Kinetics Database Logo

Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences

Feedback

Rate Our Products and Services

Help


Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty

More...


Administrative Links

NIST home page

MML home page

Chemical Sciences Division

  NIST Logo Home
©NIST, 2020
Accessibility information

Search Results


Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
1 record matched ·OH + SO3 → HO2 + SO2
1 record matched HO2 + ·Cl → ·OH + ClO
1 record matched (CH3)2CHCHO + HO2 → H2O2 + (CH3)2CCHO
3 records matched O(3P) + H2O2 → HO2 + ·OH
3 records matched HOCH2OO → CH2O + HO2
11 records matched HO2NO2 → HO2 + NO2
2 records matched O2 + CH2ClO → HC(O)Cl + HO2
4 records matched O2 + HSO2 → HO2 + SO2
8 records matched O2 + HOSO2 → HO2 + SO3
1 record matched O2 + (CH3)2CHCH2O· → (CH3)2CHCHO + HO2
2 records matched O2 + CH3CH2CH2CH2O· → CH3CH2CH2CHO + HO2
5 records matched O2 + n-C3H7O → C2H5CHO + HO2
28 records matched O2 + H· → HO2
1 record matched O2 + Cyclohexadienyl → Benzene + HO2
1 record matched H2O2 + ·CH2 → ·CH3 + HO2
8 records matched H2O2 + ·Cl → HO2 + HCl
11 records matched H2O2 + O· → HO2 + ·OH
4 records matched H2O2 + H· → H2 + HO2
3 records matched H2O2 + Br· → HO2 + HBr
1 record matched H2O2 + O2 → HO2 + HO2
1 record matched iso-C4H9 + O2 → iso-C4H8 + HO2
1 record matched iso-C4H9 + H2O2 → iso-C4H10 + HO2
6 records matched i-C3H7O + O2 → Acetone + HO2
1 record matched ·OH + ClO → HO2 + ·Cl
5 records matched ·OH + NO3 → HO2 + NO2
2 records matched ·OH + NO2 → HO2 + NO
8 records matched ·OH + O3 → HO2 + O2
1 record matched ·OH + N2O → HO2 + N2
1 record matched ·OH + O2 → HO2 + O·
14 records matched ·OH + H2O2 → HO2 + H2O
1 record matched HO2 + CF3CFHO2· → Other Products + O2
1 record matched HO2 + CF3CFHO2· → Products
2 records matched HO2 + CF3CCl2OO(·) → O2 + CF3CCl2OOH
2 records matched HO2 + CH3C(O)CH2OO· → CH3C(O)CH2OOH + O2
4 records matched HO2 + CH2ClO2 → O2 + CH2ClOOH
1 record matched HO2 + ·CH2 → Products
5 records matched HO2 + HOCH2CH2O2· → Products
2 records matched HO2 + CH3C(O)OO(·) → CH3C(O)OOH + O2
2 records matched HO2 + CH3C(O)OO(·) → CH3C(O)OH + O3
6 records matched HO2 + CH3C(O)OO(·) → Products
4 records matched HO2 + HOCH2OO → Products
9 records matched HO2 + ·Cl → HCl + O2
8 records matched HO2 + ·Cl → ·OH + ClO
2 records matched HO2 + ·Cl → Products
1 record matched HO2 + Cylopentyldioxy- → O2 + Hydroperoxide cyclopentyl
12 records matched HO2 + O· → ·OH + O2
3 records matched HO2 + BrO → O2 + HOBr
5 records matched HO2 + BrO → Products
3 records matched HO2 + ClO → O2 + HOCl
1 record matched HO2 + ClO → HCl + O3
5 records matched HO2 + ClO → Products
7 records matched HO2 + IO → O2 + HIO
1 record matched HO2 + IO → Products
7 records matched HO2 + I → O2 + HI
4 records matched HO2 + NH2 → Products
8 records matched HO2 + H· → H2O + O·
12 records matched HO2 + H· → ·OH + ·OH
12 records matched HO2 + H· → H2 + O2
3 records matched HO2 + H· → Products
1 record matched HO2 + NO3 → Other Products + O2
5 records matched HO2 + NO3 → Products
15 records matched HO2 + NO2 → HO2NO2
1 record matched HO2 + NO2 → Products
9 records matched HO2 + NO → ·OH + NO2
9 records matched HO2 + Br· → O2 + HBr
8 records matched HO2 + O3 → ·OH + O2 + O2
1 record matched HO2 + O3 → Other Products + ·OH
5 records matched HO2 + H2S → Products
1 record matched HO2 + H2O → ·OH + H2O2
1 record matched HO2 + SO2 → ·OH + SO3
7 records matched HO2 + SO2 → Products
1 record matched HO2 + iso-C4H9 → CH2O + iso-C3H7 + ·OH
16 records matched HO2 + ·OH → H2O + O2
21 records matched HO2 + HO2 → H2O2 + O2
2 records matched HO2 → O2 + H·
1 record matched CH3CO + H2O2 → CH3CHO + HO2
1 record matched CH3CO + HO2 → Products
9 records matched C2H5OO· + HO2 → CH3CH2OOH + O2
2 records matched C2H3 + O2 → C2H2 + HO2
1 record matched C2H3 + H2O2 → C2H4 + HO2
1 record matched C2H3 + HO2 → Products
8 records matched HCO + O2 → CO + HO2
1 record matched HCO + H2O2 → CH2O + HO2
1 record matched HCO + HO2 → Products
7 records matched (·)CH2OH + O2 → CH2O + HO2
1 record matched (·)CH2OH + H2O2 → CH3OH + HO2
1 record matched (·)CH2OH + HO2 → CH2O + H2O2
3 records matched CH3CH(·)OH + O2 → CH3CHO + HO2
1 record matched ·CH3 + H2O2 → CH4 + HO2
3 records matched ·CH3 + HO2 → CH3O· + ·OH
1 record matched ·CH3 + HO2 → CH4 + O2
1 record matched Benzyl + HO2 → ·OH + C6H5CH2O
9 records matched CH3CH2O· + O2 → CH3CHO + HO2
14 records matched CH3O· + O2 → CH2O + HO2
1 record matched CH3O· + HO2 → CH2O + H2O2
2 records matched 1-C3H7 + O2 → CH3CH=CH2 + HO2
1 record matched 1-C3H7 + H2O2 → C3H8 + HO2
1 record matched 1-C3H7 + HO2 → ·OH + n-C3H7O
1 record matched Cyclohexyldioxyl + HO2 → Cyclohexyl hydroperoxide + O2
1 record matched CH3O2· + H2O2 → CH3OOH + HO2
9 records matched CH3O2· + HO2 → CH3OOH + O2
2 records matched CH3O2· + HO2 → Products
1 record matched ·C2H + HO2 → ·OH + HCCO
1 record matched ·C2H + HO2 → C2H2 + O2
10 records matched ·C2H5 + O2 → C2H4 + HO2
1 record matched ·C2H5 + H2O2 → C2H6 + HO2
1 record matched ·C2H5 + HO2 → C2H4 + H2O2
1 record matched ·C2H5 + HO2 → C2H6 + O2
2 records matched iso-C3H7 + O2 → CH3CH=CH2 + HO2
1 record matched iso-C3H7 + H2O2 → C3H8 + HO2
1 record matched iso-C3H7 + HO2 → CH3CHO + ·CH3 + ·OH
1 record matched ·CH2CH=CH2 + O2 → CH2=C=CH2 + HO2
2 records matched ·CH2CH=CH2 + H2O2 → CH3CH=CH2 + HO2
1 record matched ·CH2CH=CH2 + HO2 → ·OH + CH2=CHCH2O
1 record matched tert-C4H9 + O2 → iso-C4H8 + HO2
1 record matched tert-C4H9 + H2O2 → iso-C4H10 + HO2
1 record matched tert-C4H9 + HO2 → Acetone + ·CH3 + ·OH
1 record matched H2 + O2 → HO2 + H·
4 records matched H2 + HO2 → H2O2 + H·
5 records matched CO + HO2 → CO2 + ·OH
1 record matched iso-C4H8 + HO2 → Products
2 records matched CH3CH=CH2 + O2 → ·CH2CH=CH2 + HO2
1 record matched CH3CH=CH2 + HO2 → ·CH2CH=CH2 + H2O2
1 record matched CH3CH=CH2 + HO2 → Methyloxirane + ·OH
2 records matched Toluene + O2 → Benzyl + HO2
1 record matched Toluene + HO2 → 4-methylphenyl + H2O2
1 record matched Toluene + HO2 → Benzyl + H2O2
1 record matched 1-C4H10 + HO2 → sec-C4H9 + H2O2
1 record matched 1-C4H10 + HO2 → Other Products + H2O2
1 record matched Ethylbenzene + HO2 → H2O2 + 2-phenylethyl
1 record matched Ethylbenzene + HO2 → 4-Methylbenzyl + H2O2
1 record matched Ethylbenzene + HO2 → 1-phenylethyl + H2O2
1 record matched iso-C4H10 + O2 → HO2 + iso-C4H9
1 record matched iso-C4H10 + O2 → tert-C4H9 + HO2
1 record matched iso-C4H10 + HO2 → iso-C4H9 + H2O2
2 records matched iso-C4H10 + HO2 → tert-C4H9 + H2O2
1 record matched iso-C4H10 + HO2 → Other Products + H2O2
5 records matched (CH3)2S + HO2 → Products
1 record matched CH3CHO + O2 → CH3CO + HO2
1 record matched CH3CHO + HO2 → CH3CO + H2O2
1 record matched C3H8 + O2 → 1-C3H7 + HO2
1 record matched C3H8 + O2 → iso-C3H7 + HO2
1 record matched C3H8 + HO2 → 1-C3H7 + H2O2
2 records matched C3H8 + HO2 → iso-C3H7 + H2O2
1 record matched C3H8 + HO2 → Other Products + H2O2
1 record matched C3H8 + HO2 → Propyl Radical + H2O2
5 records matched CH3SH + HO2 → Products
1 record matched C2H2 + O2 → ·C2H + HO2
1 record matched C2H2 + HO2 → H2C=C=O + ·OH
1 record matched C2H4 + O2 → C2H3 + HO2
1 record matched C2H4 + HO2 → Oxirane + ·OH
1 record matched C2H4 + HO2 → CH3CHO + ·OH
1 record matched C2H4 + HO2 → Adduct
1 record matched C2H4 + HO2 → Products
2 records matched C2H6 + O2 → ·C2H5 + HO2
4 records matched C2H6 + HO2 → ·C2H5 + H2O2
2 records matched CH4 + O2 → ·CH3 + HO2
2 records matched CH4 + HO2 → ·CH3 + H2O2
1 record matched CH3OH + O2 → (·)CH2OH + HO2
1 record matched CH3OH + HO2 → (·)CH2OH + H2O2
1 record matched C2H5OH + HO2 → CH3CH(·)OH + H2O2
2 records matched CH2O + O2 → HCO + HO2
6 records matched CH2O + HO2 → HOCH2OO
3 records matched CH2O + HO2 → HCO + H2O2
1 record matched CH2BrO + O2 → HO2 + HC(O)Br
2 records matched M + HO2NO2 → M + HO2 + NO2
2 records matched M + O2 + H· → M + HO2
2 records matched M + HO2 + NO2 → M + HO2NO2
3 records matched M + HO2 + HO2 → M + H2O2 + O2
1 record matched O2(X3Sigma_g-) + H2O → HO2 + ·OH
1 record matched 2,4-Cyclohexadienylperoxy, 6-hydroxy- → Phenol + HO2
6 records matched HOCH2OO → CH2O + HO2
17 records matched HO2NO2 → HO2 + NO2
1 record matched O3 + H· → HO2 + O·
2 records matched O3 + HBr → HO2 + BrO
1 record matched O2 + HC(O)CO → CO + CO + HO2
2 records matched O2 + CF3CClHO(.) → CF3COCl + HO2
14 records matched O2 + CF3CFHO → CF3COF + HO2
6 records matched O2 + CH2ClO → HC(O)Cl + HO2
1 record matched O2 + HOCH2O → HCOOH + HO2
1 record matched O2 + (CF3)2CHO(·) → (CF3)2CO + HO2
1 record matched O2 + HSO2 → HO2 + SO2
1 record matched O2 + ·CH2CH=CHCH2CH3 → CH2=CHCH=CHCH3 + HO2
1 record matched O2 + HN=N → HO2 + N2
5 records matched O2 + HOSO2 → HO2 + SO3
1 record matched O2 + (CH3)2CHC(O)(CH3)2 → Other Products + HO2
2 records matched O2 + HOCH2CH2O → HOCH2CHO + HO2
2 records matched O2 + (CH3)2CHCH2O· → (CH3)2CHCHO + HO2
2 records matched O2 + (CH3)2CHC(·)(CH3)2 → (CH3)2C=C(CH3)2 + HO2
1 record matched O2 + (CH3)2CHC(·)(CH3)2 → (CH3)2CHC(CH3)=CH2 + HO2
2 records matched O2 + (CH3)3C-C(·)(CH3)2 → (CH3)3CC(CH3)=CH2 + HO2
2 records matched O2 + CH3CH2CH2CH2O· → CH3CH2CH2CHO + HO2
1 record matched O2 + CH2=CHCH(·)CH2CH3 → CH2=CHCH=CHCH3 + HO2
2 records matched O2 + n-C3H7O → C2H5CHO + HO2
2 records matched O2 + (CH3)2N → CH2=NCH3 + HO2
67 records matched O2 + H· → HO2
2 records matched O2 + Cyclohexadienyl, 6-hydroxy- → Phenol + HO2
1 record matched O2 + HI → HO2 + I
7 records matched H2O2 + ·Cl → HO2 + HCl
1 record matched H2O2 + ClO → HO2 + HOCl
2 records matched H2O2 + ·F → HO2 + HF
2 records matched H2O2 + OD → HO2 + HDO
4 records matched H2O2 + H· → H2 + HO2
3 records matched H2O2 + Br· → HO2 + HBr
1 record matched HCl + NaO2 → HO2 + NaCl
1 record matched Ar + O2 + H· → HO2 + Ar
1 record matched CH3S· + H2O2 → CH3SH + HO2
1 record matched C2H5CH(·)OH + O2 → C2H5CHO + HO2
1 record matched (CH3)2C(OH) + O2 → Acetone + HO2
5 records matched iso-C4H9 + O2 → iso-C4H8 + HO2
1 record matched i-C3H7O + O2 → Acetone + HO2
1 record matched Cyclohexyloxy- + O2 → Cyclohexanone + HO2
1 record matched ·OH + HO2NO2 → HO2 + HNO3
1 record matched ·OH + CH3CH2CH2CH2OO· → HO2 + CH3CH2CH2CH2
1 record matched ·OH + CF3O2 → HO2 + CF3O
4 records matched ·OH + ClO → HO2 + ·Cl
2 records matched ·OH + NO3 → HO2 + NO2
3 records matched ·OH + NO2 → HO2 + NO
12 records matched ·OH + O3 → HO2 + O2
3 records matched ·OH + N2O → HO2 + N2
1 record matched ·OH + O2 + NO → HO2 + NO2
1 record matched ·OH + O2 → HO2 + O·
34 records matched ·OH + H2O2 → HO2 + H2O
1 record matched HO2 + CF3CF2OO· → O2 + CF3CF2OOH
1 record matched HO2 + CF2ClCH2OO· → Other Products + O2
1 record matched HO2 + CFCl2CH2OO(·) → Other Products + O2
3 records matched HO2 + CF3CFHO2· → O2 + CF3CFHOOH
1 record matched HO2 + CF3CCl2OO(·) → O2 + CF3CCl2OOH
1 record matched HO2 + CH3CH(OH)CH(CH3)OO(·) → CH3CH(OH)CH(OOH)CH3 + O2
1 record matched HO2 + CH2FO2 → O2 + CH2FOOH
1 record matched HO2 + CH2FO2 → HFCO + H2O + O2
1 record matched HO2 + CH2BrOO → Products
1 record matched HO2 + CH2BrOO → BrCH2OOH + O2
2 records matched HO2 + CH2ClCH2O2 → ClCH2CH2OOH + O2
1 record matched HO2 + CD3O2· → CD2O + O2 + HDO
1 record matched HO2 + CClF2OO → Other Products + O2
1 record matched HO2 + FC(O)O· → CO2 + HF + O2
1 record matched HO2 + CH3CH2C(O)OO → CH3CH2C(O)OOH + O2
1 record matched HO2 + CH3CH2C(O)OO → ·OH + O2 + CH3CH2C(O)O·
1 record matched HO2 + CH3CH2C(O)OO → C2H5COOH + O3
3 records matched HO2 + CH3C(O)CH2OO· → CH3C(O)CH2O· + ·OH + O2
3 records matched HO2 + CH3C(O)CH2OO· → CH3C(O)CH2OOH + O2
1 record matched HO2 + CH2OOH → Products
3 records matched HO2 + CH2ClO2 → O2 + CH2ClOOH
1 record matched HO2 + CH2ClO2 → HC(O)Cl + H2O + O2
1 record matched HO2 + Methyldioxy, dichloro- → Products
2 records matched HO2 + CH3OCH2O2 → O2 + CH3OCH2OOH
1 record matched HO2 + CH3OCH2O2 → ·OH + O2 + CH3OCH2
1 record matched HO2 + CH3OCH2O2 → HC(O)OCH3 + H2O + O2
1 record matched HO2 + CH3OCH2O2 → CH3OCH(O) + H2O + O2
1 record matched HO2 + CCl3O2 → Products
1 record matched HO2 + HOC(CH3)2CH2OO(·) → (CH3)2C(OH)CH2OOH + O2
1 record matched HO2 + HOCH2CH2O2· → O2 + HOCH2CH2OOH
3 records matched HO2 + HOCH2CH2O2· → Products
3 records matched HO2 + CH3C(O)OO(·) → ·OH + O2 + CH3C(O)O
1 record matched HO2 + CH3C(O)OO(·) → CO2 + ·CH3 + ·OH + O2
8 records matched HO2 + CH3C(O)OO(·) → CH3C(O)OOH + O2
10 records matched HO2 + CH3C(O)OO(·) → CH3C(O)OH + O3
7 records matched HO2 + CH3C(O)OO(·) → Products
1 record matched HO2 + CH3C(O)OO(·) → CH3C(O)O(·) + ·OH + O2
1 record matched HO2 + CH3C(O)OO(·) → CH3CH(OH)O2
1 record matched HO2 + (CH3)3CCH2OO → (CH3)3CCH2OOH + O2
1 record matched HO2 + (CH3)3CCH2OO → Products
1 record matched HO2 + HOCH2OO → ·OH + O2 + HOCH2O
1 record matched HO2 + HOCH2OO → HCOOH + H2O + O2
2 records matched HO2 + HOCH2OO → Products
12 records matched HO2 + ·Cl → HCl + O2
8 records matched HO2 + ·Cl → ·OH + ClO
3 records matched HO2 + ·Cl → Products
2 records matched HO2 + Cylopentyldioxy- → O2 + Hydroperoxide cyclopentyl
1 record matched HO2 + N → Products
15 records matched HO2 + O· → ·OH + O2
2 records matched HO2 + CF3O2 → O2 + CF3OOH
1 record matched HO2 + CF3O2 → Products
2 records matched HO2 + BrO → O3 + HBr
5 records matched HO2 + BrO → O2 + HOBr
5 records matched HO2 + BrO → Products
1 record matched HO2 + O2F → Products
5 records matched HO2 + ClO → O2 + HOCl
2 records matched HO2 + ClO → HCl + O3
2 records matched HO2 + ClO → Products
3 records matched HO2 + IO → O2 + HIO
2 records matched HO2 + IO → Products
1 record matched HO2 + I → O2 + HI
1 record matched HO2 + NH → Products
1 record matched HO2 + NH2 → NH2(OH)O
1 record matched HO2 + NH2 → NH2OOH
1 record matched HO2 + NH2 → HN(OH)2
1 record matched HO2 + NH2 → H2O + :NOH
4 records matched HO2 + NH2 → H2O + HNO
2 records matched HO2 + NH2 → NH3 + O2
2 records matched HO2 + NH2 → ·OH + NH2O
3 records matched HO2 + NH2 → Products
5 records matched HO2 + H· → H2O + O·
6 records matched HO2 + H· → ·OH + ·OH
7 records matched HO2 + H· → H2 + O2
5 records matched HO2 + H· → Products
1 record matched HO2 + H· → O2(1DELTA) + H2
2 records matched HO2 + NO3 → HNO3 + O2
2 records matched HO2 + NO3 → ·OH + O2 + NO2
2 records matched HO2 + NO3 → Other Products + ·OH
2 records matched HO2 + NO3 → Products
25 records matched HO2 + NO2 → HO2NO2
9 records matched HO2 + NO2 → O2 + HNO2
1 record matched HO2 + NO2 → Products
1 record matched HO2 + NO → O2 + HNO
7 records matched HO2 + NO → HNO3
30 records matched HO2 + NO → ·OH + NO2
2 records matched HO2 + NO → Products
1 record matched HO2 + N2O5 → Products
4 records matched HO2 + Br· → O2 + HBr
2 records matched HO2 + HBr → H2O2 + Br·
1 record matched HO2 + O3 → ·OH + O2 + O2
8 records matched HO2 + O3 → Other Products + ·OH
2 records matched HO2 + N2O → Products
2 records matched HO2 + FNO → HF + O2 + NO
1 record matched HO2 + H2S → H2O + HSO
1 record matched HO2 + H2S → Products
1 record matched HO2 + F2 → HF + O2 + ·F
1 record matched HO2 + H2O + NO → HNO3 + H2O
1 record matched HO2 + H2O → HO2-H2O Complex
2 records matched HO2 + (Z)-2-C6H12 → ·OH + Oxirane, 2-methyl-3-propyl-, cis-
5 records matched HO2 + SO2 → ·OH + SO3
1 record matched HO2 + SO2 → Adduct
1 record matched HO2 + SO2 → Products
1 record matched HO2 + CH2=CHCH2OO → CH2=CHCH2OOH + O2
2 records matched HO2 + C6H5CH2OO → C6H5CH2OOH + O2
2 records matched HO2 + (E)-2-C6H12 → ·OH + Oxirane, 2-methyl-3-propyl-, trans-
1 record matched HO2 + NF2 → Other Products + FNO
37 records matched HO2 + ·OH → H2O + O2
1 record matched HO2 + HO2 + H2O → H2O2 + H2O + O2
1 record matched HO2 + HO2 + H2O → Products + H2O
46 records matched HO2 + HO2 → H2O2 + O2
1 record matched HO2 + HO2 → H2 + O2 + O2
3 records matched HO2 + HO2 → Other Products + H2
6 records matched HO2 + HO2 → Products
1 record matched C2H5OO· + ·OH → CH3CH2O· + HO2
3 records matched C2H5OO· + HO2 → CH3CH2OOH + O2
1 record matched C2H5OO· + HO2 → CH3CH2OOH
5 records matched C2H5OO· + HO2 → Products
2 records matched C2H5OO· → C2H4 + HO2
1 record matched 1-C5H11 + O2 → 1-C5H10 + HO2
1 record matched C2H3 + O2 → C2H2 + HO2
24 records matched HCO + O2 → CO + HO2
14 records matched (·)CH2OH + O2 → CH2O + HO2
1 record matched (·)CH2OH + HO2 → Products
2 records matched HOC(·)O + O2 → CO2 + HO2
4 records matched 1-C4H9 + O2 → 1-C4H8 + HO2
4 records matched sec-C4H9 + O2 → (E)-2-C4H8 + HO2
4 records matched sec-C4H9 + O2 → (Z)-2-C4H8 + HO2
1 record matched sec-C4H9 + O2 → 1-C4H8 + HO2
1 record matched 1-phenylethyl + HO2 → C6H5CH(OOH)CH3
1 record matched CH3CH(·)OH + O2 → CH3CHO + HO2
1 record matched ·CH3 + HO2 → CH3O· + ·OH
1 record matched ·CH3 + HO2 → CH4 + O2
1 record matched ·CH3 + HO2 → Products
1 record matched Benzyl + HO2 → ·OH + C6H5CH2O
1 record matched Benzyl + HO2 → Products
5 records matched CH3CH2O· + O2 → CH3CHO + HO2
25 records matched CH3O· + O2 → CH2O + HO2
1 record matched CH3O· + HO2 → Products
10 records matched 1-C3H7 + O2 → CH3CH=CH2 + HO2
1 record matched Cyclohexyldioxyl + HO2 → Cyclohexyl hydroperoxide + O2
1 record matched Cyclohexyldioxyl + HO2 → Products
2 records matched CH3O2· + ·OH → CH3O· + HO2
5 records matched CH3O2· + HO2 → CH3OOH + O2
1 record matched CH3O2· + HO2 → CH2O + H2O + O2
6 records matched CH3O2· + HO2 → Products
21 records matched ·C2H5 + O2 → C2H4 + HO2
1 record matched ·C2H5 + HO2 → CH3CH2O· + ·OH
1 record matched ·C2H5 + HO2 → C2H4 + H2O2
1 record matched ·C2H5 + HO2 → Products
4 records matched iso-C3H7 + O2 → CH3CH=CH2 + HO2
1 record matched ·CH2CH=CH2 + O2 → CH2=C=CH2 + HO2
3 records matched ·CH2CH=CH2 + HO2 → CH3CH=CH2 + O2
3 records matched ·CH2CH=CH2 + HO2 → Other Products + CO
2 records matched tert-C4H9 + O2 → iso-C4H8 + HO2
2 records matched H2 + O2 → HO2 + H·
1 record matched CO + HO2 → HC(O)O2
14 records matched CO + HO2 → CO2 + ·OH
2 records matched (E)-2-C4H8 + HO2 → Oxirane, 2,3-dimethyl- + ·OH
1 record matched (E)-2-C4H8 + HO2 → Products
1 record matched 1,3-Cyclohexadiene + O2 → HO2 + Cyclohexadienyl
2 records matched CH2=CHCH2CH2CH=CH2 + O2 → Other Products + HO2
2 records matched 1-C6H12 + HO2 → Oxirane, butyl- + ·OH
1 record matched n-C4H9COCH3 + HO2
1 record matched (CH3)2C=C(CH3)2 + HO2 → ·OH + oxirane, tetramethyl-
1 record matched (CH3)2C=C(CH3)2 + HO2 → Products
1 record matched neo-C5H12 + O2 → HO2 + Neopentyl
2 records matched Cyclopentane + HO2 → Cyclopentyl + H2O2
1 record matched CH3CH2CH2CHO + HO2 → H2O2 + CH3CH2CH2CO
4 records matched C2H5CHO + O2 → HO2 + CH3CH2CO
1 record matched C2H5CHO + HO2 → H2O2 + CH3C(·)HCHO
3 records matched C2H5CHO + HO2 → H2O2 + CH3CH2CO
1 record matched CF3CF=CF2 + HO2 → Products
1 record matched iso-C4H8 + O2 → HO2 + ·CH2C(CH3)=CH2
2 records matched CH3CH=CH2 + O2 → ·CH2CH=CH2 + HO2
1 record matched CH3CH=CH2 + HO2 → Methyloxirane + ·OH
2 records matched Cyclohexane + HO2 → Cyclohexyl + H2O2
2 records matched 1-C5H10 + HO2 → Propyl oxirane + ·OH
2 records matched Toluene + O2 → Benzyl + HO2
2 records matched Toluene + HO2 → Benzyl + H2O2
1 record matched n-C3H7C(O)CH3 + HO2
1 record matched (CHO)2 + HO2 → Products
1 record matched Ethylbenzene + HO2 → C6H5C2H4 + H2O2
1 record matched (C2H5)2CO + HO2
1 record matched (CH3)2CHCH(CH3)2 + O2 → HO2 + (CH3)3CC(·)H(CH3)
1 record matched (CH3)2CHCH(CH3)2 + HO2 → H2O2 + (CH3)2CHC(·)(CH3)2
1 record matched (CH3)2CHCH(CH3)2 + HO2 → Products
1 record matched C2H5COCH3 + HO2
1 record matched (CH3)2CHCHO + O2 → HO2 + (CH3)2CHC=O
1 record matched (CH3)2CHCHO + HO2 → H2O2 + (CH3)2CCHO
1 record matched (CH3)2CHCHO + HO2 → H2O2 + (CH3)2CHC=O
1 record matched iso-C4H10 + HO2 → iso-C4H9 + H2O2
1 record matched iso-C4H10 + HO2 → tert-C4H9 + H2O2
1 record matched iso-C4H10 + HO2 → Other Products + H2O2
2 records matched iso-C4H10 + HO2 → Products
1 record matched Cyclopropane + O2 → Cyclopropyl + HO2
1 record matched (CH3)2S + HO2 → Products
1 record matched CH3CHO + O2 → HO2 + CH2=CHO·
1 record matched CH3CHO + O2 → CH3CO + HO2
1 record matched CH3CHO + HO2 → CH2=CHO· + H2O2
1 record matched CH3CHO + HO2 → CH3CH(OH)O2
2 records matched C3H8 + O2 → Other Products + HO2
1 record matched C3H8 + HO2 → 1-C3H7 + H2O2
1 record matched C3H8 + HO2 → iso-C3H7 + H2O2
1 record matched C3H8 + HO2 → Other Products + H2O2
2 records matched C3H8 + HO2 → Products
1 record matched C3H8 + HO2 → Propyl Radical + H2O2
1 record matched CH3SH + HO2 → Products
1 record matched C2H2 + HO2 → C2H3 + O2
1 record matched C2H4 + O3 → Other Products + HO2
5 records matched C2H4 + HO2 → Oxirane + ·OH
1 record matched C2H4 + HO2 → Products
2 records matched C2H6 + O2 → ·C2H5 + HO2
7 records matched C2H6 + HO2 → ·C2H5 + H2O2
2 records matched CH4 + O2 → ·CH3 + HO2
2 records matched CH4 + HO2 → ·CH3 + H2O2
1 record matched Acetone + HO2
1 record matched Acetone + HO2 → Adduct
1 record matched Acetone + HO2 → (CH3)2C(OH)OO
1 record matched CH3OH + HO2 + HO2 → CH3OH + H2O2 + O2
1 record matched CH3OH + HO2 + HO2 → Products + CH3OH
1 record matched CH3OH + HO2 → HO2-CH3OH complex
4 records matched CH2O + O2 → HCO + HO2
5 records matched CH2O + HO2 → HOCH2OO
9 records matched CH2O + HO2 → HCO + H2O2
1 record matched CH2O + HO2 → (·)CH2OH + O2
1 record matched C2F5C(O)O2 + HO2 → C2F5COOH + O3
1 record matched C2F5C(O)O2 + HO2 → C2F5C(O)O + ·OH + O2
1 record matched CH3CHClO· + O2 → CH3COCl + HO2
1 record matched CH3CF2OO· + HO2 → CH3CF2OOH + O2
1 record matched CH3CF2OO· + HO2 → CH3CF2O(·) + ·OH + O2
1 record matched CH3CH2CH2C(O)OO· + HO2 → O2 + CH3CH2CH2C(O)OOH
1 record matched CH3CH2CH2C(O)OO· + HO2 → ·OH + O2 + CH3CH2CH2C(O)O·
1 record matched CH3CH2CH2C(O)OO· + HO2 → n-C3H7COOH + O3
2 records matched CFCl2CH2O· + O2 → HO2 + CCl2FCHO
3 records matched CF3CF2CFHO(.) + O2 → Other Products + HO2
1 record matched (CH3)2C(OH)COO(.)(CH3)2 + HO2 → (CH3)2C(OH)C(OOH)(CH3)2 + O2
1 record matched CF2ClCH2O(.) + O2 → Acetaldehyde, chlorodifluoro- + HO2
1 record matched CH2ClCHClO(.) + O2 → CH2ClCOCl + HO2
1 record matched (·)CH2C(CH3)2OOH → iso-C4H8 + HO2
1 record matched CH2DO + O2 → CHDO + HO2
1 record matched CH3OCH2OCH2O(.) + O2 → CH3OCH2OCHO(.) + HO2
1 record matched 3-pentoxy radical + O2 → (C2H5)2CO + HO2
2 records matched HO2-H2O Complex + HO2 → Products
1 record matched [CH3OH..HO2] complex + HO2 → CH3OH + H2O2 + O2
1 record matched C6H5C(O)O2 + HO2 → C6H5C(O)OOH + O2
1 record matched C6H5C(O)O2 + HO2 → Benzoic acid + O3
1 record matched C6H5C(O)O2 + HO2 → Products
1 record matched C6H5C(O)O2 + HO2 → C6H5C(O)O· + ·OH + O2
1 record matched C6H6-OH-O2 + NO → Other Products + HO2
1 record matched CH3CH2CH2CH2CH2O + O2 → CH3CH2CH2CH2CHO + HO2
1 record matched CH3CH2CH2CH2O· + O2 → CH3CH2CH2CHO + HO2
10 records matched M + O2 + H· → M + HO2
1 record matched M + HO2 + HO2 → M + H2O2 + O2
1 record matched BrC(CH3)2C(CH3)2O2 + HO2 → Products
1 record matched ·CH(OH)C(O)CH3 + O2 → CH3C(O)CHO + HO2
1 record matched isoprene hydroxy-peroxy + HO2 → Products
1 record matched CH3CH2CH2OO· + ·OH → HO2 + n-C3H7O
1 record matched CH2ClCH(OO)C(O)CH3 + HO2 → CH2ClCH(OOH)C(O)CH3 + O2
1 record matched CH2ClCH(OO)C(O)CH3 + HO2 → CH2ClCH(O·)C(O)CH3 + ·OH + O2
1 record matched CH2FOCHFO + O2 → CH2FOC(O)F + HO2
1 record matched C3H7CF(OCHO(·)CH3)CF(CF3)2 + O2 → C3H7CF(OC(O)CH3)CF(CF3)2 + HO2
1 record matched ClCH2CH(O)CF3 + O2 → CF3C(O)CH2Cl + HO2
1 record matched HO2-CH3OH complex + HO2 → Products
1 record matched HO2-CH3OH complex → CH3OH + HO2
1 record matched (CH3)CH(OO·)COCH3 + HO2 → ·OH + O2 + CH3C(O)CH(O·)CH3
1 record matched (CH3)CH(OO·)COCH3 + HO2 → O=C(CH3)CH(CH3)OOH + O2
1 record matched (cyc-C(i-C3F7)CFCF2CF(i-C3F7)O)-O-CH(O·)CH3 + O2 → 2-acetoxy-3,3,4,4,5-pentafluorotetra-hydro-2,5-bis[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]-furan + HO2
1 record matched CH3C(·)(OH)CH2CH=CH2 + O2 → HO2 + CH3C(O)CH2CH=CH2
1 record matched CH2ClC(CH3)(OO·)CHO + HO2 → CH2ClC(CH3)(OOH)CHO + O2
1 record matched CH2ClC(CH3)(OO·)CHO + HO2 → CH2ClC(CH3)(O·)CHO + ·OH + O2
1 record matched 1,2-dichloro-1-hydroxyethylperoxy radical + HO2 → Products
1 record matched 2-hydroxycyclohexyldioxyl + HO2 → Products
1 record matched HO-(alpha-Pinene)-OO + HO2 → Products
1 record matched HO-(gamma-terpinene)-OO + HO2 → Products
1 record matched HO-(d-limonene)-OO + HO2 → Products
1 record matched decylperoxy radical + HO2 → Products
1 record matched tetradecylperoxy radical + HO2 → Products
1 record matched CH3CH(CH3)(OH)CH(CH3)(OO)CH3 + HO2 → Products
1 record matched (CH3)2C(OH)CH2O2· + HO2 → (CH3)2C(OH)CH2OOH + O2
1 record matched Propyl Radical + O2 → C2H4 + HO2
2 records matched CH3CH(OH)O2 → CH3CHO + HO2
1 record matched CF3C(O·)HCHFCl + O2 → CF3C(O)CHFCl + HO2
1 record matched C2H5CH(OH)CH2OO· + HO2 → C2H5CH(OH)CH2OOH + O2
1 record matched C2H5CH(OO·)CH2OH + HO2 → C2H5CH(OOH)CH2OH + O2
1 record matched O2(X3Sigma_g-) + C2H3 → C2H2(X1Σg+) + HO2
1 record matched (·)C(CH2OOH)(CH3)CH2CH3 → C2H5C(CH3)=CH2 + HO2
2 records matched HOOCH2O → CH2O + HO2
1 record matched CH2=CH(CH2)3CH2OO(·) → CH2=CHCH2CH=CH2 + HO2
1 record matched (CH3)2C(CH2OOH)CH2· → iso-C4H8 + HO2
1 record matched CH2ClO2 + CH2ClO2 → HC(O)Cl + HO2 + CH2ClO
1 record matched CH2=CHOOH → C2H3 + HO2
2 records matched CH3(CH2)3CH2OO· → 1-C5H10 + HO2
1 record matched n-C3H7O2 → CH3CH=CH2 + HO2
1 record matched (C2H5)2CHO2 → 2-(E)-C5H10 + HO2
1 record matched (C2H5)2CHO2 → 2-(Z)-C5H10 + HO2
1 record matched n-C3H7CH(CH3)O2 → 2-(E)-C5H10 + HO2
1 record matched n-C3H7CH(CH3)O2 → 2-(Z)-C5H10 + HO2
1 record matched n-C3H7CH(CH3)O2 → 1-C5H10 + HO2
1 record matched CH3(CH2)4CH(CH3)OO· → Other Products + HO2
1 record matched HOCH2OO → CH2O + HO2
1 record matched (CH3)2CHCH2O2 → iso-C4H8 + HO2
1 record matched (CH3)2CHC(OO)(CH3)2 → (CH3)2C=C(CH3)2 + HO2
1 record matched 1-C7H15-OO· → 1-C7H14 + HO2
3 records matched CH3CH2CH2CH2OO· → 1-C4H8 + HO2
1 record matched C2H5CH(CH3)O2 → (E)-2-C4H8 + HO2
1 record matched C2H5CH(CH3)O2 → (Z)-2-C4H8 + HO2
1 record matched C2H5CH(CH3)O2 → 1-C4H8 + HO2
1 record matched HBr + DO2 → HO2 + DBr
1 record matched HI + DO2 → HO2 + DI
1 record matched O3 + H· → HO2 + O·
1 record matched O2 + CH3CHBrO(·) → CH3COBr + HO2
2 records matched O2 + CF3CFHO → CF3COF + HO2
1 record matched O2 + HOOCH2O → HC(O)OOH + HO2
1 record matched O2 + CH2CHC·CH2 → Vinylacetylene + HO2
1 record matched O2 + HOCH2O → HCOOH + HO2
3 records matched O2 + ·CH2CH=CHCH2CH3 → CH2=CHCH=CHCH3 + HO2
1 record matched O2 + cyclopentyloxy → Cyclopentanone + HO2
1 record matched O2 + (CH3)2S.OH → (CH3)2SO + HO2
1 record matched O2 + CH3NH → CH2=NH + HO2
1 record matched O2 + HC=S → CS + HO2
2 records matched O2 + HOSO2 → HO2 + SO3
1 record matched O2 + (CH3)3C-C(·)(CH3)2 → (CH3)3CC(CH3)=CH2 + HO2
3 records matched O2 + CH2=CHCH(·)CH2CH3 → CH2=CHCH=CHCH3 + HO2
1 record matched O2 + 2-phenylethyl → Styrene + HO2
1 record matched O2 + NH2 → HO2 + NH
20 records matched O2 + H· → HO2
1 record matched O2 + Cyclohexadienyl → Benzene + HO2
1 record matched O2 + Cyclohexadienyl, 6-hydroxy- → Phenol + HO2
1 record matched O2 + 2-Isopropylfuran → 2-(furan-2-yl)-2-propyl radical + HO2
1 record matched O2 + CH2NH2 → CH2=NH + HO2
1 record matched O2 + H2S → HO2 + SH
2 records matched H2O + O· → HO2 + H·
1 record matched H2O + O2 + HOSO2 → HO2 + H2SO4
1 record matched H2O + O2 → HO2 + ·OH
2 records matched H2O2 + ·Cl → HO2 + HCl
1 record matched H2O2 + I → HO2 + HI
1 record matched H2O2 + OD → HO2 + HDO
8 records matched H2O2 + H· → H2 + HO2
1 record matched H2O2 + NO3 → HO2 + HNO3
2 records matched H2O2 + Br· → HO2 + HBr
1 record matched H2O2 + O2 → HO2 + HO2
2 records matched HNO3 → HO2 + NO
1 record matched HF + DO2 → HO2 + DF
1 record matched HCl + DO2 → HO2 + DCl
2 records matched CH3S· + O2 → CH2S + HO2
1 record matched iso-C4H9 + O2 → iso-C4H8 + HO2
1 record matched CH2=CHCH2OO → CH2=C=CH2 + HO2
1 record matched *CH2C(O)H + O2 → H2C=C=O + HO2
1 record matched C6H5CH2OO + H· → Benzyl + HO2
4 records matched (CH3)2CHO2 → CH3CH=CH2 + HO2
2 records matched (CH3)3CO2 → iso-C4H8 + HO2
2 records matched Cyclohexyloxy- + O2 → Cyclohexanone + HO2
1 record matched ·OH + CH2OO → CH2O + HO2
1 record matched ·OH + BrO2 → HO2 + BrO
2 records matched ·OH + OClO → HO2 + ClO
1 record matched ·OH + CF3O2 → HO2 + CF3O
1 record matched ·OH + ClO → HO2 + ·Cl
1 record matched ·OH + NO3 → HO2 + NO2
1 record matched ·OH + NO2 → HO2 + NO
3 records matched ·OH + O3 → HO2 + O2
3 records matched ·OH + N2O → HO2 + N2
12 records matched ·OH + H2O2 → HO2 + H2O
3 records matched ·OH + ·OH → HO2 + H·
1 record matched 2-Ethylfuran + O2 → 2-(furan-2-yl)ethyl radical + HO2
1 record matched HO2 + CHF2OO → Products
1 record matched HO2 + CF3C(O)OO(·) → CF3C(O)OOH + O2
2 records matched HO2 + CF3C(O)OO(·) → CF3COOH + O3
1 record matched HO2 + CF3CFHO2· → O2 + CF3CFHOOH
1 record matched HO2 + CF3CFHO2· → CF3COF + HO2 + ·OH
1 record matched HO2 + CF3CFHO2· → CF3CHO + HF + O3
1 record matched HO2 + CF3CFHO2· → CF3CFHOH + O3
1 record matched HO2 + CF3CFHO2· → HOOOH + CF3COF
1 record matched HO2 + CF3CFHO2· → FOOOH + CF3CHO
1 record matched HO2 + CF3CCl2OO(·) → O2 + CF3CCl2OOH
1 record matched HO2 + CH3CH(OH)CH(CH3)OO(·) → Products
1 record matched HO2 + CH2FO2 → Products
2 records matched HO2 + CH2BrOO → CH2BrO + ·OH + O2
2 records matched HO2 + CH3C(O)CH2OO· → CH3C(O)CH2OH + O3
2 records matched HO2 + CH3C(O)CH2OO· → CH3C(O)CH2O· + ·OH + O2
2 records matched HO2 + CH3C(O)CH2OO· → CH3C(O)CH2OOH + O2
1 record matched HO2 + cis-2,cis-5-heptadiene → CH3CH=CHCH(·)CH=CHCH3 + H2O2
1 record matched HO2 + cis-2,cis-5-heptadiene → (5Z)(·)CH2CH=CHCH2CH=CHCH3 + H2O2
1 record matched HO2 + 5-Methyl-2-furanol → trans-5-hydroxy-2-methyl-4,5-dihydro-furan-4-ylperoxy
1 record matched HO2 + CH2ClO2 → O3 + ClCH2OH
2 records matched HO2 + CH2ClO2 → O2 + CH2ClOOH
1 record matched HO2 + CH2ClO2 → HCl + O2 + CH2OO
1 record matched HO2 + CH2ClO2 → HC(O)Cl + H2O + O2
1 record matched HO2 + CH2ClO2 → HC(O)Cl + HO2 + ·OH
1 record matched HO2 + CH2ClO2 → CH2O + O2 + HOCl
1 record matched HO2 + CH2ClO2 → HO3 + CH2O + ·Cl
1 record matched HO2 + CH2ClO2 → HOOOCl + CH2O
1 record matched HO2 + CH2ClO2 → CHClOO + H2O2
1 record matched HO2 + Methyldioxy, dichloro- → COCl2 + HO2 + ·OH
1 record matched HO2 + Methyldioxy, dichloro- → CHCl2OOH + O2
1 record matched HO2 + 1H-inden-1-yl → indenoxy radical + ·OH
1 record matched HO2 + CCl3O2 → CCl3OOH + O2
1 record matched HO2 + CH2OO → ·OOCH2OOH
1 record matched HO2 + OSCl → ·OH + ClSO2
1 record matched HO2 + OSCl → ·OH + SO2 + ·Cl
1 record matched HO2 + CH3(CH2)3CH2OO· → 1-C5H11OOH + O2
1 record matched HO2 + 3,4-dimethylphenyl-methyl → ·OH + 3,4-dimethylbenzaldehyde + H·
1 record matched HO2 + 3,4-dimethylphenyl-methyl → 1,2-Dimethylbenzene + HCO + ·OH
1 record matched HO2 + 2,5-dimethylphenyl-methyl → ·OH + 2,5-dimethylbenzaldehyde + H·
1 record matched HO2 + 2,5-dimethylphenyl-methyl → 1,4-Dimethylbenzene + HCO + ·OH
1 record matched HO2 + 2,4-dimethylphenyl-methyl → ·OH + H· + 2,4-dimethylbenzaldehyde
1 record matched HO2 + 2,4-dimethylphenyl-methyl → 1,3-Dimethylbenzene + HCO + ·OH
1 record matched HO2 + n-C3H7O2 → Products
1 record matched HO2 + (2E,5E)-2,5-Heptadiene → CH3CH=CHCH(·)CH=CHCH3 + H2O2
1 record matched HO2 + (2E,5E)-2,5-Heptadiene → (5E)(·)CH2CH=CHCH2CH=CHCH3 + H2O2
3 records matched HO2 + CH3C(O)OO(·) → ·OH + O2 + CH3C(O)O
3 records matched HO2 + CH3C(O)OO(·) → CH3C(O)OOH + O2
3 records matched HO2 + CH3C(O)OO(·) → CH3C(O)OH + O3
1 record matched HO2 + CH3C(O)OO(·) → Products
1 record matched HO2 + cis-4-Oxo-2-pentenal → cis-2-hydroxy-2-methyl-2,5-dihydro-furan-5-ylperoxy
1 record matched HO2 + cis-4-Oxo-2-pentenal → cis-5-hydroxy-2-methyl-2,5-dihydro-furan-2-ylperoxy
1 record matched HO2 + (CH3)3CCH2OO → (CH3)3CCH2OOH + O2
1 record matched HO2 + HOCH2OO → Products
1 record matched HO2 + CH3SO → O2 + CH3SOH
1 record matched HO2 + NCO → HN=C=O + O2
1 record matched HO2 + n-C8H17O2 → 1-C8H17OOH + O2
1 record matched HO2 + 1-C7H15-OO· → 1-C7H15OOH + O2
1 record matched HO2 + n-C6H13O2 → 1-C6H13OOH + O2
1 record matched HO2 + CH3CH2CH2CH2OO· → 1-C4H9OOH + O2
1 record matched HO2 + CH3CH2CH2CH2OO· → Products
1 record matched HO2 + C2H5CH(CH3)O2 → Products
4 records matched HO2 + O· → ·OH + O2
2 records matched HO2 + O· → Products
1 record matched HO2 + CF3O2 → O2 + CF3OOH
2 records matched HO2 + BrCOCOBr → BrC(O)C(OO·)(OH)Br
1 record matched HO2 + ·CH2C(CH3)=CH2 → iso-C4H8 + O2
4 records matched HO2 + ClO → O2 + HOCl
1 record matched HO2 + ClO → HCl + O3
2 records matched HO2 + ClO → ·OH + OClO
2 records matched HO2 + ClO → ·OH + ClOO
2 records matched HO2 + ClO → Adduct
5 records matched HO2 + ClO → Products
2 records matched HO2 + ClO → O2(1Delta_g) + HOCl
1 record matched HO2 + ClO → HOOOCl
2 records matched HO2 + ClO → HOOOCl
1 record matched HO2 + ClO → O3[triplet] + HCl
1 record matched HO2 + ·F → HF + O2
1 record matched HO2 + DF → HF + DO2
1 record matched HO2 + DI → HI + DO2
1 record matched HO2 + SH → O2 + H2S
1 record matched HO2 + SH → ·OH + HSO
1 record matched HO2 + Methyl trans-3-hexenoate → Methyl 3,4-epoxyhexanoate
1 record matched HO2 + Methyl trans-3-hexenoate → Methyl 3-peroxy-hexanoate-4-yl
1 record matched HO2 + Methyl trans-3-hexenoate → Methyl 4-peroxy-hexanoate-3-yl
1 record matched HO2 + SO → ·OH + SO2
1 record matched HO2 + DBr → HBr + DO2
1 record matched HO2 + HOBr → H2O2 + BrO
1 record matched HO2 + HOBr → Products
6 records matched HO2 + H· → H2O + O·
8 records matched HO2 + H· → ·OH + ·OH
7 records matched HO2 + H· → H2 + O2
2 records matched HO2 + H· → Products
2 records matched HO2 + H· → O(1D) + H2O
2 records matched HO2 + H· → O2(1DELTA) + H2
2 records matched HO2 + H· → O2(1Delta_g) + H2
1 record matched HO2 + H· → H2OO
1 record matched HO2 + H· → O2(3Delta_u) + H2
1 record matched HO2 + C2H5C(CH3)=C(CH3)2 → CH3CH2CH(CH3)C(CH3)2OO·
1 record matched HO2 + C2H5C(CH3)=C(CH3)2 → (CH3)2CHC(CH3)(OO·)CH2CH3
1 record matched HO2 + C2H5C(CH3)=C(CH3)2 → CH3CH2C(·)(CH3)C(CH3)2OOH
1 record matched HO2 + C2H5C(CH3)=C(CH3)2 → (CH3)2C(·)C(CH3)(OOH)CH2CH3
2 records matched HO2 + NO2 → HO2NO2
1 record matched HO2 + NO2 → trans-HONO + O2
1 record matched HO2 + NO2 → O2(1Delta_g) + trans-HONO
3 records matched HO2 + NO → HOONO
4 records matched HO2 + NO → HNO3
4 records matched HO2 + NO → ·OH + NO2
1 record matched HO2 + HBr → H2O2 + Br·
1 record matched HO2 + HBr → HO2 + HBr
1 record matched HO2 + HI → HO2 + HI
1 record matched HO2 + HgBr → HOOBr + Hg
1 record matched HO2 + HgBr → BrHgH + O2
1 record matched HO2 + HgBr → BrHgOOH
1 record matched HO2 + O3 → ·OH + O2 + O2
1 record matched HO2 + O3 → Other Products + ·OH
1 record matched HO2 + O3 → HO3 + O2
2 records matched HO2 + HOCl → Products
1 record matched HO2 + H2O + SH → H2O + O2 + H2S
1 record matched HO2 + H2O + NO → HNO3 + H2O
1 record matched HO2 + H2O + NO → ·OH + H2O + NO2
1 record matched HO2 + H2O → ·OH + H2O2
1 record matched HO2 + H2O2 → ·OH + H2O + O2
1 record matched HO2 + H2O2 → Products
1 record matched HO2 + DCl → HCl + DO2
1 record matched HO2 + HF → HO2 + HF
1 record matched HO2 + HCl → HO2 + HCl
1 record matched HO2 + SO3 → O2 + HOSO2
1 record matched HO2 + SO3 → SO3···HO2 complex
1 record matched HO2 + SO2 → O2 + HSO2
2 records matched HO2 + SO2 → ·OH + SO3
1 record matched HO2 + SO2 → HOSO + O2
1 record matched HO2 + SO2 → HO2SO2 adduct
1 record matched HO2 + CH3S· → ·OH + CH3SO
1 record matched HO2 + CH3S· → CH2S + H2O2
1 record matched HO2 + CH3S· → CH3SH + O2
1 record matched HO2 + CH3S· → CH3S-OOH
1 record matched HO2 + C6H5CH2OO → Products
1 record matched HO2 + (CH3)2CHO2 → Products
8 records matched HO2 + ·OH → H2O + O2
1 record matched HO2 + ·OH → O2(1DELTA) + H2O
2 records matched HO2 + ·OH → HOOOH
1 record matched HO2 + HO2 → H2O + O3
9 records matched HO2 + HO2 → H2O2 + O2
1 record matched HO2 + HO2 → Products
2 records matched C2H5OO· + HO2 → CH3CH2OOH + O2
1 record matched C2H5OO· + HO2 → CH3CH2O· + ·OH + O2
1 record matched C2H5OO· + HO2 → CH3CHO + H2O + O2
1 record matched C2H5OO· + HO2 → C2H5OH + O3
1 record matched C2H5OO· + HO2 → Products
2 records matched C2H5OO· + C2H5OO· → CH3CHO + CH3CH2O· + HO2
4 records matched C2H5OO· → C2H4 + HO2
1 record matched C6H5CH2OOH → Benzyl + HO2
1 record matched CH3CH2OOH → ·C2H5 + HO2
1 record matched C2H3 + O2 → C2H2 + HO2
1 record matched C2H3 + HO2 → CH2=CHOOH
1 record matched C2H3 + HO2 → C2H4 + O2
3 records matched HCO + O2 → CO + HO2
4 records matched (·)CH2OH + O2 → CH2O + HO2
1 record matched (·)CH2OH + H2O2 → CH3OH + HO2
1 record matched (·)CH2OH + HO2 → HOCH2OOH
1 record matched (·)CH2OH + HO2 → HCOOH + H2O
1 record matched (·)CH2OH + HO2 → CH2O + H2O2
1 record matched (·)CH2OH + HO2 → O2(1DELTA) + CH3OH
1 record matched (·)CH2OH + HO2 → H2OO + CH2O
1 record matched (·)CH2OH + HO2 → (3)CH2O + H2O2
1 record matched HC(O)Cl + HO2 → CHCl(OH)OO·
1 record matched HOC(·)O + O2 → CO2 + HO2
1 record matched 4-Methylbenzyl + O2 → 1,4-Cyclohexadiene,3,6-bis(methylene)- + HO2
1 record matched 4-Methylbenzyl + HO2 → ·OH + Methoxy (4-methylphenyl)-
1 record matched 1-phenylethyl + O2 → Styrene + HO2
1 record matched CH3CH(·)OH + O2 → CH2=CHOH + HO2
2 records matched CH3CH(·)OH + O2 → CH3CHO + HO2
1 record matched ·CH3 + HO2 → CH3O· + ·OH
1 record matched ·CH3 + HO2 → O2(1DELTA) + CH4
3 records matched Benzyl + HO2 → ·OH + C6H5CH2O
3 records matched Benzyl + HO2 → C6H5CH2OOH
6 records matched CH3O· + O2 → CH2O + HO2
1 record matched CH3O· + HO2 → CH3OH + O2
1 record matched CH3O· + HO2 → CH2O + H2O2
1 record matched CH3O· + HO2 → H2OO + CH2O
1 record matched CH3O· + HO2 → CH3OOOH
1 record matched CH3O· + HO2 → (3)CH2O + H2O2
2 records matched 1-C3H7 + O2 → CH3CH=CH2 + HO2
1 record matched Cyclohexyldioxyl + HO2 → Cyclohexyl hydroperoxide + O2
1 record matched CH3O2· + CH2OO → CH2O + CH2O + HO2
6 records matched CH3O2· + HO2 → CH3OOH + O2
1 record matched CH3O2· + HO2 → CH3OH + O3
1 record matched CH3O2· + HO2 → Products
1 record matched Cyclopentadienyl + HO2 → 2,4-cyclopentadienoxy + ·OH
1 record matched ·C2H + HO2 → H2O + C2O
1 record matched ·C2H + HO2 → HCO + HCO
1 record matched ·C2H + HO2 → CO + CO + H2
1 record matched ·C2H + HO2 → C2H2 + O2
1 record matched ·C2H + HO2 → Products
1 record matched CH2=NH + O2 → HC=NH + HO2
1 record matched CH2=NH + HO2 → NH2CH2OO(·)
1 record matched CH2=NH + HO2 → H2O2 + H2C=N
7 records matched ·C2H5 + O2 → C2H4 + HO2
1 record matched ·C2H5 + HO2 → CH3CH2OOH
1 record matched ·C2H5 + HO2 → CH3CH2O· + ·OH
1 record matched ·C2H5 + HO2 → CH3CHO + H2O
1 record matched ·C2H5 + HO2 → C2H4 + H2O2
1 record matched ·C2H5 + HO2 → C2H6 + O2
1 record matched iso-C3H7 + O2 → CH3CH=CH2 + HO2
1 record matched ·CH2CH=CH2 + O2 → CH2=C=CH2 + HO2
2 records matched ·CH2CH=CH2 + HO2 → CH2=CHCH2OOH
1 record matched ·CH2CH=CH2 + HO2 → ·OH + CH2=CHCH2O
3 records matched ·CH2CH=CH2 + HO2 → CH3CH=CH2 + O2
1 record matched ·CH2CH=CH2 + HO2 → CH2=CHCHO + H2O
1 record matched Phenyl formate + HO2 → C6H5OC(=O)· + H2O2
1 record matched Phenyl formate + HO2 → 2-Formyloxy phenyl + H2O2
1 record matched Phenyl formate + HO2 → 3-Formyloxy phenyl + H2O2
1 record matched Phenyl formate + HO2 → 4-Formyloxy phenyl + H2O2
1 record matched HFCO + HO2 → CHF(OH)OO·
1 record matched H2 + O2 + O2 → HO2 + O2 + H·
1 record matched H2 + O2 + O2 → HO2 + HO2
5 records matched H2 + O2 → HO2 + H·
3 records matched H2 + HO2 → H2O2 + H·
1 record matched 2,5-Dimethyltetrahydrofuran + HO2 → Other Products + H2O2
1 record matched 2,5-Dimethyltetrahydrofuran + HO2 → tetrahydro-2,5-dimethyl-2-furanyl + H2O2
1 record matched 2,5-Dimethyltetrahydrofuran + HO2 → tetrahydro-2,5-dimethyl-3-furanyl + H2O2
1 record matched 2,5-Dimethyltetrahydrofuran + HO2 → tetrahydro-5-methyl-2-furanylmethyl + H2O2
1 record matched CH3CH=C(CH3)C2H5 + HO2 → C2H5CH(CH3)CH(CH3)O2
1 record matched CH3CH=C(CH3)C2H5 + HO2 → (C2H5)2C(CH3)OO·
1 record matched CH3CH=C(CH3)C2H5 + HO2 → CH3CH2C(·)(CH3)CH(CH3)OOH
1 record matched CH3CH=C(CH3)C2H5 + HO2 → CH3CH(·)C(CH3)(OOH)CH2CH3
1 record matched CH2S + HO2 → CH3SOO
1 record matched CH2S + HO2 → HOOCH2
1 record matched Methyl-2-pentenoate + HO2 → CH3CH2CH=CHC(O)OCH2· + H2O2
1 record matched Methyl-2-pentenoate + HO2 → CH3CH2CH=C(·)C(O)OCH3 + H2O2
1 record matched Methyl-2-pentenoate + HO2 → CH3CH2C(·)=CHC(O)OCH3 + H2O2
1 record matched Methyl-2-pentenoate + HO2 → CH3CH(·)CH=CHC(O)OCH3 + H2O2
1 record matched Methyl-2-pentenoate + HO2 → ·CH2CH2CH=CHC(O)OCH3 + H2O2
1 record matched Methyl-3-pentenoate + HO2 → CH3CH=CHCH2C(O)OCH2· + H2O2
1 record matched Methyl-3-pentenoate + HO2 → CH3CH=CHCH(·)C(O)OCH3 + H2O2
1 record matched Methyl-3-pentenoate + HO2 → CH3CH=C(·)CH2C(O)OCH3 + H2O2
1 record matched Methyl-3-pentenoate + HO2 → CH3C(·)=CHCH2C(O)OCH3 + H2O2
1 record matched Methyl-3-pentenoate + HO2 → ·CH2CH=CHCH2C(O)OCH3 + H2O2
1 record matched Methyl-4-pentenoate + HO2 → CH2=CHCH2CH2C(O)OCH2· + H2O2
1 record matched Methyl-4-pentenoate + HO2 → CH2=CHCH2CH(·)C(O)OCH3 + H2O2
1 record matched Methyl-4-pentenoate + HO2 → CH2=CHCH(·)CH2C(O)OCH3 + H2O2
1 record matched Methyl-4-pentenoate + HO2 → CH2=C(·)CH2CH2C(O)OCH3 + H2O2
1 record matched Methyl-4-pentenoate + HO2 → ·CH=CHCH2CH2C(O)OCH3 + H2O2
1 record matched C2H5CH2C(CH3)=CH2 + HO2 → CH3CH2CH2CH(CH3)CH2OO·
1 record matched C2H5CH2C(CH3)=CH2 + HO2 → CH3CH2CH2C(·)(CH3)COOH
1 record matched (C2H5)2C=CH2 + HO2 → (C2H5)2C(CH3)OO·
1 record matched (C2H5)2C=CH2 + HO2 → (C2H5)2C(OOH)CH2·
1 record matched 2-(E)-C5H10 + HO2 → (C2H5)2CHO2
1 record matched 2-(E)-C5H10 + HO2 → Other Products + ·OH
1 record matched 2-(E)-C5H10 + HO2 → CH3CH2CH(·)CH(CH3)OOH
1 record matched 2-(E)-C5H10 + HO2 → CH3CH(·)CH(OOH)CH2CH3
1 record matched 2-(E)-C5H10 + HO2 → CH3CH2CH2CH(OO·)CH3
5 records matched CO + HO2 → CO2 + ·OH
1 record matched 2-(Z)-C5H10 + HO2 → Other Products + ·OH
1 record matched (CH3)2C=CHC2H5 + HO2 → (CH3)2CHCH(OO·)CH2CH3
1 record matched (CH3)2C=CHC2H5 + HO2 → CH3CH2CH2C(CH3)2OO·
1 record matched (CH3)2C=CHC2H5 + HO2 → CH3CH2CH(·)C(CH3)2OOH
1 record matched (CH3)2C=CHC2H5 + HO2 → (CH3)2C(·)CH(OOH)CH2CH3
2 records matched (E)-2-C4H8 + HO2 → C2H5CH(CH3)O2
1 record matched (E)-2-C4H8 + HO2 → H2O2 + CH2=CHCH(·)CH3
1 record matched (E)-2-C4H8 + HO2 → Other Products + ·OH
2 records matched (E)-2-C4H8 + HO2 → CH3C(·)HCH(CH3)OOH
1 record matched Methyl pentanoate + HO2 → CH3CH2CH2CH2C(O)OCH2· + H2O2
1 record matched Methyl pentanoate + HO2 → CH3CH2CH2CH(·)C(O)OCH3 + H2O2
1 record matched Methyl pentanoate + HO2 → CH3CH2CH(·)CH2C(O)OCH3 + H2O2
1 record matched Methyl pentanoate + HO2 → CH3CH(·)CH2CH2C(O)OCH3 + H2O2
1 record matched Methyl pentanoate + HO2 → ·CH2CH2CH2CH2C(O)OCH3 + H2O2
1 record matched (CH3)3CC(CH3)3 + HO2 → H2O2 + (CH3)3CC(CH3)2CH2
1 record matched CH2=CHCH2CH=CH2 + O2 → Pentadienyl radical + HO2
1 record matched (Z)-2-C4H8 + HO2 → Other Products + ·OH
1 record matched (CH3)2C=C(CH3)2 + HO2 → (CH3)2CHC(OO)(CH3)2
1 record matched (CH3)2C=C(CH3)2 + HO2 → (CH3)2C(·)C(OOH)(CH3)2
1 record matched C2H5C(CH3)=CH2 + HO2 → (·)C(CH2OOH)(CH3)CH2CH3
1 record matched C2H5C(CH3)=CH2 + HO2 → ·OH + 2-ethyl-2-methyl-oxirane
1 record matched C2H5C(CH3)=CH2 + HO2 → CH3CH2CH(CH3)CH2OO·
1 record matched C2H5C(CH3)=CH2 + HO2 → CH3CH2C(CH3)(OOH)CH2·
1 record matched C2H5C(CH3)=CH2 + HO2 → (CH3)2C(OO·)CH2CH3
1 record matched (CH3)2CHCH=CH2 + O2 → CH2=CHC(·)(CH3)2 + HO2
1 record matched (CH3)2CHCH=CH2 + HO2 → (1-methylethyl)oxirane + ·OH
1 record matched (CH3)2CHCH=CH2 + HO2 → (CH3)2CHCH(CH3)OO·
1 record matched (CH3)2CHCH=CH2 + HO2 → (CH3)2CHCH2CH2OO·
1 record matched (CH3)2CHCH=CH2 + HO2 → (CH3)2CHCH(OOH)CH2·
1 record matched (CH3)2CHCH=CH2 + HO2 → (CH3)2CHCH(·)CH2OOH
1 record matched CH2=CHOH + HO2 → CH2=CHO· + H2O2
1 record matched CH2=CHOH + HO2 → CH3CH(·)OH + O2
1 record matched CH2=CHOH + HO2 → CH3CHO + HO2
2 records matched CH2=CHOH + HO2 → ·CH2CH(OOH)OH
1 record matched CH2=CHOH + HO2 → HOOCH2CH(·)OH
2 records matched CH2=CHOH + HO2 → CH3CH(OH)O2
1 record matched C2H5C(O)OCH3 + HO2 → CH3CH(·)C(O)OCH3 + H2O2
1 record matched C2H5C(O)OCH3 + HO2 → CH3CH2C(O)OCH2· + H2O2
1 record matched C2H5C(O)OCH3 + HO2 → CH3OC(O)CH2CH2· + H2O2
1 record matched 1,3-dichloropropene + O2 → CHCl=CHCHCl· + HO2
1 record matched 2-Methylfuran + O2 → furan-2-yl methyl radical + HO2
1 record matched (CH3)2C=CHCH3 + HO2 → ·OH + 2,2,3-trimethyl-oxirane
1 record matched (CH3)2C=CHCH3 + HO2 → Other Products + ·OH
1 record matched (CH3)2C=CHCH3 + HO2 → CH3C(·)HC(CH3)2OOH
1 record matched (CH3)2C=CHCH3 + HO2 → (CH3)2CHCH(CH3)OO·
1 record matched (CH3)2C=CHCH3 + HO2 → (CH3)2C(·)CH(CH3)OOH
1 record matched (CH3)2C=CHCH3 + HO2 → (CH3)2C(OO·)CH2CH3
2 records matched CH3COBr + HO2 → CH3C(OO·)(OH)Br
1 record matched 3,4-Epoxytetrahydrofuran + HO2 → 3,4-Epoxytetrahydrofuran-2-yl + H2O2
1 record matched 3,4-Epoxytetrahydrofuran + HO2 → 3,4-Epoxytetrahydrofuran-3-yl + H2O2
1 record matched HOCH2CHO + HO2 → Products
1 record matched (CH3)2NH + HO2 → H2O2 + CH2NHCH3
1 record matched (CH3)2NH + HO2 → H2O2 + (CH3)2N
1 record matched (CH3)2NH + HO2 → Other Products + H2O2
1 record matched CO2 + HO2 + HO2 → CO2 + H2O2 + O2
1 record matched CH3CH2CH2CHO + HO2 → Other Products + H2O2
2 records matched 3-methyl-1-butanol + HO2 → (CH3)2CHCH2CH(OH)· + H2O2
2 records matched 3-methyl-1-butanol + HO2 → (CH3)2CHCH(·)CH2OH + H2O2
1 record matched 3-methyl-1-butanol + HO2 → (CH3)2C(·)CH2CH2OH + H2O2
3 records matched 3-methyl-1-butanol + HO2 → ·CH2CH(CH3)CH2CH2OH + H2O2
1 record matched 3-methyl-1-butanol + HO2 → CH3CH(CH3)CH2CH2O(·) + H2O2
1 record matched C2H5CHO + HO2 → H2O2 + CH3C(·)HCHO
1 record matched C2H5CHO + HO2 → H2O2 + CH3CH2CO
1 record matched Cyclopentanone + HO2 → 2-oxocyclopentyl + H2O2
1 record matched Cyclopentanone + HO2 → 3-oxocyclopentyl + H2O2
2 records matched iso-C4H8 + O2 → HO2 + ·CH2C(CH3)=CH2
1 record matched iso-C4H8 + HO2 → (CH3)2CHCH2O2
1 record matched iso-C4H8 + HO2 → H2O2 + ·CH2C(CH3)=CH2
3 records matched iso-C4H8 + HO2 → (CH3)3CO2
4 records matched iso-C4H8 + HO2 → (·)CH2C(CH3)2OOH
1 record matched iso-C4H8 + HO2 → (CH3)2C=CH· + H2O2
2 records matched iso-C4H8 + HO2 → (CH3)2C(·)CH2OOH
1 record matched (CH3)2O + O2 → HO2 + CH3OCH2·
1 record matched CH3CH=CH2 + O2 → ·CH2CH=CH2 + HO2
2 records matched CH3CH=CH2 + HO2 → (CH3)2CHO2
1 record matched CH3CH=CH2 + HO2 → ·CH2CH=CH2 + H2O2
2 records matched CH3CH=CH2 + HO2 → Methyloxirane + ·OH
1 record matched CH3CH=CH2 + HO2 → CH3CH2CH2OO·
1 record matched CH3CH=CH2 + HO2 → (CH3)2C(·)OOH
2 records matched CH3CH=CH2 + HO2 → CH3CH(·)CH2OOH
2 records matched CH3CH=CH2 + HO2 → ·CH2CH(OOH)CH3
1 record matched Cyclohexene + HO2 → H2O2 + 3-Cyclohexenyl
1 record matched Cyclohexene + HO2 → Cyclohexyldioxyl
1 record matched Cyclohexene + HO2 → 2-hydroperoxycyclohexyl radical
1 record matched HC(O)OC2H5 + HO2 → H2O2 + CH3CH2OC(O)·
1 record matched HC(O)OC2H5 + HO2 → CH3CH(·)OC(O)H + H2O2
1 record matched HC(O)OC2H5 + HO2 → ·CH2CH2OC(O)H + H2O2
1 record matched 1-C5H10 + O2 → HO2 + CH2=CHCH2CH(·)CH3
1 record matched 1-C5H10 + HO2 → CH3(CH2)3CH2OO·
1 record matched 1-C5H10 + HO2 → CH3CH2CH2CH(OOH)CH2·
1 record matched 1-C5H10 + HO2 → CH3CH2CH2CH(·)CH2OOH
1 record matched 1-C5H10 + HO2 → CH3CH2CH2CH(OO·)CH3
2 records matched Phenol + HO2 → C6H5O + H2O2
1 record matched Phenol + HO2 → 5-hydroxy-4-hydroperoxy-2,5-cyclohexadienyl
1 record matched Phenol + HO2 → 4-hydroxy-4-hydroperoxy-2,5-cyclohexadienyl
1 record matched Phenol + HO2 → 3-hydroxy-6-hydroperoxy-1,3-cyclohexadienyl
1 record matched Phenol + HO2 → 2-hydroxy-4-hydroperoxy-2,5-cyclohexadienyl
3 records matched Toluene + O2 → Benzyl + HO2
1 record matched Toluene + O2 → C6H4CH3 + HO2
1 record matched Toluene + HO2 → H2O2 + 2-methylphenyl
1 record matched Toluene + HO2 → 3-methylphenyl + H2O2
1 record matched Toluene + HO2 → 4-methylphenyl + H2O2
4 records matched Toluene + HO2 → Benzyl + H2O2
1 record matched Toluene + HO2 → C6H4CH3 + H2O2
1 record matched 1,3,5-Trimethylbenzene + HO2 → H2O2 + 3,5-dimethylbenzyl radical
1 record matched HC(O)OCH3 + HO2 → H2O2 + CH3OC(·)(O)
1 record matched HC(O)OCH3 + HO2 → HC(O)OCH2(·) + H2O2
1 record matched (CHO)2 + HO2 → HCOOH + CO + ·OH
1 record matched (CHO)2 + HO2 → Products
2 records matched (CHO)2 + HO2 → HC(O)CHO· · ·HO2 complex
1 record matched (CHO)2 + HO2 → HC(OH)(OO·)CHO
1 record matched CH3CH=CHCH3 + O2 → HO2 + (E)-CH3CH=CHCH2
1 record matched CH3CH=CHCH3 + HO2 → Adduct
1 record matched 1-C4H8 + O2 → HO2 + CH2=CHCH(·)CH3
1 record matched 1-C4H8 + HO2 → CH3CH2CH2CH2OO·
2 records matched 1-C4H8 + HO2 → C2H5CH(CH3)O2
1 record matched 1-C4H8 + HO2 → H2O2 + CH2=CHCH(·)CH3
1 record matched 1-C4H8 + HO2 → Other Products + ·OH
1 record matched 1-C4H8 + HO2 → CH3CH2CH(·)CH2OOH
2 records matched 1-C4H8 + HO2 → CH3CH2CH(OOH)CH2·
1 record matched 1-C4H10 + HO2 → 1-C4H9 + H2O2
1 record matched Benzeneacetic acid + O2 → C6H5CH2C(O)O· + HO2
1 record matched 1-Phenylpropane + O2 → CH3CH(·)CH2C6H5 + HO2
1 record matched Ethylbenzene + O2 → HO2 + 2-phenylethyl
1 record matched Ethylbenzene + O2 → 1-phenylethyl + HO2
1 record matched Ethylbenzene + HO2 → H2O2 + 2-phenylethyl
1 record matched Ethylbenzene + HO2 → 1-phenylethyl + H2O2
1 record matched Ethylbenzene + HO2 → 2-ethylphenyl + H2O2
1 record matched Ethylbenzene + HO2 → ortho-(HO2)C6H5CH2CH3
1 record matched Ethylbenzene + HO2 → ipso-(HO2)C6H5CH2CH3
1 record matched Ethylbenzene + HO2 → meta-(HO2)C6H5CH2CH3
1 record matched Ethylbenzene + HO2 → para-(HO2)C6H5CH2CH3
1 record matched 2-Phenylpropane + O2 → HO2 + 2-Phenyl-2-propyl radical
1 record matched 2-methyltetrahydrofuran + HO2 → Other Products + H2O2
1 record matched 2-methyltetrahydrofuran + HO2 → (2-tetrahydrofuran)-methyl + H2O2
1 record matched 2-methyltetrahydrofuran + HO2 → 2-methyl-tetrahydrofuran-2-yl + H2O2
1 record matched 2-methyltetrahydrofuran + HO2 → 2-methyl-tetrahydrofuran-3-yl + H2O2
1 record matched 2-methyltetrahydrofuran + HO2 → 2-methyl-tetrahydrofuran-4-yl + H2O2
1 record matched 2-methyltetrahydrofuran + HO2 → 2-methyl-tetrahydrofuran-5-yl + H2O2
1 record matched Methylcyclopentane + HO2 → ·CH2-cyc-C5H9 + H2O2
1 record matched Methylcyclopentane + HO2 → 2-methyl-cyclopentyl + H2O2
1 record matched Methylcyclopentane + HO2 → 1-methyl-cyclopentyl + H2O2
1 record matched 1,2,4-Trimethylbenzene + O2 → HO2 + 3,4-dimethylphenyl-methyl
2 records matched (COCl)2 + HO2 → ClC(O)C(OO·)(OH)Cl
1 record matched (CH3)2CHCH(CH3)2 + HO2 → H2O2 + (CH3)2CHC(·)(CH3)2
2 records matched CH3C(O)OCH3 + HO2 → H2O2 + ·CH2C(O)OCH3
2 records matched CH3C(O)OCH3 + HO2 → CH3C(O)OCH2· + H2O2
2 records matched CH3C(O)CHO + HO2 → Products
1 record matched CH2=CHCOCH3 + HO2 → Products
1 record matched CH2=CHCOCH3 + HO2 → CH2=CHC(CH3)(OH)OO·
1 record matched sec-C4H9OH + HO2 → 2-C4H9O + H2O2
1 record matched sec-C4H9OH + HO2 → Other Products + H2O2
2 records matched sec-C4H9OH + HO2 → CH3CH2CH(OH)CH2· + H2O2
2 records matched sec-C4H9OH + HO2 → CH3CH(OH)CH2CH2· + H2O2
2 records matched sec-C4H9OH + HO2 → CH3CH2C(·)(OH)CH3 + H2O2
2 records matched sec-C4H9OH + HO2 → CH3CH(·)CH(OH)CH3 + H2O2
1 record matched Methacrolein + HO2 → CH2=C(CH3)CO + H2O2
1 record matched Methacrolein + HO2 → CH2=C(CH3)CH(OH)OO·
1 record matched (CH3)2CHCHO + HO2 → H2O2 + (CH3)2CHC=O
1 record matched iso-C4H9OH + HO2 → H2O2 + (CH3)2CHCH2
1 record matched iso-C4H9OH + HO2 → (CH3)2C(·)CH2OH + H2O2
1 record matched iso-C4H9OH + HO2 → ·CH2CH(CH3)CH2OH + H2O2
1 record matched tert-C4H9OH + HO2 → (CH3)2C(OH)CH2· + H2O2
1 record matched tert-C4H9OH + HO2 → (CH3)3CO· + H2O2
1 record matched tert-C4H9OH + HO2 → ·CH2C(CH3)2OH + H2O2
1 record matched (CH3)3N + HO2 → Other Products + H2O2
2 records matched CH3COCl + HO2 → CH3C(OO·)(OH)Cl
1 record matched iso-C4H10 + HO2 → iso-C4H9 + H2O2
1 record matched iso-C4H10 + HO2 → tert-C4H9 + H2O2
2 records matched CH3CHO + HO2 → CH2=CHO· + H2O2
4 records matched CH3CHO + HO2 → CH3CO + H2O2
2 records matched CH3CHO + HO2 → CH3CH(·)OH + O2
1 record matched CH3CHO + HO2 → CH3C(O)OH + ·OH
1 record matched CH3CHO + HO2 → CH3CH(O·)OOH
1 record matched CH3CHO + HO2 → [CH3CHO…HO2] complex
1 record matched CH3CHO + HO2 → CH3CH(OH)O2
1 record matched C3H8 + HO2 → 1-C3H7 + H2O2
1 record matched C3H8 + HO2 → iso-C3H7 + H2O2
1 record matched CH3SH + ·OH → HO2 + CH3SOH
1 record matched CH3NH2 + HO2 → Other Products + H2O2
1 record matched C2H2 + HO2 → Products
1 record matched C2H4 + O2 → C2H3 + HO2
2 records matched C2H4 + HO2 → C2H5OO·
1 record matched C2H4 + HO2 → Oxirane + ·OH
4 records matched C2H4 + HO2 → (·)CH2CH2OOH
2 records matched C2H6 + O2 → ·C2H5 + HO2
5 records matched C2H6 + HO2 → ·C2H5 + H2O2
5 records matched CH4 + O2 → ·CH3 + HO2
1 record matched Benzene + O2 → Phenyl + HO2
1 record matched n-C5H11OH + O2 → Products + HO2
1 record matched n-C4H9OH + O2 → Products + HO2
3 records matched n-C4H9OH + HO2 → H2O2 + CH3CH2CH2C(·)HOH
2 records matched n-C4H9OH + HO2 → H2O2 + CH3CH2CH2CH2
1 record matched n-C4H9OH + HO2 → HOCH2CH2CH2CH2 + H2O2
1 record matched n-C4H9OH + HO2 → Other Products + H2O2
2 records matched n-C4H9OH + HO2 → CH3CH2CH(·)CH2OH + H2O2
3 records matched n-C4H9OH + HO2 → CH3CH(·)CH2CH2OH + H2O2
1 record matched n-C4H9OH + HO2 → (·)CH2CH2CH2CH2OH + H2O2
1 record matched n-C3H7OH + O2 → Products + HO2
1 record matched Acetone + HO2 → CH3C(O)CH2(·) + H2O2
2 records matched Acetone + HO2 → (CH3)2C(OH)OO
1 record matched CH3OH + O2 → (·)CH2OH + HO2
1 record matched CH3OH + O2 → Products + HO2
4 records matched CH3OH + HO2 → (·)CH2OH + H2O2
3 records matched CH3OH + HO2 → CH3O· + H2O2
1 record matched Naphthalene-1-carboxyaldehyde + O2 → C10H7C(O)· + HO2
1 record matched Naphthalene-1-carboxyaldehyde + HO2 → C10H7C(O)· + H2O2
1 record matched C2H5OH + O2 → Products + HO2
1 record matched (C2H5)2O + HO2 → C2H5OCH2CH2· + H2O2
1 record matched (C2H5)2O + HO2 → CH3CH(·)OCH2CH3 + H2O2
1 record matched CH2O + O2 → HCO + HO2
1 record matched CH2O + H2O → ·CH3 + HO2
5 records matched CH2O + HO2 → HCO + H2O2
1 record matched CH2O + HO2 → Products
1 record matched CH2O + CO2 + HO2 → CO2 + HCO + H2O2
1 record matched O2(1DELTA) + H2O → HO2 + ·OH
1 record matched O2(1DELTA) + H2 → HO2 + H·
1 record matched O2(1DELTA) + CH4 → ·CH3 + HO2
1 record matched CH3CF2OO· + HO2 → COF2 + ·CH3 + ·OH + O2
1 record matched CH3CF2OO· + HO2 → CH3OH + COF2 + O2
1 record matched CH3CF2OO· + HO2 → CH3CF2OOH + O2
2 records matched CH2BrO + O2 → HO2 + HC(O)Br
1 record matched (·)CH2C(CH3)2OOH → iso-C4H8 + HO2
1 record matched CH2DO + O2 → CD2O + HO2
1 record matched BrCH2CH2O(.) + O2 → HO2 + Acetaldehyde, bromo-
3 records matched HO2-H2O Complex + SO3 → HO2 + H2SO4
1 record matched HO2-H2O Complex + HO2 → H2O + H2O + O3
1 record matched HO2-H2O Complex + HO2 → H2O2 + H2O + O2
1 record matched 1-methyl-2-hydroxy-3,5-cyclohexadienyl + O2 → 2-Methylphenol + HO2
1 record matched 1-methyl-4-hydroxy-1,5-cyclohexadienyl + O2 → 4-Methylphenol + HO2
1 record matched OH(v=4) + O3 → HO2 + O2
1 record matched OH(v=4) + O3 → HO2 + ·OH + O2 + H· + O·
1 record matched OH(v=2) + O3 → HO2 + O2
1 record matched OH(v=2) + O3 → HO2 + ·OH + O2 + H· + O·
1 record matched OH(v=1) + O3 → HO2 + O2
1 record matched OH(v=1) + O3 → HO2 + ·OH + O2 + H· + O·
1 record matched CH3CH2CH(O)CH2OCH3 + O2 → CH3CH2C(O)CH2OCH3 + HO2
1 record matched CH3CH2CH2CH(O)OCH3 + O2 → CH3CH2CH2C(O)OCH3 + HO2
1 record matched HOCH2CH(O)OCH(CH3)2 + O2 → HOCH2C(O)CH(CH3)2 + HO2
1 record matched HOSO + O2 → HO2 + SO2
2 records matched M + HO2-HNO3 → HO2 + HNO3
1 record matched OCH2OCH2CH2CH2CH3 + O2 → OCHOCH2CH2CH2CH3 + HO2
1 record matched -10261 + HO2 → Products
1 record matched -10295 + HO2 → Products
1 record matched O(3P) + H2O2 → HO2 + ·OH
1 record matched O(3P) + HO2 → ·OH + O2
2 records matched O2(1Delta_g) + H· → HO2
1 record matched O2(1Delta_g) + H2O → HO2 + ·OH
1 record matched O2(1Delta_g) + ·C2H5 → C2H4 + HO2
3 records matched O2(1Delta_g) + H2 → HO2 + H·
3 records matched (CH3)2C(OH)OO → Acetone + HO2
1 record matched CH3CH2CH2OO· + HO2 → Propylhydroperoxide + O2
1 record matched CH3CH2CH2OO· → C2H5CHO + HO2
5 records matched CH3CH2CH2OO· → CH3CH=CH2 + HO2
1 record matched CH3CH2CH2OO· → Cyclopropane + HO2
1 record matched CHBr2OO(·) + HO2 → Products
2 records matched CHBr2OO(·) + HO2 → CHBr2O(.) + ·OH + O2
1 record matched CBr3OO(·) + HO2 → Products
2 records matched CBr3OO(·) + HO2 → CBr3O(·) + ·OH + O2
1 record matched CH3CH(ONO2)CH2O2(·) + HO2 → Products
1 record matched CH3CH(OO·)CH2ONO2 + HO2 → Products
1 record matched (CH3)2C(ONO2)C(OO·)(CH3)2 + HO2 → Products
1 record matched CCl2OHCCl2OO + HO2 → Products
1 record matched CCl3CCl2OO + HO2 → Products
1 record matched CCl2(ONO2)CCl2OO + HO2 → Products
1 record matched CH2OHCH2OO + HO2 → Products
1 record matched CH2ClCH2OO + HO2 → Products
1 record matched CH2(ONO2)CH2OO + HO2 → Products
1 record matched CH2OHCH(OO)OO + HO2 → Products
1 record matched CH2ClCH(OO)OO + HO2 → Products
1 record matched CH2(ONO2)CH(OO)OO + HO2 → Products
1 record matched CH2OHCH2CH(OO)CHCH2 + HO2 → Products
1 record matched CH2ClCH2CH(OO)CHCH2 + HO2 → Products
1 record matched CH2(ONO2)CH2CH(OO)CHCH2 + HO2 → Products
1 record matched CH2OHCH2CHCHCH2CH2OO + HO2 → Products
1 record matched CH2ClCH2CHCHCH2CH2OO + HO2 → Products
1 record matched CH2(ONO2)CH2CHCHCH2CH2OO + HO2 → Products
1 record matched C(CH3)(CH2OH)2C(CH3)(OO)C(CH3)C(CH3)2 + HO2 → Products
1 record matched C(CH3)(CH2Cl)2C(CH3)(OO)C(CH3)C(CH3)2 + HO2 → Products
1 record matched C(CH3)(CH2(ONO2))2C(CH3)(OO)C(CH3)C(CH3)2 + HO2 → Products
1 record matched C(OH)(CH3)2C(CH3)C(CH3)C(CH3)2OO + HO2 → Products
1 record matched CCl(CH3)2C(CH3)C(CH3)C(CH3)2OO + HO2 → Products
1 record matched C(ONO2)(CH3)2C(CH3)C(CH3)C(CH3)2OO + HO2 → Products
1 record matched CH2OHCH(OO·)C(O)CH3 + HO2 → Products
1 record matched CH2OHCH(OO·)C(O)CH3 → 4-Hydroxy-3-buten-2-one + HO2
1 record matched CH2ClCH(OO)C(O)CH3 + HO2 → Products
1 record matched CH2(ONO2)CH(OO)C(O)CH3 + HO2 → Products
1 record matched C(OH)(CH3)2C(CH3)(OO)C(O)CH3 + HO2 → Products
1 record matched CCl(CH3)2C(CH3)(OO)C(O)CH3 + HO2 → Products
1 record matched C(ONO2)(CH3)2C(CH3)(OO)C(O)CH3 + HO2 → Products
1 record matched CCl2(OH)CCl(OO)CClCCl2 + HO2 → Products
1 record matched CCl3CCl(OO)CClCCl2 + HO2 → Products
1 record matched CCl2(ONO2)CCl(OO)CClCCl2 + HO2 → Products
1 record matched CCl2(OH)CClCClCCl2OO + HO2 → Products
1 record matched CCl3CClCClCCl2OO + HO2 → Products
1 record matched CCl2(ONO2)CClCClCCl2OO + HO2 → Products
1 record matched HOCO + O· → CO + HO2
1 record matched CH3CH(·)CH2CH2OH + H2O2 → n-C4H9OH + HO2
2 records matched (·)CH2CH2OOH → C2H4 + HO2
1 record matched HOOCH2CH2OO· → HO2 + CH2=CHOOH
1 record matched HOOCH2CH2OO· → H2C=CHOOH + HO2
1 record matched syn-CH3SOO → CH2S + HO2
1 record matched C(·)H2SOOH → CH2S + HO2
1 record matched ·OCH2C(O)OH + O2 → OCHCOOH + HO2
1 record matched (CH3)CH(OO·)COCH3 → CH2=CHCOCH3 + HO2
1 record matched CH3CH2CH(·)CH2OOH → 1-C4H8 + HO2
1 record matched CH2BrCHBrO· + O2 → CH2BrC(O)Br + HO2
1 record matched CHBrO(·)CHO + O2 → CBr(O)CH(O) + HO2
1 record matched CH3CH(O·)OOH → CH3CHO + HO2
1 record matched [CH3CHO…HO2] complex → CH3CHO + HO2
1 record matched ·CH2CH(OOH)OH → CH2=CHOH + HO2
1 record matched CH3S(O)(OH)CH3 + O2 → (CH3)2SO2 + HO2
1 record matched CH3S(O)(OH)CH3 + HO2 → (CH3)2SO2 + H2O2
1 record matched (2-methylenehydroperoxyphenyl) methyl → HO2 + Methyl, 1,2-phenylenebis-
1 record matched (2-methylenehydroperoxyphenyl) methyl → Benzocyclobutene + HO2
2 records matched HOS(O)(O)OO· → HO2 + SO3
1 record matched CH2=CHCH2CH2OO· → 1,3-Butadiene + HO2
1 record matched CH3CH2CH2CH2C(·)HCH2OOH → 1-C6H12 + HO2
1 record matched CH3C(·)HCH(CH3)OOH → (E)-2-C4H8 + HO2
1 record matched CH3C(·)HCH(CH3)OOH → (Z)-2-C4H8 + HO2
2 records matched CH3C(·)HC(CH3)2OOH → (CH3)2C=CHCH3 + HO2
1 record matched (CH3)2C(·)CH(CH3)OOH → (CH3)2C=CHCH3 + HO2
1 record matched ·CH2CH(CH3)CH2OOH → CH3CH=CH2 + HO2
2 records matched (CH3)2CHCH2CH2OO· → (CH3)2CHCH=CH2 + HO2
1 record matched HOOCH(CH3)CH(CH3)OO· → CH2=CHCH(CH3)OOH + HO2
1 record matched HOOCH(CH3)CH(CH3)OO· → CH3CH=C(CH3)OOH + HO2
1 record matched HOOCH2CH2CH2OO· → HO2 + CH2=CHCH2OOH
1 record matched HOOCH2CH2CH(CH3)OO· → CH3CH=CHCH2OOH + HO2
1 record matched HOOCH2CH2CH(CH3)OO· → HOOCH2CH2CH=CH2 + HO2
1 record matched HOOCH(CH3)CH2CH2OO· → CH2=CHCH(CH3)OOH + HO2
2 records matched HOOCH2CH2CH2CH2OO· → HOOCH2CH2CH=CH2 + HO2
1 record matched CH3C(OOH)HCH2C(OO·)HCH3 → CH3C(OOH)HCH=CHCH3 + HO2
1 record matched (CH3)2CHCH(CH3)OO· → (CH3)2CHCH=CH2 + HO2
1 record matched (CH3)2CHCH(CH3)OO· → (CH3)2C=CHCH3 + HO2
2 records matched CH3CH2CH(CH3)CH2OO· → C2H5C(CH3)=CH2 + HO2
1 record matched (CH3)2CHCH(OO·)CH2CH3 → (CH3)2C=CHC2H5 + HO2
1 record matched CH3CH2CH(OOH)CH2· → 1-C4H8 + HO2
1 record matched 2,5-cyclohexadienyl, 2-methyl,3,4-dihydroxy + O2 → 1,2-Dihydroxy-3-methylbenzene + HO2
1 record matched CH3CH2CH2CH(OOH)CH2· → 1-C5H10 + HO2
1 record matched CH3CH2C(CH3)(OOH)CH2· → C2H5C(CH3)=CH2 + HO2
2 records matched (CH3)2CHCH(OOH)CH2· → (CH3)2CHCH=CH2 + HO2
1 record matched CH3CH2CH(·)CH(CH3)OOH → HO2 + (Z)-2-C6H12
1 record matched CH3CH2CH(·)CH(CH3)OOH → HO2 + (E)-2-C6H12
1 record matched CH3CH(·)CH(OOH)CH2CH3 → HO2 + (Z)-2-C6H12
1 record matched CH3CH(·)CH(OOH)CH2CH3 → HO2 + (E)-2-C6H12
2 records matched (CH3)2CHCH(·)CH2OOH → (CH3)2CHCH=CH2 + HO2
1 record matched ·CH2CH2CH(OOH)CH2CH3 → C2H5C(CH3)=CH2 + HO2
1 record matched (CH3)2C(·)CH2CH(CH3)OOH → (CH3)2C=CHC2H5 + HO2
1 record matched CH3CH=CHCH2CH2OO· → (Z)-CH2=CHCH=CHCH3 + HO2
1 record matched CH3CH2CH=CHCH2OO· → CH2=C=CHCH2CH3 + HO2
1 record matched HC(O)CHO· · ·HO2 complex → (CHO)2 + HO2
1 record matched HC(OH)(OO·)CHO → (CHO)2 + HO2
1 record matched HC(O)CH(OH)CH=CH2 + HO2 → Products
1 record matched CH3CH2C(·)(CH3)CH2OOH → C2H5C(CH3)=CH2 + HO2
1 record matched CH3CH2CH2CH2CH(OOH)CH2· → 1-C6H12 + HO2
1 record matched CH3CH2CH2CH(OOH)C(·)HCH3 → HO2 + (Z)-2-C6H12
1 record matched CH3CH2CH2CH(OOH)C(·)HCH3 → HO2 + (E)-2-C6H12
1 record matched CH3CH2CH2C(·)HCH(CH3)OOH → HO2 + (Z)-2-C6H12
1 record matched CH3CH2CH2C(·)HCH(CH3)OOH → HO2 + (E)-2-C6H12
1 record matched CH3C(O)CH2CH2OO· → CH2=CHCOCH3 + HO2
1 record matched ·CH2NHNO2 + O2 → HO2 + H2C=NNO2
1 record matched (CH3)3CCH2C(OO·)(CH3)2 → (CH3)3CCH=C(CH3)2 + HO2
1 record matched (CH3)3CCH2C(OO·)(CH3)2 → (tert-C4H9)CH2C(CH3)=CH2 + HO2
1 record matched (CH3)3CCH2C(OO·)(CH3)2 → Other Products + HO2
1 record matched (CH3)3CC(·)HC(OOH)(CH3)2 → (CH3)3CCH=C(CH3)2 + HO2
1 record matched (CH3)3CCH2C(OOH)(CH3)CH2· → (tert-C4H9)CH2C(CH3)=CH2 + HO2
1 record matched (CF3)2CHOCHFO· + O2 → (CF3)2CHOCFO + HO2
1 record matched NH2CH(·)CH2OH + O2 → NH=CHCH2OH + HO2
1 record matched 4-OH-methyl salicylate adduct + O2 → Methyl 2,4-dihydroxybenzoate + HO2
1 record matched (CH3)2C(OH)CH(OO·)CH2OH → HO2 + 2-(2-Oxiranyl)-2-propanol
1 record matched (CH3)2C(OH)CH(OO·)CH2OH → HO2 + (3,3-Dimethyloxiranyl)methanol
1 record matched 1-phenylethyl peroxy radical → Styrene + HO2
1 record matched 2-phenylethyl peroxy radical → Styrene + HO2
1 record matched 2-hydroperoxy-2-phenylethyl → Styrene + HO2
1 record matched C6H5CH(·)CH2OOH → Styrene + HO2
1 record matched 2-Methyl-3-furanol + HO2 → trans-2-methyl-3-hydroxy-2,3-dihydro-furan-2-ylperoxy
1 record matched 2-methylene-3-furanol + HO2 → cis-2-methyl-3-hydroxy-2,3-dihydro-furan-2-ylperoxy
1 record matched 2-methylene-3-furanol + HO2 → trans-2-methyl-3-hydroxy-2,3-dihydro-furan-2-ylperoxy
1 record matched 2-Methyl-4-furanol + HO2 → trans-2-methyl-4-hydroxy-4,5-dihydro-furan-5-ylperoxy
1 record matched 2-methylene-5-furanol + HO2 → cis-5-hydroxy-2-methyl-2,5-dihydro-furan-2-ylperoxy
1 record matched 2-methylene-5-furanol + HO2 → trans-5-hydroxy-2-methyl-2,5-dihydro-furan-2-ylperoxy
1 record matched cis-2-hydroxy-2-methyl-2,5-dihydro-furan-5-ylperoxy → HO2 + cis-4-Oxo-2-pentenal
1 record matched cis-2-methyl-3-hydroxy-2,3-dihydro-furan-2-ylperoxy → 2-methylene-3-furanol + HO2
1 record matched trans-2-methyl-3-hydroxy-2,3-dihydro-furan-2-ylperoxy → 2-Methyl-3-furanol + HO2
1 record matched trans-2-methyl-3-hydroxy-2,3-dihydro-furan-2-ylperoxy → 2-methylene-3-furanol + HO2
1 record matched trans-2-methyl-4-hydroxy-4,5-dihydro-furan-5-ylperoxy → 2-Methyl-4-furanol + HO2
1 record matched cis-5-hydroxy-2-methyl-2,5-dihydro-furan-2-ylperoxy → HO2 + cis-4-Oxo-2-pentenal
1 record matched cis-5-hydroxy-2-methyl-2,5-dihydro-furan-2-ylperoxy → 2-methylene-5-furanol + HO2
1 record matched trans-5-hydroxy-2-methyl-2,5-dihydro-furan-2-ylperoxy → 2-methylene-5-furanol + HO2
1 record matched trans-5-hydroxy-2-methyl-4,5-dihydro-furan-4-ylperoxy → HO2 + 5-Methyl-2-furanol
1 record matched 1-naphthylperoxy + HO2 → 1-naphthylperoxide + O2
1 record matched 1-Oxa-4-thiacyclohex-2-yl peroxy radical + HO2 → 2-hydroperoxy-1,4-thioxane + O2
1 record matched 1-hydroxy,2-hydro-2-naphthalenyl + O2 → 1-Naphthalenol + HO2
1 record matched 1-hydroxy,2-hydro-2-naphthalenyl + HO2 → 2-Hydroperoxy-1,2-dihydronaphthalene-1-ol + O2
2 records matched ·OCH2N(CH3)NO + O2 → HO2 + N-Methyl-N-nitrosoformamide
1 record matched O2(3Delta_u) + H2 → HO2 + H·
1 record matched HOOCH2C(O)CH(CH3)OO· → HOOCH2C(O)CH=CH2 + HO2
1 record matched ·OOCH2CH2C(O)CH2OOH → HOOCH2C(O)CH=CH2 + HO2
1 record matched 1-methyl-3-hydroxy-1,5-cyclohexadienyl + O2 → 3-Methylphenol + HO2
1 record matched (CH3)3CCH(OO·)CH(CH3)2 → Other Products + HO2
1 record matched HOOCH2CH(C2H5)OO· → CH3CH=CHCH2OOH + HO2
1 record matched HOOCH2CH(C2H5)OO· → HOOCH=CHCH2CH3 + HO2
1 record matched HOOCH(C2H5)CH2OO· → CH3CH2C(OOH)=CH2 + HO2
1 record matched HOOCH2C(CH3)2OO· → (CH3)2C=CHOOH + HO2
1 record matched SO3···HO2 complex → HO2 + SO3
1 record matched 2,3-Epoxytetrahydrofuran + HO2 → 2,3-Epoxytetrahydrofuran-2-yl + H2O2
1 record matched 2,3-Epoxytetrahydrofuran + HO2 → 2,3-Epoxytetrahydrofuran-3-yl + H2O2
1 record matched 2,3-Epoxytetrahydrofuran + HO2 → 2,3-Epoxytetrahydrofuran-4-yl + H2O2
1 record matched 2,3-Epoxytetrahydrofuran + HO2 → 2,3-Epoxytetrahydrofuran-5-yl + H2O2
1 record matched 2-hydroxycyclohexyldioxyl → Cyclohexanone + HO2
1 record matched cyclo-C6H10(OH)OO → Cyclohexanone + HO2
2 records matched CH3CH(·)CH2OOH → CH3CH=CH2 + HO2
1 record matched (CH3)2C(·)CH2OOH → iso-C4H8 + HO2
1 record matched (·)CH2CH2CH2OOH → CH3CH=CH2 + HO2
1 record matched HOCH2CH(CH3)=CHCHOH + O2 → HOCH2CH(CH3)=CHCHO + HO2
1 record matched CH3CH(OH)O2 → CH2=CHOH + HO2
2 records matched CH3CH(OH)O2 → CH3CHO + HO2
1 record matched CH3CH2CH2CH(·)CH2OOH → 1-C5H10 + HO2
1 record matched CH3CH2CH2CH(OO·)CH3 → CH3CH=CHC2H5 + HO2
1 record matched (CH3)2C(OO·)CH2CH3 → C2H5C(CH3)=CH2 + HO2
1 record matched (CH3)2C(OO·)CH2CH3 → (CH3)2C=CHCH3 + HO2
1 record matched ·CH2CH(OOH)CH3 → CH3CH=CH2 + HO2
1 record matched HOOOCl → HO2 + ClO
1 record matched O=P(·)(OH)2 + O2 → HO2 + HOPO2
1 record matched O2(X3Sigma_g-) + 2-Chlorophenol → 2-chlorophenoxy + HO2
5 records matched O2(X3Sigma_g-) + C2H4 → C2H3 + HO2
1 record matched O2(b1Sigma_g+) + H2O → HO2 + ·OH
1 record matched O2(b1Sigma_g+) + H2 → HO2 + H·
1 record matched O2(b1Sigma_g+) + C2H6 → ·C2H5 + HO2
1 record matched O2(b1Sigma_g+) + CH4 → ·CH3 + HO2
1 record matched ·CH3 + HO2 → CH3O· + ·OH

Search returned 2652 records.