Click on a link in the table below to see detail on the selected reaction.
Records |
|
Reaction |
1 record matched | | ·CH3 + NO2 → Products |
1 record matched | | ·CH3 + HBr → CH4 + Br· |
1 record matched | | Cyclopentanone + ·CH3 → cyclopentanon-2-yl + CH4 |
1 record matched | | Cyclopentanone + ·CH3 → cyclopentanon-3-yl + CH4 |
1 record matched | | iso-C4H10 + ·CH3 → CH4 + tert-C4H9 |
1 record matched | | C2H4 + O· → ·CH3 + HCO |
1 record matched | | Acetone + ·OH → CH3C(O)OH + ·CH3 |
2 records matched | | CH3CH2CH(CH3)O· → C2H5CHO + ·CH3 |
1 record matched | | C2H5C(CH3)2O(·) → C2H5COCH3 + ·CH3 |
2 records matched | | NO + CH3C(O)OO(·) → CO2 + ·CH3 + NO2 |
1 record matched | | H2O + ·CH2 → ·CH3 + ·OH |
1 record matched | | H2O2 + ·CH2 → ·CH3 + HO2 |
3 records matched | | iso-C4H9 → CH3CH=CH2 + ·CH3 |
1 record matched | | (CH3)2C(·)CH2CH3 → iso-C4H8 + ·CH3 |
2 records matched | | i-C3H7O → CH3CHO + ·CH3 |
1 record matched | | Neopentyl → iso-C4H8 + ·CH3 |
1 record matched | | CH3CO + ·CH2 → H2C=C=O + ·CH3 |
2 records matched | | CH3CO + O· → CO2 + ·CH3 |
6 records matched | | CH3CO → CO + ·CH3 |
2 records matched | | (CH3)3CO· → Acetone + ·CH3 |
1 record matched | | C2H3 + ·CH2 → C2H2 + ·CH3 |
1 record matched | | C2H3 + CH3CO → ·CH3 + CH2=CHC(·)O |
1 record matched | | HCO + ·CH2 → CO + ·CH3 |
1 record matched | | (·)CH2OH + ·CH2 → CH2O + ·CH3 |
1 record matched | | (·)CH2OH + H· → ·CH3 + ·OH |
2 records matched | | sec-C4H9 → CH3CH=CH2 + ·CH3 |
3 records matched | | ·CH3 + ·CH2 → C2H4 + H· |
1 record matched | | ·CH3 + CH3CHNHCH2CH3 → Other Products + CH4 |
6 records matched | | ·CH3 + O· → CH2O + H· |
4 records matched | | ·CH3 + O· → Products |
1 record matched | | ·CH3 + H· → H2 + ·CH2 |
12 records matched | | ·CH3 + H· → CH4 |
1 record matched | | ·CH3 + NO2 → CH3O· + NO |
1 record matched | | ·CH3 + NO2 → Products |
1 record matched | | ·CH3 + HBr → CH4 + Br· |
1 record matched | | ·CH3 + HI → CH4 + I |
6 records matched | | ·CH3 + O3 → Products |
1 record matched | | ·CH3 + SiH4 → CH4 + SiH3 |
2 records matched | | ·CH3 + H2S → CH4 + SH |
1 record matched | | ·CH3 + Cl2 → CH3Cl + ·Cl |
5 records matched | | ·CH3 + O2 → CH3O· + O· |
14 records matched | | ·CH3 + O2 → CH3O2· |
2 records matched | | ·CH3 + O2 → CH2O + ·OH |
2 records matched | | ·CH3 + O2 → Products |
1 record matched | | ·CH3 + D2 → CH3D + D |
2 records matched | | ·CH3 + H2O → CH4 + ·OH |
1 record matched | | ·CH3 + Br2 → CH3Br + Br· |
1 record matched | | ·CH3 + H2O2 → CH4 + HO2 |
2 records matched | | ·CH3 + NH3 → CH4 + NH2 |
1 record matched | | ·CH3 + HF → CH4 + ·F |
2 records matched | | ·CH3 + HCl → CH4 + ·Cl |
1 record matched | | ·CH3 + iso-C4H9 → iso-C5H12 |
1 record matched | | ·CH3 + iso-C4H9 → CH4 + iso-C4H8 |
1 record matched | | ·CH3 + ·OH → H2O + ·CH2 |
1 record matched | | ·CH3 + ·OH → CH4 + O· |
3 records matched | | ·CH3 + ·OH → CH3OH |
3 records matched | | ·CH3 + ·OH → Products |
1 record matched | | ·CH3 + ·OH → CH2(1) + H2O |
3 records matched | | ·CH3 + HO2 → CH3O· + ·OH |
1 record matched | | ·CH3 + HO2 → CH4 + O2 |
1 record matched | | ·CH3 + CH3CO → Acetone |
1 record matched | | ·CH3 + C2H3 → CH3CH=CH2 |
2 records matched | | ·CH3 + C2H3 → CH4 + C2H2 |
2 records matched | | ·CH3 + C2H3 → Products |
1 record matched | | ·CH3 + HCO → CH3CHO |
1 record matched | | ·CH3 + HCO → CH4 + CO |
1 record matched | | ·CH3 + (·)CH2OH → C2H5OH |
1 record matched | | ·CH3 + (·)CH2OH → CH2O + CH4 |
2 records matched | | ·CH3 + ·CH3 → ·C2H5 + H· |
1 record matched | | ·CH3 + ·CH3 → C2H4 + H2 |
9 records matched | | ·CH3 + ·CH3 → C2H6 |
2 records matched | | ·CH3 → H· + ·CH2 |
3 records matched | | CH3CH2O· → CH2O + ·CH3 |
1 record matched | | CH3O· + ·CH2 → CH2O + ·CH3 |
1 record matched | | CH3O· + ·CH3 → (CH3)2O |
1 record matched | | CH3O· + ·CH3 → CH2O + CH4 |
1 record matched | | CH3O· + ·CH3 → Products |
1 record matched | | 1-C3H7 + ·CH2 → CH3CH=CH2 + ·CH3 |
1 record matched | | 1-C3H7 + ·CH3 → 1-C4H10 |
1 record matched | | 1-C3H7 + ·CH3 → CH4 + CH3CH=CH2 |
7 records matched | | 1-C3H7 → C2H4 + ·CH3 |
1 record matched | | CH3O2· + ·CH3 → CH3O· + CH3O· |
1 record matched | | CH3O2· → ·CH3 + O2 |
1 record matched | | ·C2H + ·CH3 → CH2C≡CH + H· |
1 record matched | | ·C2H5 + ·CH2 → C2H4 + ·CH3 |
1 record matched | | ·C2H5 + O· → CH2O + ·CH3 |
2 records matched | | ·C2H5 + H· → ·CH3 + ·CH3 |
4 records matched | | ·C2H5 + ·CH3 → C3H8 |
2 records matched | | ·C2H5 + ·CH3 → CH4 + C2H4 |
1 record matched | | ·C2H5 + ·C2H → ·CH3 + CH2C≡CH |
1 record matched | | iso-C3H7 + ·CH2 → CH3CH=CH2 + ·CH3 |
1 record matched | | iso-C3H7 + O· → CH3CHO + ·CH3 |
1 record matched | | iso-C3H7 + HO2 → CH3CHO + ·CH3 + ·OH |
1 record matched | | iso-C3H7 + ·CH3 → iso-C4H10 |
1 record matched | | iso-C3H7 + CH3O2· → CH3CHO + CH3O· + ·CH3 |
1 record matched | | ·CH2CH=CH2 + ·CH3 → 1-C4H8 |
1 record matched | | ·CH2CH=CH2 + ·CH3 → CH4 + CH2=C=CH2 |
1 record matched | | CD3CDO + ·CH3 → CH3D + CD3CO |
1 record matched | | tert-C4H9 + ·CH2 → iso-C4H8 + ·CH3 |
1 record matched | | tert-C4H9 + HO2 → Acetone + ·CH3 + ·OH |
1 record matched | | tert-C4H9 + ·CH3 → neo-C5H12 |
1 record matched | | tert-C4H9 + ·CH3 → CH4 + iso-C4H8 |
1 record matched | | tert-C4H9 + CH3O2· → Acetone + CH3O· + ·CH3 |
1 record matched | | tert-C4H9 → CH3CH=CH2 + ·CH3 |
1 record matched | | H2 + ·CH2 → ·CH3 + H· |
6 records matched | | H2 + ·CH3 → CH4 + H· |
1 record matched | | CH3SiD3 + ·CH3 → Other Products + CH3D |
1 record matched | | (CH3)3SiH + ·CH3 → CH4 + (CH3)3Si· |
4 records matched | | CO + ·CH3 → CH3CO |
1 record matched | | CO + CH3O· → CO2 + ·CH3 |
1 record matched | | (E)-2-C4H8 + ·CH3 → (CH3)2CHCH(·)CH3 |
1 record matched | | (E)-2-C4H8 + ·CH3 → CH4 + ·CH2CH=CHCH3 |
1 record matched | | CH3F + H· → ·CH3 + HF |
1 record matched | | (Z)-2-C4H8 + ·CH3 → (CH3)2CHCH(·)CH3 |
1 record matched | | (Z)-2-C4H8 + ·CH3 → CH4 + ·CH2CH=CHCH3 |
1 record matched | | (CH3)2C=C(CH3)2 + ·CH3 → (CH3)3C-C(·)(CH3)2 |
1 record matched | | (CH3)2CHCH=CH2 + ·CH3 → (CH3)2CHCH(·)C2H5 |
1 record matched | | CD4 + ·CH3 → CH3D + CD3 |
1 record matched | | (CH3)2C=CHCH3 + ·CH3 → Products |
1 record matched | | (CH3N)2 + ·CH3 → CH4 + ·CH2N=NCH3 |
1 record matched | | (CH3N)2 → ·CH3 + ·CH3 + N2 |
1 record matched | | neo-C5H12 + ·CH3 → CH4 + Neopentyl |
1 record matched | | CH2=C=CH2 + ·CH3 → CH3CH2C(·)=CH2 |
1 record matched | | C2H5CHO + ·CH3 → CH3CH2CH(CH3)O· |
1 record matched | | CF3CF=CF2 + ·CH3 → Products |
1 record matched | | C2F4 + ·CH3 → Adduct |
1 record matched | | iso-C4H8 + ·CH3 → (CH3)2C(·)CH2CH3 |
1 record matched | | iso-C4H8 + ·CH3 → Neopentyl |
1 record matched | | iso-C4H8 + ·CH3 → Products |
1 record matched | | (CH3)2O + ·CH3 → CH4 + CH3OCH2· |
1 record matched | | CH3CH=CH2 + ·CH2 → ·CH2CH=CH2 + ·CH3 |
1 record matched | | CH3CH=CH2 + C2H3 → 1,3-Butadiene + ·CH3 |
3 records matched | | CH3CH=CH2 + ·CH3 → iso-C4H9 |
3 records matched | | CH3CH=CH2 + ·CH3 → sec-C4H9 |
3 records matched | | CH3CH=CH2 + ·CH3 → CH4 + ·CH2CH=CH2 |
1 record matched | | CH3CH=CH2 + ·CH3 → Adduct |
2 records matched | | CH3CH=CH2 + ·CH3 → Products |
1 record matched | | CH3CH=CH2 → ·CH3 + C2H3 |
1 record matched | | 1,2-Dimethoxyethane + ·CH3 → CH3OCH2CH2OCH2· + CH4 |
2 records matched | | Toluene + H· → Benzene + ·CH3 |
1 record matched | | 1,3-Butadiene + ·CH3 → CH2=CHCH(·)CH2CH3 |
1 record matched | | 1-C4H8 + ·CH3 → CH4 + ·CH2CH=CHCH3 |
1 record matched | | 1-C4H8 + ·CH3 → Products |
1 record matched | | 1-C4H10 + ·CH3 → Other Products + CH4 |
1 record matched | | 1-C4H10 → 1-C3H7 + ·CH3 |
1 record matched | | Methoxybenzene → C6H5O + ·CH3 |
1 record matched | | Ethylbenzene → Benzyl + ·CH3 |
1 record matched | | CH3C(O)OCH3 + ·CH3 → CH4 + ·CH2C(O)OCH3 |
1 record matched | | (CH3)4Si + ·CH3 → CH4 + (CH3)3SiCH2 |
1 record matched | | iso-C4H10 + ·CH2 → tert-C4H9 + ·CH3 |
2 records matched | | iso-C4H10 + ·CH3 → CH4 + iso-C4H9 |
2 records matched | | iso-C4H10 + ·CH3 → CH4 + tert-C4H9 |
3 records matched | | iso-C4H10 + ·CH3 → Other Products + CH4 |
3 records matched | | iso-C4H10 → iso-C3H7 + ·CH3 |
1 record matched | | Oxirane + ·CH3 → CH4 + Oxiranyl |
8 records matched | | (CH3)2S + O· → ·CH3 + CH3SO |
1 record matched | | CH3CHO + ·CH3 → i-C3H7O |
2 records matched | | CH3CHO + ·CH3 → CH4 + CH3CO |
2 records matched | | CH3CHO → ·CH3 + HCO |
1 record matched | | CH2=CHCl + ·CH3 → Products |
1 record matched | | CH3CCH + ·CH3 → Products |
1 record matched | | C3H8 + ·CH2 → 1-C3H7 + ·CH3 |
1 record matched | | C3H8 + ·CH2 → iso-C3H7 + ·CH3 |
1 record matched | | C3H8 + ·CH3 → CH4 + 1-C3H7 |
1 record matched | | C3H8 + ·CH3 → CH4 + iso-C3H7 |
1 record matched | | C3H8 + ·CH3 → Products |
5 records matched | | C3H8 → ·C2H5 + ·CH3 |
1 record matched | | CH3I + I → ·CH3 + I2 |
3 records matched | | C2H2 + ·CH3 → CH3CH=C(·)H |
1 record matched | | C2H2 + ·CH3 → ·CH2CH=CH2 |
1 record matched | | C2H2 + ·CH3 → CH4 + ·C2H |
1 record matched | | C2H2 + iso-C3H7 → 1,3-Butadiene + ·CH3 |
1 record matched | | C2H2 + tert-C4H9 → CH2=C(CH3)CH=CH2 + ·CH3 |
2 records matched | | C2H4 + O· → ·CH3 + HCO |
5 records matched | | C2H4 + ·CH3 → 1-C3H7 |
3 records matched | | C2H4 + ·CH3 → CH4 + C2H3 |
4 records matched | | C2H6 + ·CH3 → CH4 + ·C2H5 |
13 records matched | | C2H6 → ·CH3 + ·CH3 |
1 record matched | | CH3Br + H· → ·CH3 + HBr |
1 record matched | | CH4 + ·CH2 → ·CH3 + ·CH3 |
10 records matched | | CH4 + ·Cl → ·CH3 + HCl |
4 records matched | | CH4 + CF3O → CF3OH + ·CH3 |
13 records matched | | CH4 + O· → ·CH3 + ·OH |
8 records matched | | CH4 + ·F → ·CH3 + HF |
2 records matched | | CH4 + NH2 → ·CH3 + NH3 |
8 records matched | | CH4 + H· → H2 + ·CH3 |
2 records matched | | CH4 + NO3 → ·CH3 + HNO3 |
2 records matched | | CH4 + Br· → ·CH3 + HBr |
2 records matched | | CH4 + O2 → ·CH3 + HO2 |
1 record matched | | CH4 + iso-C4H9 → iso-C4H10 + ·CH3 |
21 records matched | | CH4 + ·OH → ·CH3 + H2O |
2 records matched | | CH4 + HO2 → ·CH3 + H2O2 |
1 record matched | | CH4 + CH3CO → CH3CHO + ·CH3 |
1 record matched | | CH4 + C2H3 → C2H4 + ·CH3 |
1 record matched | | CH4 + HCO → CH2O + ·CH3 |
1 record matched | | CH4 + (·)CH2OH → CH3OH + ·CH3 |
1 record matched | | CH4 + ·CF3 → CHF3 + ·CH3 |
1 record matched | | CH4 + ·CH3 → CH4 + ·CH3 |
1 record matched | | CH4 + CH2=C → ·CH3 + C2H3 |
1 record matched | | CH4 + CH3O· → CH3OH + ·CH3 |
1 record matched | | CH4 + 1-C3H7 → C3H8 + ·CH3 |
1 record matched | | CH4 + CH3O2· → ·CH3 + CH3OOH |
1 record matched | | CH4 + ·C2H → C2H2 + ·CH3 |
1 record matched | | CH4 + ·C2H5 → C2H6 + ·CH3 |
1 record matched | | CH4 + iso-C3H7 → C3H8 + ·CH3 |
1 record matched | | CH4 + ·CH2CH=CH2 → CH3CH=CH2 + ·CH3 |
1 record matched | | CH4 + tert-C4H9 → iso-C4H10 + ·CH3 |
13 records matched | | CH4 → ·CH3 + H· |
1 record matched | | Acetone + ·CH3 → (CH3)3CO· |
2 records matched | | Acetone + ·CH3 → CH4 + CH3C(O)CH2(·) |
1 record matched | | CH3OH + ·CH2 → ·CH3 + (·)CH2OH |
1 record matched | | CH3OH + ·CH2 → CH3O· + ·CH3 |
1 record matched | | CH3OH + ·CH3 → CH4 + (·)CH2OH |
1 record matched | | CH3OH + ·CH3 → CH4 + CH3O· |
5 records matched | | CH3OH → ·CH3 + ·OH |
1 record matched | | C2H5OH + ·CH3 → CH4 + HOCH2CH2· |
1 record matched | | C2H5OH + ·CH3 → CH4 + CH3CH(·)OH |
1 record matched | | C2H5OH + ·CH3 → CH4 + CH3CH2O· |
9 records matched | | C2H5OH → ·CH3 + (·)CH2OH |
2 records matched | | CN + CH4 → HCN + ·CH3 |
1 record matched | | CH2O + ·CH2 → ·CH3 + HCO |
1 record matched | | CH2O + ·CH3 → CH3CH2O· |
5 records matched | | CH2O + ·CH3 → CH4 + HCO |
2 records matched | | O(1D) + CH4 → ·CH3 + ·OH |
1 record matched | | M + ·CH3 + O2 → M + CH3O2· |
1 record matched | | CH3C(·)=NH → ·CH3 + HNC |
2 records matched | | Methyl, methoxy(1-methylethoxy)phenyl- → Benzoic acid 1-methylethyl ester + ·CH3 |
2 records matched | | CH3CH(O.)CH2CH2CH3 → CH3CH2CH2CHO + ·CH3 |
1 record matched | | CH3In → ·CH3 + In(CH3)2 |
2 records matched | | CH3In → ·CH3 + In |
1 record matched | | (CH3)2Ga → ·CH3 + CH3Ga |
1 record matched | | CH3Ga → ·CH3 + Ga |
1 record matched | | (CH3)2CD· → ·CH3 + CH2=CHD |
1 record matched | | CH3CH=C(·)CH3 → CH3CCH + ·CH3 |
1 record matched | | CH3N=N → ·CH3 + N2 |
1 record matched | | CH3(CH2)2CH(CH3)O → CH3CH2CH2CHO + ·CH3 |
3 records matched | | ·CH2CH=CHCH2CH3 → 1,3-Butadiene + ·CH3 |
2 records matched | | CH3SOO → ·CH3 + SO2 |
1 record matched | | C2H5CHCHO → CH2=CHCHO + ·CH3 |
1 record matched | | CH3Zn → ·CH3 + Zn |
1 record matched | | Oxiranyl → CO + ·CH3 |
2 records matched | | CH3SCH2 → CH2S + ·CH3 |
1 record matched | | CH3CH2CH(CH3)O· → C2H5CHO + ·CH3 |
1 record matched | | (CH3)2CHC(·)(CH3)2 → (CH3)2C=CHCH3 + ·CH3 |
1 record matched | | (CH3)3C-C(·)(CH3)2 → (CH3)2C=C(CH3)2 + ·CH3 |
1 record matched | | (CH3)3CC(CH3)2CH2 → (CH3)3CC(CH3)=CH2 + ·CH3 |
1 record matched | | (CH3CH2)2CH → 1-C4H8 + ·CH3 |
1 record matched | | (CH3)2CHC≡CCH3 → ·CH3 + CH3C≡CCHCH3 |
3 records matched | | CH3OCH2· → CH2O + ·CH3 |
1 record matched | | CH3OC(·)(O) → CO2 + ·CH3 |
1 record matched | | CH3CO → CO + ·CH3 |
2 records matched | | ·CH2C(CH3)=CH2 → CH2=C=CH2 + ·CH3 |
1 record matched | | C2H5C≡CCH=CH2 → ·CH3 + CH2=CHC≡CCH2· |
1 record matched | | (CD3)3CH + ·CH2 → ·CH3 + tert-C4D9 |
1 record matched | | C2H5C(CH3)2O(·) → C2H5COCH3 + ·CH3 |
2 records matched | | CH2D + H· → ·CH3 + D |
2 records matched | | NO + CH3C(O)OO(·) → CO2 + ·CH3 + NO2 |
1 record matched | | HBr + ·CH2 → ·CH3 + Br· |
1 record matched | | HCl + ·CH2 → ·CH3 + ·Cl |
1 record matched | | CH2=CHO· → CO + ·CH3 |
2 records matched | | CH3CH=C(·)H → C2H2 + ·CH3 |
1 record matched | | Isoxazole, 5-methyl- → ·CH3 + N≡CCH2C(O)· |
1 record matched | | (CH3)2C(OH) → CH3CHO + ·CH3 |
1 record matched | | CH3S(O)2 + He → ·CH3 + SO2 |
4 records matched | | CH3S(O)2 → ·CH3 + SO2 |
7 records matched | | iso-C4H9 → CH3CH=CH2 + ·CH3 |
1 record matched | | HOCH2CH2· → CH2O + ·CH3 |
1 record matched | | (E)-CH3N=NCH3 → ·CH3 + CH3N=N |
2 records matched | | (E)-CH3N=NCH3 → ·CH3 + ·CH3 + N2 |
12 records matched | | i-C3H7O → CH3CHO + ·CH3 |
8 records matched | | Neopentyl → iso-C4H8 + ·CH3 |
1 record matched | | CH3N=NCH(CH3)2 → iso-C3H7 + ·CH3 + N2 |
1 record matched | | 4-Ethylstyrene → ·CH3 + 4-Vinylbenzyl |
1 record matched | | In(CH3)3 → ·CH3 + In(CH3)2 |
1 record matched | | HO2 + CH3C(O)OO(·) → CO2 + ·CH3 + ·OH + O2 |
1 record matched | | CH3CO + O· → CO2 + ·CH3 |
1 record matched | | CH3CO + H· → ·CH3 + HCO |
1 record matched | | CH3CO + NO2 → CO2 + ·CH3 + NO |
17 records matched | | CH3CO → CO + ·CH3 |
21 records matched | | (CH3)3CO· → Acetone + ·CH3 |
1 record matched | | CH3C(O)CH2(·) → H2C=C=O + ·CH3 |
1 record matched | | Benzene, 2-ethyl-1,3-dimethyl- → ·CH3 + Methyl,(2,6-dimethylphenyl)- |
1 record matched | | C2H3 + O2 → CO2 + ·CH3 |
1 record matched | | 1-C4H9 → CH3CH=CH2 + ·CH3 |
8 records matched | | sec-C4H9 → CH3CH=CH2 + ·CH3 |
1 record matched | | ·CH3 + CH3CH2N=NCH(·)CH3 → Other Products + CH4 |
3 records matched | | ·CH3 + ·CH2 → C2H4 + H· |
1 record matched | | ·CH3 + ·CH2 → Products |
1 record matched | | ·CH3 + CH3ICl → CH3Cl + CH3I |
1 record matched | | ·CH3 + CH3ICl → Products |
1 record matched | | ·CH3 + CH2C(CH3)=C(CH3)2 → C2H5C(CH3)=C(CH3)2 |
1 record matched | | ·CH3 + CH2C(CH3)=C(CH3)2 → CH4 + CH2=C(CH3)C(CH3)=CH2 |
1 record matched | | ·CH3 + D2NCH2CH2ND2 → D2NCH(·)CH2ND2 + CH4 |
1 record matched | | ·CH3 + D2NCH2CH2ND2 → ·ND CH2CH2ND2 + CH3D |
1 record matched | | ·CH3 + DCONH2 → Other Products + CH3D |
1 record matched | | ·CH3 + HCOND2 → Other Products + CH4 |
1 record matched | | ·CH3 + HCOND2 → HC(O)ND· + CH3D |
1 record matched | | ·CH3 + CH3N=NH → CH4 + CH3N=N |
1 record matched | | ·CH3 + N=C-CH2CH2 → CH4 + CH2CHCN |
2 records matched | | ·CH3 + CH3C(O)OCD3 → CH3D + CH3C(O)OCD2 |
3 records matched | | ·CH3 + CH3C(O)OCD3 → Other Products + CH4 |
1 record matched | | ·CH3 + CD3C(O)CD2CH3 → Other Products + CH3D |
3 records matched | | ·CH3 + ·Cl → CH3Cl |
1 record matched | | ·CH3 + NCO → CH2O + HNC |
1 record matched | | ·CH3 + NCO → CH2O + HCN |
1 record matched | | ·CH3 + NCO → Products |
1 record matched | | ·CH3 + CD3C(O)C(O)CD3 → CH3C(O)CD3 + CD3CO |
1 record matched | | ·CH3 + CD3C(O)C(O)CD3 → Other Products + CD3 |
1 record matched | | ·CH3 + CD3C(O)C(O)CD3 → Other Products + CH3D |
2 records matched | | ·CH3 + CD3C(O)OCH3 → Other Products + CH3D |
1 record matched | | ·CH3 + CD3C(O)OCH3 → Other Products + CH4 |
1 record matched | | ·CH3 + CH3SiHCl2 → CH4 + Silyl, dichloromethyl- |
1 record matched | | ·CH3 + SiCl3 → Products |
1 record matched | | ·CH3 + C6H5SiD3 → Other Products + CH3D |
1 record matched | | ·CH3 + C6H5SiD3 → Other Products + CH4 |
2 records matched | | ·CH3 + N → H· + H2C=N |
1 record matched | | ·CH3 + N → H2 + HNC |
1 record matched | | ·CH3 + N → HCN + H· + H· |
2 records matched | | ·CH3 + N → HCN + H2 |
2 records matched | | ·CH3 + N → Products |
1 record matched | | ·CH3 + O· → CH3O· |
5 records matched | | ·CH3 + O· → CO + H2 + H· |
23 records matched | | ·CH3 + O· → CH2O + H· |
6 records matched | | ·CH3 + O· → Products |
1 record matched | | ·CH3 + OClO → Products |
1 record matched | | ·CH3 + C6H5OCH2 → Ethoxybenzene |
1 record matched | | ·CH3 + D → CH2D + H· |
2 records matched | | ·CH3 + D → CH3D |
1 record matched | | ·CH3 + 2-Phenyl-2-propyl radical → t-Butylbenzene |
1 record matched | | ·CH3 + (iso-C3H7O)2 → Other Products + CH4 |
2 records matched | | ·CH3 + (CH3)3Si· → CH4 + (CH3)2Si=CH2 |
1 record matched | | ·CH3 + (CH3)3Si· → Products |
1 record matched | | ·CH3 + CH3OC(·)(O) → CH3C(O)OCH3 |
4 records matched | | ·CH3 + (CH3)2N → (CH3)3N |
2 records matched | | ·CH3 + (CH3)2N → CH4 + CH2=NCH3 |
1 record matched | | ·CH3 + ·CH2C(CH3)=CH2 → C2H5C(CH3)=CH2 |
1 record matched | | ·CH3 + ClO → Products |
1 record matched | | ·CH3 + Oxetane, 2,4-dimethyl- → Other Products + CH4 |
1 record matched | | ·CH3 + ·F → Products |
2 records matched | | ·CH3 + I → CH3I |
2 records matched | | ·CH3 + HD → CH4 + D |
1 record matched | | ·CH3 + BrCl → CH3Cl + Br· |
2 records matched | | ·CH3 + NH2 → CH3NH2 |
1 record matched | | ·CH3 + SiH3 → Products |
1 record matched | | ·CH3 + N2D4 → Other Products + CH3D |
1 record matched | | ·CH3 + N2D4 → ND2ND· + CH3D |
1 record matched | | ·CH3 + OD → HDO + ·CH2 |
2 records matched | | ·CH3 + OD → CH3OD |
2 records matched | | ·CH3 + OD → H2 + CHDO |
2 records matched | | ·CH3 + OD → CH2O + HD |
2 records matched | | ·CH3 + OD → Products |
1 record matched | | ·CH3 + ND3 → CH3D + ND2 |
1 record matched | | ·CH3 + Si2D6 → SiD3SiD2· + CH3D |
1 record matched | | ·CH3 + SiD4 → CH3D + SiD3 |
2 records matched | | ·CH3 + D2S → CH3D + SD |
3 records matched | | ·CH3 + DBr → CH3D + Br· |
1 record matched | | ·CH3 + SiHF3 → CH4 + SiF3 |
1 record matched | | ·CH3 + (CH3)3CD → CH4 + (CH3)2CDC(·)H2 |
21 records matched | | ·CH3 + H· → CH4 |
1 record matched | | ·CH3 + Cyclohexadienyl → 1,3-Cyclohexadiene, 5-methyl- |
1 record matched | | ·CH3 + Cyclohexadienyl → 1,4-Cyclohexadiene, 3-methyl- |
1 record matched | | ·CH3 + Cyclohexadienyl → Benzene + CH4 |
1 record matched | | ·CH3 + NO3 → Products |
9 records matched | | ·CH3 + NO2 → CH3O· + NO |
6 records matched | | ·CH3 + NO2 → CH3NO2 |
1 record matched | | ·CH3 + NO2 → Products |
2 records matched | | ·CH3 + NO → ·OH + H2C=N |
32 records matched | | ·CH3 + NO → CH3NO |
3 records matched | | ·CH3 + NO → HCN + H2O |
4 records matched | | ·CH3 + NO → Products |
7 records matched | | ·CH3 + Br· → CH3Br |
2 records matched | | ·CH3 + N2F4 → Methanamine, N,N-difluoro- + NF2 |
11 records matched | | ·CH3 + HBr → CH4 + Br· |
4 records matched | | ·CH3 + HI → CH4 + I |
1 record matched | | ·CH3 + O3 → CH3O· + O2 |
7 records matched | | ·CH3 + O3 → Products |
2 records matched | | ·CH3 + SiHCl3 → CH4 + SiCl3 |
2 records matched | | ·CH3 + N2O → CH3O· + N2 |
4 records matched | | ·CH3 + SiH4 → CH4 + SiH3 |
1 record matched | | ·CH3 + UF6 → CH3F + UF5 |
1 record matched | | ·CH3 + NF3 → Methanamine, N,N-difluoro- + ·F |
10 records matched | | ·CH3 + H2S → CH4 + SH |
1 record matched | | ·CH3 + HN3 → CH4 + ·N3 |
1 record matched | | ·CH3 + HNO2 → CH4 + NO2 |
6 records matched | | ·CH3 + Cl2 → CH3Cl + ·Cl |
2 records matched | | ·CH3 + O2 → HCO + H2O |
14 records matched | | ·CH3 + O2 → CH3O· + O· |
51 records matched | | ·CH3 + O2 → CH3O2· |
22 records matched | | ·CH3 + O2 → CH2O + ·OH |
3 records matched | | ·CH3 + O2 → Products |
2 records matched | | ·CH3 + F2 → CH3F + ·F |
4 records matched | | ·CH3 + D2 → CH3D + D |
4 records matched | | ·CH3 + Br2 → CH3Br + Br· |
2 records matched | | ·CH3 + DCl → CH3D + ·Cl |
3 records matched | | ·CH3 + NH3 → CH4 + NH2 |
12 records matched | | ·CH3 + HCl → CH4 + ·Cl |
5 records matched | | ·CH3 + I2 → CH3I + I |
6 records matched | | ·CH3 + SO2 → CH3S(O)2 |
1 record matched | | ·CH3 + SO2 → Products |
1 record matched | | ·CH3 + He + ·Cl → CH3Cl + He |
1 record matched | | ·CH3 + He + NO2 → Products + He |
1 record matched | | ·CH3 + Ar → Ar + H· + ·CH2 |
1 record matched | | ·CH3 + Ar → H2 + ·CH + Ar |
1 record matched | | ·CH3 + Si → SiCH + H2 |
2 records matched | | ·CH3 + CD3O → CH3D + CD2O |
1 record matched | | ·CH3 + CD3SH → CH3SH + CD3 |
1 record matched | | ·CH3 + CD3SH → CH4 + CD3S |
1 record matched | | ·CH3 + CD3SH → ·CD2SH + CH3D |
2 records matched | | ·CH3 + ·CH2Cl → Products |
1 record matched | | ·CH3 + CH2=C=CH → 1,2-butadiene |
1 record matched | | ·CH3 + CH3CD2C(O)CD2CH3 → Other Products + CH3D |
1 record matched | | ·CH3 + CH3CD2C(O)CD2CH3 → Other Products + CH4 |
1 record matched | | ·CH3 + CD3CH2NH2 → Other Products + CH4 |
1 record matched | | ·CH3 + CH3CH2ND2 → CH3CH2ND· + CH3D |
1 record matched | | ·CH3 + CH3CH2ND2 → ·CH2CH2ND2 + CH4 |
1 record matched | | ·CH3 + Hydrazine-1,2-d2, 1,2-dimethyl- → Other Products + CH3D |
1 record matched | | ·CH3 + Hydrazine-1,2-d2, 1,2-dimethyl- → CH3NDN(·)CH3 + CH3D |
1 record matched | | ·CH3 + Hydrazine-1,2-d2, 1,2-dimethyl- → ·CH2NDNDCH3 + CH4 |
2 records matched | | ·CH3 + CD3NH2 → CH4 + CD3NH· |
2 records matched | | ·CH3 + CD3NH2 → Other Products + CH3D |
1 record matched | | ·CH3 + HOCH2CH2· → CH3CH=CH2 + H2O |
1 record matched | | ·CH3 + Aziridine-2,2,3,3-d4 → Adduct |
1 record matched | | ·CH3 + (CH3)2C(·)CH2CH3 → Other Products + CH4 |
1 record matched | | ·CH3 + (E)-CH3CH=CHCHO → CH4 + CH3CH=CHC(O)· |
2 records matched | | ·CH3 + (E)-CH3N=NCH3 → Other Products + CH4 |
1 record matched | | ·CH3 + CH3CDO → Other Products + CH4 |
1 record matched | | ·CH3 + (CH3)2Si=CH2 → Products |
1 record matched | | ·CH3 + CH2=C(CH3)NNCH3 → Other Products + CH4 |
1 record matched | | ·CH3 + Aziridine,1-(1,1-dimethylethyl)- → Other Products + CH4 |
2 records matched | | ·CH3 + 2-Propan-2-d-ol → CH3D + (CH3)2C(OH) |
1 record matched | | ·CH3 + 2-Propan-2-d-ol → Other Products + CH4 |
1 record matched | | ·CH3 + ·CH2F → C2H4 + HF |
2 records matched | | ·CH3 + NF2 → Methanamine, N,N-difluoro- |
1 record matched | | ·CH3 + (C2H5)2NOH → Other Products + CH4 |
1 record matched | | ·CH3 + CHCl2 → Products |
3 records matched | | ·CH3 + ·OH → H2O + ·CH2 |
2 records matched | | ·CH3 + ·OH → (·)CH2OH + H· |
2 records matched | | ·CH3 + ·OH → CH3O· + H· |
3 records matched | | ·CH3 + ·OH → H2 + HOCH |
13 records matched | | ·CH3 + ·OH → CH3OH |
3 records matched | | ·CH3 + ·OH → CH2O + H2 |
12 records matched | | ·CH3 + ·OH → Products |
2 records matched | | ·CH3 + ·OH → CH2(1) + H2O |
1 record matched | | ·CH3 + Phenoxy, 2-methyl- → Phenol, 2,5-dimethyl- |
1 record matched | | ·CH3 + HO2 → CH3O· + ·OH |
1 record matched | | ·CH3 + HO2 → CH4 + O2 |
1 record matched | | ·CH3 + HO2 → Products |
1 record matched | | ·CH3 + ·CCl3 → CH2=CCl2 + HCl |
2 records matched | | ·CH3 + ·CCl3 → Products |
1 record matched | | ·CH3 + CH3CO → C2H6 + CO |
3 records matched | | ·CH3 + CH3CO → CH4 + H2C=C=O |
6 records matched | | ·CH3 + CH3CO → Acetone |
2 records matched | | ·CH3 + CH3CO → Products |
1 record matched | | ·CH3 + Cyclohexyl → Methylcyclohexane |
1 record matched | | ·CH3 + Cyclohexyl → CH4 + Cyclohexene |
1 record matched | | ·CH3 + 1,1,3-Trimethylcyclohexane → Other Products + CH4 |
2 records matched | | ·CH3 + CH2C≡CH → 1,2-butadiene |
2 records matched | | ·CH3 + CH2C≡CH → Products |
2 records matched | | ·CH3 + CH3CD2CH3 → CH4 + CH3CD2CH2 |
1 record matched | | ·CH3 + 1-C5H11 → CH4 + 1-C5H10 |
1 record matched | | ·CH3 + ·CHF2 → CH4 + ·CF2 |
2 records matched | | ·CH3 + C2H3 → ·CH2CH=CH2 + H· |
2 records matched | | ·CH3 + C2H3 → CH3CH=CH2 |
4 records matched | | ·CH3 + C2H3 → Cyclopropane |
4 records matched | | ·CH3 + C2H3 → CH4 + C2H2 |
3 records matched | | ·CH3 + C2H3 → Products |
2 records matched | | ·CH3 + CH3ND2 → CH3D + CH3ND |
2 records matched | | ·CH3 + CH3ND2 → Other Products + CH4 |
6 records matched | | ·CH3 + HCO → CH3CHO |
5 records matched | | ·CH3 + HCO → CH4 + CO |
4 records matched | | ·CH3 + HCO → Products |
2 records matched | | ·CH3 + (·)CH2OH → CH2O + CH4 |
1 record matched | | ·CH3 + SF6 → CH3F + SF5 |
1 record matched | | ·CH3 + 1-C4H9 → n-C5H12 |
3 records matched | | ·CH3 + 1-C4H9 → CH4 + 1-C4H8 |
1 record matched | | ·CH3 + 1-C4H9 → Products |
1 record matched | | ·CH3 + CH3CH2CH2CH(·)CH3 → Products |
1 record matched | | ·CH3 + Phenyl → Toluene |
1 record matched | | ·CH3 + Phenyl → C6H6CH3 |
1 record matched | | ·CH3 + sec-C4H9 → Other Products + CH4 |
1 record matched | | ·CH3 + 1-phenylethyl → 2-Phenylpropane |
1 record matched | | ·CH3 + CF3I → CH3I + ·CF3 |
2 records matched | | ·CH3 + CF3I → Products |
4 records matched | | ·CH3 + ·CF3 → CH3CF3 |
2 records matched | | ·CH3 + ·CF3 → CH2=CF2 + HF |
1 record matched | | ·CH3 + 1,2,4-Trimethylcyclohexane → Other Products + CH4 |
8 records matched | | ·CH3 + ·CH3 → ·C2H5 + H· |
5 records matched | | ·CH3 + ·CH3 → C2H4 + H2 |
75 records matched | | ·CH3 + ·CH3 → C2H6 |
1 record matched | | ·CH3 + ·CH3 → CH4 + ·CH2 |
4 records matched | | ·CH3 + ·CH3 → Products |
6 records matched | | ·CH3 → H· + ·CH2 |
5 records matched | | ·CH3 → H2 + ·CH |
1 record matched | | 2-methyl-oxetane + ·CH3 → Other Products + CH4 |
2 records matched | | Benzyl + ·CH3 → Ethylbenzene |
6 records matched | | CH3CH2O· → CH2O + ·CH3 |
1 record matched | | CH3O· + O· → ·CH3 + O2 |
1 record matched | | CH3O· + H· → ·CH3 + ·OH |
1 record matched | | CH3O· + ·CH3 → (CH3)2O |
7 records matched | | CH3O· + ·CH3 → CH2O + CH4 |
1 record matched | | 1-C3H7 + ·CH3 → 1-C4H10 |
5 records matched | | 1-C3H7 + ·CH3 → CH4 + CH3CH=CH2 |
1 record matched | | 1-C3H7 + ·CH3 → Products |
10 records matched | | 1-C3H7 → C2H4 + ·CH3 |
2 records matched | | CH3O2· + ·CH3 → CH3O· + CH3O· |
1 record matched | | CH3O2· → ·CH3 + O2 |
2 records matched | | C6H5O + ·CH3 → Methoxybenzene |
1 record matched | | C6H5O + ·CH3 → 2-Methylphenol + 4-Methylphenol |
2 records matched | | C6H5O + ·CH3 → 2-Methylphenol |
1 record matched | | C6H5O + ·CH3 → Products |
1 record matched | | C6D5CD3 + ·CH3 → Other Products + CH3D |
1 record matched | | CH3CD3 + ·CH3 → CH4 + ·CH2CD3 |
8 records matched | | ·C2H5 + H· → ·CH3 + ·CH3 |
10 records matched | | ·C2H5 + ·CH3 → C3H8 |
8 records matched | | ·C2H5 + ·CH3 → CH4 + C2H4 |
4 records matched | | ·C2H5 + ·CH3 → Products |
1 record matched | | iso-C3H7 + O· → CH3CHO + ·CH3 |
1 record matched | | iso-C3H7 + ·CH3 → iso-C4H10 |
5 records matched | | iso-C3H7 + ·CH3 → CH4 + CH3CH=CH2 |
2 records matched | | iso-C3H7 + ·CH3 → Products |
4 records matched | | iso-C3H7 → C2H4 + ·CH3 |
2 records matched | | ·CH2CH=CH2 + ·CH3 → Products |
1 record matched | | CH3CD2OH + ·CH3 → CH3D + CH3CH(·)OD |
1 record matched | | CH3CD2OH + ·CH3 → Other Products + CH3D |
1 record matched | | CH3CD2OH + ·CH3 → Other Products + CH4 |
3 records matched | | CD3OH + ·CH3 → CH3D + CD2OH |
2 records matched | | CD3OH + ·CH3 → CH4 + CD3O |
1 record matched | | 1,3,5-Trimethylcyclohexane + ·CH3 → Other Products + CH4 |
1 record matched | | Benzene, 2-ethyl-1,4-dimethyl- → ·CH3 + 2,5-dimethylphenyl-methyl |
2 records matched | | (CH3)2CHONO2 → CH3CHO + ·CH3 + NO2 |
1 record matched | | ·CCl2F + ·CH3 → CH3Cl + ·CClF |
1 record matched | | ·CClF2 + ·CH3 → CH3Cl + ·CF2 |
1 record matched | | CD3CDO + ·CH3 → CH3D + CD3CO |
3 records matched | | tert-C4H9 + ·CH3 → CH4 + iso-C4H8 |
1 record matched | | tert-C4H9 + ·CH3 → Products |
1 record matched | | tert-C4H9 → CH3CH=CH2 + ·CH3 |
1 record matched | | C6D5CH3 + ·CH3 → CH4 + C6D5CH2 |
2 records matched | | C6D5CH3 + ·CH3 → Other Products + CH3D |
1 record matched | | C6D5CH3 → ·CH3 + Phenyl-d5 radical |
1 record matched | | Si2H6 + ·CH3 → CH4 + Si2H5 |
1 record matched | | FC(O)OCH3 + ·CH3 → Other Products + CH4 |
2 records matched | | Cyclopropanecarboxaldehyde + ·CH3 → CH4 + Methyl, cyclopropyloxo- |
1 record matched | | (CH3)6Si2 → ·CH3 + (CH3)3SiSi(·)(CH3)2 |
2 records matched | | (CH3)3Ga → ·CH3 + (CH3)2Ga |
1 record matched | | (CH3)3Ga → Other Products + ·CH3 |
4 records matched | | H2 + ·CH2 → ·CH3 + H· |
3 records matched | | H2 + ·CH → ·CH3 |
16 records matched | | H2 + ·CH3 → CH4 + H· |
1 record matched | | C6H5-C(CH3)2C≡N → ·CH3 + C6H5-C(·)(CH3)C≡N |
1 record matched | | (Z)-CH3CH=CHCN → ·CH3 + CH2=C(CN) |
1 record matched | | C6H5CD3 + ·CH3 → CH3D + C6H5CD2 |
1 record matched | | C6H5CD3 + ·CH3 → Other Products + CH3D |
2 records matched | | C6H5CD3 + ·CH3 → Other Products + CH4 |
1 record matched | | CH2=CHCH(CH3)CH=CH2 → ·CH3 + (CH2=CH)2CH |
2 records matched | | (CH3)2SiH2 + ·CH3 → CH4 + (CH3)2SiH |
1 record matched | | Methylthiirane + ·CH3 → CH3CH=CH2 + CH3S· |
1 record matched | | Methylthiirane + ·CH3 → Other Products + CH4 |
1 record matched | | CH3SiD3 + ·CH3 → Other Products + CH3D |
1 record matched | | (tert-C4H9)C≡CCH3 → ·CH3 + CH3C≡CC(CH3)2 |
4 records matched | | (CH3)3SiH + ·CH3 → CH4 + (CH3)3Si· |
1 record matched | | (CH3)3SiH + ·CH3 → Other Products + CH4 |
1 record matched | | (CH3)3SiH → ·CH3 + (CH3)2SiH |
2 records matched | | CH3SiH3 + ·CH2 → ·CH3 + CH3SiH2 |
2 records matched | | CH3SiH3 + ·CH3 → CH4 + CH3SiH2 |
1 record matched | | CH3SiH3 → ·CH3 + SiH3 |
1 record matched | | Benzene, 1-ethyl-3,5-dimethyl- → ·CH3 + 3,5-dimethylbenzyl radical |
1 record matched | | (CH3)3CC≡CH → ·CH3 + HC≡CC(CH3)2 |
1 record matched | | Methanamine-d, N-methyl- + ·CH3 → CH3D + (CH3)2N |
1 record matched | | Methanamine-d, N-methyl- + ·CH3 → Other Products + CH4 |
1 record matched | | (CH3)4Ge + ·CH3 → CH4 + (CH3)3GeCH2 |
2 records matched | | (CH3)4Ge → ·CH3 + (CH3)3Ge |
3 records matched | | CH3NO + NO + NO → ·CH3 + N2 + NO3 |
1 record matched | | 1-Phenyl-1-butene → ·CH3 + 3-Phenyl-2-propenyl |
1 record matched | | 2,2'-Diphenylpropane → ·CH3 + 1,1'-Diphenylethyl |
1 record matched | | 1-Methylindene → ·CH3 + 1H-Inden-1-yl |
1 record matched | | C2H5CH2C(CH3)=CH2 + ·CH3 → Adduct |
1 record matched | | (CH3)2SnCl2 → ·CH3 + ·CH3 + SnCl2 |
1 record matched | | (CH3)2SnCl2 → SnCl2CH3 + ·CH3 |
1 record matched | | Methanamine, N,N-difluoro- → ·CH3 + NF2 |
1 record matched | | (CH3O)2 + ·CH3 → Other Products + CH4 |
1 record matched | | Vinylacetylene + ·CH3 → Products |
2 records matched | | (CF3)2CO + ·CH3 → (CF3)2C(CH3)O· |
1 record matched | | (CF3)2CO + ·CH3 → CH3COCF3 + ·CF3 |
2 records matched | | CH3D → ·CH3 + D |
1 record matched | | (CD3)2CO + ·CH3 → Other Products + CH3D |
1 record matched | | (CD3)2CO + ·CH3 → Adduct |
1 record matched | | 2-(E)-C5H10 + CH3C(O)OO(·) → CO2 + ·CH3 + trans-2-ethyl-3-methyl-oxirane |
1 record matched | | tert-C4H9OC2H5 → (CH3)2C(·)OCH2CH3 + ·CH3 |
1 record matched | | C6H5-CH=CHCH3 + H· → Styrene + ·CH3 |
1 record matched | | ((CH3)2N)2CO + ·CH3 → CH4 + (CH3)2NC(O)N(CH3)CH2· |
1 record matched | | 2,2-dimethylpropanal + ·CH3 → CH4 + (CH3)3CC(O)· |
2 records matched | | (CH3)3C-CN → ·CH3 + (CH3)2CCN |
4 records matched | | CO + ·CH3 → CH3CO |
5 records matched | | CO + CH3O· → CO2 + ·CH3 |
1 record matched | | (E)-CH3CH=CHCN → ·CH3 + CH2=C(CN) |
1 record matched | | C2H5C≡CCH3 → ·CH3 + CH3CCCH2· |
1 record matched | | 2-(Z)-C5H10 + CH3C(O)OO(·) → CO2 + ·CH3 + cis-2-ethyl-3-methyl-oxirane |
1 record matched | | 2-(Z)-C5H10 + ·CH3 → Other Products + CH4 |
1 record matched | | (CH3)2CHCH=C(CH3)2 → ·CH3 + (CH3)2CCH=CHCH3 |
1 record matched | | HCOOCH(CH3)2 + ·CH3 → CH4 + ·C(O)OCH(CH3)2 |
1 record matched | | (CH3)2C=CHC2H5 + ·CH3 → Adduct |
1 record matched | | (E)-2-C4H8 + O· → ·CH3 + CH3C(·)HCHO |
1 record matched | | (E)-2-C4H8 + O· → ·CH3 + CH3CH2CO |
1 record matched | | (E)-2-C4H8 + Phenyl → C6H5-CH=CHCH3 + ·CH3 |
1 record matched | | (E)-2-C4H8 + ·CH3 → (CH3)2CHCH(·)CH3 |
1 record matched | | (E)-2-C4H8 + ·CH3 → CH4 + ·CH2CH=CHCH3 |
1 record matched | | (E)-2-C4H8 + ·CH3 → Other Products + CH4 |
1 record matched | | (E)-2-C4H8 + ·C2H → CH3CH=CHC≡CH + ·CH3 |
1 record matched | | 1-Ethyl-4-methylbenzene → ·CH3 + 4-Methylbenzyl |
1 record matched | | 1-Ethyl-3-methylbenzene → ·CH3 + 3-Methylbenzyl |
2 records matched | | CH3OCOOCH3 + ·CH3 → CH4 + CH3OC(O)OCH2· |
2 records matched | | CH3OCOOCH3 + ·CH3 → Other Products + CH4 |
1 record matched | | CH3OCOOCH3 → CH3OC(O)O· + ·CH3 |
1 record matched | | 1,1'-Diphenylethane → ·CH3 + Diphenylmethyl |
1 record matched | | 1-Ethyl-2-methylbenzene → ·CH3 + 2-Methylbenzyl |
1 record matched | | CH3C(O)C(O)C2H5 + ·CH3 → Other Products + CH4 |
1 record matched | | CH2=CHCH(OH)CH3 → ·CH3 + CH(OH)CH=CH2 |
1 record matched | | CH2=C=C(CH3)2 → ·CH3 + CH3C=C=CH2 |
1 record matched | | (CH3)2CHC≡CH → ·CH3 + CHCCH(·)CH3 |
1 record matched | | (CH3)3CC(CH3)3 + ·CH3 → CH4 + (CH3)3CC(CH3)2CH2 |
1 record matched | | (CH3)3CNO2 + ·CH3 → Other Products + CH4 |
5 records matched | | (CH3)4Sn + ·CF3 → (CH3)3SnCF3 + ·CH3 |
1 record matched | | (CH3)4Sn + ·CH3 → CH4 + (CH3)3SnCH2· |
2 records matched | | (CH3)4Sn → ·CH3 + (CH3)3Sn |
2 records matched | | CCl2Br2 + ·CH3 → Products |
1 record matched | | (CH3)3Sb → ·CH3 + (CH3)2Sb |
1 record matched | | Bismuthine, trimethyl- → (CH3)2Bi Bismuthino, dimethyl- + ·CH3 |
2 records matched | | (CH3)2Hg + ·Cl → CH3HgCl + ·CH3 |
1 record matched | | (CH3)2Hg + O· → ·CH3 + ·CH3 + HgO |
1 record matched | | (CH3)2Hg + ·OH → Mercury, hydroxymethyl- + ·CH3 |
1 record matched | | (CH3)2Hg + ·CH3 → C2H6 + ·CH3 + Hg |
2 records matched | | (CH3)2Hg + ·CH3 → Other Products + CH4 |
7 records matched | | (CH3)2Hg → ·CH3 + CH3Hg |
2 records matched | | CH2=CHBr + O· → ·CH3 + BrCO |
1 record matched | | CH3F + D → ·CH3 + DF |
3 records matched | | CH3F + H· → ·CH3 + HF |
1 record matched | | CH3F + Ca → ·CH3 + FCa |
1 record matched | | CH3F + Cs → ·CH3 + CsF |
1 record matched | | CH3F + Na → ·CH3 + NaF |
1 record matched | | CH3F + K → ·CH3 + KF |
1 record matched | | HCOO(CH2)3CH3 + ·CH3 → Other Products + CH4 |
1 record matched | | C2H5CH=CHCH=CH2 → ·CH3 + CH2=CHCH=CHCH2· |
1 record matched | | 1-C6H12 + CH3C(O)OO(·) → CO2 + Oxirane, butyl- + ·CH3 |
1 record matched | | CH3C(O)OCH2CH=CH2 + ·CH3 → 1-C4H8 + CO2 + ·CH3 |
1 record matched | | CH3C(O)OCH2CH=CH2 + ·CH3 → Other Products + CH4 |
1 record matched | | Iodobenzene + ·CH3 → CH3I + Phenyl |
1 record matched | | Cyclohexane, 1,3-dimethyl- + ·CH3 → Other Products + CH4 |
1 record matched | | 3-Methylbutanal + ·CH3 → CH4 + iso-C4H9CO· |
1 record matched | | 1,1-Dimethylcyclohexane + ·CH3 → Other Products + CH4 |
1 record matched | | 1,2-butadiene + ·CH3 → Other Products + CH4 |
1 record matched | | 1,2-butadiene → ·CH3 + CH2=C=CH |
1 record matched | | (Z)-2-C4H8 + CH3C(O)OO(·) → Other Products + ·CH3 |
2 records matched | | (Z)-2-C4H8 + ·CH3 → (CH3)2CHCH(·)CH3 |
3 records matched | | (Z)-2-C4H8 + ·CH3 → CH4 + ·CH2CH=CHCH3 |
1 record matched | | (Z)-2-C4H8 + ·CH3 → Other Products + CH4 |
1 record matched | | (Z)-2-C4H8 + ·C2H → CH3CH=CHC≡CH + ·CH3 |
1 record matched | | (Z)-2-C4H8 → ·CH2CH=CH2 + ·CH3 |
1 record matched | | 1,4-Dimethylcyclohexane + ·CH3 → Other Products + CH4 |
1 record matched | | Cyclohexane, 1,2-dimethyl-(cis/trans) + ·CH3 → Other Products + CH4 |
1 record matched | | (CH3)2C=C(CH3)2 + ·CH3 → (CH3)3C-C(·)(CH3)2 |
3 records matched | | (CH3)2C=C(CH3)2 + ·CH3 → CH4 + CH2C(CH3)=C(CH3)2 |
1 record matched | | C2H5C(CH3)=CH2 + CH3C(O)OO(·) → CO2 + ·CH3 + 2-ethyl-2-methyl-oxirane |
1 record matched | | C2H5C(CH3)=CH2 → ·CH3 + ·CH2C(CH3)=CH2 |
1 record matched | | (CH3)2CHCH=CH2 + CH3C(O)OO(·) → CO2 + (1-methylethyl)oxirane + ·CH3 |
1 record matched | | (CH3)2CHCH=CH2 → ·CH3 + CH2=CHCH(·)CH3 |
1 record matched | | (CH3)3CCH=CH2 → ·CH3 + (CH3)2C(·)CH=CH2 |
3 records matched | | CD4 + ·CH3 → CH3D + CD3 |
2 records matched | | CBr4 + ·CH3 → CH3Br + CBr3 |
1 record matched | | CH3COF + ·OH → ·CH3 + FC(O)OH |
2 records matched | | CCl3CN + ·CH3 → Products |
4 records matched | | (CH3)2Zn → ·CH3 + CH3Zn |
2 records matched | | CH3NH-NHCH3 + ·CH3 → Other Products + CH4 |
1 record matched | | CH3NH-NHCH3 + ·CH3 → CH3NHN(·)CH3 + CH4 |
1 record matched | | C2H5OCH3 + ·CH3 → Other Products + CH4 |
1 record matched | | n-C3H7Cl + ·CH2 → ·CH3 + CH3CH2CHCl |
1 record matched | | 1,1-Dichloroacetone → CHCl2CO + ·CH3 |
1 record matched | | (CH3)2C=CHCH3 + CH3C(O)OO(·) → CO2 + ·CH3 + 2,2,3-trimethyl-oxirane |
1 record matched | | (CH3)2C=CHCH3 + ·CH3 → (CH3)2CHC(·)(CH3)2 |
2 records matched | | (CH3)2C=CHCH3 + ·CH3 → Other Products + CH4 |
5 records matched | | (CH3)2Cd → ·CH3 + CH3Cd |
1 record matched | | Oxetane + ·CH3 → Other Products + CH4 |
11 records matched | | (CH3N)2 + ·CH3 → CH4 + ·CH2N=NCH3 |
10 records matched | | (CH3N)2 + ·CH3 → Other Products + CH4 |
15 records matched | | (CH3N)2 → ·CH3 + ·CH3 + N2 |
15 records matched | | neo-C5H12 + ·CH3 → CH4 + Neopentyl |
15 records matched | | neo-C5H12 → tert-C4H9 + ·CH3 |
1 record matched | | neo-C5H12 → iso-C4H8 + ·CH3 + H· |
1 record matched | | H2C=C=O + ·CH2 → ·CH3 + HCCO |
6 records matched | | H2C=C=O + H· → CO + ·CH3 |
1 record matched | | H2C=C=O + ·OH → CO2 + ·CH3 |
1 record matched | | CH2=C=CH2 + ·OH → H2C=C=O + ·CH3 |
3 records matched | | CH2=C=CH2 + ·CH3 → CH3CH2C(·)=CH2 |
2 records matched | | CF3C(O)OCH3 + ·CH3 → Other Products + CH4 |
1 record matched | | (CH3CO)2 + ·CH3 → CH4 + H2C=C=O + CH3CO |
3 records matched | | (CH3CO)2 + ·CH3 → Acetone + CH3CO |
7 records matched | | (CH3CO)2 + ·CH3 → Other Products + CH4 |
1 record matched | | (CH3CO)2 + ·CH3 → Products |
1 record matched | | (CH3CO)2 + ·C2H5 → CH3C(O)C(O)C2H5 + ·CH3 |
1 record matched | | Propanal, pentafluoro- + ·CH3 → CH4 + Propyl,2,2,3,3,3-pentafluoro-1-oxo- |
1 record matched | | Thiirane + ·CH3 → C2H4 + CH3S· |
1 record matched | | Butanal, heptafluoro- + ·CH3 → CF3CF2CF2C(O)· + CH4 |
2 records matched | | C2HF3 + ·CH3 → CH3CHFCF2· |
2 records matched | | C2HF3 + ·CH3 → CH3CF2CHF· |
1 record matched | | CF3CCl3 + ·CH3 → CH3Cl + CF3CCl2 |
1 record matched | | CF2BrCl + ·CH3 → Products |
2 records matched | | 3-Fluorotoluene + H· → Fluorobenzene + ·CH3 |
1 record matched | | CH2N2 + H· → ·CH3 + N2 |
4 records matched | | N2H4 + ·CH3 → CH4 + NH2NH |
2 records matched | | Cyclopentane + ·CH3 → CH4 + Cyclopentyl |
1 record matched | | Bicyclo[2.1.1]hexane + ·CH3 → Other Products + CH4 |
5 records matched | | Aziridine + ·CH3 → CH4 + 1-Aziridinyl |
1 record matched | | Aziridine + ·CH3 → 2-Aziridinyl + CH4 |
1 record matched | | 1,3-Dimethoxybenzene → ·CH3 + 3-Methoxyphenoxy radical |
1 record matched | | 1,4-Dimethoxybenzene → ·CH3 + 4-Methoxyphenoxy radical |
1 record matched | | 4-Methoxyphenol → ·CH3 + 4-Hydroxyphenoxy |
1 record matched | | 3-Methoxyphenol → ·CH3 + 3-Hydroxyphenoxy |
2 records matched | | CH3CON(CH3)2 + ·CH3 → CH4 + CH3C(O)N(CH3)CH2· |
1 record matched | | C2Cl4 + ·CH3 → CH3Cl + CCl2=CCl |
2 records matched | | (CH3)2NH + ·CH3 → CH4 + (CH3)2N |
1 record matched | | (CH3)2NH + ·CH3 → Other Products + CH4 |
2 records matched | | (CH3)2NH → ·CH3 + CH3NH |
1 record matched | | CH3CH2CH2CHO + ·CH3 → CH4 + CH3CH2CH2CO |
1 record matched | | HCONHCH3 + ·CH3 → CH4 + Methyl, (Methylamino)oxo- |
2 records matched | | N,N-Dimethylbenzenamine → ·CH3 + Amidogen, methylphenyl- |
3 records matched | | 2-Propanone, 1,1,1,3,3,3-hexachloro- + ·CH3 → CH3Cl + CCl3C(O)CCl2· |
1 record matched | | CF3CF=CF2 + ·CH3 → CH3CF=CF2 + ·CF3 |
4 records matched | | C2F4 + ·CH3 → CH3CF2CF2· |
1 record matched | | CH3C(O)CH2OH → COCH2OH + ·CH3 |
1 record matched | | iso-C4H8 + O· → ·CH3 + CH3C(·)HCHO |
2 records matched | | iso-C4H8 + H· → CH3CH=CH2 + ·CH3 |
1 record matched | | iso-C4H8 + ·CH3 → (CH3)2C(·)CH2CH3 |
1 record matched | | iso-C4H8 + ·CH3 → Neopentyl |
6 records matched | | iso-C4H8 + ·CH3 → CH4 + ·CH2C(CH3)=CH2 |
1 record matched | | iso-C4H8 + ·CH3 → Other Products + CH4 |
1 record matched | | iso-C4H8 + ·CH3 → Adduct |
1 record matched | | iso-C4H8 + ·C2H → CH3CH=CHC≡CH + ·CH3 |
1 record matched | | iso-C4H8 + ·C2H → CH2=C(CH3)C≡CH + ·CH3 |
1 record matched | | iso-C4H8 → ·CH3 + CH2=C(·)CH3 |
1 record matched | | iso-C4H8 → ·CH2CH=CH2 + ·CH3 |
11 records matched | | (CH3)2O + ·CH3 → CH4 + CH3OCH2· |
15 records matched | | (CH3)2O → CH3O· + ·CH3 |
1 record matched | | CH3CH=CH2 + CH3C(O)OO(·) → Methyloxirane + CO2 + ·CH3 |
3 records matched | | CH3CH=CH2 + O· → ·CH3 + *CH2C(O)H |
1 record matched | | CH3CH=CH2 + O· → Other Products + ·CH3 |
2 records matched | | CH3CH=CH2 + ·F → CH2=CHF + ·CH3 |
1 record matched | | CH3CH=CH2 + BO → CH2=CHB=O + ·CH3 |
3 records matched | | CH3CH=CH2 + H· → C2H4 + ·CH3 |
1 record matched | | CH3CH=CH2 + ·OH → CH3CHO + ·CH3 |
2 records matched | | CH3CH=CH2 + Phenyl → Styrene + ·CH3 |
3 records matched | | CH3CH=CH2 + ·CH3 → iso-C4H9 |
4 records matched | | CH3CH=CH2 + ·CH3 → sec-C4H9 |
3 records matched | | CH3CH=CH2 + ·CH3 → CH4 + ·CH2CH=CH2 |
2 records matched | | CH3CH=CH2 + ·CH3 → Other Products + CH4 |
2 records matched | | CH3CH=CH2 + ·CH3 → Adduct |
1 record matched | | CH3CH=CH2 + ·C2H → Vinylacetylene + ·CH3 |
6 records matched | | CH3CH=CH2 → ·CH3 + C2H3 |
1 record matched | | CH3CH=CH2 → C2H4 + ·CH3 |
1 record matched | | n-C8H18 → ·CH3 + 1-C7H15 |
2 records matched | | Cyclohexane + ·CH3 → CH4 + Cyclohexyl |
1 record matched | | HCOOCH2CH2CH3 + ·CH3 → CH4 + ·C(O)OCH2CH2CH3 |
1 record matched | | n-C4H9CHO + ·CH3 → CH4 + CH3CH2CH2CH2CO· |
1 record matched | | 1-C6H14 + ·CH3 → Other Products + CH4 |
1 record matched | | 2,5-Hexanedione + ·CH3 → Other Products + CH4 |
5 records matched | | (tert-C4H9O)2 + ·CH3 → CH4 + (CH3)3COOC(CH3)2CH2 |
1 record matched | | HC(O)OC2H5 + ·CH3 → CH4 + CH3CH2OC(O)· |
1 record matched | | (C2H5)2NH + ·CH3 → CH4 + (C2H5)2N· |
1 record matched | | CH3CH=CHC2H5 + ·CH3 → Adduct |
1 record matched | | 1-C5H10 + ·CH3 → Adduct |
2 records matched | | n-C5H12 + ·CH3 → Other Products + CH4 |
1 record matched | | 2-Methylpyridine + ·CH3 → CH4 + Methyl, 2-pyridinyl- |
1 record matched | | 2-Methylpyridine → ·CH3 + 2-pyridinyl |
1 record matched | | Phenol + ·CH3 → CH4 + C6H5O |
1 record matched | | Toluene + ·F → Fluorobenzene + ·CH3 |
7 records matched | | Toluene + H· → Benzene + ·CH3 |
1 record matched | | Toluene + 2-Naphthalenyl → Naphthalene, 2-phenyl- + ·CH3 |
1 record matched | | Toluene + ·OH → Phenol + ·CH3 |
1 record matched | | Toluene + Phenyl → Biphenyl + ·CH3 |
7 records matched | | Toluene + ·CH3 → CH4 + Benzyl |
2 records matched | | Toluene + ·CH3 → Other Products + CH4 |
2 records matched | | Toluene → ·CH3 + Phenyl |
1 record matched | | Methylcyclohexane + ·CH3 → Other Products + CH4 |
1 record matched | | Methylcyclohexane → ·CH3 + Cyclohexyl |
5 records matched | | 1,3,5-Trimethylbenzene + H· → 1,3-Dimethylbenzene + ·CH3 |
1 record matched | | 1,3-Dimethylbenzene + ·OH → 3-Methylphenol + ·CH3 |
1 record matched | | 1,3-Dimethylbenzene + ·OH → 4-Methylphenol + ·CH3 |
1 record matched | | 1,3-Dimethylbenzene + ·OH → 2-Methylphenol + ·CH3 |
1 record matched | | 1,3-Dimethylbenzene + ·OH → methylphenol (unspecified isomer) + ·CH3 |
1 record matched | | 1,3-Dimethylbenzene + ·CH3 → CH4 + 3-Methylbenzyl |
2 records matched | | (iso-C3H7)2O + ·CH3 → CH4 + (CH3)2CHC(O)(CH3)2 |
1 record matched | | (iso-C3H7)2NH + ·CH3 → CH4 + (iso-C3H7)2N· |
2 records matched | | HC(O)OCH3 + ·CH3 → CH4 + CH3OC(·)(O) |
1 record matched | | HC(O)OCH3 → ·CH3 + HCOO |
1 record matched | | H2NCH2CH2NH2 + ·CH3 → Other Products + CH4 |
2 records matched | | H2NCH2CH2NH2 + ·CH3 → H2NCH(·)CH2NH2 + CH4 |
1 record matched | | H2NCH2CH2NH2 + ·CH3 → NH2CH2CH2NH + CH4 |
1 record matched | | C2H5CN + ·CH3 → CH4 + N=C-CH2CH2 |
3 records matched | | C2H5CN → ·CH3 + CH2CN |
1 record matched | | n-C3H7I + ·CH3 → CH3I + 1-C3H7 |
1 record matched | | CH2=CHCHO + CH3C(O)OO(·) → CH3C(O)CHO + CO2 + ·CH3 |
1 record matched | | CH3CH=CHCH3 + ·CH3 → CH4 + ·CH2CH=CHCH3 |
1 record matched | | CH3CH=CHCH3 → ·CH3 + CH3CH=C(·)H |
1 record matched | | 1-butyne + ·C2H → ·CH3 + CH3C≡CC≡CH |
1 record matched | | 1-butyne + ·C2H → CH2CCHCCH + ·CH3 |
3 records matched | | 1-butyne → ·CH3 + CH2C≡CH |
1 record matched | | 1,3-Butadiene + ·CH3 → CH4 + CH2=CHCH=CH· |
1 record matched | | 1,3-Butadiene + ·CH3 → Adduct |
1 record matched | | 1-C4H8 + O· → ·CH3 + CH3C(·)HCHO |
3 records matched | | 1-C4H8 + H· → CH3CH=CH2 + ·CH3 |
1 record matched | | 1-C4H8 + ·CH3 → Other Products + CH4 |
1 record matched | | 1-C4H8 + ·CH3 → Adduct |
1 record matched | | 1-C4H8 + ·C2H → CH2=CHCH2C≡CH + ·CH3 |
9 records matched | | 1-C4H8 → ·CH2CH=CH2 + ·CH3 |
4 records matched | | 1-C4H10 + ·CH3 → CH4 + 1-C4H9 |
4 records matched | | 1-C4H10 + ·CH3 → CH4 + sec-C4H9 |
7 records matched | | 1-C4H10 + ·CH3 → Other Products + CH4 |
1 record matched | | 1-C4H10 + ·CH3 → Products |
6 records matched | | 1-C4H10 → 1-C3H7 + ·CH3 |
1 record matched | | 1,4-Dimethylbenzene + ·OH → methylphenol (unspecified isomer) + ·CH3 |
1 record matched | | 1,4-Dimethylbenzene + ·CH3 → CH4 + 4-Methylbenzyl |
1 record matched | | 1,4-Dimethylbenzene → ·CH3 + 4-methylphenyl |
1 record matched | | 1,4-Dimethylbenzene → Benzyl + ·CH3 |
1 record matched | | Methylthiobenzene → ·CH3 + C6H5S |
1 record matched | | Methoxybenzene + ·CH3 → CH4 + C6H5OCH2 |
6 records matched | | Methoxybenzene → C6H5O + ·CH3 |
2 records matched | | N-Methylbenzenamine → ·CH3 + Phenyl amidogen |
1 record matched | | Ethylbenzene + ·CH3 → CH4 + 2-phenylethyl |
1 record matched | | Ethylbenzene + ·CH3 → CH4 + 1-phenylethyl |
11 records matched | | Ethylbenzene → Benzyl + ·CH3 |
1 record matched | | p-Cimene → ·CH3 + Ethyl, 1-(4-methylphenyl)- |
1 record matched | | 1-Phenylethanone + ·CH3 → Other Products + CH4 |
4 records matched | | 2-Phenylpropane → ·CH3 + 1-phenylethyl |
2 records matched | | Trichloromethyl benzene + ·CH3 → Dichloromethyl, phenyl- + CH3Cl |
3 records matched | | t-Butylbenzene → ·CH3 + 2-Phenyl-2-propyl radical |
1 record matched | | (C2H5)3B + ·CH3 → Borane, diethylmethyl- + ·C2H5 |
1 record matched | | (C2H5)3B + ·CH3 → Other Products + CH4 |
1 record matched | | Pyrrole, 1-methyl- → ·CH3 + 1H-Pyrrol-1-yl |
1 record matched | | Methylcyclopentane → ·CH3 + Cyclopentyl |
1 record matched | | sec-C4H9CHO + ·CH3 → Other Products + CH4 |
2 records matched | | 2-Fluorotoluene + H· → Fluorobenzene + ·CH3 |
1 record matched | | 1,2-Dimethylbenzene + ·OH → methylphenol (unspecified isomer) + ·CH3 |
1 record matched | | 1,2-Dimethylbenzene + ·CH3 → CH4 + 2-Methylbenzyl |
1 record matched | | 1,2-Dimethoxybenzene → ·CH3 + 2-Methoxyphenoxy radical |
1 record matched | | 2-Methoxyphenol → ·CH3 + 2-Hydroxyphenoxy radical |
2 records matched | | 2-nitropropane + ·CH3 → Products |
1 record matched | | (CH3)2CHCH(CH3)2 + ·CH3 → Other Products + CH4 |
2 records matched | | (CH3)2CHCH(CH3)2 → ·CH3 + (CH3)2CHCH(·)CH3 |
2 records matched | | CH3C(O)OCH3 + ·CH3 → CH4 + ·CH2C(O)OCH3 |
2 records matched | | CH3C(O)OCH3 + ·CH3 → CH4 + CH3C(O)OCH2· |
2 records matched | | CH3C(O)OCH3 + ·CH3 → Other Products + CH4 |
1 record matched | | CH3C(O)OCH3 → ·CH3 + CH3C(O)O |
1 record matched | | CH3C(O)OCH3 → CO2 + ·CH3 + ·CH3 |
1 record matched | | CH3C(O)OCH3 → CH3OCO + ·CH3 |
1 record matched | | CH3C(O)CHO + ·CH3 → Other Products + CH4 |
1 record matched | | C2H5COCH3 + ·CH3 → C2H5C(CH3)2O(·) |
1 record matched | | (CH3)2CHCHO + ·CH3 → CH4 + (CH3)2CHC=O |
1 record matched | | iso-C4H9OH → ·CH3 + CH3CH(·)CH2OH |
1 record matched | | iso-C3H7CN → ·CH3 + CH3CHCN |
1 record matched | | (C2H5O)4Si → (.)CH2OSi(OC2H5)3 + ·CH3 |
1 record matched | | CF3CF2Cl + ·CH3 → CH3Cl + C2F5 |
1 record matched | | CFCl2CF2Cl + ·CH3 → Other Products + CH3Cl |
2 records matched | | CF3CHO + ·CH3 → CH4 + CF3C(O) |
1 record matched | | CH3SiCl3 + ·CH3 → CH4 + Cl3SiCH2· |
1 record matched | | CH3SiCl3 → ·CH3 + SiCl3 |
1 record matched | | (CH3)2SiCl2 + ·CH3 → CH4 + CH3Cl2SiCH2· |
1 record matched | | (CH3)3SiCl + ·CH3 → CH4 + (CH3)2SiClCH2 |
5 records matched | | (CH3)4Si + ·CH3 → CH4 + (CH3)3SiCH2 |
3 records matched | | (CH3)4Si → ·CH3 + (CH3)3Si· |
1 record matched | | (CH3)4Pb + ·CH3 → CH4 + (CH3)3PbCH2 |
1 record matched | | CF3Cl + ·CH3 → CH3Cl + ·CF3 |
2 records matched | | CF2Cl2 + ·CH3 → CH3Cl + ·CClF2 |
3 records matched | | CFCl3 + ·CH3 → CH3Cl + ·CCl2F |
1 record matched | | tert-C4H9SH + ·CH3 → CH4 + (CH3)3CS· |
4 records matched | | CF3Br + ·CH3 → CH3Br + ·CF3 |
1 record matched | | CCl3Br + ·CH3 → CH3Cl + BrCCl2 |
3 records matched | | CCl3Br + ·CH3 → CH3Br + ·CCl3 |
2 records matched | | CF2Br2 + ·CH3 → CH3Br + CBrF2 |
1 record matched | | Methyloxirane → ·CH3 + *CH2C(O)H |
1 record matched | | Methyloxirane → ·CH3 + CH3CO |
2 records matched | | CH3NO2 + H· → ·CH3 + HNO2 |
2 records matched | | CH3NO2 + ·CH3 → CH4 + CH2NO2 |
15 records matched | | CH3NO2 → ·CH3 + NO2 |
1 record matched | | (CH3)3N + ·CH3 → CH4 + CH2N(CH3)2 |
1 record matched | | CHF2Cl + ·CH3 → CH4 + ·CClF2 |
2 records matched | | CH2=CF2 + ·CH3 → CH3CF2CH2(·) |
1 record matched | | iso-C3H7SH + ·CH3 → CH4 + (CH3)2CHS |
1 record matched | | iso-C3H7I + ·CH3 → CH3I + iso-C3H7 |
2 records matched | | iso-C4H10 + N + N → iso-C3H7 + ·CH3 + N2 |
2 records matched | | iso-C4H10 + ·CH3 → CH4 + tert-C4H9 |
6 records matched | | iso-C4H10 + ·CH3 → Other Products + CH4 |
17 records matched | | iso-C4H10 → iso-C3H7 + ·CH3 |
1 record matched | | Oxirane + ·CH3 → CH4 + Oxiranyl |
2 records matched | | Oxirane → ·CH3 + HCO |
1 record matched | | (CH3)2S + ·Cl → ·CH3 + CH3SCl |
6 records matched | | (CH3)2S + O· → ·CH3 + CH3SO |
1 record matched | | (CH3)2S + OD → CH3SOD + ·CH3 |
1 record matched | | (CH3)2S + H· → CH3SH + ·CH3 |
1 record matched | | (CH3)2S + ·CH3 → CH4 + CH3SCH2 |
1 record matched | | (CH3)2S → ·CH3 + CH3S· |
3 records matched | | HCONH2 + ·CH3 → CH4 + C(O)NH2 |
1 record matched | | HCONH2 + ·CH3 → Other Products + CH4 |
1 record matched | | CH2I2 + ·CH3 → CH3I + ·CH2I |
1 record matched | | CH2Cl2 + ·CH3 → CH4 + CHCl2 |
1 record matched | | C2H5SH + ·CH3 → CH4 + CH3CH2S |
1 record matched | | C2H5SH + ·CH3 → Other Products + CH4 |
2 records matched | | CH3CHO + H· → CO + H2 + ·CH3 |
1 record matched | | CH3CHO + CH3S· → CH3SH + CO + ·CH3 |
1 record matched | | CH3CHO + ·OH → HCOOH + ·CH3 |
1 record matched | | CH3CHO + ·CH → H2C=C=O + ·CH3 |
1 record matched | | CH3CHO + ·CH3 → CH4 + CH3CO |
1 record matched | | CH3CHO + ·CH3 → CH4 + CH2=CHO· |
1 record matched | | CH3CHO + ·CH3 → CH4 + *CH2C(O)H |
14 records matched | | CH3CHO + ·CH3 → CH4 + CH3CO |
2 records matched | | CH3CHO + ·CH3 → Acetone + H· |
14 records matched | | CH3CHO → ·CH3 + HCO |
1 record matched | | CH3CHO → CO + ·CH3 + H· |
1 record matched | | CH3CN + H· → HCN + ·CH3 |
1 record matched | | CH3CN + ·CH3 → CH4 + CH2CN |
2 records matched | | C2H5NH2 + ·CH3 → CH4 + CH3CH2NH· |
1 record matched | | C2H5NH2 + ·CH3 → CH4 + CH3CHNH2 |
1 record matched | | C2H5NH2 + ·CH3 → Other Products + CH4 |
1 record matched | | C2H5I + ·CH3 → CH3I + ·C2H5 |
2 records matched | | CH2=CHF + O· → FCO + ·CH3 |
2 records matched | | CH2=CHF + ·CH3 → CH3CH2CHF(·) |
2 records matched | | CH2=CHF + ·CH3 → CH3CHFCH2 |
2 records matched | | CH2=CHCl + O· → ·CH3 + ClCO |
2 records matched | | CH2=CHCl + ·CH3 → CH3CH2CHCl |
1 record matched | | C2H5Cl + ·CH2 → ·CH3 + CH2CH2Cl |
1 record matched | | CH3CCH + O· → ·CH3 + HCCO |
8 records matched | | CH3CCH + H· → C2H2 + ·CH3 |
1 record matched | | CH3CCH + ·CH3 → CH3CH=C(·)CH3 |
2 records matched | | CH3CCH + ·C2H → 1,3-Butadiyne + ·CH3 |
1 record matched | | C3H8 + ·CH2 → 1-C3H7 + ·CH3 |
5 records matched | | C3H8 + ·CH3 → CH4 + 1-C3H7 |
1 record matched | | C3H8 + ·CH3 → CH4 + iso-C3H7 |
1 record matched | | C3H8 + ·CH3 → Other Products + CH4 |
8 records matched | | C3H8 + ·CH3 → Products |
20 records matched | | C3H8 → ·C2H5 + ·CH3 |
1 record matched | | CH3SH + H· → ·CH3 + H2S |
1 record matched | | CH3SH + ·CH3 → CH4 + CH3S· |
3 records matched | | CH3NH2 + ·CH3 → CH4 + CH3NH |
2 records matched | | CH3NH2 + ·CH3 → CH4 + CH2NH2 |
1 record matched | | CH3NH2 + ·CH3 → Other Products + CH4 |
5 records matched | | CH3NH2 → ·CH3 + NH2 |
2 records matched | | CH3I + O· → ·CH3 + IO |
3 records matched | | CH3I + ·F → ·CH3 + IF |
3 records matched | | CH3I + I → ·CH3 + I2 |
5 records matched | | CH3I + H· → ·CH3 + HI |
1 record matched | | CH3I + Cu → ·CH3 + CuI |
1 record matched | | CH3I + Na → ·CH3 + NaI |
1 record matched | | CH3I + K → ·CH3 + KI |
10 records matched | | CH3I → ·CH3 + I |
1 record matched | | CH3Cl + (CH3)3Si· → (CH3)3SiCl + ·CH3 |
1 record matched | | CH3Cl + BF → ·CH3 + ClBF |
4 records matched | | CH3Cl + H· → ·CH3 + HCl |
1 record matched | | CH3Cl + Ca → ·CH3 + CaCl |
1 record matched | | CH3Cl + Cu → ·CH3 + CuCl |
2 records matched | | CH3Cl + Cs → ·CH3 + CsCl |
3 records matched | | CH3Cl + Na → ·CH3 + NaCl |
2 records matched | | CH3Cl + Rb → ·CH3 + RbCl |
1 record matched | | CH3Cl + K → ·CH3 + KCl |
1 record matched | | CH3Cl + Pb → ·CH3 + PbCl |
2 records matched | | CH3Cl + ·CH3 → CH4 + ·CH2Cl |
7 records matched | | CH3Cl → ·CH3 + ·Cl |
1 record matched | | C2H2 + ·OH → CO + ·CH3 |
4 records matched | | C2H2 + ·CH3 → CH3CH=C(·)H |
1 record matched | | C2H2 + ·CH3 → ·CH2CH=CH2 |
2 records matched | | C2H2 + ·CH3 → CH2=C=CH2 + H· |
4 records matched | | C2H2 + ·CH3 → CH3CCH + H· |
1 record matched | | C2H2 + ·CH3 → Products |
11 records matched | | C2H4 + N → HCN + ·CH3 |
12 records matched | | C2H4 + O· → ·CH3 + HCO |
6 records matched | | C2H4 + ·CH3 → 1-C3H7 |
1 record matched | | C2H4 + ·CH3 → CH3CH=CH2 + H· |
7 records matched | | C2H4 + ·CH3 → CH4 + C2H3 |
1 record matched | | C2H4 + ·CH3 → Products |
1 record matched | | C2H4 + ·C2H5 → CH3CH=CH2 + ·CH3 |
1 record matched | | C2H6 + ·CH2 → ·C2H5 + ·CH3 |
1 record matched | | C2H6 + H· → CH4 + ·CH3 |
1 record matched | | C2H6 + ·CH → C2H4 + ·CH3 |
9 records matched | | C2H6 + ·CH3 → CH4 + ·C2H5 |
48 records matched | | C2H6 → ·CH3 + ·CH3 |
1 record matched | | CH3Br + SiCl3 → ·CH3 + Silane, bromotrichloro- |
1 record matched | | CH3Br + D → ·CH3 + DBr |
5 records matched | | CH3Br + H· → ·CH3 + HBr |
1 record matched | | CH3Br + Cu → ·CH3 + CuBr |
1 record matched | | CH3Br + Cs → ·CH3 + CsBr |
2 records matched | | CH3Br + Na → ·CH3 + NaBr |
2 records matched | | CH3Br + Rb → ·CH3 + RbBr |
2 records matched | | CH3Br + K → ·CH3 + KBr |
1 record matched | | CH3Br + Pb → ·CH3 + Lead bromide |
1 record matched | | CH3Br + ·CH3 → CH4 + ·CH2Br |
1 record matched | | CH3Br → ·CH3 + Br· |
2 records matched | | CH4 + CCCN → HCCCN + ·CH3 |
2 records matched | | CH4 + ·CH2 → ·CH3 + ·CH3 |
1 record matched | | CH4 + CF3CF → ·CH3 + CF3CHF |
64 records matched | | CH4 + ·Cl → ·CH3 + HCl |
9 records matched | | CH4 + CF3O → CF3OH + ·CH3 |
24 records matched | | CH4 + O· → ·CH3 + ·OH |
5 records matched | | CH4 + D → ·CH3 + HD |
1 record matched | | CH4 + (CH3)3Si· → (CH3)3SiH + ·CH3 |
1 record matched | | CH4 + SiF3 → ·CH3 + SiHF3 |
30 records matched | | CH4 + ·F → ·CH3 + HF |
1 record matched | | CH4 + AlO → ·CH3 + AlOH |
3 records matched | | CH4 + I → ·CH3 + HI |
1 record matched | | CH4 + NH → ·CH3 + NH2 |
5 records matched | | CH4 + NH2 → ·CH3 + NH3 |
2 records matched | | CH4 + OD → ·CH3 + HDO |
2 records matched | | CH4 + H· → ·CH3 + H· |
29 records matched | | CH4 + H· → H2 + ·CH3 |
1 record matched | | CH4 + NO2 → ·CH3 + HNO2 |
7 records matched | | CH4 + Br· → ·CH3 + HBr |
2 records matched | | CH4 + O2 → ·CH3 + HO2 |
1 record matched | | CH4 + F2 → ·CH3 + HF + ·F |
1 record matched | | CH4 + S → ·CH3 + SH |
1 record matched | | CH4 + Si → ·CH3 + SiH |
1 record matched | | CH4 + Kr → ·CH3 + Kr + H· |
62 records matched | | CH4 + ·OH → ·CH3 + H2O |
2 records matched | | CH4 + HO2 → ·CH3 + H2O2 |
4 records matched | | CH4 + ·CCl3 → CHCl3 + ·CH3 |
1 record matched | | CH4 + n-C3F7 → ·CH3 + C2F5CF2H |
2 records matched | | CH4 + ·CHF2 → CH2F2 + ·CH3 |
3 records matched | | CH4 + Phenyl → Benzene + ·CH3 |
2 records matched | | CH4 + ·CF3 → CHF3 + ·CH3 |
1 record matched | | CH4 + ·CH3 → C2H6 + H· |
2 records matched | | CH4 + ·CH3 → CH4 + ·CH3 |
1 record matched | | CH4 + ·CF2 → ·CH3 + ·CHF2 |
1 record matched | | CH4 + CH3O· → CH3OH + ·CH3 |
10 records matched | | CH4 + ·C2H → C2H2 + ·CH3 |
4 records matched | | CH4 + CD3 → CHD3 + ·CH3 |
1 record matched | | CH4 + ·C2H5 → C2H6 + ·CH3 |
31 records matched | | CH4 → ·CH3 + H· |
2 records matched | | Benzene + ·CH3 → Cyclohexadienyl, 6-methyl- |
3 records matched | | Benzene + ·CH3 → CH4 + Phenyl |
1 record matched | | n-C4H9OH → ·CH3 + HOCH2CH2CH2· |
1 record matched | | HCON(CH3)2 + ·CH3 → Other Products + CH4 |
3 records matched | | CCl3CCl3 + ·CH3 → CH3Cl + C2Cl5 |
1 record matched | | (CH3)2SO2 → ·CH3 + CH3S(O)2 |
1 record matched | | (CH3)2SO + ·OH → ·CH3 + CH3S(O)OH |
1 record matched | | (CH3)2SO + ·CH3 → Products |
1 record matched | | CHCl3 + ·CH3 → CH4 + ·CCl3 |
1 record matched | | Acetone + ·Cl → CH3COCl + ·CH3 |
3 records matched | | Acetone + ·OH → CH3C(O)OH + ·CH3 |
2 records matched | | Acetone + ·CH3 → (CH3)3CO· |
26 records matched | | Acetone + ·CH3 → CH4 + CH3C(O)CH2(·) |
7 records matched | | Acetone → ·CH3 + CH3CO |
1 record matched | | iso-C3H7OH + ·CH3 → Other Products + CH4 |
1 record matched | | CH3ONH2 + ·CH3 → Other Products + CH4 |
3 records matched | | CH3OH + N → ·CH3 + HNO |
1 record matched | | CH3OH + Kr → ·CH3 + ·OH + Kr |
2 records matched | | CH3OH + ·CH3 → CH4 + (·)CH2OH |
2 records matched | | CH3OH + ·CH3 → CH4 + CH3O· |
5 records matched | | CH3OH + ·CH3 → Other Products + CH4 |
11 records matched | | CH3OH → ·CH3 + ·OH |
1 record matched | | CH3C(O)OH + ·OH → CO2 + ·CH3 + H2O |
3 records matched | | C2H5OH + ·CH3 → CH4 + CH3CH(·)OH |
1 record matched | | C2H5OH + ·CH3 → CH4 + CH3CH2O· |
1 record matched | | C2H5OH + ·CH3 → Other Products + CH4 |
6 records matched | | C2H5OH → ·CH3 + (·)CH2OH |
1 record matched | | CH3NHNH2 + ·CH3 → Other Products + CH4 |
1 record matched | | (C2H5)2O + ·CH3 → CH4 + 2-C4H9O |
1 record matched | | (C2H5)2O + ·CH3 → Other Products + CH4 |
1 record matched | | (CH3)2NNH2 + ·CH3 → CH4 + Hydrazyl, 2,2-dimethyl- |
2 records matched | | (CH3)2NNH2 + ·CH3 → Other Products + CH4 |
1 record matched | | CN + CH3CH=CH2 → CH2CHCN + ·CH3 |
16 records matched | | CN + CH4 → HCN + ·CH3 |
5 records matched | | CCl4 + ·CH3 → CH3Cl + ·CCl3 |
6 records matched | | CH2O + ·CH3 → CH4 + HCO |
1 record matched | | Cl(2P3/2) + CH4 → ·CH3 + HCl |
1 record matched | | O(1D) + CH3Cl → ·CH3 + ClO |
1 record matched | | O(1D) + C2H4 → ·CH3 + HCO |
1 record matched | | O(1D) + CH3Br → ·CH3 + BrO |
6 records matched | | O(1D) + CH4 → ·CH3 + ·OH |
1 record matched | | (CH3)2NND2 + ·CH3 → (CH3)2NN(D)· + CH3D |
1 record matched | | (CH3)2NND2 + ·CH3 → ·CH2N(CH3)ND2 + CH4 |
1 record matched | | (CH3)2C(·)CH2C(CH3)2CH2CH3 + ·CH3 → CH4 + 2,4,4-Trimethyl-1-hexene |
1 record matched | | ·CHFCF2Cl + ·CH3 → CF3CHClCH3 |
1 record matched | | ·CHFCF2Cl + ·CH3 → CH3CF=CF2 + HCl |
1 record matched | | ·CHFCF2Cl + ·CH3 → CF2ClCH=CH2 + HF |
1 record matched | | 2,5-Cyclohexadien-1-one, 4-methyl- + ·CH3 → CH4 + Phenoxy, 4-methyl- |
1 record matched | | Aziridine-1-d + ·CH3 → 2-Aziridinyl + CH3D |
1 record matched | | Aziridine-1-d + ·CH3 → 2-Aziridinyl-1-d + CH4 |
1 record matched | | CH3CH2CH2CHO → ·CH3 + ·CH2CH2CHO |
1 record matched | | M + ·CH3 → M + H· + ·CH2 |
1 record matched | | M + ·CH3 → M + H2 + ·CH |
1 record matched | | M + CH3CH2O· → CH2O + ·CH3 |
1 record matched | | M + CH4 → M + ·CH3 + H· |
2 records matched | | OCH(CH3)2 → CH3CHO + ·CH3 |
1 record matched | | O(3P) + C3H8 → CH3CH2O· + ·CH3 |
1 record matched | | O(3P) + C3H8 → CH3CHO + ·CH3 + H· |
1 record matched | | O(3P) + C2H6 → CH3O· + ·CH3 |
1 record matched | | O(3P) + CH4 → ·CH3 + ·OH |
1 record matched | | O(1D) + CH4 → ·CH3 + ·OH |
1 record matched | | ·CH(OH)C(O)CH3 + O2 → HCOOH + CO2 + ·CH3 |
1 record matched | | CH2=C(·)CH2CH3 → CH2=C=CH2 + ·CH3 |
2 records matched | | CH3CHOCH2CH3 → C2H5CHO + ·CH3 |
3 records matched | | CH3CH2C(CH3)2O(·) → C2H5COCH3 + ·CH3 |
2 records matched | | S(1D) + C2H4 → ·CH3 + HC=S |
1 record matched | | 6-hydroxy-1,2,3,4,5,6-hexamethylcyclohexa-2,4-dien-1-yl → ·CH3 + 2,3,4,5,6-pentamethylphenol |
1 record matched | | CH3C(O)CHCl· → ·CH3 + CHCl=C=O |
1 record matched | | CH3CH2CH2CH(·)CH(CH3)2 → ·CH3 + (Z)-2-C6H12 |
1 record matched | | (CH3)2C(O·)CH2CH2CH3 → n-C3H7C(O)CH3 + ·CH3 |
2 records matched | | CH3CH2CH2CH(CH3)CH2· → 1-C5H10 + ·CH3 |
1 record matched | | 5-isopropylcyclopenta-1,3-diene → Toluene + ·CH3 |
1 record matched | | 2-tert-butylcyclopenta-1,3-diene → 2-isopropylcyclopenta-1,3-diene + ·CH3 |
1 record matched | | 1-tert-butylcyclopenta-1,3-diene → 1-isopropylcyclopenta-1,3-diene + ·CH3 |
2 records matched | | CH2(1) + H2 → ·CH3 + H· |
1 record matched | | C2H5OCHO·CH3 → HC(O)OC2H5 + ·CH3 |
1 record matched | | O2(X3Sigma_g-) + C2H3 → CO2 + ·CH3 |
1 record matched | | CH3OBH* → ·CH3 + HBO |
2 records matched | | CH3CHBrO(·) → ·CH3 + HC(O)Br |
1 record matched | | CH3SO3 → ·CH3 + SO3 |
2 records matched | | In(CH3)2 → InCH3(singlet) + ·CH3 |
2 records matched | | In(CH3)2 → InCH3(triplet) + ·CH3 |
2 records matched | | 3-C8H17 → 1-C7H14 + ·CH3 |
1 record matched | | CH3(CH2)6CH(·)C2H5 → 1-C9H18 + ·CH3 |
1 record matched | | (CH3)2Ga → ·CH3 + CH3Ga |
1 record matched | | 2-Azido-N,N-Dimethylethanamine → CH3N(·)CH2CH2N3 + ·CH3 |
2 records matched | | (CH3)2C(CH2OOH)CH2· → ·CH3 + 2-Methyl-2-propenylhydroperoxide |
1 record matched | | CH3SSCH2 → cyc-CH2SS + ·CH3 |
2 records matched | | 2,3-Dihydro-1-methylinden-2-yl → Indene + ·CH3 |
1 record matched | | Cyclohexadienyl, 6-methyl- → Benzene + ·CH3 |
1 record matched | | CH2=CHCH(·)CH3 → CH2=C=CH2 + ·CH3 |
1 record matched | | ·CH2CH=CHCH2CH3 → 1,3-Butadiene + ·CH3 |
3 records matched | | CH2=CHCH(CH3)CH2· → 1,3-Butadiene + ·CH3 |
1 record matched | | CH3NH → ·CH3 + NH |
1 record matched | | 2-Methoxyphenoxy radical → o-Benzoquinone + ·CH3 |
1 record matched | | Silyl, dichloromethyl- → ·CH3 + SiCl2 |
2 records matched | | CH3OF → ·CH3 + OF |
2 records matched | | Oxiranyl → CO + ·CH3 |
1 record matched | | CH3SCH2 → CH2S + ·CH3 |
1 record matched | | CH2=C(OH)CH3 → ·CH3 + CH3CO |
1 record matched | | (CH3)2CHC(O)(CH3)2 → 3-methyl-2-butanone + ·CH3 |
1 record matched | | CH3CH2CH(CH3)O· → C2H5CHO + ·CH3 |
2 records matched | | (CH3)3CCH(CH3)CH2· → (CH3)3CCH=CH2 + ·CH3 |
1 record matched | | (CH3)3CC(CH3)2CH2 → (CH3)3CC(CH3)=CH2 + ·CH3 |
1 record matched | | 4-C7H15 → 1-C6H12 + ·CH3 |
1 record matched | | (CH3)2CHCH(CH3)CH(·)CH3 → (Z)-(CH3)2CHCH=CHCH3 + ·CH3 |
3 records matched | | 3-C7H15 → 1-C6H12 + ·CH3 |
1 record matched | | 4-C8H17 → 1-C7H14 + ·CH3 |
2 records matched | | 3-hexyl radical → 1-C5H10 + ·CH3 |
2 records matched | | C6H5CH(·)CH2CH3 → Styrene + ·CH3 |
3 records matched | | CH2=CHCH(·)CH2CH3 → 1,3-Butadiene + ·CH3 |
1 record matched | | CH3OCH2· + O· → HCOOH + ·CH3 |
7 records matched | | CH3OCH2· → CH2O + ·CH3 |
1 record matched | | CH3CH2C(·)=CH2 → CH2=C=CH2 + ·CH3 |
7 records matched | | CH3OC(·)(O) → CO2 + ·CH3 |
1 record matched | | CH3CO → CO + ·CH3 |
1 record matched | | CH3C(O)CH(·)CH3 → ·CH3 + CH3CH=C=O |
4 records matched | | ·CH2C(CH3)=CH2 → CH2=C=CH2 + ·CH3 |
1 record matched | | CH3CH2S → CH2S + ·CH3 |
2 records matched | | CH3C(O)O → CO2 + ·CH3 |
1 record matched | | NH2 + CH3Ga → GaNH2 + ·CH3 |
1 record matched | | C2H5C(CH3)2O(·) → C2H5COCH3 + ·CH3 |
1 record matched | | H· + ·CH2 → ·CH3 |
1 record matched | | SiHCl3 + ·CH2 → ·CH3 + SiCl3 |
1 record matched | | HCl + ·CH2 → ·CH3 + ·Cl |
1 record matched | | C + PH3 → ·CH3 + P |
1 record matched | | ·CH2CH(CH3)CH2CH3 → 1-C4H8 + ·CH3 |
1 record matched | | 3-Methoxypyridine → CO + ·CH3 + 1H-Pyrrol-1-yl |
1 record matched | | CH3S· + O2 → ·CH3 + SO2 |
1 record matched | | HOCH2CH2CH2· → CH2=CHOH + ·CH3 |
1 record matched | | 4-Methoxyphenoxy radical → 1,4-Benzoquinone + ·CH3 |
2 records matched | | CH3CH=C(·)H → C2H2 + ·CH3 |
3 records matched | | CH3S(O)2 → ·CH3 + SO2 |
6 records matched | | iso-C4H9 → CH3CH=CH2 + ·CH3 |
2 records matched | | 1-C8H17 → 1-C7H14 + ·CH3 |
1 record matched | | *CH2C(O)H → CO + ·CH3 |
2 records matched | | (CH3)2C(·)CH2CH3 → iso-C4H8 + ·CH3 |
1 record matched | | (E)-CH3N=NCH3 → ·CH3 + ·CH3 + N2 |
3 records matched | | i-C3H7O → CH3CHO + ·CH3 |
2 records matched | | Neopentyl + O2 → ·CH3 + 2-Methyl-2-propenylhydroperoxide |
6 records matched | | Neopentyl → iso-C4H8 + ·CH3 |
1 record matched | | 2-C7H15 → 1-C6H12 + ·CH3 |
3 records matched | | In(CH3)3 → ·CH3 + In(CH3)2 |
1 record matched | | 1-C7H15 → 1-C6H12 + ·CH3 |
1 record matched | | ·CH + NH3 → ·CH3 + NH |
1 record matched | | 2-C8H17 → 1-C7H14 + ·CH3 |
1 record matched | | CH3CO + O· → CO2 + ·CH3 |
1 record matched | | CH3CO + NO2 → CO2 + ·CH3 + NO |
6 records matched | | CH3CO → CO + ·CH3 |
9 records matched | | (CH3)3CO· → Acetone + ·CH3 |
1 record matched | | CH3C(O)CH2(·) → H2C=C=O + ·CH3 |
1 record matched | | (CH3)2CHCH(·)CH3 → CH3CH=CHCH3 + ·CH3 |
1 record matched | | 1-hexyl radical → 1-C5H10 + ·CH3 |
1 record matched | | 1-C5H11 → 1-C4H8 + ·CH3 |
1 record matched | | C2H3 + O· → CO + ·CH3 |
1 record matched | | C2H3 + O2 → CO2 + ·CH3 |
2 records matched | | C2H3 + ·OH → ·CH3 + HCO |
1 record matched | | C2H3 + ·OH → CO + ·CH3 + H· |
1 record matched | | 2-hexyl radical → 1-C5H10 + ·CH3 |
6 records matched | | sec-C4H9 → CH3CH=CH2 + ·CH3 |
1 record matched | | 4-Methylbenzyl → ·CH3 + 1,3-Cyclopentadiene, 5-ethenylidene- |
1 record matched | | 2-Methylbenzyl → ·CH3 + 1,3-Cyclopentadiene, 5-ethenylidene- |
1 record matched | | 3-Methylbenzyl → ·CH3 + 1,3-Cyclopentadiene, 5-ethenylidene- |
1 record matched | | CH3CH(·)OH + O· → HCOOH + ·CH3 |
2 records matched | | CH3CH(·)OH + H· → ·CH3 + (·)CH2OH |
5 records matched | | CH3CH(·)OH → CH2O + ·CH3 |
1 record matched | | CH3C(O)OONO2 → CO2 + ·CH3 + NO3 |
1 record matched | | ·CH3 + 1,3-Cyclopentadiene, 5-ethynyl- → fulvallenyl + CH4 |
2 records matched | | ·CH3 + In(CH3)2 → In(CH3)3 |
1 record matched | | ·CH3 + AlH(CH3) → AlH(CH3)2 |
1 record matched | | ·CH3 + cis-2,cis-5-heptadiene → CH3CH=CHCH(·)CH=CHCH3 + CH4 |
1 record matched | | ·CH3 + cis-2,cis-5-heptadiene → (5Z)(·)CH2CH=CHCH2CH=CHCH3 + CH4 |
1 record matched | | ·CH3 + SiHCl2 → CH4 + SiCl2 |
1 record matched | | ·CH3 + ·CH2 → ·C2H5 |
1 record matched | | ·CH3 + ·CH2 → C2H4 + H· |
1 record matched | | ·CH3 + CH2=NCH2 → CH3CH2N=CH2 |
1 record matched | | ·CH3 + CH2=CHNH → CH3CH2CH=NH |
1 record matched | | ·CH3 + CH2=CHNH → CH3NHCH=CH2 |
1 record matched | | ·CH3 + (2E,5E)-2,5-Heptadiene → CH3CH=CHCH(·)CH=CHCH3 + CH4 |
1 record matched | | ·CH3 + (2E,5E)-2,5-Heptadiene → (5E)(·)CH2CH=CHCH2CH=CHCH3 + CH4 |
1 record matched | | ·CH3 + CH3SS → (CH3S)2 |
1 record matched | | ·CH3 + 1,3-Cyclopentadiene, 5-ethenylidene- → fulvallenyl + CH4 |
1 record matched | | ·CH3 + CH3N=NH → CH4 + CH3N=N |
1 record matched | | ·CH3 + CH3CHNHCH2CH3 → Other Products + CH4 |
1 record matched | | ·CH3 + DCOOCH3 → CH4 + ·CH2C(O)OD |
2 records matched | | ·CH3 + ·Cl → HCl + ·CH2 |
1 record matched | | ·CH3 + SiCl3 → SiHCl3 + ·CH2 |
1 record matched | | ·CH3 + SiCl3 → CH3SiCl3 |
1 record matched | | ·CH3 + SiCl3 → CH3Cl + SiCl2 |
1 record matched | | ·CH3 + 3,5-dimethylbenzyl radical → Benzene, 1-ethyl-3,5-dimethyl- |
1 record matched | | ·CH3 + N → H· + H2C=N |
2 records matched | | ·CH3 + N → Products |
1 record matched | | ·CH3 + N → trans-HCNH + H· |
1 record matched | | ·CH3 + N → H2NC + H· |
1 record matched | | ·CH3 + O· → CH3O· |
1 record matched | | ·CH3 + O· → H2 + HCO |
1 record matched | | ·CH3 + O· → CO + H2 + H· |
3 records matched | | ·CH3 + O· → CH2O + H· |
2 records matched | | ·CH3 + O· → Products |
1 record matched | | ·CH3 + D → CH3D |
1 record matched | | ·CH3 + (CH3)3Si· → (CH3)4Si |
1 record matched | | ·CH3 + ·CH2I → C2H5I |
1 record matched | | ·CH3 + CH3CH2CO → C2H5COCH3 |
1 record matched | | ·CH3 + BrO → CH3OBr |
1 record matched | | ·CH3 + (CH3)2N → CH4 + CH2=NCH3 |
1 record matched | | ·CH3 + ClO → CH3OCl |
1 record matched | | ·CH3 + ·F → ·CH2F + H· |
1 record matched | | ·CH3 + ·F → H2 + ·CHF |
1 record matched | | ·CH3 + ·F → CH3F |
1 record matched | | ·CH3 + ·F → CH2(X3B_1) + HF |
1 record matched | | ·CH3 + ·F → CH_2(aA_1) + HF |
1 record matched | | ·CH3 + HNO → CH3NO + H· |
2 records matched | | ·CH3 + HNO → CH4 + NO |
2 records matched | | ·CH3 + HD → CH3D + H· |
2 records matched | | ·CH3 + HD → CH4 + D |
1 record matched | | ·CH3 + SH → CH3SH |
18 records matched | | ·CH3 + NH2 → CH4 + NH |
1 record matched | | ·CH3 + NH2NH → CH3NHNH2 |
1 record matched | | ·CH3 + SiCl2 → Silyl, dichloromethyl- |
2 records matched | | ·CH3 + DBr → CH3D + Br· |
1 record matched | | ·CH3 + SiHF3 → CH4 + SiF3 |
1 record matched | | ·CH3 + (E)-3-C6H12 → CH3CH2CH=CHCH2CH2· + CH4 |
1 record matched | | ·CH3 + (E)-3-C6H12 → CH3CH2CH=CHCH(·)CH3 + CH4 |
1 record matched | | ·CH3 + (E)-3-C6H12 → CH3CH2CH=C(·)CH2CH3 + CH4 |
2 records matched | | ·CH3 + H· → H2 + ·CH2 |
13 records matched | | ·CH3 + H· → CH4 |
1 record matched | | ·CH3 + OF → CH3OF |
1 record matched | | ·CH3 + 2-Naphthalenyl → 2-Methylnaphthalene |
1 record matched | | ·CH3 + NO2 → HNO2 + ·CH2 |
1 record matched | | ·CH3 + NO2 → CH3O· + NO |
1 record matched | | ·CH3 + NO2 → CH3ONO |
2 records matched | | ·CH3 + NO2 → CH3NO2 |
1 record matched | | ·CH3 + NO2 → CH2O + HNO |
1 record matched | | ·CH3 + NO2 → trans-HONO + ·CH2 |
4 records matched | | ·CH3 + NO → CH3NO |
1 record matched | | ·CH3 + NO → Products |
1 record matched | | ·CH3 + Br· → HBr + ·CH2 |
6 records matched | | ·CH3 + HBr → CH4 + Br· |
3 records matched | | ·CH3 + HI → CH4 + I |
1 record matched | | ·CH3 + O3 → CH3O· + O2 |
2 records matched | | ·CH3 + SiHCl3 → CH4 + SiCl3 |
1 record matched | | ·CH3 + SiH4 → CH4 + SiH3 |
1 record matched | | ·CH3 + ICl → CH3I + ·Cl |
1 record matched | | ·CH3 + IBr → CH3I + Br· |
1 record matched | | ·CH3 + H2S → CH3SH + H· |
3 records matched | | ·CH3 + H2S → CH4 + SH |
1 record matched | | ·CH3 + HN3 → CH4 + ·N3 |
1 record matched | | ·CH3 + GeH4 → CH4 + GeH3 |
1 record matched | | ·CH3 + Cl2 → CH3Cl + ·Cl |
1 record matched | | ·CH3 + O2 → HCO + H2O |
1 record matched | | ·CH3 + O2 → CH3O· + O· |
4 records matched | | ·CH3 + O2 → CH3O2· |
6 records matched | | ·CH3 + O2 → CH2O + ·OH |
1 record matched | | ·CH3 + O2 → Products |
4 records matched | | ·CH3 + D2 → CH3D + D |
2 records matched | | ·CH3 + H2O → CH4 + ·OH |
3 records matched | | ·CH3 + Br2 → CH3Br + Br· |
3 records matched | | ·CH3 + NH3 → CH4 + NH2 |
1 record matched | | ·CH3 + HF → CH4 + ·F |
2 records matched | | ·CH3 + HCl → CH3Cl + H· |
18 records matched | | ·CH3 + HCl → CH4 + ·Cl |
3 records matched | | ·CH3 + I2 → CH3I + I |
2 records matched | | ·CH3 + In → InCH3(singlet) |
2 records matched | | ·CH3 + In → InCH3(triplet) |
1 record matched | | ·CH3 + HOCH2CH2CH2CH2 → n-C5H11OH |
1 record matched | | ·CH3 + HNC → Products |
1 record matched | | ·CH3 + ·CH2Cl → ·C2H5 + ·Cl |
1 record matched | | ·CH3 + ·CH2Cl → C2H5Cl |
1 record matched | | ·CH3 + ·CH2Cl → C2H4 + HCl |
1 record matched | | ·CH3 + CH2=C=CH → 1,2-butadiene |
1 record matched | | ·CH3 + CH3CH=C=O → CH3C(O)CH(·)CH3 |
1 record matched | | ·CH3 + 2-Hydroxyphenoxy radical → 2-Methoxyphenol |
1 record matched | | ·CH3 + (CH3)2CS → Adduct |
1 record matched | | ·CH3 + 1-C8H17 → n-C9H20 |
1 record matched | | ·CH3 + Dodecahedrane → Products |
1 record matched | | ·CH3 + (E)-CH3CH=CHCHO → (E)-2-C4H8 + HCO |
1 record matched | | ·CH3 + CH3CDO → CH3D + CH3CO |
1 record matched | | ·CH3 + (CH3)2Si=CH2 → (CH3)3SiCH2 |
1 record matched | | ·CH3 + (E)-2-C6H12 → CH3CH=CHCH(·)CH2CH3 + CH4 |
1 record matched | | ·CH3 + (E)-2-C6H12 → trans-CH3CH=CHCH2CH2CH2· + CH4 |
1 record matched | | ·CH3 + (E)-2-C6H12 → trans-CH3CH=CHCH2CH(·)CH3 + CH4 |
1 record matched | | ·CH3 + (E)-2-C6H12 → CH3CH2CH2CH=CHCH2· + CH4 |
1 record matched | | ·CH3 + (E)-2-C6H12 → CH3CH2CH2CH=C(·)CH3 + CH4 |
1 record matched | | ·CH3 + (E)-2-C6H12 → CH3CH2CH2C(·)=CHCH3 + CH4 |
1 record matched | | ·CH3 + ·CH2F → C2H5F |
1 record matched | | ·CH3 + NF2 → Adduct |
1 record matched | | ·CH3 + CHCl2 → CH3CHCl + ·Cl |
1 record matched | | ·CH3 + CHCl2 → CH2=CHCl + HCl |
2 records matched | | ·CH3 + ·OH → H2O + ·CH2 |
4 records matched | | ·CH3 + ·OH → (·)CH2OH + H· |
3 records matched | | ·CH3 + ·OH → CH3O· + H· |
5 records matched | | ·CH3 + ·OH → CH3OH |
2 records matched | | ·CH3 + ·OH → CH2O + H2 |
1 record matched | | ·CH3 + ·OH → Products |
1 record matched | | ·CH3 + ·OH → CH2(X3B_1) + H2O |
2 records matched | | ·CH3 + ·OH → trans-HCOH + H2 |
2 records matched | | ·CH3 + ·OH → cis-HCOH + H2 |
2 records matched | | ·CH3 + ·OH → CH2(1) + H2O |
1 record matched | | ·CH3 + HO2 → CH3O· + ·OH |
1 record matched | | ·CH3 + HO2 → O2(1DELTA) + CH4 |
1 record matched | | ·CH3 + ·CCl3 → CH3CCl2· + ·Cl |
1 record matched | | ·CH3 + ·CCl3 → CH2=CCl2 + HCl |
1 record matched | | ·CH3 + CH3C(O)CH2(·) → C2H5COCH3 |
1 record matched | | ·CH3 + (E)-CH3C(O)CH=CHCH3 → (E)-2-C4H8 + CH3CO |
1 record matched | | ·CH3 + CH2C≡CH → 1,2-butadiene |
1 record matched | | ·CH3 + CH2C≡CH → 1-butyne |
1 record matched | | ·CH3 + CH2C≡CH → Products |
1 record matched | | ·CH3 + C2H3 → ·CH2CH=CH2 + H· |
1 record matched | | ·CH3 + ·HCC≡N → CH3CN + H· |
1 record matched | | ·CH3 + HCO → CH3CHO |
2 records matched | | ·CH3 + HCO → CH4 + CO |
2 records matched | | ·CH3 + (·)CH2OH → C2H5OH |
1 record matched | | ·CH3 + 1-Naphthalenyl → 1-Naphthylmethyl + H· |
1 record matched | | ·CH3 + 1-Naphthalenyl → 1-Methylnaphthalene |
1 record matched | | ·CH3 + SnH4 → SnH3 + CH4 |
1 record matched | | ·CH3 + Phenyl → Benzyl + H· |
1 record matched | | ·CH3 + Phenyl → Toluene |
1 record matched | | ·CH3 + CF3I → CH3I + ·CF3 |
1 record matched | | ·CH3 + ·CF3 → CH3CF3 |
2 records matched | | ·CH3 + ·CH3 → ·C2H5 + H· |
41 records matched | | ·CH3 + ·CH3 → C2H6 |
2 records matched | | ·CH3 + ·CH3 → CH4 + ·CH2 |
3 records matched | | ·CH3 → H· + ·CH2 |
1 record matched | | S=C(CH3)SCH3 + ·CH3 → CH3SC(·)(CH3)SCH3 |
1 record matched | | CH2=CHCH2CH2· → CH2=C=CH2 + ·CH3 |
1 record matched | | ·CF2 + ·CH3 → CH2=CF2 + H· |
1 record matched | | Benzyl + ·CH3 → 2-Methylbenzyl |
1 record matched | | Benzyl + ·CH3 → 3-Methylbenzyl |
4 records matched | | Benzyl + ·CH3 → Ethylbenzene |
1 record matched | | Benzyl → o-C6H4 + ·CH3 |
1 record matched | | CH3CH2O· + H· → ·CH3 + (·)CH2OH |
20 records matched | | CH3CH2O· → CH2O + ·CH3 |
2 records matched | | CH3O· + O· → ·CH3 + O2 |
1 record matched | | 1-C3H7 + ·CH3 → CH4 + CH3CH=CH2 |
15 records matched | | 1-C3H7 → C2H4 + ·CH3 |
1 record matched | | CH3O2· + ·CH3 → CH3O· + CH3O· |
1 record matched | | Cyclopentadienyl + ·CH3 → H· + CH3(cyc-C5H4) |
1 record matched | | Cyclopentadienyl + ·CH3 → Fulvene + H2 |
1 record matched | | Cyclopentadienyl + ·CH3 → 1,3-Cyclopentadiene, 5-methyl- |
1 record matched | | Cyclopentadienyl + ·CH3 → Products |
1 record matched | | Cyclopentadienyl + ·CH3 → cyc-C(=CH2)-C(·)H-CH=CH-CH2 + H· |
1 record matched | | Cyclopentadienyl + ·CH3 → cyc-C(=CH2)-CH=CH-CH2-CH· + H· |
1 record matched | | Cyclopentadienyl + ·CH3 → cyc-C(-C(·)H2)-CH=CH-CH=CH + H· |
1 record matched | | Cyclopentadienyl + ·CH3 → methylcyclopentadiene (mixture of isomers) |
1 record matched | | Stannane, dimethyl- + CH3CO → CH3SnH2COCH3 + ·CH3 |
1 record matched | | CH3CD3 + D → CD4 + ·CH3 |
1 record matched | | ·C2H5 + N → ·CH3 + H2C=N |
2 records matched | | ·C2H5 + O· → CH2O + ·CH3 |
1 record matched | | ·C2H5 + ·CH3 → 1-C3H7 |
4 records matched | | ·C2H5 + ·CH3 → C3H8 |
1 record matched | | ·C2H5 + ·CH3 → C2H6 + ·CH2 |
4 records matched | | ·C2H5 + ·CH3 → CH4 + C2H4 |
1 record matched | | ·C2H5 → ·CH3 + ·CH2 |
1 record matched | | iso-C3H7 + O· → CH3CHO + ·CH3 |
3 records matched | | iso-C3H7 + ·CH3 → iso-C4H10 |
3 records matched | | iso-C3H7 + ·CH3 → CH4 + CH3CH=CH2 |
1 record matched | | ·CH2CH=CH2 + ·CH3 → 1-C4H8 |
2 records matched | | CH3CD2OH + ·CH3 → CH3D + CH3CH(·)OD |
4 records matched | | CH3CD2OH + ·CH3 → CH3CD2O + CH4 |
1 record matched | | CD3CDO + ·CH3 → CH3D + CD2CDO |
1 record matched | | tert-C4H9 + O· → ·CH3 + CH2=C(OH)CH3 |
1 record matched | | tert-C4H9 + O· → Acetone + ·CH3 |
1 record matched | | tert-C4H9 + ·CH3 → neo-C5H12 |
1 record matched | | tert-C4H9 → CH3CH=CH2 + ·CH3 |
1 record matched | | HFCO + ·CH3 → CH4 + FCO |
1 record matched | | CH3OD + H· → ·CH3 + HDO |
1 record matched | | (CH3)2GeH2: + CH3CO → CH3GeH2COCH3 + ·CH3 |
1 record matched | | (CH3)3Ga + NH2 → GaMe2NH2 + ·CH3 |
1 record matched | | (CH3)3Ga + H· → CH4 + ·CH3 + CH3Ga |
1 record matched | | (CH3)3Ga + H· → Ga(CH3)2H + ·CH3 |
1 record matched | | (CH3)3Ga + ·CH3 → C2H6 + ·CH3 + CH3Ga |
3 records matched | | (CH3)3Ga → ·CH3 + (CH3)2Ga |
2 records matched | | H2 + ·CH2 → ·CH3 + H· |
1 record matched | | H2 + ·CH → ·CH3 |
16 records matched | | H2 + ·CH3 → CH4 + H· |
1 record matched | | (CH3)2SiH2 + CH3CO → CH3SiH2C(O)CH3 + ·CH3 |
1 record matched | | 2,5-Dimethyltetrahydrofuran + ·CH3 → tetrahydro-2,5-dimethyl-2-furanyl + CH4 |
1 record matched | | 2,5-Dimethyltetrahydrofuran + ·CH3 → tetrahydro-2,5-dimethyl-3-furanyl + CH4 |
1 record matched | | 2,5-Dimethyltetrahydrofuran + ·CH3 → tetrahydro-5-methyl-2-furanylmethyl + CH4 |
1 record matched | | 2,5-Dimethyltetrahydrofuran → tetrahydro-2-methyl-5-furanyl + ·CH3 |
1 record matched | | O=P(OH)2CH3 + ·OH → O=P(OH)3 + ·CH3 |
1 record matched | | (CH3)3SiH + ·CH3 → CH4 + (CH3)3Si· |
1 record matched | | CH3SiH3 → ·CH3 + SiH3 |
1 record matched | | 9-Methylphenanthrene + ·CH3 → 1,9-dimethylphenanthrenyl radical |
1 record matched | | CH3NO + H· → ·CH3 + HNO |
1 record matched | | AlH(CH3)2 → ·CH3 + AlH(CH3) |
2 records matched | | CH2S + ·CH3 → CH3CH2S |
1 record matched | | CH2S + ·CH3 → Adduct |
1 record matched | | 1-Methylphenanthrene → 1-Phenanthryl + ·CH3 |
1 record matched | | (C2H5)2NN + ·CH3 → CH4 + CH3CH2N=NCH(·)CH3 |
1 record matched | | (C2H5)2NN + ·CH3 → Adduct |
1 record matched | | CH3CH2Si(CH3)2H → ·CH3 + CH3CH2Si(CH3)H |
1 record matched | | (CH3O)2P(O)CH3 + O· → CH3-O-P(O)(-O-CH3)-O· + ·CH3 |
1 record matched | | (CH3O)2P(O)CH3 + O· → CH3-O-P(O)(CH3)-OO· + ·CH3 |
1 record matched | | Vinylacetylene + ·CH3 → HC≡CC(CH3)CH2· |
1 record matched | | Vinylacetylene + ·CH3 → H2C=CHC(CH3)=CH· |
1 record matched | | Vinylacetylene + ·CH3 → HC≡CC(·)HCH2CH3 |
1 record matched | | Vinylacetylene + ·CH3 → CH2=CHC(·)=CHCH3 |
1 record matched | | (CF3)2CO + ·CH3 → CH3COCF3 + ·CF3 |
3 records matched | | CH3D + CD3 → CD4 + ·CH3 |
1 record matched | | 2-(E)-C5H10 + ·CH3 → CH4 + (E)-CH3CH=CHCH2CH2· |
1 record matched | | 2-(E)-C5H10 + ·CH3 → CH4 + CH3CH(·)CH=CHCH3 |
1 record matched | | 2-(E)-C5H10 + ·CH3 → Products |
1 record matched | | 2-(E)-C5H10 + ·CH3 → (E)-(·)CH2CH=CHCH2CH3 + CH4 |
1 record matched | | 2-(E)-C5H10 + ·CH3 → (E)-CH3C(·)=CHCH2CH3 + CH4 |
1 record matched | | 2-(E)-C5H10 + ·CH3 → (E)-CH3CH=C(·)CH2CH3 + CH4 |
2 records matched | | CO + CH3S· → COS + ·CH3 |
1 record matched | | CO + CH3CO → CO2 + ·CH3 |
1 record matched | | CO + (CH3)3CO· → (CH3)2CCO(O) + ·CH3 |
2 records matched | | CO + ·CH3 → CH3CO |
1 record matched | | CO + ·CH3 → C2H2 + ·OH |
2 records matched | | 2,5-Dimethylfuran + H· → 2-Methylfuran + ·CH3 |
1 record matched | | 2,5-Dimethylfuran + ·CH3 → 2-methylfuran-5-yl methyl radical + CH4 |
1 record matched | | 2,4-Dimethylpyrrole → 4-methylpyrrol-2-yl + ·CH3 |
1 record matched | | 2,4-Dimethylpyrrole → 2-methylpyrrol-4-yl + ·CH3 |
1 record matched | | (CH3S)2 + ·CH3 → CH4 + CH3SSCH2 |
1 record matched | | (CH3S)2 → ·CH3 + CH3SS |
1 record matched | | CH3ONO + H· → cis-HONO + ·CH3 |
1 record matched | | CH3ONO + H· → trans-HONO + ·CH3 |
1 record matched | | C2H5SCH3 + ·OH → CH3CH2SOH + ·CH3 |
1 record matched | | (E)-2-C4H8 + C → ·CH3 + CH3C=C=CH2 |
1 record matched | | (E)-2-C4H8 + C → ·CH3 + CHCCH(·)CH3 |
1 record matched | | (E)-2-C4H8 + C → CH3-cCHCCH + ·CH3 |
1 record matched | | (E)-2-C4H8 + ·CH3 → CH4 + CH3CH=C(·)CH3 |
1 record matched | | (E)-2-C4H8 + ·CH3 → CH4 + (E)-CH3CH=CHCH2 |
1 record matched | | Methyl levulinate + ·CH3 → CH3C(O)CH2CH2C(O)OCH2· + CH4 |
1 record matched | | Methyl levulinate + ·CH3 → CH3C(O)CH2CH(·)C(O)OCH3 + CH4 |
1 record matched | | Methyl levulinate + ·CH3 → CH3C(O)CH(·)CH2C(O)OCH3 + CH4 |
1 record matched | | Methyl levulinate + ·CH3 → ·CH2C(O)CH2CH2C(O)OCH3 + CH4 |
1 record matched | | Methyl butanoate + ·CH3 → ·CH2OC(O)CH2CH2CH3 + CH4 |
1 record matched | | Methyl butanoate + ·CH3 → CH3OC(O)CH·CH2CH3 + CH4 |
1 record matched | | Methyl butanoate + ·CH3 → CH3OC(O)CH2CH·CH3 + CH4 |
1 record matched | | Methyl butanoate + ·CH3 → CH3OC(O)CH2CH2CH2· + CH4 |
1 record matched | | Methyl butanoate → ·CH3 + CH3CH2CH2C(O)O· |
1 record matched | | Methyl butanoate → CH3OC(O)CH2CH2· + ·CH3 |
2 records matched | | CH3OCOOCH3 → CH3OC(O)O· + ·CH3 |
1 record matched | | CH3NHNO2 → NN(OH)O + ·CH3 |
1 record matched | | CH3NHNO2 → NHNO2 + ·CH3 |
1 record matched | | CH3NHNO2 → NHONO + ·CH3 |
1 record matched | | (CH3)3CC(CH3)=CH2 + ·CH3 → (CH3)3CC(CH3)2CH2 |
2 records matched | | (CH3)4Sn + ·CH3 → C2H6 + (CH3)3Sn |
3 records matched | | (CH3)4Sn + ·CH3 → CH4 + (CH3)3SnCH2· |
1 record matched | | (CH3)2Se + ·OH → ·CH3 + CH3SeOH |
1 record matched | | CH3OCl → ·CH3 + ClO |
1 record matched | | (CH3)2Hg + H· → CH4 + ·CH3 + Hg |
2 records matched | | (CH3)2Hg + ·CH3 → CH4 + CH3HgCH2 |
2 records matched | | (CH3)2Hg + ·CH3 → Other Products + CH4 |
1 record matched | | (CH3)2Hg → ·CH3 + CH3Hg |
1 record matched | | (CH3)2Hg → ·CH3 + ·CH3 + Hg |
1 record matched | | CH3F + H· → ·CH3 + HF |
3 records matched | | CH3F + ·CH3 → CH4 + ·CH2F |
1 record matched | | CH3F → ·CH3 + ·F |
1 record matched | | 3-Hexene + ·CH3 → CH3CH2CH(CH3)CH(·)CH2CH3 |
1 record matched | | 1-C6H12 + ·CH3 → 3-C7H15 |
1 record matched | | 1-C6H12 + ·CH3 → CH4 + ·CH2(CH2)3CH=CH2 |
1 record matched | | 1-C6H12 + ·CH3 → CH2=CHCH(·)CH2CH2CH3 + CH4 |
1 record matched | | 1-C6H12 + ·CH3 → CH2=C(·)CH2CH2CH2CH3 + CH4 |
1 record matched | | 1-C6H12 + ·CH3 → CH2=CHCH2C(·)HCH2CH3 + CH4 |
1 record matched | | 1-C6H12 + ·CH3 → ·CH=CHCH2CH2CH2CH3 + CH4 |
1 record matched | | 1-C6H12 + ·CH3 → CH2=CHCH2CH2CH(·)CH3 + CH4 |
1 record matched | | CH2=CHCH2CH=CH2 + ·CH3 → CH4 + CH2=CHCH2CH=CH· |
1 record matched | | CH2=CHCH2CH=CH2 + ·CH3 → CH4 + CH2=CHCH=CHCH2· |
1 record matched | | CH2=CHCH2CH=CH2 + ·CH3 → CH2=CHCH2C(·)=CH2 + CH4 |
1 record matched | | CH3C(O)OCH2CH=CH2 → CO2 + ·CH2CH=CH2 + ·CH3 |
1 record matched | | 1,2-butadiene + Phenyl → ·CH3 + C6H5CH2C2H |
1 record matched | | 1,2-butadiene + Phenyl → ·CH3 + Benzene, 1,2-propadienyl- |
3 records matched | | 1,2-butadiene + Phenyl → Indene + ·CH3 |
1 record matched | | 1,2-butadiene + ·CH3 → CH2=C(CH3)CH(·)CH3 |
3 records matched | | 1,2-butadiene → ·CH3 + CH2=C=CH |
3 records matched | | 1,2-butadiene → ·CH3 + CH2C≡CH |
1 record matched | | 2,3,4-Trimethylpentane + ·CH3 → Other Products + CH4 |
1 record matched | | 2,3,4-Trimethylpentane → ·CH3 + (CH3)2CHCH(CH3)CH(·)CH3 |
1 record matched | | (CH3)2CHC(CH3)=CH2 → ·CH3 + CH2=C(CH3)CHCH3 |
1 record matched | | C2H5C(CH3)=CH2 + ·CH3 → CH2=C(CH3)CH2CH2· + CH4 |
1 record matched | | C2H5C(CH3)=CH2 + ·CH3 → CH2=C(CH3)CH(·)CH3 + CH4 |
1 record matched | | C2H5C(CH3)=CH2 + ·CH3 → CH2=C(CH2·)CH2CH3 + CH4 |
1 record matched | | C2H5C(CH3)=CH2 + ·CH3 → (C2H5)(CH3)C=CH· + CH4 |
1 record matched | | (CH3)2CHCH=CH2 + ·CH3 → CH4 + CH2=CHCH(CH3)CH2· |
1 record matched | | (CH3)2CHCH=CH2 + ·CH3 → CH4 + (CH3)2C(·)CH=CH2 |
1 record matched | | (CH3)2CHCH=CH2 + ·CH3 → CH4 + (CH3)2CHCH=CH· |
1 record matched | | (CH3)2CHCH=CH2 + ·CH3 → CH3CH2C(·)CH(CH3)2 |
1 record matched | | (CH3)2CHCH=CH2 + ·CH3 → CH3CH(CH3)CH(CH3)CH2· |
1 record matched | | (CH3)2CHCH=CH2 + ·CH3 → (CH3)2CHC·=CH2 + CH4 |
1 record matched | | (CH3)3CCH=CH2 + ·CH3 → (CH3)3CCH(CH3)CH2· |
1 record matched | | (CH3)3CCH=CH2 → ·CH3 + (CH3)2C(·)CH=CH2 |
1 record matched | | CD4 + ·CH3 → CH3CD3 + D |
2 records matched | | CD4 + ·CH3 → CH3D + CD3 |
1 record matched | | CH2=CHOH + ·CH3 → CH3CH(OH)CH2 |
1 record matched | | CH2=CHOH + ·CH3 → C2H5CH(·)OH |
1 record matched | | CH2=CHOH → ·CH3 + HCO |
1 record matched | | C2H5C(O)OCH3 + ·CH3 → CH3CH(·)C(O)OCH3 + CH4 |
1 record matched | | C2H5C(O)OCH3 + ·CH3 → CH3CH2C(O)OCH2· + CH4 |
1 record matched | | C2H5C(O)OCH3 + ·CH3 → CH3OC(O)CH2CH2· + CH4 |
1 record matched | | (CH3)2Zn + SeH → Zn(CH3)SeH + ·CH3 |
1 record matched | | (CH3)2Zn → ·CH3 + CH3Zn |
1 record matched | | CH3(CH2)14CH3 + ·CH3 → Other Products + CH4 |
1 record matched | | (CH3)2CHCH2C(CH3)3 + ·CH3 → Other Products + CH4 |
1 record matched | | (CH3)2CHCH2C(CH3)3 → Other Products + ·CH3 |
1 record matched | | 2-Methylfuran → CO + ·CH3 + CH2=C=CH |
1 record matched | | (CH3)2C=CHCH3 + ·CH3 → CH4 + ·CH2C(CH3)=CHCH3 |
1 record matched | | (CH3)2C=CHCH3 + ·CH3 → (CH3)2C=C(·)CH3 + CH4 |
1 record matched | | (CH3)2C=CHCH3 + ·CH3 → (CH3)2C=CHCH2· + CH4 |
2 records matched | | CH2OHCHOHCH3 → HOCH2CH(·)OH + ·CH3 |
1 record matched | | (CH3N)2 + ·CH3 → (CH3)2N-N(·)CH3 |
1 record matched | | (CH3N)2 → ·CH3 + ·CH3 + N2 |
1 record matched | | 2-butyne + Y → YCCCH3 + ·CH3 |
2 records matched | | 2-butyne + Phenyl → 1-Phenylpropyne + ·CH3 |
1 record matched | | 2-butyne → ·CH3 + CH3C≡C |
3 records matched | | 2-butyne → ·CH3 + CH2C≡CH |
2 records matched | | neo-C5H12 + ·CH3 → CH4 + Neopentyl |
4 records matched | | neo-C5H12 → tert-C4H9 + ·CH3 |
4 records matched | | H2C=C=O + H· → CO + ·CH3 |
2 records matched | | H2C=C=O + ·CH3 → CO + ·C2H5 |
1 record matched | | H2C=C=O + ·CH3 → CH2=C=CH2 + ·OH |
1 record matched | | H2C=C=O + ·CH3 → CH3CCH + ·OH |
1 record matched | | H2C=C=O + ·CH3 → CH4 + HCCO |
2 records matched | | CH2=C=CH2 + ·CH3 → ·CH2C(CH3)=CH2 |
1 record matched | | CH2=C=CH2 + ·CH3 → 1,2-butadiene + H· |
1 record matched | | CH2=C=CH2 + ·CH3 → 1-butyne + H· |
1 record matched | | CH2=C=CH2 + ·CH3 → 1,3-Butadiene + H· |
1 record matched | | CH2=C=CH2 + ·CH3 → C2H4 + C2H3 |
1 record matched | | CH2=C=CH2 + ·CH3 → CH2=C(·)CH2CH3 |
1 record matched | | CH2=C=CH2 + ·C2H → 1,3-Butadiyne + ·CH3 |
1 record matched | | 1,3-Butadiyne + ·CH3 → HC≡CC(CH3)=CH· |
1 record matched | | 1,3-Butadiyne + ·CH3 → CH2=CHC(·)=CHCH3 |
1 record matched | | CH3CF3 + ·OH → CF3OH + ·CH3 |
1 record matched | | N2H4 + ·CH3 → CH4 + NH2NH |
1 record matched | | 3,4-Epoxytetrahydrofuran + ·CH3 → 3,4-Epoxytetrahydrofuran-2-yl + CH4 |
1 record matched | | 3,4-Epoxytetrahydrofuran + ·CH3 → 3,4-Epoxytetrahydrofuran-3-yl + CH4 |
1 record matched | | Dibenz[a,j]anthracene + ·CH3 → Products |
1 record matched | | Benzo[c]phenanthrene + ·CH3 → Products |
1 record matched | | Benzo[g,h,i]perylene + ·CH3 → Products |
1 record matched | | Coronene + ·CH3 → Products |
1 record matched | | Dibenzo[c,g]phenanthrene + ·CH3 → Products |
1 record matched | | 1,3-Dimethoxybenzene → ·CH3 + 3-Methoxyphenoxy radical |
1 record matched | | 1,4-Dimethoxybenzene → ·CH3 + 4-Methoxyphenoxy radical |
1 record matched | | 1-C7H16 + ·CH3 → CH4 + 3-C7H15 |
1 record matched | | 1-C7H16 + ·CH3 → CH4 + 2-C7H15 |
1 record matched | | 1-C7H16 + ·CH3 → CH4 + 1-C7H15 |
2 records matched | | 1-C7H16 → ·CH3 + 1-hexyl radical |
1 record matched | | CH3C(O)OC2H5 → ·CH3 + CH3CH2OC(O)· |
1 record matched | | CH3C(O)OC2H5 → ·CH3 + CH3C(O)OCH2· |
1 record matched | | CH3CH2CH(CH3)CH2OH → CH3CH2CH(·)CH2OH + ·CH3 |
1 record matched | | CH3CH2CH(CH3)CH2OH → ·CH2CH(CH3)CH2OH + ·CH3 |
1 record matched | | sec-Butylbenzene → ·CH3 + C6H5CH(·)CH2CH3 |
1 record matched | | Pentacene + ·CH3 → Products |
1 record matched | | Pyrene + ·CH3 → Products |
1 record matched | | (CH3)2NH + ·CH3 → CH4 + CH2NHCH3 |
1 record matched | | (CH3)2NH + ·CH3 → CH4 + (CH3)2N |
3 records matched | | CO2 + ·CH3 → CH3OC(·)(O) |
1 record matched | | CH3CH2CH2CHO + ·CH3 → CH3(CH2)2CH(CH3)O |
2 records matched | | 3-methyl-1-butanol → CH3CH(·)CH2CH2OH + ·CH3 |
1 record matched | | C2H5CHO + ·CH3 → CH3CH2CH(CH3)O· |
1 record matched | | C2H5CHO + ·CH3 → 2-C4H9O |
1 record matched | | Cyclopentanone + ·CH3 → Other Products + CH4 |
2 records matched | | Anthracene + ·CH3 → CH4 + 2-Anthracenyl |
1 record matched | | Anthracene + ·CH3 → CH4 + 9-Anthracenyl |
2 records matched | | Anthracene + ·CH3 → CH4 + 1-Anthracenyl |
1 record matched | | Anthracene + ·CH3 → Products |
1 record matched | | iso-C4H8 + C2H3 → CH2=C(CH3)CH=CH2 + ·CH3 |
2 records matched | | iso-C4H8 + ·CH3 → (CH3)2C(·)CH2CH3 |
2 records matched | | iso-C4H8 + ·CH3 → Neopentyl |
4 records matched | | iso-C4H8 + ·CH3 → CH4 + ·CH2C(CH3)=CH2 |
1 record matched | | iso-C4H8 + ·CH3 → Adduct |
1 record matched | | iso-C4H8 + ·CH3 → (CH3)2C=CH· + CH4 |
4 records matched | | (CH3)2O + ·CH3 → CH4 + CH3OCH2· |
6 records matched | | (CH3)2O → CH3O· + ·CH3 |
2 records matched | | CH3CH=CH2 + O· → ·CH3 + *CH2C(O)H |
1 record matched | | CH3CH=CH2 + O· → ·CH3 + CH3CO |
1 record matched | | CH3CH=CH2 + O· → H2C=C=O + ·CH3 + H· |
1 record matched | | CH3CH=CH2 + BO → CH2=CHB=O + ·CH3 |
1 record matched | | CH3CH=CH2 + H· → C2H4 + ·CH3 |
1 record matched | | CH3CH=CH2 + C → ·CH3 + Cycloprop-1-enyl |
1 record matched | | CH3CH=CH2 + C → ·CH3 + CH2=C=CH |
1 record matched | | CH3CH=CH2 + ·OH → CH2=CHOH + ·CH3 |
1 record matched | | CH3CH=CH2 + ·OH → CH3CHO + ·CH3 |
1 record matched | | CH3CH=CH2 + Phenyl → Styrene + ·CH3 |
4 records matched | | CH3CH=CH2 + ·CH3 → iso-C4H9 |
4 records matched | | CH3CH=CH2 + ·CH3 → sec-C4H9 |
1 record matched | | CH3CH=CH2 + ·CH3 → CH4 + CH2=C(·)CH3 |
1 record matched | | CH3CH=CH2 + ·CH3 → CH4 + CH3CH=C(·)H |
4 records matched | | CH3CH=CH2 + ·CH3 → CH4 + ·CH2CH=CH2 |
5 records matched | | CH3CH=CH2 → ·CH3 + C2H3 |
1 record matched | | CH3CH=CH2 → C2H4 + ·CH3 |
1 record matched | | n-C8H18 + ·CH3 → CH4 + 1-C8H17 |
1 record matched | | n-C8H18 → ·CH3 + 1-C7H15 |
1 record matched | | 1,2-Dimethoxyethane → ·OCH2CH2OCH3 + ·CH3 |
1 record matched | | HC(O)OC2H5 + ·CH3 → CH4 + CH3CH2OC(O)· |
1 record matched | | HC(O)OC2H5 + ·CH3 → CH3CH(·)OC(O)H + CH4 |
1 record matched | | HC(O)OC2H5 + ·CH3 → ·CH2CH2OC(O)H + CH4 |
2 records matched | | HC(O)OC2H5 → ·CH3 + HC(O)OCH2(·) |
1 record matched | | CH3OCH2OCH3 + ·CH3 → CH4 + HC(O)OCH3 + ·CH3 |
2 records matched | | CH3OCH2OCH3 + ·CH3 → CH3OCH(·)OCH3 + CH4 |
1 record matched | | CH3OCH2OCH3 + ·CH3 → ·CH2OCH2OCH3 + CH4 |
1 record matched | | 1-C5H10 + ·CH3 → CH4 + CH2=CHCH2CH(·)CH3 |
1 record matched | | 1-C5H10 + ·CH3 → CH4 + CH2=CHCH(·)CH2CH3 |
1 record matched | | 1-C5H10 + ·CH3 → CH3CH2CH2C·=CH2 + CH4 |
1 record matched | | 1-C5H10 + ·CH3 → CH3CH2CH2CHCH· + CH4 |
1 record matched | | 1-C5H10 + ·CH3 → CH2=CHCH2CH2CH2· + CH4 |
1 record matched | | n-C5H12 + ·CH3 → CH4 + (CH3CH2)2CH |
2 records matched | | n-C5H12 + ·CH3 → CH4 + 1-C5H11 |
1 record matched | | n-C5H12 + ·CH3 → CH4 + CH3CH2CH2CH(·)CH3 |
1 record matched | | n-C5H12 → ·CH3 + 1-C4H9 |
1 record matched | | Cyclohexanone + ·CH3 → cyc-[C(O)CH2CH2CH2CH2C(·)H] + CH4 |
1 record matched | | Cyclohexanone + ·CH3 → 3-cyclohexanone-yl radical + CH4 |
1 record matched | | Cyclohexanone + ·CH3 → 4-cyclohexanone-yl radical + CH4 |
1 record matched | | Toluene + ·OH → Phenol + ·CH3 |
1 record matched | | Toluene + ·CH3 → CH4 + 2-methylphenyl |
1 record matched | | Toluene + ·CH3 → CH4 + 3-methylphenyl |
1 record matched | | Toluene + ·CH3 → CH4 + 4-methylphenyl |
3 records matched | | Toluene + ·CH3 → CH4 + Benzyl |
5 records matched | | Toluene → ·CH3 + Phenyl |
1 record matched | | Methylcyclohexane + ·CH3 → Other Products + CH4 |
2 records matched | | Methylcyclohexane + ·CH3 → cyc-CH2CH2CH2CH2CH2C(·)(CH3) + CH4 |
2 records matched | | Methylcyclohexane + ·CH3 → 3-methyl-cyclohexyl + CH4 |
4 records matched | | Methylcyclohexane + ·CH3 → 2-methyl-cyclohexyl + CH4 |
3 records matched | | Methylcyclohexane + ·CH3 → 4-methyl-cyclohexyl + CH4 |
2 records matched | | Methylcyclohexane + ·CH3 → Cyclohexylmethyl + CH4 |
2 records matched | | Methylcyclohexane → ·CH3 + Cyclohexyl |
1 record matched | | 1,3,5-Trimethylbenzene + ·CH3 → CH4 + 3,5-dimethylbenzyl radical |
1 record matched | | 1,3,5-Trimethylbenzene → ·CH3 + 3,5-Dimethylphenyl |
1 record matched | | γ-Valerolactone → Tetrahydro-2-furanone-3-yl + ·CH3 |
1 record matched | | Sarin + O· → (CH3)2CH-O-PF(O)O· + ·CH3 |
1 record matched | | Sarin + O· → ·OCH(CH3)-O-PF(O)CH3 + ·CH3 |
2 records matched | | HC(O)OCH3 + ·CH3 → CH4 + CH3OC(·)(O) |
2 records matched | | HC(O)OCH3 + ·CH3 → CH4 + HC(O)OCH2(·) |
1 record matched | | HC(O)OCH3 → ·CH3 + HCOO |
1 record matched | | CH2=CHCHO + ·CH3 → CH2=CHCH(CH3)O |
1 record matched | | CH3CH=CHCH3 + C2H3 → CH2=CHCH=CHCH3 + ·CH3 |
2 records matched | | 1-butyne + Phenyl → ·CH3 + Benzene, 1,2-propadienyl- |
4 records matched | | 1-butyne → ·CH3 + CH2C≡CH |
5 records matched | | 1,3-Butadiene + Phenyl → Indene + ·CH3 |
4 records matched | | 1,3-Butadiene + ·CH3 → ·CH2CH=CHCH2CH3 |
3 records matched | | 1,3-Butadiene + ·CH3 → CH2=CHCH(CH3)CH2· |
1 record matched | | 1,3-Butadiene + ·CH3 → CH2=CHCH(·)CH2CH3 |
3 records matched | | 1,3-Butadiene → ·CH3 + CH2C≡CH |
1 record matched | | 1-C4H8 + C2H3 → CH2=CHCH2CH=CH2 + ·CH3 |
1 record matched | | 1-C4H8 + ·CH3 → CH4 + CH2=CHCH(·)CH3 |
1 record matched | | 1-C4H8 + ·CH3 → CH4 + CH2=CHCH(·)CH3 |
1 record matched | | 1-C4H8 + ·CH3 → CH4 + CH3CH2C(·)=CH2 |
2 records matched | | 1-C4H8 + ·CH3 → CH4 + CH3CH2CH=CH· |
2 records matched | | 1-C4H8 + ·CH3 → CH4 + CH2=CHCH2CH2· |
3 records matched | | 1-C4H8 + ·CH3 → 3-C5H11 |
2 records matched | | 1-C4H10 + ·CH3 → CH4 + 1-C4H9 |
2 records matched | | 1-C4H10 + ·CH3 → CH4 + sec-C4H9 |
1 record matched | | 1-C4H10 + ·CH3 → Other Products + CH4 |
1 record matched | | 1-C4H10 → 1-C3H7 + ·CH3 |
1 record matched | | C2H5C(O)OC2H5 → ·H2CC(O)OCH2CH3 + ·CH3 |
1 record matched | | C2H5C(O)OC2H5 → CH3CH2C(O)OCH2· + ·CH3 |
1 record matched | | Methoxybenzene + H· → Phenol + ·CH3 |
2 records matched | | Styrene + ·CH3 → C6H5CH(·)CH2CH3 |
2 records matched | | Styrene + ·CH3 → C6H5CH(CH3)CH2· |
1 record matched | | Ethylbenzene + ·CH3 → Toluene + 1-C4H9 |
2 records matched | | Ethylbenzene → Benzyl + ·CH3 |
1 record matched | | 2-Phenylpropene + ·CH3 → C6H5C(CH3)2CH2· |
1 record matched | | 2-Phenylpropene + ·CH3 → C6H5C(·)(CH3)CH2CH3 |
1 record matched | | t-Butylbenzene → ·CH3 + 2-Phenyl-2-propyl radical |
1 record matched | | 2-methyltetrahydrofuran + ·CH3 → (2-tetrahydrofuran)-methyl + CH4 |
1 record matched | | 2-methyltetrahydrofuran + ·CH3 → 2-methyl-tetrahydrofuran-2-yl + CH4 |
1 record matched | | 2-methyltetrahydrofuran + ·CH3 → 2-methyl-tetrahydrofuran-3-yl + CH4 |
1 record matched | | 2-methyltetrahydrofuran + ·CH3 → 2-methyl-tetrahydrofuran-4-yl + CH4 |
1 record matched | | 2-methyltetrahydrofuran + ·CH3 → 2-methyl-tetrahydrofuran-5-yl + CH4 |
1 record matched | | CH2=CHC(O)OCH3 + ·CH3 → CH3OC(O)CH·CH2CH3 |
1 record matched | | Indene + ·CH3 → 2,3-Dihydro-1-methylinden-2-yl |
1 record matched | | Naphthacene + ·CH3 → Products |
1 record matched | | 2-Methylnaphthalene → ·CH3 + 2-Naphthalenyl |
1 record matched | | Naphthalene + ·CH3 → ·CH3 + 2-Naphthalenyl |
1 record matched | | Naphthalene + ·CH3 → ·CH3 + 1-Naphthalenyl |
1 record matched | | Naphthalene + ·CH3 → CH4 + 2-Naphthalenyl |
2 records matched | | Naphthalene + ·CH3 → CH4 + 1-Naphthalenyl |
1 record matched | | Naphthalene + ·CH3 → Products |
1 record matched | | 1,2-Dimethoxybenzene → ·CH3 + 2-Methoxyphenoxy radical |
1 record matched | | 1-Methylnaphthalene + H· → Naphthalene + ·CH3 |
1 record matched | | 1-Methylnaphthalene → ·CH3 + 1-Naphthalenyl |
1 record matched | | 2-Methoxyphenol → ·CH3 + 2-Hydroxyphenoxy radical |
1 record matched | | Phenanthrene + ·CH3 → Products |
1 record matched | | 3,3',5,5'-Tetrabromobisphenol A + ·CH3 → 3,3',5,5'-Tetrabromo-4,4-dihydroxy-2,2-diphenyl-1-propyl radical + CH4 |
1 record matched | | 3,3',5,5'-Tetrabromobisphenol A + ·CH3 → 1,6-dibromo-4-(3,5-dibromo-4-hydroxyphenyl,dimethyl)methylphenoxy radical + CH4 |
1 record matched | | 3,3',5,5'-Tetrabromobisphenol A + ·CH3 → 2-hydroxy-3-bromo-3-(3,5-dibromo-4-hydroxyphenyl,dimethyl)methylphenyl radical + CH3Br |
1 record matched | | 3,3',5,5'-Tetrabromobisphenol A + ·CH3 → 2,6-Dibromo-4-[2-(3-bromo-4-hydroxyphenyl-5-methyl)-2-propanyl]phenol + Br· |
1 record matched | | 3,3',5,5'-Tetrabromobisphenol A + ·CH3 → 2,4-dibromo-3-hydroxy-5-methyl-6-(3,5-dibromo-4-hydroxyphenyl,dimethyl)-1,3-cyclohexadien-6-yl radical |
1 record matched | | 3,3',5,5'-Tetrabromobisphenol A + ·CH3 → 4,6-dibromo-5-hydroxy-5-methyl-2-(3,5-dibromo-4-hydroxyphenyl,dimethyl)-1,3-cyclohexadien-6-yl radical |
2 records matched | | 3,3',5,5'-Tetrabromobisphenol A → 3,3',5,5'-Tetrabromo-4,4-dihydroxy-1,1-diphenylethyl radical + ·CH3 |
1 record matched | | (CH3)2CHCH(CH3)2 + ·CH3 → Products |
3 records matched | | CH3C(O)OCH3 + ·CH3 → CH4 + ·CH2C(O)OCH3 |
3 records matched | | CH3C(O)OCH3 + ·CH3 → CH4 + CH3C(O)OCH2· |
1 record matched | | CH3C(O)OCH3 → ·CH3 + CH3OC(·)(O) |
1 record matched | | CH3C(O)OCH3 → ·CH3 + CH3C(O)O |
1 record matched | | CH3C(O)OCH3 → CO2 + ·CH3 + ·CH3 |
1 record matched | | CH3C(O)OCH3 → CH3OCO + ·CH3 |
1 record matched | | C2H5COCH3 + ·CH3 → CH4 + ·CH2CH2C(O)CH3 |
1 record matched | | C2H5COCH3 + ·CH3 → CH4 + CH3C(O)CH(·)CH3 |
1 record matched | | C2H5COCH3 + ·CH3 → ·CH2C(O)C2H5 + CH4 |
1 record matched | | C2H5COCH3 → ·CH3 + CH3CH2CO |
1 record matched | | C2H5COCH3 → ·CH3 + CH3C(O)CH2(·) |
1 record matched | | sec-C4H9OH → ·CH3 + CH3CH(OH)CH2 |
1 record matched | | sec-C4H9OH → ·CH3 + C2H5CH(·)OH |
1 record matched | | CH2=C(CH3)C≡CH + ·CH3 → HC≡CC(CH3)2CH2· |
1 record matched | | CH2=C(CH3)C≡CH + ·CH3 → HC≡CC(·)(CH3)CH2CH3 |
1 record matched | | CH2=C(CH3)CH=CH2 + ·CH3 → CH2=CHC(CH3)2CH2· |
1 record matched | | CH2=C(CH3)CH=CH2 + ·CH3 → CH2=CHC(·)(CH3)CH2CH3 |
2 records matched | | iso-C5H12 + ·CH3 → CH4 + ·CH2CH(CH3)CH2CH3 |
2 records matched | | iso-C5H12 + ·CH3 → CH4 + (CH3)2C(·)CH2CH3 |
2 records matched | | iso-C5H12 + ·CH3 → CH4 + (CH3)2CHCH(·)CH3 |
2 records matched | | iso-C5H12 + ·CH3 → CH4 + (CH3)2CHCH2CH2· |
1 record matched | | iso-C5H12 + ·CH3 → Other Products + CH4 |
1 record matched | | iso-C5H12 → Other Products + ·CH3 |
1 record matched | | tert-C4H9OOH + ·CH3 → CH4 + (CH3)3CO2 |
1 record matched | | CH3SiCl3 + ·CH3 → CH3Cl + Silyl, dichloromethyl- |
1 record matched | | CH3SiCl3 + ·CH3 → CH4 + Cl3SiCH2· |
1 record matched | | CH3SiCl3 → ·CH3 + SiCl3 |
1 record matched | | CF4 + ·CH3 → CH3F + ·CF3 |
1 record matched | | CF3Cl + ·CH3 → CH3Cl + ·CF3 |
1 record matched | | tert-C4H9OH → ·CH3 + (CH3)2C(OH) |
1 record matched | | CF3Br + ·CH3 → CH3Br + ·CF3 |
1 record matched | | Methyloxirane → ·CH3 + Oxiranyl |
4 records matched | | CH3NO2 → ·CH3 + NO2 |
2 records matched | | CHF3 + ·CH3 → CH4 + ·CF3 |
1 record matched | | CH3CHF2 → ·CH3 + ·CHF2 |
2 records matched | | iso-C4H10 + ·CH3 → CH4 + iso-C4H9 |
4 records matched | | iso-C4H10 + ·CH3 → CH4 + tert-C4H9 |
1 record matched | | iso-C4H10 → iso-C3H7 + ·CH3 |
1 record matched | | Al(CH3)3 → Al(CH3)2 + ·CH3 |
1 record matched | | Oxirane + ·CH3 → CH4 + Oxiranyl |
2 records matched | | Oxirane → ·CH3 + HCO |
1 record matched | | Cyclopropane + ·CH3 → CH4 + Cyclopropyl |
2 records matched | | (CH3)2S + H· → CH3SH + ·CH3 |
1 record matched | | (CH3)2S + Br· → CH3SBr + ·CH3 |
1 record matched | | (CH3)2S + ·OH → ·CH3 + CH3SOH |
1 record matched | | (CH3)2S → ·CH3 + CH3S· |
1 record matched | | CS2 + ·CH3 → S=C(·)-S-CH3 |
1 record matched | | HN=C=O + ·CH3 → CH3O· + HNC |
2 records matched | | HN=C=O + ·CH3 → CO + CH3NH |
2 records matched | | HN=C=O + ·CH3 → CH4 + NCO |
1 record matched | | HN=C=O + ·CH3 → CH3C(O)NH |
2 records matched | | CH2F2 + ·CH3 → CH4 + ·CHF2 |
1 record matched | | CH3CHO + ·OH → HCOOH + ·CH3 |
1 record matched | | CH3CHO + Phenyl → Benzaldehyde + ·CH3 |
2 records matched | | CH3CHO + ·CH3 → i-C3H7O |
3 records matched | | CH3CHO + ·CH3 → CH4 + CH3CO |
4 records matched | | CH3CHO → ·CH3 + HCO |
1 record matched | | CH3CHO → CO + ·CH3 + H· |
1 record matched | | CH3CN + O· → ·CH3 + CNO |
2 records matched | | CH3CN + O· → ·CH3 + NCO |
1 record matched | | CH3CN + ·CH3 → CH4 + CH2CN |
1 record matched | | C2H5Cl → ·CH3 + ·CH2Cl |
1 record matched | | CH3CCH + O· → ·CH3 + HCCO |
1 record matched | | CH3CCH + ·F → ·CH3 + HCCF |
1 record matched | | CH3CCH + H· → C2H2 + ·CH3 |
1 record matched | | CH3CCH + Zr → Zr-CCH + ·CH3 |
1 record matched | | CH3CCH + Zr → Zr(CC)H + ·CH3 |
1 record matched | | CH3CCH + Phenyl → Phenylacetylene + ·CH3 |
1 record matched | | CH3CCH + ·CH3 → (CH3)2C=CH· |
1 record matched | | CH3CCH + ·CH3 → CH3CH=C(·)(CH3) |
1 record matched | | CH3CCH + ·C2H → 1,3-Butadiyne + ·CH3 |
2 records matched | | C3H8 + ·CH3 → CH4 + 1-C3H7 |
3 records matched | | C3H8 + ·CH3 → CH4 + iso-C3H7 |
8 records matched | | C3H8 → ·C2H5 + ·CH3 |
1 record matched | | CH3SH + O· → ·CH3 + HSO |
3 records matched | | CH3SH + H· → ·CH3 + H2S |
1 record matched | | CH3SH → ·CH3 + SH |
1 record matched | | CH3NH2 + B → ·CH3 + HBNH |
1 record matched | | CH3I + IO → IIO + ·CH3 |
1 record matched | | CH3I + IO → IOI + ·CH3 |
2 records matched | | CH3I + I → ·CH3 + I2 |
1 record matched | | CH3I + H· → ·CH3 + HI |
1 record matched | | CH3I + ·OH → ·CH3 + HIO |
1 record matched | | CH3I + CH3CO → CH3C(O)I + ·CH3 |
2 records matched | | CH3I + ·CH3 → CH4 + ·CH2I |
1 record matched | | CH3I → ·CH3 + I |
1 record matched | | CH3Cl + Silyl, dichloromethyl- → CH3SiCl3 + ·CH3 |
2 records matched | | CH3Cl + ·Cl → ·CH3 + Cl2 |
1 record matched | | CH3Cl + SiCl3 → ·CH3 + SiCl4 |
1 record matched | | CH3Cl + SiH2 → ·CH3 + SiH2Cl |
1 record matched | | CH3Cl + SiH3 → ·CH3 + SiH3Cl |
1 record matched | | CH3Cl + SiCl2 → ·CH3 + SiCl3 |
5 records matched | | CH3Cl + H· → ·CH3 + HCl |
1 record matched | | CH3Cl + ·OH → ·CH3 + HOCl |
1 record matched | | CH3Cl + CH3CO → CH3COCl + ·CH3 |
2 records matched | | CH3Cl + ·CF3 → CF3Cl + ·CH3 |
2 records matched | | CH3Cl → ·CH3 + ·Cl |
2 records matched | | C2H2 + ·OH → CO + ·CH3 |
4 records matched | | C2H2 + ·CH3 → CH3CH=C(·)H |
1 record matched | | C2H2 + ·CH3 → ·CH2CH=CH2 |
3 records matched | | C2H2 + ·CH3 → CH3CCH + H· |
1 record matched | | C2H2 + ·CH3 → CH4 + ·C2H |
2 records matched | | C2H2 + ·CH3 → Products |
1 record matched | | C2H2 + ·CH3 → CH3CH2=CH(·) |
1 record matched | | C2H4 + COH → H2C=C=O + ·CH3 |
6 records matched | | C2H4 + O· → ·CH3 + HCO |
1 record matched | | C2H4 + S → ·CH3 + HC=S |
1 record matched | | C2H4 + HCO → H2C=C=O + ·CH3 |
6 records matched | | C2H4 + ·CH3 → 1-C3H7 |
3 records matched | | C2H4 + ·CH3 → CH4 + C2H3 |
1 record matched | | C2H4 + ·CH3 → Adduct |
2 records matched | | C2H4 + ·CH3 → Propyl Radical |
1 record matched | | C2H6 + ·CH2 → ·C2H5 + ·CH3 |
1 record matched | | C2H6 + O· → CH3O· + ·CH3 |
1 record matched | | C2H6 + H· → CH4 + ·CH3 |
1 record matched | | C2H6 + ·CH3 → C2H6 + ·CH3 |
7 records matched | | C2H6 + ·CH3 → CH4 + ·C2H5 |
11 records matched | | C2H6 → ·CH3 + ·CH3 |
1 record matched | | CH3Br + H· → ·CH3 + HBr |
1 record matched | | CH3Br + Br· → ·CH3 + Br2 |
1 record matched | | CH3Br + CH3CO → CH3COBr + ·CH3 |
1 record matched | | CH4 + CH3SSCH2 → (CH3S)2 + ·CH3 |
1 record matched | | CH4 + ·CH2 → ·CH3 + ·CH3 |
6 records matched | | CH4 + CH≡CC≡C → 1,3-Butadiyne + ·CH3 |
1 record matched | | CH4 + HC=S → H2CS + ·CH3 |
1 record matched | | CH4 + CH3SCH2 → (CH3)2S + ·CH3 |
24 records matched | | CH4 + ·Cl → ·CH3 + HCl |
1 record matched | | CH4 + CF3O → CF3OH + ·CH3 |
1 record matched | | CH4 + Cl3SiCH2· → CH3SiCl3 + ·CH3 |
1 record matched | | CH4 + SiCl3 → ·CH3 + SiHCl3 |
16 records matched | | CH4 + O· → ·CH3 + ·OH |
11 records matched | | CH4 + D → ·CH3 + HD |
1 record matched | | CH4 + BrO → ·CH3 + HOBr |
1 record matched | | CH4 + ClO → ·CH3 + HOCl |
9 records matched | | CH4 + ·F → ·CH3 + HF |
1 record matched | | CH4 + I → ·CH3 + HI |
1 record matched | | CH4 + SH → ·CH3 + H2S |
19 records matched | | CH4 + NH → ·CH3 + NH2 |
7 records matched | | CH4 + NH2 → ·CH3 + NH3 |
5 records matched | | CH4 + OD → ·CH3 + HDO |
1 record matched | | CH4 + SiCl2 → ·CH3 + SiHCl2 |
47 records matched | | CH4 + H· → H2 + ·CH3 |
1 record matched | | CH4 + OF → ·CH3 + HOF |
1 record matched | | CH4 + NO3 → ·CH3 + HNO3 |
5 records matched | | CH4 + NO2 → ·CH3 + HNO2 |
3 records matched | | CH4 + NO2 → cis-HONO + ·CH3 |
4 records matched | | CH4 + NO2 → trans-HONO + ·CH3 |
2 records matched | | CH4 + NO → ·CH3 + HNO |
2 records matched | | CH4 + Br· → ·CH3 + HBr |
2 records matched | | CH4 + O3 → HO3 + ·CH3 |
5 records matched | | CH4 + O2 → ·CH3 + HO2 |
1 record matched | | CH4 + C → ·CH3 + ·CH |
1 record matched | | CH4 + Ni → ·CH3 + NiH |
32 records matched | | CH4 + ·OH → ·CH3 + H2O |
1 record matched | | CH4 + ·OH → H2 + ·CH3 |
4 records matched | | CH4 + C2H3 → C2H4 + ·CH3 |
1 record matched | | CH4 + HCO → CH2O + ·CH3 |
1 record matched | | CH4 + (·)CH2OH → CH3OH + ·CH3 |
1 record matched | | CH4 + Phenyl → Benzene + ·CH3 |
2 records matched | | CH4 + ·CF3 → CHF3 + ·CH3 |
1 record matched | | CH4 + ·CH3 → H2 + ·C2H5 |
3 records matched | | CH4 + ·CH3 → C2H6 + H· |
9 records matched | | CH4 + ·CH3 → CH4 + ·CH3 |
1 record matched | | CH4 + CH2=C → ·CH3 + C2H3 |
3 records matched | | CH4 + CH3O· → CH3OH + ·CH3 |
4 records matched | | CH4 + ·C2H → C2H2 + ·CH3 |
1 record matched | | CH4 + CD3 → CHD3 + ·CH3 |
1 record matched | | CH4 + ·C2H5 → C2H6 + ·CH3 |
1 record matched | | CH4 + ·CH2CH=CH2 → CH3CH=CH2 + ·CH3 |
2 records matched | | CH4 + PdO → PdOH + ·CH3 |
2 records matched | | CH4 + NiO → ·CH3 + NiOH |
1 record matched | | CH4 + MgO → ·CH3 + MgOH |
11 records matched | | CH4 → ·CH3 + H· |
6 records matched | | Benzene + CH2=CHCH=CH· → Indene + ·CH3 |
1 record matched | | Benzene + ·CH3 → Cyclohexadienyl, 6-methyl- |
1 record matched | | Benzene + ·CH3 → Toluene + H· |
3 records matched | | Benzene + ·CH3 → CH4 + Phenyl |
1 record matched | | Benzene + ·CH3 → Products |
1 record matched | | Benzene + ·CH3 → ipso-C7H9 |
1 record matched | | n-C5H11OH → ·CH3 + HOCH2CH2CH2CH2 |
1 record matched | | n-C4H9OH + ·CH3 → CH4 + CH3CH2CH2C(·)HOH |
2 records matched | | n-C4H9OH + ·CH3 → CH4 + CH3CH2CH2CH2O· |
1 record matched | | n-C4H9OH + ·CH3 → CH4 + HOCH2CH2CH2CH2 |
2 records matched | | n-C4H9OH + ·CH3 → CH3CH2CH(·)CH2OH + CH4 |
2 records matched | | n-C4H9OH + ·CH3 → CH3CH(·)CH2CH2OH + CH4 |
1 record matched | | n-C4H9OH + ·CH3 → CH3CH2CH2CH(·)OH + CH4 |
1 record matched | | n-C4H9OH + ·CH3 → (·)CH2CH2CH2CH2OH + CH4 |
1 record matched | | n-C4H9OH → ·CH3 + HOCH2CH2CH2· |
2 records matched | | n-C3H7OH → ·CH3 + HOCH2CH2· |
1 record matched | | (CH3)2SO + ·Cl → CH3S(O)Cl + ·CH3 |
1 record matched | | (CH3)2SO + O· → ·CH3 + CH3S(O)2 |
4 records matched | | (CH3)2SO + ·OH → ·CH3 + CH3S(O)OH |
1 record matched | | (CH3)2SO → ·CH3 + CH3SO |
1 record matched | | Acetone + O· → ·CH3 + CH3C(O)O |
1 record matched | | Acetone + ·OH → CH3C(O)OH + ·CH3 |
3 records matched | | Acetone + ·CH3 → (CH3)3CO· |
2 records matched | | Acetone + ·CH3 → CH4 + CH3C(O)CH2(·) |
1 record matched | | Acetone + ·CH3 → Adduct |
1 record matched | | Acetone + ·CH3 → Products |
1 record matched | | Acetone + ·CH3 → (CH3)2C(·)OCH3 |
1 record matched | | Acetone → ·CH3 + CH3CO |
6 records matched | | iso-C3H7OH → ·CH3 + CH3CH(·)OH |
1 record matched | | CH3OH + N → ·CH3 + :NOH |
5 records matched | | CH3OH + H· → ·CH3 + H2O |
2 records matched | | CH3OH + ·CH3 → CH4 + (·)CH2OH |
2 records matched | | CH3OH + ·CH3 → CH4 + CH3O· |
1 record matched | | CH3OH + ·CH3 → Other Products + CH4 |
8 records matched | | CH3OH → ·CH3 + ·OH |
1 record matched | | CH3C(O)OH + ·OH → CO2 + ·CH3 + H2O |
1 record matched | | C2H5OH + ·CH3 → (·)CH2OH |
1 record matched | | C2H5OH + ·CH3 → C2H5OCH3 + H· |
2 records matched | | C2H5OH + ·CH3 → CH4 + HOCH2CH2· |
2 records matched | | C2H5OH + ·CH3 → CH4 + CH3CH(·)OH |
2 records matched | | C2H5OH + ·CH3 → CH4 + CH3CH2O· |
1 record matched | | C2H5OH + ·CH3 → CH3OH + ·C2H5 |
2 records matched | | C2H5OH + ·CH3 → Products |
10 records matched | | C2H5OH → ·CH3 + (·)CH2OH |
1 record matched | | CH3NHNH2 + ·F → NHFNH2 + ·CH3 |
3 records matched | | CH3NHNH2 → ·CH3 + NH2NH |
1 record matched | | (C2H5)2O + ·CH3 → CH4 + C2H5OCH2CH2· |
1 record matched | | (C2H5)2O + ·CH3 → CH3CH(·)OCH2CH3 + CH4 |
2 records matched | | (C2H5)2O → C2H5OCH2(·) + ·CH3 |
1 record matched | | CN + CH3CH=CH2 → CH2CHCN + ·CH3 |
1 record matched | | CN + CH3NH2 → H2NCN + ·CH3 |
3 records matched | | CN + CH4 → HCN + ·CH3 |
1 record matched | | Benz[a]anthracene + ·CH3 → Products |
2 records matched | | Benzo[a]pyrene + ·CH3 → Other Products + CH4 |
1 record matched | | Benzo[a]pyrene + ·CH3 → benzo[a]pyrenyl armchair radical + CH4 |
1 record matched | | Benzo[a]pyrene + ·CH3 → benzo[a]pyrenyl zigzag radical + CH4 |
1 record matched | | CH2O + H2O → ·CH3 + HO2 |
1 record matched | | CH2O + ·CH → CO + ·CH3 |
1 record matched | | CH2O + C2H3 → H2C=C=O + ·CH3 |
1 record matched | | CH2O + ·CH3 → CH3OCH2· |
3 records matched | | CH2O + ·CH3 → CH3CH2O· |
7 records matched | | CH2O + ·CH3 → CH4 + HCO |
1 record matched | | CH2O + ·CH3 → Adduct |
1 record matched | | methylene (ground state) + CH2O → ·CH3 + HCO |
1 record matched | | O(1D) + CH3CN → ·CH3 + CNO |
1 record matched | | O(1D) + CH3CN → ·CH3 + NCO |
1 record matched | | O(1D) + CH4 → ·CH3 + ·OH |
1 record matched | | O2(1DELTA) + CH4 → ·CH3 + HO2 |
1 record matched | | O(3P) + ·CH3 → CH3O· |
1 record matched | | O(3P) + C2H6 → ·CH3 + (·)CH2OH |
1 record matched | | O(3P) + CH4 → ·CH3 + ·OH |
1 record matched | | CH3CHClO· → ·CH3 + HC(O)Cl |
1 record matched | | CH3CF2OO· + HO2 → COF2 + ·CH3 + ·OH + O2 |
1 record matched | | (CH3)2C(O)OCH2CH2OH → CH3C(O)OCH2CH2OH + ·CH3 |
1 record matched | | CH3OCH(·)CH2OCH3 → ·CH3 + CH3OCH2CHO |
2 records matched | | CH3OCH(·)OCH3 → HC(O)OCH3 + ·CH3 |
11 records matched | | O(3P) + CH4 → ·CH3 + ·OH |
1 record matched | | O(1D) + C2H5F → ·CH3 + ·CHFOH |
1 record matched | | O(1D) + C2H6 → Products + ·CH3 |
1 record matched | | O(1D) + CH4 → ·CH3 + ·OH |
1 record matched | | 5-Methyl-2-cyclopenten-2-yl → Cyclopentadiene + ·CH3 |
1 record matched | | CH2=CHC(CH3)(O·)CH2Cl → CH2=CHC(O)CH2Cl + ·CH3 |
1 record matched | | CH2=CHC(O)CH2Cl + ·CH3 → CH2=CHC(CH3)(O·)CH2Cl |
1 record matched | | CH2=CHC(CH3)2CH2· → CH2=C(CH3)CH=CH2 + ·CH3 |
2 records matched | | C6H5C(CH3)2CH2· → 2-Phenylpropene + ·CH3 |
1 record matched | | C6H5CH(CH3)CH2· → Styrene + ·CH3 |
1 record matched | | HC≡CC(CH3)CH2· → Vinylacetylene + ·CH3 |
1 record matched | | HC≡CC(CH3)2CH2· → CH2=C(CH3)C≡CH + ·CH3 |
1 record matched | | H2C=CHC(CH3)=CH· → Vinylacetylene + ·CH3 |
1 record matched | | (CH3)2C=CH· → CH2=C=CH2 + ·CH3 |
1 record matched | | (CH3)2C=CH· → CH3CCH + ·CH3 |
1 record matched | | HC≡CC(CH3)=CH· → 1,3-Butadiyne + ·CH3 |
1 record matched | | CH2=CHC(·)(CH3)CH2CH3 → CH2=C(CH3)CH=CH2 + ·CH3 |
1 record matched | | CH2=CHC(CH=CH2)=CH2 + ·CH3 → CH2=CHC(·)(CH=CH2)CH2CH3 |
1 record matched | | CH2=CHC(·)(CH=CH2)CH2CH3 → CH2=CHC(CH=CH2)=CH2 + ·CH3 |
1 record matched | | HC≡CC(·)HCH2CH3 → Vinylacetylene + ·CH3 |
1 record matched | | HC≡CC(·)(CH3)CH2CH3 → CH2=C(CH3)C≡CH + ·CH3 |
1 record matched | | CH2=C(·)CH2CH3 → CH2=C=CH2 + ·CH3 |
1 record matched | | CH2=C(CH3)CH(·)CH3 → 1,2-butadiene + ·CH3 |
1 record matched | | CH2=C(CH3)C(·)(CH3)2 → CH2=C=C(CH3)2 + ·CH3 |
1 record matched | | CH2=C=C(CH3)2 + ·CH3 → CH2=C(CH3)C(·)(CH3)2 |
1 record matched | | CH3CH2=CH(·) → C2H2 + ·CH3 |
1 record matched | | CH2=CHC(·)=CHCH3 → Vinylacetylene + ·CH3 |
2 records matched | | CH3CH=C(·)(CH3) → CH3CCH + ·CH3 |
1 record matched | | CH2=CHC(·)=CHCH3 → 1,3-Butadiyne + ·CH3 |
1 record matched | | C6H5C(·)(CH3)CH2CH3 → 2-Phenylpropene + ·CH3 |
1 record matched | | CH3CH2C(·)CH(CH3)2 → (CH3)2CHCH=CH2 + ·CH3 |
1 record matched | | CH3CH(CH3)CH(CH3)CH2· → (CH3)2CHCH=CH2 + ·CH3 |
1 record matched | | CH3C(·)=NH → ·CH3 + HNC |
1 record matched | | ScOH + ·CH3 → CH3OH + Sc |
1 record matched | | ScOH + ·CH3 → CH3ScOH |
1 record matched | | CH3CF2O(·) → COF2 + ·CH3 |
1 record matched | | CH2(X3B_1) + ·CH3 → C2H4 + H· |
1 record matched | | CH3CH2C(CH3)2O(·) → C2H5COCH3 + ·CH3 |
1 record matched | | 9-methylphenanthryl radical + ·CH3 → 9-phenanthrylethane |
1 record matched | | 9-methylhydrophenanthryl radical → Phenanthrene + ·CH3 |
1 record matched | | CH3BeOH → ·CH3 + Beryllium hydroxide |
1 record matched | | HOCO + ·CH3 → H2C=C=O + H2O |
1 record matched | | HOCO + ·CH3 → Products |
2 records matched | | S(1D) + C2H4 → ·CH3 + HC=S |
1 record matched | | CH3CH2CH(·)CH2OH + ·CH3 → CH3CH2CH(CH3)CH2OH |
2 records matched | | CH3CH2CH(·)CH2OH → CH2=CHCH2OH + ·CH3 |
2 records matched | | CH3CH(·)CH2CH2OH + ·CH3 → 3-methyl-1-butanol |
1 record matched | | OHC5H8 → ·CH3 + CH2=CHC(OH)=CH2 |
1 record matched | | CH2=CHC(O)CH2OH + ·CH3 → CH2=CHC(CH3)(O·)CH2OH |
1 record matched | | cy-CH3C(O·)CH=CHCHC(CH3)2CH(cy-CH2) → cy-CH(cy-CH2)C(CH3)2CHC(O)CH=CH + ·CH3 |
1 record matched | | CH3OSO → ·CH3 + SO2 |
1 record matched | | CH3N(·)NH2 → ·CH3 + H2N≡N |
1 record matched | | CH3CO(OH)2 → HOC(O)OH + ·CH3 |
1 record matched | | (CH3)3CC(CH3)2O· → tert-C4H9COCH3 + ·CH3 |
1 record matched | | (CH3)3CCH2C(CH3)2O· → neo-C5H11COCH3 + ·CH3 |
1 record matched | | (CH3)2C(·)OCH3 → Acetone + ·CH3 |
2 records matched | | C6H5CH(O·)CH3 → Benzaldehyde + ·CH3 |
1 record matched | | Ga(CH3)(NH2)2 + NH2 → Ga(NH2)3 + ·CH3 |
1 record matched | | Ga(CH3)(NH2)2 + ·CH3 → Ga(CH3)(CH2)NH· + CH4 |
1 record matched | | Ga(NH2)3 + ·CH3 → Ga(NH2)2NH· + CH4 |
1 record matched | | GaNH2 + ·CH3 → GaNH· + CH4 |
1 record matched | | Ga(CH3)2H + NH2 → Ga(CH3)NH2H + ·CH3 |
1 record matched | | Ga(CH3)2H + H· → Ga(CH3)H2 + ·CH3 |
1 record matched | | Ga(CH3)H2 + H· → ·CH3 + GaH3 |
1 record matched | | Ga(CH3)NH2H + NH2 → Ga(NH2)2H + ·CH3 |
1 record matched | | GaNH· + CH3Ga → GaNHGa + ·CH3 |
1 record matched | | GaNH· + (CH3)3Ga → GaNHGa(CH3)2 + ·CH3 |
1 record matched | | GaNH· + Ga(CH3)(NH2)2 → GaNHGa(NH2)2 + ·CH3 |
1 record matched | | Ga(CH3)2NH· + (CH3)3Ga → (CH3)2GaNHGa(CH3)2 + ·CH3 |
1 record matched | | Ga(CH3)2NH· + Ga(CH3)(NH2)2 → (CH3)(NH2)GaNHGa(CH3)NH2 + ·CH3 |
1 record matched | | Ga(CH3)(CH2)NH· + (CH3)3Ga → (CH3)2GaNHGa(CH3)(NH2) + ·CH3 |
1 record matched | | Ga(CH3)(CH2)NH· + Ga(CH3)(NH2)2 → (NH2)2GaNHGa(CH3)NH2 + ·CH3 |
1 record matched | | Ga(NH2)2NH· + (CH3)3Ga → (CH3)(NH2)GaNHGa(CH3)NH2 + ·CH3 |
1 record matched | | Ga(NH2)2NH· + Ga(CH3)(NH2)2 → (NH2)2GaNHGa(NH2)2 + ·CH3 |
1 record matched | | (CH3)2GaNHGa(CH3)(NH2) + ·CH3 → (CH3)2GaNHGa(CH3)NH· + CH4 |
1 record matched | | (CH3)(NH2)GaNHGa(CH3)NH2 + Ga(CH3)2NH· → (NH2)2GaNHGa(CH3)NHGa(CH3)2 + ·CH3 |
1 record matched | | (CH3)(NH2)GaNHGa(CH3)NH2 + Ga(CH3)(CH2)NH· → (NH2)(CH3)GaNHGa(CH3)NHGa(NH2)2 + ·CH3 |
1 record matched | | (CH3)2GaNHGa(CH3)2 + Ga(CH3)(CH2)NH· → (CH3)2GaNHGa(CH3)NHGa(CH3)NH2 + ·CH3 |
1 record matched | | (NH2)2GaNHGa(CH3)NH2 + Ga(CH3)2NH· → (NH2)(CH3)GaNHGa(CH3)NHGa(NH2)2 + ·CH3 |
1 record matched | | CH3CH2CH(·)CH2OOH → ·CH3 + CH2=CHCH2OOH |
1 record matched | | CH3CH2C(·)(OH)CH3 → ·CH3 + CH2=C(OH)CH3 |
1 record matched | | CH3CH(·)CH(OH)CH3 → CH3CH=CHOH (unspecified isomer) + ·CH3 |
1 record matched | | CH3OBr → ·CH3 + BrO |
1 record matched | | CH2=C(OH)-CH2· + H· → ·CH3 + CH3CO |
1 record matched | | HNiOCH3 → ·CH3 + NiOH |
1 record matched | | CH3NiOH → ·CH3 + NiOH |
1 record matched | | HC(O)OC(CH3)2O· → ·CH3 + Formic acetic anhydride |
1 record matched | | HC(O)OCH(CH3)O· → HC(O)OC(O)H + ·CH3 |
1 record matched | | CH3CH2CH2CH(·)CH(CH3)2 → ·CH3 + (Z)-2-C6H12 |
1 record matched | | CH3CH2CH2CH(·)CH(CH3)2 → ·CH3 + (E)-2-C6H12 |
1 record matched | | CH3CH2CH(·)CH2CH(CH3)2 → (CH3)2CHCH2CH=CH2 + ·CH3 |
1 record matched | | CH3CH2CH(·)CH2CH(CH3)2 → 1-C6H12 + ·CH3 |
1 record matched | | cyc-CH2SS + ·CH3 → CH3SSCH2 |
1 record matched | | cyc-CH2SS + ·CH3 → cyc-CH(·)SS + CH4 |
1 record matched | | cyc-CH2SS + ·CH3 → CH3SCH2S· |
1 record matched | | cyc-CH(·)SS + CH4 → cyc-CH2SS + ·CH3 |
1 record matched | | S=C(·)-S-CH3 → CS2 + ·CH3 |
1 record matched | | CH3SCH2S· → cyc-CH2SS + ·CH3 |
1 record matched | | CH3C(·)HCH(CH3)OOH → ·CH3 + CH3CH=CHOOH |
1 record matched | | (CH3)2C(·)CH(CH3)OOH → (CH3)2C=CHOOH + ·CH3 |
1 record matched | | ·CH2CH(CH3)CH2OOH → ·CH3 + CH2=CHOOH |
1 record matched | | ·CH2CH(CH3)CH2OOH → ·CH3 + CH2=CHCH2OOH |
1 record matched | | ·CH2CH(CH3)CH2OH + ·CH3 → CH3CH2CH(CH3)CH2OH |
4 records matched | | 3-C5H11 → 1-C4H8 + ·CH3 |
1 record matched | | 1-Phenanthryl + ·CH3 → 1-Methylphenanthrene |
1 record matched | | 1-Phenanthryl + ·CH3 → 1-Phenanthrylmethyl + H· |
1 record matched | | (CH3)2CHCH(·)CH2OOH → CH3CH=CHCH2OOH + ·CH3 |
1 record matched | | ·CH2CH(CH3)CH(CH3)OOH → CH2=CHCH(CH3)OOH + ·CH3 |
1 record matched | | CH3CH(·)CH(CH3)CH2OOH → CH3CH=CHCH2OOH + ·CH3 |
1 record matched | | CH3OCH(·)CH3 → CH3CHO + ·CH3 |
1 record matched | | CH3OCH(·)CH2CH3 → C2H5CHO + ·CH3 |
1 record matched | | CH3OCH(·)CH(CH3)2 → (CH3)2CHCHO + ·CH3 |
1 record matched | | CH3CH=CHCH(·)CH2CH3 → (E)-CH2=CHCH=CHCH3 + ·CH3 |
1 record matched | | trans-CH2=C=CHCH=C(CH3)O· → CH2=C=CHCH=C=O + ·CH3 |
1 record matched | | cis-CH3NHNH· → ·CH3 + (E)-HN=NH |
1 record matched | | cis-CH3NHNH· → ·CH3 + (Z)-HN=NH |
1 record matched | | trans-CH3NHNH· → ·CH3 + (Z)-HN=NH |
1 record matched | | trans-CH3NHNH· → ·CH3 + HN=NH |
1 record matched | | CH3CH2C(·)(CH3)CH2OOH → CH2=C(CH3)CH2OOH + ·CH3 |
1 record matched | | ·CH2C(CH3)2CH2OOH → CH2=C(CH3)CH2OOH + ·CH3 |
1 record matched | | 1-(2-Chloroethyl)-2-methylsulfanylbenzene → ·CH3 + Benzothiophane + ·Cl |
2 records matched | | 1,4-epoxy-1,4-dimethyl-1-buten-3-yl radical → 2-Methylfuran + ·CH3 |
1 record matched | | (CH3)3CC(·)HC(OOH)(CH3)2 → (CH3)2C=CHC(CH3)2OOH + ·CH3 |
1 record matched | | (CH3)2Se(O)OH → ·CH3 + CH3Se(O)OH |
2 records matched | | CH3C(O)CH=C=C(·)CH3 → O=C=CHC≡CCH3 + ·CH3 |
1 record matched | | 2,3-dihydro-2-methylfuran-3-yl radical → Furan + ·CH3 |
2 records matched | | (OH)3SiOCH2CH3 → (OH)3SiOCH2· + ·CH3 |
1 record matched | | (OH)3SiOCH2· + ·CH3 → (OH)3SiOCH2CH3 |
1 record matched | | CH2=CHCH2CH2CH(CH3)CH2· → CH2=CHCH2CH2CH=CH2 + ·CH3 |
1 record matched | | 2-methyl-cyclohexyl → Cyclohexene + ·CH3 |
1 record matched | | O=C(·)OCH2CH2SCH3 → ·CH3 + 1,3-Oxathiolan-2-one |
1 record matched | | O=C(·)OCH2CH2CH2SCH3 → 1,3-Oxathian-2-one + ·CH3 |
1 record matched | | CH2=CHCH(·)CH(CH3)CH2CH3 → C2H5CH=CHCH=CH2 + ·CH3 |
1 record matched | | CH3CH2C(·)=CHC(O)OCH3 → ·CH3 + CH3OC(O)CHCCH2 |
1 record matched | | CH3CH=C(·)CH2C(O)OCH3 → ·CH3 + Methyl 3-butynoate |
1 record matched | | CH3C(O)CH(·)CH2C(O)OCH3 → CH3OC(O)CH2CH=C=O + ·CH3 |
1 record matched | | CH3CH2CH(·)CH2OC(O)H → Allyl formate + ·CH3 |
1 record matched | | Perfluorodedecahedrane + ·CH3 → Products |
1 record matched | | C6H5CH2CH(·)CH2CH3 → 3-Phenylpropene + ·CH3 |
1 record matched | | C6H5CH2CH(·)CH2CH3 → 2-Phenylpropene + ·CH3 |
1 record matched | | CH3CH2CH(·)CH2C(O)OCH3 → ·CH3 + CH2=CHCH2C(O)OCH3 |
1 record matched | | 3-C12H25 → 1-Undecene + ·CH3 |
1 record matched | | 2-methylcyclopropyl → ·CH3 + Cyclopropene |
1 record matched | | benzo[a]pyrenyl armchair radical + CH4 → Benzo[a]pyrene + ·CH3 |
1 record matched | | benzo[a]pyrenyl zigzag radical + CH4 → Benzo[a]pyrene + ·CH3 |
1 record matched | | ·CH2OCH2OCH3 → HC(O)OCH3 + ·CH3 |
1 record matched | | 2,3-Epoxytetrahydrofuran + ·CH3 → 2,3-Epoxytetrahydrofuran-2-yl + CH4 |
1 record matched | | 2,3-Epoxytetrahydrofuran + ·CH3 → 2,3-Epoxytetrahydrofuran-3-yl + CH4 |
1 record matched | | 2,3-Epoxytetrahydrofuran + ·CH3 → 2,3-Epoxytetrahydrofuran-4-yl + CH4 |
1 record matched | | 2,3-Epoxytetrahydrofuran + ·CH3 → 2,3-Epoxytetrahydrofuran-5-yl + CH4 |
1 record matched | | CH3CH(O·)CH2CH2CH2CH3 → n-C4H9CHO + ·CH3 |
6 records matched | | 2-pentoxy radical → CH3CH2CH2CHO + ·CH3 |
1 record matched | | CH2=CHC(CH3)(O·)CH2OH → CH2=CHC(O)CH2OH + ·CH3 |
1 record matched | | CH3SC(·)(CH3)SCH3 → S=C(CH3)SCH3 + ·CH3 |
1 record matched | | CH3SC(·)(C5H5)SCH3 → S=C(C5H5)SCH3 + ·CH3 |
1 record matched | | CH3SC(·)(C7H7)SCH3 → S=C(C7H7)SCH3 + ·CH3 |
1 record matched | | S=C(C5H5)SCH3 + ·CH3 → CH3SC(·)(C5H5)SCH3 |
1 record matched | | S=C(C7H7)SCH3 + ·CH3 → CH3SC(·)(C7H7)SCH3 |
2 records matched | | Propyl Radical → C2H4 + ·CH3 |
1 record matched | | GaMe2NH2 + NH2 → Ga(CH3)(NH2)2 + ·CH3 |
1 record matched | | GaMe2NH2 + H· → GaNH2 + CH4 + ·CH3 |
1 record matched | | GaMe2NH2 + ·CH3 → GaNH2 + C2H6 + ·CH3 |
1 record matched | | GaMe2NH2 + ·CH3 → Ga(CH3)2NH· + CH4 |
1 record matched | | GaMe2NH2 + GaNH· → GaNHGa(CH3)NH2 + ·CH3 |
1 record matched | | GaMe2NH2 + Ga(CH3)2NH· → (CH3)2GaNHGa(CH3)(NH2) + ·CH3 |
1 record matched | | GaMe2NH2 + Ga(CH3)(CH2)NH· → (CH3)(NH2)GaNHGa(CH3)NH2 + ·CH3 |
1 record matched | | GaMe2NH2 + Ga(NH2)2NH· → (NH2)2GaNHGa(CH3)NH2 + ·CH3 |
1 record matched | | H2CS + ·CH3 → CH3CH2S |
1 record matched | | H2CS + ·CH3 → CH4 + HC=S |
1 record matched | | CH2=CHCH(CH3)O → CH2=CHCHO + ·CH3 |
1 record matched | | CH3Li + ·CH3 → CH2Li + CH4 |
1 record matched | | ·CH2OC(O)CH2CH2CH3 + CH4 → Methyl butanoate + ·CH3 |
1 record matched | | CH3OC(O)CH·CH2CH3 + CH4 → Methyl butanoate + ·CH3 |
1 record matched | | CH3OC(O)CH·CH2CH3 → CH2=CHC(O)OCH3 + ·CH3 |
1 record matched | | CH3OC(O)CH2CH·CH3 + CH4 → Methyl butanoate + ·CH3 |
1 record matched | | CH3OC(O)CH2CH2CH2· + CH4 → Methyl butanoate + ·CH3 |
1 record matched | | CH3CH2CH2NHC(O)OCH3 + ·CH3 → Products + CH4 |
1 record matched | | ·CH2CH(C6H5)CH3 → Styrene + ·CH3 |
1 record matched | | CH3CH(·)CH2C6H5 → Styrene + ·CH3 |
1 record matched | | C30H18 + ·CH3 → Products |
1 record matched | | C26H16 + ·CH3 → Products |
2 records matched | | ipso-C7H9 → Benzene + ·CH3 |
1 record matched | | C6H5C(O*)(CH3)2 → 1-Phenylethanone + ·CH3 |
1 record matched | | C2(X1ΣPlg) + CH4 → ·C2H + ·CH3 |
1 record matched | | CF2-trip + CH4 → ·CH3 + ·CHF2 |
1 record matched | | methylcyclopentadiene (mixture of isomers) → Cyclopentadienyl + ·CH3 |
1 record matched | | (·)OP(OH)3CH3 → O=P(OH)3 + ·CH3 |
1 record matched | | O2(X3Sigma_g-) + C2H4 → ·CH3 + HCOO |
1 record matched | | O2(b1Sigma_g+) + CH4 → ·CH3 + HO2 |
1 record matched | | trans-Rh(P(CH3)3)2(CO)Cl + ·CH3 → Products |
2 records matched | | C2(a3PIu) + CH4 → ·C2H + ·CH3 |
2 records matched | | InCH3(singlet) + ·CH3 → In(CH3)2 |
3 records matched | | InCH3(singlet) → ·CH3 + In |
2 records matched | | InCH3(triplet) + ·CH3 → In(CH3)2 |
2 records matched | | InCH3(triplet) → ·CH3 + In |
1 record matched | | ·CH3 + HN=N → CH2N2 + H2 |
1 record matched | | ·CH3 + O· → CO + H2 + H· |
1 record matched | | ·CH3 + N2O → CH3O· + N2 |
1 record matched | | ·CH3 + N2O → CH2=NH + NO |
1 record matched | | ·CH3 + HO2 → CH3O· + ·OH |