Kinetics Database Logo

Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences


Rate Our Products and Services


Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty


Administrative Links

NIST home page

MML home page

Chemical Sciences Division

  NIST Logo Home
©NIST, 2020
Accessibility information

Search Results

Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
1 record matched Acetone + ·OH → CH3C(O)OH + ·CH3
2 records matched HO2 + CH3C(O)OO(·) → CH3C(O)OH + O3
3 records matched CH3O2· + CH3C(O)OO(·) → CH2O + CH3C(O)OH + O2
1 record matched CH3O2· + CH3C(O)OO(·) → Other Products + CH3C(O)OH
1 record matched (CH3CO)2O → CH3C(O)OH + H2C=C=O
2 records matched CH3C(O)OH + ·Cl → Other Products + HCl
1 record matched CH3C(O)OH + ·Cl → Products
4 records matched CH3C(O)OH + ·OH → Other Products + H2O
3 records matched CH3C(O)OH + ·OH → Products
1 record matched Benzyl alcohol, m-fluoro-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-3-fluoro-
1 record matched CH3C(O)OCH2CH2C[Si(CH3)3]3 → CH2=CHC[Si(CH3)3]3 + CH3C(O)OH
1 record matched Benzyl alcohol, p-iodo-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-4-iodo-
1 record matched CH3C(O)OCH(CH3)CH2F → CH3C(O)OH + CH2=CHCH2F
1 record matched 2,4-Dimethyl-3-pentanol acetate → Other Products + CH3C(O)OH
1 record matched Benzenemethanol, 3-chloro-α-[(trimethylsilyl)methyl]-, acetate → Silane, [2-(3-chlorophenyl)ethenyl]trimethyl- + CH3C(O)OH
1 record matched Benzenemethanol, 4-chloro-α-[(trimethylsilyl)methyl]-, acetate → CH3C(O)OH + Silane, [2-(4-chlorophenyl)ethenyl]trimethyl-
1 record matched Benzenemethanol, α-[(trimethylsilyl)methyl]-, acetate → CH3C(O)OH + Silane, trimethyl(2-phenylethenyl)-
1 record matched Benzenemethanol, 4-methyl-α-[(trimethylsilyl)methyl]-, acetate → CH3C(O)OH + Silane, trimethyl[2-(4-methylphenyl)ethenyl]-
1 record matched Ethanol, 2-(dimethylphenylsilyl)-, acetate → CH3C(O)OH + Silane, ethenyldimethylphenyl-
1 record matched Benzenemethanol, 3-methyl-α-[(trimethylsilyl)methyl]-, acetate → Silane, trimethyl[2-(3-methylphenyl)ethenyl]- + CH3C(O)OH
1 record matched 2-Pyridinemethanol, 4-ethoxy-α-methyl-, acetate → Other Products + CH3C(O)OH
1 record matched 2-Pyridinemethanol, 6-ethoxy-α-methyl-, acetate → CH3C(O)OH + Pyridine, 2-ethenyl-6-ethoxy-
1 record matched 2-Pyridinemethanol, 5-chloro-α-methyl-, acetate → Other Products + CH3C(O)OH
1 record matched 2-Pyridinemethanol, α,4-dimethyl-, acetate → CH3C(O)OH + Pyridine, 2-ethenyl-4-methyl-
1 record matched 2-Pyridinemethanol, α,6-dimethyl-, acetate → CH3C(O)OH + Pyridine, 2-ethenyl-6-methyl-
1 record matched 2-Pyridinemethanol, α,5-dimethyl-, acetate → CH3C(O)OH + Pyridine, 2-ethenyl-5-methyl-
1 record matched 2-Pyridinemethanol, α,α-dimethyl-, acetate → CH3C(O)OH + Pyridine, 2-(1-methylethyl)-
1 record matched 3-Pyridinemethanol, α,α-dimethyl-, acetate → CH3C(O)OH + Pyridine, 3-(1-methylethyl)-
1 record matched Benzenemethanol, 4-chloro-α,α-dimethyl-, acetate → CH3C(O)OH + Benzene, 1-chloro-4-(1-methylethenyl)-
1 record matched Benzo[b]thiophene-7-methanol, α-methyl-, acetate → Other Products + CH3C(O)OH
1 record matched Benzo[b]thiophene-6-methanol, α-methyl-, acetate → Other Products + CH3C(O)OH
1 record matched Benzo[b]thiophene-5-methanol, α-methyl-, acetate → Other Products + CH3C(O)OH
1 record matched Benzo[b]thiophene-4-methanol, α-methyl-, acetate → Other Products + CH3C(O)OH
1 record matched CH3C(O)OC(CH2CH3)(CH3)CH(CH3)2 → Other Products + CH3C(O)OH
1 record matched Benzyl alcohol, p-(1,1-dimethylethyl)-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-(1,1-dimethylethyl)-4-ethenyl-
1 record matched CH3C(O)OCH(CH3)CH2C(CH3)3 → CH3C(O)OH + (CH3)3CCH2CH=CH2
1 record matched CH3C(O)OCH(CH3)CH2C(CH3)3 → Other Products + CH3C(O)OH
1 record matched Benzeneethanol, 2-fluoro-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-2-fluoro-
1 record matched Benzeneethanol, 4-fluoro-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-4-fluoro-
1 record matched Benzeneethanol, 2,3,4,5,6-pentafluoro-, acetate → CH3C(O)OH + Benzene, ethenylpentafluoro-
1 record matched Benzeneethanol, 4-chloro-, acetate → CH3C(O)OH + Benzene, 1-chloro-4-ethenyl-
1 record matched Benzeneethanol, 3-fluoro-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-3-fluoro-
1 record matched Benzeneethanol, 3-(trifluoromethyl)-, acetate → Other Products + CH3C(O)OH
1 record matched Benzeneethanol, 2-(trifluoromethyl)-, acetate → Other Products + CH3C(O)OH
1 record matched 1-Propanol, 3-phenoxy-, acetate → CH3C(O)OH + Benzene,(2-propenyloxy)-
1 record matched CH3C(O)OC(CH3)2C(O)OCH3 → CH3C(O)OH + Methyl methacrylate
1 record matched CH3C(O)O(CH2)4SCH3 → CH3C(O)OH + CH3SCH2CH2CH=CH2
1 record matched 1-Naphthalenemethanol, α-methyl-, acetate → CH3C(O)OH + 1-Ethenylnaphthalene
2 records matched CH3C(O)OC(CN)(CH3)2 → CH3C(O)OH + CH2=C(CH3)CN
1 record matched CH3C(O)OCH2CH2C≡CH → CH3C(O)OH + Vinylacetylene
1 record matched 4-Pyridinemethanol, α,α-dimethyl-, acetate → CH3C(O)OH + Pyridine, 4-(1-methylethyl)-
1 record matched 5-Hexen-3-ol, 2,2-dimethyl-, acetate → Other Products + CH3C(O)OH
1 record matched Cyclopentaneethanol acetate → CH3C(O)OH + Cyclopentane, ethenyl-
1 record matched CH3C(O)O(CH2)3OCH3 → CH3C(O)OH + CH2=CHCH2OCH3
1 record matched CH3C(O)OCH(CH2CH3)C(CH3)3 → CH3C(O)OH + CH3CH=CHC(CH3)3
1 record matched 3-Pentanol, 2,2,4-trimethyl-, acetate → CH3C(O)OH + (CH3)3CCH=C(CH3)2
1 record matched CH3C(O)OCH(CH3)CH2CH3 → CH3C(O)OH + 1-C4H8
1 record matched CH3C(O)OCH2CH2C(O)OCH3 → CH3C(O)OH + CH2=CHC(O)OCH3
1 record matched CH3C(O)OO(·) + CH3C(O)CH2OO· → CH3C(O)OH + CH3C(O)CHO + O2
1 record matched Cyclopentanol, 2-chloro-, acetate, cis- → CH3C(O)OH + Cyclopentene, 3-chloro-
1 record matched Cyclopentanol, 2-chloro-, acetate, trans- → CH3C(O)OH + Cyclopentene, 1-chloro-
1 record matched Cyclopentanol, 2-chloro-, acetate, trans- → CH3C(O)OH + Cyclopentene, 3-chloro-
1 record matched Cyclohexanol, 2-chloro-, acetate, cis- → CH3C(O)OH + Cyclohexene, 3-chloro-
1 record matched CH3C(O)OCH2CH2CH(CH3)CH2CH3 → CH3C(O)OH + C2H5CH(CH3)CH=CH2
2 records matched 3-Pyridinemethanol, α-methyl-, acetate → CH3C(O)OH + Pyridine, 3-etheryl-
1 record matched 8-Quinolinemethanol, α-acetate → CH3C(O)OH + Quinoline, 8-ethenyl-
1 record matched 7-Quinolinemethanol, α-methyl-, acetate → Quinoline, 7-ethenyl- + CH3C(O)OH
1 record matched 6-Quinolinemethanol, α-methyl-, acetate → Quinoline, 6-ethenyl- + CH3C(O)OH
1 record matched 5-Quinolinemethanol, α-methyl-, acetate → Quinoline, 5-ethenyl- + CH3C(O)OH
1 record matched 4-Quinolinemethanol, α-methyl-, acetate → CH3C(O)OH + Quinoline, 4-ethenyl-
1 record matched 3-Quinolinemethanol, α-methyl-, acetate → Quinoline, 3-ethenyl- + CH3C(O)OH
1 record matched 2-Quinolinemethanol, α-methyl-, acetate → CH3C(O)OH + Quinoline, 2-ethenyl-
1 record matched CH3C(O)OCH(CH3)CH(CH3)C2H5 → Other Products + CH3C(O)OH
1 record matched 2-Pentanol, 2-methyl-, acetate → Other Products + CH3C(O)OH
1 record matched CH3C(O)OC(CH3)2CH2CH(CH3)2 → CH3C(O)OH + (CH3)2CHCH2C(CH3)=CH2
1 record matched Cyclohexanol, 2-chloro-, acetate, trans- → CH3C(O)OH + Cyclohexene, 3-chloro-
1 record matched Cyclohexanol, 2-chloro-, acetate, trans- → CH3C(O)OH + Cyclohexene, 1-chloro-
2 records matched Phenylethyl alchol, m-chloro, acetate → CH3C(O)OH + Benzene, 1-chloro-3-ethenyl-
1 record matched Benzyl alcohol, p-benzyl-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-4-(phenylmethyl)-
1 record matched Benzyl alcohol, o-benzyl-α-methyl-, acetate → Other Products + CH3C(O)OH
1 record matched Benzyl alcohol, α-methyl-p-(methylthio)-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-4-(methylthio)-
1 record matched Benzyl alcohol, α-methyl-o-(methylthio)-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-2-(methylthio)-
1 record matched Benzyl alcohol, α-methyl-p-(phenylthio)-, acetate → Other Products + CH3C(O)OH
1 record matched Benzyl alcohol, α-methyl-m-(phenylthio)-, acetate → Other Products + CH3C(O)OH
1 record matched Benzyl alcohol, α-methyl-o-(phenylthio)-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-2-(phenylthio)-
1 record matched Benzyl alcohol, α-methyl-p-(phenoxy)-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-4-phenoxy-
1 record matched Benzyl alcohol, α-methyl-o-(phenoxy)-, acetate → Other Products + CH3C(O)OH
1 record matched 2-Naphthalenemethanol, α-methyl-, acetate → CH3C(O)OH + Naphthalene, 2-ethenyl-
1 record matched Benzyl alcohol, o-iodo-α-methyl-, acetate → Other Products + CH3C(O)OH
1 record matched Benzyl alcohol, α-methyl-o-nitro-, acetate → CH3C(O)OH + (CH2=CH)-C6H4-2-(NO2)
1 record matched Benzyl alcohol, α-methyl-p-(trifluoromethyl)-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-4-(trifluoromethyl)-
1 record matched Benzyl alcohol, α-methyl-m-(trifluoromethyl)-, acetate → CH3C(O)OH + Benzene, 1-(trifluoromethyl)-3-(ethenyl)-
1 record matched Benzyl alcohol, α-methyl-o-(trifluoromethyl)-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-2-(trifluoromethyl)-
2 records matched CH3C(O)OCH(CH3)CH2N(CH3)2 → CH3C(O)OH + CH2=CHCH2N(CH3)2
1 record matched CH3C(O)OCH(CH3)-C6F5 → CH3C(O)OH + Benzene, ethenylpentafluoro-
1 record matched 3-Benzofuranmethanol, α-methyl-, acetate → CH3C(O)OH + Benzofuran, 3-ethenyl-
1 record matched 2-Benzofuranmethanol, α-methyl-, acetate → CH3C(O)OH + Benzofuran, 2-ethenyl-
1 record matched Benzo[b]thiophene-3-methanol, α-methyl-, acetate → CH3C(O)OH + Benzo[b]thiophene, 3-ethenyl-
1 record matched Benzo[b]thiophene-2-methanol, α-methyl-, acetate → CH3C(O)OH + Benzo[b]thiophene, 2-ethenyl-
1 record matched Benzenemethanol, α-phenyl-, acetate → CH3C(O)OH + 1,2-Diphenylethylene
1 record matched Cyclopentadecanol acetate → CH3C(O)OH + Cyclopentadecene (unspecified)
2 records matched Benzeneethanol, 4-methoxy-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-4-methoxy-
2 records matched Benzeneethanol, 4-methyl-, acetate → CH3C(O)OH + 4-Methylstyrene
1 record matched 2-Furanmethanol, α-methyl-, acetate → CH3C(O)OH + Furan, 2-ethenyl-
1 record matched 2-Thiophenemethanol, α-methyl-, acetate → CH3C(O)OH + Thiophene, 2-ethenyl-
1 record matched 3-Furan methanol, α-methyl-, acetate → CH3C(O)OH + Furan, 3-ethyenyl-
1 record matched Cyclohexaneethanol acetate → CH3C(O)OH + Cyclohexane, ethenyl-
1 record matched Cyclohexanol, 5-methyl-2-(1-methylethyl)-, acetate,(1α,2β,5β)- → CH3C(O)OH + Cyclohexene, 3-methyl-6-(1-methylethyl)-, cis-
1 record matched Cyclohexanol, 5-methyl-2-(1-methylethyl)-, acetate,(1α,2β,5β)- → CH3C(O)OH + Cyclohexene, 4-methyl-1-(1-methylethyl)-
1 record matched Cyclohexanol, 2-(1,1-dimethylethyl)-, acetate, trans- → CH3C(O)OH + Cyclohexene, 3-(1,1-dimethylethyl)-
1 record matched Cyclohexanol, 2-(1,1-dimethylethyl)-, acetate, trans- → CH3C(O)OH + Cyclohexene, 1-(1,1-dimethylethyl)-
1 record matched Cyclohexanol, 2-(1,1-dimethylethyl)-, acetate, cis- → CH3C(O)OH + Cyclohexene, 3-(1,1-dimethylethyl)-
1 record matched C2H5CH(CH3)O2 → CH3C(O)OH + ·C2H5
4 records matched Benzenemethanol, 4-chloro-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-chloro-4-ethenyl-
4 records matched Benzenemethanol, α,4-dimethyl-, acetate → CH3C(O)OH + 4-Methylstyrene
3 records matched Benzyl alcohol, o-methoxy-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-2-methoxy-
4 records matched Benzenemethanol, α-methyl-3-nitro-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-3-nitro-
2 records matched Benzenemethanol, α-methyl-4-nitro-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-4-nitro-
3 records matched Benzyl alcohol, m-chloro-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-chloro-3-ethenyl-
3 records matched Benzyl alcohol, p-bromo-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-bromo-4-ethenyl-
2 records matched Benzenemethanol, α, 3-dimethyl-, acetate → CH3C(O)OH + 3-Methylstyrene
4 records matched Benzyl alcohol, o,α-dimethyl-, acetate → CH3C(O)OH + 2-Methylstyrene
1 record matched CH3C(O)OCH(CH3)CCl3 → CH3C(O)OH + CH2=CHCCl3
1 record matched Cycloheptanol acetate → CH3C(O)OH + (Z)-Cycloheptene
1 record matched CH3C(O)OCH2CH2Si(C2H5)3 → CH3C(O)OH + CH2=CHSi(C2H5)3
1 record matched 2-Acetoxycyclohexanone → CH3C(O)OH + 2-Cyclohexen-1-one
1 record matched Cyclohexanol, 1-methyl-, acetate → Other Products + CH3C(O)OH
1 record matched CH3C(O)OCH2CH2Si(CH3)3 → CH3C(O)OH + CH2=CHSi(CH3)3
1 record matched CH3C(O)OCH(CH3)CN → CH3C(O)OH + CH2CHCN
1 record matched Cyclohexanol, 2-methyl-, acetate,(1R-trans)- → CH3C(O)OH + Cyclohexene, 1-methyl-
1 record matched Cyclohexanol, 2-methyl-, acetate,(1R-trans)- → CH3C(O)OH + Cyclohexene, 3-methyl-
1 record matched Cyclohexanol, 2-methyl-, acetate,(1S-cis)- → CH3C(O)OH + Cyclohexene, 3-methyl-
1 record matched CH3C(O)O(CH2)4OCH3 → CH3C(O)OH + CH2=CHCH2CH2OCH3
1 record matched 3-Thiophenemethanol, α-methyl-, acetate → CH3C(O)OH + Thiophene, 3-ethyenyl-
1 record matched CH3COOCH2COOH → CH2O + CH3C(O)OH + CO
1 record matched 3-Cyclohexen-1-ol acetate → CH3C(O)OH + 1,4-Cyclohexadiene
1 record matched CH3C(O)OCH(CH3)CH2CH2C6H5 → Other Products + CH3C(O)OH
1 record matched Cyclohexanol, 4-(1,1-dimethylethyl)-, acetate, cis- → CH3C(O)OH + Cyclohexene, 4-(1,1-dimethylethyl)-
1 record matched CH3C(O)OC(CH3)(C2H5)2 → Other Products + CH3C(O)OH
1 record matched CH3C(O)OC(CH3)2C(O)CH3 → CH3C(O)OH + CH2=C(CH3)C(=O)CH3
1 record matched CH3C(O)OCH2CH2C(O)CH3 → CH3C(O)OH + CH2=CHCOCH3
1 record matched 1-butanol, 2-ethyl-, acetate → CH3C(O)OH + (C2H5)2C=CH2
1 record matched Bicyclo[2.2.1]hept-2-en-7-ol, 7-methyl, acetate, syn- → Other Products + CH3C(O)OH
1 record matched Bicyclo[2.2.1]hept-2-en-7-ol, 7-methyl, acetate, anti- → Other Products + CH3C(O)OH
1 record matched Cyclodecanol acetate → CH3C(O)OH + Cyclodecene (unspecified)
1 record matched Benzenemethanol, α,α,3-methyl-, acetate → CH3C(O)OH + Benzene, 1-methyl-3-(1-methylethenyl)-
1 record matched Benzenemethanol, 3-chloro-α,α-dimethyl-, acetate → CH3C(O)OH + Benzene, 1-chloro-3-(1-methylethyl)-
1 record matched Bicyclo[2.2.1]heptan-7-ol, 7-methyl, acetate → CH3C(O)OH + Bicyclo[2.2.1]heptane,7-methylene-
1 record matched Benzyl alcohol, m-bromo-α-methyl- acetate → CH3C(O)OH + Benzene, 1-bromo-3-ethenyl-
3 records matched CH3C(O)OCH(CH3)C(O)OCH3 → CH3C(O)OH + CH2=CHC(O)OCH3
1 record matched Cyclododecanol acetate → CH3C(O)OH + Cyclododecene (unspecified)
1 record matched Ethanol, 2-phenoxy-, acetate → CH3C(O)OH + Benzene,(ethenyloxy)-
1 record matched 4-Heptanol, acetate → CH3C(O)OH + (E)-3-heptene
1 record matched CH3C(O)OCH(C2H5)C4H9-n → Other Products + CH3C(O)OH
1 record matched 2-Heptanol, acetate → Other Products + CH3C(O)OH
1 record matched CH3C(O)O(CH2)2SCH3 → CH3C(O)OH + CH2=CHSCH3
1 record matched CH3C(O)OCH(CH3)CH(CH3)2 → Other Products + CH3C(O)OH
1 record matched CH3C(O)O(CH2)2CN → CH3C(O)OH + CH2CHCN
1 record matched CH3C(O)O(CH2)3C(O)CH3 → CH3C(O)OH + CH3C(O)CH2CH=CH2
1 record matched CH3C(O)O(CH2)3C(O)CH3 → CH3C(O)OH + CH3CH=CHC(=O)CH3 (unspecified)
1 record matched CH3C(O)O(CH2)3C(O)CH3 → Other Products + CH3C(O)OH
1 record matched Benzenemethanol, α,α,4-trimethyl-, acetate → CH3C(O)OH + Benzene, 1-methyl-4-(1-methylethenyl)-
1 record matched CH3C(O)O(CH2)4CH=CH2 → CH3C(O)OH + CH2=CHCH2CH2CH=CH2
2 records matched CH3C(O)OCH(CH3)C(O)CH3 → CH3C(O)OH + CH2=CHCOCH3
1 record matched CH3C(O)OC(CH3)2CH(CH3)2 → Other Products + CH3C(O)OH
1 record matched CH3C(O)O(CH2)2CH2N(CH3)2 → Other Products + CH3C(O)OH
10 records matched HO2 + CH3C(O)OO(·) → CH3C(O)OH + O3
1 record matched C2H5OO· + CH3C(O)OO(·) → CH3C(O)OH + CH3CHO + O2
3 records matched Benzyl alcohol, p-fluoro-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-4-fluoro-
1 record matched CH3C(O)OCH2CH2Ge(C2H5)3 → CH3C(O)OH + CH2=CHGe(C2H5)3
2 records matched CH3C(O)OCH(CH3)CH2CH=CH2 → Other Products + CH3C(O)OH
2 records matched 4-Pyridinemethanol, α-methyl-, acetate → CH3C(O)OH + 4-Vinylpyridine
3 records matched 2-Pyridinemethanol, α-methyl-, acetate → CH3C(O)OH + 2-Vinylpyridine
1 record matched 1,2-Cyclohexanol diacetate, cis- → CH3C(O)OH + 2-Cyclohexen-1-ol acetate
2 records matched CH3O2· + CH3C(O)OO(·) → CH2O + CH3C(O)OH + O2
1 record matched CH3O2· + CH3C(O)OO(·) → Other Products + CH3C(O)OH
1 record matched CH3C(O)OCH(CH3)CH2C6H5 → Other Products + CH3C(O)OH
2 records matched CH3C(O)OC(CH3)2C(CH3)3 → CH3C(O)OH + (CH3)3CC(CH3)=CH2
1 record matched Cyclohexanol, 4-(1,1-dimethylethyl)-, acetate, trans- → CH3C(O)OH + Cyclohexene, 4-(1,1-dimethylethyl)-
2 records matched Benzyl alcohol, o-fluoro-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-2-fluoro-
3 records matched Benzyl alcohol, o-chloro-α-methyl-, acetate → CH3C(O)OH + 2-Chlorostyrene
3 records matched Benzyl alcohol, o-bromo-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-bromo-2-ethenyl-
1 record matched 1,2-Cyclohexanediol diacetate, trans- → CH3C(O)OH + 2-Cyclohexen-1-ol acetate
1 record matched 1,2-Cyclohexanediol diacetate, trans- → CH3C(O)OH + 1-Cyclohexen-1-ol acetate
1 record matched CH3C(O)OC(CH3)2CH2C(O)CH3 → CH3C(O)OH + CH3C(O)CH2C(CH3)=CH2
1 record matched CH3C(O)OC(CH3)2CH2C(O)CH3 → CH3C(O)OH + (CH3)2C=CHC(=O)CH3
1 record matched CH3C(O)O(CH2)3CH=CH2 → CH3C(O)OH + CH2=CHCH2CH=CH2
1 record matched CH3C(O)O(CH2)2CH=CH2 → CH3C(O)OH + 1,3-Butadiene
1 record matched CH3C(O)O(CH2)2N(CH3)2 → CH3C(O)OH + CH2=CHN(CH3)2
2 records matched CH3C(O)O(CH2)2C(CH3)3 → CH3C(O)OH + (CH3)3CCH=CH2
3 records matched Benzyl alcohol, p-methoxy-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-4-methoxy-
2 records matched Cyclopentanol acetate → CH3C(O)OH + Cyclopentene
1 record matched CH3C(O)O(CH2)2CH=C(CH3)2 → Other Products + CH3C(O)OH
1 record matched CH3C(O)OC(CH3)2CH2CH=CH2 → Other Products + CH3C(O)OH
1 record matched Cyclooctanol acetate → CH3C(O)OH + (Z)-Cyclooctene
1 record matched CH3CH(O2)OCHCH3 → CH3C(O)OH + CH3CHO
1 record matched CH3C(O)OCH2CH2CH2CH(CH3)2 → CH3C(O)OH + (CH3)2CHCH2CH=CH2
1 record matched Acetic acid, pentyl ester → CH3C(O)OH + 1-C5H10
1 record matched 2-Pentanol, acetate → Other Products + CH3C(O)OH
2 records matched CH3C(O)NHC(O)CH3 → CH3C(O)OH + CH3CN
2 records matched CH3C(O)OC(CH3)2CH2CH3 → CH3C(O)OH + C2H5C(CH3)=CH2
1 record matched CH3C(O)OC(CH3)2CH2CH3 → CH3C(O)OH + (CH3)2C=CHCH3
1 record matched CH3C(O)OC(CH3)2CH2CH3 → Other Products + CH3C(O)OH
1 record matched 1-Butanol, 2-methyl-, acetate → CH3C(O)OH + C2H5C(CH3)=CH2
2 records matched CH3C(O)OCH(CH3)CH2Cl → CH3C(O)OH + CH2=CHCH2Cl
3 records matched Acetic acid cyclohexyl ester → CH3C(O)OH + Cyclohexene
1 record matched CH3C(O)OCH(C2H5)2 → CH3C(O)OH + CH3CH=CHC2H5
1 record matched CH3C(O)OCH(CH3)C(CH3)3 → CH3C(O)OH + (CH3)3CCH=CH2
1 record matched CH3C(O)OCH2CH2Cl → CH3C(O)OH + CH2=CHCl
7 records matched CH3C(O)OC(CH3)3 → CH3C(O)OH + iso-C4H8
1 record matched CH3COOCH(CH3)COOH → CH3C(O)OH + CH3CHO + CO
1 record matched CH3C(O)OCH2CH2F → CH3C(O)OH + CH2=CHF
1 record matched CH2(COOH)2 → CH3C(O)OH + CO2
20 records matched CH3C(O)OC2H5 → CH3C(O)OH + C2H4
3 records matched CH3C(O)O(CH2)2CH(CH3)2 → CH3C(O)OH + (CH3)2CHCH=CH2
1 record matched CH3COO(CH2)3CH3 → CH3C(O)OH + iso-C4H8
2 records matched CH3COO(CH2)3CH3 → CH3C(O)OH + 1-C4H8
1 record matched Benzenepropanol acetate → CH3C(O)OH + 3-Phenylpropene
1 record matched CH3C(O)OCH2CH2OC(O)CH3 → CH3C(O)OH + CH3CO2CH=CH2
1 record matched 2-Ethoxyethyl acetate → CH3C(O)OH + CH2=CHOC2H5
3 records matched CH3C(O)O(CH2)2OCH3 → CH3C(O)OH + CH2=CHOCH3
1 record matched isobutyl acetate → CH3C(O)OH + iso-C4H8
2 records matched CH3COOCH2CH2CH3 → CH3C(O)OH + CH3CH=CH2
1 record matched 2-Propanol, 1-methoxy-, acetate → Other Products + CH3C(O)OH
4 records matched (CH3CO)2O → CH3C(O)OH + H2C=C=O
8 records matched CH3COOCH(CH3)2 → CH3C(O)OH + CH3CH=CH2
1 record matched CH3COOCH(CH3)C2H5 → Other Products + CH3C(O)OH
3 records matched Acetic acid 2-phenylethyl ester → CH3C(O)OH + Styrene
9 records matched Benzenemethanol, α-methyl-, acetate → CH3C(O)OH + Styrene
1 record matched CH3C(O)OOH + 2-(E)-C5H10 → CH3C(O)OH + trans-2-ethyl-3-methyl-oxirane
1 record matched CH3C(O)OOH + 2-(Z)-C5H10 → CH3C(O)OH + cis-2-ethyl-3-methyl-oxirane
1 record matched CH3C(O)OOH + (E)-2-C4H8 → CH3C(O)OH + trans-2,3-Dimethyloxirane
1 record matched CH3C(O)OOH + 1-C6H12 → CH3C(O)OH + Oxirane, butyl-
1 record matched CH3C(O)OOH + (Z)-2-C4H8 → CH3C(O)OH + cis-2,3-Dimethyloxirane
1 record matched CH3C(O)OOH + C2H5C(CH3)=CH2 → CH3C(O)OH + 2-ethyl-2-methyl-oxirane
1 record matched CH3C(O)OOH + (CH3)2CHCH=CH2 → CH3C(O)OH + (1-methylethyl)oxirane
1 record matched CH3C(O)OOH + (CH3)2C=CHCH3 → CH3C(O)OH + 2,2,3-trimethyl-oxirane
1 record matched CH3C(O)OOH + iso-C4H8 → CH3C(O)OH + 2,2-Dimethyloxirane
1 record matched CH3C(O)OOH + CH3CH=CH2 → CH3C(O)OH + Methyloxirane
1 record matched CH3C(O)OOH + 1-C4H8 → CH3C(O)OH + Ethyloxirane
1 record matched CH3CHO + ·OH → CH3C(O)OH + H·
3 records matched Acetone + ·OH → CH3C(O)OH + ·CH3
1 record matched CH3C(O)OH + (CH3)2C(·)OO· → Products
1 record matched CH3C(O)OH + CH3CH(·)OO· → Products
3 records matched CH3C(O)OH + ·Cl → Other Products + HCl
2 records matched CH3C(O)OH + ·Cl → Products
1 record matched CH3C(O)OH + ·OH → CO2 + ·CH3 + H2O
3 records matched CH3C(O)OH + ·OH → Other Products + H2O
7 records matched CH3C(O)OH + ·OH → Products
2 records matched CH3C(O)OH + H2C=C=O → (CH3CO)2O
8 records matched CH3C(O)OH → H2C=C=O + H2O
7 records matched CH3C(O)OH → CH4 + CO2
1 record matched Benzene methane(1-d1)-ol, α-methyl-, acetate → CH3C(O)OH + Benzene, ethenyl-1-d-
1 record matched Erythoro-CH3C(O)OCH(C6H5)CHDC6H5 → CH3C(O)OH + C6H5CH=CDC6H5
1 record matched CH3C(O)OCD2CHD2 → CH3C(O)OH + C2D4
1 record matched Threo-Benzene ethan (2β-d-ol)-, α-phenyl-, acetate → CH3C(O)OH + C6H5CH=CDC6H5
1 record matched 9H-Fluorene-2-methanol, α-methyl-, acetate → CH3C(O)OH + 9H-Fluorene, 2-ethenyl-
1 record matched Benzenemethanol, α-methyl-o-phenyl-, acetate → CH3C(O)OH + 1,1'-Biphenyl, 2-ethenyl-
1 record matched Benzenenethanol. α-methyl-4-phenyl-, acetate → CH3C(O)OH + 1,1'-Biphenyl, 4-ethenyl-
1 record matched Benzenemethanol, α-methyl-3-phenyl-, acetate → CH3C(O)OH + 1,1'-Biphenyl, 3-ethenyl-
2 records matched Benzenemethanol, 3-iodo-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-3-iodo-
1 record matched CH3C(O)OCH2O → CH3C(O)OH + HCO
1 record matched ·CH(OH)C(O)CH3 + O2 → CH3C(O)OH + CO + ·OH
1 record matched ·CH(OH)C(O)CH3 + O2 → CH3C(O)OH + CO2 + H·
1 record matched (CH3)2C(OOCCH3)COOH → CH3C(O)OH + CH2=C(CH3)COOH
1 record matched (CH3)2C(OOCCH3)COOH → CH3C(O)OH + Acetone + CO
1 record matched p-CH3OC6H4NH(CH2)5O(O)CCH3 → N-(p-methoxyphenyl)piperidine + CH3C(O)OH
1 record matched p-CH3C6H4NH(CH2)5O(O)CCH3 → N-(p-methylphenyl)piperidine + CH3C(O)OH
1 record matched p-ClC6H4NH(CH2)5O(O)CCH3 → N-(p-chlorophenyl)piperidine + CH3C(O)OH
1 record matched p-ClC6H4NH(CH2)4OC(O)CH3 → N-(p-chlorophenyl)pyrrolidine + CH3C(O)OH
1 record matched p-CH3C6H4NH(CH2)4OC(O)CH3 → N-(p-methylphenyl)pyrrolidine + CH3C(O)OH
1 record matched p-CH3OC6H4NH(CH2)4OC(O)CH3 → N-(p-methoxyphenyl)pyrrolidine + CH3C(O)OH
1 record matched CH3N(C6H5)CH2CH2CH2CH2OC(O)CH3 → C6H5N(CH3)CH2CH2CH=CH2 + CH3C(O)OH
1 record matched C6H5NHCH2CH2CH2CH2OC(O)CH3 → CH3C(O)OH + N-Phenylpyrrolidine
1 record matched C6H5NHCH2CH2CH2CH2OC(O)CH3 → aniline + CH3C(O)OH + 1,3-Butadiene
1 record matched C6H5NHCH2CH2CH2CH2OC(O)CH3 → C6H5NHCH2CH2CH=CH2 + CH3C(O)OH
1 record matched C6H5NHCH2CH2CH2CH2CH2OC(O)CH3 → CH3C(O)OH + N-Phenylpiperidine
1 record matched C6H5NHCH2CH2CH2CH2CH2OC(O)CH3 → C6H5NHCH2CH2CH2CH=CH2 + CH3C(O)OH
1 record matched C6H5N(CH3)CH2CH2CH2CH2CH2OC(O)CH3 → C6H5N(CH3)CH2CH2CH2CH=CH2 + CH3C(O)OH
1 record matched 2-butyne-OH adduct + O2 → CH3C(O)OH + CH3CO
1 record matched CH2=C(OH)2 → CH3C(O)OH
3 records matched HO2 + CH3C(O)OO(·) → CH3C(O)OH + O3
1 record matched CH3OOH + CH3CO → CH3C(O)OH + CH3
1 record matched CH3CH(·)OH + O· → CH3C(O)OH + H·
1 record matched CH3C(O)NHC(O)CH3 → CH3C(O)OH + CH2=C=NH
1 record matched CH2(COOH)2 → CH3C(O)OH + CO2
1 record matched CH3C(O)OC2H5 → CH3C(O)OH + C2H4
2 records matched (CH3CO)2O → CH3C(O)OH + H2C=C=O
1 record matched CH3CHO + ·OH → CH3C(O)OH + H·
1 record matched CH3CHO + HO2 → CH3C(O)OH + ·OH
1 record matched Acetone + ·OH → CH3C(O)OH + ·CH3
1 record matched CH3C(O)OH + SiH3 → CH3C(SiH3)(O·)OH
1 record matched CH3C(O)OH + SiH3 → CH3C(·)(OSiH3)OH
2 records matched CH3C(O)OH + ·OH → H2O + CH3C(O)O
2 records matched CH3C(O)OH + ·OH → ·CH2C(O)OH + H2O
1 record matched CH3C(O)OH + ·OH → CO2 + ·CH3 + H2O
1 record matched CH3C(O)OH + ·OH → Other Products + H2O
1 record matched CH3C(O)OH + ·OH → CH3CO(OH)2
1 record matched CH3C(O)OH + (CH3)2C(OCH3)2 → CH3C(O)OH + CH3OH + CH2=C(CH3)OCH3
1 record matched CH3C(O)OH + Benzene + H2 → CH3C(O)OH + 1,4-Cyclohexadiene
1 record matched CH3C(O)OH + Benzene + H2 → CH3C(O)OH + 1,3-Cyclohexadiene
1 record matched CH3C(O)OH → CH2=C(OH)2
1 record matched CH3C(O)OH → H2C=C=O + H2O
1 record matched CH3C(O)OH → CH4 + CO2
1 record matched CH3C(O)OH → Products
1 record matched CH3CONH2 + CH3C(O)OH → (CH3CO)2O + NH3
1 record matched CH3C(O)OCH(O·)CH3 → CH3C(O)OH + CH3CO
1 record matched 2-hydroxy-1,2-dioxolane → CH2O + CH3C(O)OH
1 record matched CH3C(OH)NH + H2C=C=O → CH3C(O)OH + CH3CN
1 record matched CH3C(OH)NH + CH3CONH2 → CH3C(O)OH + CH3CN + NH3
1 record matched CH2OO···H2O complex + CH3C(O)OH → CH3C(O)OH + HOCH2OOH

Search returned 464 records.