH2=CHC(O)OCH3 + ·C2H5
1 record matched 4-C12H25 → 1-C10H20 + ·C2H5
1 record matched (·)CH2CH2CH2CH2OH → CH2=CHOH + ·C2H5
1 record matched CH3CH2CH(O·)CH2CH2CH3 → n-C4H9CHO + ·C2H5
1 record matched Propyl Radical + C2H4 → CH3CH=CH2 + ·C2H5
1 record matched CH3CH2CH2CH(·)CH2OOH → CH3CH=CHCH2OOH + ·C2H5
1 record matched (CH3)2C(·)OCH2CH3 → Acetone + ·C2H5
1 record matched CH3CH2CH2O· → CH2O + ·C2H5
1 record matched O2(b1Sigma_g+) + C2H6 → ·C2H5 + HO2

Search returned 1789 records.