Kinetics Database Logo

Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences

Feedback

Rate Our Products and Services

Help


Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty

More...


Administrative Links

NIST home page

MML home page

Chemical and Biochemical Reference Data Division

MML home page

Chemical and Biochemical Reference Data Division

  NIST Logo Home
©NIST, 2013
Accessibility information

Search Results


Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
1 record matched ·CH3 + NO2 → Products
1 record matched ·CH3 + HBr → CH4 + Br·
1 record matched iso-C4H10 + ·CH3 → CH4 + tert-C4H9
1 record matched C2H4 + O· → ·CH3 + HCO
1 record matched (CH3)2CO + ·OH → CH3C(O)OH + ·CH3
2 records matched CH3CH2CH(CH3)O → C2H5CHO + ·CH3
1 record matched C2H5C(CH3)2O(·) → C2H5COCH3 + ·CH3
2 records matched NO + CH3C(O)OO(·) → CO2 + ·CH3 + NO2
1 record matched H2O + ·CH2 → ·CH3 + ·OH
1 record matched H2O2 + ·CH2 → ·CH3 + HO2
3 records matched iso-C4H9 → CH3CH=CH2 + ·CH3
1 record matched (CH3)2CCH2CH3 → iso-C4H8 + ·CH3
2 records matched i-C3H7O → CH3CHO + ·CH3
1 record matched (CH3)3CCH2 → iso-C4H8 + ·CH3
1 record matched CH3CO + ·CH2 → H2C=C=O + ·CH3
2 records matched CH3CO + O· → CO2 + ·CH3
6 records matched CH3CO → CO + ·CH3
2 records matched (CH3)3CO → (CH3)2CO + ·CH3
1 record matched C2H3 + ·CH2 → C2H2 + ·CH3
1 record matched C2H3 + CH3CO → ·CH3 + CH2=CHC(·)O
1 record matched HCO + ·CH2 → CO + ·CH3
1 record matched (·)CH2OH + ·CH2 → CH2O + ·CH3
1 record matched (·)CH2OH + H· → ·CH3 + ·OH
2 records matched sec-C4H9 → CH3CH=CH2 + ·CH3
3 records matched ·CH3 + ·CH2 → C2H4 + H·
1 record matched ·CH3 + CH3CHNHCH2CH3 → Other Products + CH4
6 records matched ·CH3 + O· → CH2O + H·
4 records matched ·CH3 + O· → Products
1 record matched ·CH3 + H· → H2 + ·CH2
11 records matched ·CH3 + H· → CH4
1 record matched ·CH3 + NO2 → CH3O· + NO
1 record matched ·CH3 + NO2 → Products
1 record matched ·CH3 + HBr → CH4 + Br·
1 record matched ·CH3 + HI → CH4 + I
6 records matched ·CH3 + O3 → Products
1 record matched ·CH3 + SiH4 → CH4 + SiH3
2 records matched ·CH3 + H2S → CH4 + SH
1 record matched ·CH3 + Cl2 → CH3Cl + Cl
5 records matched ·CH3 + O2 → CH3O· + O·
14 records matched ·CH3 + O2 → CH3O2·
2 records matched ·CH3 + O2 → CH2O + ·OH
2 records matched ·CH3 + O2 → Products
1 record matched ·CH3 + D2 → CH3D + D
2 records matched ·CH3 + H2O → CH4 + ·OH
1 record matched ·CH3 + Br2 → CH3Br + Br·
1 record matched ·CH3 + H2O2 → CH4 + HO2
2 records matched ·CH3 + NH3 → CH4 + NH2
1 record matched ·CH3 + HF → CH4 + ·F
2 records matched ·CH3 + HCl → CH4 + Cl
1 record matched ·CH3 + iso-C4H9 → iso-C5H12
1 record matched ·CH3 + iso-C4H9 → CH4 + iso-C4H8
1 record matched ·CH3 + ·OH → H2O + ·CH2
1 record matched ·CH3 + ·OH → CH4 + O·
3 records matched ·CH3 + ·OH → CH3OH
3 records matched ·CH3 + ·OH → Products
2 records matched ·CH3 + HO2 → CH3O· + ·OH
1 record matched ·CH3 + HO2 → CH4 + O2
1 record matched ·CH3 + CH3CO → (CH3)2CO
1 record matched ·CH3 + C2H3 → CH3CH=CH2
2 records matched ·CH3 + C2H3 → CH4 + C2H2
2 records matched ·CH3 + C2H3 → Products
1 record matched ·CH3 + HCO → CH3CHO
1 record matched ·CH3 + HCO → CH4 + CO
1 record matched ·CH3 + (·)CH2OH → C2H5OH
1 record matched ·CH3 + (·)CH2OH → CH2O + CH4
2 records matched ·CH3 + ·CH3 → ·C2H5 + H·
1 record matched ·CH3 + ·CH3 → C2H4 + H2
9 records matched ·CH3 + ·CH3 → C2H6
2 records matched ·CH3 → H· + ·CH2
2 records matched CH3CH2O· → CH2O + ·CH3
1 record matched CH3O· + ·CH2 → CH2O + ·CH3
1 record matched CH3O· + ·CH3 → (CH3)2O
1 record matched CH3O· + ·CH3 → CH2O + CH4
1 record matched CH3O· + ·CH3 → Products
1 record matched n-C3H7 + ·CH2 → CH3CH=CH2 + ·CH3
1 record matched n-C3H7 + ·CH3 → n-C4H10
1 record matched n-C3H7 + ·CH3 → CH4 + CH3CH=CH2
7 records matched n-C3H7 → C2H4 + ·CH3
1 record matched CH3O2· + ·CH3 → CH3O· + CH3
1 record matched CH3O2· → ·CH3 + O2
1 record matched ·C2H + ·CH3 → CH2C≡CH + H·
1 record matched ·C2H5 + ·CH2 → C2H4 + ·CH3
1 record matched ·C2H5 + O· → CH2O + ·CH3
2 records matched ·C2H5 + H· → ·CH3 + ·CH3
4 records matched ·C2H5 + ·CH3 → C3H8
2 records matched ·C2H5 + ·CH3 → CH4 + C2H4
1 record matched ·C2H5 + ·C2H → ·CH3 + CH2C≡CH
1 record matched iso-C3H7 + ·CH2 → CH3CH=CH2 + ·CH3
1 record matched iso-C3H7 + O· → CH3CHO + ·CH3
1 record matched iso-C3H7 + HO2 → CH3CHO + ·CH3 + ·OH
1 record matched iso-C3H7 + ·CH3 → iso-C4H10
1 record matched iso-C3H7 + CH3O2· → CH3CHO + CH3O· + ·CH3
1 record matched ·CH2CH=CH2 + ·CH3 → 1-C4H8
1 record matched ·CH2CH=CH2 + ·CH3 → CH4 + CH2=C=CH2
1 record matched CD3CDO + ·CH3 → CH3D + CD3CO
1 record matched tert-C4H9 + ·CH2 → iso-C4H8 + ·CH3
1 record matched tert-C4H9 + HO2 → (CH3)2CO + ·CH3 + ·OH
1 record matched tert-C4H9 + ·CH3 → neo-C5H12
1 record matched tert-C4H9 + ·CH3 → CH4 + iso-C4H8
1 record matched tert-C4H9 + CH3O2· → (CH3)2CO + CH3O· + ·CH3
1 record matched tert-C4H9 → CH3CH=CH2 + ·CH3
1 record matched H2 + ·CH2 → ·CH3 + H·
6 records matched H2 + ·CH3 → CH4 + H·
1 record matched CH3SiD3 + ·CH3 → Other Products + CH3D
1 record matched (CH3)3SiH + ·CH3 → CH4 + (CH3)3Si·
4 records matched CO + ·CH3 → CH3CO
1 record matched CO + CH3O· → CO2 + ·CH3
1 record matched (E)-2-C4H8 + ·CH3 → (CH3)2CHCHCH3
1 record matched (E)-2-C4H8 + ·CH3 → CH4 + CH2CH=CHCH3
1 record matched CH3F + H· → ·CH3 + HF
1 record matched (Z)-2-C4H8 + ·CH3 → (CH3)2CHCHCH3
1 record matched (Z)-2-C4H8 + ·CH3 → CH4 + CH2CH=CHCH3
1 record matched (CH3)2C=C(CH3)2 + ·CH3 → (CH3)3C-C(·)(CH3)2
1 record matched (CH3)2CHCH=CH2 + ·CH3 → (CH3)2CHCHC2H5
1 record matched CD4 + ·CH3 → CH3D + CD3
1 record matched (CH3)2C=CHCH3 + ·CH3 → Products
1 record matched (CH3N)2 + ·CH3 → CH4 + ·CH2N=NCH3
1 record matched (CH3N)2 → ·CH3 + ·CH3 + N2
1 record matched neo-C5H12 + ·CH3 → CH4 + (CH3)3CCH2
1 record matched CH2=C=CH2 + ·CH3 → CH3CH2C=CH2
1 record matched C2H5CHO + ·CH3 → CH3CH2CH(CH3)O
1 record matched CF3CF=CF2 + ·CH3 → Products
1 record matched C2F4 + ·CH3 → Adduct
1 record matched iso-C4H8 + ·CH3 → (CH3)2CCH2CH3
1 record matched iso-C4H8 + ·CH3 → (CH3)3CCH2
1 record matched iso-C4H8 + ·CH3 → Products
1 record matched (CH3)2O + ·CH3 → CH4 + CH3OCH2
1 record matched CH3CH=CH2 + ·CH2 → ·CH2CH=CH2 + ·CH3
1 record matched CH3CH=CH2 + C2H3 → 1,3-Butadiene + ·CH3
3 records matched CH3CH=CH2 + ·CH3 → iso-C4H9
3 records matched CH3CH=CH2 + ·CH3 → sec-C4H9
3 records matched CH3CH=CH2 + ·CH3 → CH4 + ·CH2CH=CH2
1 record matched CH3CH=CH2 + ·CH3 → Adduct
2 records matched CH3CH=CH2 + ·CH3 → Products
1 record matched CH3CH=CH2 → ·CH3 + C2H3
2 records matched Toluene + H· → Benzene + ·CH3
1 record matched 1,3-Butadiene + ·CH3 → CH2=CHCHCH2CH3
1 record matched 1-C4H8 + ·CH3 → CH4 + CH2CH=CHCH3
1 record matched 1-C4H8 + ·CH3 → Products
1 record matched n-C4H10 + ·CH3 → Other Products + CH4
1 record matched n-C4H10 → n-C3H7 + ·CH3
1 record matched Methoxybenzene → C6H5O + ·CH3
1 record matched Ethylbenzene → Benzyl + ·CH3
1 record matched CH3C(O)OCH3 + ·CH3 → CH4 + CH2C(O)OCH3
1 record matched (CH3)4Si + ·CH3 → CH4 + (CH3)3SiCH2
1 record matched iso-C4H10 + ·CH2 → tert-C4H9 + ·CH3
2 records matched iso-C4H10 + ·CH3 → CH4 + iso-C4H9
2 records matched iso-C4H10 + ·CH3 → CH4 + tert-C4H9
3 records matched iso-C4H10 + ·CH3 → Other Products + CH4
3 records matched iso-C4H10 → iso-C3H7 + ·CH3
1 record matched Oxirane + ·CH3 → CH4 + Oxiranyl
8 records matched (CH3)2S + O· → ·CH3 + CH3SO
1 record matched CH3CHO + ·CH3 → i-C3H7O
2 records matched CH3CHO + ·CH3 → CH4 + CH3CO
2 records matched CH3CHO → ·CH3 + HCO
1 record matched CH2=CHCl + ·CH3 → Products
1 record matched CH3CCH + ·CH3 → Products
1 record matched C3H8 + ·CH2 → n-C3H7 + ·CH3
1 record matched C3H8 + ·CH2 → iso-C3H7 + ·CH3
1 record matched C3H8 + ·CH3 → CH4 + n-C3H7
1 record matched C3H8 + ·CH3 → CH4 + iso-C3H7
1 record matched C3H8 + ·CH3 → Products
5 records matched C3H8 → ·C2H5 + ·CH3
1 record matched CH3I + I → ·CH3 + I2
3 records matched C2H2 + ·CH3 → CH3CH=CH
1 record matched C2H2 + ·CH3 → ·CH2CH=CH2
1 record matched C2H2 + ·CH3 → CH4 + ·C2H
1 record matched C2H2 + iso-C3H7 → 1,3-Butadiene + ·CH3
1 record matched C2H2 + tert-C4H9 → CH2=C(CH3)CH=CH2 + ·CH3
2 records matched C2H4 + O· → ·CH3 + HCO
5 records matched C2H4 + ·CH3 → n-C3H7
3 records matched C2H4 + ·CH3 → CH4 + C2H3
4 records matched C2H6 + ·CH3 → CH4 + ·C2H5
13 records matched C2H6 → ·CH3 + ·CH3
1 record matched CH3Br + H· → ·CH3 + HBr
1 record matched CH4 + ·CH2 → ·CH3 + ·CH3
10 records matched CH4 + Cl → ·CH3 + HCl
4 records matched CH4 + CF3O → CF3OH + ·CH3
13 records matched CH4 + O· → ·CH3 + ·OH
8 records matched CH4 + ·F → ·CH3 + HF
2 records matched CH4 + NH2 → ·CH3 + NH3
8 records matched CH4 + H· → H2 + ·CH3
2 records matched CH4 + NO3 → ·CH3 + HNO3
2 records matched CH4 + Br· → ·CH3 + HBr
2 records matched CH4 + O2 → ·CH3 + HO2
1 record matched CH4 + iso-C4H9 → iso-C4H10 + ·CH3
21 records matched CH4 + ·OH → ·CH3 + H2O
2 records matched CH4 + HO2 → ·CH3 + H2O2
1 record matched CH4 + CH3CO → CH3CHO + ·CH3
1 record matched CH4 + C2H3 → C2H4 + ·CH3
1 record matched CH4 + HCO → CH2O + ·CH3
1 record matched CH4 + (·)CH2OH → CH3OH + ·CH3
1 record matched CH4 + ·CF3 → CHF3 + ·CH3
1 record matched CH4 + ·CH3 → CH4 + ·CH3
1 record matched CH4 + CH2=C → ·CH3 + C2H3
1 record matched CH4 + CH3O· → CH3OH + ·CH3
1 record matched CH4 + n-C3H7 → C3H8 + ·CH3
1 record matched CH4 + CH3O2· → ·CH3 + CH3OOH
1 record matched CH4 + ·C2H → C2H2 + ·CH3
1 record matched CH4 + ·C2H5 → C2H6 + ·CH3
1 record matched CH4 + iso-C3H7 → C3H8 + ·CH3
1 record matched CH4 + ·CH2CH=CH2 → CH3CH=CH2 + ·CH3
1 record matched CH4 + tert-C4H9 → iso-C4H10 + ·CH3
13 records matched CH4 → ·CH3 + H·
1 record matched (CH3)2CO + ·CH3 → (CH3)3CO
2 records matched (CH3)2CO + ·CH3 → CH4 + CH3C(O)CH2(·)
1 record matched CH3OH + ·CH2 → ·CH3 + (·)CH2OH
1 record matched CH3OH + ·CH2 → CH3O· + ·CH3
1 record matched CH3OH + ·CH3 → CH4 + (·)CH2OH
1 record matched CH3OH + ·CH3 → CH4 + CH3
5 records matched CH3OH → ·CH3 + ·OH
7 records matched C2H5OH → ·CH3 + (·)CH2OH
2 records matched CN + CH4 → HCN + ·CH3
1 record matched CH2O + ·CH2 → ·CH3 + HCO
1 record matched CH2O + ·CH3 → CH3CH2
5 records matched CH2O + ·CH3 → CH4 + HCO
2 records matched O(1D) + CH4 → ·CH3 + ·OH
1 record matched M + ·CH3 + O2 → M + CH3O2·
1 record matched CH3C(·)=NH → ·CH3 + HNC
2 records matched Methyl, methoxy(1-methylethoxy)phenyl- → Benzoic acid 1-methylethyl ester + ·CH3
2 records matched CH3CH(O.)CH2CH2CH3 → n-C3H7CHO + ·CH3
1 record matched CH3In → ·CH3 + In(CH3)2
2 records matched CH3In → ·CH3 + In
1 record matched (CH3)2Ga → ·CH3 + CH3Ga
1 record matched CH3Ga → ·CH3 + Ga
1 record matched (CH3)2CD· → ·CH3 + CH2=CHD
1 record matched CH3CH=CCH3 → CH3CCH + ·CH3
1 record matched CH3N=N → ·CH3 + N2
1 record matched CH3(CH2)2CH(CH3)O → n-C3H7CHO + ·CH3
3 records matched CH2CH=CHCH2CH3 → 1,3-Butadiene + ·CH3
2 records matched CH3SOO → ·CH3 + SO2
1 record matched C2H5CHCHO → CH2=CHCHO + ·CH3
1 record matched CH3Zn → ·CH3 + Zn
1 record matched Oxiranyl → CO + ·CH3
2 records matched CH3SCH2 → CH2S + ·CH3
1 record matched CH3CH2CH(CH3)O → C2H5CHO + ·CH3
1 record matched (CH3)2CHC(·)(CH3)2 → (CH3)2C=CHCH3 + ·CH3
1 record matched (CH3)3C-C(·)(CH3)2 → (CH3)2C=C(CH3)2 + ·CH3
1 record matched (CH3)3CC(CH3)2CH2 → (CH3)3CC(CH3)=CH2 + ·CH3
1 record matched (CH3CH2)2CH → 1-C4H8 + ·CH3
1 record matched (CH3)2CHC≡CCH3 → ·CH3 + CH3C≡CCHCH3
3 records matched CH3OCH2 → CH2O + ·CH3
1 record matched CH3OC(·)(O) → CO2 + ·CH3
1 record matched CH3CO → CO + ·CH3
2 records matched CH2C(CH3)=CH2 → CH2=C=CH2 + ·CH3
1 record matched C2H5C≡CCH=CH2 → ·CH3 + CH2=CHC≡CCH2·
1 record matched (CD3)3CH + ·CH2 → ·CH3 + tert-C4D9
1 record matched C2H5C(CH3)2O(·) → C2H5COCH3 + ·CH3
2 records matched CH2D + H· → ·CH3 + D
2 records matched NO + CH3C(O)OO(·) → CO2 + ·CH3 + NO2
1 record matched HBr + ·CH2 → ·CH3 + Br·
1 record matched HCl + ·CH2 → ·CH3 + Cl
1 record matched CH2=CHO· → CO + ·CH3
2 records matched CH3CH=CH → C2H2 + ·CH3
1 record matched Isoxazole, 5-methyl- → ·CH3 + N≡CCH2C(O)·
1 record matched (CH3)2C(OH) → CH3CHO + ·CH3
1 record matched CH3S(O)2 + He → ·CH3 + SO2
4 records matched CH3S(O)2 → ·CH3 + SO2
6 records matched iso-C4H9 → CH3CH=CH2 + ·CH3
1 record matched (E)-CH3N=NCH3 → ·CH3 + CH3N=N
2 records matched (E)-CH3N=NCH3 → ·CH3 + ·CH3 + N2
12 records matched i-C3H7O → CH3CHO + ·CH3
8 records matched (CH3)3CCH2 → iso-C4H8 + ·CH3
1 record matched CH3N=NCH(CH3)2 → iso-C3H7 + ·CH3 + N2
1 record matched 4-Ethylstyrene → ·CH3 + 4-Vinylbenzyl
1 record matched In(CH3)3 → ·CH3 + In(CH3)2
1 record matched CH3CO + O· → CO2 + ·CH3
1 record matched CH3CO + H· → ·CH3 + HCO
1 record matched CH3CO + NO2 → CO2 + ·CH3 + NO
17 records matched CH3CO → CO + ·CH3
21 records matched (CH3)3CO → (CH3)2CO + ·CH3
1 record matched CH3C(O)CH2(·) → H2C=C=O + ·CH3
1 record matched Benzene, 2-ethyl-1,3-dimethyl- → ·CH3 + Methyl,(2,6-dimethylphenyl)-
1 record matched C2H3 + O2 → CO2 + ·CH3
1 record matched n-C4H9 → CH3CH=CH2 + ·CH3
8 records matched sec-C4H9 → CH3CH=CH2 + ·CH3
1 record matched ·CH3 + CH3CH2N=NCH(·)CH3 → Other Products + CH4
3 records matched ·CH3 + ·CH2 → C2H4 + H·
1 record matched ·CH3 + ·CH2 → Products
1 record matched ·CH3 + CH3ICl → CH3Cl + CH3I
1 record matched ·CH3 + CH2C(CH3)=C(CH3)2 → C2H5C(CH3)=C(CH3)2
1 record matched ·CH3 + CH2C(CH3)=C(CH3)2 → CH4 + CH2=C(CH3)C(CH3)=CH2
1 record matched ·CH3 + D2NCH2CH2ND2 → D2NCH(·)CH2ND2 + CH4
1 record matched ·CH3 + D2NCH2CH2ND2 → ·ND CH2CH2ND2 + CH3D
1 record matched ·CH3 + DCONH2 → Other Products + CH3D
1 record matched ·CH3 + HCOND2 → Other Products + CH4
1 record matched ·CH3 + HCOND2 → HC(O)ND· + CH3D
1 record matched ·CH3 + CH3N=NH → CH4 + CH3N=N
1 record matched ·CH3 + N=C-CH2CH2 → CH4 + CH2CHCN
2 records matched ·CH3 + CH3C(O)OCD3 → CH3D + CH3C(O)OCD2
3 records matched ·CH3 + CH3C(O)OCD3 → Other Products + CH4
1 record matched ·CH3 + CD3C(O)CD2CH3 → Other Products + CH3D
3 records matched ·CH3 + Cl → CH3Cl
1 record matched ·CH3 + NCO → CH2O + HNC
1 record matched ·CH3 + NCO → CH2O + HCN
1 record matched ·CH3 + NCO → Products
1 record matched ·CH3 + CD3C(O)C(O)CD3 → CH3C(O)CD3 + CD3CO
1 record matched ·CH3 + CD3C(O)C(O)CD3 → Other Products + CD3
1 record matched ·CH3 + CD3C(O)C(O)CD3 → Other Products + CH3D
2 records matched ·CH3 + CD3C(O)OCH3 → Other Products + CH3D
1 record matched ·CH3 + CD3C(O)OCH3 → Other Products + CH4
1 record matched ·CH3 + CH3SiHCl2 → CH4 + Silyl, dichloromethyl-
1 record matched ·CH3 + SiCl3 → Products
1 record matched ·CH3 + C6H5SiD3 → Other Products + CH3D
1 record matched ·CH3 + C6H5SiD3 → Other Products + CH4
2 records matched ·CH3 + N → H· + H2C=N
1 record matched ·CH3 + N → H2 + HNC
1 record matched ·CH3 + N → HCN + H· + H·
2 records matched ·CH3 + N → HCN + H2
2 records matched ·CH3 + N → Products
1 record matched ·CH3 + O· → CH3
5 records matched ·CH3 + O· → CO + H2 + H·
23 records matched ·CH3 + O· → CH2O + H·
6 records matched ·CH3 + O· → Products
1 record matched ·CH3 + OClO → Products
1 record matched ·CH3 + C6H5OCH2 → Ethoxybenzene
1 record matched ·CH3 + D → CH2D + H·
2 records matched ·CH3 + D → CH3D
1 record matched ·CH3 + 2-Phenyl-2-propyl radical → t-Butylbenzene
1 record matched ·CH3 + (iso-C3H7O)2 → Other Products + CH4
2 records matched ·CH3 + (CH3)3Si· → CH4 + (CH3)2Si=CH2
1 record matched ·CH3 + (CH3)3Si· → Products
1 record matched ·CH3 + CH3OC(·)(O) → CH3C(O)OCH3
4 records matched ·CH3 + (CH3)2N → (CH3)3N
2 records matched ·CH3 + (CH3)2N → CH4 + CH2=NCH3
1 record matched ·CH3 + CH2C(CH3)=CH2 → C2H5C(CH3)=CH2
1 record matched ·CH3 + ClO → Products
1 record matched ·CH3 + Oxetane, 2,4-dimethyl- → Other Products + CH4
1 record matched ·CH3 + ·F → Products
2 records matched ·CH3 + I → CH3I
2 records matched ·CH3 + HD → CH4 + D
1 record matched ·CH3 + BrCl → CH3Cl + Br·
2 records matched ·CH3 + NH2 → CH3NH2
1 record matched ·CH3 + SiH3 → Products
1 record matched ·CH3 + N2D4 → Other Products + CH3D
1 record matched ·CH3 + N2D4 → ND2ND· + CH3D
1 record matched ·CH3 + OD → HDO + ·CH2
2 records matched ·CH3 + OD → CH3OD
2 records matched ·CH3 + OD → H2 + CHDO
2 records matched ·CH3 + OD → CH2O + HD
2 records matched ·CH3 + OD → Products
1 record matched ·CH3 + ND3 → CH3D + ND2
1 record matched ·CH3 + Si2D6 → SiD3SiD2· + CH3D
1 record matched ·CH3 + SiD4 → CH3D + SiD3
2 records matched ·CH3 + D2S → CH3D + SD
3 records matched ·CH3 + DBr → CH3D + Br·
1 record matched ·CH3 + SiHF3 → CH4 + SiF3
1 record matched ·CH3 + (CH3)3CD → CH4 + (CH3)2CDC(·)H2
21 records matched ·CH3 + H· → CH4
1 record matched ·CH3 + Cyclohexadienyl → 1,3-Cyclohexadiene, 5-methyl-
1 record matched ·CH3 + Cyclohexadienyl → 1,4-Cyclohexadiene, 3-methyl-
1 record matched ·CH3 + Cyclohexadienyl → Benzene + CH4
1 record matched ·CH3 + NO3 → Products
8 records matched ·CH3 + NO2 → CH3O· + NO
6 records matched ·CH3 + NO2 → CH3NO2
1 record matched ·CH3 + NO2 → Products
2 records matched ·CH3 + NO → ·OH + H2C=N
32 records matched ·CH3 + NO → CH3NO
3 records matched ·CH3 + NO → HCN + H2O
4 records matched ·CH3 + NO → Products
7 records matched ·CH3 + Br· → CH3Br
2 records matched ·CH3 + N2F4 → Methanamine, N,N-difluoro- + NF2
11 records matched ·CH3 + HBr → CH4 + Br·
4 records matched ·CH3 + HI → CH4 + I
1 record matched ·CH3 + O3 → CH3O· + O2
7 records matched ·CH3 + O3 → Products
2 records matched ·CH3 + SiHCl3 → CH4 + SiCl3
2 records matched ·CH3 + N2O → CH3O· + N2
4 records matched ·CH3 + SiH4 → CH4 + SiH3
1 record matched ·CH3 + UF6 → CH3F + UF5
1 record matched ·CH3 + NF3 → Methanamine, N,N-difluoro- + ·F
10 records matched ·CH3 + H2S → CH4 + SH
1 record matched ·CH3 + HN3 → CH4 + ·N3
1 record matched ·CH3 + HNO2 → CH4 + NO2
6 records matched ·CH3 + Cl2 → CH3Cl + Cl
2 records matched ·CH3 + O2 → HCO + H2O
14 records matched ·CH3 + O2 → CH3O· + O·
50 records matched ·CH3 + O2 → CH3O2·
22 records matched ·CH3 + O2 → CH2O + ·OH
3 records matched ·CH3 + O2 → Products
2 records matched ·CH3 + F2 → CH3F + ·F
4 records matched ·CH3 + D2 → CH3D + D
4 records matched ·CH3 + Br2 → CH3Br + Br·
2 records matched ·CH3 + DCl → CH3D + Cl
3 records matched ·CH3 + NH3 → CH4 + NH2
12 records matched ·CH3 + HCl → CH4 + Cl
5 records matched ·CH3 + I2 → CH3I + I
6 records matched ·CH3 + SO2 → CH3S(O)2
1 record matched ·CH3 + SO2 → Products
1 record matched ·CH3 + He + Cl → CH3Cl + He
1 record matched ·CH3 + He + NO2 → Products + He
1 record matched ·CH3 + Ar → Ar + H· + ·CH2
1 record matched ·CH3 + Ar → H2 + ·CH + Ar
1 record matched ·CH3 + Si → SiCH + H2
2 records matched ·CH3 + CD3O → CH3D + CD2O
1 record matched ·CH3 + CD3SH → CH3SH + CD3
1 record matched ·CH3 + CD3SH → CH4 + CD3S
1 record matched ·CH3 + CD3SH → ·CD2SH + CH3D
2 records matched ·CH3 + ·CH2Cl → Products
1 record matched ·CH3 + CH2=C=CH → CH2=C=CHCH3
1 record matched ·CH3 + CH3CD2C(O)CD2CH3 → Other Products + CH3D
1 record matched ·CH3 + CH3CD2C(O)CD2CH3 → Other Products + CH4
1 record matched ·CH3 + CD3CH2NH2 → Other Products + CH4
1 record matched ·CH3 + CH3CH2ND2 → CH3CH2ND· + CH3D
1 record matched ·CH3 + CH3CH2ND2 → ·CH2CH2ND2 + CH4
1 record matched ·CH3 + Hydrazine-1,2-d2, 1,2-dimethyl- → Other Products + CH3D
1 record matched ·CH3 + Hydrazine-1,2-d2, 1,2-dimethyl- → CH3NDN(·)CH3 + CH3D
1 record matched ·CH3 + Hydrazine-1,2-d2, 1,2-dimethyl- → ·CH2NDNDCH3 + CH4
2 records matched ·CH3 + CD3NH2 → CH4 + CD3NH·
2 records matched ·CH3 + CD3NH2 → Other Products + CH3D
1 record matched ·CH3 + HOCH2CH2 → CH3CH=CH2 + H2O
1 record matched ·CH3 + Aziridine-2,2,3,3-d4 → Adduct
1 record matched ·CH3 + (CH3)2CCH2CH3 → Other Products + CH4
1 record matched ·CH3 + (E)-CH3CH=CHCHO → CH4 + CH3CH=CHC(O)·
2 records matched ·CH3 + (E)-CH3N=NCH3 → Other Products + CH4
1 record matched ·CH3 + CH3CDO → Other Products + CH4
1 record matched ·CH3 + (CH3)2Si=CH2 → Products
1 record matched ·CH3 + CH2=C(CH3)NNCH3 → Other Products + CH4
1 record matched ·CH3 + Aziridine,1-(1,1-dimethylethyl)- → Other Products + CH4
2 records matched ·CH3 + 2-Propan-2-d-ol → CH3D + (CH3)2C(OH)
1 record matched ·CH3 + 2-Propan-2-d-ol → Other Products + CH4
1 record matched ·CH3 + ·CH2F → C2H4 + HF
2 records matched ·CH3 + NF2 → Methanamine, N,N-difluoro-
1 record matched ·CH3 + (C2H5)2NOH → Other Products + CH4
1 record matched ·CH3 + CHCl2 → Products
3 records matched ·CH3 + ·OH → H2O + ·CH2
2 records matched ·CH3 + ·OH → (·)CH2OH + H·
2 records matched ·CH3 + ·OH → CH3O· + H·
3 records matched ·CH3 + ·OH → H2 + HOCH
13 records matched ·CH3 + ·OH → CH3OH
3 records matched ·CH3 + ·OH → CH2O + H2
11 records matched ·CH3 + ·OH → Products
1 record matched ·CH3 + ·OH → CH2(1) + H2O
1 record matched ·CH3 + Phenoxy, 2-methyl- → Phenol, 2,5-dimethyl-
1 record matched ·CH3 + HO2 → CH3O· + ·OH
1 record matched ·CH3 + HO2 → CH4 + O2
2 records matched ·CH3 + ·CCl3 → Products
1 record matched ·CH3 + CH3CO → C2H6 + CO
3 records matched ·CH3 + CH3CO → CH4 + H2C=C=O
6 records matched ·CH3 + CH3CO → (CH3)2CO
2 records matched ·CH3 + CH3CO → Products
1 record matched ·CH3 + Cyclohexyl → Cyclohexane, methyl-
1 record matched ·CH3 + Cyclohexyl → CH4 + Cyclohexene
1 record matched ·CH3 + 1,1,3-Trimethylcyclohexane → Other Products + CH4
2 records matched ·CH3 + CH2C≡CH → CH2=C=CHCH3
2 records matched ·CH3 + CH2C≡CH → Products
2 records matched ·CH3 + CH3CD2CH3 → CH4 + CH3CD2CH2
1 record matched ·CH3 + 1-C5H11 → CH4 + 1-C5H10
1 record matched ·CH3 + ·CHF2 → CH4 + ·CF2
2 records matched ·CH3 + C2H3 → ·CH2CH=CH2 + H·
2 records matched ·CH3 + C2H3 → CH3CH=CH2
4 records matched ·CH3 + C2H3 → Cyclopropane
4 records matched ·CH3 + C2H3 → CH4 + C2H2
3 records matched ·CH3 + C2H3 → Products
2 records matched ·CH3 + CH3ND2 → CH3D + CH3ND
2 records matched ·CH3 + CH3ND2 → Other Products + CH4
6 records matched ·CH3 + HCO → CH3CHO
5 records matched ·CH3 + HCO → CH4 + CO
4 records matched ·CH3 + HCO → Products
2 records matched ·CH3 + (·)CH2OH → CH2O + CH4
1 record matched ·CH3 + SF6 → CH3F + SF5
1 record matched ·CH3 + n-C4H9 → n-C5H12
3 records matched ·CH3 + n-C4H9 → CH4 + 1-C4H8
1 record matched ·CH3 + n-C4H9 → Products
1 record matched ·CH3 + CH3CH2CH2CHCH3 → Products
1 record matched ·CH3 + Phenyl → Toluene
1 record matched ·CH3 + Phenyl → C6H6CH3
1 record matched ·CH3 + sec-C4H9 → Other Products + CH4
1 record matched ·CH3 + 1-phenylethyl → 2-Phenylpropane
1 record matched ·CH3 + CF3I → CH3I + ·CF3
2 records matched ·CH3 + CF3I → Products
4 records matched ·CH3 + ·CF3 → CH3CF3
2 records matched ·CH3 + ·CF3 → CH2=CF2 + HF
1 record matched ·CH3 + 1,2,4-Trimethylcyclohexane → Other Products + CH4
8 records matched ·CH3 + ·CH3 → ·C2H5 + H·
5 records matched ·CH3 + ·CH3 → C2H4 + H2
74 records matched ·CH3 + ·CH3 → C2H6
1 record matched ·CH3 + ·CH3 → CH4 + ·CH2
4 records matched ·CH3 + ·CH3 → Products
6 records matched ·CH3 → H· + ·CH2
5 records matched ·CH3 → H2 + ·CH
1 record matched Oxetane, 2-methyl- + ·CH3 → Other Products + CH4
2 records matched Benzyl + ·CH3 → Ethylbenzene
6 records matched CH3CH2O· → CH2O + ·CH3
1 record matched CH3O· + O· → ·CH3 + O2
1 record matched CH3O· + H· → ·CH3 + ·OH
1 record matched CH3O· + ·CH3 → (CH3)2O
7 records matched CH3O· + ·CH3 → CH2O + CH4
1 record matched n-C3H7 + ·CH3 → n-C4H10
5 records matched n-C3H7 + ·CH3 → CH4 + CH3CH=CH2
1 record matched n-C3H7 + ·CH3 → Products
10 records matched n-C3H7 → C2H4 + ·CH3
2 records matched CH3O2· + ·CH3 → CH3O· + CH3
1 record matched CH3O2· → ·CH3 + O2
2 records matched C6H5O + ·CH3 → Methoxybenzene
1 record matched C6H5O + ·CH3 → 2-Methylphenol + 4-Methylphenol
2 records matched C6H5O + ·CH3 → 2-Methylphenol
1 record matched C6H5O + ·CH3 → Products
1 record matched C6D5CD3 + ·CH3 → Other Products + CH3D
1 record matched CH3CD3 + ·CH3 → CH4 + ·CH2CD3
8 records matched ·C2H5 + H· → ·CH3 + ·CH3
10 records matched ·C2H5 + ·CH3 → C3H8
8 records matched ·C2H5 + ·CH3 → CH4 + C2H4
4 records matched ·C2H5 + ·CH3 → Products
1 record matched iso-C3H7 + ·CH3 → iso-C4H10
5 records matched iso-C3H7 + ·CH3 → CH4 + CH3CH=CH2
2 records matched iso-C3H7 + ·CH3 → Products
4 records matched iso-C3H7 → C2H4 + ·CH3
2 records matched ·CH2CH=CH2 + ·CH3 → Products
1 record matched CH3CD2OH + ·CH3 → CH3D + CH3CH(·)OD
1 record matched CH3CD2OH + ·CH3 → Other Products + CH3D
1 record matched CH3CD2OH + ·CH3 → Other Products + CH4
3 records matched CD3OH + ·CH3 → CH3D + CD2OH
2 records matched CD3OH + ·CH3 → CH4 + CD3O
1 record matched Cyclohexane, 1,3,5-trimethyl- + ·CH3 → Other Products + CH4
1 record matched Benzene, 2-ethyl-1,4-dimethyl- → ·CH3 + Methyl,(2,5-dimethylphenyl)-
1 record matched ·CCl2F + ·CH3 → CH3Cl + ·CClF
1 record matched ·CClF2 + ·CH3 → CH3Cl + ·CF2
1 record matched CD3CDO + ·CH3 → CH3D + CD3CO
3 records matched tert-C4H9 + ·CH3 → CH4 + iso-C4H8
1 record matched tert-C4H9 + ·CH3 → Products
1 record matched tert-C4H9 → CH3CH=CH2 + ·CH3
1 record matched C6D5CH3 + ·CH3 → CH4 + C6D5CH2
2 records matched C6D5CH3 + ·CH3 → Other Products + CH3D
1 record matched Si2H6 + ·CH3 → CH4 + Si2H5
1 record matched FC(O)OCH3 + ·CH3 → Other Products + CH4
2 records matched Cyclopropanecarboxaldehyde + ·CH3 → CH4 + Methyl, cyclopropyloxo-
1 record matched (CH3)6Si2 → ·CH3 + (CH3)3SiSi(·)(CH3)2
2 records matched (CH3)3Ga → ·CH3 + (CH3)2Ga
1 record matched (CH3)3Ga → Other Products + ·CH3
4 records matched H2 + ·CH2 → ·CH3 + H·
3 records matched H2 + ·CH → ·CH3
16 records matched H2 + ·CH3 → CH4 + H·
1 record matched C6H5-C(CH3)2C≡N → ·CH3 + C6H5-C(·)(CH3)C≡N
1 record matched (Z)-CH3CH=CHCN → ·CH3 + CH2=C(CN)
1 record matched C6H5CD3 + ·CH3 → CH3D + C6H5CD2
1 record matched C6H5CD3 + ·CH3 → Other Products + CH3D
2 records matched C6H5CD3 + ·CH3 → Other Products + CH4
1 record matched CH2=CHCH(CH3)CH=CH2 → ·CH3 + (CH2=CH)2CH
2 records matched (CH3)2SiH2 + ·CH3 → CH4 + (CH3)2SiH
1 record matched Methylthiirane + ·CH3 → CH3CH=CH2 + CH3
1 record matched Methylthiirane + ·CH3 → Other Products + CH4
1 record matched CH3SiD3 + ·CH3 → Other Products + CH3D
1 record matched (tert-C4H9)C≡CCH3 → ·CH3 + CH3C≡CC(CH3)2
4 records matched (CH3)3SiH + ·CH3 → CH4 + (CH3)3Si·
1 record matched (CH3)3SiH + ·CH3 → Other Products + CH4
1 record matched (CH3)3SiH → ·CH3 + (CH3)2SiH
2 records matched CH3SiH3 + ·CH2 → ·CH3 + CH3SiH2
2 records matched CH3SiH3 + ·CH3 → CH4 + CH3SiH2
1 record matched CH3SiH3 → ·CH3 + SiH3
1 record matched Benzene, 1-ethyl-3,5-dimethyl- → ·CH3 + Methyl,(3,5-dimethylphenyl)-
1 record matched (CH3)3CC≡CH → ·CH3 + HC≡CC(CH3)2
1 record matched Methanamine-d, N-methyl- + ·CH3 → CH3D + (CH3)2N
1 record matched Methanamine-d, N-methyl- + ·CH3 → Other Products + CH4
1 record matched (CH3)4Ge + ·CH3 → CH4 + (CH3)3GeCH2
2 records matched (CH3)4Ge → ·CH3 + (CH3)3Ge
3 records matched CH3NO + NO + NO → ·CH3 + N2 + NO3
1 record matched 1-Phenyl-1-butene → ·CH3 + 3-Phenyl-2-propenyl
1 record matched 2,2'-Diphenylpropane → ·CH3 + 1,1'-Diphenylethyl
1 record matched 1-Methylindene → ·CH3 + 1H-Inden-1-yl
1 record matched C2H5CH2C(CH3)=CH2 + ·CH3 → Adduct
1 record matched (CH3)2SnCl2 → ·CH3 + ·CH3 + SnCl2
1 record matched (CH3)2SnCl2 → SnCl2CH3 + ·CH3
1 record matched Methanamine, N,N-difluoro- → ·CH3 + NF2
1 record matched (CH3O)2 + ·CH3 → Other Products + CH4
1 record matched CH2CHCCH + ·CH3 → Products
2 records matched (CF3)2CO + ·CH3 → (CF3)2C(CH3)O·
1 record matched (CF3)2CO + ·CH3 → CH3COCF3 + ·CF3
2 records matched CH3D → ·CH3 + D
1 record matched (CD3)2CO + ·CH3 → Other Products + CH3D
1 record matched (CD3)2CO + ·CH3 → Adduct
1 record matched 2-(E)-C5H10 + CH3C(O)OO(·) → CO2 + ·CH3 + Oxirane, 2-ethyl-3-methyl-, trans-
1 record matched tert-C4H9OC2H5 → (CH3)2C(·)OCH2CH3 + ·CH3
1 record matched C6H5-CH=CHCH3 + H· → Styrene + ·CH3
1 record matched ((CH3)2N)2CO + ·CH3 → CH4 + (CH3)2NC(O)N(CH3)CH2·
1 record matched 2,2-dimethylpropanal + ·CH3 → CH4 + (CH3)3CC(O)·
2 records matched (CH3)3C-CN → ·CH3 + (CH3)2CCN
4 records matched CO + ·CH3 → CH3CO
5 records matched CO + CH3O· → CO2 + ·CH3
1 record matched (E)-CH3CH=CHCN → ·CH3 + CH2=C(CN)
1 record matched C2H5C≡CCH3 → ·CH3 + CH3CCCH2·
1 record matched 2-(Z)-C5H10 + CH3C(O)OO(·) → CO2 + ·CH3 + Oxirane, 2-ethyl-3-methyl-, cis-
1 record matched 2-(Z)-C5H10 + ·CH3 → Other Products + CH4
1 record matched (CH3)2CHCH=C(CH3)2 → ·CH3 + (CH3)2CCH=CHCH3
1 record matched HCOOCH(CH3)2 + ·CH3 → CH4 + ·C(O)OCH(CH3)2
1 record matched (CH3)2C=CHC2H5 + ·CH3 → Adduct
1 record matched (E)-2-C4H8 + O· → ·CH3 + CH3C(·)HCHO
1 record matched (E)-2-C4H8 + O· → ·CH3 + CH3CH2CO
1 record matched (E)-2-C4H8 + ·CH3 → (CH3)2CHCHCH3
1 record matched (E)-2-C4H8 + ·CH3 → CH4 + CH2CH=CHCH3
1 record matched (E)-2-C4H8 + ·CH3 → Other Products + CH4
1 record matched Benzene, 1-ethyl-4-methyl- → ·CH3 + 4-Methylbenzyl
1 record matched Benzene, 1-ethyl-3-methyl- → ·CH3 + 3-Methylbenzyl
2 records matched CH3OCOOCH3 + ·CH3 → CH4 + CH3OC(O)OCH2·
2 records matched CH3OCOOCH3 + ·CH3 → Other Products + CH4
1 record matched 1,1'-Diphenylethane → ·CH3 + Diphenylmethyl
1 record matched Benzene, 1-ethyl-2-methyl- → ·CH3 + 2-Methylbenzyl
1 record matched CH3C(O)C(O)C2H5 + ·CH3 → Other Products + CH4
1 record matched CH2=CHCH(OH)CH3 → ·CH3 + CH(OH)CH=CH2
1 record matched CH2=C=C(CH3)2 → ·CH3 + CH3C=C=CH2
1 record matched (CH3)2CHC≡CH → ·CH3 + CHCCH(·)CH3
1 record matched (CH3)3CC(CH3)3 + ·CH3 → CH4 + (CH3)3CC(CH3)2CH2
1 record matched (CH3)3CNO2 + ·CH3 → Other Products + CH4
5 records matched (CH3)4Sn + ·CF3 → (CH3)3SnCF3 + ·CH3
1 record matched (CH3)4Sn + ·CH3 → CH4 + (CH3)3SnCH2·
2 records matched (CH3)4Sn → ·CH3 + (CH3)3Sn
2 records matched CCl2Br2 + ·CH3 → Products
1 record matched (CH3)3Sb → ·CH3 + (CH3)2Sb
1 record matched Bismuthine, trimethyl- → (CH3)2Bi Bismuthino, dimethyl- + ·CH3
2 records matched (CH3)2Hg + Cl → CH3HgCl + ·CH3
1 record matched (CH3)2Hg + O· → ·CH3 + ·CH3 + HgO
1 record matched (CH3)2Hg + ·OH → Mercury, hydroxymethyl- + ·CH3
1 record matched (CH3)2Hg + ·CH3 → C2H6 + ·CH3 + Hg
2 records matched (CH3)2Hg + ·CH3 → Other Products + CH4
7 records matched (CH3)2Hg → ·CH3 + CH3Hg
2 records matched CH2=CHBr + O· → ·CH3 + BrCO
1 record matched CH3F + D → ·CH3 + DF
3 records matched CH3F + H· → ·CH3 + HF
1 record matched CH3F + Ca → ·CH3 + FCa
1 record matched CH3F + Cs → ·CH3 + CsF
1 record matched CH3F + Na → ·CH3 + NaF
1 record matched CH3F + K → ·CH3 + KF
1 record matched HCOO(CH2)3CH3 + ·CH3 → Other Products + CH4
1 record matched C2H5CH=CHCH=CH2 → ·CH3 + CH2=CHCH=CHCH2
1 record matched 1-C6H12 + CH3C(O)OO(·) → CO2 + Oxirane, butyl- + ·CH3
1 record matched CH3C(O)OCH2CH=CH2 + ·CH3 → 1-C4H8 + CO2 + ·CH3
1 record matched CH3C(O)OCH2CH=CH2 + ·CH3 → Other Products + CH4
1 record matched Iodobenzene + ·CH3 → CH3I + Phenyl
1 record matched Cyclohexane, 1,3-dimethyl- + ·CH3 → Other Products + CH4
1 record matched iso-C4H9CHO + ·CH3 → CH4 + iso-C4H9CO·
1 record matched 1,1-Dimethylcyclohexane + ·CH3 → Other Products + CH4
1 record matched CH2=C=CHCH3 + ·CH3 → Other Products + CH4
1 record matched CH2=C=CHCH3 → ·CH3 + CH2=C=CH
1 record matched (Z)-2-C4H8 + CH3C(O)OO(·) → Other Products + ·CH3
2 records matched (Z)-2-C4H8 + ·CH3 → (CH3)2CHCHCH3
3 records matched (Z)-2-C4H8 + ·CH3 → CH4 + CH2CH=CHCH3
1 record matched (Z)-2-C4H8 + ·CH3 → Other Products + CH4
1 record matched (Z)-2-C4H8 → ·CH2CH=CH2 + ·CH3
1 record matched Cyclohexane, 1,4-dimethyl- + ·CH3 → Other Products + CH4
1 record matched Cyclohexane, 1,2-dimethyl-(cis/trans) + ·CH3 → Other Products + CH4
1 record matched (CH3)2C=C(CH3)2 + ·CH3 → (CH3)3C-C(·)(CH3)2
3 records matched (CH3)2C=C(CH3)2 + ·CH3 → CH4 + CH2C(CH3)=C(CH3)2
1 record matched C2H5C(CH3)=CH2 + CH3C(O)OO(·) → CO2 + ·CH3 + Oxirane, 2-ethyl-2-methyl-
1 record matched C2H5C(CH3)=CH2 → ·CH3 + CH2C(CH3)=CH2
1 record matched (CH3)2CHCH=CH2 + CH3C(O)OO(·) → CO2 + Oxirane,(1-methylethyl)- + ·CH3
1 record matched (CH3)2CHCH=CH2 → ·CH3 + CH2=CHCHCH3
1 record matched (CH3)3CCH=CH2 → ·CH3 + (CH3)2CCH=CH2
3 records matched CD4 + ·CH3 → CH3D + CD3
2 records matched CBr4 + ·CH3 → CH3Br + CBr3
2 records matched CCl3CN + ·CH3 → Products
4 records matched (CH3)2Zn → ·CH3 + CH3Zn
2 records matched CH3NH-NHCH3 + ·CH3 → Other Products + CH4
1 record matched CH3NH-NHCH3 + ·CH3 → CH3NHN(·)CH3 + CH4
1 record matched C2H5OCH3 + ·CH3 → Other Products + CH4
1 record matched n-C3H7Cl + ·CH2 → ·CH3 + CH3CH2CHCl
1 record matched 1,1-Dichloroacetone → CHCl2CO + ·CH3
1 record matched (CH3)2C=CHCH3 + CH3C(O)OO(·) → CO2 + ·CH3 + oxirane, 2,2,3-trimethyl-
1 record matched (CH3)2C=CHCH3 + ·CH3 → (CH3)2CHC(·)(CH3)2
2 records matched (CH3)2C=CHCH3 + ·CH3 → Other Products + CH4
5 records matched (CH3)2Cd → ·CH3 + CH3Cd
1 record matched Oxetane + ·CH3 → Other Products + CH4
11 records matched (CH3N)2 + ·CH3 → CH4 + ·CH2N=NCH3
10 records matched (CH3N)2 + ·CH3 → Other Products + CH4
15 records matched (CH3N)2 → ·CH3 + ·CH3 + N2
15 records matched neo-C5H12 + ·CH3 → CH4 + (CH3)3CCH2
15 records matched neo-C5H12 → tert-C4H9 + ·CH3
1 record matched neo-C5H12 → iso-C4H8 + ·CH3 + H·
1 record matched H2C=C=O + ·CH2 → ·CH3 + HCCO
6 records matched H2C=C=O + H· → CO + ·CH3
1 record matched H2C=C=O + ·OH → CO2 + ·CH3
1 record matched CH2=C=CH2 + ·OH → H2C=C=O + ·CH3
3 records matched CH2=C=CH2 + ·CH3 → CH3CH2C=CH2
2 records matched CF3C(O)OCH3 + ·CH3 → Other Products + CH4
1 record matched (CH3CO)2 + ·CH3 → CH4 + H2C=C=O + CH3CO
3 records matched (CH3CO)2 + ·CH3 → (CH3)2CO + CH3CO
7 records matched (CH3CO)2 + ·CH3 → Other Products + CH4
1 record matched (CH3CO)2 + ·CH3 → Products
1 record matched (CH3CO)2 + ·C2H5 → CH3C(O)C(O)C2H5 + ·CH3
1 record matched Propanal, pentafluoro- + ·CH3 → CH4 + Propyl,2,2,3,3,3-pentafluoro-1-oxo-
1 record matched Thiirane + ·CH3 → C2H4 + CH3
1 record matched Butanal, heptafluoro- + ·CH3 → CF3CF2CF2C(O)· + CH4
2 records matched C2HF3 + ·CH3 → CH3CHFCF2·
2 records matched C2HF3 + ·CH3 → CH3CF2CHF·
1 record matched CF3CCl3 + ·CH3 → CH3Cl + CF3CCl2
1 record matched CF2BrCl + ·CH3 → Products
2 records matched 3-Fluorotoluene + H· → Fluorobenzene + ·CH3
1 record matched CH2N2 + H· → ·CH3 + N2
4 records matched N2H4 + ·CH3 → CH4 + NH2NH
2 records matched Cyclopentane + ·CH3 → CH4 + Cyclopentyl
1 record matched Bicyclo[2.1.1]hexane + ·CH3 → Other Products + CH4
5 records matched Aziridine + ·CH3 → CH4 + 1-Aziridinyl
1 record matched Aziridine + ·CH3 → 2-Aziridinyl + CH4
1 record matched 1,3-Dimethoxybenzene → ·CH3 + 3-Methoxyphenoxy radical
1 record matched 1,4-Dimethoxybenzene → ·CH3 + 4-Methoxyphenoxy radical
1 record matched 4-Methoxyphenol → ·CH3 + 4-Hydroxyphenoxy
1 record matched 3-Methoxyphenol → ·CH3 + 3-Hydroxyphenoxy
2 records matched CH3CON(CH3)2 + ·CH3 → CH4 + CH3C(O)N(CH3)CH2·
1 record matched C2Cl4 + ·CH3 → CH3Cl + CCl2=CCl
2 records matched (CH3)2NH + ·CH3 → CH4 + (CH3)2N
1 record matched (CH3)2NH + ·CH3 → Other Products + CH4
1 record matched n-C3H7CHO + ·CH3 → CH4 + CH3CH2CH2CO
1 record matched HCONHCH3 + ·CH3 → CH4 + Methyl, (Methylamino)oxo-
2 records matched N,N-Dimethylbenzenamine → ·CH3 + Amidogen, methylphenyl-
3 records matched 2-Propanone, 1,1,1,3,3,3-hexachloro- + ·CH3 → CH3Cl + CCl3C(O)CCl2·
1 record matched CF3CF=CF2 + ·CH3 → CH3CF=CF2 + ·CF3
4 records matched C2F4 + ·CH3 → CH3CF2CF2·
1 record matched CH3C(O)CH2OH → COCH2OH + ·CH3
1 record matched iso-C4H8 + O· → ·CH3 + CH3C(·)HCHO
2 records matched iso-C4H8 + H· → CH3CH=CH2 + ·CH3
1 record matched iso-C4H8 + ·CH3 → (CH3)2CCH2CH3
1 record matched iso-C4H8 + ·CH3 → (CH3)3CCH2
6 records matched iso-C4H8 + ·CH3 → CH4 + CH2C(CH3)=CH2
1 record matched iso-C4H8 + ·CH3 → Other Products + CH4
1 record matched iso-C4H8 + ·CH3 → Adduct
1 record matched iso-C4H8 → ·CH3 + CH2=C(·)CH3
1 record matched iso-C4H8 → ·CH2CH=CH2 + ·CH3
11 records matched (CH3)2O + ·CH3 → CH4 + CH3OCH2
14 records matched (CH3)2O → CH3O· + ·CH3
1 record matched CH3CH=CH2 + CH3C(O)OO(·) → Methyloxirane + CO2 + ·CH3
2 records matched CH3CH=CH2 + O· → ·CH3 + *CH2C(O)H
2 records matched CH3CH=CH2 + ·F → CH2=CHF + ·CH3
1 record matched CH3CH=CH2 + H· → C2H4 + ·CH3
1 record matched CH3CH=CH2 + ·OH → CH3CHO + ·CH3
1 record matched CH3CH=CH2 + Phenyl → Styrene + ·CH3
3 records matched CH3CH=CH2 + ·CH3 → iso-C4H9
4 records matched CH3CH=CH2 + ·CH3 → sec-C4H9
3 records matched CH3CH=CH2 + ·CH3 → CH4 + ·CH2CH=CH2
2 records matched CH3CH=CH2 + ·CH3 → Other Products + CH4
2 records matched CH3CH=CH2 + ·CH3 → Adduct
1 record matched CH3CH=CH2 + ·C2H → CH2CHCCH + ·CH3
6 records matched CH3CH=CH2 → ·CH3 + C2H3
1 record matched n-C8H18 → ·CH3 + 1-C7H15
2 records matched Cyclohexane + ·CH3 → CH4 + Cyclohexyl
1 record matched HCOOCH2CH2CH3 + ·CH3 → CH4 + ·C(O)OCH2CH2CH3
1 record matched n-C4H9CHO + ·CH3 → CH4 + n-C4H9CO·
1 record matched n-C6H14 + ·CH3 → Other Products + CH4
1 record matched 2,5-Hexanedione + ·CH3 → Other Products + CH4
5 records matched (tert-C4H9O)2 + ·CH3 → CH4 + (CH3)3COOC(CH3)2CH2
1 record matched HCOOC2H5 + ·CH3 → CH4 + CH3CH2OCO
1 record matched (C2H5)2NH + ·CH3 → CH4 + (C2H5)2N·
1 record matched CH3CH=CHC2H5 + ·CH3 → Adduct
1 record matched 1-C5H10 + ·CH3 → Adduct
2 records matched n-C5H12 + ·CH3 → Other Products + CH4
1 record matched 2-Methylpyridine + ·CH3 → CH4 + Methyl, 2-pyridinyl-
1 record matched 2-Methylpyridine → ·CH3 + 2-pyridinyl
1 record matched Phenol + ·CH3 → CH4 + C6H5O
1 record matched Toluene + ·F → Fluorobenzene + ·CH3
7 records matched Toluene + H· → Benzene + ·CH3
1 record matched Toluene + 2-Naphthalenyl → Naphthalene, 2-phenyl- + ·CH3
1 record matched Toluene + ·OH → Phenol + ·CH3
1 record matched Toluene + Phenyl → Biphenyl + ·CH3
7 records matched Toluene + ·CH3 → CH4 + Benzyl
2 records matched Toluene + ·CH3 → Other Products + CH4
2 records matched Toluene → ·CH3 + Phenyl
1 record matched Cyclohexane, methyl- + ·CH3 → Other Products + CH4
1 record matched Cyclohexane, methyl- → ·CH3 + Cyclohexyl
4 records matched 1,3,5-Trimethylbenzene + H· → 1,3-Dimethylbenzene + ·CH3
1 record matched 1,3-Dimethylbenzene + ·OH → 3-Methylphenol + ·CH3
1 record matched 1,3-Dimethylbenzene + ·OH → 4-Methylphenol + ·CH3
1 record matched 1,3-Dimethylbenzene + ·OH → 2-Methylphenol + ·CH3
1 record matched 1,3-Dimethylbenzene + ·OH → methylphenol (unspecified isomer) + ·CH3
1 record matched 1,3-Dimethylbenzene + ·CH3 → CH4 + 3-Methylbenzyl
2 records matched (iso-C3H7)2O + ·CH3 → CH4 + (CH3)2CHC(O)(CH3)2
1 record matched (iso-C3H7)2NH + ·CH3 → CH4 + (iso-C3H7)2N·
2 records matched HC(O)OCH3 + ·CH3 → CH4 + CH3OC(·)(O)
1 record matched HC(O)OCH3 → ·CH3 + HCOO
1 record matched H2NCH2CH2NH2 + ·CH3 → Other Products + CH4
2 records matched H2NCH2CH2NH2 + ·CH3 → H2NCH(·)CH2NH2 + CH4
1 record matched H2NCH2CH2NH2 + ·CH3 → NH2CH2CH2NH + CH4
1 record matched C2H5CN + ·CH3 → CH4 + N=C-CH2CH2
3 records matched C2H5CN → ·CH3 + CH2CN
1 record matched n-C3H7I + ·CH3 → CH3I + n-C3H7
1 record matched CH2=CHCHO + CH3C(O)OO(·) → CH3C(O)CHO + CO2 + ·CH3
1 record matched CH3CH=CHCH3 + ·CH3 → CH4 + CH2CH=CHCH3
1 record matched CH3CH=CHCH3 → ·CH3 + CH3CH=CH
1 record matched C2H5CCH + ·C2H → ·CH3 + CH3C≡CC≡CH
1 record matched C2H5CCH + ·C2H → CH2CCHCCH + ·CH3
3 records matched C2H5CCH → ·CH3 + CH2C≡CH
1 record matched 1,3-Butadiene + ·CH3 → CH4 + CH2=CHCH=CH·
1 record matched 1,3-Butadiene + ·CH3 → Adduct
1 record matched 1-C4H8 + O· → ·CH3 + CH3C(·)HCHO
1 record matched 1-C4H8 + ·CH3 → Other Products + CH4
1 record matched 1-C4H8 + ·CH3 → Adduct
7 records matched 1-C4H8 → ·CH2CH=CH2 + ·CH3
2 records matched n-C4H10 + ·CH3 → CH4 + sec-C4H9
7 records matched n-C4H10 + ·CH3 → Other Products + CH4
1 record matched n-C4H10 + ·CH3 → Products
5 records matched n-C4H10 → n-C3H7 + ·CH3
1 record matched 1,4-Dimethylbenzene + ·OH → methylphenol (unspecified isomer) + ·CH3
1 record matched 1,4-Dimethylbenzene + ·CH3 → CH4 + 4-Methylbenzyl
1 record matched 1,4-Dimethylbenzene → ·CH3 + Phenyl, 4-methyl-
1 record matched 1,4-Dimethylbenzene → Benzyl + ·CH3
1 record matched Methylthiobenzene → ·CH3 + C6H5S
1 record matched Methoxybenzene + ·CH3 → CH4 + C6H5OCH2
6 records matched Methoxybenzene → C6H5O + ·CH3
2 records matched N-Methylbenzenamine → ·CH3 + Amidogen, phenyl-
1 record matched Ethylbenzene + ·CH3 → CH4 + Ethyl, 2-phenyl-
1 record matched Ethylbenzene + ·CH3 → CH4 + 1-phenylethyl
11 records matched Ethylbenzene → Benzyl + ·CH3
1 record matched 1-Methyl-4-isopropylbenzene → ·CH3 + Ethyl, 1-(4-methylphenyl)-
1 record matched 1-Phenylethanone + ·CH3 → Other Products + CH4
4 records matched 2-Phenylpropane → ·CH3 + 1-phenylethyl
2 records matched Trichloromethyl benzene + ·CH3 → Dichloromethyl, phenyl- + CH3Cl
3 records matched t-Butylbenzene → ·CH3 + 2-Phenyl-2-propyl radical
1 record matched (C2H5)3B + ·CH3 → Borane, diethylmethyl- + ·C2H5
1 record matched (C2H5)3B + ·CH3 → Other Products + CH4
1 record matched Pyrrole, 1-methyl- → ·CH3 + 1H-Pyrrol-1-yl
1 record matched Methylcyclopentane → ·CH3 + Cyclopentyl
1 record matched sec-C4H9CHO + ·CH3 → Other Products + CH4
2 records matched 2-Fluorotoluene + H· → Fluorobenzene + ·CH3
1 record matched 1,2-Dimethylbenzene + ·OH → methylphenol (unspecified isomer) + ·CH3
1 record matched 1,2-Dimethylbenzene + ·CH3 → CH4 + 2-Methylbenzyl
1 record matched 1,2-Dimethoxybenzene → ·CH3 + 2-Methoxyphenoxy radical
1 record matched 2-Methoxyphenol → ·CH3 + 2-Hydroxyphenoxy radical
2 records matched 2-nitropropane + ·CH3 → Products
1 record matched (CH3)2CHCH(CH3)2 + ·CH3 → Other Products + CH4
2 records matched (CH3)2CHCH(CH3)2 → ·CH3 + (CH3)2CHCHCH3
2 records matched CH3C(O)OCH3 + ·CH3 → CH4 + CH2C(O)OCH3
2 records matched CH3C(O)OCH3 + ·CH3 → CH4 + CH3C(O)OCH2
2 records matched CH3C(O)OCH3 + ·CH3 → Other Products + CH4
1 record matched CH3C(O)OCH3 → ·CH3 + CH3C(O)O
1 record matched CH3C(O)CHO + ·CH3 → Other Products + CH4
1 record matched C2H5COCH3 + ·CH3 → C2H5C(CH3)2O(·)
1 record matched (CH3)2CHCHO + ·CH3 → CH4 + (CH3)2CHC=O
1 record matched iso-C3H7CN → ·CH3 + CH3CHCN
1 record matched (C2H5O)4Si → (.)CH2OSi(OC2H5)3 + ·CH3
1 record matched CF3CF2Cl + ·CH3 → CH3Cl + C2F5
1 record matched CFCl2CF2Cl + ·CH3 → Other Products + CH3Cl
2 records matched CF3CHO + ·CH3 → CH4 + CF3C(O)
1 record matched CH3SiCl3 + ·CH3 → CH4 + Cl3SiCH2·
1 record matched CH3SiCl3 → ·CH3 + SiCl3
1 record matched (CH3)2SiCl2 + ·CH3 → CH4 + CH3Cl2SiCH2·
1 record matched (CH3)3SiCl + ·CH3 → CH4 + (CH3)2SiClCH2
5 records matched (CH3)4Si + ·CH3 → CH4 + (CH3)3SiCH2
3 records matched (CH3)4Si → ·CH3 + (CH3)3Si·
1 record matched (CH3)4Pb + ·CH3 → CH4 + (CH3)3PbCH2
1 record matched CF3Cl + ·CH3 → CH3Cl + ·CF3
2 records matched CF2Cl2 + ·CH3 → CH3Cl + ·CClF2
3 records matched CFCl3 + ·CH3 → CH3Cl + ·CCl2F
1 record matched tert-C4H9SH + ·CH3 → CH4 + (CH3)3CS·
4 records matched CF3Br + ·CH3 → CH3Br + ·CF3
1 record matched CCl3Br + ·CH3 → CH3Cl + BrCCl2
3 records matched CCl3Br + ·CH3 → CH3Br + ·CCl3
2 records matched CF2Br2 + ·CH3 → CH3Br + CBrF2
1 record matched Methyloxirane → ·CH3 + *CH2C(O)H
1 record matched Methyloxirane → ·CH3 + CH3CO
2 records matched CH3NO2 + H· → ·CH3 + HNO2
2 records matched CH3NO2 + ·CH3 → CH4 + CH2NO2
14 records matched CH3NO2 → ·CH3 + NO2
1 record matched (CH3)3N + ·CH3 → CH4 + CH2N(CH3)2
1 record matched CHF2Cl + ·CH3 → CH4 + ·CClF2
2 records matched CH2=CF2 + ·CH3 → CH3CF2CH2(·)
1 record matched iso-C3H7SH + ·CH3 → CH4 + (CH3)2CHS
1 record matched iso-C3H7I + ·CH3 → CH3I + iso-C3H7
2 records matched iso-C4H10 + N + N → iso-C3H7 + ·CH3 + N2
2 records matched iso-C4H10 + ·CH3 → CH4 + tert-C4H9
6 records matched iso-C4H10 + ·CH3 → Other Products + CH4
15 records matched iso-C4H10 → iso-C3H7 + ·CH3
1 record matched Oxirane + ·CH3 → CH4 + Oxiranyl
2 records matched Oxirane → ·CH3 + HCO
1 record matched (CH3)2S + Cl → ·CH3 + CH3SCl
6 records matched (CH3)2S + O· → ·CH3 + CH3SO
1 record matched (CH3)2S + OD → CH3SOD + ·CH3
1 record matched (CH3)2S + H· → CH3SH + ·CH3
1 record matched (CH3)2S + ·CH3 → CH4 + CH3SCH2
1 record matched (CH3)2S → ·CH3 + CH3
3 records matched HCONH2 + ·CH3 → CH4 + C(O)NH2
1 record matched HCONH2 + ·CH3 → Other Products + CH4
1 record matched CH2I2 + ·CH3 → CH3I + ·CH2I
1 record matched CH2Cl2 + ·CH3 → CH4 + CHCl2
1 record matched C2H5SH + ·CH3 → CH4 + CH3CH2S
1 record matched C2H5SH + ·CH3 → Other Products + CH4
2 records matched CH3CHO + H· → CO + H2 + ·CH3
1 record matched CH3CHO + CH3S· → CH3SH + CO + ·CH3
1 record matched CH3CHO + ·OH → HCOOH + ·CH3
1 record matched CH3CHO + ·CH → H2C=C=O + ·CH3
1 record matched CH3CHO + ·CH3 → CH4 + CH3CO
1 record matched CH3CHO + ·CH3 → CH4 + CH2=CHO·
1 record matched CH3CHO + ·CH3 → CH4 + *CH2C(O)H
14 records matched CH3CHO + ·CH3 → CH4 + CH3CO
2 records matched CH3CHO + ·CH3 → (CH3)2CO + H·
14 records matched CH3CHO → ·CH3 + HCO
1 record matched CH3CHO → CO + ·CH3 + H·
1 record matched CH3CN + H· → HCN + ·CH3
1 record matched CH3CN + ·CH3 → CH4 + CH2CN
2 records matched C2H5NH2 + ·CH3 → CH4 + CH3CH2NH·
1 record matched C2H5NH2 + ·CH3 → CH4 + CH3CHNH2
1 record matched C2H5NH2 + ·CH3 → Other Products + CH4
1 record matched C2H5I + ·CH3 → CH3I + ·C2H5
2 records matched CH2=CHF + O· → FCO + ·CH3
2 records matched CH2=CHF + ·CH3 → CH3CH2CHF(·)
2 records matched CH2=CHF + ·CH3 → CH3CHFCH2
2 records matched CH2=CHCl + O· → ·CH3 + ClCO
2 records matched CH2=CHCl + ·CH3 → CH3CH2CHCl
1 record matched C2H5Cl + ·CH2 → ·CH3 + CH2CH2Cl
6 records matched CH3CCH + H· → C2H2 + ·CH3
1 record matched CH3CCH + ·CH3 → CH3CH=CCH3
2 records matched CH3CCH + ·C2H → 1,3-Butadiyne + ·CH3
1 record matched C3H8 + ·CH2 → n-C3H7 + ·CH3
5 records matched C3H8 + ·CH3 → CH4 + n-C3H7
1 record matched C3H8 + ·CH3 → CH4 + iso-C3H7
1 record matched C3H8 + ·CH3 → Other Products + CH4
8 records matched C3H8 + ·CH3 → Products
19 records matched C3H8 → ·C2H5 + ·CH3
1 record matched CH3SH + H· → ·CH3 + H2S
1 record matched CH3SH + ·CH3 → CH4 + CH3
3 records matched CH3NH2 + ·CH3 → CH4 + CH3NH
2 records matched CH3NH2 + ·CH3 → CH4 + CH2NH2
1 record matched CH3NH2 + ·CH3 → Other Products + CH4
5 records matched CH3NH2 → ·CH3 + NH2
2 records matched CH3I + O· → ·CH3 + IO
3 records matched CH3I + ·F → ·CH3 + IF
3 records matched CH3I + I → ·CH3 + I2
5 records matched CH3I + H· → ·CH3 + HI
1 record matched CH3I + Cu → ·CH3 + CuI
1 record matched CH3I + Na → ·CH3 + NaI
1 record matched CH3I + K → ·CH3 + KI
9 records matched CH3I → ·CH3 + I
1 record matched CH3Cl + (CH3)3Si· → (CH3)3SiCl + ·CH3
1 record matched CH3Cl + BF → ·CH3 + ClBF
4 records matched CH3Cl + H· → ·CH3 + HCl
1 record matched CH3Cl + Ca → ·CH3 + CaCl
1 record matched CH3Cl + Cu → ·CH3 + CuCl
2 records matched CH3Cl + Cs → ·CH3 + CsCl
3 records matched CH3Cl + Na → ·CH3 + NaCl
2 records matched CH3Cl + Rb → ·CH3 + RbCl
1 record matched CH3Cl + K → ·CH3 + KCl
1 record matched CH3Cl + Pb → ·CH3 + PbCl
2 records matched CH3Cl + ·CH3 → CH4 + ·CH2Cl
7 records matched CH3Cl → ·CH3 + Cl
1 record matched C2H2 + ·OH → CO + ·CH3
4 records matched C2H2 + ·CH3 → CH3CH=CH
1 record matched C2H2 + ·CH3 → ·CH2CH=CH2
2 records matched C2H2 + ·CH3 → CH2=C=CH2 + H·
3 records matched C2H2 + ·CH3 → CH3CCH + H·
11 records matched C2H4 + N → HCN + ·CH3
12 records matched C2H4 + O· → ·CH3 + HCO
6 records matched C2H4 + ·CH3 → n-C3H7
1 record matched C2H4 + ·CH3 → CH3CH=CH2 + H·
7 records matched C2H4 + ·CH3 → CH4 + C2H3
1 record matched C2H4 + ·C2H5 → CH3CH=CH2 + ·CH3
1 record matched C2H6 + ·CH2 → ·C2H5 + ·CH3
1 record matched C2H6 + H· → CH4 + ·CH3
1 record matched C2H6 + ·CH → C2H4 + ·CH3
8 records matched C2H6 + ·CH3 → CH4 + ·C2H5
48 records matched C2H6 → ·CH3 + ·CH3
1 record matched CH3Br + SiCl3 → ·CH3 + Silane, bromotrichloro-
1 record matched CH3Br + D → ·CH3 + DBr
5 records matched CH3Br + H· → ·CH3 + HBr
1 record matched CH3Br + Cu → ·CH3 + CuBr
1 record matched CH3Br + Cs → ·CH3 + CsBr
2 records matched CH3Br + Na → ·CH3 + NaBr
2 records matched CH3Br + Rb → ·CH3 + RbBr
2 records matched CH3Br + K → ·CH3 + KBr
1 record matched CH3Br + Pb → ·CH3 + Lead bromide
1 record matched CH3Br + ·CH3 → CH4 + ·CH2Br
1 record matched CH3Br → ·CH3 + Br·
2 records matched CH4 + CCCN → HCCCN + ·CH3
2 records matched CH4 + ·CH2 → ·CH3 + ·CH3
1 record matched CH4 + CF3CF → ·CH3 + CF3CHF
64 records matched CH4 + Cl → ·CH3 + HCl
9 records matched CH4 + CF3O → CF3OH + ·CH3
24 records matched CH4 + O· → ·CH3 + ·OH
5 records matched CH4 + D → ·CH3 + HD
1 record matched CH4 + (CH3)3Si· → (CH3)3SiH + ·CH3
1 record matched CH4 + SiF3 → ·CH3 + SiHF3
30 records matched CH4 + ·F → ·CH3 + HF
1 record matched CH4 + AlO → ·CH3 + AlOH
3 records matched CH4 + I → ·CH3 + HI
1 record matched CH4 + NH → ·CH3 + NH2
5 records matched CH4 + NH2 → ·CH3 + NH3
2 records matched CH4 + OD → ·CH3 + HDO
2 records matched CH4 + H· → ·CH3 + H·
29 records matched CH4 + H· → H2 + ·CH3
1 record matched CH4 + NO2 → ·CH3 + HNO2
7 records matched CH4 + Br· → ·CH3 + HBr
1 record matched CH4 + O2 → ·CH3 + HO2
1 record matched CH4 + F2 → ·CH3 + HF + ·F
1 record matched CH4 + S → ·CH3 + SH
1 record matched CH4 + Si → ·CH3 + SiH
1 record matched CH4 + Kr → ·CH3 + Kr + H·
57 records matched CH4 + ·OH → ·CH3 + H2O
1 record matched CH4 + HO2 → ·CH3 + H2O2
4 records matched CH4 + ·CCl3 → CHCl3 + ·CH3
1 record matched CH4 + n-C3F7 → ·CH3 + C2F5CF2H
2 records matched CH4 + ·CHF2 → CH2F2 + ·CH3
3 records matched CH4 + Phenyl → Benzene + ·CH3
2 records matched CH4 + ·CF3 → CHF3 + ·CH3
1 record matched CH4 + ·CH3 → C2H6 + H·
2 records matched CH4 + ·CH3 → CH4 + ·CH3
1 record matched CH4 + ·CF2 → ·CH3 + ·CHF2
1 record matched CH4 + CH3O· → CH3OH + ·CH3
9 records matched CH4 + ·C2H → C2H2 + ·CH3
4 records matched CH4 + CD3 → CHD3 + ·CH3
1 record matched CH4 + ·C2H5 → C2H6 + ·CH3
30 records matched CH4 → ·CH3 + H·
2 records matched Benzene + ·CH3 → Cyclohexadienyl, 6-methyl-
3 records matched Benzene + ·CH3 → CH4 + Phenyl
1 record matched n-C4H9OH → ·CH3 + HOCH2CH2CH2
1 record matched HCON(CH3)2 + ·CH3 → Other Products + CH4
3 records matched CCl3CCl3 + ·CH3 → CH3Cl + C2Cl5
1 record matched (CH3)2SO2 → ·CH3 + CH3S(O)2
1 record matched (CH3)2SO + ·OH → ·CH3 + CH3S(O)OH
1 record matched (CH3)2SO + ·CH3 → Products
1 record matched CHCl3 + ·CH3 → CH4 + ·CCl3
1 record matched (CH3)2CO + Cl → CH3COCl + ·CH3
3 records matched (CH3)2CO + ·OH → CH3C(O)OH + ·CH3
2 records matched (CH3)2CO + ·CH3 → (CH3)3CO
26 records matched (CH3)2CO + ·CH3 → CH4 + CH3C(O)CH2(·)
6 records matched (CH3)2CO → ·CH3 + CH3CO
1 record matched iso-C3H7OH + ·CH3 → Other Products + CH4
1 record matched CH3ONH2 + ·CH3 → Other Products + CH4
3 records matched CH3OH + N → ·CH3 + HNO
1 record matched CH3OH + Kr → ·CH3 + ·OH + Kr
1 record matched CH3OH + ·CH3 → CH4 + (·)CH2OH
1 record matched CH3OH + ·CH3 → CH4 + CH3
4 records matched CH3OH + ·CH3 → Other Products + CH4
11 records matched CH3OH → ·CH3 + ·OH
1 record matched CH3C(O)OH + ·OH → CO2 + ·CH3 + H2O
3 records matched C2H5OH + ·CH3 → CH4 + CH3CHOH
1 record matched C2H5OH + ·CH3 → CH4 + CH3CH2
1 record matched C2H5OH + ·CH3 → Other Products + CH4
5 records matched C2H5OH → ·CH3 + (·)CH2OH
1 record matched CH3NHNH2 + ·CH3 → Other Products + CH4
1 record matched (C2H5)2O + ·CH3 → CH4 + 2-C4H9O
1 record matched (C2H5)2O + ·CH3 → Other Products + CH4
1 record matched (CH3)2NNH2 + ·CH3 → CH4 + Hydrazyl, 2,2-dimethyl-
2 records matched (CH3)2NNH2 + ·CH3 → Other Products + CH4
16 records matched CN + CH4 → HCN + ·CH3
5 records matched CCl4 + ·CH3 → CH3Cl + ·CCl3
6 records matched CH2O + ·CH3 → CH4 + HCO
1 record matched Cl(2P3/2) + CH4 → ·CH3 + HCl
1 record matched O(1D) + CH3Cl → ·CH3 + ClO
1 record matched O(1D) + C2H4 → ·CH3 + HCO
1 record matched O(1D) + CH3Br → ·CH3 + BrO
6 records matched O(1D) + CH4 → ·CH3 + ·OH
1 record matched (CH3)2NND2 + ·CH3 → (CH3)2NN(D)· + CH3D
1 record matched (CH3)2NND2 + ·CH3 → ·CH2N(CH3)ND2 + CH4
1 record matched (CH3)2C(·)CH2C(CH3)2CH2CH3 + ·CH3 → CH4 + 2,4,4-Trimethyl-1-hexene
1 record matched ·CHFCF2Cl + ·CH3 → CF3CHClCH3
1 record matched ·CHFCF2Cl + ·CH3 → CH3CF=CF2 + HCl
1 record matched ·CHFCF2Cl + ·CH3 → CF2ClCH=CH2 + HF
1 record matched 2,5-Cyclohexadien-1-one, 4-methyl- + ·CH3 → CH4 + Phenoxy, 4-methyl-
1 record matched Aziridine-1-d + ·CH3 → 2-Aziridinyl + CH3D
1 record matched Aziridine-1-d + ·CH3 → 2-Aziridinyl-1-d + CH4
1 record matched M + ·CH3 → M + H· + ·CH2
1 record matched M + ·CH3 → M + H2 + ·CH
1 record matched M + CH3CH2O· → CH2O + ·CH3
1 record matched M + CH4 → M + ·CH3 + H·
2 records matched OCH(CH3)2 → CH3CHO + ·CH3
1 record matched O(3P) + C3H8 → CH3CH2O· + ·CH3
1 record matched O(3P) + C3H8 → CH3CHO + ·CH3 + H·
1 record matched O(3P) + C2H6 → CH3O· + ·CH3
1 record matched O(3P) + CH4 → ·CH3 + ·OH
1 record matched O(1D) + CH4 → ·CH3 + ·OH
1 record matched ·CH(OH)C(O)CH3 + O2 → HCOOH + CO2 + ·CH3
1 record matched CH2=C(·)CH2CH3 → CH2=C=CH2 + ·CH3
2 records matched CH3CHOCH2CH3 → C2H5CHO + ·CH3
3 records matched CH3CH2C(CH3)2O(·) → C2H5COCH3 + ·CH3
2 records matched S(1D) + C2H4 → ·CH3 + HC=S
1 record matched 6-hydroxy-1,2,3,4,5,6-hexamethylcyclohexa-2,4-dien-1-yl → ·CH3 + 2,3,4,5,6-pentamethylphenol
1 record matched CH3C(O)CHCl· → ·CH3 + CHCl=C=O
1 record matched CH3CH2CH2CH(·)CH(CH3)2 → ·CH3 + (Z)-2-C6H12
1 record matched (CH3)2C(O·)CH2CH2CH3 → n-C3H7C(O)CH3 + ·CH3
2 records matched CH3CH2CH2CH(CH3)CH2· → 1-C5H10 + ·CH3
1 record matched 5-isopropylcyclopenta-1,3-diene → Toluene + ·CH3
1 record matched 2-tert-butylcyclopenta-1,3-diene → 2-isopropylcyclopenta-1,3-diene + ·CH3
1 record matched 1-tert-butylcyclopenta-1,3-diene → 1-isopropylcyclopenta-1,3-diene + ·CH3
1 record matched C2H5OCHO·CH3 → HCOOC2H5 + ·CH3
1 record matched O2(X3Sigma_g-) + C2H3 → CO2 + ·CH3
1 record matched CH3OBH* → ·CH3 + HBO
2 records matched CH3CHBrO(·) → ·CH3 + HC(O)Br
2 records matched In(CH3)2 → InCH3(singlet) + ·CH3
2 records matched In(CH3)2 → InCH3(triplet) + ·CH3
1 record matched (CH3)2Ga → ·CH3 + CH3Ga
2 records matched (CH3)2C(CH2OOH)CH2· → ·CH3 + 2-Methyl-2-propenylhydroperoxide
1 record matched CH3SSCH2 → cyc-CH2SS + ·CH3
2 records matched 2,3-Dihydro-1-methylinden-2-yl → Indene + ·CH3
1 record matched Cyclohexadienyl, 6-methyl- → Benzene + ·CH3
1 record matched CH2CH=CHCH2CH3 → 1,3-Butadiene + ·CH3
2 records matched CH2=CHCH(CH3)CH2· → 1,3-Butadiene + ·CH3
1 record matched CH3NH → ·CH3 + NH
1 record matched Silyl, dichloromethyl- → ·CH3 + SiCl2
2 records matched CH3OF → ·CH3 + OF
1 record matched Oxiranyl → CO + ·CH3
1 record matched CH3SCH2 → CH2S + ·CH3
1 record matched CH2=C(OH)CH3 → ·CH3 + CH3CO
1 record matched (CH3)2CHC(O)(CH3)2 → iso-C3H7C(O)CH3 + ·CH3
1 record matched CH3CH2CH(CH3)O → C2H5CHO + ·CH3
2 records matched (CH3)3CCH(CH3)CH2· → (CH3)3CCH=CH2 + ·CH3
1 record matched (CH3)3CC(CH3)2CH2 → (CH3)3CC(CH3)=CH2 + ·CH3
1 record matched (CH3)2CHCH(CH3)CH(·)CH3 → (Z)-(CH3)2CHCH=CHCH3 + ·CH3
1 record matched 3-hexyl radical → 1-C5H10 + ·CH3
1 record matched C6H5CH(.)CH2CH3 → Styrene + ·CH3
3 records matched CH2=CHCHCH2CH3 → 1,3-Butadiene + ·CH3
1 record matched CH3OCH2 + O· → HCOOH + ·CH3
3 records matched CH3OCH2 → CH2O + ·CH3
6 records matched CH3OC(·)(O) → CO2 + ·CH3
1 record matched CH3CO → CO + ·CH3
2 records matched CH2C(CH3)=CH2 → CH2=C=CH2 + ·CH3
1 record matched CH3CH2S → CH2S + ·CH3
2 records matched CH3C(O)O → CO2 + ·CH3
1 record matched NH2 + CH3Ga → GaNH2 + ·CH3
1 record matched C2H5C(CH3)2O(·) → C2H5COCH3 + ·CH3
1 record matched H· + ·CH2 → ·CH3
1 record matched SiHCl3 + ·CH2 → ·CH3 + SiCl3
1 record matched HCl + ·CH2 → ·CH3 + Cl
1 record matched CH3S· + O2 → ·CH3 + SO2
1 record matched CH3CH=CH → C2H2 + ·CH3
2 records matched CH3S(O)2 → ·CH3 + SO2
4 records matched iso-C4H9 → CH3CH=CH2 + ·CH3
1 record matched 1-C8H17 → 1-C7H14 + ·CH3
1 record matched *CH2C(O)H → CO + ·CH3
1 record matched (CH3)2CCH2CH3 → iso-C4H8 + ·CH3
1 record matched (E)-CH3N=NCH3 → ·CH3 + ·CH3 + N2
3 records matched i-C3H7O → CH3CHO + ·CH3
2 records matched (CH3)3CCH2 + O2 → ·CH3 + 2-Methyl-2-propenylhydroperoxide
5 records matched (CH3)3CCH2 → iso-C4H8 + ·CH3
3 records matched In(CH3)3 → ·CH3 + In(CH3)2
1 record matched CH3CO + O· → CO2 + ·CH3
1 record matched CH3CO + NO2 → CO2 + ·CH3 + NO
5 records matched CH3CO → CO + ·CH3
8 records matched (CH3)3CO → (CH3)2CO + ·CH3
1 record matched 1-C5H11 → 1-C4H8 + ·CH3
1 record matched C2H3 + O· → CO + ·CH3
1 record matched C2H3 + ·OH → ·CH3 + HCO
1 record matched C2H3 + ·OH → CO + ·CH3 + H·
4 records matched sec-C4H9 → CH3CH=CH2 + ·CH3
1 record matched 4-Methylbenzyl → ·CH3 + 1,3-Cyclopentadiene, 5-ethenylidene-
1 record matched 2-Methylbenzyl → ·CH3 + 1,3-Cyclopentadiene, 5-ethenylidene-
1 record matched 3-Methylbenzyl → ·CH3 + 1,3-Cyclopentadiene, 5-ethenylidene-
3 records matched CH3CHOH → CH2O + ·CH3
1 record matched CH3C(O)OONO2 → CO2 + ·CH3 + NO3
1 record matched ·CH3 + 1,3-Cyclopentadiene, 5-ethynyl- → fulvallenyl + CH4
2 records matched ·CH3 + In(CH3)2 → In(CH3)3
1 record matched ·CH3 + AlH(CH3) → AlH(CH3)2
1 record matched ·CH3 + SiHCl2 → CH4 + SiCl2
1 record matched ·CH3 + ·CH2 → ·C2H5
1 record matched ·CH3 + ·CH2 → C2H4 + H·
1 record matched ·CH3 + CH2=NCH2 → CH3CH2N=CH2
1 record matched ·CH3 + CH2=CHNH → CH3CH2CH=NH
1 record matched ·CH3 + CH2=CHNH → CH3NHCH=CH2
1 record matched ·CH3 + CH3SS → (CH3S)2
1 record matched ·CH3 + 1,3-Cyclopentadiene, 5-ethenylidene- → fulvallenyl + CH4
1 record matched ·CH3 + CH3N=NH → CH4 + CH3N=N
1 record matched ·CH3 + CH3CHNHCH2CH3 → Other Products + CH4
1 record matched ·CH3 + DCOOCH3 → CH4 + ·CH2C(O)OD
2 records matched ·CH3 + Cl → HCl + ·CH2
1 record matched ·CH3 + SiCl3 → SiHCl3 + ·CH2
1 record matched ·CH3 + SiCl3 → CH3SiCl3
1 record matched ·CH3 + SiCl3 → CH3Cl + SiCl2
1 record matched ·CH3 + Methyl,(3,5-dimethylphenyl)- → Benzene, 1-ethyl-3,5-dimethyl-
1 record matched ·CH3 + N → H· + H2C=N
2 records matched ·CH3 + N → Products
1 record matched ·CH3 + N → trans-HCNH + H·
1 record matched ·CH3 + N → H2NC + H·
1 record matched ·CH3 + O· → CH3
1 record matched ·CH3 + O· → CO + H2 + H·
2 records matched ·CH3 + O· → CH2O + H·
1 record matched ·CH3 + D → CH3D
1 record matched ·CH3 + (CH3)3Si· → (CH3)4Si
1 record matched ·CH3 + ·CH2I → C2H5I
1 record matched ·CH3 + CH3CH2CO → C2H5COCH3
1 record matched ·CH3 + BrO → CH3OBr
1 record matched ·CH3 + (CH3)2N → CH4 + CH2=NCH3
1 record matched ·CH3 + ClO → CH3OCl
1 record matched ·CH3 + ·F → ·CH2F + H·
1 record matched ·CH3 + ·F → H2 + ·CHF
1 record matched ·CH3 + ·F → CH3F
1 record matched ·CH3 + ·F → CH2(X3B_1) + HF
1 record matched ·CH3 + ·F → CH_2(aA_1) + HF
1 record matched ·CH3 + HNO → CH3NO + H·
2 records matched ·CH3 + HNO → CH4 + NO
2 records matched ·CH3 + HD → CH3D + H·
2 records matched ·CH3 + HD → CH4 + D
1 record matched ·CH3 + SH → CH3SH
18 records matched ·CH3 + NH2 → CH4 + NH
1 record matched ·CH3 + SiCl2 → Silyl, dichloromethyl-
2 records matched ·CH3 + DBr → CH3D + Br·
1 record matched ·CH3 + H· → H2 + ·CH2
9 records matched ·CH3 + H· → CH4
1 record matched ·CH3 + OF → CH3OF
1 record matched ·CH3 + 2-Naphthalenyl → 2-Methylnaphthalene
1 record matched ·CH3 + NO2 → HNO2 + ·CH2
1 record matched ·CH3 + NO2 → CH3O· + NO
1 record matched ·CH3 + NO2 → CH3ONO
2 records matched ·CH3 + NO2 → CH3NO2
1 record matched ·CH3 + NO2 → CH2O + HNO
1 record matched ·CH3 + NO2 → trans-HONO + ·CH2
4 records matched ·CH3 + NO → CH3NO
1 record matched ·CH3 + NO → Products
1 record matched ·CH3 + Br· → HBr + ·CH2
5 records matched ·CH3 + HBr → CH4 + Br·
2 records matched ·CH3 + HI → CH4 + I
1 record matched ·CH3 + O3 → CH3O· + O2
1 record matched ·CH3 + SiHCl3 → CH4 + SiCl3
1 record matched ·CH3 + SiH4 → CH4 + SiH3
1 record matched ·CH3 + ICl → CH3I + Cl
1 record matched ·CH3 + IBr → CH3I + Br·
1 record matched ·CH3 + H2S → CH3SH + H·
2 records matched ·CH3 + H2S → CH4 + SH
1 record matched ·CH3 + HN3 → CH4 + ·N3
1 record matched ·CH3 + GeH4 → CH4 + GeH3
4 records matched ·CH3 + O2 → CH3O2·
5 records matched ·CH3 + O2 → CH2O + ·OH
1 record matched ·CH3 + O2 → Products
4 records matched ·CH3 + D2 → CH3D + D
2 records matched ·CH3 + H2O → CH4 + ·OH
3 records matched ·CH3 + Br2 → CH3Br + Br·
3 records matched ·CH3 + NH3 → CH4 + NH2
1 record matched ·CH3 + HF → CH4 + ·F
2 records matched ·CH3 + HCl → CH3Cl + H·
18 records matched ·CH3 + HCl → CH4 + Cl
3 records matched ·CH3 + I2 → CH3I + I
2 records matched ·CH3 + In → InCH3(singlet)
2 records matched ·CH3 + In → InCH3(triplet)
1 record matched ·CH3 + HNC → Products
1 record matched ·CH3 + ·CH2Cl → ·C2H5 + Cl
1 record matched ·CH3 + ·CH2Cl → C2H5Cl
1 record matched ·CH3 + ·CH2Cl → C2H4 + HCl
1 record matched ·CH3 + CH2=C=CH → CH2=C=CHCH3
1 record matched ·CH3 + 1-C8H17 → n-C9H20
1 record matched ·CH3 + (E)-CH3CH=CHCHO → (E)-2-C4H8 + HCO
1 record matched ·CH3 + CH3CDO → CH3D + CH3CO
1 record matched ·CH3 + (CH3)2Si=CH2 → (CH3)3SiCH2
1 record matched ·CH3 + ·CH2F → C2H5F
1 record matched ·CH3 + NF2 → Adduct
1 record matched ·CH3 + CHCl2 → CH3CHCl + Cl
1 record matched ·CH3 + CHCl2 → CH2=CHCl + HCl
2 records matched ·CH3 + ·OH → H2O + ·CH2
4 records matched ·CH3 + ·OH → (·)CH2OH + H·
3 records matched ·CH3 + ·OH → CH3O· + H·
4 records matched ·CH3 + ·OH → CH3OH
2 records matched ·CH3 + ·OH → CH2O + H2
1 record matched ·CH3 + ·OH → Products
1 record matched ·CH3 + ·OH → CH2(X3B_1) + H2O
2 records matched ·CH3 + ·OH → trans-HCOH + H2
2 records matched ·CH3 + ·OH → cis-HCOH + H2
2 records matched ·CH3 + ·OH → CH2(1) + H2O
1 record matched ·CH3 + HO2 → CH3O· + ·OH
1 record matched ·CH3 + HO2 → O2(1DELTA) + CH4
1 record matched ·CH3 + ·CCl3 → CH3CCl2· + Cl
1 record matched ·CH3 + ·CCl3 → CH2=CCl2 + HCl
1 record matched ·CH3 + CH3C(O)CH2(·) → C2H5COCH3
1 record matched ·CH3 + (E)-CH3C(O)CH=CHCH3 → (E)-2-C4H8 + CH3CO
1 record matched ·CH3 + CH2C≡CH → C2H5CCH
1 record matched ·CH3 + C2H3 → ·CH2CH=CH2 + H·
1 record matched ·CH3 + ·HCC≡N → CH3CN + H·
2 records matched ·CH3 + HCO → CH4 + CO
1 record matched ·CH3 + (·)CH2OH → C2H5OH
1 record matched ·CH3 + SnH4 → SnH3 + CH4
1 record matched ·CH3 + CF3I → CH3I + ·CF3
1 record matched ·CH3 + ·CF3 → CH3CF3
2 records matched ·CH3 + ·CH3 → ·C2H5 + H·
37 records matched ·CH3 + ·CH3 → C2H6
1 record matched ·CH3 + ·CH3 → CH4 + ·CH2
3 records matched ·CH3 → H· + ·CH2
1 record matched S=C(CH3)SCH3 + ·CH3 → CH3SC(·)(CH3)SCH3
1 record matched ·CF2 + ·CH3 → CH2=CF2 + H·
3 records matched Benzyl + ·CH3 → Ethylbenzene
16 records matched CH3CH2O· → CH2O + ·CH3
2 records matched CH3O· + O· → ·CH3 + O2
1 record matched n-C3H7 + ·CH3 → CH4 + CH3CH=CH2
8 records matched n-C3H7 → C2H4 + ·CH3
1 record matched CH3O2· + ·CH3 → CH3O· + CH3
1 record matched Cyclopentadienyl + ·CH3 → H· + CH3(cyc-C5H4)
1 record matched Cyclopentadienyl + ·CH3 → Fulvene + H2
1 record matched Cyclopentadienyl + ·CH3 → 1,3-Cyclopentadiene, 5-methyl-
1 record matched Cyclopentadienyl + ·CH3 → cyc-C(=CH2)-C(·)H-CH=CH-CH2 + H·
1 record matched Cyclopentadienyl + ·CH3 → cyc-C(=CH2)-CH=CH-CH2-CH· + H·
1 record matched Cyclopentadienyl + ·CH3 → cyc-C(-C(·)H2)-CH=CH-CH=CH + H·
1 record matched Cyclopentadienyl + ·CH3 → methylcyclopentadiene (mixture of isomers)
1 record matched Stannane, dimethyl- + CH3CO → CH3SnH2COCH3 + ·CH3
1 record matched ·C2H5 + N → ·CH3 + H2C=N
2 records matched ·C2H5 + O· → CH2O + ·CH3
1 record matched ·C2H5 + ·CH3 → n-C3H7
4 records matched ·C2H5 + ·CH3 → C3H8
1 record matched ·C2H5 + ·CH3 → C2H6 + ·CH2
4 records matched ·C2H5 + ·CH3 → CH4 + C2H4
1 record matched ·C2H5 → ·CH3 + ·CH2
3 records matched iso-C3H7 + ·CH3 → iso-C4H10
3 records matched iso-C3H7 + ·CH3 → CH4 + CH3CH=CH2
1 record matched ·CH2CH=CH2 + ·CH3 → 1-C4H8
2 records matched CH3CD2OH + ·CH3 → CH3D + CH3CH(·)OD
4 records matched CH3CD2OH + ·CH3 → CH3CD2O + CH4
1 record matched CD3CDO + ·CH3 → CH3D + CD2CDO
1 record matched tert-C4H9 + O· → ·CH3 + CH2=C(OH)CH3
1 record matched tert-C4H9 + O· → (CH3)2CO + ·CH3
1 record matched tert-C4H9 + ·CH3 → neo-C5H12
1 record matched tert-C4H9 → CH3CH=CH2 + ·CH3
1 record matched HFCO + ·CH3 → CH4 + FCO
1 record matched CH3OD + H· → ·CH3 + HDO
1 record matched (CH3)2GeH2: + CH3CO → CH3GeH2COCH3 + ·CH3
1 record matched (CH3)3Ga + NH2 → GaMe2NH2 + ·CH3
1 record matched (CH3)3Ga + H· → CH4 + ·CH3 + CH3Ga
1 record matched (CH3)3Ga + H· → Ga(CH3)2H + ·CH3
1 record matched (CH3)3Ga + ·CH3 → C2H6 + ·CH3 + CH3Ga
3 records matched (CH3)3Ga → ·CH3 + (CH3)2Ga
2 records matched H2 + ·CH2 → ·CH3 + H·
16 records matched H2 + ·CH3 → CH4 + H·
1 record matched (CH3)2SiH2 + CH3CO → CH3SiH2C(O)CH3 + ·CH3
1 record matched O=P(OH)2CH3 + ·OH → O=P(OH)3 + ·CH3
1 record matched CH3SiH3 → ·CH3 + SiH3
1 record matched 9-Methylphenanthrene + ·CH3 → 1,9-dimethylphenanthrenyl radical
1 record matched CH3NO + H· → ·CH3 + HNO
1 record matched AlH(CH3)2 → ·CH3 + AlH(CH3)
2 records matched CH2S + ·CH3 → CH3CH2S
1 record matched (C2H5)2NN + ·CH3 → CH4 + CH3CH2N=NCH(·)CH3
1 record matched (C2H5)2NN + ·CH3 → Adduct
1 record matched CH3CH2Si(CH3)2H → ·CH3 + CH3CH2Si(CH3)H
1 record matched (CH3O)2P(O)CH3 + O· → CH3-O-P(O)(-O-CH3)-O· + ·CH3
1 record matched (CH3O)2P(O)CH3 + O· → CH3-O-P(O)(CH3)-OO· + ·CH3
1 record matched CH2CHCCH + ·CH3 → HC≡CC(CH3)CH2·
1 record matched CH2CHCCH + ·CH3 → H2C=CHC(CH3)=CH·
1 record matched CH2CHCCH + ·CH3 → HC≡CC(·)HCH2CH3
1 record matched CH2CHCCH + ·CH3 → CH2=CHC(·)=CHCH3
1 record matched (CF3)2CO + ·CH3 → CH3COCF3 + ·CF3
2 records matched CH3D + CD3 → CD4 + ·CH3
1 record matched 2-(E)-C5H10 + ·CH3 → Products
2 records matched CO + CH3S· → COS + ·CH3
1 record matched CO + CH3CO → CO2 + ·CH3
1 record matched CO + (CH3)3CO → (CH3)2CCO(O) + ·CH3
2 records matched CO + ·CH3 → CH3CO
1 record matched CO + ·CH3 → C2H2 + ·OH
1 record matched 2,4-Dimethylpyrrole → 4-methylpyrrol-2-yl + ·CH3
1 record matched 2,4-Dimethylpyrrole → 2-methylpyrrol-4-yl + ·CH3
1 record matched (CH3S)2 + ·CH3 → CH4 + CH3SSCH2
1 record matched (CH3S)2 → ·CH3 + CH3SS
1 record matched CH3ONO + H· → cis-HONO + ·CH3
1 record matched CH3ONO + H· → trans-HONO + ·CH3
1 record matched (E)-2-C4H8 + C → ·CH3 + CH3C=C=CH2
1 record matched (E)-2-C4H8 + C → ·CH3 + CHCCH(·)CH3
1 record matched (E)-2-C4H8 + C → CH3-cCHCCH + ·CH3
1 record matched n-C3H7COOCH3 + ·CH3 → ·CH2OC(O)CH2CH2CH3 + CH4
1 record matched n-C3H7COOCH3 + ·CH3 → CH3OC(O)CH·CH2CH3 + CH4
1 record matched n-C3H7COOCH3 + ·CH3 → CH3OC(O)CH2CH·CH3 + CH4
1 record matched n-C3H7COOCH3 + ·CH3 → CH3OC(O)CH2CH2CH2· + CH4
1 record matched CH3NHNO2 → NN(OH)O + ·CH3
1 record matched CH3NHNO2 → NHNO2 + ·CH3
1 record matched CH3NHNO2 → NHONO + ·CH3
1 record matched (CH3)3CC(CH3)=CH2 + ·CH3 → (CH3)3CC(CH3)2CH2
2 records matched (CH3)4Sn + ·CH3 → C2H6 + (CH3)3Sn
3 records matched (CH3)4Sn + ·CH3 → CH4 + (CH3)3SnCH2·
1 record matched CH3OCl → ·CH3 + ClO
1 record matched (CH3)2Hg + H· → CH4 + ·CH3 + Hg
2 records matched (CH3)2Hg + ·CH3 → CH4 + CH3HgCH2
2 records matched (CH3)2Hg + ·CH3 → Other Products + CH4
1 record matched (CH3)2Hg → ·CH3 + CH3Hg
1 record matched (CH3)2Hg → ·CH3 + ·CH3 + Hg
1 record matched CH3F + H· → ·CH3 + HF
3 records matched CH3F + ·CH3 → CH4 + ·CH2F
1 record matched CH3F → ·CH3 + ·F
1 record matched CH3C(O)OCH2CH=CH2 → CO2 + ·CH2CH=CH2 + ·CH3
1 record matched CH2=C=CHCH3 + Phenyl → ·CH3 + C6H5CH2C2H
2 records matched CH2=C=CHCH3 + Phenyl → Indene + ·CH3
1 record matched CH2=C=CHCH3 + ·CH3 → CH2=C(CH3)CH(·)CH3
3 records matched CH2=C=CHCH3 → ·CH3 + CH2=C=CH
1 record matched (CH3)2CHCH(CH3)CH(CH3)2 + ·CH3 → Other Products + CH4
1 record matched (CH3)2CHCH(CH3)CH(CH3)2 → ·CH3 + (CH3)2CHCH(CH3)CH(·)CH3
1 record matched (CH3)2CHC(CH3)=CH2 → ·CH3 + CH2=C(CH3)CHCH3
1 record matched (CH3)2CHCH=CH2 + ·CH3 → CH3CH2C(·)CH(CH3)2
1 record matched (CH3)2CHCH=CH2 + ·CH3 → CH3CH(CH3)CH(CH3)CH2·
1 record matched (CH3)3CCH=CH2 + ·CH3 → (CH3)3CCH(CH3)CH2·
1 record matched (CH3)3CCH=CH2 → ·CH3 + (CH3)2CCH=CH2
1 record matched CD4 + ·CH3 → CH3D + CD3
1 record matched CH2=CHOH + ·CH3 → CH3CH(OH)CH2
1 record matched CH2=CHOH + ·CH3 → C2H5CHOH
1 record matched (CH3)2Zn + SeH → Zn(CH3)SeH + ·CH3
1 record matched (CH3)2Zn → ·CH3 + CH3Zn
1 record matched CH3(CH2)14CH3 + ·CH3 → Other Products + CH4
1 record matched (CH3)2CHCH2C(CH3)3 + ·CH3 → Other Products + CH4
1 record matched (CH3)2CHCH2C(CH3)3 → Other Products + ·CH3
1 record matched (CH3N)2 + ·CH3 → (CH3)2N-N(·)CH3
1 record matched (CH3N)2 → ·CH3 + ·CH3 + N2
1 record matched CH3CCCH3 + Y → YCCCH3 + ·CH3
1 record matched CH3CCCH3 + Phenyl → 1-Phenylpropyne + ·CH3
1 record matched CH3CCCH3 → ·CH3 + CH3C≡C
2 records matched neo-C5H12 + ·CH3 → CH4 + (CH3)3CCH2
4 records matched neo-C5H12 → tert-C4H9 + ·CH3
4 records matched H2C=C=O + H· → CO + ·CH3
1 record matched H2C=C=O + ·CH3 → CO + ·C2H5
2 records matched CH2=C=CH2 + ·CH3 → CH2C(CH3)=CH2
1 record matched CH2=C=CH2 + ·CH3 → CH2=C(·)CH2CH3
1 record matched CH2=C=CH2 + ·C2H → 1,3-Butadiyne + ·CH3
1 record matched 1,3-Butadiyne + ·CH3 → HC≡CC(CH3)=CH·
1 record matched 1,3-Butadiyne + ·CH3 → CH2=CHC(·)=CHCH3
1 record matched CH3CF3 + ·OH → CF3OH + ·CH3
1 record matched N2H4 + ·CH3 → CH4 + NH2NH
1 record matched Dibenz[a,j]anthracene + ·CH3 → Products
1 record matched Benzo[c]phenanthrene + ·CH3 → Products
1 record matched Benzo[g,h,i]perylene + ·CH3 → Products
1 record matched Coronene + ·CH3 → Products
1 record matched Dibenzo[c,g]phenanthrene + ·CH3 → Products
1 record matched Pentacene + ·CH3 → Products
1 record matched Pyrene + ·CH3 → Products
3 records matched CO2 + ·CH3 → CH3OC(·)(O)
1 record matched n-C3H7CHO + ·CH3 → CH3(CH2)2CH(CH3)O
1 record matched C2H5CHO + ·CH3 → CH3CH2CH(CH3)O
1 record matched C2H5CHO + ·CH3 → 2-C4H9O
1 record matched Anthracene + ·CH3 → CH4 + 2-Anthracenyl
1 record matched Anthracene + ·CH3 → CH4 + 9-Anthracenyl
1 record matched Anthracene + ·CH3 → CH4 + 1-Anthracenyl
1 record matched Anthracene + ·CH3 → Products
1 record matched iso-C4H8 + C2H3 → CH2=C(CH3)CH=CH2 + ·CH3
2 records matched iso-C4H8 + ·CH3 → (CH3)2CCH2CH3
2 records matched iso-C4H8 + ·CH3 → (CH3)3CCH2
3 records matched iso-C4H8 + ·CH3 → CH4 + CH2C(CH3)=CH2
4 records matched (CH3)2O + ·CH3 → CH4 + CH3OCH2
4 records matched (CH3)2O → CH3O· + ·CH3
1 record matched CH3CH=CH2 + O· → ·CH3 + *CH2C(O)H
1 record matched CH3CH=CH2 + O· → H2C=C=O + ·CH3 + H·
1 record matched CH3CH=CH2 + H· → C2H4 + ·CH3
1 record matched CH3CH=CH2 + C → ·CH3 + Cycloprop-1-enyl
1 record matched CH3CH=CH2 + C → ·CH3 + CH2=C=CH
1 record matched CH3CH=CH2 + ·OH → CH2=CHOH + ·CH3
1 record matched CH3CH=CH2 + ·OH → CH3CHO + ·CH3
3 records matched CH3CH=CH2 + ·CH3 → iso-C4H9
3 records matched CH3CH=CH2 + ·CH3 → sec-C4H9
1 record matched CH3CH=CH2 + ·CH3 → CH4 + CH2=C(·)CH3
1 record matched CH3CH=CH2 + ·CH3 → CH4 + CH3CH=CH
3 records matched CH3CH=CH2 + ·CH3 → CH4 + ·CH2CH=CH2
3 records matched CH3CH=CH2 → ·CH3 + C2H3
1 record matched n-C8H18 + ·CH3 → CH4 + 1-C8H17
1 record matched n-C8H18 → ·CH3 + 1-C7H15
1 record matched n-C5H12 + ·CH3 → CH4 + (CH3CH2)2CH
2 records matched n-C5H12 + ·CH3 → CH4 + 1-C5H11
1 record matched n-C5H12 + ·CH3 → CH4 + CH3CH2CH2CHCH3
1 record matched n-C5H12 → ·CH3 + n-C4H9
1 record matched Toluene + ·OH → Phenol + ·CH3
2 records matched Toluene + ·CH3 → CH4 + Benzyl
4 records matched Toluene → ·CH3 + Phenyl
1 record matched Sarin + O· → (CH3)2CH-O-PF(O)O· + ·CH3
1 record matched Sarin + O· → ·OCH(CH3)-O-PF(O)CH3 + ·CH3
1 record matched HC(O)OCH3 + ·CH3 → CH4 + CH3OC(·)(O)
1 record matched HC(O)OCH3 + ·CH3 → CH4 + HC(O)OCH2(·)
1 record matched HC(O)OCH3 → ·CH3 + HCOO
1 record matched CH2=CHCHO + ·CH3 → CH2=CHCH(CH3)O
1 record matched CH3CH=CHCH3 + C2H3 → CH2=CHCH=CHCH3 + ·CH3
1 record matched C2H5CCH + Phenyl → ·CH3 + Benzene, 1,2-propadienyl-
2 records matched C2H5CCH → ·CH3 + CH2C≡CH
5 records matched 1,3-Butadiene + Phenyl → Indene + ·CH3
3 records matched 1,3-Butadiene + ·CH3 → CH2CH=CHCH2CH3
2 records matched 1,3-Butadiene + ·CH3 → CH2=CHCH(CH3)CH2·
1 record matched 1,3-Butadiene + ·CH3 → CH2=CHCHCH2CH3
1 record matched 1-C4H8 + C2H3 → CH2=CHCH2CH=CH2 + ·CH3
1 record matched 1-C4H8 + ·CH3 → CH4 + CH2=CHCHCH3
1 record matched 1-C4H8 + ·CH3 → CH4 + CH3CH2CH=CH
1 record matched 1-C4H8 + ·CH3 → CH4 + CH2=CHCH2CH2·
3 records matched 1-C4H8 + ·CH3 → 3-C5H11
2 records matched n-C4H10 + ·CH3 → CH4 + n-C4H9
2 records matched n-C4H10 + ·CH3 → CH4 + sec-C4H9
1 record matched n-C4H10 + ·CH3 → Other Products + CH4
1 record matched n-C4H10 → n-C3H7 + ·CH3
1 record matched Methoxybenzene + H· → Phenol + ·CH3
2 records matched Styrene + ·CH3 → C6H5CH(.)CH2CH3
2 records matched Styrene + ·CH3 → C6H5CH(CH3)CH2·
1 record matched Ethylbenzene → Benzyl + ·CH3
1 record matched 2-Phenylpropene + ·CH3 → C6H5C(CH3)2CH2·
1 record matched 2-Phenylpropene + ·CH3 → C6H5C(·)(CH3)CH2CH3
1 record matched CH2=CHCOOCH3 + ·CH3 → CH3OC(O)CH·CH2CH3
1 record matched Indene + ·CH3 → 2,3-Dihydro-1-methylinden-2-yl
1 record matched Naphthacene + ·CH3 → Products
1 record matched 2-Methylnaphthalene → ·CH3 + 2-Naphthalenyl
1 record matched Naphthalene + ·CH3 → ·CH3 + 2-Naphthalenyl
1 record matched Naphthalene + ·CH3 → ·CH3 + 1-Naphthalenyl
1 record matched Naphthalene + ·CH3 → CH4 + 1-Naphthalenyl
1 record matched Naphthalene + ·CH3 → Products
1 record matched 1-Methylnaphthalene + H· → Naphthalene + ·CH3
1 record matched Phenanthrene + ·CH3 → Products
1 record matched (CH3)2CHCH(CH3)2 + ·CH3 → Products
1 record matched CH3C(O)OCH3 + ·CH3 → CH4 + CH2C(O)OCH3
1 record matched CH3C(O)OCH3 + ·CH3 → CH4 + CH3C(O)OCH2
1 record matched CH3C(O)OCH3 → ·CH3 + CH3OC(·)(O)
1 record matched CH3C(O)OCH3 → ·CH3 + CH3C(O)O
1 record matched C2H5COCH3 → ·CH3 + CH3CH2CO
1 record matched C2H5COCH3 → ·CH3 + CH3C(O)CH2(·)
1 record matched CH2=C(CH3)C≡CH + ·CH3 → HC≡CC(CH3)2CH2·
1 record matched CH2=C(CH3)C≡CH + ·CH3 → HC≡CC(·)(CH3)CH2CH3
1 record matched CH2=C(CH3)CH=CH2 + ·CH3 → CH2=CHC(CH3)2CH2·
1 record matched CH2=C(CH3)CH=CH2 + ·CH3 → CH2=CHC(·)(CH3)CH2CH3
1 record matched iso-C5H12 + ·CH3 → CH4 + CH2CH(CH3)CH2CH3
1 record matched iso-C5H12 + ·CH3 → CH4 + (CH3)2CCH2CH3
1 record matched iso-C5H12 + ·CH3 → CH4 + (CH3)2CHCHCH3
1 record matched iso-C5H12 + ·CH3 → CH4 + (CH3)2CHCH2CH2
1 record matched iso-C5H12 + ·CH3 → Other Products + CH4
1 record matched iso-C5H12 → Other Products + ·CH3
1 record matched tert-C4H9OOH + ·CH3 → CH4 + (CH3)3CO2
1 record matched CH3SiCl3 + ·CH3 → CH3Cl + Silyl, dichloromethyl-
1 record matched CH3SiCl3 + ·CH3 → CH4 + Cl3SiCH2·
1 record matched CH3SiCl3 → ·CH3 + SiCl3
1 record matched CF4 + ·CH3 → CH3F + ·CF3
1 record matched CF3Cl + ·CH3 → CH3Cl + ·CF3
1 record matched tert-C4H9OH → ·CH3 + (CH3)2C(OH)
1 record matched CF3Br + ·CH3 → CH3Br + ·CF3
1 record matched Methyloxirane → ·CH3 + Oxiranyl
2 records matched CH3NO2 → ·CH3 + NO2
2 records matched CHF3 + ·CH3 → CH4 + ·CF3
1 record matched CH3CHF2 → ·CH3 + ·CHF2
2 records matched iso-C4H10 + ·CH3 → CH4 + iso-C4H9
4 records matched iso-C4H10 + ·CH3 → CH4 + tert-C4H9
1 record matched iso-C4H10 → iso-C3H7 + ·CH3
1 record matched Al(CH3)3 → Al(CH3)2 + ·CH3
1 record matched Oxirane + ·CH3 → CH4 + Oxiranyl
2 records matched Oxirane → ·CH3 + HCO
1 record matched Cyclopropane + ·CH3 → CH4 + Cyclopropyl
2 records matched (CH3)2S + H· → CH3SH + ·CH3
1 record matched (CH3)2S + Br· → CH3SBr + ·CH3
1 record matched (CH3)2S + ·OH → ·CH3 + CH3SOH
1 record matched (CH3)2S → ·CH3 + CH3
1 record matched CS2 + ·CH3 → S=C(·)-S-CH3
1 record matched HN=C=O + ·CH3 → CH3O· + HNC
2 records matched HN=C=O + ·CH3 → CO + CH3NH
2 records matched HN=C=O + ·CH3 → CH4 + NCO
1 record matched HN=C=O + ·CH3 → CH3C(O)NH
2 records matched CH2F2 + ·CH3 → CH4 + ·CHF2
1 record matched CH3CHO + ·OH → HCOOH + ·CH3
1 record matched CH3CHO + Phenyl → Benzaldehyde + ·CH3
2 records matched CH3CHO + ·CH3 → i-C3H7O
3 records matched CH3CHO + ·CH3 → CH4 + CH3CO
2 records matched CH3CHO → ·CH3 + HCO
1 record matched CH3CN + O· → ·CH3 + CNO
2 records matched CH3CN + O· → ·CH3 + NCO
1 record matched CH3CN + ·CH3 → CH4 + CH2CN
1 record matched C2H5Cl → ·CH3 + ·CH2Cl
1 record matched CH3CCH + ·F → ·CH3 + HCCF
1 record matched CH3CCH + H· → C2H2 + ·CH3
1 record matched CH3CCH + Zr → Zr-CCH + ·CH3
1 record matched CH3CCH + Zr → Zr(CC)H + ·CH3
1 record matched CH3CCH + Phenyl → Phenylacetylene + ·CH3
1 record matched CH3CCH + ·CH3 → (CH3)2C=CH·
1 record matched CH3CCH + ·CH3 → CH3CH=C(·)(CH3)
1 record matched CH3CCH + ·C2H → 1,3-Butadiyne + ·CH3
2 records matched C3H8 + ·CH3 → CH4 + n-C3H7
3 records matched C3H8 + ·CH3 → CH4 + iso-C3H7
6 records matched C3H8 → ·C2H5 + ·CH3
1 record matched CH3SH + H· → ·CH3 + H2S
1 record matched CH3SH → ·CH3 + SH
1 record matched CH3NH2 + B → ·CH3 + HBNH
1 record matched CH3I + I → ·CH3 + I2
1 record matched CH3I + ·OH → ·CH3 + HOI
1 record matched CH3I + CH3CO → CH3C(O)I + ·CH3
2 records matched CH3I + ·CH3 → CH4 + ·CH2I
1 record matched CH3I → ·CH3 + I
1 record matched CH3Cl + Silyl, dichloromethyl- → CH3SiCl3 + ·CH3
1 record matched CH3Cl + Cl → ·CH3 + Cl2
1 record matched CH3Cl + SiCl3 → ·CH3 + SiCl4
1 record matched CH3Cl + SiH2 → ·CH3 + SiH2Cl
1 record matched CH3Cl + SiH3 → ·CH3 + SiH3Cl
1 record matched CH3Cl + SiCl2 → ·CH3 + SiCl3
5 records matched CH3Cl + H· → ·CH3 + HCl
1 record matched CH3Cl + CH3CO → CH3COCl + ·CH3
2 records matched CH3Cl + ·CF3 → CF3Cl + ·CH3
2 records matched CH3Cl → ·CH3 + Cl
2 records matched C2H2 + ·OH → CO + ·CH3
4 records matched C2H2 + ·CH3 → CH3CH=CH
1 record matched C2H2 + ·CH3 → ·CH2CH=CH2
1 record matched C2H2 + ·CH3 → CH3CCH + H·
1 record matched C2H2 + ·CH3 → CH4 + ·C2H
2 records matched C2H2 + ·CH3 → Products
1 record matched C2H2 + ·CH3 → CH3CH2=CH(·)
1 record matched C2H4 + COH → H2C=C=O + ·CH3
5 records matched C2H4 + O· → ·CH3 + HCO
1 record matched C2H4 + S → ·CH3 + HC=S
1 record matched C2H4 + HCO → H2C=C=O + ·CH3
4 records matched C2H4 + ·CH3 → n-C3H7
3 records matched C2H4 + ·CH3 → CH4 + C2H3
2 records matched C2H4 + ·CH3 → Propyl Radical
1 record matched C2H6 + ·CH2 → ·C2H5 + ·CH3
1 record matched C2H6 + O· → CH3O· + ·CH3
1 record matched C2H6 + ·CH3 → C2H6 + ·CH3
6 records matched C2H6 + ·CH3 → CH4 + ·C2H5
9 records matched C2H6 → ·CH3 + ·CH3
1 record matched CH3Br + H· → ·CH3 + HBr
1 record matched CH3Br + Br· → ·CH3 + Br2
1 record matched CH3Br + CH3CO → CH3COBr + ·CH3
1 record matched CH4 + CH3SSCH2 → (CH3S)2 + ·CH3
1 record matched CH4 + ·CH2 → ·CH3 + ·CH3
1 record matched CH4 + HC=S → H2CS + ·CH3
1 record matched CH4 + CH3SCH2 → (CH3)2S + ·CH3
22 records matched CH4 + Cl → ·CH3 + HCl
1 record matched CH4 + CF3O → CF3OH + ·CH3
1 record matched CH4 + Cl3SiCH2· → CH3SiCl3 + ·CH3
1 record matched CH4 + SiCl3 → ·CH3 + SiHCl3
15 records matched CH4 + O· → ·CH3 + ·OH
9 records matched CH4 + D → ·CH3 + HD
1 record matched CH4 + BrO → ·CH3 + HOBr
1 record matched CH4 + ClO → ·CH3 + HOCl
9 records matched CH4 + ·F → ·CH3 + HF
19 records matched CH4 + NH → ·CH3 + NH2
6 records matched CH4 + NH2 → ·CH3 + NH3
2 records matched CH4 + OD → ·CH3 + HDO
1 record matched CH4 + SiCl2 → ·CH3 + SiHCl2
43 records matched CH4 + H· → H2 + ·CH3
1 record matched CH4 + OF → ·CH3 + HOF
1 record matched CH4 + NO3 → ·CH3 + HNO3
3 records matched CH4 + NO2 → ·CH3 + HNO2
1 record matched CH4 + NO2 → cis-HONO + ·CH3
2 records matched CH4 + NO2 → trans-HONO + ·CH3
2 records matched CH4 + NO → ·CH3 + HNO
2 records matched CH4 + Br· → ·CH3 + HBr
2 records matched CH4 + O3 → HO3 + ·CH3
4 records matched CH4 + O2 → ·CH3 + HO2
1 record matched CH4 + C → ·CH3 + ·CH
1 record matched CH4 + Ni → ·CH3 + NiH
25 records matched CH4 + ·OH → ·CH3 + H2O
4 records matched CH4 + C2H3 → C2H4 + ·CH3
1 record matched CH4 + HCO → CH2O + ·CH3
1 record matched CH4 + (·)CH2OH → CH3OH + ·CH3
1 record matched CH4 + Phenyl → Benzene + ·CH3
2 records matched CH4 + ·CF3 → CHF3 + ·CH3
1 record matched CH4 + ·CH3 → H2 + ·C2H5
2 records matched CH4 + ·CH3 → C2H6 + H·
8 records matched CH4 + ·CH3 → CH4 + ·CH3
1 record matched CH4 + CH2=C → ·CH3 + C2H3
3 records matched CH4 + CH3O· → CH3OH + ·CH3
2 records matched CH4 + ·C2H → C2H2 + ·CH3
1 record matched CH4 + CD3 → CHD3 + ·CH3
1 record matched CH4 + ·C2H5 → C2H6 + ·CH3
1 record matched CH4 + ·CH2CH=CH2 → CH3CH=CH2 + ·CH3
2 records matched CH4 + PdO → PdOH + ·CH3
2 records matched CH4 + NiO → ·CH3 + NiOH
1 record matched CH4 + MgO → ·CH3 + MgOH
9 records matched CH4 → ·CH3 + H·
6 records matched Benzene + CH2=CHCH=CH· → Indene + ·CH3
1 record matched Benzene + ·CH3 → Cyclohexadienyl, 6-methyl-
1 record matched Benzene + ·CH3 → Toluene + H·
3 records matched Benzene + ·CH3 → CH4 + Phenyl
1 record matched Benzene + ·CH3 → Products
1 record matched Benzene + ·CH3 → ipso-C7H9
1 record matched n-C4H9OH + ·CH3 → CH4 + n-C3H7CHOH
1 record matched n-C4H9OH + ·CH3 → CH4 + n-C4H9O
1 record matched n-C4H9OH + ·CH3 → CH4 + HOCH2CH2CH2CH2
1 record matched n-C4H9OH + ·CH3 → CH3CH2CHCH2OH + CH4
1 record matched n-C4H9OH + ·CH3 → CH3CHCH2CH2OH + CH4
1 record matched n-C4H9OH → ·CH3 + HOCH2CH2CH2
1 record matched n-C3H7OH → ·CH3 + HOCH2CH2
1 record matched (CH3)2SO + Cl → CH3S(O)Cl + ·CH3
4 records matched (CH3)2SO + ·OH → ·CH3 + CH3S(O)OH
1 record matched (CH3)2SO → ·CH3 + CH3SO
1 record matched (CH3)2CO + O· → ·CH3 + CH3C(O)O
1 record matched (CH3)2CO + ·OH → CH3C(O)OH + ·CH3
3 records matched (CH3)2CO + ·CH3 → (CH3)3CO
2 records matched (CH3)2CO + ·CH3 → CH4 + CH3C(O)CH2(·)
1 record matched (CH3)2CO + ·CH3 → Products
1 record matched (CH3)2CO + ·CH3 → (CH3)2C(·)OCH3
5 records matched iso-C3H7OH → ·CH3 + CH3CHOH
4 records matched CH3OH + H· → ·CH3 + H2O
1 record matched CH3OH + ·CH3 → CH4 + (·)CH2OH
1 record matched CH3OH + ·CH3 → CH4 + CH3
1 record matched CH3OH + ·CH3 → Other Products + CH4
7 records matched CH3OH → ·CH3 + ·OH
1 record matched CH3C(O)OH + ·OH → CO2 + ·CH3 + H2O
1 record matched C2H5OH + ·CH3 → C2H5OCH3 + H·
2 records matched C2H5OH + ·CH3 → CH4 + HOCH2CH2
2 records matched C2H5OH + ·CH3 → CH4 + CH3CHOH
2 records matched C2H5OH + ·CH3 → CH4 + CH3CH2
1 record matched C2H5OH + ·CH3 → CH3OH + ·C2H5
2 records matched C2H5OH + ·CH3 → Products
2 records matched C2H5OH → ·CH3 + (·)CH2OH
2 records matched (C2H5)2O → C2H5OCH2(·) + ·CH3
1 record matched CN + CH3CH=CH2 → CH2CHCN + ·CH3
1 record matched CN + CH4 → HCN + ·CH3
1 record matched Benz[a]anthracene + ·CH3 → Products
1 record matched CH2O + H2O → ·CH3 + HO2
1 record matched CH2O + C2H3 → H2C=C=O + ·CH3
1 record matched CH2O + ·CH3 → CH3OCH2
3 records matched CH2O + ·CH3 → CH3CH2
7 records matched CH2O + ·CH3 → CH4 + HCO
1 record matched methylene (ground state) + CH2O → ·CH3 + HCO
1 record matched O(1D) + CH3CN → ·CH3 + CNO
1 record matched O(1D) + CH3CN → ·CH3 + NCO
1 record matched O(1D) + CH4 → ·CH3 + ·OH
1 record matched O2(1DELTA) + CH4 → ·CH3 + HO2
1 record matched O(3P) + ·CH3 → CH3
1 record matched O(3P) + C2H6 → ·CH3 + (·)CH2OH
1 record matched O(3P) + CH4 → ·CH3 + ·OH
1 record matched CH3CHClO· → ·CH3 + HC(O)Cl
1 record matched CH3CF2OO· + HO2 → COF2 + ·CH3 + ·OH + O2
1 record matched (CH3)2C(O)OCH2CH2OH → CH3C(O)OCH2CH2OH + ·CH3
11 records matched O(3P) + CH4 → ·CH3 + ·OH
1 record matched O(1D) + C2H5F → ·CH3 + ·CHFOH
1 record matched O(1D) + C2H6 → Products + ·CH3
1 record matched O(1D) + CH4 → ·CH3 + ·OH
1 record matched 5-Methyl-2-cyclopenten-2-yl → Cyclopentadiene + ·CH3
1 record matched CH2=CHC(CH3)(O·)CH2Cl → CH2=CHC(O)CH2Cl + ·CH3
1 record matched CH2=CHC(O)CH2Cl + ·CH3 → CH2=CHC(CH3)(O·)CH2Cl
1 record matched CH2=CHC(CH3)2CH2· → CH2=C(CH3)CH=CH2 + ·CH3
1 record matched C6H5C(CH3)2CH2· → 2-Phenylpropene + ·CH3
1 record matched C6H5CH(CH3)CH2· → Styrene + ·CH3
1 record matched HC≡CC(CH3)CH2· → CH2CHCCH + ·CH3
1 record matched HC≡CC(CH3)2CH2· → CH2=C(CH3)C≡CH + ·CH3
1 record matched H2C=CHC(CH3)=CH· → CH2CHCCH + ·CH3
1 record matched (CH3)2C=CH· → CH3CCH + ·CH3
1 record matched HC≡CC(CH3)=CH· → 1,3-Butadiyne + ·CH3
1 record matched CH2=CHC(·)(CH3)CH2CH3 → CH2=C(CH3)CH=CH2 + ·CH3
1 record matched CH2=CHC(CH=CH2)=CH2 + ·CH3 → CH2=CHC(·)(CH=CH2)CH2CH3
1 record matched CH2=CHC(·)(CH=CH2)CH2CH3 → CH2=CHC(CH=CH2)=CH2 + ·CH3
1 record matched HC≡CC(·)HCH2CH3 → CH2CHCCH + ·CH3
1 record matched HC≡CC(·)(CH3)CH2CH3 → CH2=C(CH3)C≡CH + ·CH3
1 record matched CH2=C(·)CH2CH3 → CH2=C=CH2 + ·CH3
1 record matched CH2=C(CH3)CH(·)CH3 → CH2=C=CHCH3 + ·CH3
1 record matched CH2=C(CH3)C(·)(CH3)2 → CH2=C=C(CH3)2 + ·CH3
1 record matched CH2=C=C(CH3)2 + ·CH3 → CH2=C(CH3)C(·)(CH3)2
1 record matched CH3CH2=CH(·) → C2H2 + ·CH3
1 record matched CH2=CHC(·)=CHCH3 → CH2CHCCH + ·CH3
1 record matched CH3CH=C(·)(CH3) → CH3CCH + ·CH3
1 record matched CH2=CHC(·)=CHCH3 → 1,3-Butadiyne + ·CH3
1 record matched C6H5C(·)(CH3)CH2CH3 → 2-Phenylpropene + ·CH3
1 record matched CH3CH2C(·)CH(CH3)2 → (CH3)2CHCH=CH2 + ·CH3
1 record matched CH3CH(CH3)CH(CH3)CH2· → (CH3)2CHCH=CH2 + ·CH3
1 record matched CH3C(·)=NH → ·CH3 + HNC
1 record matched ScOH + ·CH3 → CH3OH + Sc
1 record matched ScOH + ·CH3 → CH3ScOH
1 record matched CH3CF2O(·) → COF2 + ·CH3
1 record matched CH2(X3B_1) + ·CH3 → C2H4 + H·
1 record matched CH3CH2C(CH3)2O(·) → C2H5COCH3 + ·CH3
1 record matched 9-methylphenanthryl radical + ·CH3 → 9-phenanthrylethane
1 record matched 9-methylhydrophenanthryl radical → Phenanthrene + ·CH3
1 record matched CH3BeOH → ·CH3 + Beryllium hydroxide
1 record matched HOCO + ·CH3 → H2C=C=O + H2O
1 record matched HOCO + ·CH3 → Products
2 records matched S(1D) + C2H4 → ·CH3 + HC=S
1 record matched CH3CH2CHCH2OH → CH2=CHCH2OH + ·CH3
1 record matched OHC5H8 → ·CH3 + CH2=CHC(OH)=CH2
1 record matched CH2=CHC(O)CH2OH + ·CH3 → CH2=CHC(CH3)(O·)CH2OH
1 record matched cy-CH3C(O·)CH=CHCHC(CH3)2CH(cy-CH2) → cy-CH(cy-CH2)C(CH3)2CHC(O)CH=CH + ·CH3
1 record matched CH3OSO → ·CH3 + SO2
1 record matched CH3CO(OH)2 → HOC(O)OH + ·CH3
1 record matched (CH3)3CC(CH3)2O· → tert-C4H9COCH3 + ·CH3
1 record matched (CH3)3CCH2C(CH3)2O· → neo-C5H11COCH3 + ·CH3
1 record matched C6H5CH(O·)CH3 → Benzaldehyde + ·CH3
1 record matched Ga(CH3)(NH2)2 + NH2 → Ga(NH2)3 + ·CH3
1 record matched Ga(CH3)(NH2)2 + ·CH3 → Ga(CH3)(CH2)NH· + CH4
1 record matched Ga(NH2)3 + ·CH3 → Ga(NH2)2NH· + CH4
1 record matched GaNH2 + ·CH3 → GaNH· + CH4
1 record matched Ga(CH3)2H + NH2 → Ga(CH3)NH2H + ·CH3
1 record matched Ga(CH3)2H + H· → Ga(CH3)H2 + ·CH3
1 record matched Ga(CH3)H2 + H· → ·CH3 + GaH3
1 record matched Ga(CH3)NH2H + NH2 → Ga(NH2)2H + ·CH3
1 record matched GaNH· + CH3Ga → GaNHGa + ·CH3
1 record matched GaNH· + (CH3)3Ga → GaNHGa(CH3)2 + ·CH3
1 record matched GaNH· + Ga(CH3)(NH2)2 → GaNHGa(NH2)2 + ·CH3
1 record matched Ga(CH3)2NH· + (CH3)3Ga → (CH3)2GaNHGa(CH3)2 + ·CH3
1 record matched Ga(CH3)2NH· + Ga(CH3)(NH2)2 → (CH3)(NH2)GaNHGa(CH3)NH2 + ·CH3
1 record matched Ga(CH3)(CH2)NH· + (CH3)3Ga → (CH3)2GaNHGa(CH3)(NH2) + ·CH3
1 record matched Ga(CH3)(CH2)NH· + Ga(CH3)(NH2)2 → (NH2)2GaNHGa(CH3)NH2 + ·CH3
1 record matched Ga(NH2)2NH· + (CH3)3Ga → (CH3)(NH2)GaNHGa(CH3)NH2 + ·CH3
1 record matched Ga(NH2)2NH· + Ga(CH3)(NH2)2 → (NH2)2GaNHGa(NH2)2 + ·CH3
1 record matched (CH3)2GaNHGa(CH3)(NH2) + ·CH3 → (CH3)2GaNHGa(CH3)NH· + CH4
1 record matched (CH3)(NH2)GaNHGa(CH3)NH2 + Ga(CH3)2NH· → (NH2)2GaNHGa(CH3)NHGa(CH3)2 + ·CH3
1 record matched (CH3)(NH2)GaNHGa(CH3)NH2 + Ga(CH3)(CH2)NH· → (NH2)(CH3)GaNHGa(CH3)NHGa(NH2)2 + ·CH3
1 record matched (CH3)2GaNHGa(CH3)2 + Ga(CH3)(CH2)NH· → (CH3)2GaNHGa(CH3)NHGa(CH3)NH2 + ·CH3
1 record matched (NH2)2GaNHGa(CH3)NH2 + Ga(CH3)2NH· → (NH2)(CH3)GaNHGa(CH3)NHGa(NH2)2 + ·CH3
1 record matched CH3OBr → ·CH3 + BrO
1 record matched CH2=C(OH)-CH2· + H· → ·CH3 + CH3CO
1 record matched HNiOCH3 → ·CH3 + NiOH
1 record matched CH3NiOH → ·CH3 + NiOH
1 record matched HC(O)OC(CH3)2O· → ·CH3 + Formic acetic anhydride
1 record matched HC(O)OCH(CH3)O· → HC(O)OC(O)H + ·CH3
1 record matched CH3CH2CH2CH(·)CH(CH3)2 → ·CH3 + (Z)-2-C6H12
1 record matched CH3CH2CH2CH(·)CH(CH3)2 → ·CH3 + (E)-2-C6H12
1 record matched CH3CH2CH(·)CH2CH(CH3)2 → (CH3)2CHCH2CH=CH2 + ·CH3
1 record matched CH3CH2CH(·)CH2CH(CH3)2 → 1-C6H12 + ·CH3
1 record matched cyc-CH2SS + ·CH3 → CH3SSCH2
1 record matched cyc-CH2SS + ·CH3 → cyc-CH(·)SS + CH4
1 record matched cyc-CH2SS + ·CH3 → CH3SCH2
1 record matched cyc-CH(·)SS + CH4 → cyc-CH2SS + ·CH3
1 record matched S=C(·)-S-CH3 → CS2 + ·CH3
1 record matched CH3SCH2S· → cyc-CH2SS + ·CH3
3 records matched 3-C5H11 → 1-C4H8 + ·CH3
1 record matched CH3CH(O·)CH2CH2CH2CH3 → n-C4H9CHO + ·CH3
6 records matched 2-pentoxy radical → n-C3H7CHO + ·CH3
1 record matched CH2=CHC(CH3)(O·)CH2OH → CH2=CHC(O)CH2OH + ·CH3
1 record matched CH3SC(·)(CH3)SCH3 → S=C(CH3)SCH3 + ·CH3
1 record matched CH3SC(·)(C5H5)SCH3 → S=C(C5H5)SCH3 + ·CH3
1 record matched CH3SC(·)(C7H7)SCH3 → S=C(C7H7)SCH3 + ·CH3
1 record matched S=C(C5H5)SCH3 + ·CH3 → CH3SC(·)(C5H5)SCH3
1 record matched S=C(C7H7)SCH3 + ·CH3 → CH3SC(·)(C7H7)SCH3
2 records matched Propyl Radical → C2H4 + ·CH3
1 record matched GaMe2NH2 + NH2 → Ga(CH3)(NH2)2 + ·CH3
1 record matched GaMe2NH2 + H· → GaNH2 + CH4 + ·CH3
1 record matched GaMe2NH2 + ·CH3 → GaNH2 + C2H6 + ·CH3
1 record matched GaMe2NH2 + ·CH3 → Ga(CH3)2NH· + CH4
1 record matched GaMe2NH2 + GaNH· → GaNHGa(CH3)NH2 + ·CH3
1 record matched GaMe2NH2 + Ga(CH3)2NH· → (CH3)2GaNHGa(CH3)(NH2) + ·CH3
1 record matched GaMe2NH2 + Ga(CH3)(CH2)NH· → (CH3)(NH2)GaNHGa(CH3)NH2 + ·CH3
1 record matched GaMe2NH2 + Ga(NH2)2NH· → (NH2)2GaNHGa(CH3)NH2 + ·CH3
1 record matched H2CS + ·CH3 → CH3CH2S
1 record matched H2CS + ·CH3 → CH4 + HC=S
1 record matched CH2=CHCH(CH3)O → CH2=CHCHO + ·CH3
1 record matched CH3Li + ·CH3 → CH2Li + CH4
1 record matched ·CH2OC(O)CH2CH2CH3 + CH4 → n-C3H7COOCH3 + ·CH3
1 record matched CH3OC(O)CH·CH2CH3 + CH4 → n-C3H7COOCH3 + ·CH3
1 record matched CH3OC(O)CH·CH2CH3 → CH2=CHCOOCH3 + ·CH3
1 record matched CH3OC(O)CH2CH·CH3 + CH4 → n-C3H7COOCH3 + ·CH3
1 record matched CH3OC(O)CH2CH2CH2· + CH4 → n-C3H7COOCH3 + ·CH3
1 record matched CH3CH2CH2NHC(O)OCH3 + ·CH3 → Products + CH4
1 record matched C30H18 + ·CH3 → Products
1 record matched C26H16 + ·CH3 → Products
1 record matched ipso-C7H9 → Benzene + ·CH3
1 record matched C6H5C(O*)(CH3)2 → 1-Phenylethanone + ·CH3
1 record matched C2(X1ΣPlg) + CH4 → ·C2H + ·CH3
1 record matched CF2-trip + CH4 → ·CH3 + ·CHF2
1 record matched methylcyclopentadiene (mixture of isomers) → Cyclopentadienyl + ·CH3
1 record matched (·)OP(OH)3CH3 → O=P(OH)3 + ·CH3
1 record matched O2(X3Sigma_g-) + C2H4 → ·CH3 + HCOO
1 record matched trans-Rh(P(CH3)3)2(CO)Cl + ·CH3 → Products
2 records matched InCH3(singlet) + ·CH3 → In(CH3)2
3 records matched InCH3(singlet) → ·CH3 + In
2 records matched InCH3(triplet) + ·CH3 → In(CH3)2
2 records matched InCH3(triplet) → ·CH3 + In
1 record matched ·CH3 + HN=N → CH2N2 + H2
1 record matched ·CH3 + O· → CO + H2 + H·
1 record matched ·CH3 + N2O → CH3O· + N2
1 record matched ·CH3 + N2O → CH2=NH + NO
1 record matched ·CH3 + HO2 → CH3O· + ·OH

Search returned 4204 records.