Kinetics Database Logo     Home
©NIST, 2023
Accessibility information
Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences

Contact Us to Submit an Article



Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty


Administrative Links

DOC home page

NIST home page

MML home page

Chemical Sciences Division

Applied Chemicals and Materials Division

Search Results

Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
1 record matched Cl2O2 + ·Cl → Products
1 record matched HO2 + ·Cl → ·OH + ClO
1 record matched ·CCl3 + Cl2 → CCl4 + ·Cl
1 record matched CH2=C=CH2 + ·Cl → CH2=C=CH + HCl
2 records matched Cyclopentene + ·Cl → Products
1 record matched CH3CH=CH2 + ·Cl → Products
2 records matched Ethylbenzene + ·Cl → Products
1 record matched iso-C3H7I + ·Cl → Products
4 records matched CCl3O → COCl2 + ·Cl
3 records matched CFCl2O → COClF + ·Cl
2 records matched CF2ClO → COF2 + ·Cl
4 records matched ·Cl + CH3CCl2F → ·CH2CCl2F + HCl
4 records matched ·Cl + ·Cl → Cl2
9 records matched OClO + ·Cl → ClO + ClO
1 record matched ClO + ·Cl → Cl2 + O·
10 records matched ClO + O· → O2 + ·Cl
8 records matched ClO + ClO → OClO + ·Cl
8 records matched ClO + ClO → ClOO + ·Cl
1 record matched IO + ClO → O2 + I + ·Cl
1 record matched HOONO + ·Cl → HCl + NO3
6 records matched ClONO2 + ·Cl → Cl2 + NO3
2 records matched ClONO2 + ·Cl → Products
1 record matched ClN3 + ·Cl → Cl2 + ·N3
2 records matched SO + ClO → SO2 + ·Cl
3 records matched ClNO2 → NO2 + ·Cl
5 records matched Cl2O2 + ·Cl → Cl2 + ClOO
2 records matched Cl2O2 + ·Cl → Products
8 records matched NO3 + ·Cl → NO2 + ClO
4 records matched NO2 + ·Cl → ClNO2
4 records matched NO2 + ·Cl → ClNO2
1 record matched NO + CClF2OO → COF2 + NO2 + ·Cl
1 record matched NO + CCl2FO2 → COClF + NO2 + ·Cl
1 record matched NO + CCl3O2 → COCl2 + NO2 + ·Cl
3 records matched NO + ·Cl → NOCl
9 records matched NO + ClO → NO2 + ·Cl
1 record matched Br· + BrCl → Br2 + ·Cl
2 records matched ClOO + ·Cl → ClO + ClO
2 records matched ClOO + ·Cl → O2 + Cl2
5 records matched ClOO → O2 + ·Cl
1 record matched HBr + ·Cl → HCl + Br·
9 records matched O3 + ·Cl → O2 + ClO
7 records matched Cl2O + ·Cl → Cl2 + ClO
2 records matched HOCl + ·Cl → Products
7 records matched H2S + ·Cl → HCl + SH
2 records matched Cl2 + O· → ClO + ·Cl
2 records matched Cl2 + SH → HSCl + ·Cl
1 record matched Cl2 + H· → HCl + ·Cl
2 records matched Cl2 → ·Cl + ·Cl
1 record matched O2 + ·Cl → ClO + O·
11 records matched O2 + ·Cl → ClOO
1 record matched D2 + ·Cl → DCl + D
1 record matched H2O + ·Cl → ·OH + HCl
2 records matched Br2 + ·Cl → Br· + BrCl
8 records matched H2O2 + ·Cl → HO2 + HCl
4 records matched HNO3 + ·Cl → HCl + NO3
2 records matched HNO3 + ·Cl → Products
1 record matched HCl + ·Cl → Cl2 + H·
5 records matched HCl + O· → ·OH + ·Cl
1 record matched HCl + ·F → HF + ·Cl
3 records matched HCl + H· → H2 + ·Cl
5 records matched HCl + NO3 → HNO3 + ·Cl
1 record matched HCl → H· + ·Cl
2 records matched SO2 + ClO → SO3 + ·Cl
1 record matched Cu + Cl2 → CuCl + ·Cl
2 records matched Na + Cl2 → NaCl + ·Cl
1 record matched ·CCl + O· → CO + ·Cl
1 record matched ·OH + ·Cl → HCl + O·
1 record matched ·OH + ClO → HO2 + ·Cl
6 records matched ·OH + Cl2 → HOCl + ·Cl
1 record matched ·OH + DCl → HDO + ·Cl
10 records matched ·OH + HCl → H2O + ·Cl
9 records matched HO2 + ·Cl → HCl + O2
8 records matched HO2 + ·Cl → ·OH + ClO
2 records matched HO2 + ·Cl → Products
1 record matched ·CCl3 + O· → COCl2 + ·Cl
1 record matched C2H5OO· + ·Cl → HCl + CH3CH(·)OO·
2 records matched C2H5OO· + ·Cl → CH3CH2O· + ClO
1 record matched C2H5OO· + ·Cl → Other Products + HCl
2 records matched CH3OOH + ·Cl → Other Products + HCl
1 record matched CH3OOH + ·Cl → Products
4 records matched CF3CHFCl + ·Cl → CF3CFCl· + HCl
2 records matched NOCl + ·Cl → Cl2 + NO
1 record matched NOCl → NO + ·Cl
1 record matched ClCO + ·Cl → CO + Cl2
3 records matched ClCO → CO + ·Cl
3 records matched HC(O)Cl + ·Cl → ClCO + HCl
1 record matched Phenyl + DCl → Benzene-d + ·Cl
1 record matched Phenyl + HCl → Benzene + ·Cl
5 records matched CH3C(O)OONO2 + ·Cl → Products
1 record matched ·CF3 + HCl → CHF3 + ·Cl
1 record matched ·CH3 + Cl2 → CH3Cl + ·Cl
2 records matched ·CH3 + HCl → CH4 + ·Cl
1 record matched CH3O2· + ·Cl → HCl + CH2OO
1 record matched CH3O2· + ·Cl → CH3O· + ClO
1 record matched CH3O2· + ·Cl → Products
2 records matched (CH3)2CHONO2 + ·Cl → Other Products + HCl
1 record matched (CH3)2CHONO2 + ·Cl → Products
13 records matched H2 + ·Cl → HCl + H·
1 record matched n-C4H9ONO2 + ·Cl → Products
4 records matched CF3CH2F + ·Cl → HCl + CF3CHF
1 record matched CH3D + ·Cl → Products
5 records matched CO + ·Cl → ClCO
3 records matched n-C3H7ONO2 + ·Cl → Products
2 records matched C2H5ONO2 + ·Cl → Other Products + HCl
1 record matched C2H5ONO2 + ·Cl → Products
4 records matched CH2FCH2F + ·Cl → HCl + CH2FCHF
2 records matched CH3ONO2 + ·Cl → Other Products + HCl
1 record matched CH3ONO2 + ·Cl → Products
4 records matched CH2FCl + ·Cl → HCl + ·CClFH
4 records matched CH3F + ·Cl → ·CH2F + HCl
1 record matched Iodobenzene + ·Cl → Products
1 record matched CD4 + ·Cl → CD3 + DCl
1 record matched CH3C(O)OC(CH3)3 + ·Cl → Products
6 records matched COS + ·Cl → CO + SCl
4 records matched CH2FCHF2 + ·Cl → HCl + CHF2C(·)HF
4 records matched CH2FCHF2 + ·Cl → HCl + CH2FC(·)F2
4 records matched CH3CF3 + ·Cl → CF3CH2 + HCl
4 records matched CHF2CHF2 + ·Cl → HCl + CHF2CF2
4 records matched C2F5H + ·Cl → C2F5 + HCl
5 records matched C2H5F + ·Cl → HCl + CH3C(·)HF
3 records matched C2H5F + ·Cl → HCl + CH2CH2F
4 records matched CF3CHCl2 + ·Cl → HCl + CF3CCl2
1 record matched (E)-CHCl=CHCl + ·Cl → CHCl2CHCl
1 record matched (Z)-CHCl=CHCl + ·Cl → CHCl2CHCl
4 records matched C2Cl4 + ·Cl → C2Cl5
1 record matched C2Cl4 + ·Cl → Products
2 records matched C2H5CHO + ·Cl → Other Products + HCl
1 record matched C2H5CHO + ·Cl → Products
1 record matched methyl salicylate + ·Cl → Products
1 record matched Isobutene + ·Cl → Products
1 record matched CH3CH=CH2 + ·Cl → Products
1 record matched 1-C4H10 + ·Cl → 1-C4H9 + HCl
2 records matched C2HCl3 + ·Cl → Products
1 record matched C2HCl3 + H· → CH2=CCl2 + ·Cl
1 record matched C2H5COCH3 + ·Cl → Products
2 records matched CF3CH2Cl + ·Cl → HCl + CF3CHCl
4 records matched CH3CF2Cl + ·Cl → CF2ClCH2· + HCl
2 records matched CHF3 + ·Cl → ·CF3 + HCl
4 records matched CHF2Cl + ·Cl → ·CClF2 + HCl
4 records matched CHFCl2 + ·Cl → ·CCl2F + HCl
4 records matched CH3CHF2 + ·Cl → HCl + CH2CHF2
4 records matched CH3CHF2 + ·Cl → HCl + CH3CF2
1 record matched CH2=CCl2 + ·Cl → Products
5 records matched (CH3)2S + ·Cl → Products
4 records matched CS2 + ·Cl → Products
2 records matched CS2 + O2 + ·Cl → Products
4 records matched CH2F2 + ·Cl → ·CHF2 + HCl
6 records matched CH2Cl2 + ·Cl → CHCl2 + HCl
4 records matched CH3CHO + ·Cl → CH3CO + HCl
6 records matched CH3CN + ·Cl → Products
2 records matched CH2=CHCl + ·Cl → Products
1 record matched C3H8 + ·Cl → 1-C3H7 + HCl
5 records matched C3H8 + ·Cl → Other Products + HCl
2 records matched CH2ClBr + ·Cl → HCl + ·CHBrCl
2 records matched CH2Br2 + ·Cl → HCl + CHBr2
2 records matched CH3SH + ·Cl → CH3S· + HCl
4 records matched CH3SH + ·Cl → Products
7 records matched CH3Cl + ·Cl → ·CH2Cl + HCl
8 records matched C2H2 + ·Cl → CHCl=CH
9 records matched C2H4 + ·Cl → CH2CH2Cl
12 records matched C2H6 + ·Cl → ·C2H5 + HCl
2 records matched CH3Br + ·Cl → HCl + ·CH2Br
10 records matched CH4 + ·Cl → ·CH3 + HCl
6 records matched CH3CCl3 + ·Cl → HCl + CCl3CH2
1 record matched Benzene + ·Cl → Phenyl + HCl
2 records matched CH3CH2CH2OH + ·Cl → Other Products + HCl
1 record matched CH3CH2CH2OH + ·Cl → Products
2 records matched (CH3)2SO + ·Cl → CH3SCH2O· + HCl
6 records matched CHCl3 + ·Cl → ·CCl3 + HCl
3 records matched Acetone + ·Cl → CH3C(O)CH2(·) + HCl
2 records matched iso-C3H7OH + ·Cl → Other Products + HCl
5 records matched CH3OH + ·Cl → (·)CH2OH + HCl
2 records matched CH3C(O)OH + ·Cl → Other Products + HCl
1 record matched CH3C(O)OH + ·Cl → Products
2 records matched HCOOH + ·Cl → Other Products + HCl
1 record matched HCOOH + ·Cl → Products
2 records matched C2H5OH + ·Cl → Other Products + HCl
2 records matched C2H5OH + ·Cl → Products
6 records matched CH2O + ·Cl → HCO + HCl
1 record matched M + CFCl2O → M + COClF + ·Cl
1 record matched M + CF2ClO → M + COF2 + ·Cl
1 record matched M + ClOO → M + O2 + ·Cl
1 record matched M + O2 + ·Cl → M + ClOO
1 record matched M + ClCO → M + CO + ·Cl
1 record matched M + CO + ·Cl → M + ClCO
1 record matched M + C2Cl4 + ·Cl → M + Products
1 record matched M + CH3CH=CH2 + ·Cl → M + ClCH2CHCH3
1 record matched M + C2H2 + ·Cl → M + CH2=CCl
1 record matched M + C2H4 + ·Cl → M + CH2CH2Cl
1 record matched ClCH=CHOO(.) → (CHO)2 + ·Cl
2 records matched CHClFO(.) → HFCO + ·Cl
2 records matched CCl3O → COCl2 + ·Cl
3 records matched CFCl2O → COClF + ·Cl
9 records matched CCl2=CCl → ClC≡CCl + ·Cl
1 record matched CF2ClO → COF2 + ·Cl
1 record matched C2Cl5O → CCl3COCl + ·Cl
2 records matched CCl3CHCl → C2HCl3 + ·Cl
5 records matched CH2ClCHCl· → CH2=CHCl + ·Cl
1 record matched ·Cl + C3F7CF(OC2H5)CF(CF3)2 → Products + HCl
1 record matched ·Cl + C3F7CF(OC2H5)CF(CF3)2 → Products
4 records matched ·Cl + CH3OC4F9 → CH2OC4F9 + HCl
2 records matched ·Cl + CH2DCD2Cl → CH2DCDCl(.) + DCl
1 record matched ·Cl + CF3CFClCH2Cl → Products
1 record matched ·Cl + CHClFCHO → Products
2 records matched ·Cl + CH2ClOOH → Products
2 records matched ·Cl + CH2FOOH → HCl + CH2FO2
1 record matched ·Cl + CFCl2CH2OO(·) → CFCl2CH2O· + ClO
1 record matched ·Cl + CF3CF2CF(OCH3)CF(CF3)2 → Products
5 records matched ·Cl + CF3C(O)CHCl2 → Products
2 records matched ·Cl + CHD2CH2Cl → CHD2CHCl(.) + HCl
2 records matched ·Cl + n-C5H11CH(CH3)ONO2 → Products
5 records matched ·Cl + (E)-CF3CH=CHCl → Products
1 record matched ·Cl + (E)-CF3CH=CHCl → CF3CH(·)CHCl2
1 record matched ·Cl + (E)-CF3CH=CHCl → CF3CHClCHCl·
2 records matched ·Cl + (Z)-CF3CH=CHCl → Products
1 record matched ·Cl + (Z)-CF3CH=CHCl → CF3CH(·)CHCl2
1 record matched ·Cl + (Z)-CF3CH=CHCl → CF3CHClCHCl·
2 records matched ·Cl + CD3CHDCl → (.)CD2CHDCl + DCl
1 record matched ·Cl + FC(O)O· → Adduct
5 records matched ·Cl + FC(O)O· → FC(O)OCl
3 records matched ·Cl + CHF2CHFOCF3 → Products
1 record matched ·Cl + (CD3)2NNO2 → Other Products + DCl
1 record matched ·Cl + ·C2D5 → C2D4 + DCl
1 record matched ·Cl + CF3CF2CF2CH=CH2 → Products
5 records matched ·Cl + CH2CBrCF2CF3 → Products
1 record matched ·Cl + CD3SD → Other Products + DCl
2 records matched ·Cl + CF3CH2CCl2F → Products
4 records matched ·Cl + C6F13CHO → Products
1 record matched ·Cl + CD2ClCD2Cl → Products
1 record matched ·Cl + CD2ClCD2Cl → CD2ClCDCl· + DCl
1 record matched ·Cl + CCl2FCHO → Products
1 record matched ·Cl + γ-Valerolactone → Products
10 records matched ·Cl + CF3CHFOCHF2 → Products
1 record matched ·Cl + CF3CHFOCHF2 → CF3C(·)FOCHF2 + HCl
1 record matched ·Cl + CF3CHFOCHF2 → CF3CHFOC(·)F2 + HCl
1 record matched ·Cl + CD3CHCl2 → Other Products + DCl
1 record matched ·Cl + CD3CHCl2 → Other Products + HCl
7 records matched ·Cl + C6F13CH2CHO → Products
1 record matched ·Cl + CD3CDClCD3 → Other Products + DCl
2 records matched ·Cl + CF3CF2CF2CF2H → Products
7 records matched ·Cl + Butanoic acid, 2-methyl-, methyl ester → Products
1 record matched ·Cl + 1-Methoxy-2-butanol → Products
2 records matched ·Cl + CF3CHClOCH2CH3 → Other Products + HCl
1 record matched ·Cl + 1-trifluoromethyl-1,2,2-trifluorocyclobutane → Products
5 records matched ·Cl + (CF3)2CFCN → Products
1 record matched ·Cl + CH3OC(O)OCH2Cl → Products
1 record matched ·Cl + BrONO2 → NO3 + BrCl
2 records matched ·Cl + Ethyl-2-methyl-pentanoate → Products
1 record matched ·Cl + CD2HC(O)CD3 → Products
2 records matched ·Cl + 2,2-Dichloroethyl methyl ether → Other Products + HCl
7 records matched ·Cl + (Z)-3-Hexenyl formate → Products
1 record matched ·Cl + 1-Chloro-3-pentanone → Products
3 records matched ·Cl + H(O)COCH2OC(O)H → Products
4 records matched ·Cl + CH2=CHCF3 → Products
1 record matched ·Cl + CH2=CHCF3 → CF3CHCH2Cl
1 record matched ·Cl + CH2=CHCF3 → CF3CHClCH2
3 records matched ·Cl + CF3CH2OCHO → Products
5 records matched ·Cl + CH2FOCH(CF3)2 → Products
1 record matched ·Cl + CHF2OCHClCF3 → Other Products + HCl
8 records matched ·Cl + CHF2OCHClCF3 → Products
3 records matched ·Cl + NCl2 → Cl2 + NCl
2 records matched ·Cl + CHD2CD2Cl → Other Products + DCl
2 records matched ·Cl + CHD2CD2Cl → CHD2CDCl(.) + DCl
5 records matched ·Cl + CH2=CHC6F13 → Products
8 records matched ·Cl + CH3CCl2F → ·CH2CCl2F + HCl
1 record matched ·Cl + ClF2 → ClF + ClF
1 record matched ·Cl + CCl3CHCl → CHCl2CCl3
1 record matched ·Cl + CCl3CHCl → Products
2 records matched ·Cl + CH2DCH2Cl → Other Products + HCl
2 records matched ·Cl + CH2DCH2Cl → CH2DCHCl(.) + HCl
47 records matched ·Cl + ·Cl → Cl2
1 record matched α-Methyl-γ-crotonolactone + ·Cl → Products
1 record matched CF3OCl + ·Cl → Cl2 + CF3O
2 records matched n-C3H7CH(CH3)NO3 + ·Cl → Products
3 records matched C8F17CH=CH2 + ·Cl → Products
1 record matched (Z)-3-Octen-1-ol + ·Cl → Products
2 records matched CD3CHO + ·Cl → HCl + CD3CO
1 record matched HOCH + ·Cl → HCO + HCl
5 records matched CH2=CHC4F9 + ·Cl → Products
1 record matched C2D5Cl + ·Cl → Other Products + DCl
5 records matched C2D5Cl + ·Cl → CD3CD(·)Cl + DCl
3 records matched C2D5Cl + ·Cl → ·CD2CD2Cl + DCl
1 record matched SiCl3 → SiCl2 + ·Cl
1 record matched C6H11ClO2 + ·Cl → Products
4 records matched (E)-2-Hepten-1-al + ·Cl → Products
2 records matched CH3CH=CHC(O)OCH3 + ·Cl → Products
1 record matched Propane, 1,1,2,3-tetrachloro- + ·Cl → Products
6 records matched CH3CHClC(O)OCH3 + ·Cl → Products
3 records matched OClO + ·Cl → ClO + ClO
1 record matched CF3O2 + ·Cl → ClO + CF3O
2 records matched CF3O2 + ·Cl → Products
2 records matched AlCl2 → AlCl + ·Cl
1 record matched 3-Pentenenitrile, (3E)- + ·Cl → Products
1 record matched CH3CHCl + ·Cl → CH2=CHCl + HCl
1 record matched CH2CH2Cl → CH2=CHCl + ·Cl
3 records matched CH2CH2Cl → C2H4 + ·Cl
1 record matched 2,4,4-Trimethyl-1-pentanol + ·Cl → Products
1 record matched 2,4-dimethylbenzaldehyde + ·Cl → Products
2 records matched ClCH2OH + ·Cl → ClCH(·)OH + HCl
1 record matched FSO3 + ·Cl → FSO2OCl
1 record matched SCl + N → NS + ·Cl
1 record matched SCl + O· → SO + ·Cl
1 record matched ClO + N → NO + ·Cl
15 records matched ClO + O· → O2 + ·Cl
9 records matched ClO + ClO → OClO + ·Cl
11 records matched ClO + ClO → ClOO + ·Cl
2 records matched ClO + ClO → O2 + ·Cl + ·Cl
5 records matched 1-methoxy-2-ethylbenzene + ·Cl → Products
1 record matched IO + ·Cl → I + ClO
1 record matched IO + ClO → O2 + I + ·Cl
2 records matched ClONO2 + ·Cl → Cl2 + NO3
2 records matched ClONO2 + ·Cl → Products
4 records matched ·N3 + ·Cl → N2 + NCl
1 record matched ·N3 + ·Cl → NCl(a1DELTA) + N2
1 record matched ·N3 + ·Cl → NCl(b1SIGMA) + N2
1 record matched ·N3 + ·Cl → NCl(Χ3Σ-) + N2
2 records matched DI + ·Cl → DCl + I
2 records matched FSO2OCl + ·Cl → Cl2 + FSO3
5 records matched HD + ·Cl → DCl + H·
2 records matched HD + ·Cl → HCl + D
3 records matched HD + ·Cl → Products
3 records matched ClN3 + ·Cl → Cl2 + ·N3
1 record matched SiCl → Si + ·Cl
2 records matched SH + ·Cl → HCl + S
1 record matched BrCl + ·Cl → Cl2 + Br·
1 record matched BrCl + O· → BrO + ·Cl
1 record matched CHF2OCF2CHFCl + ·Cl → Other Products + HCl
5 records matched CHF2OCF2CHFCl + ·Cl → Products
2 records matched SO + ClO → SO2 + ·Cl
1 record matched ·NH2 + ·Cl → HCl + NH
1 record matched SiH3 + ·Cl → Products
1 record matched Nitrogen chloride fluoride (nclf2) + ·Cl → NF2 + Cl2
1 record matched SiCl2 → SiCl + ·Cl
1 record matched SiD4 + ·Cl → DCl + SiD3
2 records matched D2S + ·Cl → DCl + SD
1 record matched DBr + ·Cl → DCl + Br·
1 record matched HOBr + ·Cl → ·OH + BrCl
1 record matched HOBr + ·Cl → Products
1 record matched 3-Carene + ·Cl → Products
2 records matched SiH3Cl + ·Cl → HCl + SiH2Cl
1 record matched ClNO2 + ·Cl → Cl2 + NO2
4 records matched ClNO2 → NO2 + ·Cl
3 records matched (CH3)3CD + ·Cl → HCl + (CH3)2CDC(·)H2
2 records matched (CH3)3CD + ·Cl → Products
4 records matched (CF3)2CHOCH3 + ·Cl → Products
1 record matched Propane, 1,2,2,3-tetrachloro + ·Cl → Products
1 record matched CH3OCH2I + ·Cl → Other Products + HCl
1 record matched BrCH2OCH3 + ·Cl → Other Products + HCl
1 record matched CD3NO2 + ·Cl → Products
1 record matched Cl2O2 + ·Cl → Cl2 + ClOO
1 record matched NCl + N → N2 + ·Cl
1 record matched NCl + O· → NO + ·Cl
1 record matched NCl + ClO → NOCl + ·Cl
5 records matched NO3 + ·Cl → NO2 + ClO
1 record matched NO3 + ClO → O2 + NO2 + ·Cl
2 records matched Cl3 + ·Cl → Cl2 + Cl2
2 records matched Cl3 → Cl2 + ·Cl
2 records matched (C2H5)2NO + ·Cl → Products
1 record matched Ethyl crotonate + ·Cl → Products
1 record matched NO2 + ·Cl → ClNO2
2 records matched NO2 + ·Cl → ClNO2
5 records matched NO2 + ·Cl → Products
26 records matched NO + ·Cl → NOCl
8 records matched NO + ClO → NO2 + ·Cl
1 record matched NO + NCl → N2O + ·Cl
1 record matched N2O5 + ·Cl → Products
1 record matched Br· + BrCl → Br2 + ·Cl
2 records matched TiCl2 → TiCl + ·Cl
5 records matched ClOO + ·Cl → ClO + ClO
7 records matched ClOO + ·Cl → O2 + Cl2
1 record matched ClOO + ·Cl → Products
2 records matched ClOO → O2 + ·Cl
13 records matched HBr + ·Cl → HCl + Br·
9 records matched HI + ·Cl → HCl + I
15 records matched O3 + ·Cl → O2 + ClO
1 record matched O3 + ClO → O2 + O2 + ·Cl
2 records matched CH3OCH2OOH + ·Cl → Products
1 record matched SiCl4 + ·Cl → Cl2 + SiCl3
4 records matched SiCl4 → SiCl3 + ·Cl
1 record matched NCl3 + ·Cl → Cl2 + NCl2
3 records matched SiHCl3 + ·Cl → HCl + SiCl3
2 records matched S2Cl2 + ·Cl → Products
2 records matched N2O + ·Cl → N2 + ClO
9 records matched SiH4 + ·Cl → HCl + SiH3
4 records matched PH3 + ·Cl → HCl + PH2
4 records matched Cl2O + ·Cl → Cl2 + ClO
2 records matched Cl2O + ClO → O2 + Cl2 + ·Cl
3 records matched ICl + ·Cl → Cl2 + I
2 records matched ICl + ·F → IF + ·Cl
1 record matched ICl + H· → HI + ·Cl
3 records matched HOCl + ·Cl → ·OH + Cl2
3 records matched HOCl + ·Cl → Products
1 record matched ClF + D → DF + ·Cl
1 record matched ClF + H· → HF + ·Cl
1 record matched ClF → ·F + ·Cl
1 record matched AsH3 + ·Cl → HCl + AsH2·
10 records matched H2S + ·Cl → HCl + SH
8 records matched HN3 + ·Cl → HCl + ·N3
2 records matched GeH4 + ·Cl → HCl + GeH3
1 record matched Cl2 + CFCl2CFCl → CFCl2CFCl2 + ·Cl
1 record matched Cl2 + CCl2=CCl → C2Cl4 + ·Cl
1 record matched Cl2 + CHCl2CH2· → CHCl2CH2Cl + ·Cl
1 record matched Cl2 + Cyclohexyl, 2-chloro- → Cyclohexane, 1,2-dichloro-, cis- + ·Cl
1 record matched Cl2 + Cyclohexyl, 2-chloro- → Cyclohexane, 1,2-dichloro-, trans- + ·Cl
1 record matched Cl2 + ·CHBrCl → CHBrCl2 + ·Cl
1 record matched Cl2 + Cyclopentyl, 2-chloro-1,2,3,3,4,4,5,5-octafluoro- → Cyclopentene, 1,2-dichlorooctafluoro- + ·Cl
1 record matched Cl2 + C4ClF6 → Cyclobutane, 1,2-dichloro-1,2,3,3,4,4-hexafluoro- + ·Cl
1 record matched Cl2 + ·CH2CH2C(O)CH3 → CH3C(O)CH2CH2Cl + ·Cl
1 record matched Cl2 + CF3CHF → CF3CHFCl + ·Cl
1 record matched Cl2 + ClCH=CHCH2 → 1,3-dichloropropene + ·Cl
1 record matched Cl2 + CF3CCl2 → CF3CCl3 + ·Cl
1 record matched Cl2 + Oxiranyl → Oxirane, chloro- + ·Cl
1 record matched Cl2 + CH3SCH2 → CH3SCH2Cl + ·Cl
1 record matched Cl2 + CH3CF2 → CH3CF2Cl + ·Cl
4 records matched Cl2 + CCl3CHCl → CHCl2CCl3 + ·Cl
2 records matched Cl2 + CHCl2C(·)Cl2 → CHCl2CCl3 + ·Cl
1 record matched Cl2 + CH2ClCCl2· → CH2ClCCl3 + ·Cl
2 records matched Cl2 + CH2ClCHCl· → CHCl2CH2Cl + ·Cl
2 records matched Cl2 + ·Cl → Cl3
2 records matched Cl2 + CHCl2CHCl → (CHCl2)2 + ·Cl
1 record matched Cl2 + CH3CCl2· → CH3CCl3 + ·Cl
3 records matched Cl2 + N → NCl + ·Cl
8 records matched Cl2 + O· → ClO + ·Cl
1 record matched Cl2 + ·CH2SH → ClCH2SH + ·Cl
2 records matched Cl2 + D → DCl + ·Cl
4 records matched Cl2 + CH3CHCl → CH3CHCl2 + ·Cl
2 records matched Cl2 + CH3OCH2· → CH3OCH2Cl + ·Cl
1 record matched Cl2 + CH2CH2Cl → CH2ClCH2Cl + ·Cl
2 records matched Cl2 + ·CH2I → chloroiodomethane + ·Cl
3 records matched Cl2 + ·CH2Br → CH2ClBr + ·Cl
1 record matched Cl2 + CH3C(O)CH(·)CH3 → 2-Butanone, 3-chloro- + ·Cl
1 record matched Cl2 + FSO3 → FSO2OCl + ·Cl
4 records matched Cl2 + ·F → ClF + ·Cl
1 record matched Cl2 + I → ICl + ·Cl
1 record matched Cl2 + SH → HSCl + ·Cl
1 record matched Cl2 + SD → Other Products + ·Cl
1 record matched Cl2 + BF → ClBF + ·Cl
1 record matched Cl2 + AlCl → AlCl2 + ·Cl
15 records matched Cl2 + H· → HCl + ·Cl
1 record matched Cl2 + NCl → ·Cl + NCl2
2 records matched Cl2 + NO → NOCl + ·Cl
3 records matched Cl2 + Br· → BrCl + ·Cl
6 records matched Cl2 → ·Cl + ·Cl
1 record matched O2 + CCl2=CCl → COCl2 + CO + ·Cl
10 records matched O2 + ·Cl → ClOO
2 records matched F2 + ·Cl → ClF + ·F
2 records matched D2 + ·Cl → DCl + D
1 record matched CuCl + Cl2 → CuCl2 + ·Cl
1 record matched trans-4-Methylcyclohexanol + ·Cl → Products
1 record matched N2 + ·Cl + ·Cl → N2 + Cl2
7 records matched Br2 + ·Cl → Br· + BrCl
3 records matched P + Cl2 → PCl + ·Cl
7 records matched H2O2 + ·Cl → HO2 + HCl
2 records matched titanium(III) chloride → TiCl2 + ·Cl
1 record matched S + Cl2 → SCl + ·Cl
1 record matched DCl + O· → OD + ·Cl
2 records matched DCl + D → D2 + ·Cl
1 record matched DCl + ·F → DF + ·Cl
3 records matched DCl + OD → D2O + ·Cl
3 records matched DCl + H· → HD + ·Cl
1 record matched DCl → D + ·Cl
7 records matched HNO3 + ·Cl → HCl + NO3
2 records matched NH3 + ·Cl → HCl + ·NH2
1 record matched HCl + ·CH2 → ·CH3 + ·Cl
1 record matched HCl + CH2=CCl → CH2=CHCl + ·Cl
1 record matched HCl + CBrF2 → CHBrF2 + ·Cl
1 record matched HCl + ·Cl → HCl + ·Cl
9 records matched HCl + O· → ·OH + ·Cl
3 records matched HCl + D → HD + ·Cl
10 records matched HCl + ·F → HF + ·Cl
1 record matched HCl + SiH3 → SiH4 + ·Cl
2 records matched HCl + OD → HDO + ·Cl
13 records matched HCl + H· → H2 + ·Cl
3 records matched HCl + NO3 → HNO3 + ·Cl
1 record matched HCl + NO2 → HNO2 + ·Cl
1 record matched HCl + NO → HNO + ·Cl
6 records matched HCl → H· + ·Cl
1 record matched SnCl4 → SnCl3(2A1) + ·Cl
1 record matched CH3CHClCHClCH3 + ·Cl → Products
1 record matched ClC≡CCl + ·Cl → CCl2=CCl
1 record matched ClC≡CCl → C2 + ·Cl + ·Cl
4 records matched I2 + ·Cl → ICl + I
2 records matched TiCl4 → titanium(III) chloride + ·Cl
4 records matched Ethyl 2-methylbutanoate + ·Cl → Products
2 records matched AlCl3 → AlCl2 + ·Cl
2 records matched Ca + Cl2 → CaCl + ·Cl
1 record matched He + ·Cl + ·Cl → He + Cl2
1 record matched Ge + Cl2 → GeCl + ·Cl
1 record matched Cu + Cl2 → CuCl + ·Cl
1 record matched Cd + Cl2 → CdCl + ·Cl
1 record matched Ba + Cl2 → BaCl + ·Cl
1 record matched Sn + Cl2 → SnCl + ·Cl
2 records matched Sr + Cl2 → SrCl + ·Cl
2 records matched Na + Cl2 → NaCl + ·Cl
1 record matched Si + Cl2 → SiCl + ·Cl
1 record matched Hg + ·Cl → Mercury chloride
1 record matched Hg + N2 + ·Cl → Mercury chloride + N2
1 record matched Hg + He + ·Cl → He + Mercury chloride
2 records matched Mg + Cl2 → Magnesium chloride + ·Cl
1 record matched Pb + Cl2 → PbCl + ·Cl
1 record matched Al + ·Cl → AlCl
1 record matched Al + Cl2 → AlCl + ·Cl
2 records matched Chlorocyclopropane + ·Cl → Products
1 record matched CH3C(O)CD3 + ·Cl → Products
4 records matched C2Cl5 + Cl2 → CCl3CCl3 + ·Cl
2 records matched C2Cl5 → C2Cl4 + ·Cl
1 record matched ·CH2Cl + O· → CH2O + ·Cl
3 records matched ·CH2Cl + Cl2 → CH2Cl2 + ·Cl
4 records matched CH3CH2CH2CHCHCHO + ·Cl → Products
1 record matched C2D5I + ·Cl → Products + DCl
2 records matched Ethane, 1-bromo-2-methoxy- + ·Cl → Other Products + HCl
5 records matched CD2=CDCD2CD3 + ·Cl → Products
1 record matched CF3C(O)· + Cl2 → CF3COCl + ·Cl
2 records matched (tert-C4H9)2O + ·Cl → Products
2 records matched CH3CH=CHCH2OH + ·Cl → Products
1 record matched CH3CH=CHCH2OH + ·Cl → CH3CH=CHCH(·)OH + HCl
1 record matched CH3CH=CHCH2OH + ·Cl → CH3C(·)HCHClCH2OH
1 record matched CH3CH=CHCH2OH + ·Cl → CH3CHClC(·)HCH2OH
6 records matched n-C3H7CH(OH)CH3 + ·Cl → Products
1 record matched d-Limonene + ·Cl → Products
1 record matched CH3C(O)CH2OCH3 + ·Cl → Products
2 records matched (E)-Ethyl tiglate + ·Cl → Products
2 records matched CH3CH2C(O)OONO2 + ·Cl → Products
1 record matched Benzaldehyde, 3,5-dimethyl- + ·Cl → Products
1 record matched 2,5-dimethylbenzaldehyde + ·Cl → Products
5 records matched Z-CF3CFCHF + ·Cl → Products
7 records matched 2,3-dimethoxyphenol + ·Cl → Products
1 record matched 6-Cyano-1-hexene + ·Cl → Products
1 record matched 5-Cyano-1-pentene + ·Cl → Products
7 records matched 3-Methyl-2-Nitrophenol + ·Cl → Products
5 records matched CH3OCHCl2 + ·Cl → Products
2 records matched n-C3H7OD + ·Cl → Products
2 records matched Cyclohexanecarboxylic acid methyl ester + ·Cl → Products
2 records matched ·CFBr + Cl2 → Other Products + ·Cl
5 records matched 3-Buten-1-ol, 2-methyl- + ·Cl → Products
1 record matched CH3COCH2D + ·Cl → Products
1 record matched 2,2-Dimethyl-3-hexanol + ·Cl → Products
9 records matched (E)-CH3CH=CHCHO + ·Cl → Products
2 records matched (CH3)2NNO2 + ·Cl → Other Products + HCl
2 records matched SiH2Cl2 + ·Cl → HCl + SiHCl2
3 records matched 2-Butanone, 3-chloro- + ·Cl → Products
2 records matched Ethyl-2,2-dimethylpropionate + ·Cl → Products
1 record matched ·CCl + N → CN + ·Cl
1 record matched ·CCl + ·CCl → C2 + ·Cl + ·Cl
1 record matched 2,3-Hexanedione + ·Cl → Products
5 records matched Pentafluorodimethyl ether + ·Cl → Products
1 record matched ·CH2F + HCl → CH3F + ·Cl
1 record matched NF2 + ·Cl → Nitrogen chloride fluoride (nclf2)
1 record matched CH2=CHCH2C(O)OCH3 + ·Cl → Products
1 record matched Ethane-d5-, bromo- + ·Cl → Other Products + DCl
1 record matched CH3CD2Cl + ·Cl → ·CH2CD2Cl + HCl
4 records matched CH3CD2Cl + ·Cl → CH3CDCl· + DCl
6 records matched CH3CHDCl + ·Cl → DCl + CH3CHCl
2 records matched CH3CHDCl + ·Cl → ·CH2CHClD + HCl
3 records matched CH3CHDCl + ·Cl → CH3CDCl· + HCl
1 record matched CHCl2 + N → HCN + ·Cl + ·Cl
1 record matched CHCl2 + O· → CO + HCl + ·Cl
3 records matched CHCl2 + Cl2 → CHCl3 + ·Cl
1 record matched 1-Octen-3-ol + ·Cl → Products
1 record matched C2F5 + HCl → C2F5H + ·Cl
4 records matched ·OH + ClO → HO2 + ·Cl
1 record matched ·OH + BCl3 → Other Products + ·Cl
3 records matched ·OH + Cl2 → HOCl + ·Cl
6 records matched ·OH + DCl → HDO + ·Cl
17 records matched ·OH + HCl → H2O + ·Cl
3 records matched (CH3)3CC(O)Cl + ·Cl → Products
1 record matched (CH3)2HSiOSiH(CH3)2 + ·Cl → Products
1 record matched HC(13)HO + ·Cl → HCO + HCl
2 records matched (CH3)3SiCH2OH + ·Cl → Products
3 records matched 2-Ethylfuran + ·Cl → Products
2 records matched ClCH2OC2H5 + ·Cl → Products
12 records matched HO2 + ·Cl → HCl + O2
8 records matched HO2 + ·Cl → ·OH + ClO
3 records matched HO2 + ·Cl → Products
5 records matched ·CCl3 + ·Cl → CCl4
1 record matched ·CCl3 + N → ClCN + ·Cl + ·Cl
2 records matched ·CCl3 + O· → COCl2 + ·Cl
4 records matched ·CCl3 + Cl2 → CCl4 + ·Cl
2 records matched ·CCl3 + HCl → CHCl3 + ·Cl
1 record matched CH3CO + ·Cl → H2C=C=O + HCl
3 records matched CH3CO + Cl2 → CH3COCl + ·Cl
1 record matched C2H5OO· + ·Cl → CH3CH2O· + ClO
1 record matched C2H5OO· + ·Cl → Other Products + HCl
1 record matched C2H5OO· + ·Cl → Products
1 record matched Oxirane,(trichloromethyl)- + ·Cl → Products
1 record matched 1,1,1,3,3,3-hexafluoroisopropylmethacrylate + ·Cl → Products
2 records matched CH3CH2OOH + ·Cl → Products
2 records matched CH3OOH + ·Cl → Other Products + HCl
2 records matched ·CH2C≡CH + Cl2 → CH2ClC≡CH + ·Cl
1 record matched CD3CH2CD3 + ·Cl → Other Products + HCl
2 records matched CH3CD2CH3 + ·Cl → HCl + CH3CD2CH2
2 records matched CH3CD2CH3 + ·Cl → Products
3 records matched CF3CHFCl + ·Cl → CF3CFCl· + HCl
1 record matched CH2=CHCH2NC + ·Cl → Products
1 record matched CD3CCl3 + ·Cl → Other Products + DCl
1 record matched C4F9C(O)OH + ·Cl → Products
1 record matched Cyclobutaneacetaldehyde, 3-acetyl-2,2-dimethyl- + ·Cl → Products
11 records matched NOCl + ·Cl → Cl2 + NO
1 record matched NOCl + ClO → ClNO2 + ·Cl
2 records matched NOCl + ·OH → HNO2 + ·Cl
1 record matched NOCl + ·OH → HONO (unspecified cis/trans isomer) + ·Cl
16 records matched NOCl → NO + ·Cl
1 record matched C2H3 + ·Cl → C2H2 + HCl
3 records matched C2H3 + Cl2 → CH2=CHCl + ·Cl
1 record matched C2H3 + DCl → CH2=CHD + ·Cl
4 records matched C2H3 + HCl → C2H4 + ·Cl
1 record matched benzoyl + Cl2 → Benzoylchloride + ·Cl
3 records matched ClCO + ·Cl → CO + Cl2
1 record matched ClCO + NO2 → CO2 + NO + ·Cl
4 records matched ClCO + Cl2 → COCl2 + ·Cl
1 record matched ClCO → CO + ·Cl
5 records matched HCO + Cl2 → HC(O)Cl + ·Cl
1 record matched (·)CH2OH + ·Cl → CH2O + HCl
3 records matched (·)CH2OH + Cl2 → ClCH2OH + ·Cl
1 record matched (·)CH2OH + HCl → CH3OH + ·Cl
9 records matched HC(O)Cl + ·Cl → ClCO + HCl
1 record matched 3-Methoxy-1-butanol + ·Cl → Products
10 records matched Hexyl acrylate + ·Cl → Products
6 records matched (E)-CH3CH=CHC(=O)C2H5 + ·Cl → Products
1 record matched CH3C(O)OCH2CH=CHCH2CH2CH3-(E) + ·Cl → Products
3 records matched 1-C4H9 + Cl2 → 1-C4H9Cl + ·Cl
1 record matched Phenyl + ·Cl → Chlorobenzene
1 record matched Phenyl + Cl2 → Chlorobenzene + ·Cl
5 records matched 1,2,2,2-tetrafluoroethyl trifluoromethyl ether + ·Cl → Products
3 records matched CF3OCF2CHF2 + ·Cl → Products
2 records matched sec-C4H9 + Cl2 → sec-C4H9Cl + ·Cl
4 records matched CF3I + ·Cl → ·CF3 + ICl
1 record matched CF3I + ·Cl → Adduct
2 records matched CF3I + ·Cl → Products
3 records matched CH3C(O)OONO2 + ·Cl → Products
1 record matched ·CF3 + ·Cl → CF3Cl
2 records matched ·CF3 + ICl → CF3I + ·Cl
9 records matched ·CF3 + Cl2 → CF3Cl + ·Cl
1 record matched ·CF3 + DCl → CDF3 + ·Cl
3 records matched ·CF3 + HCl → CHF3 + ·Cl
3 records matched Formic acetic anhydride + ·Cl → Products
3 records matched C2F5CF2H + ·Cl → CF3CF2CF2· + HCl
1 record matched (E/Z)-CF3CF=CHF + ·Cl → Adduct
2 records matched (E/Z)-CF3CF=CHF + ·Cl → Products
1 record matched CF3CH2CH2OH + ·Cl → Products + HCl
7 records matched CF3CH2CH2OH + ·Cl → Products
3 records matched ·CH3 + ·Cl → CH3Cl
6 records matched ·CH3 + Cl2 → CH3Cl + ·Cl
2 records matched ·CH3 + DCl → CH3D + ·Cl
12 records matched ·CH3 + HCl → CH4 + ·Cl
1 record matched ·CH3 + He + ·Cl → CH3Cl + He
1 record matched Decachlorodicyclopentadienyl → Nonachloro-[dicyclopentadienyl]-1-yl + ·Cl
11 records matched trans-1,4-Dimethylcyclohexane + ·Cl → Products
2 records matched Methyl 2-methylpentanoate + ·Cl → Products
1 record matched 1,1,1,3,3,3-Hexafluoroisopropyl acrylate + ·Cl → Products
1 record matched Benzyl + ·Cl → C6H5CH2Cl
1 record matched Benzyl + ·Cl → Products
2 records matched CH3O· + ·Cl → CH2O + HCl
1 record matched CH3O· + ·Cl → Products
2 records matched 1-C3H7 + Cl2 → n-C3H7Cl + ·Cl
3 records matched CH3O2· + ·Cl → HCl + CH2OO
4 records matched CH3O2· + ·Cl → CH3O· + ClO
2 records matched CH3O2· + ·Cl → Products
1 record matched CD3 + Cl2 → CD3Cl + ·Cl
2 records matched CD3 + DCl → CD4 + ·Cl
2 records matched CD3 + HCl → CHD3 + ·Cl
3 records matched C3F7CH(OH)2 + ·Cl → Products
1 record matched ·CHCl + NO → HC-N=O + ·Cl
5 records matched n-C4F9CH2CH2I + ·Cl → Products
5 records matched F(CF2CF2)2CH2CH2OH + ·Cl → Products
7 records matched HC≡CCH(CH3)OH + ·Cl → Products
1 record matched ·C2H5 + ·Cl → C2H5Cl
5 records matched ·C2H5 + ·Cl → C2H4 + HCl
8 records matched ·C2H5 + Cl2 → C2H5Cl + ·Cl
3 records matched 2-C3H7 + Cl2 → iso-C3H7Cl + ·Cl
2 records matched ·CH2CH=CH2 + Cl2 → CH2=CHCH2Cl + ·Cl
1 record matched CF3CH2OCHF2 + ·Cl → Other Products + HCl
7 records matched CF3CH2OCHF2 + ·Cl → Products
1 record matched CH3CD2OH + ·Cl → Products
1 record matched CD3OH + ·Cl → Products
9 records matched 1,3,5-Trimethylcyclohexane + ·Cl → Products
1 record matched CH2=NCH3 + ·Cl → HCl + CH2=NCH2
2 records matched Cyclohexane-d12 + ·Cl → DCl + Cyclohexyl-d11
3 records matched Cyclohexane-d12 + ·Cl → Products
2 records matched (CH3)2CHONO2 + ·Cl → Other Products + HCl
1 record matched (Z)-3-Hepten-1-ol + ·Cl → Products
9 records matched 2,5-Dihydrofuran + ·Cl → Products
1 record matched d8-tetrahydrofuran + ·Cl → Products
3 records matched ·CCl2F + Cl2 → CFCl3 + ·Cl
1 record matched ·CClF2 + ·F → ·CF3 + ·Cl
2 records matched ·CClF2 + Cl2 → CF2Cl2 + ·Cl
1 record matched ·CClF2 + HCl → CHF2Cl + ·Cl
6 records matched CHF2-O-CHF2 + ·Cl → CHF2OCF2· + HCl
1 record matched 2-Methyltetrahydrofuranone + ·Cl → Products
1 record matched Ethylcyclohexane + ·Cl → Products
1 record matched CD2Cl2 + ·Cl → DCl + CDCl2
2 records matched CF2ClCH2Cl + ·Cl → Other Products + HCl
3 records matched CF3CH=CHF + ·Cl → Products
2 records matched tert-C4H9OCH3 + ·Cl → Other Products + HCl
1 record matched tert-C4H9OCH3 + ·Cl → Products
5 records matched C2D6 + ·Cl → DCl + ·C2D5
1 record matched Fenchol + ·Cl → Products
2 records matched C2H5COCH=CH2 + ·Cl → Products
4 records matched Ethane, 1-chloro-1-fluoro- + ·Cl → Other Products + HCl
2 records matched tert-C4H9 + Cl2 → tert-C4H9Cl + ·Cl
2 records matched CCl2 (X 1A1) + Cl2 → ·CCl3 + ·Cl
1 record matched CCl2 (X 1A1) + CCl2 (X 1A1) → ClC≡CCl + ·Cl + ·Cl
1 record matched CCl2 (X 1A1) → ·CCl + ·Cl
1 record matched 3-Methoxy-1-propanol + ·Cl → Products
9 records matched C2H5CH=CHCH2OH-(Z) + ·Cl → Products
4 records matched CH3CH2CHCHCHO + ·Cl → Products
1 record matched FC(O)OCH3 + ·Cl → Products
5 records matched CD3CD=CD2 + ·Cl → Products
1 record matched (Z)-2-C4F8 + ·Cl → Products
1 record matched (E)-2-C4F8 + ·Cl → Products
1 record matched CF2ClC(O)OCH3 + ·Cl → Products
5 records matched CH2CBrCF3 + ·Cl → Products
3 records matched CHBrF2 + ·Cl → HCl + CBrF2
2 records matched Cyclodecanone + ·Cl → Products
6 records matched HFCO + ·Cl → FCO + HCl
1 record matched CH3OD + ·Cl → HCl + CH2OD
3 records matched CD2=CDCD=CD2 + ·Cl → Products
1 record matched CH2=CHCH2OCF2CF2H + ·Cl → Products
16 records matched H2 + ·Cl → HCl + H·
1 record matched H2 + ·Cl → Products
1 record matched Bicyclo[2.2.1]heptane-2-one,1,3,3-trimethyl + ·Cl → Products
2 records matched Furan, 2,3-dihydro- + ·Cl → Products
1 record matched Cyclobutanone + ·Cl → Other Products + HCl
4 records matched CF3OCF=CF2 + ·Cl → Products
2 records matched CH3CF=CH2 + ·Cl → Products
1 record matched 2-Methylcyclopentanone + ·Cl → Other Products + HCl
1 record matched n-C11H24 + ·Cl → Other Products + HCl
3 records matched CH3OC(O)CH2CH2CH2C(O)OCH3 + ·Cl → Products
1 record matched CD3Cl + ·Cl → DCl + CD2Cl
2 records matched CD3Cl + ·Cl → Other Products + DCl
1 record matched CD3Br + ·Cl → DCl + CD2Br
1 record matched Benzene-d6 + ·Cl → DCl + Phenyl-d5 radical
1 record matched CH3CH2CH2CH2CH2ONO2 + ·Cl → Other Products + HCl
1 record matched (CH3)3SiH + ·Cl → Products
1 record matched cis-Cyclooctene + ·Cl → Products
1 record matched 1-Chloro-1-cyclopentene + ·Cl → Products
2 records matched 3-Methylfuran + ·Cl → Products
2 records matched (E)-3-Hexen-1-ol + ·Cl → Products
2 records matched (Z)-3-Hexen-1-ol + ·Cl → Products
2 records matched (E)-2-Hexen-1-ol + ·Cl → Products
1 record matched n-C4H9ONO2 + ·Cl → Other Products + HCl
9 records matched HC≡CCH2CH2OH + ·Cl → Products
1 record matched ClCH2CH2CH=CH2 + ·Cl → Products
1 record matched (CD3)2S + ·Cl → Products
1 record matched C2H5OD + ·Cl → Products + DCl
1 record matched C2H5OD + ·Cl → Products + HCl
2 records matched C2H5OD + ·Cl → Products
1 record matched (CH3)2CCHC(O)OCH3 + ·Cl → Products
1 record matched CF3CH(OH)CF3 + ·Cl → Products
2 records matched CH2=C(CH3)COCl + ·Cl → Products
2 records matched CCl3COCH3 + ·Cl → Products
1 record matched CCl3D + ·Cl → ·CCl3 + DCl
1 record matched CCl3D → ·Cl + CDCl2
1 record matched Pentafluoroiodobenzene + ·Cl → Adduct
1 record matched CH2=CHCH2F + ·Cl → Products
13 records matched CH2=C(CH3)C(=O)CH3 + ·Cl → Products
9 records matched CF3CH2F + ·Cl → HCl + CF3CHF
1 record matched Acetaldehyde, chlorodifluoro- + ·Cl → Products
1 record matched C6F5OH + ·Cl → Products
1 record matched n-C3H7OCH=CH2 + ·Cl → Products + HCl
1 record matched n-C3H7OCH=CH2 + ·Cl → Products
10 records matched CH2=C(CH3)CH2CH2OH + ·Cl → Products
9 records matched HC(O)OC(CH3)3 + ·Cl → Products
1 record matched ClCH2CHClCH=CH2 + ·Cl → Products
2 records matched (C2H5)2C=CH2 + ·Cl → Products
2 records matched C2H5CH(CH3)CH=CH2 + ·Cl → Products
1 record matched C2F5C(O)CF(CF3)2 + ·Cl → Products
1 record matched CF3CF2CF2I + ·Cl → Products
7 records matched CF3CF=CH2 + ·Cl → Products
7 records matched 5-methyl-2-nitrophenol + ·Cl → Products
5 records matched Cyclobutene, hexafluoro- + ·Cl → Products
1 record matched (n-C5H11)2O + ·Cl → Other Products + HCl
1 record matched (Z)-CF3CH=CHCF3 + ·Cl → Products
2 records matched (Z)-(CH3)2CHCH=CHCH3 + ·Cl → Products
4 records matched Propane, 1,1,1,3,3,3-hexafluoro- + ·Cl → HCl + (CF3)2CH·
3 records matched CH3CH2OCF3 + ·Cl → Products
1 record matched (CH3O)2 + ·Cl → ·CH2OOCH3 + HCl
5 records matched CF2=CFCF=CF2 + ·Cl → Products
1 record matched C2D4 + ·Cl → DCl + CD2CD
4 records matched C2D4 + ·Cl → Products
1 record matched F(CF2CF2)4CH2CH2OH + ·Cl → Products
1 record matched (CF3)2CFI + ·Cl → (CF3)2CF· + ICl
2 records matched Propane, 1,1,1,2,2,3-hexafluoro- + ·Cl → CF3CF2CHF· + HCl
4 records matched CHD3 + ·Cl → Products
4 records matched CH2D2 + ·Cl → Products
6 records matched CH3D + ·Cl → Products
1 record matched (CD3)2CO + ·Cl → Products
1 record matched C6F13CH2CH2OH + ·Cl → Products
2 records matched Propyl isobutyrate + ·Cl → Products
3 records matched Pentanoyl chloride + ·Cl → Products
1 record matched tert-C4H9OC2H5 + ·Cl → Products
1 record matched CH3C(O)CN + ·Cl → Products
5 records matched CH2ClCCl3 + ·Cl → HCl + CCl3CHCl
2 records matched 2,2-dimethylpropanal + ·Cl → HCl + (CH3)3CC(O)·
10 records matched 2,2-dimethylpropanal + ·Cl → Products
3 records matched CO + ·Cl → ClCO
1 record matched CH3(CH2)12CH3 + ·Cl → Other Products + HCl
1 record matched CH3(CH2)11CH3 + ·Cl → Other Products + HCl
5 records matched (Z)-Cycloheptene + ·Cl → Products
5 records matched 1-Cyanopentane + ·Cl → Products
2 records matched Acetic acid, pentyl ester + ·Cl → Products
1 record matched 1,4-Cyclohexadiene + ·Cl → HCl + Cyclohexadienyl
1 record matched 1,4-Cyclohexadiene + ·Cl → Other Products + HCl
4 records matched 1,4-Cyclohexadiene + ·Cl → Products
1 record matched 1,4-Cyclohexadiene + ·Cl → 2-chlorocyclohex-4-en-1-yl
5 records matched CH3CH2OCH2CH2Cl + ·Cl → Products
1 record matched CH3CH2CH2CH2OCH3 + ·Cl → CH3CH2CH2CH(1)OCH3 + HCl
1 record matched CH3CH2CH2CH2OCH3 + ·Cl → CH3CH2CH(·)CH2OCH3 + HCl
1 record matched CH3CH2CH2CH2OCH3 + ·Cl → CH3CH(·)CH2CH2OCH3 + HCl
3 records matched n-C5H11NO2 + ·Cl → Products
3 records matched CH3OC(O)(CH2)4C(O)OCH3 + ·Cl → Products
1 record matched 5-Methyl-2-hexanol + ·Cl → Products
2 records matched 2-Chloroethyl methyl ether + ·Cl → Other Products + HCl
1 record matched 2-Chloroethyl methyl ether + ·Cl → Products
3 records matched 1-Propanol, 3-chloro- + ·Cl → Products
8 records matched CH2=CHCH2CH2OH + ·Cl → Products
1 record matched n-C3H7ONO2 + ·Cl → Other Products + HCl
2 records matched n-C3H7ONO2 + ·Cl → Products
3 records matched n-C4H9NO2 + ·Cl → Products
1 record matched c-C6H11I + ·Cl → Adduct
1 record matched Benzene,1-chloro-3-fluoro- + H· → Fluorobenzene + ·Cl
3 records matched 2,5-Dimethylfuran + ·Cl → Products
3 records matched C2H5ONO2 + ·Cl → Other Products + HCl
5 records matched HCOOCH(CH3)2 + ·Cl → Products
5 records matched CH3CH=CHC(=O)CH3 (unspecified) + ·Cl → Products
5 records matched CH2=CHCH2CH(OH)CH3 + ·Cl → Products
1 record matched 3,3-Dimethyl-1-butanol + ·Cl → Products
2 records matched (CH3S)2 + ·Cl → HCl + CH3SSCH2
1 record matched (CH3S)2 + ·Cl → CH3SCl + CH3
2 records matched CH3ONO + ·Cl → Products
3 records matched C2H5SCH3 + ·Cl → Products
4 records matched CH2FCH2F + ·Cl → HCl + CH2FCHF
1 record matched CH2ClC≡CH + ·Cl → CH2=C=CHCl + ·Cl
1 record matched CH2ClC≡CH + ·Cl → C3H3Cl2
11 records matched (E)-2-C4H8 + ·Cl → Products
1 record matched 1-Iodo-4-methylbenzene + ·Cl → Adduct
11 records matched cis-1,4-Dimethylcyclohexane + ·Cl → Products
3 records matched Methyl pentanoate + ·Cl → Products
6 records matched Methyl butanoate + ·Cl → Products
5 records matched 5-Methyl-2-furaldehyde + ·Cl → Products
2 records matched iso-C3H7C(O)OCH(CH3)2 + ·Cl → Products
2 records matched CH3OC(O)OCH3 + ·Cl → HCl + CH3OC(O)OCH2·
8 records matched CH2=CHCH(OH)CH2CH3 + ·Cl → Products
1 record matched CH3C(O)C(O)OCH3 + ·Cl → Products
2 records matched CH3C(O)C(O)C2H5 + ·Cl → Products
5 records matched CH3O(O)CC(CH3)3 + ·Cl → Products
2 records matched (CH3)2CHCH(OH)CH3 + ·Cl → Products
2 records matched CH3ONO2 + ·Cl → Other Products + HCl
1 record matched 2,2-Dichloroethanol + ·Cl → Products
1 record matched 2,2-Dichloroethanol + ·Cl → CH2(OH)C(·)Cl2 + HCl
2 records matched CH2=CHCH(OH)CH3 + ·Cl → CH2ClCH(·)CH(CH3)OH
1 record matched CH2=CHCH(OH)CH3 + ·Cl → CH2=CHC(·)(OH)CH3 + HCl
2 records matched 2,2,3,3-Tetramethylbutane + ·Cl → HCl + (CH3)3CC(CH3)2CH2
2 records matched (CH3)2CHC(OH)(CH3)2 + ·Cl → Products
2 records matched CCl2Br2 + ·Cl → Products
1 record matched (CH3)2Se + ·Cl → Products
1 record matched CH3OCl + ·Cl → HCl + (·)CH2OCl
2 records matched CH3OCl + ·Cl → CH3O· + Cl2
3 records matched CH3OCl + ·Cl → Products
2 records matched (CH3)2Hg + ·Cl → CH3HgCl + ·CH3
1 record matched chloroiodomethane + ·Cl → ·CH2Cl + ICl
1 record matched chloroiodomethane + ·Cl → Adduct
1 record matched chloroiodomethane + ·Cl → Products
7 records matched CH2FCl + ·Cl → HCl + ·CClFH
1 record matched CH2=CHBr + ·Cl → CH2=CHCl + Br·
8 records matched CH3F + ·Cl → ·CH2F + HCl
1 record matched HCOO(CH2)3CH3 + ·Cl → HCl + HC(O)OCH2CH(·)CH2CH3
4 records matched HCOO(CH2)3CH3 + ·Cl → Products
1 record matched HCOO(CH2)3CH3 + ·Cl → HC(O)OCH2CH2CH(·)CH3 + HCl
1 record matched HCOO(CH2)3CH3 + ·Cl → HC(O)OCH2CH2CH2CH2· + HCl
13 records matched 1-C7H14 + ·Cl → Products
2 records matched CH2=CHCH2CH2C≡N + ·Cl → Products
9 records matched 1-C6H12 + ·Cl → Products
2 records matched 1-chloro-2-butene + ·Cl → Products
6 records matched CH3C(O)OCH2CH=CH2 + ·Cl → Products
6 records matched 2-Hexanone + ·Cl → Products
2 records matched Hexane, 2-methyl- + ·Cl → Other Products + HCl
4 records matched Iodobenzene + ·Cl → Chlorobenzene + I
1 record matched Iodobenzene + ·Cl → Adduct
8 records matched CH3C(O)CH2CH2OH + ·Cl → Products
1 record matched (CH3)3C(CH2)3CH3 + ·Cl → HCl + n-C4H9C(CH3)2C(·)H2
8 records matched (Z)-2-C4H8 + ·Cl → Products
2 records matched n-Butyl propanoate + ·Cl → Products
1 record matched 1,4-Dimethylcyclohexane + ·Cl → Products
6 records matched n-C3H7COC2H5 + ·Cl → Products
1 record matched n-C3H7COC2H5 + ·Cl → C6H11O + HCl
10 records matched (C2H5)2CHOH + ·Cl → Products
1 record matched 2-Methylcyclohexanone + ·Cl → Other Products + HCl
13 records matched CH3CH=C(CH3)C(=O)CH3 + ·Cl → Products
2 records matched 3-methyl-2-butanone + ·Cl → Products
1 record matched CH3CHClCH=CH2 + ·Cl → Products
2 records matched CH2=C(CH3)CH2Cl + ·Cl → Products
2 records matched C2H5C(CH3)=CH2 + ·Cl → Products
2 records matched (CH3)2CHCH=CH2 + ·Cl → Products
5 records matched Cyclopentene, octafluoro- + ·Cl → Products
3 records matched (CH3)2C(CH2Cl)OH + ·Cl → Products
4 records matched CD4 + ·Cl → CD3 + DCl
1 record matched CH2IBr + ·Cl → Adduct
1 record matched CH3CH2CH2OCH3 + ·Cl → Products
1 record matched (CH3)2C=CHCH2OH + ·Cl → Products
1 record matched (CH3)2C=CHCH2OH + ·Cl → (CH3)2C(·)CHClCH2OH
1 record matched CH2CHCH2I + ·Cl → Products
4 records matched Methyl-3-methylbutanoate + ·Cl → Products
12 records matched Methyl propanoate + ·Cl → Products
3 records matched (CH3)2CHC(O)OCH3 + ·Cl → Products
1 record matched (n-C4H9)2S + ·Cl → Other Products + HCl
1 record matched n-C4H9ONO + ·Cl → Products
1 record matched n-C3H7ONO + ·Cl → Products
4 records matched n-C5H11Cl + ·Cl → Products
3 records matched 1,3-dichloropropene + ·Cl → Products
1 record matched n-C4H9I + ·Cl → Adduct
3 records matched Isobutyl formate + ·Cl → Products
1 record matched 1,3-dichlorobenzene + H· → Chlorobenzene + ·Cl
9 records matched CH3C(O)OC(CH3)3 + ·Cl → Products
4 records matched 2,2,4-Trimethylpentane + ·Cl → Other Products + HCl
2 records matched C2H5OCH3 + ·Cl → Other Products + HCl
7 records matched n-C3H7Cl + ·Cl → Other Products + HCl
5 records matched CH3CHClC(O)OC2H5 + ·Cl → Products
3 records matched 2-Methylfuran + ·Cl → Products
4 records matched 1,3-Dichloro-2-propanone + ·Cl → Products
3 records matched 1,1-Dichloroacetone + ·Cl → Products
1 record matched 1,1-Dichloroacetone → CH3C(O)CHCl· + ·Cl
7 records matched CH3CH(OH)C(O)CH3 + ·Cl → Products
1 record matched CH2=C(CH3)CH2OH + ·Cl → Products
1 record matched CH2=C(CH3)CH2OH + ·Cl → CH2ClC(·)(CH3)CH2OH
1 record matched CH2=C(CH3)CH2OH + ·Cl → CH2=C(CH3)CH(·)OH + HCl
2 records matched (CH3)2C=CHCH3 + ·Cl → Products
1 record matched CH3CH2OCF2CF2H + ·Cl → Products
1 record matched Borneol + ·Cl → Products
1 record matched tert-C4H9OCl + ·Cl → Other Products + Cl2
1 record matched tert-C4H9OCl + ·Cl → Products
2 records matched tert-C4H9Cl + ·Cl → HCl + (CH3)2CClCH2
2 records matched tert-C4H9Cl + ·Cl → Products
1 record matched ClCN + ·Cl → CN + Cl2
1 record matched ClCN + O· → NCO + ·Cl
2 records matched ClCN → CN + ·Cl
1 record matched 1,3-Dioxane + ·Cl → Products
1 record matched (CH3N)2 + ·Cl → Products
2 records matched Cyclooctanone + ·Cl → Products
1 record matched Cycloheptanone + ·Cl → Other Products + HCl
2 records matched Cycloheptanone + ·Cl → Products
5 records matched 3-Furancarboxaldehyde + ·Cl → Products
1 record matched 2(5H)-Furanone + ·Cl → Products
1 record matched Cineole + ·Cl → Products
1 record matched 3,3-Dimethyl-2-butanol + ·Cl → Products
2 records matched 2,2,3-Trimethylbutane + ·Cl → Other Products + HCl
10 records matched neo-C5H12 + ·Cl → Neopentyl + HCl
1 record matched ClCOOH → HC(O)Cl + ·Cl
2 records matched COS + ·Cl → CO + SCl
3 records matched H2C=C=O + ·Cl → CH2C(O)Cl
1 record matched H2C=C=O + ·Cl → HCl + HCCO
2 records matched H2C=C=O + ·Cl → CO + ·CH2Cl
1 record matched H2C=C=O + ·Cl → Products
2 records matched CH2=C=CH2 + ·Cl → CH2=C=CH + HCl
2 records matched CH2=C=CH2 + ·Cl → Products
4 records matched CH2=C=CH2 + ·Cl → CH2=CCl=CH2
1 record matched 1-C5H11ONO + ·Cl → Products
3 records matched CH2FOCH2F + ·Cl → CHF(·)OCH2F + HCl
5 records matched CF3CH2CH2CH2OH + ·Cl → Products
2 records matched CF3CH2CHF2 + ·Cl → CH2FCF2CF2· + HCl
1 record matched CF3CH2OCH3 + ·Cl → Other Products + HCl
7 records matched CF3CH2OCH3 + ·Cl → Products
1 record matched CF3CH2OCH3 + ·Cl → CF3CH2OCH2· + HCl
1 record matched CF3CH2OCH3 + ·Cl → CF3CH(·)OCH3 + HCl
6 records matched CF3CH2C(O)H + ·Cl → Products
1 record matched 1,3-Butadiyne + ·Cl → Products
3 records matched CF2HC(O)OCH3 + ·Cl → Products
3 records matched CF3CHFCF3 + ·Cl → (CF3)2CF· + HCl
3 records matched CF3C(O)OCH3 + ·Cl → Products
2 records matched CF3C(O)CH2Cl + ·Cl → Products
1 record matched (CH3CO)2 + ·Cl → CH3COCl + CH3CO
5 records matched (CH3CO)2 + ·Cl → Products
1 record matched (CH3CO)2 + ·Cl → (.)CH2C(O)C(O)CH3 + HCl
3 records matched CHF2CHO + ·Cl → Products
1 record matched CH2FCHF2 + ·Cl → HCl + CHF2C(·)HF
1 record matched CH2FCHF2 + ·Cl → HCl + CH2FC(·)F2
1 record matched CH2FCHF2 + ·Cl → Products
2 records matched CH3COCH2F + ·Cl → Products
1 record matched CH3OCF2CHF2 + ·Cl → Products + HCl
1 record matched CH3OCF2CHF2 + ·Cl → Products
7 records matched CH3OCF2CHFCl + ·Cl → Products
1 record matched C2F5COOH + ·Cl → Products
5 records matched Propanal, pentafluoro- + ·Cl → Products
2 records matched C2F5CH2OH + ·Cl → Products + HCl
3 records matched C2F5CH2OH + ·Cl → Products
3 records matched CF3CH(OH)2 + ·Cl → Products
2 records matched CH3COCF3 + ·Cl → Products
3 records matched CF3OCH3 + ·Cl → CF3OCH2(.) + HCl
2 records matched CH3CF3 + ·Cl → CF3CH2 + HCl
3 records matched (CH3)2CF2 + ·Cl → HCl + CH3CF2CH2(·)
3 records matched Thiirane + ·Cl → C2H4 + SCl
1 record matched Thiirane + ·Cl → Products
1 record matched (E)-CF3CH=CHCF3 + ·Cl → Products
1 record matched 2,2,2-trifluoroethylacrylate + ·Cl → Products
5 records matched CF3C(O)OCH2CF3 + ·Cl → Products
1 record matched CF3CH2CH2CHO + ·Cl → Products
1 record matched Pentane, 1,1,1-trifluoro- + ·Cl → HCl + CF3(CH2)3CH2
1 record matched CF3CH2OCF2CF2H + ·Cl → Products
2 records matched CF3CH2CF2CH3 + ·Cl → Other Products + HCl
5 records matched CF3CH2CF2CH3 + ·Cl → Products
1 record matched CF3C(O)OC(CH3)3 + ·Cl → HCl + CF3C(O)OCH2CH(·)CH2CH3
1 record matched Hexafluorobenzene + ·Cl → 1,2,3,4,5,6-hexafluoro,6-chlorocyclohexadienyl radical
3 records matched CF3COOC2H5 + ·Cl → Products
1 record matched CF2ClC(O)OCH2CH3 + ·Cl → Products
1 record matched CF3CHFCF2OCH3 + ·Cl → Products
1 record matched CF3CHFCF2CH2OH + ·Cl → Products + HCl
2 records matched (CF3)2C=CH2 + ·Cl → Products
1 record matched CHF2COOH + ·Cl → Products
5 records matched CF3CHFCF2OCH2CH3 + ·Cl → Products
2 records matched C6F13CH2OH + ·Cl → Products
3 records matched C4F9CH(OH)2 + ·Cl → Products
1 record matched n-C3F7COOH + ·Cl → Products
1 record matched n-C3F7OCH3 + ·Cl → CF3CF2CF2OCH2 + HCl
4 records matched Butanal, heptafluoro- + ·Cl → Products
4 records matched 3,3,4,4,4-pentafluorobut-1-ene + ·Cl → Products
1 record matched CF3CH(OH)CH3 + ·Cl → Products
3 records matched CH2FCH2OH + ·Cl → Products
1 record matched CH3CH2CH2C(O)OCH2CF3 + ·Cl → Products
1 record matched CF3C(O)O(CH2)3CH3 + ·Cl → HCl + CF3C(O)OCH2CH2CH2CH2
1 record matched CF3C(O)O(CH2)3CH3 + ·Cl → HCl + CF3C(O)OCH2CH2CH(·)CH3
1 record matched CF3C(O)O(CH2)3CH3 + ·Cl → HCl + CF3C(O)OCH(·)CH2CH2CH3
1 record matched Pentafluorobenzene + ·Cl → Phenyl, pentafluoro- + HCl
1 record matched Pentafluorobenzene + ·Cl → C6F5HCl Adduct
5 records matched 2-C4F8 (unspecified) + ·Cl → Products
3 records matched CF3C(O)OOH + ·Cl → Products
4 records matched CHF2CHF2 + ·Cl → HCl + CHF2CF2
3 records matched CHF2CH2OH + ·Cl → Products
1 record matched CF2=CHCl + ·Cl → Adduct
5 records matched 1-C4H8 + ·Cl → Products
7 records matched C2F5I + ·Cl → C2F5 + ICl
6 records matched C2F5H + ·Cl → C2F5 + HCl
2 records matched C2F5H + ·Cl → Products
2 records matched CF2ClCHFCl + ·Cl → Products
6 records matched C2H5F + ·Cl → HCl + CH3C(·)HF
4 records matched C2H5F + ·Cl → HCl + CH2CH2F
1 record matched C2H5F + ·Cl → Other Products + HCl
1 record matched (C2H5)2S + ·Cl → Other Products + HCl
4 records matched (C2H5)2S + ·Cl → Products
2 records matched 2,2,2-Trifluoroethyl methacrylate + ·Cl → Products
1 record matched Benzene,1-chloro-2-fluoro- + H· → Fluorobenzene + ·Cl
4 records matched CF3CH2OCH2CF3 + ·Cl → Products
3 records matched CF3CH2OCH2CF3 + ·Cl → CF3CH(.)OCH2CF3 + HCl
7 records matched CF3CHCl2 + ·Cl → HCl + CF3CCl2
2 records matched Cyclodecane + ·Cl → Other Products + HCl
2 records matched Cyclooctane + ·Cl → Other Products + HCl
1 record matched Cyclooctane + ·Cl → Products
2 records matched Cycloheptane + ·Cl → Other Products + HCl
6 records matched Cyclopentane + ·Cl → Cyclopentyl + HCl
1 record matched Cyclopentane + ·Cl → Products
2 records matched Cyclobutane + ·Cl → Cyclobutyl + HCl
1 record matched Bicyclo[2.1.1]hexane + ·Cl → Other Products + HCl
5 records matched Acenaphthylene + ·Cl → Products
6 records matched (E)-CHCl=CHCl + ·Cl → Products
1 record matched (E)-CHCl=CHCl + ·OH → Products + ·Cl
3 records matched (Z)-CHCl=CHCl + ·Cl → CHCl2CHCl
5 records matched (Z)-CHCl=CHCl + ·Cl → Products
2 records matched CF3CHClBr + ·Cl → HCl + CF3CClBr
5 records matched 4-Methoxyphenol + ·Cl → Products
7 records matched 3-Methoxyphenol + ·Cl → Products
3 records matched Dibutyl ether + ·Cl → Other Products + HCl
1 record matched Dibutyl ether + ·Cl → Products
3 records matched (E,E)-2,4-Hexadienal + ·Cl → Products
4 records matched 1-C7H16 + ·Cl → Other Products + HCl
3 records matched 1-C7H16 + ·Cl → Products
6 records matched Tetrahydro-2H-pyran + ·Cl → Products
4 records matched Cyclopentene + ·Cl → Products
2 records matched CH2ClCH2CH2Cl + ·Cl → Other Products + HCl
1 record matched (CH3)2C=CHC(=O)CH3 + ·Cl → Products
15 records matched CH3C(O)OC2H5 + ·Cl → Products
1 record matched HOCH2CHO + ·Cl → HOCH(·)CHO + HCl
5 records matched n-Butyl acrylate + ·Cl → Products
1 record matched CH2=CHC(O)OC2H5 + ·Cl → Products
2 records matched Limonene + ·Cl → Products
2 records matched beta-pinene + ·Cl → Products
4 records matched CH3CON(CH3)2 + ·Cl → Products
10 records matched C2Cl4 + ·Cl → C2Cl5
4 records matched C2Cl4 + ·Cl → Products
1 record matched C2Cl4 + O· → Other Products + ·Cl
2 records matched C2Cl4 + H· → C2HCl3 + ·Cl
4 records matched CHClBr2 + ·Cl → Products
2 records matched (CH3)2NH + ·Cl → Products
3 records matched 1-C10H22 + ·Cl → Other Products + HCl
1 record matched 1-C10H22 + ·Cl → Products
9 records matched 1-C9H18 + ·Cl → Products
2 records matched 1,4-Dioxane + ·Cl → 1,4-Dioxan-2-yl + HCl
3 records matched 1,4-Dioxane + ·Cl → Products
1 record matched CH3COO(CH2)3CH3 + ·Cl → HCl + CH3C(O)OCH2CH2CH2CH2·
1 record matched CH3COO(CH2)3CH3 + ·Cl → HCl + CH3C(O)OCH2CH2CH(·)CH3
1 record matched CH3COO(CH2)3CH3 + ·Cl → HCl + CH3C(O)OCH2CH(·)CH2CH3
1 record matched CH3COO(CH2)3CH3 + ·Cl → HCl + CH3C(O)OCH(·)CH2CH2CH3
10 records matched CH3COO(CH2)3CH3 + ·Cl → Products
1 record matched CH3CH2CH2CHO + ·Cl → HCl + C2H5CH(·)CHO
1 record matched CH3CH2CH2CHO + ·Cl → HCl + CH3CH2CH2CO
2 records matched CH3CH2CH2CHO + ·Cl → Products
1 record matched CH3CH2CH2CHO + ·Cl → ·CH2CH2CH2CHO + HCl
1 record matched CH3CH2CH2CHO + ·Cl → CH3CH(·)CH2CHO + HCl
2 records matched 3-methyl-1-butanol + ·Cl → Products
1 record matched (CH3)2C(OH)CH2C(O)CH3 + ·Cl → Products
3 records matched HCONHCH3 + ·Cl → Products
2 records matched C2H5CHO + ·Cl → Other Products + HCl
15 records matched C2H5CHO + ·Cl → Products
1 record matched Myrcene + ·Cl → Products
1 record matched Cyclopentanone + ·Cl → Other Products + HCl
4 records matched Cyclopentanone + ·Cl → Products
1 record matched 2,4-Dichlorophenol + H· → 4-Chlorophenol + ·Cl
1 record matched 2,4-Dichlorophenol + H· → 2-Chlorophenol + ·Cl
1 record matched 1,2,4-Trichlorobenzene + H· → 1,3-dichlorobenzene + ·Cl
1 record matched 1,2,4-Trichlorobenzene + H· → 1,4-dichlorobenzene + ·Cl
1 record matched 1,2,4-Trichlorobenzene + H· → 1,2-dichlorobenzene + ·Cl
1 record matched methyl salicylate + ·Cl → Products
7 records matched 4-methyl-2-nitro-phenol + ·Cl → Products
3 records matched CF3CF=CF2 + ·Cl → Products
1 record matched CH2=C(CH3)OCH3 + ·Cl → Products
3 records matched CH3C(O)CH2OH + ·Cl → Products
3 records matched CH3C(O)C(OH)(CH3)2 + ·Cl → Products
2 records matched CCl3CH2OH + ·Cl → Products
7 records matched 2-Methyl-3-butyn-2-ol + ·Cl → Products
5 records matched CH2=CHC(CH3)2OH + ·Cl → Products
2 records matched CH2=CHC(CH3)2OH + ·Cl → CH2ClC(·)HC(CH3)2OH
7 records matched Isobutene + ·Cl → Products
9 records matched Dimethyl ether + ·Cl → HCl + CH3OCH2·
2 records matched Dimethyl ether + ·Cl → Products
2 records matched CH3CH=CH2 + ·Cl → ClCH2CHCH3
2 records matched CH3CH=CH2 + ·Cl → ·CH2CH=CH2 + HCl
24 records matched CH3CH=CH2 + ·Cl → Products
1 record matched Dodecane + ·Cl → Other Products + HCl
1 record matched 1-Octanol + ·Cl → Other Products + HCl
2 records matched n-C9H20 + ·Cl → Other Products + HCl
1 record matched n-C9H20 + ·Cl → Products
4 records matched 1,5-Cyclooctadiene (unspecified) + ·Cl → Products
5 records matched 1-C6H13CHO + ·Cl → Products
1 record matched n-C7H15OH + ·Cl → Other Products + HCl
11 records matched 1-C8H16 + ·Cl → Products
4 records matched n-C8H18 + ·Cl → Other Products + HCl
5 records matched n-C8H18 + ·Cl → Products
3 records matched CH3C(O)OCH2CH2OC(O)CH3 + ·Cl → Products
1 record matched (n-C3H7)2S + ·Cl → Other Products + HCl
2 records matched (n-C3H7)2S + ·Cl → Products
5 records matched (ClCH2CH2)2O + ·Cl → Products
3 records matched Dipropyl ether + ·Cl → Other Products + HCl
1 record matched Dipropyl ether + ·Cl → Products
1 record matched n-C6H13OH + ·Cl → Other Products + HCl
2 records matched Hexane, 1-bromo- + ·Cl → Other Products + HCl
4 records matched 1,3,5-Trioxane + ·Cl → Products
5 records matched 3,4-Dihydro-2H-pyran + ·Cl → Products
1 record matched Pyridine + ·Cl → HCl + 2-pyridinyl
5 records matched Cyclohexene + ·Cl → Products
8 records matched Cyclohexane + ·Cl → Cyclohexyl + HCl
4 records matched Cyclohexane + ·Cl → Products
1 record matched HOCH2CH2OC2H5 + ·Cl → Products
4 records matched HCOOCH2CH2CH3 + ·Cl → Products
1 record matched 1,2-Dimethoxyethane + ·Cl → CH3OCH2CH2OCH2· + HCl
1 record matched 1,2-Dimethoxyethane + ·Cl → CH3OCH(·)CH2OCH3 + HCl
15 records matched Pentanal + ·Cl → Products
1 record matched CH3(CH2)3CN + ·Cl → Products
1 record matched 1-C6H14 + ·Cl → 2-hexyl radical + HCl
6 records matched 1-C6H14 + ·Cl → Other Products + HCl
1 record matched 1-C6H14 + ·Cl → Products
2 records matched n-C5H11Br + ·Cl → Other Products + HCl
5 records matched isobutyl acetate + ·Cl → Products
2 records matched (CH3)2CHCH2CH2COCH3 + ·Cl → Products
5 records matched Furan + ·Cl → Products
11 records matched Tetrahydrofuran + ·Cl → Products
1 record matched C2H5ONO + ·Cl → Products
1 record matched HC(O)OC2H5 + ·Cl → HCl + CH3CH2OC(O)·
5 records matched HC(O)OC2H5 + ·Cl → Products
1 record matched HC(O)OC2H5 + ·Cl → CH3CH(·)OC(O)H + HCl
1 record matched CH2=CHOC2H5 + ·Cl → Products
3 records matched CH3OCH2OCH3 + ·Cl → Other Products + HCl
1 record matched CH3OCH2OCH3 + ·Cl → CH3OCH2OCH2· + HCl
1 record matched CH3OCH2OCH3 + ·Cl → CH3OCH(·)OCH3 + HCl
1 record matched CH2=CHCH2CN + ·Cl → Products
1 record matched CH3CH2CH2C≡N + ·Cl → Products
6 records matched 1-C4H9Cl + ·Cl → Other Products + HCl
5 records matched 1-C5H10 + ·Cl → Products
1 record matched n-C5H12 + ·Cl → CH3CH2CH2CH(·)CH3 + HCl
7 records matched n-C5H12 + ·Cl → Other Products + HCl
4 records matched n-C5H12 + ·Cl → Products
2 records matched n-C4H9Br + ·Cl → Other Products + HCl
10 records matched CH3COOCH2CH2CH3 + ·Cl → Products
6 records matched 5-Hexen-2-one + ·Cl → Products
2 records matched n-C3H7C(O)O(CH2)3CH3 + ·Cl → Products
12 records matched Phenol + ·Cl → C6H5O + HCl
1 record matched Cyclohexanone + ·Cl → Other Products + HCl
12 records matched Cyclohexanone + ·Cl → Products
1 record matched Cyclohexanone + ·Cl → C6H9(·)O + HCl
1 record matched Cyclohexanol + ·Cl → Products
1 record matched Chlorobenzene + ·Cl → 1,4-dichlorobenzene + H·
1 record matched Chlorobenzene + ·Cl → 1,2-dichlorobenzene + H·
2 records matched Chlorobenzene + ·Cl → Products
2 records matched Chlorobenzene + ·Cl → chlorophenyl radical (unspecified isomer) + HCl
2 records matched Chlorobenzene + D → Benzene-d + ·Cl
4 records matched Chlorobenzene + H· → Benzene + ·Cl
2 records matched Chlorobenzene + C6H5O → Diphenyl ether + ·Cl
4 records matched Chlorobenzene → Phenyl + ·Cl
4 records matched Toluene + ·Cl → Benzyl + HCl
6 records matched Toluene + ·Cl → Other Products + HCl
4 records matched Toluene + ·Cl → Products
2 records matched Methylcyclohexane + ·Cl → Other Products + HCl
11 records matched Methylcyclohexane + ·Cl → Products
1 record matched Bromobenzene + ·Cl → Chlorobenzene + Br·
1 record matched 1,3,5-Trimethylhexahydro-1,3,5-triazine + ·Cl → Methyl, [1-(3,5-dimethyl)hexahydrotriazinyl)]- + HCl
2 records matched 1,3,5-Trimethylbenzene + ·Cl → Products
4 records matched (CH3)2CHCH2C(O)OC2H5 + ·Cl → Products
1 record matched Dimethyl malonate + ·Cl → Products
4 records matched 3-Chlorophenol + ·Cl → Products
1 record matched 3-Chlorophenol + H· → Phenol + ·Cl
5 records matched 1,3-Dimethylbenzene + ·Cl → Products
1 record matched Propylene Carbonate + ·Cl → Products
1 record matched γ-Valerolactone + ·Cl → Products
7 records matched CH3COOCH(CH3)2 + ·Cl → Products
3 records matched (iso-C3H7)2O + ·Cl → Other Products + HCl
1 record matched (iso-C3H7)2O + ·Cl → Products
2 records matched Methyl Isobutyl Ketone + ·Cl → Products
2 records matched Pentane, 2,4-dimethyl- + ·Cl → Other Products + HCl
5 records matched CH3CO2CH=CH2 + ·Cl → Products
3 records matched 1-nitropropane + ·Cl → Products
1 record matched CH3OCH2CH(CH3)OH + ·Cl → Products
6 records matched 2-pentanone + ·Cl → Products
1 record matched (CH3)2C=CHCHO + ·Cl → Products
3 records matched (CH3)2CH(CH2)2CH3 + ·Cl → Other Products + HCl
3 records matched ((CH3)3Si)2O + ·Cl → Products
2 records matched HC(O)OCH3 + ·Cl → HCl + CH3OC(·)(O)
2 records matched HC(O)OCH3 + ·Cl → HC(O)OCH2(·) + HCl
7 records matched HC(O)OCH3 + ·Cl → Products
2 records matched CH3OCH2Cl + ·Cl → Products
1 record matched CH3OCH2Cl → CH3OCH2· + ·Cl
1 record matched (CHO)2 + ·Cl → Other Products + HCl
3 records matched CH2ClCHO + ·Cl → Products
5 records matched HC≡CCH2OH + ·Cl → Products
1 record matched CH2=CHCH2OH + ·Cl → HCl + CH(OH)CH=CH2
4 records matched CH2=CHCH2OH + ·Cl → Products
1 record matched CH2=CHCH2OH + ·Cl → CH2ClCH(·)CH2OH
2 records matched CH2=CHCH2OH + ·Cl → C3H6O(unspecified structure) + HCl
2 records matched CH2ClCN + ·Cl → Products
1 record matched CH2CHCN + ·Cl → Products
7 records matched CH2CHCN + ·Cl → ClCH2CH(·)CN
1 record matched C2H5CN + ·Cl → Products
1 record matched n-C3H7I + ·Cl → Adduct
1 record matched n-C3H7I + ·Cl → Products
2 records matched CH2ClCH2OH + ·Cl → Products
9 records matched CH2ClCH2Cl + ·Cl → HCl + CH2ClCHCl·
1 record matched CH2ClCH2Cl → CH2CH2Cl + ·Cl
2 records matched CH2=CHCH2Cl + ·Cl → Products
1 record matched CH3CH2CH2SH + ·Cl → CH3CH2CH2S· + HCl
1 record matched CH3CH2CH2SH + ·Cl → Products
1 record matched CH2=CHCHO + ·Cl → HCl + CH2=CHC(·)O
16 records matched CH2=CHCHO + ·Cl → Products
2 records matched CH3CH=CHCH3 + ·Cl → Products
2 records matched 1-butyne + ·Cl → Products
4 records matched 1,3-Butadiene + ·Cl → Products
17 records matched 1-C4H8 + ·Cl → Products
5 records matched 1-C4H10 + ·Cl → 1-C4H9 + HCl
6 records matched 1-C4H10 + ·Cl → sec-C4H9 + HCl
13 records matched 1-C4H10 + ·Cl → Other Products + HCl
1 record matched 1-C4H10 + ·Cl → Products + HCl
2 records matched 1-C4H10 + ·Cl → Products
1 record matched CH2=CHCH2Br + ·Cl → Products
1 record matched n-C3H7Br + ·Cl → BrCH2CHCH3
2 records matched n-C3H7Br + ·Cl → Other Products + HCl
1 record matched n-C3H7Br + ·Cl → Products
1 record matched CH2BrCH2Br + ·Cl → Products
2 records matched Heptanoic acid, methyl ester + ·Cl → Products
3 records matched Methyl hexanoate + ·Cl → Products
3 records matched CH3OC(O)CH2CH2C(O)OCH3 + ·Cl → Products
4 records matched 1,4-Benzoquinone + ·Cl → Products
2 records matched 4-Chlorophenol + ·Cl → Products
1 record matched 4-Chlorophenol + H· → Phenol + ·Cl
2 records matched 1,4-dichlorobenzene + H· → Chlorobenzene + ·Cl
5 records matched 1,4-Dimethylbenzene + ·Cl → Products
3 records matched C2H5C(O)OCH2CH2CH3 + ·Cl → Products
2 records matched CH3CH2CH2C(O)OCH2CH2CH3 + ·Cl → Products
1 record matched C2H5OC(O)OC2H5 + ·Cl → Products
4 records matched CH3CH2CH2C(O)OC2H5 + ·Cl → Products
5 records matched CH3COOCH(CH3)C2H5 + ·Cl → Products
1 record matched CH2=CHOC(O)CH2CH3 + ·Cl → Products
9 records matched C2H5C(O)OC2H5 + ·Cl → Products
1 record matched C2H5C(O)OC2H5 + ·Cl → ·CH2CH2C(O)OC2H5 + HCl
1 record matched C2H5C(O)OC2H5 + ·Cl → CH3CH(·)C(O)OC2H5 + HCl
1 record matched C2H5C(O)OC2H5 + ·Cl → CH3CH2C(O)OCH(·)CH3 + HCl
1 record matched 1-Phenylpropane + ·Cl → HCl + C6H5CH(·)CH2CH3
10 records matched 2-Ethylhexyl acrylate + ·Cl → Products
1 record matched Diphenyl ether + ·Cl → Products
7 records matched Methoxybenzene + ·Cl → Products
2 records matched Benzaldehyde + ·Cl → benzoyl + HCl
2 records matched Benzaldehyde + ·Cl → Products
2 records matched Benzyl alcohol + ·Cl → Products
3 records matched C6H5CH2Cl + ·Cl → Products
2 records matched Styrene + ·Cl → Products
2 records matched p-Cimene + ·Cl → Products
3 records matched Nitrobenzene + ·Cl → Products
5 records matched Furfural + ·Cl → Products
8 records matched Butyl methacrylate + ·Cl → Products
4 records matched Ethyl-2-methyl-propanoate + ·Cl → Products
2 records matched Methylcyclopentane + ·Cl → Products
2 records matched ClH2CCOOCH3 + ·Cl → Products
8 records matched CH2=CHC(O)OCH3 + ·Cl → Products
1 record matched (C2H5)2CO + ·Cl → CH3CH2C(O)CH(·)CH3
8 records matched (C2H5)2CO + ·Cl → Products
1 record matched (C2H5)2CO + ·Cl → C5H9O + HCl
1 record matched (C2H5)2CO + ·Cl → CH3CH2C(O)CH2CH2·
3 records matched CH2ClCHClCH2Cl + ·Cl → Products
2 records matched (C2H5)2CHCH3 + ·Cl → Other Products + HCl
9 records matched 2-Chlorophenol + ·Cl → Products
2 records matched 2-Chlorophenol + H· → Phenol + ·Cl
2 records matched 1,2-dichlorobenzene + H· → Chlorobenzene + ·Cl
5 records matched 1,2-Dimethylbenzene + ·Cl → Products
5 records matched 2-Methoxy-4-methylphenol + ·Cl → Products
5 records matched Naphthalene + ·Cl → Products
7 records matched 2,6-dimethoxyphenol + ·Cl → Products
7 records matched 2-Methoxyphenol + ·Cl → Products
1 record matched Menthol + ·Cl → Products
7 records matched 2-Nitrophenol + ·Cl → Products
1 record matched 1,2,3-Trichlorobenzene + H· → 1,3-dichlorobenzene + ·Cl
1 record matched 1,2,3-Trichlorobenzene + H· → 1,2-dichlorobenzene + ·Cl
5 records matched Acenaphthene + ·Cl → Products
2 records matched Methyl methacrylate + ·Cl → Products
3 records matched alpha-pinene + ·Cl → Products
1 record matched (COCl)2 + ·Cl → CO + ClCO + Cl2
1 record matched (COCl)2 + ·Cl → Oxalyl chloride radical + Cl2
1 record matched (COCl)2 → CO + ·Cl
2 records matched CHCl2COCl + ·Cl → HCl + ·CCl2C(O)Cl
5 records matched (CHCl2)2 + ·Cl → HCl + CHCl2C(·)Cl2
3 records matched (CH3)2CHC(O)Cl + ·Cl → Products
7 records matched 2,3-Dimethylbutane + ·Cl → Other Products + HCl
3 records matched C2H5NO2 + ·Cl → Products
3 records matched CH3C(O)OOH + ·Cl → Products
8 records matched CH3C(O)OCH3 + ·Cl → Products
4 records matched CH2=CHCOOH + ·Cl → Products
2 records matched CH2=CHCOOH + ·Cl → [ClCH2CHCOOH] complex
1 record matched C2H5COOH + ·Cl → Products
1 record matched C2H5COOH + ·Cl → ·CH2CH2OC(O)H + HCl
1 record matched CH2ClCOCl + ·Cl → (.)CHClC(O)Cl + HCl
4 records matched C2H5COCl + ·Cl → Products
1 record matched CHCl2CHO + ·Cl → Products
2 records matched C2HCl3 + ·Cl → CCl3CHCl
3 records matched C2HCl3 + ·Cl → CHCl2C(·)Cl2
6 records matched C2HCl3 + ·Cl → Products
2 records matched C2HCl3 + H· → HCCCl + HCl + ·Cl
2 records matched C2HCl3 + H· → CHCl=CHCl (Unspec.) + ·Cl
2 records matched C2HCl3 + H· → CH2=CCl2 + ·Cl
1 record matched C2HCl3 + Cyclopentyl → Cyclopentane, (2,2-dichloroethenyl)- + ·Cl
1 record matched C2HCl3 + ·OH → CCl2CHOH + ·Cl
1 record matched C2HCl3 → ·Cl + CCl2=CH·
2 records matched CHCl2CH2Cl + ·Cl → HCl + CH2ClCCl2·
4 records matched CHCl2CH2Cl + ·Cl → HCl + CHCl2CHCl
1 record matched CHCl2CH2Cl + ·Cl → Other Products + HCl
2 records matched CH3C(O)CHO + ·Cl → Other Products + HCl
3 records matched CH3COCH2Cl + ·Cl → Products
10 records matched CH2=CHCOCH3 + ·Cl → Products
1 record matched CH2=CHCOCH3 + ·Cl → H2C=CHC(O)CH2(·) + HCl
1 record matched CH2=CHCOCH3 + ·Cl → CH3C(O)C(·)HCH2Cl
2 records matched C2H5COCH3 + ·Cl → HCl + ·CH2CH2C(O)CH3
2 records matched C2H5COCH3 + ·Cl → HCl + CH3C(O)CH(·)CH3
11 records matched C2H5COCH3 + ·Cl → Products
2 records matched C2H5COCH3 + ·Cl → ·CH2C(O)C2H5 + HCl
2 records matched sec-C4H9OH + ·Cl → Products
4 records matched 2,3-dichloropropene + ·Cl → Products
3 records matched CH3CHClCH2Cl + ·Cl → Other Products + HCl
4 records matched sec-C4H9Cl + ·Cl → Other Products + HCl
14 records matched Methacrolein + ·Cl → Products
1 record matched Methacrolein + ·Cl → CH2=C(CH3)CO + HCl
1 record matched Methacrolein + ·Cl → CH2ClC(·)(CH3)CHO
1 record matched (CH3)2CHCHO + ·Cl → HCl + C2H5CH(·)CHO
1 record matched (CH3)2CHCHO + ·Cl → HCl + (CH3)2CCHO
2 records matched (CH3)2CHCHO + ·Cl → HCl + (CH3)2CHC=O
8 records matched (CH3)2CHCHO + ·Cl → Products
2 records matched iso-C4H9OH + ·Cl → Products
1 record matched CH2=C(CH3)CH=CH2 + ·Cl → HCl + (.)CH=C(CH3)CH=CH2
1 record matched CH2=C(CH3)CH=CH2 + ·Cl → Adduct
11 records matched CH2=C(CH3)CH=CH2 + ·Cl → Products
1 record matched CH2=C(CH3)CH=CH2 + ·Cl → H2C=CHC(CH3)=CH· + HCl
1 record matched CH2=C(CH3)CH=CH2 + ·Cl → CH2=C(CH3)CHClCH2·
1 record matched iso-C5H12 + ·Cl → (CH3)2C(·)CH2CH3 + HCl
4 records matched iso-C5H12 + ·Cl → Other Products + HCl
1 record matched iso-C5H12 + ·Cl → Products
1 record matched (C2H5O)3PO + ·Cl → Products
1 record matched (C2H5O)P(O)C2H5 + ·Cl → Products
1 record matched Hexachlorocyclopentadiene + ·Cl → Pentachlorocyclopentadienyl + Cl2
1 record matched Methoxyflurane + ·Cl → Products
1 record matched Bicyclo[2.2.1]heptan-2-one,1,7,7-trimethyl- + ·Cl → Products
1 record matched CF3COOH + ·Cl → Products
1 record matched CHCl2CCl3 + ·Cl → Cl2 + CCl3CHCl
8 records matched CHCl2CCl3 + ·Cl → C2Cl5 + HCl
1 record matched CHCl2CCl3 → Other Products + ·Cl
4 records matched CF3CHO + ·Cl → CF3C(O)· + HCl
4 records matched CF3CHO + ·Cl → Products
8 records matched CF3CH2OH + ·Cl → Products
4 records matched CF3CH2Cl + ·Cl → HCl + CF3CHCl
4 records matched CCl3CHO + ·Cl → Other Products + HCl
2 records matched C2H5C(CH3)2OH + ·Cl → Products
1 record matched (CH3)4Si + ·Cl → HCl + (CH3)3SiCH2
2 records matched (CH3)4Si + ·Cl → Products
1 record matched (CH3)4Pb + ·Cl → HCl + (CH3)3PbCH2
1 record matched (CH3)4Pb + ·Cl → CH3Cl + (CH3)3Pb
7 records matched CF3Cl → ·CF3 + ·Cl
1 record matched CF2Cl2 + ·F → CF3Cl + ·Cl
1 record matched CF2Cl2 → ·CClF2 + ·Cl
1 record matched CFCl3 → ·CCl2F + ·Cl
11 records matched CH3CF2Cl + ·Cl → CF2ClCH2· + HCl
3 records matched tert-C4H9OH + ·Cl → Other Products + HCl
2 records matched tert-C4H9OH + ·Cl → Products
1 record matched CF3Br + ·Cl → Products
1 record matched CCl3Br + ·Cl → ·CCl3 + BrCl
2 records matched CCl3Br + ·Cl → Products
5 records matched Methyloxirane + ·Cl → Products
3 records matched CH3NO2 + ·Cl → Products
2 records matched (CH3)3N + ·Cl → Products
1 record matched CHF3 + ·Cl → ·CF3 + HCl
5 records matched CHF2Cl + ·Cl → ·CClF2 + HCl
2 records matched CHF2Cl + ·Cl → Products
1 record matched COCl2 + ·Cl → ClCO + Cl2
6 records matched CHFCl2 + ·Cl → ·CCl2F + HCl
2 records matched CH2=CF2 + ·Cl → Adduct
6 records matched CH3CHF2 + ·Cl → HCl + CH2CHF2
8 records matched CH3CHF2 + ·Cl → HCl + CH3CF2
4 records matched CH3CHF2 + ·Cl → Other Products + HCl
5 records matched CH3CHF2 + ·Cl → Products
2 records matched CH3COCl + ·Cl → Products
1 record matched CH2=CCl2 + ·Cl → CCl3CH2
7 records matched CH2=CCl2 + ·Cl → Products
1 record matched CH2=CCl2 + ·OH → Products + ·Cl
5 records matched CH3CHCl2 + ·Cl → HCl + CHCl2CH2·
4 records matched CH3CHCl2 + ·Cl → HCl + CH3CCl2·
1 record matched CH3CHCl2 + ·Cl → Other Products + HCl
1 record matched iso-C3H7SH + ·Cl → HCl + (CH3)2CHS
1 record matched iso-C3H7I + ·Cl → iso-C3H7Cl + I
1 record matched iso-C3H7I + ·Cl → Products
6 records matched iso-C3H7Cl + ·Cl → Other Products + HCl
2 records matched iso-C3H7Cl + ·Cl → Products
5 records matched iso-C4H10 + ·Cl → iso-C4H9 + HCl
7 records matched iso-C4H10 + ·Cl → tert-C4H9 + HCl
11 records matched iso-C4H10 + ·Cl → Other Products + HCl
2 records matched iso-C4H10 + ·Cl → Products + HCl
2 records matched iso-C4H10 + ·Cl → Products
1 record matched CHBrCl2 + ·Cl → Products
2 records matched iso-C3H7Br + ·Cl → Other Products + HCl
8 records matched CHBr3 + ·Cl → CBr3 + HCl
2 records matched CHBr3 + ·Cl → Products
2 records matched Oxirane + ·Cl → HCl + Oxiranyl
1 record matched Oxirane + ·Cl → Products
4 records matched Cyclopropane + ·Cl → Cyclopropyl + HCl
6 records matched Cyclopropane + ·Cl → Products
1 record matched (CH3)2S + ·Cl → HCl + CH3SCH2
1 record matched (CH3)2S + ·Cl → ·CH3 + CH3SCl
2 records matched (CH3)2S + ·Cl → Adduct
5 records matched (CH3)2S + ·Cl → Products
2 records matched CS2 + ·Cl → Products
1 record matched CH2I2 + ·Cl → Adduct
1 record matched CH2I2 + ·Cl → Products
2 records matched CH2I2 + ·Cl → ICH2ICl
4 records matched CH2F2 + ·Cl → ·CHF2 + HCl
16 records matched CH2Cl2 + ·Cl → CHCl2 + HCl
2 records matched CH2Cl2 → ·CH2Cl + ·Cl
1 record matched C2H5SH + ·Cl → HCl + CH3CH2S
1 record matched C2H5SH + ·Cl → Products
1 record matched CH3CHO + ·Cl → HCl + CH3CO
1 record matched CH3CHO + ·Cl → *CH2C(O)H + HCl
13 records matched CH3CHO + ·Cl → CH3CO + HCl
2 records matched CH3CHO + ·Cl → Other Products + HCl
3 records matched CH3CHO + ·Cl → Products
3 records matched CH3CN + ·Cl → CH2CN + HCl
3 records matched CH3CN + ·Cl → Products
1 record matched C2H5I + ·Cl → C2H5Cl + I
3 records matched C2H5I + ·Cl → Adduct
2 records matched C2H5I + ·Cl → Products + HCl
4 records matched C2H5I + ·Cl → Products
1 record matched CH2=CHF + ·Cl → Products
1 record matched CH2=CHCl + ·Cl → CHCl2CH2·
2 records matched CH2=CHCl + ·Cl → CH2ClCHCl·
1 record matched CH2=CHCl + ·Cl → HCl + CHCl=CH
4 records matched CH2=CHCl + ·Cl → Products
1 record matched CH2=CHCl + ·F → CH2=CHF + ·Cl
1 record matched CH2=CHCl + ·OH → Products + ·Cl
17 records matched C2H5Cl + ·Cl → HCl + CH3CHCl
16 records matched C2H5Cl + ·Cl → HCl + CH2CH2Cl
10 records matched C2H5Cl + ·Cl → Other Products + HCl
2 records matched CH3CCH + ·Cl → ·CH2C≡CH + HCl
5 records matched CH3CCH + ·Cl → Products
8 records matched C3H8 + ·Cl → 1-C3H7 + HCl
8 records matched C3H8 + ·Cl → 2-C3H7 + HCl
17 records matched C3H8 + ·Cl → Other Products + HCl
2 records matched C3H8 + ·Cl → Products + HCl
1 record matched C3H8 + ·Cl → Products
5 records matched CH2ClBr + ·Cl → HCl + ·CHBrCl
1 record matched CH2ClBr + ·Cl → Products
1 record matched C2H5Br + ·Cl → CH2BrCH2
1 record matched C2H5Br + ·Cl → HCl + CH2BrCH2
3 records matched C2H5Br + ·Cl → Other Products + HCl
1 record matched C2H5Br + ·Cl → Products
5 records matched CH2Br2 + ·Cl → HCl + CHBr2
2 records matched CH2Br2 + ·Cl → Products
1 record matched CH3SH + ·Cl → HCl + ·CH2SH
5 records matched CH3SH + ·Cl → CH3S· + HCl
1 record matched CH3SH + ·Cl → Other Products + HCl
1 record matched CH3NH2 + ·Cl → HCl + CH2NH2
2 records matched CH3NH2 + ·Cl → Products
2 records matched CH3I + ·Cl → CH3ICl
5 records matched CH3I + ·Cl → HCl + ·CH2I
5 records matched CH3I + ·Cl → Adduct
12 records matched CH3I + ·Cl → Products
20 records matched CH3Cl + ·Cl → ·CH2Cl + HCl
4 records matched CH3Cl + ·Cl → Products
1 record matched CH3Cl + ·F → CH3F + ·Cl
7 records matched CH3Cl → ·CH3 + ·Cl
8 records matched C2H2 + ·Cl → CHCl=CH
20 records matched C2H2 + ·Cl → CH2CH2Cl
1 record matched C2H2 + ·Cl → ·C2H + HCl
6 records matched C2H2 + ·Cl → Products
11 records matched C2H4 + ·Cl → CH2CH2Cl
6 records matched C2H4 + ·Cl → C2H3 + HCl
21 records matched C2H4 + ·Cl → Products
40 records matched C2H6 + ·Cl → ·C2H5 + HCl
1 record matched C2H6 + ·Cl → Products
10 records matched CH3Br + ·Cl → HCl + ·CH2Br
1 record matched CH3Br + ·Cl → CH3Cl + Br·
1 record matched CH3Br + ·Cl → Adduct
64 records matched CH4 + ·Cl → ·CH3 + HCl
8 records matched CH3CCl3 + ·Cl → HCl + CCl3CH2
5 records matched Benzene + ·Cl → Phenyl + HCl
1 record matched Benzene + ·Cl → Chlorobenzene + H·
8 records matched Benzene + ·Cl → Products
1 record matched 1-C5H11OH + ·Cl → Other Products + HCl
8 records matched 1-C5H11OH + ·Cl → Products
1 record matched CH3CH2CH2CH2OH + ·Cl → HCl + CH3CH2CH2C(·)HOH
1 record matched CH3CH2CH2CH2OH + ·Cl → Other Products + HCl
8 records matched CH3CH2CH2CH2OH + ·Cl → Products
2 records matched CH3CH2CH2OH + ·Cl → CH3CH(·)CH2OH + H2O
2 records matched CH3CH2CH2OH + ·Cl → CH3CH(·)CH2OH + HCl
2 records matched CH3CH2CH2OH + ·Cl → HOCH2CH2CH2· + H2O
2 records matched CH3CH2CH2OH + ·Cl → HOCH2CH2CH2· + HCl
2 records matched CH3CH2CH2OH + ·Cl → C2H5CH(·)OH + H2O
2 records matched CH3CH2CH2OH + ·Cl → C2H5CH(·)OH + HCl
3 records matched CH3CH2CH2OH + ·Cl → Other Products + HCl
7 records matched CH3CH2CH2OH + ·Cl → Products
4 records matched HCON(CH3)2 + ·Cl → Products
1 record matched (CH3)2SO2 + ·Cl → Products
3 records matched (CH3)2SO + ·Cl → Products
2 records matched (CH3)2SO + ·Cl → CH3SCH2O· + HCl
2 records matched (CH3)2SO + ·Cl → CH3(Cl)S(O)CH3
20 records matched CHCl3 + ·Cl → ·CCl3 + HCl
1 record matched CHCl3 → CHCl2 + ·Cl
2 records matched Acetone + ·Cl → CH3C(O)CH2(·) + HCl
1 record matched Acetone + ·Cl → CH3COCl + ·CH3
20 records matched Acetone + ·Cl → Products
1 record matched iso-C3H7OH + ·Cl → (CH3)2C(·)OH + HCl
1 record matched iso-C3H7OH + ·Cl → Other Products + HCl
5 records matched iso-C3H7OH + ·Cl → Products
13 records matched CH3OH + ·Cl → (·)CH2OH + HCl
2 records matched CH3OH + ·Cl → CH3O· + HCl
1 record matched CH3OH + ·Cl → Other Products + HCl
8 records matched CH3OH + ·Cl → Products
5 records matched n-C5H11CHO + ·Cl → Products
3 records matched CH3C(O)OH + ·Cl → Other Products + HCl
2 records matched CH3C(O)OH + ·Cl → Products
1 record matched HCOOH + ·Cl → HOC(·)O + HCl
2 records matched HCOOH + ·Cl → Other Products + HCl
1 record matched HCOOH + ·Cl → HOCO + HCl
2 records matched C2H5OH + ·Cl → HOCH2CH2· + HCl
2 records matched C2H5OH + ·Cl → CH3CH(·)OH + HCl
6 records matched C2H5OH + ·Cl → Other Products + HCl
7 records matched C2H5OH + ·Cl → Products
5 records matched Diethyl ether + ·Cl → Other Products + HCl
1 record matched Diethyl ether + ·Cl → Products
4 records matched CN + HCl → HCN + ·Cl
2 records matched CN + ClCN → NCCN + ·Cl
2 records matched CCl4 + ·Cl → ·CCl3 + Cl2
6 records matched CCl4 → ·CCl3 + ·Cl
11 records matched CH2O + ·Cl → HCO + HCl
4 records matched CH2O + ·Cl → Products
4 records matched CF3OC(O)H + ·Cl → HCl + CF3C(O)O
3 records matched O(1D) + Cl2 → ClO + ·Cl
1 record matched O(1D) + DCl → OD + ·Cl
1 record matched O(1D) + HCl → ·OH + ·Cl
1 record matched Cyclohexyl, 1-chloro- + Cl2 → Cyclohexane, 1,1-dichloro- + ·Cl
1 record matched Cyclohexyl, 3-chloro- + Cl2 → ·Cl + Cyclohexane, 1,3-dichloro-, cis-
1 record matched Cyclohexyl, 3-chloro- + Cl2 → ·Cl + Cyclohexane, 1,3-dichloro-, trans-
1 record matched Cyclohexyl, 4-chloro- + Cl2 → Cyclohexane, 1,4-dichloro-, trans- + ·Cl
1 record matched Cyclohexyl, 4-chloro- + Cl2 → Cyclohexane, 1,4-dichloro-, cis- + ·Cl
2 records matched CD3CH2Cl + ·Cl → Other Products + HCl
2 records matched CD3CH2Cl + ·Cl → Products
4 records matched CD3CH2Cl + ·Cl → ·CH2CD2Cl + DCl
2 records matched CD3CH2Cl + ·Cl → CD3CHCl(.) + HCl
2 records matched CH3OCH(O) + ·Cl → Products
2 records matched Bicyclo[4.4.0]decane, cis- + ·Cl → Other Products + HCl
1 record matched CHClFCCl2O(.) → CHClFC(O)Cl + ·Cl
2 records matched [(CD3)3Si]2O + ·Cl → Products
1 record matched FC(O)OCl + ·Cl → Cl2 + FC(O)O·
2 records matched CH3OC(O)OCH(O) + ·Cl → Products
2 records matched HC(O)OC(O)OCH(O) + ·Cl → Products
3 records matched CD2=C(CD3)CD=CD2 + ·Cl → Products
3 records matched CH3OCH2OCHO(.) + ·Cl → Products
1 record matched methylsulfonyl chloride → methylsulfonyl radical + ·Cl
1 record matched methyl formate peroxy radical + ·Cl → Other Products + ClO
3 records matched CH2=CCl=CH2 → CH2=C=CH2 + ·Cl
1 record matched C6H5C(O)Cl + ·Cl → Products
1 record matched CD3CH2OH + ·Cl → Products
1 record matched CD3F + ·Cl → CD2F + DCl
5 records matched CH3OCF(CF3)2 + ·Cl → Products
2 records matched CH3OCF2CF2CF3 + ·Cl → Products
7 records matched CH3OCF2CF3 + ·Cl → Products
1 record matched ClS(CH3)2 → (CH3)2S + ·Cl
1 record matched M + C2Cl5O → CCl3COCl + ·Cl
2 records matched M + C2Cl5O → M + CCl3COCl + ·Cl
1 record matched M + NO + ·Cl → M + NOCl
1 record matched delta3-carene + ·Cl → Products
1 record matched ethylene carbonate + ·Cl → Products
1 record matched ethylene glycol diformate + ·Cl → Products
1 record matched methylene glycol diformate + ·Cl → Products
1 record matched NF(a1Delta) + ·Cl → NF(Χ3Σ-) + ·Cl
1 record matched 2-nitrooxy-1-propanol + ·Cl → Products
1 record matched 1-nitrooxy-2-propanol + ·Cl → Products
1 record matched 2-nitrooxy-1-butanol + ·Cl → Products
1 record matched 1-nitrooxy-2-butanol + ·Cl → Products
1 record matched 3-nitrooxy-1-butanol + ·Cl → Products
1 record matched 4-nitrooxy-2-butanol + ·Cl → Products
1 record matched 4-nitrooxy-1-butanol + ·Cl → Products
1 record matched 2-nitrooxy-1-pentanol + ·Cl → Products
1 record matched 1-nitrooxy-2-pentanol + ·Cl → Products
1 record matched 4-nitrooxy-1-pentanol + ·Cl → Products
1 record matched 5-nitrooxy-2-pentanol + ·Cl → Products
1 record matched 6-nitrooxy-1-hexanol + ·Cl → Products
1 record matched 1,4-butyl dinitrate + ·Cl → Products
1 record matched CH3SeClCH3 → (CH3)2Se + ·Cl
1 record matched CF3C(O)OCHF2 + ·Cl → Products
1 record matched n-butane-d1 + ·Cl → Products + DCl
1 record matched n-pentane-d1 + ·Cl → Products + DCl
1 record matched n-hexane-d1 + ·Cl → Products + DCl
1 record matched n-heptane-d1 + ·Cl → Products + DCl
1 record matched n-octane-d1 + ·Cl → Products + DCl
3 records matched CF3CF2CF2CH2OH + ·Cl → Products
3 records matched CF3CF2CF2CF2CH2OH + ·Cl → Products
4 records matched CF3CF2CF2CF2C(O)H + ·Cl → Products
2 records matched CF3CH2OCClF2 + ·Cl → Products
1 record matched (CH3)H2SiOSiH2(CH3) + ·Cl → Products
2 records matched CF3CF2CF2CF2CF2OCH3 + ·Cl → Products
2 records matched CF3CF2OC(O)H + ·Cl → CF3CF2OC(O)· + HCl
2 records matched CF3CF2CF2OC(O)H + ·Cl → CF3CF2CF2OC(O)· + HCl
1 record matched CF3CF2CF2OC(O)H + ·Cl → n-C3F7OC(O) + HCl
2 records matched CF3CF2CF2CF2CF2OCHO + ·Cl → CF3CF2CF2CF2CF2OC(O)· + HCl
1 record matched chloromethyl vinyl ketone + ·Cl → Products
1 record matched H2(v) + ·Cl → HCl + H·
1 record matched HOCO + ·Cl → CO2 + HCl
4 records matched CF3CF2CF2CF2OCH2CH3 + ·Cl → C4F9OC2H4(·) + HCl
2 records matched CHF2CF2CH2OCH3 + ·Cl → Products
9 records matched CF3CF2CH2OCH3 + ·Cl → Products
1 record matched CF3CF2CH2OCH3 + ·Cl → C2F5CH(·)OCH3 + HCl
1 record matched CF3CF2CH2OCH3 + ·Cl → C2F5CH2OCH2· + HCl
4 records matched CH2FOC(O)F + ·Cl → CHFOC(O)F + HCl
3 records matched C3H7CF(OC2H5)CF(CF3)2 + ·Cl → Products
3 records matched C3H7CF(OC(O)H)CF(CF3)2 + ·Cl → C3H7CF(OC(O)(·))CF(CF3)2 + HCl
1 record matched C3H7CF(OC(O)CH3)CF(CF3)2 + ·Cl → C3H7CF(OC(O)CH2(·))CF(CF3)2 + HCl
3 records matched CF3CF2CF2CF2CH2CHO + ·Cl → Products
3 records matched CF3CFHCF2OCF3 + ·Cl → Products
5 records matched CF3CFHCF2OCF2H + ·Cl → Products
5 records matched C4F9SO2N(H)CH2CH3 + ·Cl → Products
1 record matched CF3OCF(CF3)CF2OCF2OCF3 + ·Cl → Products
3 records matched 2-ethoxy-3,3,4,4,5-pentafluorotetra-hydro-2,5-bis[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]-furan + ·Cl → Products
3 records matched 2-formoxy-3,3,4,4,5-pentafluorotetra-hydro-2,5-bis[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]-furan + ·Cl → Products
1 record matched CD3CH2I + ·Cl → Products
1 record matched CH3CD2I + ·Cl → Products
1 record matched CF3CH(OD)CF3 + ·Cl → Products
1 record matched CH2DCOCD3 + ·Cl → Products
1 record matched CH313COCH3 + ·Cl → Products
5 records matched N-ethylperfluorobutyramide + ·Cl → Products
2 records matched CF3CHClCHO + ·Cl → Products
1 record matched ·CH2C(O)C2H5 + Cl2 → CH2ClC(O)C2H5 + ·Cl
1 record matched (E)-HC(O)CH=CHCHO + ·Cl → Products
1 record matched C2D5F + ·Cl → Other Products + DCl
2 records matched (CF3)2CFOCHO + ·Cl → (CF3)2CFOC(O)· + HCl
2 records matched [13]CH3D + ·Cl → Products
5 records matched 6-Methyl-2-nitrophenol + ·Cl → Products
1 record matched (E/Z)-CF3CHCHCF3 + ·Cl → Adduct
1 record matched FC(O)OOC(O)OCH2Cl + ·Cl → FC(O)OOC(O)OCHCl· + HCl
1 record matched FC(O)OOC(O)OCHCl2 + ·Cl → FC(O)OOC(O)OCCl2· + HCl
7 records matched FC(O)OOC(O)OCH3 + ·Cl → Products
1 record matched Pentachlorocyclopentadienyl + Cl2 → Hexachlorocyclopentadiene + ·Cl
1 record matched Pentachlorocyclopentadienyl + Pentachlorocyclopentadienyl → Nonachloro-[dicyclopentadienyl]-1-yl + ·Cl
1 record matched Nonachloro-[dicyclopentadienyl]-1-yl + ·Cl → Decachlorodicyclopentadienyl
1 record matched CCl2=CClCCl=CCl· + ClC≡CCl → Hexachlorobenzene + ·Cl
1 record matched 1,2,3,4,5,6-hexafluoro,6-chlorocyclohexadienyl radical → Hexafluorobenzene + ·Cl
1 record matched C6F5HCl Adduct → Pentafluorobenzene + ·Cl
1 record matched HC(O)OCF2CHCl2 + ·Cl → HC(O)OCF2CCl2· + HCl
1 record matched CD3ND2 + ·Cl → CD2ND2 + DCl
1 record matched I(2P1/2) + Cl2 → ICl + ·Cl
1 record matched 4-chlorocrotonaldehyde + ·Cl → Products
5 records matched CH3OCF2CF2OCH3 + ·Cl → CH3OCF2CF2OCH2 + HCl
2 records matched CH3O(CF2CF2O)2CH3 + ·Cl → CH3OCF2CF2OCH2 + HCl
3 records matched CH3O(CF2CF2O)2CH3 + ·Cl → CH3O(CF2CF2O)2CH2 + HCl
2 records matched CH3O(CF2CF2O)3CH3 + ·Cl → CH3OCF2CF2OCH2 + HCl
3 records matched CH3O(CF2CF2O)3CH3 + ·Cl → CH3O(CF2CF2O)3CH2 + HCl
1 record matched n-nonane-d1 + ·Cl → Products + DCl
1 record matched n-decane-d1 + ·Cl → Products + DCl
1 record matched (CH3)3CC(O)OC(O)OH + ·Cl → Products
1 record matched NCl(a1DELTA) + ·Cl → NCl(Χ3Σ-) + ·Cl
6 records matched C8F17CH2CHO + ·Cl → Products
1 record matched SnCl(2Π) → Sn(3P) + ·Cl
1 record matched SnCl2(1A1) → SnCl(2Π) + ·Cl
3 records matched C4F9O(CH2)3OC4F9 + ·Cl → Products
3 records matched CF3CFHCF2O(CH2)3OCF3CFHCF2 + ·Cl → Products
4 records matched F(2P) + Cl2 → ClF + ·Cl
1 record matched C4F9OC(O)CH3 + ·Cl → Products
3 records matched E-CF3CFCHF + ·Cl → Products
1 record matched CF3CD(OD)CF3 + ·Cl → Products
5 records matched [12]CH4 + ·Cl → Products
4 records matched [12]CH4 + ·Cl → [12]CH3 + HCl
1 record matched [13]CH4 + ·Cl → [13]CH3 + HCl
1 record matched [12]CH3D + ·Cl → Products
1 record matched [12]CH2D2 + ·Cl → Products
1 record matched [12]CHD3 + ·Cl → Products
1 record matched [12]CD4 + ·Cl → [12]CD3 + DCl
2 records matched CF3OC(CF3)2H + ·Cl → Products
1 record matched CH3OCF2CF2OC(O)H + ·Cl → Products
1 record matched CH3O(CF2CF2O)2C(O)H + ·Cl → Products
1 record matched CH3O(CF2CF2O)3C(O)H + ·Cl → Products
1 record matched ClNO + ·F → FNO + ·Cl
1 record matched Cu(2D5/2) + ClF → CuF + ·Cl
1 record matched Cu(2D3/2) + ClF → CuF + ·Cl
1 record matched CBr3OCl → CBr3O(·) + ·Cl
1 record matched CF3CCl2O(·) → CF3COCl + ·Cl
1 record matched CF3CFClO(.) → CF3COF + ·Cl
1 record matched CCl3O → COCl2 + ·Cl
1 record matched CHCl2CH2· → CH2=CHCl + ·Cl
3 records matched ClClO → ClO + ·Cl
1 record matched ClN=NCl → N2 + ·Cl + ·Cl
2 records matched CF2ClO → COF2 + ·Cl
1 record matched CH2ClO2 + CH2ClO2 → CH2O + O2 + ·Cl + CH2ClO
1 record matched ClCHCH=CH2 → Cyclopropene + ·Cl
1 record matched CCl3CHCl → C2HCl3 + ·Cl
1 record matched CHCl2C(·)Cl2 → C2HCl3 + ·Cl
1 record matched CH2ClCCl2· → CH2=CCl2 + ·Cl
1 record matched ·Cl + C3F7CF(OC2H5)CF(CF3)2 → Other Products + HCl
1 record matched ·Cl + CH3OC4F9 → CH2OC4F9 + HCl
1 record matched ·Cl + CHF2OO → Products
1 record matched ·Cl + CHClFCHO → Products
4 records matched ·Cl + CFCl2CH2OO(·) → CCl2FCHO + HClO
2 records matched ·Cl + CFCl2CH2OO(·) → CFCl2CH2OOCl
2 records matched ·Cl + CFCl2CH2OO(·) → CFCl2CHO2 + HCl
1 record matched ·Cl + CH2FO2 → Products
1 record matched ·Cl + CH2BrOO → Products
1 record matched ·Cl + FC(O)O· → FC(O)OCl
1 record matched ·Cl + CH2=SiCl2 → Cl3SiCH2·
1 record matched ·Cl + CH2ClO2 → Products
1 record matched ·Cl + Methyldioxy, dichloro- → Products
1 record matched ·Cl + CCl3O2 → Products
1 record matched ·Cl + SiH2Cl → HCl + SiHCl
1 record matched ·Cl + SiH2Cl → SiH2Cl2
1 record matched ·Cl + SiHCl2 → SiHCl3
1 record matched ·Cl + SiHCl2 → HCl + SiCl2
1 record matched ·Cl + FSH → Adduct
1 record matched ·Cl + ·CH2 → ·CH + HCl
2 records matched ·Cl + CF3CHFOCHF2 → Other Products + HCl
2 records matched ·Cl + CF3CHFOCHF2 → CF3C(·)FOCHF2 + HCl
2 records matched ·Cl + CF3CHFOCHF2 → CF3CHFOC(·)F2 + HCl
1 record matched ·Cl + CD3CDClCD3 → Other Products + DCl
1 record matched ·Cl + (CF3)2CFCN → Products
1 record matched ·Cl + Silyl, dichloromethyl- → CH3SiCl3
1 record matched ·Cl + CF3CH2OCHO → Products
1 record matched ·Cl + CF3CH2OCHO → CF3CH2OC(·)O + HCl
1 record matched ·Cl + CF3CH2OCHO → CF3C(·)HOCHO + HCl
2 records matched ·Cl + CH2FOCH(CF3)2 → (CF3)2CHOCHF· + HCl
2 records matched ·Cl + CH2FOCH(CF3)2 → (CF3)2C(·)OCH2F + HCl
1 record matched ·Cl + CHF2OCHClCF3 → Other Products + HCl
1 record matched ·Cl + CHF2OCHClCF3 → CF3C(·)ClOCHF2 + HCl
1 record matched ·Cl + CHF2OCHClCF3 → CF3CHClOC(·)F2 + HCl
1 record matched ·Cl + CH3CCl2F → CF2ClCH2· + HCl
1 record matched ·Cl + CH3CCl2F → ·CH2CCl2F + HCl
1 record matched ·Cl + ·Cl → Cl2
1 record matched BCl + ·Cl → BCl + ·Cl
1 record matched BCl + ·Cl → B + Cl2
1 record matched CF3CH2OCF3 + ·Cl → CF3CHOCF3 + HCl
1 record matched Cl3SiCH2· → ·Cl + CH2=SiCl2
1 record matched C2D5Cl + ·Cl → CD3CD(·)Cl + HCl
1 record matched C2D5Cl + ·Cl → ·CD2CD2Cl + HCl
1 record matched C2D5Cl + ·Cl → C2D4Cl + HCl
1 record matched SiCl3 + ·Cl → SiCl4
1 record matched SiCl3 → SiCl2 + ·Cl
1 record matched 3-Octen-1-ol + ·Cl → Products
2 records matched OClO → O2 + ·Cl
1 record matched CH2CH2Cl + ·Cl → CH2=CHCl + HCl
2 records matched CH2CH2Cl → C2H4 + ·Cl
1 record matched (E)-CH3CH=CHCl + ·Cl → Products
1 record matched (Z)-CH3CH=CHCl + ·Cl → Products
1 record matched ClCH2OH + ·Cl → HCl + CH2ClO
1 record matched ClCH2OH + ·Cl → Products
1 record matched ClCH2OH + ·Cl → ClCH(·)OH + HCl
1 record matched ClO + CH3S(O) → CH3S(O)2 + ·Cl
3 records matched ClO + ·Cl → ClClO
3 records matched ClO + ·Cl → Cl2O
1 record matched ClO + ·Cl → Cl2 + O·
1 record matched ClO + O· → O2 + ·Cl
2 records matched ClO + ClO → OClO + ·Cl
2 records matched ClO + ClO → ClOO + ·Cl
1 record matched AlH2 + ·Cl → HCl + AlH
1 record matched ·N3 + ·Cl → N2 + NCl
1 record matched HSNH2 + ·Cl → Adduct
1 record matched HD + ·Cl → DCl + H·
1 record matched HD + ·Cl → HCl + D
1 record matched ClN3 + ·Cl → Cl2 + ·N3
2 records matched AlH + ·Cl → H· + AlCl
1 record matched AlH + ·Cl → Al + HCl
2 records matched SH + ·Cl → HSCl
2 records matched SH + ·Cl → HCl + S
1 record matched Dimethyl Thiosulfinate + ·Cl → Products
1 record matched SF2 + ·Cl → Adduct
1 record matched ·NH2 + ClO → NH2O + ·Cl
1 record matched BF + ·Cl → ·F + BCl
1 record matched BF + ·Cl → B + ClF
1 record matched BH + ·Cl → H· + BCl
1 record matched BeH + ·Cl → H· + Beryllium chloride
1 record matched BeH + ·Cl → Be + HCl
1 record matched AlCl + ·Cl → Al + Cl2
1 record matched SiCl2 + ·Cl → SiCl3
1 record matched HOBr + ·Cl → ·OH + BrCl
1 record matched AlHCl2 + ·Cl → HCl + AlCl2
1 record matched SiH3Cl + ·Cl → HCl + SiH2Cl
2 records matched ClNO2 → NO2 + ·Cl
1 record matched (CF3)2CHOCH3 + ·Cl → Other Products + HCl
1 record matched H· + ·Cl → HCl
1 record matched H· + BCl → BH + ·Cl
1 record matched H· + ClO → ·OH + ·Cl
1 record matched H· + ClONO2 → HNO3 + ·Cl
1 record matched H· + AlCl → AlH + ·Cl
1 record matched Cl2O2 + ·Cl → Cl2O + ClO
2 records matched Cl2O2 + ·Cl → Cl2 + ClOO
1 record matched Cyclohexadienyl + ·Cl → Chlorocyclohexadiene (non specified)
1 record matched NO3 + ·Cl → NO2 + ClO
1 record matched 3-Hepten-1-ol + ·Cl → Products
1 record matched SCl2 + ·Cl → Cl2 + SCl
2 records matched NO2 + ·Cl → ClNO2
2 records matched NO2 + ·Cl → ClNO2
2 records matched NO + ·Cl → NOCl
1 record matched Br· + BrCl → Br2 + ·Cl
3 records matched ClOO → O2 + ·Cl
1 record matched HI + ·Cl → ICl + H·
1 record matched HI + ·Cl → HCl + I
2 records matched O3 + ·Cl → O2 + ClO
1 record matched SiCl4 → SiCl3 + ·Cl
2 records matched SiHCl3 + ·Cl → HCl + SiCl3
1 record matched SiHCl3 → ·Cl + SiHCl2
1 record matched SiH4 + ·Cl → HCl + SiH3
2 records matched Cl2O → ClO + ·Cl
1 record matched ICl + H· → HI + ·Cl
1 record matched HOCl + ·Cl → HCl + ClO
3 records matched HOCl + ·Cl → ·OH + Cl2
1 record matched HOCl + ·Cl → Products
1 record matched HOCl + HNO → H2O + NO + ·Cl
1 record matched ClF + H· → HF + ·Cl
1 record matched Beryllium hydride + ·Cl → HCl + BeH
1 record matched AlH3 + ·Cl → HCl + AlH2
1 record matched H2S + ·Cl → HCl + SH
1 record matched H2S + ·Cl → Adduct
1 record matched HN3 + ·Cl → HCl + ·N3
1 record matched HN3 + ·Cl → HNCl + N2
2 records matched Cl2 + O· → ClO + ·Cl
1 record matched Cl2 + AlCl2 → AlCl3 + ·Cl
1 record matched Cl2 + SCl → SCl2 + ·Cl
1 record matched Cl2 + ·F → ClF + ·Cl
1 record matched Cl2 + I → ICl + ·Cl
1 record matched Cl2 + SH → HSCl + ·Cl
1 record matched Cl2 + SD → ClSD + ·Cl
1 record matched Cl2 + AlCl → AlCl2 + ·Cl
1 record matched Cl2 + H· → HCl + ·Cl
1 record matched Cl2 + Cyclohexadienyl → Chlorocyclohexadiene (non specified) + ·Cl
2 records matched Cl2 → ·Cl + ·Cl
5 records matched O2 + ·Cl → ClOO
4 records matched D2 + ·Cl → DCl + D
1 record matched H2O + ·Cl → ·OH + HCl
1 record matched HC(O)Br + ·Cl → HC(O)Cl + Br·
1 record matched H2O2 + ·Cl → ·OH + HOCl
2 records matched H2O2 + ·Cl → HO2 + HCl
2 records matched DCl + ·Cl → DCl + ·Cl
1 record matched DCl + O· → OD + ·Cl
2 records matched DCl + D → D2 + ·Cl
2 records matched DCl + H· → HD + ·Cl
1 record matched NH3 + ·Cl → HCl + ·NH2
1 record matched HF + ·Cl → ClF + H·
1 record matched HCl + CH2=CHCH=CH· → 1,3-Butadiene + ·Cl
1 record matched HCl + SiH2Cl → SiH3Cl + ·Cl
2 records matched HCl + SiHCl2 → SiH2Cl2 + ·Cl
1 record matched HCl + ·CH2 → ·CH3 + ·Cl
1 record matched HCl + CH2=CCl → CH2=CHCl + ·Cl
1 record matched HCl + CF3CHF → CF3CH2F + ·Cl
1 record matched HCl + SiH2F → SiH3F + ·Cl
1 record matched HCl + ·CClFH → CH2FCl + ·Cl
1 record matched HCl + HF2Si → SiH2F2 + ·Cl
4 records matched HCl + ·Cl → Cl2 + H·
2 records matched HCl + ·Cl → HCl + ·Cl
1 record matched HCl + NCO → HN=C=O + ·Cl
1 record matched HCl + Cl3SiCH2· → CH3SiCl3 + ·Cl
2 records matched HCl + SiCl3 → SiHCl3 + ·Cl
11 records matched HCl + O· → ·OH + ·Cl
3 records matched HCl + D → HD + ·Cl
1 record matched HCl + CH3CHCl → C2H5Cl + ·Cl
1 record matched HCl + ·CH2Br → CH3Br + ·Cl
5 records matched HCl + ·F → HF + ·Cl
1 record matched HCl + SiHCl → ·Cl + SiH2Cl
1 record matched HCl + SiH3 → SiH4 + ·Cl
1 record matched HCl + OD → HDO + ·Cl
1 record matched HCl + SiCl2 → ·Cl + SiHCl2
3 records matched HCl + H· → H2 + ·Cl
1 record matched HCl → H· + ·Cl
2 records matched SnCl4 → SnCl3(2A1) + ·Cl
1 record matched HOClO3 + ·Cl → HOCl + ClO3
1 record matched HOClO3 + ·Cl → ClO4 + HCl
1 record matched Mercury chloride + ·Cl → HgCl2
1 record matched Mercury chloride + ·Cl → Hg + Cl2
1 record matched Mercury chloride + Cl2 → HgCl2 + ·Cl
1 record matched Mercury chloride → Hg + ·Cl
1 record matched SO2 + ·Cl → Products
1 record matched C + Cl2 → ·CCl + ·Cl
1 record matched B + ClF → BF + ·Cl
1 record matched B + Cl2 → BCl + ·Cl
1 record matched Hg + ·Cl → Mercury chloride
2 records matched Hg + Cl2 → Mercury chloride + ·Cl
2 records matched Al + Cl2 → AlCl + ·Cl
2 records matched C2Cl5 + ·Cl → C2Cl4 + Cl2
2 records matched C2Cl5 + ·Cl → CCl3CCl3
3 records matched C2Cl5 → C2Cl4 + ·Cl
1 record matched ·CH2Cl + N → H2C=N + ·Cl
1 record matched ·CH2Cl + N → trans-HCNH + ·Cl
3 records matched ·CH2Cl + Cl2 → CH2Cl2 + ·Cl
1 record matched ·CH2Cl + O2 → cyc-H2CO2 + ·Cl
2 records matched ·CH2Cl + HCl → CH3Cl + ·Cl
1 record matched CH3CH=CHCH2OH + ·Cl → Products
1 record matched (E)-Ethyl tiglate + ·Cl → Products
1 record matched Z-CF3CFCHF + ·Cl → Products
1 record matched Cyclopropanone + ·Cl → cyclopropanon-2-yl radical + HCl
1 record matched CHD2Cl + ·Cl → Products
1 record matched CH2DCl + ·Cl → Products
1 record matched CH3OCHCl2 + ·Cl → CH3OCCl2· + HCl
1 record matched CH3OCHCl2 + ·Cl → ·CH2OCHCl2 + HCl
1 record matched CH3S(O)2 + ClO → CH3-S(O)3 + ·Cl
2 records matched CH3CH(OH)CH2C(O)CH3 + ·Cl → Other Products + HCl
2 records matched SiH2Cl2 + ·Cl → HCl + SiHCl2
1 record matched SiH2Cl2 → ·Cl + SiH2Cl
1 record matched ·CCl + ·Cl → C + Cl2
1 record matched ·CCl + ·Cl → ·CCl + ·Cl
1 record matched ·CCl + H· → ·CH + ·Cl
1 record matched Pentafluorodimethyl ether + ·Cl → Products
2 records matched ·CH2F + HCl → CH3F + ·Cl
1 record matched CH2=CHCH2C(O)OCH3 + ·Cl → Products
1 record matched Phenyl,2-chloro- + Cl2 → 1,2-dichlorobenzene + ·Cl
1 record matched Phenyl, 3-chloro- + Cl2 → 1,3-dichlorobenzene + ·Cl
1 record matched CHCl2 + NO2 → HC(O)Cl + NO + ·Cl
1 record matched CHCl2 + Cl2 → CHCl3 + ·Cl
1 record matched CHCl2 + HCl → CH2Cl2 + ·Cl
1 record matched ·OH + ·Cl → H· + ClO
1 record matched ·OH + ClO → HO2 + ·Cl
2 records matched ·OH + Cl2 → HOCl + ·Cl
1 record matched ·OH + HCl + H2O → H2O + H2O + ·Cl
1 record matched ·OH + HCl + NH3 → NH3 + H2O + ·Cl
11 records matched ·OH + HCl → H2O + ·Cl
1 record matched ·OH + Chlordimeform → 1-(2-methylphenyl)-3,3-dimethylformanidine + ·Cl
1 record matched ·CH + ·Cl → C + HCl
1 record matched ·CH + ·Cl → ·CCl + H·
1 record matched HO2 + CH2ClO2 → HO3 + CH2O + ·Cl
1 record matched HO2 + OSCl → ·OH + SO2 + ·Cl
2 records matched HO2 + ·Cl → HCl + O2
1 record matched HO2 + ·Cl → ·OH + ClO
1 record matched HO2 + ·Cl → HOOCl
1 record matched HO2 + ·Cl → O2(c1Sigma_u-) + HCl
2 records matched ·CCl3 + ·Cl → CCl4
1 record matched ·CCl3 + NO2 → COCl2 + NO + ·Cl
3 records matched ·CCl3 + Cl2 → CCl4 + ·Cl
2 records matched ·CCl3 + HCl → CHCl3 + ·Cl
1 record matched (E)-CH3C(O)CH=CHCH3 + ·Cl → Products
1 record matched CH3CH2OOH + ·Cl → Other Products + HCl
1 record matched CH3OOH + ·Cl → Other Products + HCl
1 record matched CH2CN + HCl → CH3CN + ·Cl
1 record matched CF3CHFCl + ·Cl → CF3CFCl· + HCl
1 record matched ·CHF2 + HCl → CH2F2 + ·Cl
2 records matched C2H3 + HCl → C2H4 + ·Cl
1 record matched ClCO → CO + ·Cl
1 record matched HCO + ·Cl → HC(O)Cl
1 record matched HCO + ·Cl → CO + HCl
1 record matched (·)CH2OH + ·Cl → CH3OCl
1 record matched (·)CH2OH + HCl → CH3OH + ·Cl
1 record matched HC(O)Cl + ·Cl → HC(O)Cl
1 record matched (E)-CH3CH=CHC(=O)C2H5 + ·Cl → Products
1 record matched Phenyl, 4-chloro- + Cl2 → 1,4-dichlorobenzene + ·Cl
1 record matched CH3SCH2Cl + ·Cl → Products
1 record matched 1,2,2,2-tetrafluoroethyl trifluoromethyl ether + ·Cl → CF3CF(.)OCF3 + HCl
1 record matched Phenylallene + ·Cl → 2-C6H4CHCCH2 + HCl
2 records matched ·CF3 + ·Cl → CF3Cl
1 record matched ·CF3 + ICl → CF3I + ·Cl
1 record matched ·CF3 + HCl → CHF3 + ·Cl
1 record matched C2F5CF2H + ·Cl → CF3CF2CF2· + HCl
2 records matched ·CH3 + ·Cl → HCl + ·CH2
1 record matched ·CH3 + ICl → CH3I + ·Cl
1 record matched ·CH3 + Cl2 → CH3Cl + ·Cl
18 records matched ·CH3 + HCl → CH4 + ·Cl
1 record matched ·CH3 + ·CH2Cl → ·C2H5 + ·Cl
1 record matched ·CH3 + CHCl2 → CH3CHCl + ·Cl
1 record matched ·CH3 + ·CCl3 → CH3CCl2· + ·Cl
1 record matched Benzyl + ·Cl → C6H5CH2Cl
1 record matched CH3O· + HCl → CH3OH + ·Cl
1 record matched ·C2H + HCl → C2H2 + ·Cl
8 records matched CD3 + DCl → CD4 + ·Cl
2 records matched ·C2H5 + HCl → C2H6 + ·Cl
1 record matched CF3CH2OCHF2 + ·Cl → Other Products + HCl
1 record matched CF3CH2OCHF2 + ·Cl → Products
1 record matched CF3CH2OCHF2 + ·Cl → CF3CH2O· + CHF2Cl
1 record matched CF3CH2OCHF2 + ·Cl → CF3CH(·)OCHF2 + HCl
1 record matched CF3CH2OCHF2 + ·Cl → CF3CH2OCF2· + HCl
1 record matched CF3CH2OCHF2 + ·Cl → ·CH2OCHF2 + CF3Cl
1 record matched (CH2Cl)2C=CH2 + ·Cl → Products
1 record matched ·CCl2F + HCl → CHFCl2 + ·Cl
1 record matched ·CClF2 + HCl → CHF2Cl + ·Cl
1 record matched C2D6 + ·Cl → DCl + ·C2D5
1 record matched C2H5CH=CHCH2OH-(Z) + ·Cl → Products
1 record matched CH3CH2CHCHCHO + ·Cl → Products
1 record matched CF2ClC(O)OCH3 + ·Cl → CF2ClC(O)OCH2· + HCl
3 records matched CHBrF2 + ·Cl → HCl + CBrF2
1 record matched HFCO + ·Cl → FCO + HCl
13 records matched H2 + ·Cl → HCl + H·
1 record matched CD3Cl + ·Cl → DCl + CD2Cl
1 record matched CF3CHFCF2OCH2CF3 + ·Cl → Other Products + HCl
1 record matched (Z)-3-Hexen-1-ol + ·Cl → Products
1 record matched (E)-2-Hexen-1-ol + ·Cl → Products
1 record matched CF3CH(OH)CF3 + ·Cl → Products
1 record matched CCl3COCH3 + ·Cl → Products
1 record matched CCl3COCH3 + ·Cl → ·CH2C(O)CCl3 + HCl
1 record matched CCl3D + ·Cl → ·CCl3 + DCl
1 record matched CH2=CHCH2CH2CH2OH + ·Cl → Products
1 record matched CD3OD + ·Cl → CD2OD + DCl
1 record matched CF3CH2F + ·Cl → HCl + CF3CHF
1 record matched Acetaldehyde, chlorodifluoro- + ·Cl → Products
1 record matched CH2=C(CH3)CH2CH2OH + ·Cl → Products
1 record matched CF3CF=CH2 + ·Cl → Products
1 record matched Propane, 1,1,1,3,3,3-hexafluoro- + ·Cl → HCl + (CF3)2CH·
1 record matched CH3CH2OCF3 + ·Cl → Other Products + HCl
1 record matched (CH3O)2 + ·Cl → ·CH2OOCH3 + HCl
1 record matched Vinylacetylene + ·Cl → HCCCHCH· + HCl
1 record matched Propane, 1,1,1,2,2,3-hexafluoro- + ·Cl → CF3CF2CHF· + HCl
1 record matched CHD3 + ·Cl → CD3 + HCl
3 records matched CHD3 + ·Cl → Products
3 records matched CH2D2 + ·Cl → Products
3 records matched CH3D + ·Cl → Products
1 record matched CH2ClCCl3 + ·Cl → HCl + CCl3CHCl
1 record matched CO + ClO → CO2 + ·Cl
1 record matched (Z)-Cycloheptene + ·Cl → Products
1 record matched HCOOCH(CH3)2 + ·Cl → Other Products + HCl
1 record matched CH2FCH2F + ·Cl → HCl + CH2FCHF
1 record matched CH2ClC≡CH + ·Cl → CH2=C=CHCl + ·Cl
1 record matched CH2ClC≡CH + ·Cl → Products
1 record matched CH2ClC≡CH + ·Cl → C3H3Cl2
1 record matched CH2ClC≡CH + ·Cl → ·CHClC≡CH + HCl
1 record matched (E)-2-C4H8 + ·Cl → Products
1 record matched CH2=CHCH(OH)CH2CH3 + ·Cl → Products
1 record matched (CH3)2CHCH(OH)CH3 + ·Cl → (CH3)2CHC(·)(OH)CH3 + HCl
1 record matched (CH3)2CHC(OH)(CH3)2 + ·Cl → (CH3)2C(·)C(OH)(CH3)2 + HCl
1 record matched CH3OCl → CH3O· + ·Cl
4 records matched CH2FCl + ·Cl → HCl + ·CClFH
1 record matched CH2FCl + ·Cl → ·CH2Cl + ClF
1 record matched CH2FCl + ·Cl → ·CH2F + Cl2
1 record matched CH2FCl + ·Cl → Products
2 records matched CH2=CHNH2 + ·Cl → HCl + CH2=CHNH
1 record matched HCCCl + H· → C2H2 + ·Cl
6 records matched CH3F + ·Cl → ·CH2F + HCl
1 record matched 1-C6H12 + ·Cl → Products
3 records matched CH3C(O)CH2CH2OH + ·Cl → Products
12 records matched CD4 + ·Cl → CD3 + DCl
1 record matched CD4 + ·Cl → CD3 + HCl
1 record matched (CH3)CCl=CH2 + ·Cl → Products
1 record matched CH3CH2CH2OCH3 + ·Cl → Other Products + HCl
1 record matched CH3CH2CH2OCH3 + ·Cl → CH3CH2CH2OCH2· + HCl
1 record matched CH3CH2CH2OCH3 + ·Cl → CH3CH2CH(·)OCH3 + HCl
1 record matched CH3CH2CH2OCH3 + ·Cl → CH3CH(·)CH2OCH3 + HCl
1 record matched CH3CH2CH2OCH3 + ·Cl → ·CH2CH2CH2OCH3 + HCl
1 record matched (CH3)2C=CHCH2OH + ·Cl → Products
1 record matched Methyl propanoate + ·Cl → Other Products + HCl
1 record matched 1,3-dichloropropene → CHCl=CHCH2· + ·Cl
1 record matched Isobutyl formate + ·Cl → Other Products + HCl
1 record matched 1,3-dichlorobenzene + ·OH → 3-Chlorophenol + ·Cl
1 record matched CHCl=CHCl (Unspec.) + ·Cl → Products
1 record matched n-C3H7Cl + ·Cl → Other Products + HCl
1 record matched 1,1-Dichloroacetone + ·Cl → Products
1 record matched CH2=C(CH3)CH2OH + ·Cl → Products
1 record matched CH3COBr + ·Cl → CH3COCl + Br·
1 record matched ClCN + ·Cl → Products
1 record matched ClCN + H· → HCN + ·Cl
1 record matched CCl3CO2Cl + ·Cl → ClC(O)OCCl2· + Cl2
1 record matched CCl3CO2Cl + ·Cl → ·C(O)OCCl3 + Cl2
2 records matched neo-C5H12 + ·Cl → Neopentyl + HCl
1 record matched H2C=C=O + ·Cl → ClCH2C(O)(.)
1 record matched H2C=C=O + ·Cl → ClCH(.)CHO
1 record matched H2C=C=O + ·Cl → H· + CHCl=C=O
2 records matched H2C=C=O + ·Cl → HCl + HCCO
1 record matched H2C=C=O + ·Cl → CO + ·CH2Cl
1 record matched H2C=C=O + ·Cl → Products
1 record matched CH2=C=CH2 + ·Cl → CH2=CCl=CH2
1 record matched CF3CH2CH2CH2OH + ·Cl → Other Products + HCl
1 record matched CF3CH2OCH3 + ·Cl → CF3Cl + CH3OCH2·
1 record matched CF3CH2OCH3 + ·Cl → Other Products + HCl
1 record matched CF3CH2OCH3 + ·Cl → CF3CH2O· + CH3Cl
1 record matched CF3CH2OCH3 + ·Cl → CF3CH2OCH2· + HCl
1 record matched CF3CH2OCH3 + ·Cl → CF3CH(·)OCH3 + HCl
2 records matched CF2HC(O)OCH3 + ·Cl → Other Products + HCl
2 records matched CF3CHFCF3 + ·Cl → (CF3)2CF· + HCl
1 record matched 1,1,1,2,3,3-Hexafluoropropane + ·Cl → Products
1 record matched 1,1,1,2,3,3-Hexafluoropropane + ·Cl → CF3C(·)FCHF2 + HCl
1 record matched 1,1,1,2,3,3-Hexafluoropropane + ·Cl → CF3CHFCF2· + HCl
2 records matched CF3C(O)OCH3 + ·Cl → CF3C(O)OCH2· + HCl
1 record matched CHF2CHO + ·Cl → Products
1 record matched CH2FCHF2 + ·Cl → HCl + CHF2C(·)HF
1 record matched CH2FCHF2 + ·Cl → HCl + CH2FC(·)F2
2 records matched CH3COCH2F + ·Cl → CH3C(O)CHF· + HCl
2 records matched CH3COCH2F + ·Cl → ·CH2C(O)CH2F + HCl
1 record matched CH3COCH2F + ·Cl → C3H4FO + HCl
1 record matched CH3OCF2CHF2 + ·Cl → CF2CF2OCH3 + HCl
1 record matched CH3OCF2CHF2 + ·Cl → CHF2CF2OCH2 + HCl
1 record matched C2F5CH2OH + ·Cl → Products + HCl
1 record matched C2F5CH2OH + ·Cl → CF3CF2CH(·)OH + HCl
1 record matched C2F5CH2OH + ·Cl → CF3CF2CH2O + HCl
1 record matched CH3COCF3 + ·Cl → HCl + CF3COCH2
3 records matched CH3CF3 + ·Cl → CF3CH2 + HCl
1 record matched CF3C(O)OCH2CF3 + ·Cl → CF3C(O)OCHCF3 + HCl
1 record matched CF3CH2OCF2CF2H + ·Cl → Other Products + HCl
1 record matched CF3CH2CF2CH3 + ·Cl → Other Products + HCl
2 records matched CF3COOC2H5 + ·Cl → Other Products + HCl
1 record matched CF3COOC2H5 + ·Cl → CF3C(O)OCH(·)CH3 + HCl
1 record matched CF2ClC(O)OCH2CH3 + ·Cl → CF2ClC(O)OCH2CH2· + HCl
1 record matched CF2ClC(O)OCH2CH3 + ·Cl → CF2ClC(O)OCH(·)CH3 + HCl
1 record matched CF3CF2CF2CH2OH + ·Cl → Other Products + HCl
1 record matched CF3CH(OH)CH3 + ·Cl → Products
2 records matched CHF2CHF2 + ·Cl → HCl + CHF2CF2
1 record matched CHF2CH2OH + ·Cl → Other Products + HCl
1 record matched C2F5H + ·Cl → C2F5 + HCl
1 record matched CF3COCl → CO + ·CF3 + ·Cl
1 record matched CF3CN + ·Cl → Products
1 record matched CF2BrCl + ·Cl → Cl2 + CBrF2
1 record matched CF2BrCl → ·Cl + CBrF2
1 record matched C2H5F + ·Cl → HCl + CH3C(·)HF
1 record matched C2H5F + ·Cl → HCl + CH2CH2F
1 record matched 2,2,2-Trifluoroethyl methacrylate + ·Cl → Products
1 record matched CF3CH2OCH2CF3 + ·Cl → CF3CH(.)OCH2CF3 + HCl
1 record matched CF3CHCl2 + ·Cl → HCl + CF3CCl2
1 record matched (E)-CHCl=CHCl + ·Cl → Products
1 record matched (E)-CHCl=CHCl → ·Cl + CHCl=CH
1 record matched (Z)-CHCl=CHCl + ·Cl → Products
1 record matched (Z)-CHCl=CHCl → ·Cl + CHCl=CH
1 record matched Tetrahydro-2H-pyran + ·Cl → Products
1 record matched n-Butyl acrylate + ·Cl → Products
2 records matched CH2=CHC(O)OC2H5 + ·Cl → Products
1 record matched CH2=CHC(O)OC2H5 + ·Cl → CH2=C(·)C(O)OC2H5 + HCl
1 record matched CH2=CHC(O)OC2H5 + ·Cl → CH2ClCH(·)C(O)OC2H5
1 record matched CH2=CHC(O)OC2H5 + ·Cl → ·CH2CHClC(O)OC2H5
1 record matched Limonene + ·Cl → Products
1 record matched C2Cl4 + ·Cl → Products
1 record matched CH2=CClCH=CH2 + ·Cl → Products
1 record matched CHClBr2 + ·Cl → HCl + CClBr2
2 records matched (CH3)2NH + ·Cl → HCl + (CH3)2N·
1 record matched 1,4-Dioxane + ·Cl → 1,4-Dioxan-2-yl + HCl
1 record matched (CH3)2C(OH)CH2C(O)CH3 + ·Cl → CH3C(O)CH(·)C(CH3)2OH + HCl
1 record matched (CH3)2C(OH)CH2C(O)CH3 + ·Cl → CH3C(O)CH2C(OH)(CH3)CH(·) + HCl
2 records matched HCONHCH3 + ·Cl → Other Products + HCl
1 record matched HCONHCH3 + ·Cl → ·C(O)NHCH3 + HCl
1 record matched CCl3CH2OH + ·Cl → Products
2 records matched Isobutene + ·Cl → Products
1 record matched Dimethyl ether + ·Cl → HCl + CH3OCH2·
3 records matched CH3CH=CH2 + ·Cl → Products
1 record matched Pyridine + ·Cl → pyridine-Cl adduct (unspecified isomer)
2 records matched Pyridine + ·Cl → pyridinyl radical (unspecified isomer) + HCl
2 records matched Piperazine + ·Cl → 1-piperazinyl + HCl
1 record matched Piperazine + ·Cl → 2-piperazinyl + HCl
1 record matched Cyclohexene + ·Cl → Products
1 record matched 1-C6H14 + ·Cl → Other Products + HCl
1 record matched HC(O)OC2H5 + ·Cl → Products
1 record matched CH2=CHOC2H5 + ·Cl → Products
1 record matched 1-C5H10 + ·Cl → Products
1 record matched n-C5H12 + ·Cl → Other Products + HCl
1 record matched 5-Hexen-2-one + ·Cl → Products
1 record matched 2-Methylpyridine + ·Cl → HCl + Methyl, 2-pyridinyl-
1 record matched 3-Methylpyridine + ·Cl → HCl + 3-Pyridylmethyl radical
2 records matched Chlorobenzene + H· → Benzene + ·Cl
2 records matched Chlorobenzene + ·OH → Phenol + ·Cl
1 record matched Chlorobenzene + Phenyl → Biphenyl + ·Cl
1 record matched Chlorobenzene → Phenyl + ·Cl
1 record matched 4-Methylpyridine + ·Cl → HCl + 4-Pyridylmethyl radical
1 record matched Toluene + ·Cl → HCl + 2-methylphenyl
1 record matched Toluene + ·Cl → 3-methylphenyl + HCl
1 record matched Toluene + ·Cl → 4-methylphenyl + HCl
1 record matched Toluene + ·Cl → Benzyl + HCl
1 record matched Toluene + ·Cl → Products
1 record matched Toluene + ·Cl → c-CCl(CH3)CH=CHCH(·)CH=CH
1 record matched Toluene + ·Cl → c-CHClC(CH3)=CHCH(·)CH=CH
1 record matched Toluene + ·Cl → c-CHClCH=C(CH3)CH(·)CH=CH
1 record matched Toluene + ·Cl → c-CHClCH=CHC(·)(CH3)CH=CH
1 record matched Methylcyclohexane + ·Cl → Other Products + HCl
1 record matched 1-Chloro-3-methylbenzene + ·OH → 3-Methylphenol + ·Cl
1 record matched CH3CO2CH=CH2 + ·Cl → Products
1 record matched HC(O)OCH3 + ·Cl → HCl + CH3C(O)O·
1 record matched HC(O)OCH3 + ·Cl → HC(O)OCH2(·) + HCl
1 record matched HC(O)OCH3 + ·Cl → Products
1 record matched (CHO)2 + ·Cl → CO + HCO + HCl
1 record matched CH2ClCHO + ·Cl → HCl + ClCH2C(O)(.)
1 record matched CH2ClCHO + ·Cl → HCl + ClCH(.)CHO
1 record matched CH2ClCHO + ·Cl → Other Products + HCl
1 record matched CH2ClCHO + ·Cl → Products
1 record matched HC≡CCH2OH + ·Cl → Adduct
1 record matched HC≡CCH2OH + ·Cl → Products
1 record matched HC≡CCH2OH + ·Cl → HCCC(·)HOH + HCl
1 record matched CH2=CHCH2OH + ·Cl → Products
1 record matched CH2CHCN + ·Cl → Products
1 record matched CH2ClCH2Cl + ·Cl → HCl + CH2ClCHCl·
4 records matched CH2ClCH2Cl → CH2CH2Cl + ·Cl
1 record matched CH2=CHCH2Cl + ·Cl → Products
1 record matched CH2=CHCHO + ·Cl → Products
1 record matched 1,3-Butadiene + ·Cl → Products
2 records matched 1-C4H8 + ·Cl → Products
1 record matched 1-C4H10 + ·Cl → 1-C4H9 + HCl
1 record matched 1-C4H10 + ·Cl → sec-C4H9 + HCl
1 record matched n-C3H7Br + ·Cl → Products
1 record matched CH2BrCH2Br + ·Cl → CH2BrCH(·)Br + HCl
1 record matched 1,4-dichlorobenzene + ·OH → 4-Chlorophenol + ·Cl
1 record matched 1-Chloro-4-methylbenzene + ·OH → 4-Methylphenol + ·Cl
1 record matched CH3CH2CH2C(O)OCH2CH2CH3 + ·Cl → Other Products + HCl
1 record matched CH3CH2CH2C(O)OC2H5 + ·Cl → Products
1 record matched C2H5C(O)OC2H5 + ·Cl → Products
1 record matched 1-Phenylpropane + ·Cl → HCl + C6H5CH(·)CH2CH3
1 record matched p-Cimene + ·Cl → Products
2 records matched Nitrobenzene + ·Cl → Chlorobenzene + NO2
1 record matched Benzene, 1-chloro-4-(trifluoromethyl)- + ·OH → 4-(Trifluoromethyl)-phenol + ·Cl
1 record matched Benzene, 1-chloro-3-(trifluoromethyl)- + ·OH → 3-(Trifluoromethyl)-phenol + ·Cl
2 records matched Butyl methacrylate + ·Cl → Products
1 record matched Methylcyclopentane + ·Cl → Other Products + HCl
1 record matched CH2=CHC(O)OCH3 + ·Cl → Products
1 record matched 2-Chlorophenol + ·Cl → 2-chlorophenoxy + HCl
1 record matched 2-Chlorophenol → ·Cl + Phenyl, 2-hydroxy-
1 record matched 1,2-dichlorobenzene + ·OH → 2-Chlorophenol + ·Cl
1 record matched 1-Chloro-2-methylbenzene + ·OH → 2-Methylphenol + ·Cl
1 record matched Benzene, 1-chloro-2-(trifluoromethyl)- + ·OH → 2-(Trifluoromethyl)-phenol + ·Cl
3 records matched Methyl methacrylate + ·Cl → Products
1 record matched (COCl)2 → Oxalyl chloride radical + ·Cl
1 record matched (CHCl2)2 + ·Cl → HCl + CHCl2C(·)Cl2
1 record matched CH3C(O)OCH3 + ·Cl → HCl + ·CH2C(O)OCH3
1 record matched CH3C(O)OCH3 + ·Cl → CH3C(O)OCH2· + HCl
1 record matched CH2=CHCOOH + ·Cl → Products
1 record matched CHCl2CHO + ·Cl → Products
2 records matched C2HCl3 + ·Cl → Products
1 record matched CHCl2CH2Cl + ·Cl → HCl + CH2ClCCl2·
1 record matched CHCl2CH2Cl + ·Cl → HCl + CHCl2CHCl
1 record matched CHCl2CH2Cl + ·Cl → Products
1 record matched CH3COCH2Cl + ·Cl → Products
1 record matched CH2=CHCOCH3 + ·Cl → Products
1 record matched sec-C4H9OH + ·Cl → CH3CH2C(·)(OH)CH3 + HCl
1 record matched sec-C4H9OH + ·Cl → CH3CH(·)CH(OH)CH3 + HCl
1 record matched 2,3-dichloropropene + ·Cl → Products
1 record matched CH2=C(CH3)CH=CH2 + ·Cl → CH2ClC(CH3)=CHCH2·
1 record matched CH2=C(CH3)CH=CH2 + ·Cl → CH2=CHCCl(CH3)CH2·
1 record matched CH2=C(CH3)CH=CH2 + ·Cl → CH2=C(CH3)CHClCH2·
1 record matched CH2=C(CH3)CH=CH2 + ·Cl → CH2ClCH=C(CH3)CH2·
1 record matched Hexachlorocyclopentadiene → Pentachlorocyclopentadienyl + ·Cl
2 records matched CHCl2CCl3 + ·Cl → C2Cl5 + HCl
2 records matched CHCl2CCl3 + ·Cl → Other Products + Cl2
1 record matched CHCl2CCl3 → Other Products + ·Cl
1 record matched CF3CH2OH + ·Cl → Products
2 records matched CF3CH2Cl + ·Cl → HCl + CF3CHCl
1 record matched CCl3CHO + ·Cl → CCl3C(O)(.) + HCl
1 record matched C2H5C(CH3)2OH + ·Cl → (CH3)2C(OH)C(·)HCH3 + HCl
1 record matched CH3SiCl3 + ·Cl → HCl + Cl3SiCH2·
1 record matched CH3SiCl3 → ·Cl + Silyl, dichloromethyl-
1 record matched (CH3)4Si + ·Cl → HCl + (CH3)3SiCH2
1 record matched (CH3)4Si + ·Cl → CH3Cl + (CH3)3Si·
1 record matched (CH3)4Si + ·Cl → Products
1 record matched CF3Cl + ·Cl → ·CF3 + Cl2
5 records matched CF3Cl → ·CF3 + ·Cl
1 record matched CF2Cl2 → ·CClF2 + ·Cl
1 record matched CFCl3 → ·CCl2F + ·Cl
2 records matched (CH3)3N + ·Cl → HCl + CH2N(CH3)2
3 records matched CHF3 + ·Cl → ·CF3 + HCl
4 records matched CHF2Cl + ·Cl → ·CClF2 + HCl
1 record matched COCl2 + ·Cl → ClCO + Cl2
1 record matched COCl2 + O· → CO + ClO + ·Cl
3 records matched COCl2 → ClCO + ·Cl
3 records matched CHFCl2 + ·Cl → ·CCl2F + HCl
2 records matched CH3CHF2 + ·Cl → HCl + CH2CHF2
2 records matched CH3CHF2 + ·Cl → HCl + CH3CF2
1 record matched CH3CHF2 + ·Cl → Products
1 record matched CH2=CCl2 + ·Cl → CH2ClCCl2·
2 records matched CH2=CCl2 + ·Cl → Products
1 record matched CH3CHCl2 + ·Cl → HCl + CHCl2CH2·
1 record matched CH3CHCl2 + ·Cl → HCl + CH3CCl2·
2 records matched iso-C3H7Cl + ·Cl → Other Products + HCl
2 records matched CHBrCl2 + ·Cl → HCl + BrCCl2
2 records matched CHBr3 + ·Cl → CBr3 + HCl
1 record matched (CH3)2S + ·Cl → CH3Cl + CH3
1 record matched (CH3)2S + ClO → (CH3)2SO + ·Cl
1 record matched HN=C=O + ·Cl → Products
2 records matched HCONH2 + ·Cl → C(O)NH2 + HCl
4 records matched CH2F2 + ·Cl → ·CHF2 + HCl
2 records matched CH2Cl2 + ·Cl → ·CH2Cl + Cl2
5 records matched CH2Cl2 + ·Cl → CHCl2 + HCl
3 records matched CH3CN + ·Cl → CH2CN + HCl
1 record matched C2H5I + ·Cl → C2H5Cl + I
1 record matched C2H5I + ·Cl → Products
1 record matched C2H5I + ·Cl → CH3CHI + HCl
1 record matched C2H5I + ·Cl → ·CH2CH2I + HCl
1 record matched CH2=CHF + ·Cl → Products
1 record matched CH2=CHCl + ·Cl → HCl + CHCl=CH
2 records matched CH2=CHCl + ·Cl → Products
1 record matched CH2=CHCl → C2H3 + ·Cl
2 records matched C2H5Cl + ·Cl → HCl + CH3CHCl
2 records matched C2H5Cl + ·Cl → HCl + CH2CH2Cl
1 record matched C2H5Cl + ·Cl → C2H4Cl + HCl
1 record matched C2H5Cl → ·C2H5 + ·Cl
1 record matched CH3CCH + ·Cl → ·CH2C≡CH + HCl
1 record matched C3H8 + ·Cl → 2-C3H7 + HCl
3 records matched CH2ClBr + ·Cl → HCl + ·CHBrCl
2 records matched CH2Br2 + ·Cl → HCl + CHBr2
1 record matched CH3SH + ·Cl → Adduct
1 record matched HCN + ·Cl → CN + HCl
1 record matched HCN + ·Cl → Products
2 records matched CH3NH2 + ·Cl → Other Products + HCl
1 record matched CH3I + ·Cl → HCl + ·CH2I
7 records matched CH3Cl + ·Cl → ·CH2Cl + HCl
2 records matched CH3Cl + ·Cl → ·CH3 + Cl2
1 record matched CH3Cl + Br· → CH3Br + ·Cl
2 records matched CH3Cl → ·CH3 + ·Cl
1 record matched C2H2 + ·Cl → ·C2H + HCl
1 record matched C2H2 + ·Cl → Products
1 record matched C2H2 + ·Cl → trans-CHCl=CH
1 record matched C2H2 + Cl2 → ·Cl + CHCl=CH
1 record matched C2H2 + ·CH2Cl → Cyclopropene + ·Cl
2 records matched C2H4 + ·Cl → CH2CH2Cl
2 records matched C2H4 + ·Cl → C2H3 + HCl
9 records matched C2H6 + ·Cl → ·C2H5 + HCl
5 records matched CH3Br + ·Cl → HCl + ·CH2Br
1 record matched CH3Br + ·Cl → CH3Cl + Br·
24 records matched CH4 + ·Cl → ·CH3 + HCl
1 record matched CH4 + ·Cl → CH3Cl + H·
3 records matched CH3CCl3 + ·Cl → HCl + CCl3CH2
1 record matched Benzene + ·Cl → Chlorobenzene + H·
1 record matched Benzene + ·Cl → 6-chlorocyclohexadienyl radical
1 record matched CH3CH2CH2CH2OH + ·Cl → HCl + CH3CH2CH2C(·)HOH
1 record matched CH3CH2CH2CH2OH + ·Cl → CH3CH2CH(·)CH2OH + HCl
1 record matched CH3CH2CH2CH2OH + ·Cl → CH3CH(·)CH2CH2OH + HCl
1 record matched CH3CH2CH2CH2OH + ·Cl → (·)CH2CH2CH2CH2OH + HCl
4 records matched CCl3CCl3 + ·Cl → C2Cl5 + Cl2
1 record matched CCl3CCl3 → C2Cl5 + ·Cl
1 record matched (CH3)2SO + ·Cl → (CH3)2S + ClO
1 record matched (CH3)2SO + ·Cl → CH3Cl + CH3S(O)
2 records matched (CH3)2SO + ·Cl → Products
1 record matched (CH3)2SO + ·Cl → CH3SCH2O· + HCl
1 record matched (CH3)2SO + ·Cl → CH3S(O)Cl + ·CH3
2 records matched CHCl3 + ·Cl → CHCl2 + Cl2
7 records matched CHCl3 + ·Cl → ·CCl3 + HCl
2 records matched CHCl3 → CHCl2 + ·Cl
3 records matched Acetone + ·Cl → CH3C(O)CH2(·) + HCl
2 records matched Acetone + ·Cl → Products
1 record matched iso-C3H7OH + ·Cl → CH3CH(OH)CH2· + HCl
1 record matched iso-C3H7OH + ·Cl → (CH3)2C(·)OH + HCl
4 records matched CH3OH + ·Cl → (·)CH2OH + HCl
1 record matched CH3OH + ·Cl → CH3O· + HCl
3 records matched HCOOH + ·Cl → HOC(·)O + HCl
1 record matched HCOOH + ·OH + HCl → HCOOH + H2O + ·Cl
2 records matched aniline + ·Cl → Phenyl amidogen + HCl
1 record matched CN + HCl → HCN + ·Cl
4 records matched CCl4 + ·Cl → ·CCl3 + Cl2
5 records matched CCl4 → ·CCl3 + ·Cl
1 record matched CH2O + ·Cl → CH2ClO
1 record matched CH2O + ·Cl → HCO + HCl
1 record matched Adduct → (CH3)2S + ·Cl
1 record matched O(1D) + Cl2 → ClO + ·Cl
1 record matched O(1D) + HCl → ·OH + ·Cl
1 record matched CH3CHClO· → CH3CHO + ·Cl
2 records matched CH3CFClOO· + ·Cl → CH3COF + ClClO
1 record matched CH3CFClOO· + ·Cl → CH3CFClO + ClO
2 records matched CH3CFClOO· + ·Cl → CH3CFClOOCl
1 record matched CH3CFClOO· + ·Cl → ·CH2CFClOO· + HCl
1 record matched cis-HONO + ·Cl → HCl + NO2
1 record matched trans-HONO + ·Cl → HNO + ClO
1 record matched trans-HONO + ·Cl → HOCl + NO
2 records matched trans-HONO + ·Cl → HCl + NO2
1 record matched trans-HONO + ·Cl → ClNO + ·OH
1 record matched CHBrClO(.) → HC(O)Br + ·Cl
1 record matched AlHCl + ·Cl → HCl + AlCl
1 record matched AlHCl + Cl2 → AlHCl2 + ·Cl
1 record matched AlH2Cl + ·Cl → AlHCl + HCl
1 record matched Oxalyl chloride radical → ClCO + ·Cl
1 record matched CH2ClCHOH → CH2=CHOH + ·Cl
1 record matched CH2FSH + ·Cl → Adduct
1 record matched CH3SF + ·Cl → Adduct
1 record matched CHClOHCH2 → CH2=CHOH + ·Cl
1 record matched O(3P) + ClO → O2 + ·Cl
1 record matched (COCl)2[S1] → Oxalyl chloride radical + ·Cl
3 records matched CHBr2OO(·) + ClO → COBr2 + HO2 + ·Cl
2 records matched HOCO + ClO → HOC(O)O + ·Cl
1 record matched HOOOCl + ·Cl → cis-ClOOO + HCl
1 record matched [14]CH4 + ·Cl → [14]CH3 + HCl
1 record matched [13]CH3Cl + ·Cl → [13]CH2Cl + HCl
1 record matched CH3C(O)CCl2F + ·Cl → ·CH2C(O)CCl2F + HCl
1 record matched CH3C(O)CCl2Br + ·Cl → ·CH2C(O)CCl2Br + HCl
1 record matched CF3C(·)FOCHF2 + HCl → ·Cl + CF3CHFOCHF2
1 record matched CF3CHFOC(·)F2 + HCl → ·Cl + CF3CHFOCHF2
1 record matched c-N3 + Cl2 → N2 + NCl + ·Cl
1 record matched c-N3 + Cl2 → c-NNN(Cl) + ·Cl
1 record matched 1,2,4-trichlorocyclopentadienyl + 1,2,4-trichlorocyclopentadienyl → Tetrachloronaphthalene + ·Cl + ·Cl
1 record matched CF3CH2OCH2F + ·Cl → Other Products + HCl
1 record matched CF3CH2OCH2F + ·Cl → CF3CH2O· + CH2FCl
1 record matched CF3CH2OCH2F + ·Cl → CF3CH2OCHF· + HCl
1 record matched CF3CH2OCH2F + ·Cl → CF3CH(·)OCH2F + HCl
1 record matched CF3CH2OCH2F + ·Cl → ·CH2OCH2F + CF3Cl
1 record matched CH3CHClCH2BCl2 + ·Cl → Products
1 record matched CH3CH=CHBCl2 + ·Cl → Products
1 record matched CH3C≡CBCl2 + ·Cl → ·C≡CBCl2 + CH3Cl
1 record matched cyc-HC=C=C(BCl2) + ·Cl → cyc-(·)C=C=C(BCl2) + HCl
1 record matched n-C4F9OC(O)H + ·Cl → CF3CF2CF2CF2OC(O)· + HCl
1 record matched HONO (unspecified cis/trans isomer) + ·Cl → HCl + NO2
1 record matched 1-(2-Chloroethyl)-2-methylsulfanylbenzene → ·CH3 + Benzothiophane + ·Cl
1 record matched H2O2-H2O Complex + ·Cl → HO2-H2O Complex + HCl
1 record matched Pentachlorocyclopentadienyl + ·Cl → Hexachlorocyclopentadiene
1 record matched C10Cl9 → Octachloronaphthalene + ·Cl
1 record matched CH2FSF + ·Cl → Adduct
1 record matched NH2SF + ·Cl → Adduct
1 record matched (CF3)2CHOCHO + ·Cl → Other Products + HCl
1 record matched ClCH2CH2SCH(·)CH2Cl → ClCH2CH2SCH=CH2 + ·Cl
1 record matched 1-piperazinyl + HCl → Piperazine + ·Cl
1 record matched 2-piperazinyl + HCl → Piperazine + ·Cl
1 record matched 1-chloro-2,3,5-cyclohexatriene → Phenyl + ·Cl
1 record matched CHCl=C=CHCHClC≡CH → CHCl=C=CHC(·)HC≡CH + ·Cl
1 record matched CHCl=C=CHC(·)HC≡CH → (E)-HC≡CCH=CHC≡CH + ·Cl
1 record matched 2-Phenyl-2-chloroethyl → Phenylacetylene + ·Cl
1 record matched HN(·)C(O)Cl → HN=C=O + ·Cl
1 record matched CHF2CF2OCHO + ·Cl → CHF2CF2OC(O)· + HCl
1 record matched CHF2CF2OOH + ·Cl → HCl + CHF2CF2OO·
1 record matched ClO4 + ·Cl → ClO3 + ClO
1 record matched cis-ClOOO → O3 + ·Cl
1 record matched NCl(a1DELTA) + NCl(a1DELTA) → N2 + ·Cl + ·Cl
2 records matched SnCl2(1A1) → SnCl(2Π) + ·Cl
1 record matched trans-CHCl=CH + Cl2 → (E)-CHCl=CHCl + ·Cl
1 record matched cis-CHCl=CH + Cl2 → (Z)-CHCl=CHCl + ·Cl
1 record matched E-CF3CFCHF + ·Cl → Products
1 record matched HOOOCl → HO3 + ·Cl
1 record matched CF2-trip + HCl → ·CHF2 + ·Cl
2 records matched [13]CH4 + ·Cl → [13]CH3 + HCl
1 record matched [·OH..OH2] complex + HCl → (H2O)2 + ·Cl
1 record matched CH3OCF2CF2OC(O)H + ·Cl → Other Products + HCl
1 record matched H2S + ·Cl → HCl + SH
1 record matched HC(O)OCH3 + ·Cl → Products
1 record matched CH2ClCHO + ·Cl → Products + ClCH(.)CHO
1 record matched CH3OH + ·Cl → (·)CH2OH + HCl

Search returned 6248 records.