Kinetics Database Logo

Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences


Rate Our Products and Services


Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty


Administrative Links

NIST home page

MML home page

Chemical and Biochemical Reference Data Division

MML home page

Chemical and Biochemical Reference Data Division

  NIST Logo Home
©NIST, 2013
Accessibility information

Search Results

Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
2 records matched CH3OOH → CH3O· + ·OH
1 record matched ·CH3 + NO2 → CH3O· + NO
5 records matched ·CH3 + O2 → CH3O· + O·
3 records matched ·CH3 + HO2 → CH3O· + ·OH
1 record matched CH3O· + ·CH2 → CH2O + ·CH3
1 record matched CH3O· + O· → CH2O + ·OH
3 records matched CH3O· + O· → Products
1 record matched CH3O· + CH3C(O)O → Products
3 records matched CH3O· + H· → CH2O + H2
10 records matched CH3O· + NO2 → CH3ONO2
1 record matched CH3O· + NO2 → CH2O + HNO2
1 record matched CH3O· + NO2 → cis-HONO + CH2O
12 records matched CH3O· + NO → CH3ONO
3 records matched CH3O· + NO → CH2O + HNO
14 records matched CH3O· + O2 → CH2O + HO2
1 record matched CH3O· + iso-C4H9 → Propane, 1-methoxy-2-methyl-
1 record matched CH3O· + iso-C4H9 → CH2O + iso-C4H10
1 record matched CH3O· + ·OH → CH2O + H2O
1 record matched CH3O· + HO2 → CH2O + H2O2
1 record matched CH3O· + CH3CO → CH3OH + H2C=C=O
1 record matched CH3O· + CH3CO → CH2O + CH3CHO
1 record matched CH3O· + C2H3 → CH2O + C2H4
1 record matched CH3O· + HCO → CH3OH + CO
1 record matched CH3O· + (·)CH2OH → CH2O + CH3OH
1 record matched CH3O· + ·CH3 → (CH3)2O
1 record matched CH3O· + ·CH3 → CH2O + CH4
1 record matched CH3O· + ·CH3 → Products
1 record matched CH3O· + CH3O· → (CH3O)2
1 record matched CH3O· + CH3O· → CH2O + CH3OH
1 record matched CH3O· + CH3O· → Products
6 records matched CH3O· → CH2O + H·
1 record matched 1-C3H7 + CH3O· → CH3CH2CH2OCH3
1 record matched 1-C3H7 + CH3O· → CH2O + C3H8
1 record matched CH3O2· + CH3C(O)CH2OO· → CH3C(O)CH2O· + CH3O· + O2
1 record matched CH3O2· + ·CH2 → CH2O + CH3
2 records matched CH3O2· + CH3C(O)OO(·) → CH3O· + O2 + CH3C(O)O
1 record matched CH3O2· + ·Cl → CH3O· + ClO
2 records matched CH3O2· + O· → CH3O· + O2
2 records matched CH3O2· + ClO → CH3O· + OClO
3 records matched CH3O2· + ClO → CH3O· + ClOO
1 record matched CH3O2· + H· → CH3O· + ·OH
1 record matched CH3O2· + NO3 → CH3O· + O2 + NO2
8 records matched CH3O2· + NO → CH3O· + NO2
1 record matched CH3O2· + SO2 → CH3O· + SO3
1 record matched CH3O2· + iso-C4H9 → CH2O + iso-C3H7 + CH3
1 record matched CH3O2· + C2H3 → CH3O· + Oxiranyl
1 record matched CH3O2· + ·CH3 → CH3O· + CH3
1 record matched CH3O2· + CH3O· → CH2O + CH3OOH
1 record matched CH3O2· + CH3O· → Products
1 record matched CH3O2· + 1-C3H7 → CH2O + ·C2H5 + CH3
1 record matched CH3O2· + CH3O2· → CH3O· + CH3O· + O2
1 record matched ·C2H + CH3O· → CH2O + C2H2
1 record matched ·C2H + CH3O2· → CH3O· + HCCO
1 record matched ·C2H5 + CH3O· → CH2O + C2H6
1 record matched ·C2H5 + CH3O2· → CH3O· + CH3CH2
1 record matched iso-C3H7 + CH3O· → iso-C3H7OCH3
1 record matched iso-C3H7 + CH3O· → CH2O + C3H8
1 record matched iso-C3H7 + CH3O2· → CH3CHO + CH3O· + ·CH3
1 record matched ·CH2CH=CH2 + CH3O· → CH2O + CH3CH=CH2
1 record matched ·CH2CH=CH2 + CH3O2· → CH2=CHCHO + CH3O· + H·
1 record matched tert-C4H9 + CH3O· → tert-C4H9OCH3
1 record matched tert-C4H9 + CH3O· → CH2O + iso-C4H10
1 record matched tert-C4H9 + CH3O2· → Acetone + CH3O· + ·CH3
1 record matched CO + CH3O· → CO2 + ·CH3
1 record matched CH3CH=CH2 + CH3O· → CH3OH + ·CH2CH=CH2
1 record matched CH3CH=CH2 + CH3O2· → Methyloxirane + CH3
1 record matched iso-C4H10 + CH3O· → CH3OH + iso-C4H9
1 record matched iso-C4H10 + CH3O· → CH3OH + tert-C4H9
1 record matched C3H8 + CH3O· → CH3OH + 1-C3H7
1 record matched C3H8 + CH3O· → CH3OH + iso-C3H7
1 record matched C2H2 + CH3O· → Products
1 record matched C2H4 + CH3O· → Products
1 record matched C2H6 + CH3O· → CH3OH + ·C2H5
1 record matched CH4 + CH3O· → CH3OH + ·CH3
1 record matched CH3OH + ·CH2 → CH3O· + ·CH3
1 record matched CH3OH + O· → CH3O· + ·OH
1 record matched CH3OH + H· → H2 + CH3
1 record matched CH3OH + iso-C4H9 → iso-C4H10 + CH3
2 records matched CH3OH + ·OH → CH3O· + H2O
1 record matched CH3OH + C2H3 → C2H4 + CH3
1 record matched CH3OH + (·)CH2OH → CH3OH + CH3
1 record matched CH3OH + ·CH3 → CH4 + CH3
1 record matched CH3OH + CH3O· → CH3OH + (·)CH2OH
1 record matched CH3OH + 1-C3H7 → C3H8 + CH3
1 record matched CH3OH + ·C2H → C2H2 + CH3
1 record matched CH3OH + ·C2H5 → C2H6 + CH3
1 record matched CH3OH + iso-C3H7 → C3H8 + CH3
1 record matched CH3OH + tert-C4H9 → iso-C4H10 + CH3
1 record matched CH2O + H· → CH3
1 record matched CH2O + CH3O· → CH3OH + HCO
1 record matched C2H5CH(CH3)O2 → Acetone + CH3
1 record matched CH3OC(·)(O) → CO + CH3
1 record matched (CH3)2CHO2 → CH3CHO + CH3
2 records matched CH3CO + O2 → CO2 + CH3
1 record matched C2H5OO· → CH2O + CH3
1 record matched CH3OOH + H· → CH3O· + H2O
3 records matched CH3OOH → CH3O· + ·OH
1 record matched ·CH3 + O· → CH3
9 records matched ·CH3 + NO2 → CH3O· + NO
1 record matched ·CH3 + O3 → CH3O· + O2
2 records matched ·CH3 + N2O → CH3O· + N2
14 records matched ·CH3 + O2 → CH3O· + O·
2 records matched ·CH3 + ·OH → CH3O· + H·
1 record matched ·CH3 + HO2 → CH3O· + ·OH
2 records matched CH3O· + ·Cl → CH2O + HCl
1 record matched CH3O· + ·Cl → Products
1 record matched CH3O· + O· → ·CH3 + O2
2 records matched CH3O· + O· → Products
1 record matched CH3O· + OClO → Products
2 records matched CH3O· + D → CH2O + HD
1 record matched CH3O· + CH3OC(·)(O) → CH3OCOOCH3
1 record matched CH3O· + CH3OC(·)(O) → CH2O + HC(O)OCH3
2 records matched CH3O· + BrO → Products
1 record matched CH3O· + ClO → CH2O + HOCl
2 records matched CH3O· + ClO → Products
1 record matched CH3O· + ·F → Products
1 record matched CH3O· + IO → Products
1 record matched CH3O· + I → Products
2 records matched CH3O· + HNO → CH3OH + NO
1 record matched CH3O· + H· → ·CH3 + ·OH
3 records matched CH3O· + H· → CH2O + H2
2 records matched CH3O· + H· → Products
2 records matched CH3O· + NO3 → CH3O2· + NO2
1 record matched CH3O· + NO3 → CH2O + HNO3
2 records matched CH3O· + NO3 → Products
9 records matched CH3O· + NO2 → CH3ONO2
5 records matched CH3O· + NO2 → CH2O + HNO2
7 records matched CH3O· + NO2 → Products
18 records matched CH3O· + NO → CH3ONO
9 records matched CH3O· + NO → CH2O + HNO
7 records matched CH3O· + NO → Products
2 records matched CH3O· + Br· → Products
1 record matched CH3O· + HBr → Products
2 records matched CH3O· + O3 → Products
1 record matched CH3O· + N2O → Products
25 records matched CH3O· + O2 → CH2O + HO2
1 record matched CH3O· + NH3 → CH3OH + NH2
1 record matched CH3O· + SO2 → Adduct
1 record matched CH3O· + Sc → CH3OSc
1 record matched CH3O· + HO2 → Products
1 record matched CH3O· + CH3CO → CH2O + CH3CHO
1 record matched CH3O· + Cyclohexyl → Cyclohexane, methoxy-
2 records matched CH3O· + HCO → CH3OH + CO
1 record matched CH3O· + ·CH3 → (CH3)2O
7 records matched CH3O· + ·CH3 → CH2O + CH4
7 records matched CH3O· + CH3O· → CH2O + CH3OH
3 records matched CH3O· + CH3O· → Products
13 records matched CH3O· → CH2O + H·
2 records matched CH3O2· + CH3C(O)CH2OO· → CH3C(O)CH2O· + CH3O· + O2
1 record matched CH3O2· + CCl3O2 → CH3O· + O2 + CCl3O
2 records matched CH3O2· + CH3C(O)OO(·) → CH3O· + O2 + CH3C(O)O
4 records matched CH3O2· + ·Cl → CH3O· + ClO
2 records matched CH3O2· + O· → CH3O· + O2
2 records matched CH3O2· + BrO → Other Products + CH3
1 record matched CH3O2· + ClO → CH3O· + OClO
6 records matched CH3O2· + ClO → CH3O· + ClOO
4 records matched CH3O2· + NO3 → CH3O· + O2 + NO2
14 records matched CH3O2· + NO → CH3O· + NO2
1 record matched CH3O2· + O3 → CH3O· + O2 + O2
2 records matched CH3O2· + ·OH → CH3O· + HO2
2 records matched CH3O2· + ·CH3 → CH3O· + CH3
2 records matched CH3O2· + CH3O2· → CH3O· + CH3O· + O2
2 records matched CH3OD + ·F → CH3O· + DF
1 record matched CH3OD + CD3 → CD4 + CH3
1 record matched CH3NO + NO → CH3O· + N2O
6 records matched (CH3O)2 → CH3O· + CH3
2 records matched CO + CH3O· → CH3C(O)O
2 records matched CO + CH3O· → HC(O)OCH2(·)
2 records matched CO + CH3O· → ·CH2C(O)OH
5 records matched CO + CH3O· → CO2 + ·CH3
4 records matched CO + CH3O· → CH2O + HCO
5 records matched CO + CH3O· → Products
2 records matched CO + CH3O· → CH3OCO
1 record matched CO + CH3O2· → CO2 + CH3
1 record matched 1,4-Cyclohexadiene + CH3O· → Products
2 records matched CH3ONO + ·F → CH3O· + FNO
2 records matched CH3ONO + CH3O· → Products
11 records matched CH3ONO → CH3O· + NO
2 records matched CH3OCOOCH3 + CH3O· → CH3OH + CH3OC(O)OCH2·
1 record matched CH3OCOOCH3 + CH3O· → Other Products + CH3OH
1 record matched CH3ONO2 + CH3O· → Products
4 records matched CH3ONO2 → CH3O· + NO2
2 records matched CH3OCl + ·Cl → CH3O· + Cl2
1 record matched (CH3)2C=C(CH3)2 + CH3O2· → CH3O· + oxirane, tetramethyl-
1 record matched C2H5C(CH3)=CH2 + CH3O2· → CH3O· + 2-ethyl-2-methyl-oxirane
1 record matched Methoxymethylbenzene → CH3O· + Benzyl
1 record matched (CH3)2C=CHCH3 + CH3O2· → CH3O· + 2,2,3-trimethyl-oxirane
2 records matched neo-C5H12 + CH3O· → CH3OH + Neopentyl
2 records matched CH2=C=CH2 + CH3O· → Adduct
2 records matched (E)-CHCl=CHCl + CH3O· → Adduct
2 records matched (Z)-CHCl=CHCl + CH3O· → Adduct
2 records matched C2Cl4 + CH3O· → Adduct
2 records matched C2F4 + CH3O· → Adduct
1 record matched iso-C4H8 + CH3O· → Other Products + CH3OH
1 record matched iso-C4H8 + CH3O2· → 2,2-Dimethyloxirane + CH3
15 records matched (CH3)2O → CH3O· + ·CH3
1 record matched Cyclohexene + CH3O· → Products
1 record matched Cyclohexane + CH3O· → Products
1 record matched CH3OCH2OCH3 + CH3O· → Other Products + CH3OH
2 records matched HC(O)OCH3 + CH3O· → CH3OH + CH3OC(·)(O)
1 record matched 1-C4H8 + CH3O· → Products
3 records matched 1-C4H10 + CH3O· → Other Products + CH3OH
1 record matched 1-C4H10 + CH3O· → Products
1 record matched (CH3)2CHCH(CH3)2 + CH3O· → CH3OH + (CH3)2CHC(·)(CH3)2
2 records matched C2HCl3 + CH3O· → Adduct
1 record matched tert-C4H9OOH + CH3O· → CH3OH + (CH3)3CO2
1 record matched CHF3 + CH3O· → CH3OH + ·CF3
2 records matched iso-C4H10 + CH3O· → CH3OH + tert-C4H9
3 records matched iso-C4H10 + CH3O· → Other Products + CH3OH
3 records matched iso-C4H10 + CH3O· → Products
3 records matched Cyclopropane + CH3O· → CH3OH + Cyclopropyl
5 records matched CH3CHO + CH3O· → CH3OH + CH3CO
1 record matched CH3CHO + CH3O· → Products
2 records matched CH2=CHF + CH3O· → Adduct
2 records matched CH3CCH + CH3O· → Adduct
1 record matched CH3I + NO3 → CH3O· + NO2 + I
2 records matched C2H2 + CH3O· → Adduct
2 records matched C2H4 + CH3O· → CH3OCH2CH2·
1 record matched C2H4 + CH3O· → Products
2 records matched C2H4 + CH3O2· → Oxirane + CH3
4 records matched C2H6 + CH3O· → CH3OH + ·C2H5
1 record matched CH4 + CH3O· → CH3OH + ·CH3
2 records matched CH4 + CH3O· → Products
2 records matched CH3OH + ·Cl → CH3O· + HCl
1 record matched CH3OH + O· → CH3O· + ·OH
1 record matched CH3OH + D → CH3O· + HD
3 records matched CH3OH + ·F → CH3O· + HF
4 records matched CH3OH + ·OH → CH3O· + H2O
2 records matched CH3OH + ·CF3 → CHF3 + CH3
2 records matched CH3OH + ·CH3 → CH4 + CH3
1 record matched CH3OH + CH3O· → Products
1 record matched CH2O + CH3O· → CH3OH + HCO
2 records matched CH2O + CH3O· → Other Products + CH3OH
1 record matched O(3P) + C3H8 → ·C2H5 + CH3
1 record matched O(3P) + C2H6 → CH3O· + ·CH3
1 record matched O(3P) + CH4 → CH3O· + H·
1 record matched (CH3)2CNO2 → CH3O· + CH3CNO
1 record matched CH3SO3 → CH3O· + SO2
1 record matched HOCH2C(·)O → CO + CH3
1 record matched ·CH2C(O)OCH3 → H2C=C=O + CH3
2 records matched CH3OF → CH3O· + ·F
1 record matched CH3OCH2 + O· → CH2O + CH3
7 records matched CH3OC(·)(O) → CO + CH3
1 record matched CH3CO + O2 → CO2 + CH3
1 record matched CH3OOH + CH3CO → CH3C(O)OH + CH3
2 records matched CH3OOH → CH3O· + ·OH
1 record matched ·CH3 + O· → CH3
1 record matched ·CH3 + NO2 → CH3O· + NO
1 record matched ·CH3 + O3 → CH3O· + O2
1 record matched ·CH3 + O2 → CH3O· + O·
3 records matched ·CH3 + ·OH → CH3O· + H·
1 record matched ·CH3 + HO2 → CH3O· + ·OH
1 record matched CH3O· + CH2=C=C=O → CH3OC(O)C(·)=CH2
1 record matched CH3O· + C2H5CH=C=O → CH3OC(O)CH·CH2CH3
2 records matched CH3O· + O· → ·CH3 + O2
1 record matched CH3O· + BrO → HBr + CH2OO
1 record matched CH3O· + BrO → CH3O2· + Br·
1 record matched CH3O· + BrO → CH2O + HOBr
1 record matched CH3O· + ClO → HCl + CH2OO
1 record matched CH3O· + ClO → CH2O + HOCl
2 records matched CH3O· + ClO → Products
1 record matched CH3O· + ClO → O2(1DELTA) + CH3Cl
1 record matched CH3O· + ·F → CH3OF
1 record matched CH3O· + ·F → CH2O + HF
2 records matched CH3O· + H· → CH3OH
1 record matched CH3O· + H· → CH2O + H2
2 records matched CH3O· + NO2 → CH3ONO2
2 records matched CH3O· + NO2 → CH2O + HNO2
1 record matched CH3O· + NO2 → Products
1 record matched CH3O· + NO → CH3O· + NO2
3 records matched CH3O· + NO → CH3ONO
3 records matched CH3O· + NO → CH2O + HNO
1 record matched CH3O· + Br· → CH3OBr
1 record matched CH3O· + HBr → CH3OH + Br·
6 records matched CH3O· + O2 → CH2O + HO2
1 record matched CH3O· + H2O → CH3OH + ·OH
1 record matched CH3O· + HF → CH3OH + ·F
1 record matched CH3O· + HCl → CH3OH + ·Cl
1 record matched CH3O· + ·OH → CH2O + H2O
1 record matched CH3O· + HO2 → CH3OH + O2
1 record matched CH3O· + HO2 → CH2O + H2O2
1 record matched CH3O· + HO2 → H2OO + CH2O
1 record matched CH3O· + HO2 → CH3OOOH
1 record matched CH3O· + HO2 → (3)CH2O + H2O2
1 record matched CH3O· + CH3O· → (CH3O)2
1 record matched CH3O· + CH3O· → CH2O + CH3OH
2 records matched CH3O· → (·)CH2OH
9 records matched CH3O· → CH2O + H·
1 record matched CH3O2· + CH3C(O)CH2OO· → CH3C(O)CH2O· + CH3O· + O2
1 record matched CH3O2· + CH3C(O)OO(·) → CH3O· + O2 + CH3C(O)O
1 record matched CH3O2· + O· → CH3O· + O2
1 record matched CH3O2· + ClO → CH3O· + OClO
2 records matched CH3O2· + ClO → CH3O· + ClOO
1 record matched CH3O2· + NO → CH3O· + NO2
1 record matched CH3O2· + Br· → CH3O· + BrO
1 record matched CH3O2· + O3 → CH3O· + O2 + O2
1 record matched CH3O2· + (·)CH2OH → CH3O· + HOCH2O
1 record matched CH3O2· + ·CH3 → CH3O· + CH3
4 records matched CH3O2· + CH3O2· → CH3O· + CH3O· + O2
1 record matched CH3OD + H· → CH3O· + HD
2 records matched H2 + CH3O· → CH3OH + H·
1 record matched (CH3O)2 + CH3O· → Products
1 record matched (CH3O)2 → CH3O· + CH3
3 records matched CO + CH3O· → CH3OC(·)(O)
1 record matched CH3ONO + ·F → CH3O· + FNO
1 record matched CH3ONO + H· → CH3O· + HNO
2 records matched CH3ONO → CH3O· + NO
1 record matched Methyl butanoate → CH3O· + CH3CH2CH2CO
1 record matched CH3OCOOCH3 → CH3OCO + CH3
1 record matched CH3ONO2 + ·OH → CH3O· + HNO3
1 record matched CH3ONO2 → CH3O· + NO2
1 record matched CH3OCl + ·OH → CH3O· + HOCl
1 record matched CH3OCl → CH3O· + ·Cl
1 record matched H2C=C=O + CH3O· → ·CH2C(O)OCH3
1 record matched iso-C4H8 + CH3O· → Adduct
1 record matched iso-C4H8 + CH3O· → CH3OCH2C(·)(CH3)2
1 record matched iso-C4H8 + CH3O· → ·CH2C(CH3)2OCH3
6 records matched (CH3)2O → CH3O· + ·CH3
1 record matched 1,2-Dimethoxyethane → CH3O· + CH3OCH2CH2·
1 record matched 1,3-Butadiene + CH3O· → CH3OCH2C(·)HCH=CH2
1 record matched 1,3-Butadiene + CH3O· → ·CH2CH(OCH3)CH=CH2
3 records matched CH3NO2 → CH3O· + NO
1 record matched HN=C=O + ·CH3 → CH3O· + HNC
1 record matched CH3CHO + CH3O· → CH3OH + CH3CO
1 record matched CH3CHO + CH3O· → CH3OH + *CH2C(O)H
1 record matched CH3CN + O· → CN + CH3
1 record matched CH3Cl + ·OH → CH3O· + HCl
1 record matched C2H4 + CH3O· → Adduct
1 record matched C2H6 + O· → CH3O· + ·CH3
3 records matched CH4 + CH3O· → CH3OH + ·CH3
1 record matched (CH3)2SO + O· → CH3O· + CH3SO
1 record matched Acetone + CH3O· → Adduct
1 record matched CH3OH + ·Cl → CH3O· + HCl
1 record matched CH3OH + O· → CH3O· + ·OH
3 records matched CH3OH + ·F → CH3O· + HF
5 records matched CH3OH + H· → H2 + CH3
1 record matched CH3OH + Br· → CH3O· + HBr
7 records matched CH3OH + ·OH → CH3O· + H2O
3 records matched CH3OH + HO2 → CH3O· + H2O2
1 record matched CH3OH + Phenyl → Benzene + CH3
2 records matched CH3OH + ·CH3 → CH4 + CH3
1 record matched CH3OH + CH3O2· → CH3O· + CH3OOH
2 records matched CH3OH → CH3O· + H·
8 records matched CH2O + H· → CH3
1 record matched CH2O + CH3O· → CH3OH + HCO
1 record matched CH2O + CH3O· → Adduct
1 record matched O(1D) + CH3CN → CN + CH3
1 record matched O(3P) + ·CH3 → CH3
1 record matched CH3CH2CH2CH(O)OCH3 → CH3CH2CH2CHO + CH3
1 record matched CH3OCH(·)CH2OCH3 → CH2=CHOCH3 + CH3
1 record matched O(1D) + CH4 → CH3O· + H·
1 record matched CH3OSO → CH3O· + SO
1 record matched CH3OBr → CH3O· + Br·
1 record matched CH3OC(O)O· → CO2 + CH3
1 record matched 1-phenylethyl peroxy radical → Benzaldehyde + CH3
1 record matched CH3CH2CH=C(·)C(O)OCH3 → 1,2-pentadien-1-one + CH3
1 record matched CH2=CHCH2CH(·)C(O)OCH3 → CH2=CHCH2CH=C=O + CH3
1 record matched CH3C(O)CH2CH(·)C(O)OCH3 → CH3C(O)CH2CH=C=O + CH3
1 record matched CH3OCF2O· → COF2 + CH3
2 records matched (CH3O)2P(S·)(OH)SCH2C(O)NHCH3 → CH3OP(S)(OH)SCH2C(O)NHCH3 + CH3
1 record matched CH3CH2CH2CH(·)C(O)OCH3 → CH3O· + CH3CH2CH2CH=C=O
1 record matched CH3OC(O)C(·)=CH2 → CH3O· + CH2=C=C=O
1 record matched CH3OC(O)CH·CH2CH3 → CH3O· + C2H5CH=C=O
1 record matched ·CH3 + N2O → CH3O· + N2
1 record matched ·CH3 + HO2 → CH3O· + ·OH

Search returned 764 records.