 |
Home ©NIST, 2023 Accessibility information |
Contact Us to Submit an Article
Other Databases
NIST Standard Reference Data Program
NDRL-NIST Solution Kinetics Database
NIST Computational Chemistry Comparison and Benchmark Database
The NIST Reference on Constants, Units, and Uncertainty
Administrative Links
Search Results
Click on a link in the table below to see detail on the selected reaction.
| Records | Reaction | |
|---|---|---|
| 1 record matched | Acetone + ·OH → CH3C(O)OH + ·CH3 | |
| 2 records matched | HO2 + CH3C(O)OO(·) → CH3C(O)OH + O3 | |
| 3 records matched | CH3O2· + CH3C(O)OO(·) → CH2O + CH3C(O)OH + O2 | |
| 1 record matched | CH3O2· + CH3C(O)OO(·) → Other Products + CH3C(O)OH | |
| 1 record matched | (CH3CO)2O → CH3C(O)OH + H2C=C=O | |
| 1 record matched | CH3C(O)OH + (CH3)2C(·)OO· → Products | |
| 1 record matched | CH3C(O)OH + CH2OO → Products | |
| 2 records matched | CH3C(O)OH + ·Cl → Other Products + HCl | |
| 1 record matched | CH3C(O)OH + ·Cl → Products | |
| 4 records matched | CH3C(O)OH + ·OH → Other Products + H2O | |
| 3 records matched | CH3C(O)OH + ·OH → Products | |
| 1 record matched | syn-CH3CH(·)OO· + CH3C(O)OH → Products | |
| 1 record matched | anti-CH3CH(·)OO· + CH3C(O)OH → Products | |
| 1 record matched | Benzyl alcohol, m-fluoro-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-3-fluoro- | |
| 1 record matched | CH3C(O)OCH2CH2C[Si(CH3)3]3 → CH2=CHC[Si(CH3)3]3 + CH3C(O)OH | |
| 1 record matched | Benzyl alcohol, p-iodo-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-4-iodo- | |
| 1 record matched | CH3C(O)OCH(CH3)CH2F → CH3C(O)OH + CH2=CHCH2F | |
| 1 record matched | 2,4-Dimethyl-3-pentanol acetate → Other Products + CH3C(O)OH | |
| 1 record matched | Benzenemethanol, 3-chloro-α-[(trimethylsilyl)methyl]-, acetate → Silane, [2-(3-chlorophenyl)ethenyl]trimethyl- + CH3C(O)OH | |
| 1 record matched | Benzenemethanol, 4-chloro-α-[(trimethylsilyl)methyl]-, acetate → CH3C(O)OH + Silane, [2-(4-chlorophenyl)ethenyl]trimethyl- | |
| 1 record matched | Benzenemethanol, α-[(trimethylsilyl)methyl]-, acetate → CH3C(O)OH + Silane, trimethyl(2-phenylethenyl)- | |
| 1 record matched | Benzenemethanol, 4-methyl-α-[(trimethylsilyl)methyl]-, acetate → CH3C(O)OH + Silane, trimethyl[2-(4-methylphenyl)ethenyl]- | |
| 1 record matched | Ethanol, 2-(dimethylphenylsilyl)-, acetate → CH3C(O)OH + Silane, ethenyldimethylphenyl- | |
| 1 record matched | Benzenemethanol, 3-methyl-α-[(trimethylsilyl)methyl]-, acetate → Silane, trimethyl[2-(3-methylphenyl)ethenyl]- + CH3C(O)OH | |
| 1 record matched | 2-Pyridinemethanol, 4-ethoxy-α-methyl-, acetate → Other Products + CH3C(O)OH | |
| 1 record matched | 2-Pyridinemethanol, 6-ethoxy-α-methyl-, acetate → CH3C(O)OH + Pyridine, 2-ethenyl-6-ethoxy- | |
| 1 record matched | 2-Pyridinemethanol, 5-chloro-α-methyl-, acetate → Other Products + CH3C(O)OH | |
| 1 record matched | 2-Pyridinemethanol, α,4-dimethyl-, acetate → CH3C(O)OH + Pyridine, 2-ethenyl-4-methyl- | |
| 1 record matched | 2-Pyridinemethanol, α,6-dimethyl-, acetate → CH3C(O)OH + Pyridine, 2-ethenyl-6-methyl- | |
| 1 record matched | 2-Pyridinemethanol, α,5-dimethyl-, acetate → CH3C(O)OH + Pyridine, 2-ethenyl-5-methyl- | |
| 1 record matched | 2-Pyridinemethanol, α,α-dimethyl-, acetate → CH3C(O)OH + Pyridine, 2-(1-methylethyl)- | |
| 1 record matched | 3-Pyridinemethanol, α,α-dimethyl-, acetate → CH3C(O)OH + Pyridine, 3-(1-methylethyl)- | |
| 1 record matched | Benzenemethanol, 4-chloro-α,α-dimethyl-, acetate → CH3C(O)OH + Benzene, 1-chloro-4-(1-methylethenyl)- | |
| 1 record matched | Benzo[b]thiophene-7-methanol, α-methyl-, acetate → Other Products + CH3C(O)OH | |
| 1 record matched | Benzo[b]thiophene-6-methanol, α-methyl-, acetate → Other Products + CH3C(O)OH | |
| 1 record matched | Benzo[b]thiophene-5-methanol, α-methyl-, acetate → Other Products + CH3C(O)OH | |
| 1 record matched | Benzo[b]thiophene-4-methanol, α-methyl-, acetate → Other Products + CH3C(O)OH | |
| 1 record matched | CH3C(O)OC(CH2CH3)(CH3)CH(CH3)2 → Other Products + CH3C(O)OH | |
| 1 record matched | Benzyl alcohol, p-(1,1-dimethylethyl)-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-(1,1-dimethylethyl)-4-ethenyl- | |
| 1 record matched | CH3C(O)OCH(CH3)CH2C(CH3)3 → CH3C(O)OH + (CH3)3CCH2CH=CH2 | |
| 1 record matched | CH3C(O)OCH(CH3)CH2C(CH3)3 → Other Products + CH3C(O)OH | |
| 1 record matched | Benzeneethanol, 2-fluoro-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-2-fluoro- | |
| 1 record matched | Benzeneethanol, 4-fluoro-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-4-fluoro- | |
| 1 record matched | Benzeneethanol, 2,3,4,5,6-pentafluoro-, acetate → CH3C(O)OH + Benzene, ethenylpentafluoro- | |
| 1 record matched | Benzeneethanol, 4-chloro-, acetate → CH3C(O)OH + Benzene, 1-chloro-4-ethenyl- | |
| 1 record matched | Benzeneethanol, 3-fluoro-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-3-fluoro- | |
| 1 record matched | Benzeneethanol, 3-(trifluoromethyl)-, acetate → Other Products + CH3C(O)OH | |
| 1 record matched | Benzeneethanol, 2-(trifluoromethyl)-, acetate → Other Products + CH3C(O)OH | |
| 1 record matched | 1-Propanol, 3-phenoxy-, acetate → CH3C(O)OH + Benzene,(2-propenyloxy)- | |
| 1 record matched | CH3C(O)OC(CH3)2C(O)OCH3 → CH3C(O)OH + Methyl methacrylate | |
| 1 record matched | CH3C(O)O(CH2)4SCH3 → CH3C(O)OH + CH3SCH2CH2CH=CH2 | |
| 1 record matched | 1-Naphthalenemethanol, α-methyl-, acetate → CH3C(O)OH + 1-Ethenylnaphthalene | |
| 2 records matched | CH3C(O)OC(CN)(CH3)2 → CH3C(O)OH + CH2=C(CH3)CN | |
| 1 record matched | CH3C(O)OCH2CH2C≡CH → CH3C(O)OH + Vinylacetylene | |
| 1 record matched | 4-Pyridinemethanol, α,α-dimethyl-, acetate → CH3C(O)OH + Pyridine, 4-(1-methylethyl)- | |
| 1 record matched | 5-Hexen-3-ol, 2,2-dimethyl-, acetate → Other Products + CH3C(O)OH | |
| 1 record matched | Cyclopentaneethanol acetate → CH3C(O)OH + Cyclopentane, ethenyl- | |
| 1 record matched | CH3C(O)O(CH2)3OCH3 → CH3C(O)OH + CH2=CHCH2OCH3 | |
| 1 record matched | CH3C(O)OCH(CH2CH3)C(CH3)3 → CH3C(O)OH + CH3CH=CHC(CH3)3 | |
| 1 record matched | 3-Pentanol, 2,2,4-trimethyl-, acetate → CH3C(O)OH + (CH3)3CCH=C(CH3)2 | |
| 1 record matched | CH3C(O)OCH(CH3)CH2CH3 → CH3C(O)OH + 1-C4H8 | |
| 1 record matched | CH3C(O)OCH2CH2C(O)OCH3 → CH3C(O)OH + CH2=CHC(O)OCH3 | |
| 1 record matched | CH3C(O)OO(·) + CH3C(O)CH2OO· → CH3C(O)OH + CH3C(O)CHO + O2 | |
| 1 record matched | Cyclopentanol, 2-chloro-, acetate, cis- → CH3C(O)OH + Cyclopentene, 3-chloro- | |
| 1 record matched | Cyclopentanol, 2-chloro-, acetate, trans- → CH3C(O)OH + 1-Chloro-1-cyclopentene | |
| 1 record matched | Cyclopentanol, 2-chloro-, acetate, trans- → CH3C(O)OH + Cyclopentene, 3-chloro- | |
| 1 record matched | Cyclohexanol, 2-chloro-, acetate, cis- → CH3C(O)OH + Cyclohexene, 3-chloro- | |
| 1 record matched | CH3C(O)OCH2CH2CH(CH3)CH2CH3 → CH3C(O)OH + C2H5CH(CH3)CH=CH2 | |
| 2 records matched | 3-Pyridinemethanol, α-methyl-, acetate → CH3C(O)OH + Pyridine, 3-etheryl- | |
| 1 record matched | 8-Quinolinemethanol, α-acetate → CH3C(O)OH + Quinoline, 8-ethenyl- | |
| 1 record matched | 7-Quinolinemethanol, α-methyl-, acetate → Quinoline, 7-ethenyl- + CH3C(O)OH | |
| 1 record matched | 6-Quinolinemethanol, α-methyl-, acetate → Quinoline, 6-ethenyl- + CH3C(O)OH | |
| 1 record matched | 5-Quinolinemethanol, α-methyl-, acetate → Quinoline, 5-ethenyl- + CH3C(O)OH | |
| 1 record matched | 4-Quinolinemethanol, α-methyl-, acetate → CH3C(O)OH + Quinoline, 4-ethenyl- | |
| 1 record matched | 3-Quinolinemethanol, α-methyl-, acetate → Quinoline, 3-ethenyl- + CH3C(O)OH | |
| 1 record matched | 2-Quinolinemethanol, α-methyl-, acetate → CH3C(O)OH + Quinoline, 2-ethenyl- | |
| 1 record matched | CH3C(O)OCH(CH3)CH(CH3)C2H5 → Other Products + CH3C(O)OH | |
| 1 record matched | 2-Pentanol, 2-methyl-, acetate → Other Products + CH3C(O)OH | |
| 1 record matched | CH3C(O)OC(CH3)2CH2CH(CH3)2 → CH3C(O)OH + (CH3)2CHCH2C(CH3)=CH2 | |
| 1 record matched | Cyclohexanol, 2-chloro-, acetate, trans- → CH3C(O)OH + Cyclohexene, 3-chloro- | |
| 1 record matched | Cyclohexanol, 2-chloro-, acetate, trans- → CH3C(O)OH + Cyclohexene, 1-chloro- | |
| 2 records matched | Phenylethyl alchol, m-chloro, acetate → CH3C(O)OH + Benzene, 1-chloro-3-ethenyl- | |
| 1 record matched | Benzyl alcohol, p-benzyl-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-4-(phenylmethyl)- | |
| 1 record matched | Benzyl alcohol, o-benzyl-α-methyl-, acetate → Other Products + CH3C(O)OH | |
| 1 record matched | Benzyl alcohol, α-methyl-p-(methylthio)-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-4-(methylthio)- | |
| 1 record matched | Benzyl alcohol, α-methyl-o-(methylthio)-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-2-(methylthio)- | |
| 1 record matched | Benzyl alcohol, α-methyl-p-(phenylthio)-, acetate → Other Products + CH3C(O)OH | |
| 1 record matched | Benzyl alcohol, α-methyl-m-(phenylthio)-, acetate → Other Products + CH3C(O)OH | |
| 1 record matched | Benzyl alcohol, α-methyl-o-(phenylthio)-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-2-(phenylthio)- | |
| 1 record matched | Benzyl alcohol, α-methyl-p-(phenoxy)-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-4-phenoxy- | |
| 1 record matched | Benzyl alcohol, α-methyl-o-(phenoxy)-, acetate → Other Products + CH3C(O)OH | |
| 1 record matched | 2-Naphthalenemethanol, α-methyl-, acetate → CH3C(O)OH + Naphthalene, 2-ethenyl- | |
| 1 record matched | Benzyl alcohol, o-iodo-α-methyl-, acetate → Other Products + CH3C(O)OH | |
| 1 record matched | Benzyl alcohol, α-methyl-o-nitro-, acetate → CH3C(O)OH + (CH2=CH)-C6H4-2-(NO2) | |
| 1 record matched | Benzyl alcohol, α-methyl-p-(trifluoromethyl)-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-4-(trifluoromethyl)- | |
| 1 record matched | Benzyl alcohol, α-methyl-m-(trifluoromethyl)-, acetate → CH3C(O)OH + Benzene, 1-(trifluoromethyl)-3-(ethenyl)- | |
| 1 record matched | Benzyl alcohol, α-methyl-o-(trifluoromethyl)-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-2-(trifluoromethyl)- | |
| 2 records matched | CH3C(O)OCH(CH3)CH2N(CH3)2 → CH3C(O)OH + CH2=CHCH2N(CH3)2 | |
| 1 record matched | CH3C(O)OCH(CH3)-C6F5 → CH3C(O)OH + Benzene, ethenylpentafluoro- | |
| 1 record matched | 3-Benzofuranmethanol, α-methyl-, acetate → CH3C(O)OH + Benzofuran, 3-ethenyl- | |
| 1 record matched | 2-Benzofuranmethanol, α-methyl-, acetate → CH3C(O)OH + Benzofuran, 2-ethenyl- | |
| 1 record matched | Benzo[b]thiophene-3-methanol, α-methyl-, acetate → CH3C(O)OH + Benzo[b]thiophene, 3-ethenyl- | |
| 1 record matched | Benzo[b]thiophene-2-methanol, α-methyl-, acetate → CH3C(O)OH + Benzo[b]thiophene, 2-ethenyl- | |
| 1 record matched | Benzenemethanol, α-phenyl-, acetate → CH3C(O)OH + 1,2-Diphenylethylene | |
| 1 record matched | Cyclopentadecanol acetate → CH3C(O)OH + Cyclopentadecene (unspecified) | |
| 2 records matched | Benzeneethanol, 4-methoxy-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-4-methoxy- | |
| 2 records matched | Benzeneethanol, 4-methyl-, acetate → CH3C(O)OH + 4-Methylstyrene | |
| 1 record matched | 2-Furanmethanol, α-methyl-, acetate → CH3C(O)OH + Furan, 2-ethenyl- | |
| 1 record matched | 2-Thiophenemethanol, α-methyl-, acetate → CH3C(O)OH + Thiophene, 2-ethenyl- | |
| 1 record matched | 3-Furan methanol, α-methyl-, acetate → CH3C(O)OH + Furan, 3-ethyenyl- | |
| 1 record matched | Cyclohexaneethanol acetate → CH3C(O)OH + Cyclohexane, ethenyl- | |
| 1 record matched | Cyclohexanol, 5-methyl-2-(1-methylethyl)-, acetate,(1α,2β,5β)- → CH3C(O)OH + Cyclohexene, 3-methyl-6-(1-methylethyl)-, cis- | |
| 1 record matched | Cyclohexanol, 5-methyl-2-(1-methylethyl)-, acetate,(1α,2β,5β)- → CH3C(O)OH + Cyclohexene, 4-methyl-1-(1-methylethyl)- | |
| 1 record matched | Cyclohexanol, 2-(1,1-dimethylethyl)-, acetate, trans- → CH3C(O)OH + Cyclohexene, 3-(1,1-dimethylethyl)- | |
| 1 record matched | Cyclohexanol, 2-(1,1-dimethylethyl)-, acetate, trans- → CH3C(O)OH + Cyclohexene, 1-(1,1-dimethylethyl)- | |
| 1 record matched | Cyclohexanol, 2-(1,1-dimethylethyl)-, acetate, cis- → CH3C(O)OH + Cyclohexene, 3-(1,1-dimethylethyl)- | |
| 1 record matched | C2H5CH(CH3)OO· → CH3C(O)OH + ·C2H5 | |
| 4 records matched | Benzenemethanol, 4-chloro-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-chloro-4-ethenyl- | |
| 4 records matched | Benzenemethanol, α,4-dimethyl-, acetate → CH3C(O)OH + 4-Methylstyrene | |
| 3 records matched | Benzyl alcohol, o-methoxy-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-2-methoxy- | |
| 4 records matched | Benzenemethanol, α-methyl-3-nitro-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-3-nitro- | |
| 2 records matched | Benzenemethanol, α-methyl-4-nitro-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-4-nitro- | |
| 3 records matched | Benzyl alcohol, m-chloro-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-chloro-3-ethenyl- | |
| 3 records matched | Benzyl alcohol, p-bromo-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-bromo-4-ethenyl- | |
| 2 records matched | Benzenemethanol, α, 3-dimethyl-, acetate → CH3C(O)OH + 3-Methylstyrene | |
| 4 records matched | Benzyl alcohol, o,α-dimethyl-, acetate → CH3C(O)OH + 2-Methylstyrene | |
| 1 record matched | CH3C(O)OCH(CH3)CCl3 → CH3C(O)OH + CH2=CHCCl3 | |
| 1 record matched | Cycloheptanol acetate → CH3C(O)OH + (Z)-Cycloheptene | |
| 1 record matched | CH3C(O)OCH2CH2Si(C2H5)3 → CH3C(O)OH + CH2=CHSi(C2H5)3 | |
| 1 record matched | 2-Acetoxycyclohexanone → CH3C(O)OH + 2-Cyclohexen-1-one | |
| 1 record matched | Cyclohexanol, 1-methyl-, acetate → Other Products + CH3C(O)OH | |
| 1 record matched | CH3C(O)OCH2CH2Si(CH3)3 → CH3C(O)OH + CH2=CHSi(CH3)3 | |
| 1 record matched | CH3C(O)OCH(CH3)CN → CH3C(O)OH + CH2CHCN | |
| 1 record matched | Cyclohexanol, 2-methyl-, acetate,(1R-trans)- → CH3C(O)OH + 1-Methylcyclohexene | |
| 1 record matched | Cyclohexanol, 2-methyl-, acetate,(1R-trans)- → CH3C(O)OH + 3-methylcyclohexene | |
| 1 record matched | Cyclohexanol, 2-methyl-, acetate,(1S-cis)- → CH3C(O)OH + 3-methylcyclohexene | |
| 1 record matched | CH3C(O)O(CH2)4OCH3 → CH3C(O)OH + CH2=CHCH2CH2OCH3 | |
| 1 record matched | 3-Thiophenemethanol, α-methyl-, acetate → CH3C(O)OH + Thiophene, 3-ethyenyl- | |
| 1 record matched | CH3COOCH2COOH → CH2O + CH3C(O)OH + CO | |
| 1 record matched | 3-Cyclohexen-1-ol acetate → CH3C(O)OH + 1,4-Cyclohexadiene | |
| 1 record matched | CH3C(O)OCH(CH3)CH2CH2C6H5 → Other Products + CH3C(O)OH | |
| 1 record matched | Cyclohexanol, 4-(1,1-dimethylethyl)-, acetate, cis- → CH3C(O)OH + Cyclohexene, 4-(1,1-dimethylethyl)- | |
| 1 record matched | CH3C(O)OC(CH3)(C2H5)2 → Other Products + CH3C(O)OH | |
| 1 record matched | CH3C(O)OC(CH3)2C(O)CH3 → CH3C(O)OH + CH2=C(CH3)C(=O)CH3 | |
| 1 record matched | CH3C(O)OCH2CH2C(O)CH3 → CH3C(O)OH + CH2=CHCOCH3 | |
| 1 record matched | 1-butanol, 2-ethyl-, acetate → CH3C(O)OH + (C2H5)2C=CH2 | |
| 1 record matched | Bicyclo[2.2.1]hept-2-en-7-ol, 7-methyl, acetate, syn- → Other Products + CH3C(O)OH | |
| 1 record matched | Bicyclo[2.2.1]hept-2-en-7-ol, 7-methyl, acetate, anti- → Other Products + CH3C(O)OH | |
| 1 record matched | Cyclodecanol acetate → CH3C(O)OH + Cyclodecene (unspecified) | |
| 1 record matched | Benzenemethanol, α,α,3-methyl-, acetate → CH3C(O)OH + Benzene, 1-methyl-3-(1-methylethenyl)- | |
| 1 record matched | Benzenemethanol, 3-chloro-α,α-dimethyl-, acetate → CH3C(O)OH + Benzene, 1-chloro-3-(1-methylethyl)- | |
| 1 record matched | Bicyclo[2.2.1]heptan-7-ol, 7-methyl, acetate → CH3C(O)OH + Bicyclo[2.2.1]heptane,7-methylene- | |
| 1 record matched | Benzyl alcohol, m-bromo-α-methyl- acetate → CH3C(O)OH + Benzene, 1-bromo-3-ethenyl- | |
| 3 records matched | CH3C(O)OCH(CH3)C(O)OCH3 → CH3C(O)OH + CH2=CHC(O)OCH3 | |
| 1 record matched | Cyclododecanol acetate → CH3C(O)OH + Cyclododecene (unspecified) | |
| 1 record matched | Ethanol, 2-phenoxy-, acetate → CH3C(O)OH + Benzene,(ethenyloxy)- | |
| 1 record matched | 4-Heptanol, acetate → CH3C(O)OH + (E)-3-heptene | |
| 1 record matched | CH3C(O)OCH(C2H5)C4H9-n → Other Products + CH3C(O)OH | |
| 1 record matched | 2-Heptanol, acetate → Other Products + CH3C(O)OH | |
| 1 record matched | CH3C(O)O(CH2)2SCH3 → CH3C(O)OH + CH2=CHSCH3 | |
| 1 record matched | CH3C(O)OCH(CH3)CH(CH3)2 → Other Products + CH3C(O)OH | |
| 1 record matched | CH3C(O)O(CH2)2CN → CH3C(O)OH + CH2CHCN | |
| 1 record matched | CH3C(O)O(CH2)3C(O)CH3 → CH3C(O)OH + CH3C(O)CH2CH=CH2 | |
| 1 record matched | CH3C(O)O(CH2)3C(O)CH3 → CH3C(O)OH + CH3CH=CHC(=O)CH3 (unspecified) | |
| 1 record matched | CH3C(O)O(CH2)3C(O)CH3 → Other Products + CH3C(O)OH | |
| 1 record matched | Benzenemethanol, α,α,4-trimethyl-, acetate → CH3C(O)OH + Benzene, 1-methyl-4-(1-methylethenyl)- | |
| 1 record matched | CH3C(O)O(CH2)4CH=CH2 → CH3C(O)OH + 1,5-Hexadiene | |
| 2 records matched | CH3C(O)OCH(CH3)C(O)CH3 → CH3C(O)OH + CH2=CHCOCH3 | |
| 1 record matched | CH3C(O)OC(CH3)2CH(CH3)2 → Other Products + CH3C(O)OH | |
| 1 record matched | CH3C(O)O(CH2)2CH2N(CH3)2 → Other Products + CH3C(O)OH | |
| 11 records matched | HO2 + CH3C(O)OO(·) → CH3C(O)OH + O3 | |
| 1 record matched | C2H5OO· + CH3C(O)OO(·) → CH3C(O)OH + CH3CHO + O2 | |
| 3 records matched | Benzyl alcohol, p-fluoro-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-4-fluoro- | |
| 1 record matched | CH3C(O)OCH2CH2Ge(C2H5)3 → CH3C(O)OH + CH2=CHGe(C2H5)3 | |
| 2 records matched | CH3C(O)OCH(CH3)CH2CH=CH2 → Other Products + CH3C(O)OH | |
| 2 records matched | 4-Pyridinemethanol, α-methyl-, acetate → CH3C(O)OH + 4-Vinylpyridine | |
| 3 records matched | 2-Pyridinemethanol, α-methyl-, acetate → CH3C(O)OH + 2-Vinylpyridine | |
| 1 record matched | 1,2-Cyclohexanol diacetate, cis- → CH3C(O)OH + 2-Cyclohexen-1-ol acetate | |
| 2 records matched | CH3O2· + CH3C(O)OO(·) → CH2O + CH3C(O)OH + O2 | |
| 1 record matched | CH3O2· + CH3C(O)OO(·) → Other Products + CH3C(O)OH | |
| 1 record matched | CH3C(O)OCH(CH3)CH2C6H5 → Other Products + CH3C(O)OH | |
| 2 records matched | CH3C(O)OC(CH3)2C(CH3)3 → CH3C(O)OH + (CH3)3CC(CH3)=CH2 | |
| 1 record matched | Cyclohexanol, 4-(1,1-dimethylethyl)-, acetate, trans- → CH3C(O)OH + Cyclohexene, 4-(1,1-dimethylethyl)- | |
| 2 records matched | Benzyl alcohol, o-fluoro-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-2-fluoro- | |
| 3 records matched | Benzyl alcohol, o-chloro-α-methyl-, acetate → CH3C(O)OH + 2-Chlorostyrene | |
| 3 records matched | Benzyl alcohol, o-bromo-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-bromo-2-ethenyl- | |
| 1 record matched | 1,2-Cyclohexanediol diacetate, trans- → CH3C(O)OH + 2-Cyclohexen-1-ol acetate | |
| 1 record matched | 1,2-Cyclohexanediol diacetate, trans- → CH3C(O)OH + 1-Cyclohexen-1-ol acetate | |
| 1 record matched | CH3C(O)OC(CH3)2CH2C(O)CH3 → CH3C(O)OH + CH3C(O)CH2C(CH3)=CH2 | |
| 1 record matched | CH3C(O)OC(CH3)2CH2C(O)CH3 → CH3C(O)OH + (CH3)2C=CHC(=O)CH3 | |
| 1 record matched | CH3C(O)O(CH2)3CH=CH2 → CH3C(O)OH + CH2=CHCH2CH=CH2 | |
| 1 record matched | CH3C(O)O(CH2)2CH=CH2 → CH3C(O)OH + 1,3-Butadiene | |
| 1 record matched | CH3C(O)O(CH2)2N(CH3)2 → CH3C(O)OH + CH2=CHN(CH3)2 | |
| 2 records matched | CH3C(O)O(CH2)2C(CH3)3 → CH3C(O)OH + (CH3)3CCH=CH2 | |
| 3 records matched | Benzyl alcohol, p-methoxy-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-4-methoxy- | |
| 2 records matched | Cyclopentanol acetate → CH3C(O)OH + Cyclopentene | |
| 1 record matched | CH3C(O)O(CH2)2CH=C(CH3)2 → Other Products + CH3C(O)OH | |
| 1 record matched | CH3C(O)OC(CH3)2CH2CH=CH2 → Other Products + CH3C(O)OH | |
| 1 record matched | Cyclooctanol acetate → CH3C(O)OH + (Z)-Cyclooctene | |
| 1 record matched | CH3CH(O2)OCHCH3 → CH3C(O)OH + CH3CHO | |
| 1 record matched | CH3C(O)OCH2CH2CH2CH(CH3)2 → CH3C(O)OH + (CH3)2CHCH2CH=CH2 | |
| 1 record matched | Acetic acid, pentyl ester → CH3C(O)OH + 1-C5H10 | |
| 1 record matched | 2-Pentanol, acetate → Other Products + CH3C(O)OH | |
| 2 records matched | CH3C(O)NHC(O)CH3 → CH3C(O)OH + CH3CN | |
| 2 records matched | CH3C(O)OC(CH3)2CH2CH3 → CH3C(O)OH + C2H5C(CH3)=CH2 | |
| 1 record matched | CH3C(O)OC(CH3)2CH2CH3 → CH3C(O)OH + (CH3)2C=CHCH3 | |
| 1 record matched | CH3C(O)OC(CH3)2CH2CH3 → Other Products + CH3C(O)OH | |
| 1 record matched | 1-Butanol, 2-methyl-, acetate → CH3C(O)OH + C2H5C(CH3)=CH2 | |
| 2 records matched | CH3C(O)OCH(CH3)CH2Cl → CH3C(O)OH + CH2=CHCH2Cl | |
| 3 records matched | Acetic acid cyclohexyl ester → CH3C(O)OH + Cyclohexene | |
| 1 record matched | CH3C(O)OCH(C2H5)2 → CH3C(O)OH + 2-C5H10 | |
| 1 record matched | CH3C(O)OCH(CH3)C(CH3)3 → CH3C(O)OH + (CH3)3CCH=CH2 | |
| 1 record matched | CH3C(O)OCH2CH2Cl → CH3C(O)OH + CH2=CHCl | |
| 7 records matched | CH3C(O)OC(CH3)3 → CH3C(O)OH + Isobutene | |
| 1 record matched | CH3COOCH(CH3)COOH → CH3C(O)OH + CH3CHO + CO | |
| 1 record matched | CH3C(O)OCH2CH2F → CH3C(O)OH + CH2=CHF | |
| 1 record matched | CH2(COOH)2 → CH3C(O)OH + CO2 | |
| 20 records matched | CH3C(O)OC2H5 → CH3C(O)OH + C2H4 | |
| 3 records matched | CH3C(O)O(CH2)2CH(CH3)2 → CH3C(O)OH + (CH3)2CHCH=CH2 | |
| 1 record matched | CH3COO(CH2)3CH3 → CH3C(O)OH + Isobutene | |
| 2 records matched | CH3COO(CH2)3CH3 → CH3C(O)OH + 1-C4H8 | |
| 1 record matched | Benzenepropanol acetate → CH3C(O)OH + 3-Phenylpropene | |
| 1 record matched | CH3C(O)OCH2CH2OC(O)CH3 → CH3C(O)OH + CH3CO2CH=CH2 | |
| 1 record matched | 2-Ethoxyethyl acetate → CH3C(O)OH + CH2=CHOC2H5 | |
| 3 records matched | CH3C(O)O(CH2)2OCH3 → CH3C(O)OH + CH2=CHOCH3 | |
| 1 record matched | isobutyl acetate → CH3C(O)OH + Isobutene | |
| 3 records matched | CH3COOCH2CH2CH3 → CH3C(O)OH + CH3CH=CH2 | |
| 1 record matched | 1-Methoxy-2-propyl acetate → Other Products + CH3C(O)OH | |
| 4 records matched | (CH3CO)2O → CH3C(O)OH + H2C=C=O | |
| 8 records matched | CH3COOCH(CH3)2 → CH3C(O)OH + CH3CH=CH2 | |
| 1 record matched | CH3COOCH(CH3)C2H5 → Other Products + CH3C(O)OH | |
| 3 records matched | Acetic acid 2-phenylethyl ester → CH3C(O)OH + Styrene | |
| 9 records matched | Benzenemethanol, α-methyl-, acetate → CH3C(O)OH + Styrene | |
| 1 record matched | CH3C(O)OOH + 2-(E)-C5H10 → CH3C(O)OH + trans-2-ethyl-3-methyl-oxirane | |
| 1 record matched | CH3C(O)OOH + 2-(Z)-C5H10 → CH3C(O)OH + cis-2-ethyl-3-methyl-oxirane | |
| 1 record matched | CH3C(O)OOH + (E)-2-C4H8 → CH3C(O)OH + trans-2,3-Dimethyloxirane | |
| 1 record matched | CH3C(O)OOH + 1-C6H12 → CH3C(O)OH + Oxirane, butyl- | |
| 1 record matched | CH3C(O)OOH + (Z)-2-C4H8 → CH3C(O)OH + cis-2,3-Dimethyloxirane | |
| 1 record matched | CH3C(O)OOH + C2H5C(CH3)=CH2 → CH3C(O)OH + 2-ethyl-2-methyl-oxirane | |
| 1 record matched | CH3C(O)OOH + (CH3)2CHCH=CH2 → CH3C(O)OH + (1-methylethyl)oxirane | |
| 1 record matched | CH3C(O)OOH + (CH3)2C=CHCH3 → CH3C(O)OH + 2,2,3-trimethyl-oxirane | |
| 1 record matched | CH3C(O)OOH + Isobutene → CH3C(O)OH + 2,2-Dimethyloxirane | |
| 1 record matched | CH3C(O)OOH + CH3CH=CH2 → CH3C(O)OH + Methyloxirane | |
| 1 record matched | CH3C(O)OOH + 1-C4H8 → CH3C(O)OH + Ethyloxirane | |
| 1 record matched | CH3CHO + ·OH → CH3C(O)OH + H· | |
| 3 records matched | Acetone + ·OH → CH3C(O)OH + ·CH3 | |
| 1 record matched | CH3C(O)OH + (CH3)2C(·)OO· → Products | |
| 1 record matched | CH3C(O)OH + CH3CH(·)OO· → Products | |
| 3 records matched | CH3C(O)OH + ·Cl → Other Products + HCl | |
| 2 records matched | CH3C(O)OH + ·Cl → Products | |
| 1 record matched | CH3C(O)OH + OD → Products | |
| 1 record matched | CH3C(O)OH + ·OH → CO2 + ·CH3 + H2O | |
| 3 records matched | CH3C(O)OH + ·OH → Other Products + H2O | |
| 9 records matched | CH3C(O)OH + ·OH → Products | |
| 2 records matched | CH3C(O)OH + H2C=C=O → (CH3CO)2O | |
| 8 records matched | CH3C(O)OH → H2C=C=O + H2O | |
| 7 records matched | CH3C(O)OH → CH4 + CO2 | |
| 1 record matched | Benzene methane(1-d1)-ol, α-methyl-, acetate → CH3C(O)OH + Benzene, ethenyl-1-d- | |
| 1 record matched | Erythoro-CH3C(O)OCH(C6H5)CHDC6H5 → CH3C(O)OH + C6H5CH=CDC6H5 | |
| 1 record matched | CH3C(O)OCD2CHD2 → CH3C(O)OH + C2D4 | |
| 1 record matched | Threo-Benzene ethan (2β-d-ol)-, α-phenyl-, acetate → CH3C(O)OH + C6H5CH=CDC6H5 | |
| 1 record matched | 9H-Fluorene-2-methanol, α-methyl-, acetate → CH3C(O)OH + 9H-Fluorene, 2-ethenyl- | |
| 1 record matched | Benzenemethanol, α-methyl-o-phenyl-, acetate → CH3C(O)OH + 1,1'-Biphenyl, 2-ethenyl- | |
| 1 record matched | Benzenenethanol. α-methyl-4-phenyl-, acetate → CH3C(O)OH + 1,1'-Biphenyl, 4-ethenyl- | |
| 1 record matched | Benzenemethanol, α-methyl-3-phenyl-, acetate → CH3C(O)OH + 1,1'-Biphenyl, 3-ethenyl- | |
| 2 records matched | Benzenemethanol, 3-iodo-α-methyl-, acetate → CH3C(O)OH + Benzene, 1-ethenyl-3-iodo- | |
| 1 record matched | CH3C(O)OCH2O → CH3C(O)OH + HCO | |
| 1 record matched | ·CH(OH)C(O)CH3 + O2 → CH3C(O)OH + CO + ·OH | |
| 1 record matched | ·CH(OH)C(O)CH3 + O2 → CH3C(O)OH + CO2 + H· | |
| 1 record matched | (CH3)2C(OOCCH3)COOH → CH3C(O)OH + CH2=C(CH3)COOH | |
| 1 record matched | (CH3)2C(OOCCH3)COOH → CH3C(O)OH + Acetone + CO | |
| 1 record matched | p-CH3OC6H4NH(CH2)5O(O)CCH3 → N-(p-methoxyphenyl)piperidine + CH3C(O)OH | |
| 1 record matched | p-CH3C6H4NH(CH2)5O(O)CCH3 → N-(p-methylphenyl)piperidine + CH3C(O)OH | |
| 1 record matched | p-ClC6H4NH(CH2)5O(O)CCH3 → N-(p-chlorophenyl)piperidine + CH3C(O)OH | |
| 1 record matched | p-ClC6H4NH(CH2)4OC(O)CH3 → N-(p-chlorophenyl)pyrrolidine + CH3C(O)OH | |
| 1 record matched | p-CH3C6H4NH(CH2)4OC(O)CH3 → N-(p-methylphenyl)pyrrolidine + CH3C(O)OH | |
| 1 record matched | p-CH3OC6H4NH(CH2)4OC(O)CH3 → N-(p-methoxyphenyl)pyrrolidine + CH3C(O)OH | |
| 1 record matched | CH3N(C6H5)CH2CH2CH2CH2OC(O)CH3 → C6H5N(CH3)CH2CH2CH=CH2 + CH3C(O)OH | |
| 1 record matched | C6H5NHCH2CH2CH2CH2OC(O)CH3 → CH3C(O)OH + N-Phenylpyrrolidine | |
| 1 record matched | C6H5NHCH2CH2CH2CH2OC(O)CH3 → aniline + CH3C(O)OH + 1,3-Butadiene | |
| 1 record matched | C6H5NHCH2CH2CH2CH2OC(O)CH3 → C6H5NHCH2CH2CH=CH2 + CH3C(O)OH | |
| 1 record matched | C6H5NHCH2CH2CH2CH2CH2OC(O)CH3 → CH3C(O)OH + N-Phenylpiperidine | |
| 1 record matched | C6H5NHCH2CH2CH2CH2CH2OC(O)CH3 → C6H5NHCH2CH2CH2CH=CH2 + CH3C(O)OH | |
| 1 record matched | C6H5N(CH3)CH2CH2CH2CH2CH2OC(O)CH3 → C6H5N(CH3)CH2CH2CH2CH=CH2 + CH3C(O)OH | |
| 1 record matched | 2-butyne-OH adduct + O2 → CH3C(O)OH + CH3CO | |
| 2 records matched | CH2=C(OH)2 → CH3C(O)OH | |
| 1 record matched | H2O + CH2=C(OH)2 → CH3C(O)OH + H2O | |
| 1 record matched | HNO3 + CH2=C(OH)2 → CH3C(O)OH + HNO3 | |
| 1 record matched | ·OH + CH3CO → CH3C(O)OH | |
| 3 records matched | HO2 + CH3C(O)OO(·) → CH3C(O)OH + O3 | |
| 1 record matched | CH3OOH + CH3CO → CH3C(O)OH + CH3O· | |
| 1 record matched | ·CH2C(O)OH + H· → CH3C(O)OH | |
| 1 record matched | CH3CH(·)OH + O· → CH3C(O)OH + H· | |
| 1 record matched | ·CH3 + HOC(·)O → CH3C(O)OH | |
| 1 record matched | CH3C(O)NHC(O)CH3 → CH3C(O)OH + CH2=C=NH | |
| 2 records matched | H2C=C=O + H2O → CH3C(O)OH | |
| 1 record matched | H2C=C=O + HNO3 + H2O → CH3C(O)OH + HNO3 | |
| 1 record matched | CH2(COOH)2 → CH3C(O)OH + CO2 | |
| 1 record matched | CH3C(O)OC2H5 → CH3C(O)OH + C2H4 | |
| 1 record matched | CH3COOCH2CH2CH3 → CH3C(O)OH + CH3CH=CH2 | |
| 2 records matched | (CH3CO)2O → CH3C(O)OH + H2C=C=O | |
| 1 record matched | CH3CHO + ·OH → CH3C(O)OH + H· | |
| 1 record matched | CH3CHO + HO2 → CH3C(O)OH + ·OH | |
| 1 record matched | Acetone + ·OH → CH3C(O)OH + ·CH3 | |
| 1 record matched | CH3C(O)OH + SiH3 → CH3C(SiH3)(O·)OH | |
| 1 record matched | CH3C(O)OH + SiH3 → CH3C(·)(OSiH3)OH | |
| 1 record matched | CH3C(O)OH + H· → H2 + CH3C(O)O· | |
| 1 record matched | CH3C(O)OH + H· → H2 + ·CH2C(O)OH | |
| 1 record matched | CH3C(O)OH + O2 → ·CH2C(O)OH + HO2 | |
| 3 records matched | CH3C(O)OH + ·OH → H2O + CH3C(O)O· | |
| 3 records matched | CH3C(O)OH + ·OH → ·CH2C(O)OH + H2O | |
| 1 record matched | CH3C(O)OH + ·OH → CO2 + ·CH3 + H2O | |
| 1 record matched | CH3C(O)OH + ·OH → Other Products + H2O | |
| 1 record matched | CH3C(O)OH + ·OH → CH3CO(OH)2 | |
| 1 record matched | CH3C(O)OH + HO2 → H2O2 + CH3C(O)O· | |
| 1 record matched | CH3C(O)OH + HO2 → ·CH2C(O)OH + H2O2 | |
| 1 record matched | CH3C(O)OH + ·CH3 → CH4 + CH3C(O)O· | |
| 1 record matched | CH3C(O)OH + ·CH3 → CH4 + ·CH2C(O)OH | |
| 1 record matched | CH3C(O)OH + (CH3)2C(OCH3)2 → CH3C(O)OH + CH3OH + CH2=C(CH3)OCH3 | |
| 1 record matched | CH3C(O)OH + Benzene + H2 → CH3C(O)OH + 1,4-Cyclohexadiene | |
| 1 record matched | CH3C(O)OH + Benzene + H2 → CH3C(O)OH + 1,3-Cyclohexadiene | |
| 1 record matched | CH3C(O)OH → H· + ·CH2OOH | |
| 1 record matched | CH3C(O)OH → CH2=C(OH)2 | |
| 1 record matched | CH3C(O)OH → ·CH3 + HOC(·)O | |
| 2 records matched | CH3C(O)OH → H2C=C=O + H2O | |
| 2 records matched | CH3C(O)OH → CH4 + CO2 | |
| 1 record matched | CH3C(O)OH → Products | |
| 1 record matched | CH3C(O)NH2 + CH3C(O)OH → (CH3CO)2O + NH3 | |
| 1 record matched | CH3C(O)OCH(O·)CH3 → CH3C(O)OH + CH3CO | |
| 1 record matched | 2-hydroxy-1,2-dioxolane → CH2O + CH3C(O)OH | |
| 1 record matched | CH3C(OH)NH + H2C=C=O → CH3C(O)OH + CH3CN | |
| 1 record matched | CH3C(OH)NH + CH3C(O)NH2 → CH3C(O)OH + CH3CN + NH3 | |
| 1 record matched | CH2OO···H2O complex + CH3C(O)OH → CH3C(O)OH + HOCH2OOH |
Search returned 496 records.