Kinetics Database Logo

Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences


Rate Our Products and Services


Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty


Administrative Links

NIST home page

MML home page

Chemical Sciences Division

  NIST Logo Home
©NIST, 2013
Accessibility information

Search Results

Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
1 record matched HCCNCO → CO + ·HCC≡N
1 record matched NCO + NCO → CO + CO + N2
3 records matched NCO → CO + N
1 record matched N + NCO → CO + N2
1 record matched O· + HCCO → CO + CO + H·
1 record matched O· + NCO → CO + NO
1 record matched H· + HCCO → CO + ·CH2
1 record matched H· + NCO → CO + NH
1 record matched NO + HCCO → -10202 + CO
1 record matched N2O + NCO → CO + N2 + NO
1 record matched O2 + ·CH2 → CO + H2O
1 record matched *CH2C(O)H + O2 → CH2O + CO + ·OH
1 record matched ·CCl + O· → CO + ·Cl
1 record matched ·OH + C2 → CO + ·CH
2 records matched ·CH + O· → CO + H·
6 records matched CH3CO → CO + ·CH3
11 records matched CS + O· → CO + S
1 record matched CS + O2 → CO + SO
1 record matched ClCO + ·Cl → CO + Cl2
3 records matched ClCO → CO + ·Cl
1 record matched HCO + ·CH2 → CO + ·CH3
1 record matched HCO + NCO → HN=C=O + CO
3 records matched HCO + O· → CO + ·OH
4 records matched HCO + H· → CO + H2
1 record matched HCO + NO2 → CO + HNO2
1 record matched HCO + NO → CO + HNO
8 records matched HCO + O2 → CO + HO2
1 record matched HCO + iso-C4H9 → iso-C4H10 + CO
3 records matched HCO + ·OH → CO + H2O
1 record matched HCO + CH3CO → CH3CHO + CO
1 record matched HCO + C2H3 → C2H4 + CO
2 records matched HCO + HCO → CH2O + CO
6 records matched HCO → CO + H·
1 record matched (·)CH2OH + HCO → CH3OH + CO
1 record matched ·CH3 + HCO → CH4 + CO
1 record matched CH3O· + HCO → CH3OH + CO
1 record matched 1-C3H7 + HCO → C3H8 + CO
2 records matched ·C2H + O· → CO + ·CH
1 record matched ·C2H + O2 → CO + HCO
1 record matched ·C2H + ·OH → CO + ·CH2
1 record matched ·C2H + HCO → C2H2 + CO
1 record matched C6H5O → CO + Cyclopentadienyl
1 record matched ·C2H5 + HCO → C2H6 + CO
1 record matched 2-C3H7 + HCO → C3H8 + CO
1 record matched ·CH2CH=CH2 + HCO → CH3CH=CH2 + CO
1 record matched tert-C4H9 + HCO → iso-C4H10 + CO
1 record matched CO + ·CH2 → H2C=C=O
5 records matched CO + ·Cl → ClCO
4 records matched CO + CF3O → CF3C(O)O
2 records matched CO + CF3O → Products
3 records matched CO + O· → CO2
2 records matched CO + CF3O2 → CO2 + CF3O
4 records matched CO + O2F → Products
2 records matched CO + ClO → Products
1 record matched CO + ·F → FCO
3 records matched CO + H· → HCO
2 records matched CO + NO3 → Products
2 records matched CO + NO2 → CO2 + NO
1 record matched CO + N2O → CO2 + N2
4 records matched CO + O2 → CO2 + O·
8 records matched CO + ·OH → CO2 + H·
2 records matched CO + ·OH → Products
1 record matched CO + ·CH → Products
5 records matched CO + HO2 → CO2 + ·OH
1 record matched CO + C2H3 → CH2=CHC(·)O
4 records matched CO + ·CH3 → CH3CO
1 record matched CO + CH3O· → CO2 + ·CH3
1 record matched CO + ·C2H5 → CH3CH2C(O)·
1 record matched CO → C + O·
1 record matched 2-butyne + O· → CH3CH=CH2 + CO
6 records matched COS + ·Cl → CO + SCl
9 records matched COS + O· → CO + SO
1 record matched COS + S → CO + S2
3 records matched H2C=C=O → CO + ·CH2
1 record matched 1,3-Butadiyne + O· → CO + CH≡CC(·)H
1 record matched CO2 + ·CH2 → CH2O + CO
3 records matched CO2 + O· → CO + O2
2 records matched CO2 + H· → CO + ·OH
1 record matched 1-butyne + O· → CH3CH=CH2 + CO
1 record matched CS2 + O· → CO + S2
1 record matched HN=C=O + H· → CO + ·NH2
4 records matched HN=C=O → CO + NH
1 record matched HCN + O· → CO + NH
2 records matched C2H2 + O· → CO + ·CH2
1 record matched C2H2 + CO → ·C2H + HCO
1 record matched C2H4 + CO → HCO + C2H3
1 record matched CN + NCO → CO + CNN
3 records matched CN + O· → CO + N
1 record matched CN + NO → CO + N2
1 record matched CN + HCO → HCN + CO
1 record matched M + ClCO → M + CO + ·Cl
2 records matched M + HCO → M + CO + H·
1 record matched M + CO + ·Cl → M + ClCO
1 record matched N(2D) + CO2 → CO + NO
1 record matched N(2P) + CO → Products
1 record matched N2(A3Sigma_u+) + CO → Products
1 record matched HC(O)CO → CO + HCO
1 record matched CF(O)NO → CO + FNO
1 record matched t-C4H9C(N(O)=NOCH3 → Isobutene + CO + NH3 + HNO
2 records matched DOC(O)· → CO + OD
1 record matched Manganese, carbonyl [(1,2,3,4,5-eta)-1-methyl-2,4-cyclopentadien-1-yl]- → CO + Manganese(1+), [(1,2,3,4,5-eta)-1-methyl-2,4-cyclopentadien-1-yl]-
1 record matched Bicyclo[2.2.1]hept-2-en-7-one, 5,6-bis(methylene)- → CO + o-Xylylene
1 record matched CH2OO → CO + H2O
1 record matched Ethyl 1-Piperidineglyoxylate → CO + Ethyl 1-piperidinecarboxylate
1 record matched (CH3)2CCHO → CO + 2-C3H7
2 records matched (CH3)3CC(O)· → CO + tert-C4H9
2 records matched (CH3)3CC(O)· → Products + CO
1 record matched exo-2-Norbornyl formate → exo-Norbornanol + CO
1 record matched Manganese, dicarbonyl [(1,2,3,4,5-eta)-1-methyl-2,4-cyclopentadien-1-yl]- → CO + Manganese, carbonyl [(1,2,3,4,5-eta)-1-methyl-2,4-cyclopentadien-1-yl]-
3 records matched (CH3)2CHC=O → CO + 2-C3H7
2 records matched (CH3)2CHC=O → Propyl Radical + CO
3 records matched CH3CH2CH2CO → CO + 1-C3H7
1 record matched (CH3)2CHOCH2COOH → CH2O + iso-C3H7OH + CO
1 record matched Oxiranyl → CO + ·CH3
3 records matched iso-C4H9CO· → CO + iso-C4H9
3 records matched CH3CH2CH2CH2CO· → CO + 1-C4H9
1 record matched Methyl, cyclopropyloxo- → CO + Cyclopropyl
1 record matched NCO + NCO → CO + CO + N2
5 records matched NCO → CO + N
1 record matched 4-formylphenoxyacetic acid → CH2O + 4-Hydroxybenzaldehyde + CO
1 record matched O· + [5,6]-Fullerene-C60 → Other Products + CO
4 records matched O· + ·CH2 → CO + H· + H·
1 record matched O· + ·CH2 → CO + H2
1 record matched O· + ·CH2 → Other Products + CO
5 records matched O· + NCO → CO + NO
2 records matched HCOO → CO + ·OH
1 record matched CH3OC(·)(O) → CO + CH3
1 record matched CHCl2C(O)NC(CH3)3 → Other Products + CO
6 records matched CH3CH2C(O)· → CO + ·C2H5
1 record matched CH3CO → CO + ·CH3
1 record matched CCl3C(O)NC(CH3)3 → Other Products + CO
1 record matched CH2ClC(O)NC(CH3)3 → Other Products + CO
1 record matched Methyl benzoylformate → CH2O + Benzaldehyde + CO
1 record matched ·F + NCO → CO + NF
3 records matched 3-Cyclopenten-1-one → 1,3-Butadiene + CO
4 records matched W(CO)6 → CO + W(CO)5
4 records matched Mo(CO)6 → CO + Mo(CO)5
1 record matched CH3COOCH2COOH → CH2O + CH3C(O)OH + CO
1 record matched Fe(CO)5 → CO + Fe(CO)4
1 record matched Ni(CO)4 → CO + Ni(CO)3
1 record matched ·CHF + O· → CO + HF
1 record matched 2,4-Cyclopentadiene-1-one → CO + Vinylacetylene
1 record matched 2,4-Cyclopentadiene-1-one → C2H2 + C2H2 + CO
1 record matched CF3C(O)C(O)OCH3 → CF3C(O)OCH3 + CO
2 records matched Cr(CO)6 → CO + Cr(CO)5
3 records matched H· + HCCO → CO + ·CH2
2 records matched H· + NCO → CO + NH
1 record matched 5-Methylcyclopentadienyl) manganese tricarbonyl- → CO + Manganese, dicarbonyl [(1,2,3,4,5-eta)-1-methyl-2,4-cyclopentadien-1-yl]-
1 record matched C2O + N → CN + CO
2 records matched C2O + O· → CO + CO
2 records matched C2O + H· → CO + ·CH
1 record matched C2 + O· → CO + C
1 record matched NO2 + CCl2=CCl → CO + ·CCl3 + NO
1 record matched NO2 + HCCO → CO + HCO + NO
1 record matched NO2 + NCO → CO + NO + NO
1 record matched NO + c-COC → CO + NCO
2 records matched NO + HCCO → CO + HC-N=O
1 record matched NO + HCCO → Other Products + CO
1 record matched NO + HCCO → -10202 + CO
1 record matched NO + CDO → CO + DNO
8 records matched NO + NCO → CO + N2O
2 records matched NO + NCO → CO + N2 + O·
1 record matched O2 + HC(O)CO → CO + CO + HO2
1 record matched O2 + HC(O)CO → CO2 + CO + ·OH
1 record matched O2 + [5,6]-Fullerene-C60 → Other Products + CO
1 record matched O2 + CCl2=CCl → CO + CCl3O
1 record matched O2 + CCl2=CCl → COCl2 + CO + ·Cl
1 record matched O2 + CH=C=CH → CO + H· + HCCO
1 record matched O2 + HCCO → CO + CO + ·OH
2 records matched O2 + HCCO → CO2 + CO + H·
1 record matched O2 + CDO → CO + DO2
1 record matched O2 + C2O → CO + CO + O·
1 record matched O2 + C2 → CO + CO
1 record matched C + O· → CO
2 records matched C + NO → CO + N
1 record matched C + NO → N(2D) + CO
9 records matched C + O2 → CO + O·
1 record matched CH2=CHO· → CO + ·CH3
1 record matched ·CH2Cl + O· → CO + HCl + H·
1 record matched Methyl carbazate → CH3NH2 + CO + HNO
10 records matched CF3C(O) → CO + ·CF3
1 record matched SCSe + O· → CO + SeS
2 records matched CH2=CHC(CH3)2CHO → (CH3)2C=CHCH3 + CO
1 record matched ClC(O)C(O)OCH3 → ClC(O)OCH3 + CO
1 record matched Isoxazole, 5-methyl- → C2H5CN + CO
1 record matched CD2=C=O + CD2 → CO + C2D4
1 record matched ClC(O)C(O)OCH2CH3 → ClC(O)OCH2CH3 + CO
1 record matched 2,4-Cyclopentadien-1-ylidene methanone → C5H4(all isomers) + CO
4 records matched Cl2C=C=O → CO + CCl2 (X 1A1)
1 record matched Methyl mandelate → CH3OH + Benzaldehyde + CO
1 record matched Cyclobutanone, 2,2,4,4-tetramethyl- → CO + Cyclopropane, 1,1,2,2-tetramethyl-
2 records matched (E)-CH3CH=CHCHO → CH3CH=CH2 + CO
1 record matched C2H5CHClCOOH → C2H5CHO + CO + HCl
1 record matched H2NNHCOOCH2CH3 → C2H5NH2 + CO + HNO
1 record matched CF + O· → CO + ·F
1 record matched C2H5(CH3)C(OH)COOH → C2H5COCH3 + CO + H2O
1 record matched (C2H5)2C(OH)COOH → (C2H5)2CO + CO + H2O
1 record matched CHCl2 + O· → CO + HCl + ·Cl
1 record matched CHCl2 + NO2 → ClNO + CO + HCl
1 record matched ·OH + C2 → CO + ·CH
1 record matched ·CH + O· → CO + H·
1 record matched ·CH + NO2 → CO + HNO
1 record matched ·CH + NO2 → Other Products + CO
4 records matched ·CH + NO → CO + NH
4 records matched ·CH + O2 → CO + ·OH
2 records matched ·CH + O2 → OH(A2Sigma+) + CO
1 record matched CH2=C=CHCl + O· → CO + ClCH2-CH:
17 records matched CH3CO → CO + ·CH3
4 records matched CS + O· → CO + S
1 record matched CS + O2 → CO + SO
1 record matched ·CH2C≡CH + O2 → CO + CH3CO
2 records matched C(O)NH2 → CO + ·NH2
1 record matched benzoyl → CO + Phenyl
3 records matched ClCO + ·Cl → CO + Cl2
1 record matched ClCO → CO + ·Cl
1 record matched HCO + CH3CH2CH2C(·)HOH → CH3CH2CH2CH2OH + CO
4 records matched HCO + O· → CO + ·OH
10 records matched HCO + H· → CO + H2
2 records matched HCO + NO2 → CO + HNO2
1 record matched HCO + NO2 → CO + ·OH + NO
13 records matched HCO + NO → CO + HNO
1 record matched HCO + Br· → CO + HBr
24 records matched HCO + O2 → CO + HO2
2 records matched HCO + ·OH → CO + H2O
2 records matched HCO + HCO → CO + CO + H2
6 records matched HCO + HCO → CH2O + CO
16 records matched HCO → CO + H·
2 records matched HOC(·)O → CO + ·OH
5 records matched ·CH3 + O· → CO + H2 + H·
1 record matched ·CH3 + CH3CO → C2H6 + CO
5 records matched ·CH3 + HCO → CH4 + CO
1 record matched ·CF2 + O2 → Other Products + CO
2 records matched CH3O· + HCO → CH3OH + CO
1 record matched 1-C3H7 + HCO → C3H8 + CO
1 record matched ·C2H + O· → CO + ·CH
2 records matched ·C2H + O· → CH(A2Delta, B2Sigma-) + CO
1 record matched ·C2H + NO → HCN + CO
1 record matched ·C2H + O2 → CO + HCO
4 records matched C6H5O → CO + Cyclopentadienyl
1 record matched CD3 + CD3CO → CO + C2D6
1 record matched ·C2H5 + O· → Other Products + CO
1 record matched ·CH2CH=CH2 + O· → C2H4 + CO + H·
3 records matched ·CH2CH=CH2 + O2 → Other Products + CO
3 records matched ·CH2CH=CH2 + HO2 → Other Products + CO
1 record matched 4-bromophenoxyacetic acid → CH2O + 4-bromophenol + CO
1 record matched 4-cyanophenoxyacetic acid → CH2O + CO + 4-hydroxybenzonitrile
1 record matched 4-acetylphenoxyacetic acid → CH2O + 4-Hydroxyacetophenone + CO
1 record matched 4-methoxyphenoxyacetic acid → CH2O + 4-Methoxyphenol + CO
1 record matched FCO + ·F → CO + F2
8 records matched FCO + FCO → COF2 + CO
3 records matched FCO → CO + ·F
1 record matched 4-nitrophenoxyacetic acid → CH2O + 4-Nitrophenol + CO
1 record matched 4-tert-butylphenoxyacetic acid → CH2O + 4-t-Butylphenol + CO
1 record matched COSe + O· → CO + OSe
1 record matched C6H5COC(O)OC2H5 → Ethyl benzoate + CO
2 records matched HFCO → CO + HF
3 records matched Cyclobutanone → Cyclopropane + CO
2 records matched 3,5-Cycloheptadienone → CO + (E)-CH2=CHCH=CHCH=CH2
1 record matched 4-methylphenoxyacetic acid → CH2O + 4-Methylphenol + CO
1 record matched CH3CH(C6H5O)COOH → CH3CHO + Phenol + CO
1 record matched HCOCOOCH2CH3 → Products + CO
1 record matched CH3C(O)NHC(CH3)3 → Other Products + CO
5 records matched Bicyclo[2.2.1]hept-2-en-7-one → 1,3-Cyclohexadiene + CO
1 record matched C4H9C≡CH + O· → Other Products + CO
2 records matched CO + Cr(CO)4(C2H4) → Cr(CO)5(C2H4)
1 record matched CO + Rhodium carbonyl (5-2,4-cyclopentadien-1-yl)- → (<.Eta.>5-cyclopentadienyl)dicarbonylrhodium
1 record matched CO + Mn2(CO)9 → Mn2(CO)10
3 records matched CO + Fe(CO)3(C2H4) → (CH2=CH2)(CO)4Fe
1 record matched CO + Manganese, carbonyl[η5-2,4-cyclopentadien-1-yl]- → Manganese, dicarbonyl[η5-2,4-cyclopentadien-1-yl]-
1 record matched CO + Fe(CO)2 → Fe(CO)3
1 record matched CO + (C6H6) Cr(CO)2 → Chromium,(6-benzene)tricarbonyl-
1 record matched CO + V(CO)5 → V(CO)6
2 records matched CO + ·CH2 → Products
1 record matched CO + V(CO)4 → V(CO)5
1 record matched CO + V(CO)3 → V(CO)4
2 records matched CO + Co(CO)2 → Co(CO)3
1 record matched CO + Co(CO) → Co(CO)2
2 records matched CO + Co(CO)3 → Co(CO)4
4 records matched CO + Cr(CO)4 → Cr(CO)5
1 record matched CO + CH2OO → Products
2 records matched CO + Mo(CO)3 → Mo(CO)4
1 record matched CO + Fe(CO)3(N2) → Fe(CO)4(N2)
2 records matched CO + Fe(CO)3 → Fe(CO)4
2 records matched CO + Mo(CO)4 → Mo(CO)5
1 record matched CO + Manganese, dicarbonyl[η5-2,4-cyclopentadien-1-yl]- → (η5-Cyclopentadienyl) manganese tricarbonyl
2 records matched CO + Mo(CO)5 → Mo(CO)6
1 record matched CO + W(CO)5 → W(CO)6
1 record matched CO + CH2CH2F → Adduct
5 records matched CO + Cr(CO)5 → Cr(CO)6
1 record matched CO + Fe2(CO)8 → Fe2(CO)9
3 records matched CO + ·Cl → ClCO
1 record matched CO + CF3O → CF3C(O)O
1 record matched CO + CF3O → COF2 + FCO
1 record matched CO + CF3O → CO2 + ·CF3
7 records matched CO + CF3O → Products
1 record matched CO + N → CN + O·
41 records matched CO + O· → CO2
1 record matched CO + CF3O2 → Products
1 record matched CO + (FO)2=CF2 → FCO + CF3O2
1 record matched CO + H2C=N → Products
1 record matched CO + O2F → Products
2 records matched CO + Fe(CO)4 → Fe(CO)5
6 records matched CO + ·F → FCO
1 record matched CO + IO → Products
1 record matched CO + AlO → Products
2 records matched CO + ·N3 → N2 + NCO
1 record matched CO + HNO → CO2 + NH
1 record matched CO + SH → COS + H·
1 record matched CO + SiH2 → Products
7 records matched CO + SiH2 → SiH2CO
1 record matched CO + BH → Products
1 record matched CO + SiH3 → Products
2 records matched CO + OD → DOC(O)·
6 records matched CO + OD → CO2 + D
6 records matched CO + OD → Products
1 record matched CO + SiCl2 → Products
2 records matched CO + BH3 → BH3CO
1 record matched CO + NaO → CO2 + Na
19 records matched CO + H· → HCO
3 records matched CO + Cu2 → Cu2(CO)
1 record matched CO + Au2 → Adduct
2 records matched CO + C2O → Products
1 record matched CO + OF → CO2 + ·F
2 records matched CO + OF → Products
2 records matched CO + NO3 → Products
4 records matched CO + NO2 → CO2 + NO
1 record matched CO + O3 → CO2 + O2
1 record matched CO + O3 → Products
9 records matched CO + N2O → CO2 + N2
1 record matched CO + OF2 → FCO + OF
1 record matched CO + OF2 → Products
1 record matched CO + Cl2 → COCl2
11 records matched CO + O2 → CO2 + O·
3 records matched CO + F2 → FCO + ·F
1 record matched CO + H2O → Products + CO2
1 record matched CO + P → Products
1 record matched CO + SO2 → Products
1 record matched CO + Ga → Products
1 record matched CO + Cu → Cu(CO)
2 records matched CO + Cr → Products
1 record matched CO + C → C2O
1 record matched CO + Si → C + SiO
1 record matched CO + Ni → NiCO
2 records matched CO + Pb → Products
2 records matched CO + Fe → Fe(CO)
1 record matched CO + Al → Adduct
1 record matched CO + CH3S· → Products
1 record matched CO + (CH3)2Si → Products
1 record matched CO + NF2 → Products
92 records matched CO + ·OH → CO2 + H·
8 records matched CO + ·OH → Products
1 record matched CO + ·OH → HOCO
4 records matched CO + ·CH → HCCO
1 record matched CO + ·CH → C2O + H·
12 records matched CO + ·CH → Products
1 record matched CO + HO2 → HC(O)O2
14 records matched CO + HO2 → CO2 + ·OH
1 record matched CO + (CH3)3CO· → CO2 + tert-C4H9
1 record matched CO + ·HCC≡N → Products
1 record matched CO + HOC(·)O → CO2 + HCO
1 record matched CO + Phenyl → benzoyl
1 record matched CO + CH3C(O)OONO2 → Products
4 records matched CO + ·CH3 → CH3CO
2 records matched CO + CH3O· → CH3C(O)O·
2 records matched CO + CH3O· → HC(O)OCH2(·)
2 records matched CO + CH3O· → ·CH2C(O)OH
5 records matched CO + CH3O· → CO2 + ·CH3
4 records matched CO + CH3O· → CH2O + HCO
5 records matched CO + CH3O· → Products
2 records matched CO + CH3O· → CH3OCO
1 record matched CO + CH3O2· → CO2 + CH3
1 record matched CO + ·C2H → Products
1 record matched CO + ·C2H5 → CH3CH2C(O)·
1 record matched CO + ·CClF → Products
1 record matched CO + CCl2 (X 1A1) → Products
1 record matched CO + FeO → CO2 + Fe
1 record matched CO + H2 + NO → Products
5 records matched CO → C + O·
1 record matched C3H7C≡CH + O· → CO + CH3CH2CH2CH
1 record matched C2H5OCH2COOH → CH2O + C2H5OH + CO
1 record matched 2,5-Dimethylfuran → Other Products + CO
1 record matched CH3OCH2COOH → CH2O + CH3OH + CO
2 records matched HC≡CCHO → C2H2 + CO
1 record matched C6H5CH(OH)COOH → Benzaldehyde + CO + H2O
1 record matched CH3CHBrCOOH → CH3CHO + CO + HBr
1 record matched (CH3)2C=C=O → CO + (CH3)2C
1 record matched (CH3)2COHCOOH → Acetone + CO + H2O
1 record matched CH3C(O)OCH2CH=CH2 → CH4 + CH2=CHCHO + CO
1 record matched (Z)-2-C4H8 + O· → Other Products + CO
1 record matched (CH3)2CHCHBrCOOH → (CH3)2CHCHO + CO + HBr
1 record matched DFCO → CO + DF
1 record matched CH3CH(OH)C(O)OCH3 → CH3OH + CH3CHO + CO
1 record matched CH3COOCH(CH3)COOH → CH3C(O)OH + CH3CHO + CO
1 record matched 2-Methylfuran → Other Products + CO
1 record matched Isopsoralen → C10H6O2 (unspecified isomer) + CO
1 record matched CSe2 + O· → CO + Se2
3 records matched C3O2 + H· → CO + HCCO
2 records matched C3O2 + C2O → Other Products + CO
1 record matched C3O2 + C → Other Products + CO
3 records matched C3O2 → CO + C2O
1 record matched 2-butyne + O· → CO + (CH3)2C
1 record matched 2-butyne + O· → CH3CH=CH2 + CO
1 record matched Benzofuran, 2,3-dihydro → Toluene + CO
1 record matched 1,3-Dihydro-2-benzofuran → Other Products + CO
2 records matched COS + ·Cl → CO + SCl
12 records matched COS + O· → CO + SO
1 record matched COS + ·F → CO + SF
3 records matched COS + H· → CO + SH
9 records matched COS + S → CO + S2
1 record matched COS + Ge → CO + GeS
1 record matched COS + C → CO + CS
1 record matched COS + Sn → CO + SnS
1 record matched COS + CD3 → CO + CD3S
5 records matched COS → CO + S
5 records matched H2C=C=O + ·CH2 → C2H4 + CO
2 records matched H2C=C=O + ·Cl → CO + ·CH2Cl
1 record matched H2C=C=O + ·F → CO + ·CH2F
6 records matched H2C=C=O + H· → CO + ·CH3
1 record matched H2C=C=O + ·OH → CO + (·)CH2OH
2 records matched H2C=C=O → CO + ·CH2
5 records matched CH2=C=CH2 + O· → C2H4 + CO
1 record matched 1,3-Butadiyne + O· → CO + CH≡CC(·)H
1 record matched 4-fluorophenoxyacetic acid → CH2O + 4-Fluorophenol + CO
1 record matched COF2 + CO → FCO + FCO
1 record matched Isooxazole → CH3CN + CO
2 records matched CO2 + ·CH2 → CH2O + CO
1 record matched CO2 + BCl → CO + OBCl
3 records matched CO2 + N → CO + NO
4 records matched CO2 + O· → CO + O2
1 record matched CO2 + AlO → CO + AlO2
1 record matched CO2 + SiH2 → CO + H2Si=O
1 record matched CO2 + BF → CO + OBF
1 record matched CO2 + AlCl → CO + OAlCl
10 records matched CO2 + H· → CO + ·OH
1 record matched CO2 + NO → CO + NO2
2 records matched CO2 + Cr → CO + CrO
2 records matched CO2 + C → CO + CO
1 record matched CO2 + B → CO + BO
1 record matched CO2 + Ba → CO + BaO
1 record matched CO2 + Sn → CO + SnO
1 record matched CO2 + Ta → CO + TaO
2 records matched CO2 + Si → CO + SiO
2 records matched CO2 + Mo → CO + MoO
1 record matched CO2 + Lu → CO + LuO
2 records matched CO2 + Fe → CO + FeO
7 records matched CO2 + Al → CO + AlO
1 record matched CO2 + FeO → CO + FeO2
23 records matched CO2 → CO + O·
1 record matched CO2 → O(1D) + CO
1 record matched 1,4-Benzenediol → CO + 1,4-Cyclopentadien-1-ol
1 record matched C6H5OCH2COOH → CH2O + Phenol + CO
3 records matched Furan → CH3CCH + CO
2 records matched Phenol → Cyclopentadiene + CO
1 record matched HC(O)OCH3 + HBr → CH3OH + CO + HBr
2 records matched HC(O)OCH3 → CH3OH + CO
2 records matched (CHO)2 + H· → CO + H2 + HCO
1 record matched 1-butyne + O· → CO + CH3CH2CH
1 record matched 1-butyne + O· → CH3CH=CH2 + CO
1 record matched CH≡CCH2Br + O· → CH2=CHBr + CO
1 record matched C6H5CH=C(CH3)COH → Products + CO
1 record matched 2-Furancarboxaldehyde → CO + CH2=CHCH=C=O
1 record matched 2(3H)-Furanone, dihydro- → Other Products + CO
1 record matched (COCl)2 + ·Cl → CO + ClCO + Cl2
1 record matched (COCl)2 → CO + ·Cl
1 record matched HOCH2COOH → CH2O + CO + H2O
1 record matched CH2ClCOOH → CH2O + CO + HCl
1 record matched C2HCl3 + O· → CO + CCl2 (X 1A1) + HCl
1 record matched Oxirane + C2O → C2H4 + CO + CO
2 records matched Oxirane → CH4 + CO
4 records matched CS2 + O· → CO + S2
2 records matched HN=C=O + H· → CO + ·NH2
4 records matched HN=C=O → CO + NH
2 records matched HCONH2 → CO + NH3
2 records matched CH3CHO + H· → CO + H2 + ·CH3
1 record matched CH3CHO + CH3S· → CH3SH + CO + ·CH3
1 record matched CH3CHO + ·CH → CO + ·C2H5
1 record matched CH3CHO → CO + ·CH3 + H·
2 records matched CH3CHO → CH4 + CO
2 records matched CH3CCH + O· → CO + CH3CH
1 record matched CH3CCH + O· → C2H2 + CO + H2
1 record matched CH3CCH + O· → C2H4 + CO
2 records matched HCN + O· → CO + NH
1 record matched C2H2 + HCCO → CO + ·CH2C≡CH
15 records matched C2H2 + O· → CO + ·CH2
1 record matched C2H2 + O· → CH2(X3B_1) + CO
1 record matched C2H2 + NO → HCN + CO + H·
1 record matched C2H2 + ·OH → CO + ·CH3
1 record matched Benzene + O· → CO + Cyclopentadienyl + H·
1 record matched Benzene + O· → Cyclopentadiene + CO
2 records matched Benzene + ·OH → Other Products + CO
9 records matched HCOOH → CO + H2O
1 record matched 2-Phenylethanol → Ethylbenzene + CO
1 record matched CN + NCO → CO + NCN
5 records matched CN + O· → CO + N
2 records matched CN + NO2 → CO + N2O
5 records matched CN + NO → CO + N2
2 records matched CN + O2 → CO + NO
2 records matched CN + COS → CO + SCN
4 records matched CN + CO2 → CO + NCO
1 record matched Propanoic acid, 2-hydroxy- → CH3CHO + CO + H2O
1 record matched CH2O + O· → CO + ·OH + H·
1 record matched CH2O + Ar → CO + H2 + Ar
11 records matched CH2O → CO + H2
6 records matched O(1D) + CO → CO + O·
5 records matched O(1D) + CO → CO2
1 record matched O(1D) + CO → Products
1 record matched O(1D) + C3O2 → CO + CO + CO
2 records matched O(1D) + COS → CO + SO
5 records matched O(1D) + CO2 → CO + O2
1 record matched CH3C(O)C(O)· → CO + CH3CO
1 record matched (C6H6)Cr(CO) + CO → (C6H6) Cr(CO)2
2 records matched BrCH=CHOO(.) → CO + HCO + HBr
1 record matched CCl(O)NO → CO + NOCl
1 record matched CF (A 2Sigma+, v=1) + CO → CO + CF
1 record matched CF (A 2Sigma+, v=0) + CO → CO + CF
1 record matched CH2CHCOH → C2H4 + CO
1 record matched CH3CH2CH2CHO → CO + 1-C3H7 + H·
1 record matched M + (CH3)3CC(O)· → M + CO + tert-C4H9
1 record matched M + (CH3)2CHC=O → M + CO + 2-C3H7
1 record matched M + CO + FSO3 → FS(O2)OCO + M
1 record matched M + HCOOH → M + CO + H2O
1 record matched NCCO + NO → CO + ONCN
1 record matched N(2S) + CO → Products
1 record matched O(1D) + ·C2H → CH(A2Delta) + CO
1 record matched NF(a1Delta) + CO → Products
1 record matched ·CH(OH)C(O)CH3 + O2 → CH3C(O)OH + CO + ·OH
1 record matched IFe(CO)4(COC2H5) → IFe(CO)3(eta(1)-COC2H5) + CO
1 record matched (CH3)2C(OOCCH3)COOH → CH3C(O)OH + Acetone + CO
1 record matched 2-(4-nitrophenoxy)propanoic acid → CH3CHO + 4-Nitrophenol + CO
1 record matched 2-(4-chlorophenoxy)propanoic acid → CH3CHO + 4-Chlorophenol + CO
1 record matched 2-(3-chlorophenoxy)propanoic acid → CH3CHO + 3-Chlorophenol + CO
1 record matched 2-(4-methylphenoxy)propanoic acid → CH3CHO + 4-Methylphenol + CO
1 record matched 2-(4-methoxyphenoxy)propanoic acid → CH3CHO + 4-Methoxyphenol + CO
1 record matched 2-(N-phenylamino)propanoic acid → aniline + CH3CHO + CO
1 record matched 2-(phenylthio)propanoic acid → CH3CHO + Benzenethiol + CO
1 record matched N3CH2CONH2 → HCN + CO + NH3 + N2
1 record matched H2NCOCH=NH → HCN + CO + NH3 + N2
1 record matched C(3Pj) + O2 → CO + O·
1 record matched S(1D) + COS → CO + S2
1 record matched 34S + COS → CO + SO
1 record matched HOCH2C(CH3)(OOH)C(O)· → CH3C(O)CH2OH + CO + ·OH
1 record matched Pentachlorocyclopentadienoxy → CCl2=CClCCl=CCl· + CO
1 record matched O3(v) + CO → CO + O3
1 record matched 4-ethylphenoxyacetic acid → CH2O + 4-Ethylphenol + CO
1 record matched Xe(5d) + CO → CO + Xe
1 record matched Fe(CO)3(C2Cl4) + CO → Fe(CO)4(C2Cl4)
1 record matched Fe(CO)3(neohexene) + CO → Fe(CO)4(neohexene)
1 record matched C2H5CH(CH3)C(O)· → CO + sec-C4H9
2 records matched Cl(2P) + NCO(X2PI) → CO + NCl
1 record matched CH3S·(A-state) + CO → CO + CH3
1 record matched O2(b1Sigma_g+) + CO → CO2 + O·
2 records matched O2(b1Sigma_g+) + CO → Products
1 record matched cyclopentoxy (chemically activated) → C2H4 + C2H4 + CO + H·
1 record matched C2(a3PIu) + NO → CN + CO
1 record matched (CH3)2C(OH)C(O)OCH3 → CH3OH + Acetone + CO
1 record matched C2H5OCH=CHNH2 → C2H4 + CH3NH2 + CO
5 records matched HC(O)CO → CO + HCO
1 record matched 3,4-epoxycyclopentene → 1,3-Butadiene + CO
1 record matched Nitrosoketene → CO + HC-N=O
1 record matched HOCH2C(·)O → CO + (·)CH2OH
1 record matched HOCH2C(·)O → CO + CH3
1 record matched 1,4-Cyclopentadien-1-ol → 1,3-Butadiene + CO
1 record matched 1-(4-Hydroxyphenyl)-2-propen-1-one → CO + 4-vinylphenol
1 record matched C2H5OCH=CHN(C2H5)2 → C2H4 + (C2H5)2(CH3)N + CO
2 records matched Cr(CO)3 → Cr(CO)2 + CO
3 records matched CH2=CHC(·)O → CO + C2H3
4 records matched ClCH2C(O)(.) → CO + ·CH2Cl
2 records matched Cr(CO)4 → CO + Cr(CO)3
2 records matched CH2OO → CO + H2O
1 record matched Propyl,2,2,3,3,3-pentafluoro-1-oxo- → CO + C2F5
1 record matched CH2=C=CHCHO → CH3CCH + CO
1 record matched HCCO → CO + ·CH
3 records matched (CH3)3CC(O)· → CO + tert-C4H9
1 record matched Oxiranone, methyl- → CH3CHO + CO
1 record matched Oxiranone → CH2O + CO
1 record matched 3-Methyl-phenoxy → CO + Cyclopentadienyl, methyl-
2 records matched 2-Methoxyphenoxy radical → methoxycyclopentadienyl radical + CO
3 records matched (CH3)2CHC=O → CO + 2-C3H7
2 records matched CH3CH2CH2CO → CO + 1-C3H7
2 records matched Oxiranyl → CO + ·CH3
1 record matched iso-C4H9CO· → CO + iso-C4H9
1 record matched CH3CH2CH2CH2CO· → CO + 1-C4H9
2 records matched 3-Methoxyphenoxy radical → methoxycyclopentadienyl radical + CO
2 records matched Cr(CO)5 → CO + Cr(CO)4
1 record matched 3-Hydroxyphenoxy → hydroxycyclopentadienyl radical + CO
2 records matched NCO + HCNO → CO + HCO + N2
2 records matched NCO + HCNO → HCN + CO + NO
1 record matched NCO + NCO → CO + CO + N2
1 record matched NCO → CO + N
1 record matched HOCH → CO + CO + H2
1 record matched Oxiranone, dimethyl- → Acetone + CO
3 records matched N + NCO → CO + N2
1 record matched O· + ·CH2 → CO + H· + H·
1 record matched O· + NCO → CO + NO
1 record matched HC-N=O + ·OH → CO + H2 + NO
7 records matched CH3OC(·)(O) → CO + CH3
4 records matched CH3CH2C(O)· → CO + ·C2H5
1 record matched CH3CO → CO + ·CH3
2 records matched Methyl benzoylformate → Methylbenzoate + CO
1 record matched ·F + NCO → CO + NF
1 record matched CH3CH2OC(O)· → CO + CH3CH2
1 record matched 3-Cyclopenten-1-one → 1,3-Butadiene + CO
1 record matched BH3CO + BH3 → CO + Diborane(6)
1 record matched BH3CO → CO + BH3
1 record matched 2,4-Cyclopentadiene-1-one → CO + 1,3-Cyclobutadiene
1 record matched 2,4-Cyclopentadiene-1-one → CO + Vinylacetylene
1 record matched CF3C(O)C(O)OCH3 → CF3C(O)OCH3 + CO
2 records matched Cr(CO)6 → CO + Cr(CO)5
1 record matched H· + HCCO → CH2(X3B_1) + CO
1 record matched H· + HCCO → CH2(1) + CO
3 records matched H· + NCO → CO + NH
1 record matched H· + NCO → (3)NH + CO
1 record matched H· + 2,4-Cyclopentadiene-1-one → CO + CH2=CHCH=CH·
1 record matched C2O + O· → CO + CO
1 record matched NO2 + CCl2=CCl → ClNOCCl2 + CO
2 records matched NO2 + NCO → CO + NO + NO
1 record matched NO2 + C2O → CO + CO + NO
1 record matched NO + HCCO → CO + HC-N=O
1 record matched NO + NCO → CO + N2O
1 record matched NO + NCO → CO + N2 + O·
1 record matched NO + C2 → CN + CO
1 record matched O2 + HC(O)CO → CO2 + CO + ·OH
2 records matched O2 + ·CH2 → CO + H2O
1 record matched O2 + ·CH2 → CO + ·OH + H·
1 record matched O2 + ·CH2 → Other Products + CO
1 record matched O2 + ·CH2 → O(1D) + CO + H2
1 record matched H2O + C2F → CO + ·CH2F
1 record matched H2O + C2 → CO + ·CH2
1 record matched N2 + C2O → CO + CNN
1 record matched N2 + C2O → cyc-NCN + CO
1 record matched N2 + C2O → 3CNN + CO
1 record matched N2 + C2O → NCN3 + CO
1 record matched C + NO2 → CO + NO
6 records matched C + NO → CO + N
1 record matched 3-Methoxypyridine → CO + ·CH3 + 1H-Pyrrol-1-yl
1 record matched HNC + O· → CO + NH
1 record matched 3-Oxetanone → Oxirane + CO
1 record matched Methyl carbazate → CH3NH2 + CO + HNO
7 records matched CF3C(O) → CO + ·CF3
2 records matched 4-Methoxyphenoxy radical → methoxycyclopentadienyl radical + CO
1 record matched CH3CH=C=O + H· → CO + ·C2H5
2 records matched CH3CH=C=O → C2H4 + CO
1 record matched CH2=CHC(CH3)2CHO → (CH3)2C=CHCH3 + CO
1 record matched 2-Hydroxyphenoxy radical → hydroxycyclopentadienyl radical + CO
1 record matched Cyclopropanone → C2H4 + CO
1 record matched Cl2C=C=O + H· → CO + CHCl2
1 record matched HC(O)C≡N → CO + HNC
1 record matched HC(O)C≡N → HCN + CO
1 record matched *CH2C(O)H → CO + ·CH3
1 record matched Methyl mandelate → CH3OH + Benzaldehyde + CO
1 record matched CC≡N + O· → CN + CO
1 record matched ·OH + 1-(Nitroperoxy)-2-propen-1-one → HOCH2CHO + CO + NO3
5 records matched ·OH + NCO → CO + NO + H·
3 records matched ·OH + C → CO + H·
1 record matched ·OH + CH3CH=C=O → CO + CH3CH(·)OH
1 record matched ·CH + O· → CO + H·
2 records matched ·CH + O2 → CO + ·OH
1 record matched 4-Hydroxyphenoxy → hydroxycyclopentadienyl radical + CO
1 record matched 2-Methyl-phenoxy → CO + Cyclopentadienyl, methyl-
1 record matched Phenoxy, 4-methyl- → CO + Cyclopentadienyl, methyl-
6 records matched CH3CO → CO + ·CH3
1 record matched CS + O· → CO + S
1 record matched ·CH2C≡CH + NO → CO + CH2=C=NH
1 record matched ·CH2C≡CH + NO → CH3CN + CO
1 record matched ·CH2C≡CH + O2 → CO + CH3CO
2 records matched ·CH2C≡CH + ·OH → CO + CH3CH
2 records matched ·CH2C≡CH + ·OH → C2H2 + CO + H2
3 records matched ·CH2C≡CH + ·OH → C2H4 + CO
1 record matched C2H3 + O· → CO + ·CH3
1 record matched C2H3 + NO → CO + CH2=NH
1 record matched C2H3 + O2 → CH2O + CO + H·
1 record matched C2H3 + ·OH → CO + ·CH3 + H·
2 records matched C2H3 + ·OH → CH4 + CO
1 record matched NCN + O· → CO + N2
1 record matched ClCO → CO + ·Cl
1 record matched HCO + ·Cl → CO + HCl
1 record matched HCO + ·F → CO + HF
3 records matched HCO + HNO → CO + NHOH
1 record matched HCO + HNO → CO + NH2O
2 records matched HCO + NHOH → CO + NH2OH
3 records matched HCO + NHOH → CO + H2 + HNO
4 records matched HCO + H· → CO + H2
3 records matched HCO + NO2 → CO + HNO2
1 record matched HCO + NO2 → CO + ·OH + NO
1 record matched HCO + NO2 → cis-HONO + CO
1 record matched HCO + NO2 → trans-HONO + CO
2 records matched HCO + NO → CO + HNO
2 records matched HCO + HNO2 → CO + H2O + NO
3 records matched HCO + O2 → CO + HO2
1 record matched HCO + Be → CO + BeH
1 record matched HCO + Na → CO + Sodium hydride
1 record matched HCO + Al → CO + AlH
2 records matched HCO + ·OH → CO + H2O
2 records matched HCO → CO + H·
1 record matched (·)CH2OH + ·OH → CO + H2 + H2O
1 record matched HC(O)Cl → CO + HCl
1 record matched HOC(·)O → CO + H2
1 record matched Phenyl + O· → CO + Cyclopentadienyl
1 record matched ·CH3 + O· → CO + H2 + H·
2 records matched ·CH3 + HCO → CH4 + CO
2 records matched Cyclopentadienyl + O· → CO + CH2=CHCH=CH·
1 record matched Cyclopentadienyl + O2 → CH2=CHCH=CHO· + CO
2 records matched Cyclopentadienyl + ·OH → 1,3-Butadiene + CO
1 record matched ·C2H + O· → CO + ·CH
1 record matched ·C2H + N2O → CO + CHN2
2 records matched ·C2H + O2 → CO + HCO
2 records matched ·C2H + O2 → CO + CO + H·
1 record matched ·C2H + HO2 → CO + CO + H2
8 records matched C6H5O → CO + Cyclopentadienyl
1 record matched CD3 + O· → CO + H2 + H·
1 record matched (N烩2C: + O· → CN + CN + CO
2 records matched FCO + H· → CO + HF
1 record matched FCO + NO → CO + FNO
1 record matched FCO + NO → FON + CO
1 record matched FCO → CO + ·F
2 records matched Cyclobutanone → CH3CH=CH2 + CO
2 records matched Cyclobutanone → Cyclopropane + CO
1 record matched Dihydro-3-(2H)-thiophenone → C2H4 + CO + CH2S
1 record matched CO + SF5O → CO2 + SF5
1 record matched CO + CH2OO → CH2O + CO2
1 record matched CO + CF3O → COF2 + FCO
1 record matched CO + CF3O → CO2 + ·CF3
1 record matched CO + CF3O → ·C(O)OCF3
1 record matched CO + CHN2 → N2 + HCCO
1 record matched CO + Diborane(6) → BH2OBHCH3
2 records matched CO + Diborane(6) → BH3CO + BH3
1 record matched CO + Diborane(6) → Products
1 record matched CO + N → C + NO
1 record matched CO + N → CN + O·
2 records matched CO + O· → CO2
1 record matched CO + 2-Phenyl-2-propyl radical → C6H5-C(CH3)2C(·)O
1 record matched CO + (FO)2=CF2 → FCO + CF3O2
1 record matched CO + FSO3 → FS(O2)OCO
1 record matched CO + SF5OF → Products
1 record matched CO + ClO → CO2 + ·Cl
2 records matched CO + ·F → FCO
1 record matched CO + IO → CO2 + I
1 record matched CO + OD → DOC(O)·
3 records matched CO + OD → CO2 + D
2 records matched CO + OD → Products
1 record matched CO + H· → HCO
1 record matched CO + OF → CO2 + ·F
1 record matched CO + NO3 → Products
1 record matched CO + NO2 → CO2 + NO
1 record matched CO + N2O → CO2 + N2
2 records matched CO + O2 → CO2 + O·
1 record matched CO + O2 → Products
2 records matched CO + H2O → CO2 + H2
2 records matched CO + H2O → HCOOH
2 records matched CO + H2O2 → HOCO + ·OH
2 records matched CO + CH3S· → COS + ·CH3
1 record matched CO + CH3S· → CH3SCO adduct
1 record matched CO + CH3CH=C(·)H → CH3CH(·)CHCO
1 record matched CO + iso-C4H9 → iso-C4H9CO·
1 record matched CO + Cyclopentyl → cyc-C5H9-C(·)O
1 record matched CO + ·OH + H2O → CO2 + H2O + H·
1 record matched CO + ·OH → HOC(·)O
27 records matched CO + ·OH → CO2 + H·
2 records matched CO + ·OH → Products
9 records matched CO + ·OH → HOCO
6 records matched CO + HO2 → CO2 + ·OH
1 record matched CO + CH3CO → CO2 + ·CH3
1 record matched CO + CH3CO → CH2O + HCO
1 record matched CO + Cyclohexyl → cyc-C6H11-C(·)O
1 record matched CO + (CH3)3CO· → CO2 + tert-C4H9
1 record matched CO + (CH3)3CO· → (CH3)2CCO(O) + ·CH3
1 record matched CO + ·CHF2 → FC≡CF + ·OH
1 record matched CO + ·CHF2 → Products
1 record matched CO + ·CHF2 → CHF2CO
1 record matched CO + ·CHF2 → CFCFOH
1 record matched CO + ·CHF2 → CF2CHO
1 record matched CO + ·CHF2 → CF2COH
1 record matched CO + C2H3 → ·CH2CH=CO
1 record matched CO + 1-C4H9 → CH3CH2CH2CH2CO·
1 record matched CO + sec-C4H9 → C2H5CH(CH3)C(O)·
1 record matched CO + 1-phenylethyl → C6H5-CH(CH3)C(·)O
2 records matched CO + ·CH3 → CH3CO
1 record matched CO + ·CH3 → C2H2 + ·OH
1 record matched CO + Benzyl → C6H5-CH2C(·)O
3 records matched CO + CH3O· → CH3OC(·)(O)
1 record matched CO + 1-C3H7 → CH3CH2CH2CO
1 record matched CO + ·C2H5 → CH3CH2C(O)·
1 record matched CO + 2-C3H7 → (CH3)2CHC=O
1 record matched CO + tert-C4H9 → (CH3)3CC(O)·
1 record matched CO + CCl2 (X 1A1) → Cl2C=C=O
1 record matched CO + H2 → HOC(·)O
1 record matched CO + H2 → CO2 + H·
1 record matched CO + H2 → Products
1 record matched HC≡CCHO → C2H2 + CO
1 record matched Methyl pentanoate → Pentanal + CO
1 record matched 2-Hexanone → CH4 + 1-C4H8 + CO
1 record matched 5-Methylfuran-2(3H)-one → CH2=CHCOCH3 + CO
1 record matched 2-Methylfuran → CO + ·CH3 + CH2=C=CH
1 record matched 2-Methylfuran → 1,2-butadiene + CO
1 record matched 2-Methylfuran → 2-butyne + CO
2 records matched 2-Methylfuran → 1-butyne + CO
1 record matched 2-Methylfuran → 1,3-Butadiene + CO
1 record matched 2-Methylfuran → C2H4 + C2H2 + CO
1 record matched Isopsoralen → Furo[3,2-e][1]benzofuran + CO
1 record matched C3O2 + O3 → CO2 + CO2 + CO
1 record matched C3O2 + F2 → CO + CO + ·CF2
1 record matched 1H-Inden-1-one + H· → Other Products + CO
1 record matched HC≡CCOOH → CO + HC≡COH
1 record matched HC≡CCOOH → H2C=C=O + CO
3 records matched COS + O· → CO + SO
1 record matched COS + H· → CO + SH
1 record matched COS + O2 → CO + SO2
2 records matched COS + S → CO + S2
2 records matched COS + S → S2(1Delta) + CO
1 record matched COS + V → CO + VS
1 record matched COS + Cu → CO + CuS
1 record matched COS + ·OH → CO + SOH
2 records matched COS → CO + S
1 record matched H2C=C=O + ·CH2 → C2H4 + CO
1 record matched H2C=C=O + ·CH2 → (3)C2H4 + CO
1 record matched H2C=C=O + ·Cl → CO + ·CH2Cl
2 records matched H2C=C=O + NCO → CH2NCO + CO
1 record matched H2C=C=O + NCO → CH2OCN + CO
1 record matched H2C=C=O + NCO → CH2C(O)N + CO
1 record matched H2C=C=O + SCN → CH2NCS + CO
1 record matched H2C=C=O + ·F → CO + ·CH2F
4 records matched H2C=C=O + H· → CO + ·CH3
1 record matched H2C=C=O + ·OH → CO + (·)CH2OH
1 record matched H2C=C=O + ·OH → CO + CH3
2 records matched H2C=C=O + ·CH3 → CO + ·C2H5
1 record matched H2C=C=O + H2C=C=O → C2H4 + CO + CO
1 record matched CH2=C=CH2 + O· → C2H4 + CO
1 record matched CF3COCl → CO + ·CF3 + ·Cl
1 record matched Isooxazole → CO + CH2=C=NH
1 record matched Isooxazole → CH3CN + CO
1 record matched Benzoxazole → CO + Cyclopentadienecarbonitrile
3 records matched HOOCCOOH → CO2 + CO + H2O
1 record matched CO2 + ·CH2 → CH2O + CO
1 record matched CO2 + :GeH2 → CO + GeH2O
1 record matched CO2 + SiH2 → CO + H2Si=O
1 record matched CO2 + NH → CO + HNO
1 record matched CO2 + NO → CO + NO2
1 record matched CO2 + V → CO + VO
1 record matched CO2 + B → CO + BO
1 record matched CO2 + Sc → CO + ScO
1 record matched CO2 + Ni → CO + NiO
1 record matched CO2 + H2 → CO + H2O
1 record matched CO2 + CO + CH2OO → CH2O + CO2 + CO2
2 records matched CO2 + CO + ·OH → CO2 + CO2 + H·
1 record matched Phenylethanal → Toluene + CO
4 records matched HC(O)OC2H5 → C2H5OH + CO
1 record matched Phenol → Cyclopentadiene + CO
1 record matched γ-Valerolactone → C2H4 + CH3CHO + CO
1 record matched HC(O)OCH3 → CH3OH + CO
1 record matched (CHO)2 + ·Cl → CO + HCO + HCl
1 record matched (CHO)2 + ·OH → CO + HCO + H2O
1 record matched (CHO)2 + HO2 → HCOOH + CO + ·OH
1 record matched (CHO)2 → CO + HOCH
1 record matched (CHO)2 → CO + CO + H2
1 record matched (CHO)2 → CH2O + CO
1 record matched CH2=CHCHO + ·CH → CO + CH3CH=C(·)H
1 record matched 1,4-Benzoquinone → CO + 2,4-Cyclopentadiene-1-one
1 record matched (COCl)2 → CO + CO + Cl2
1 record matched HOCH2COOH → CH2O + CO + H2O
1 record matched CHCl2CHO → CH2Cl2 + CO
1 record matched CF3CHO → CHF3 + CO
1 record matched COCl2 + O· → CO + ClO + ·Cl
3 records matched COCl2 → CO + Cl2
1 record matched Oxirane → CH4 + CO
1 record matched CS2 + O· → CO + S2
2 records matched HN=C=O + H· → CO + ·NH2
1 record matched HN=C=O + C2H3 → cis-CH2CHNH + CO
1 record matched HN=C=O + C2H3 → trans-CH2CHNH + CO
2 records matched HN=C=O + ·CH3 → CO + CH3NH·
2 records matched HCONH2 → CO + NH3
1 record matched CH3CHO + HCO → CH4 + CO + HCO
1 record matched CH3CHO → CO + ·CH3 + H·
2 records matched CH3CHO → CH4 + CO
1 record matched CH3CCH + O· → CO + CH3CH
1 record matched CH3CCH + O· → C2H2 + CO + H2
1 record matched CH3CCH + O· → C2H4 + CO
1 record matched CH3CCH + CO → CH2=C=CHCHO
1 record matched HCN + O· → CO + NH
1 record matched HCN + ·OH → CO + ·NH2
1 record matched C2H2 + COH → CO + C2H3
4 records matched C2H2 + O· → CO + ·CH2
1 record matched C2H2 + O· → CH2(X3B_1) + CO
2 records matched C2H2 + ·OH → CO + ·CH3
1 record matched C2H2 + HCO → CO + C2H3
1 record matched C2H4 + COH → CO + ·C2H5
1 record matched C2H4 + HCO → CO + ·C2H5
3 records matched Benzene + O· → Cyclopentadiene + CO
1 record matched Acetone → C2H6 + CO
1 record matched CH3OH + Br2 → Other Products + CO
4 records matched HCOOH → CO + H2O
2 records matched CN + NCO → CO + NCN
5 records matched CN + O· → CO + N
1 record matched CN + CO → NCCO
1 record matched CN + H2C=C=O → CO + CH2NC
1 record matched CN + H2C=C=O → CO + CH2CN
1 record matched CN + CO2 → CO + NCO
1 record matched Nitroglycerin → HONO (unspecified cis/trans isomer) + HONO (unspecified cis/trans isomer) + HONO (unspecified cis/trans isomer) + CO + HC(O)CO
1 record matched Propanoic acid, 2-hydroxy- → CH3CHO + CO + H2O
1 record matched CH2O + CH2OO → CH2O + CO + H2O
1 record matched CH2O + H· → CO + H2 + H·
1 record matched CH2O + Y → CO + YH2
2 records matched CH2O + ·OH → CO + H2O + H·
1 record matched CH2O + ·CH → CO + ·CH3
1 record matched CH2O + C2H3 → CO + ·C2H5
1 record matched CH2O + ·C2H → C2H2 + CO + H·
7 records matched CH2O → CO + H2
2 records matched O(1D) + COS → CO + SO
1 record matched CF3CF2CF2C(O)· → CO + n-C3F7
2 records matched CH3C(O)C(O)· → CO + CH3CO
2 records matched CCl3C(O)(.) → CO + ·CCl3
2 records matched BrCH2C(O)(.) → CO + ·CH2Br
1 record matched C3H + H2O → CO + C2H3
1 record matched cyc-(-CH2CH2SiH2-O-C(:)-) → Silacyclobutane + CO
1 record matched ·OOCH2OC(O)H → HCOOH + CO + ·OH
1 record matched CF2CF=O → CO + ·CF3
1 record matched O2(1Delta_g) + CO → O(1D) + CO2
2 records matched CHCl2CO → CO + CHCl2
1 record matched HO(CH3)2CCO → CO + (CH3)2C(·)OH
1 record matched HO(CH3)2CCO → ·OCH(CH3)2 + CO
1 record matched IFe(CO)3(eta(1)-COC2H5) + CO → IFe(CO)4(COC2H5)
1 record matched CF2CO + ·F → CO + ·CF3
1 record matched 2,4-dichlorocyclohexa-2,4-dienon-5-yl radical → 1,3-dichlorocyclopentadienyl + CO
1 record matched 2,4,6-trichlorophenoxy radical → 1,2,4-trichlorocyclopentadienyl + CO
2 records matched 1-napthoxy → CO + 1H-Inden-1-yl
1 record matched N3CH2CONH2 → HCN + CO + NH3 + N2
1 record matched H2NCOCH=NH → HCN + CO + NH3 + N2
1 record matched HOCO + O· → CO + HO2
1 record matched HOCO + CO → ·C(O)C(O)OH
1 record matched 2-chlorophenoxy → CO + cyc-C5H4Cl
1 record matched Ni(3D) + CO2 + H2 → Ni(3D) + CO + H2O
1 record matched ·C(O)C(O)OH → HOCO + CO
1 record matched 1-dibenzofuranylperoxy → 2-benzofuranyl + C2H2 + CO + CO
1 record matched 1-dibenzofuranylperoxy → 1-benzofuranyl + C2H2 + CO + CO
1 record matched C12H7O2 → 2-ethynylphenyl + C2H2 + CO + CO
1 record matched 2,5-dioxy-dibenzofuran → 2-ethynylfuran + CO + CO
1 record matched HOOCH2(CH2)4C(·)=O → ·CH2CH2CH2CH2CH2OOH + CO
1 record matched 3-chlorophenoxy → CO + cyc-C5H4Cl
1 record matched 4-chlorophenoxy → CO + cyc-C5H4Cl
1 record matched SiCCCO → CO + C2Si
1 record matched CHBr2C(O)H → CH2Br2 + CO
1 record matched CH2(OH)CH(OH)CH(OH)CH(OH)CH(OH)C(·)O → CH2(OH)CH(OH)CH(OH)CH(OH)CH(·)OH + CO
1 record matched CH2(OH)CH(OH)CH(OH)CH(OH)CH(·)OH + CO → CH2(OH)CH(OH)CH(OH)CH(OH)CH(OH)C(·)O
1 record matched cyc-C6H11-C(·)O → CO + Cyclohexyl
1 record matched cyc-CH2CH2CH2CH2CH2C(CH3)(C(·)O) → cyc-CH2CH2CH2CH2CH2C(·)(CH3) + CO
1 record matched cyc-CH2CH2CH2CH2CH2C(·)(CH3) + CO → cyc-CH2CH2CH2CH2CH2C(CH3)(C(·)O)
1 record matched cyc-C5H9-C(·)O → CO + Cyclopentyl
1 record matched C6H5-CH2C(·)O → CO + Benzyl
1 record matched C6H5-CH(CH3)C(·)O → CO + 1-phenylethyl
1 record matched C6H5-C(CH3)2C(·)O → CO + 2-Phenyl-2-propyl radical
2 records matched 2,4-cyclopentadienoxy → CO + CH2=CHCH=CH·
1 record matched 2,4-cyclopentadienoxy → cyc-C4H5 + CO
1 record matched 2,3-dichlorophenoxy radical → 1,2-dichlorocyclopentadienyl + CO
1 record matched 2,5-dichlorophenoxy radical → 1,3-dichlorocyclopentadienyl + CO
1 record matched 3,4-dichlorophenoxy radical → 1,2-dichlorocyclopentadienyl + CO
1 record matched 3,5-dichlorophenoxy radical → 1,3-dichlorocyclopentadienyl + CO
1 record matched 2,3,4-trichlorophenoxy radical → 1,2,3-trichlorocyclopentadienyl + CO
1 record matched 2,3,5-trichlorophenoxy radical → 1,2,4-trichlorocyclopentadienyl + CO
1 record matched 2,3,6-trichlorophenoxy radical → 1,2,3-trichlorocyclopentadienyl + CO
1 record matched 2,4,5-trichlorophenoxy radical → 1,2,4-trichlorocyclopentadienyl + CO
1 record matched 3,4,5-trichlorophenoxy radical → 1,2,3-trichlorocyclopentadienyl + CO
1 record matched 2,3,4,5-tetrachlorophenoxy radical → tetrachlorocyclopentadienyl + CO
1 record matched 2,3,4,6-tetrachlorophenoxy radical → tetrachlorocyclopentadienyl + CO
1 record matched 2,3,5,6-tetrachlorophenoxy radical → tetrachlorocyclopentadienyl + CO
1 record matched 2,6-dichlorophenoxy radical → 1,2-dichlorocyclopentadienyl + CO
1 record matched cis-CHCl=CCl· + O2 → CO + ClCO + HCl
1 record matched CH2ONi → CO + NiH2
1 record matched CH2ONi → CO + H2 + Ni
1 record matched OC(·)C(O)OOH → OC(·)OOH + CO
2 records matched Cr(CO)2 → CO + CrCO
1 record matched 34S + COS → CO + SO
1 record matched hydroxycyclopentadienyl radical → CO + CH2=CHCH=CH·
2 records matched 4H-Pyranyl → CO + CH2=CHCH=CH·
1 record matched HC(OH)(OO·)CHO → HCOOH + CO + ·OH
1 record matched HC(OH)(OOH)C(·)O → HCOOH + CO + ·OH
1 record matched ·OCH2O· → CO + H2O
1 record matched Bicyclo(3.1.0)hex-2-en-6-one → Cyclopentadiene + CO
1 record matched (3Z)-1,3,5-Hexatrien-1-one → Cyclopentadiene + CO
1 record matched cis-CH2=CHCH2CH2=CHC(·)=O → CO + CH2=CHCH2CH=CH·
1 record matched cis-CH2=CHCH=CHCH2C(·)=O → CO + CH2=CHCH=CHCH2·
1 record matched cyclopent-2-enyl formyl radical → cyclopent-2-en-1-yl + CO
1 record matched CH2=C=C=CHC(O)· → CO + CH2C(·)CCCH
1 record matched (eta(5)-C5H4P)Rh(CO)2 → (eta(5)-C5H4P)RhCO + CO
1 record matched HOCH2C(CH3)(OOH)C(O)· → CH3C(O)CH2OH + CO + ·OH
1 record matched ·CH=CHCH=CH=CO → CO + CH2=C=CH
2 records matched CH2=CHCH2CH2C(O)· → CO + CH2=CHCH2CH2·
1 record matched 3-Pyridoxy → CO + 1H-Pyrrol-1-yl
1 record matched peroxyacrylic acid + ·OH → HOCH2CHO + CO + ·OH
1 record matched methacryloylperoxy nitrate + ·OH → CH3C(O)CH2OH + CO + NO3
1 record matched methacrylicperoxy acid + ·OH → CH3C(O)CH2OH + CO + ·OH
1 record matched CH3CH2CH2CH2OC(=O)· → CO + CH3CH2CH2CH2
1 record matched 2,4-cyclopentadien-3-oxy → CO + CH2=CHCH=CH·
1 record matched Methylenephenanthrenyl + O· → 1-Phenanthryl + CO
1 record matched ·C(O)OCCl3 → CO + CCl3O
1 record matched 1H-Isochromene-1-yl radical → Other Products + CO
1 record matched HOOCH2OC(O)· → HCOOH + CO + ·OH
1 record matched (Z)-HC(O)OH → CO + H2O
1 record matched ·CH2CH2CH2CH2C(=O)· → ·CH2CH2CH2CH2· + CO
1 record matched (2R,3R)-2-Me-2,3,4-triOOH-1-oxo-1-butyl → CH3C(·)(OOH)CH(OOH)CH2OOH + CO
1 record matched (2R,3S)-2-Me-2,3,4-triOOH-1-oxo-1-butyl → CH3C(·)(OOH)CH(OOH)CH2OOH + CO
1 record matched CH(X2 Pi) + HCCO → C2H2 + CO
1 record matched CH3CH(·)CHCO → CO + CH3CH=C(·)H
1 record matched ·CH2CH=CO + CO → Products
3 records matched ·CH2CH=CO → CO + C2H3
1 record matched C2H5CH(CH3)C(O)· → CO + sec-C4H9
1 record matched naphthalen-2-olate → CO + 1H-Inden-1-yl
1 record matched ·CH2CHCCH2 + CO → Products
1 record matched trans-HC(O·)SH → CO + H2S
1 record matched [·OH..OH2] complex + CO → CO2 + H2O + H·
1 record matched CH_2(aA_1) + H2C=C=O → C2H4 + CO
1 record matched C(OOH)H2CO → CO + ·CH2OOH
1 record matched C2(a3PIu) + O2 → CO + CO
1 record matched O=Cu=C=O → CO + CuO
1 record matched S=Cu=C=O → CO + CuS
1 record matched CH2=CHC(·)O → CO + C2H3
1 record matched C + O2 → O(1D) + CO
1 record matched Oxirane-d4 + Y → CO + YD(CD3)
1 record matched ·CH3 + O· → CO + H2 + H·
1 record matched CD3 + O· → CO + H2 + H·
1 record matched CO + ·OH → [OH...CO] complex
1 record matched CH3CHO + Y → CO + YH(CH3)
1 record matched Acetone + Y → CO + Y(CH3)2
1 record matched CH2O + Y → CO + YH2

Search returned 2009 records.