Kinetics Database Logo

Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences


Rate Our Products and Services


Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty


Administrative Links

NIST home page

MML home page

Chemical Sciences Division

  NIST Logo Home
©NIST, 2013
Accessibility information

Search Results

Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
3 records matched Acetone + ·OH → CH3C(O)CH2(·) + H2O
1 record matched Acetone + ·OH → CH3C(O)OH + ·CH3
1 record matched C2H5C(CH3)2O(·) → Acetone + ·C2H5
2 records matched (CH3)2CHO2 + (CH3)2CHO2 → iso-C3H7OH + Acetone + O2
2 records matched i-C3H7O + NO → Acetone + HNO
6 records matched i-C3H7O + O2 → Acetone + HO2
2 records matched i-C3H7O → Acetone + H·
2 records matched (CH3)3CO· → Acetone + ·CH3
1 record matched ·CH3 + CH3CO → Acetone
1 record matched iso-C3H7 + O· → Acetone + H·
1 record matched tert-C4H9 + HO2 → Acetone + ·CH3 + ·OH
1 record matched tert-C4H9 + CH3O2· → Acetone + CH3O· + ·CH3
3 records matched Acetone + ·Cl → CH3C(O)CH2(·) + HCl
1 record matched Acetone + O· → CH3C(O)CH2(·) + ·OH
1 record matched Acetone + H· → i-C3H7O
2 records matched Acetone + NO3 → CH3C(O)CH2(·) + HNO3
4 records matched Acetone + ·OH → CH3C(O)CH2(·) + H2O
3 records matched Acetone + ·OH → Products
1 record matched Acetone + ·CH3 → (CH3)3CO·
2 records matched Acetone + ·CH3 → CH4 + CH3C(O)CH2(·)
1 record matched N2(A3Sigma_u+) + Acetone → Products
1 record matched (CH3)2C(CH2OOH)CH2· → Other Products + Acetone
1 record matched HC≡CC(CH3)2C(CH3)2OH → Acetone + CH2=C=C(CH3)2
1 record matched 1,2,4-Trioxolane, 3,3-dimethyl- → HCOOH + Acetone
1 record matched C2H5CH(CH3)O2 → Acetone + CH3
2 records matched (CH3)2C(OH)CH2C(O)OC2H5 → Acetone + CH3C(O)OC2H5
3 records matched C2H5C(CH3)2O(·) → Acetone + ·C2H5
2 records matched O2 + (CH3)2C(CH2OOH)CH2· → Other Products + Acetone
1 record matched 2,2-dimethyl-oxetane → Acetone + C2H4
2 records matched (CH3)2C(OH)CH2C(O)OCH3 → Acetone + CH3C(O)OCH3
2 records matched (CH3)2CHOCH2CH=CH2 → Acetone + CH3CH=CH2
1 record matched C2H5CH(·)OH + NO → Acetone + HNO
1 record matched (CH3)2C(OH) + O2 → Acetone + HO2
2 records matched oxirane, tetramethyl- → Acetone + CH3CH=CH2
1 record matched (CH3)2CHO2 + (CH3)2CHC(OO)(CH3)2 → Acetone + (CH3)2CHC(OH)(CH3)2 + O2
2 records matched (CH3)2CHO2 + (CH3)2CHO2 → iso-C3H7OH + Acetone + O2
2 records matched (CH3)2CHOC(CH3)-CH2 → Acetone + CH3CH=CH2
2 records matched CH3CH(OH)CH2C(O)CH3 → Acetone + CH3CHO
4 records matched i-C3H7O + NO → Acetone + HNO
1 record matched i-C3H7O + O2 → Acetone + HO2
2 records matched i-C3H7O → Acetone + H·
1 record matched ·OH + Bicyclo[3.1.1]heptan-2-one, 6,6-dimethyl- → Products + Acetone
21 records matched (CH3)3CO· → Acetone + ·CH3
2 records matched CH3C(O)CH2(·) + HBr → Acetone + Br·
1 record matched 1,3-Dioxolane, 2,2-dimethyl- → Acetone + CH3CHO
6 records matched ·CH3 + CH3CO → Acetone
2 records matched iso-C3H7 + O· → Acetone + H·
1 record matched (CH3)3COCH2CH=CH2 → Acetone + 1-C4H8
1 record matched 1,2,4,5-Tetroxane, 3,3,6,6-tetramethyl- → Acetone + Acetone + O2
2 records matched CH2=C(CH3)OC2H5 → Acetone + C2H4
2 records matched CH2=CHCH2C(CH3)2OH → Acetone + CH3CH=CH2
1 record matched (CH3)2C(NO2)2 → Acetone + NO + NO2
1 record matched (CH3)2COHCOOH → Acetone + CO + H2O
1 record matched n-C4H9COCH3 → Acetone + CH3CH=CH2
2 records matched CH3C(O)CH2CH2OH → CH2O + Acetone
1 record matched HC≡CCH2C(CH3)2OH → Acetone + CH2=C=CH2
1 record matched (CH3)2C=C(CH3)2 + O3 → Acetone + (CH3)2C(·)OO·
1 record matched (CH3)2CHC(O)OCH3 + ·OH → Other Products + Acetone
2 records matched i-C3H7ONO → Acetone + HNO
1 record matched (CH3)2C=CHCH3 + O3 → Other Products + Acetone
3 records matched (CH3CO)2 + ·CH3 → Acetone + CH3CO
1 record matched beta-pinene + ·OH → pinonaldehyde + Products + Acetone
1 record matched (CH3)2C(OC2H5)2 → C2H5OH + Acetone + C2H4
1 record matched CH3COCH2COCH3 → Acetone + H2C=C=O
4 records matched (CH3)2C(OH)CH2C(O)CH3 → Acetone + Acetone
2 records matched CH3C(O)C(OH)(CH3)2 → Acetone + CH3CHO
1 record matched CH2=CHC(CH3)2OH + O· → Other Products + Acetone
1 record matched (CH3)2CHCH2CH2COCH3 → Acetone + iso-C4H8
1 record matched 2-methyl-1-phenyl-2-propanol → Acetone + Toluene
2 records matched alpha-pinene + ·OH → Other Products + Acetone
1 record matched alpha-pinene + ·OH → pinonaldehyde + Products + Acetone
2 records matched Methyloxirane → Acetone
1 record matched CH3CHO + CH3CO → Acetone + HCO
2 records matched CH3CHO + ·CH3 → Acetone + H·
1 record matched Acetone + ·CH2 → Products
3 records matched Acetone + CH2OO → Products
1 record matched Acetone + ·Cl → CH3C(O)CH2(·) + HCl
1 record matched Acetone + ·Cl → CH3COCl + ·CH3
20 records matched Acetone + ·Cl → Products
7 records matched Acetone + O· → CH3C(O)CH2(·) + ·OH
1 record matched Acetone + ·F → CH3C(O)CH2(·) + HF
1 record matched Acetone + I → CH3C(O)CH2(·) + HI
1 record matched Acetone + SiH2 → Products
1 record matched Acetone + OD → Products
5 records matched Acetone + H· → H2 + CH3C(O)CH2(·)
1 record matched Acetone + NO3 → Products
1 record matched Acetone + NO2 → CH3C(O)CH2(·) + HNO2
1 record matched Acetone + Br· → CH3C(O)CH2(·) + HBr
1 record matched Acetone + SiHCl3 → (CH3)2CHO-SiCl3
1 record matched Acetone + NF2 → CH3C(O)CH2(·) + HNF2
11 records matched Acetone + ·OH → CH3C(O)CH2(·) + H2O
3 records matched Acetone + ·OH → CH3C(O)OH + ·CH3
13 records matched Acetone + ·OH → Products
1 record matched Acetone + ·CH → (CH3)2C=C=O + H·
1 record matched Acetone + ·CH → Methacrolein + H·
1 record matched Acetone + HO2
1 record matched Acetone + HO2 → Adduct
1 record matched Acetone + HO2 → (CH3)2C(OH)OO
1 record matched Acetone + (CH3)3CO· → tert-C4H9OH + CH3C(O)CH2(·)
1 record matched Acetone + Phenyl → Benzene + CH3C(O)CH2(·)
1 record matched Acetone + ·CF3 → CHF3 + CH3C(O)CH2(·)
2 records matched Acetone + ·CH3 → (CH3)3CO·
26 records matched Acetone + ·CH3 → CH4 + CH3C(O)CH2(·)
1 record matched Acetone + (C2H5)3B → Other Products + ·C2H5
1 record matched Acetone + Acetone → C2H6 + (CH3CO)2
7 records matched Acetone → ·CH3 + CH3CO
2 records matched iso-C3H7OH + NO3 → Other Products + Acetone
1 record matched iso-C3H7OH → Acetone + H2
1 record matched O2(1DELTA) + Acetone → Products
1 record matched OH(v=1) + Acetone → Products + ·OH
1 record matched pinonaldehyde + ·OH → Other Products + Acetone
1 record matched pinonaldehyde + ·OH → Products + Acetone
3 records matched CH3CH2C(CH3)2O(·) → Acetone + ·C2H5
1 record matched (18)OH + Acetone → Products
1 record matched (CH3)2C(OOCCH3)COOH → CH3C(O)OH + Acetone + CO
1 record matched CH3C(CH3)(OH)CH2CN → Acetone + CH3CN
1 record matched HOC(CH3)2CH2NO2 → Acetone + CH3NO2
1 record matched (CH3)2C(O·)CH2CH2CH3 → Acetone + 1-C3H7
1 record matched (CH3)2CNO2 → Acetone + NO
1 record matched (CH3)2C(OH)C(O)OCH3 → CH3OH + Acetone + CO
1 record matched (CH3)2C(·)OO· + (CH3)2C(·)OO· → O2(1DELTA) + Acetone + Acetone
1 record matched CH2=C(OH)CH3 → Acetone
2 records matched (CH3)2CHC(O)(CH3)2 → Acetone + iso-C3H7
1 record matched Oxiranone, dimethyl- → Acetone + CO
2 records matched C2H5C(CH3)2O(·) → Acetone + ·C2H5
2 records matched (CH3)2CHO2 → Acetone + ·OH
2 records matched i-C3H7O + NO → Acetone + HNO
1 record matched i-C3H7O → Acetone + H·
9 records matched (CH3)3CO· → Acetone + ·CH3
1 record matched 1,3-Dioxolane, 2,2-dimethyl- → Acetone + CH3CHO
2 records matched iso-C3H7 + O· → Acetone + H·
1 record matched tert-C4H9 + O· → Acetone + ·CH3
1 record matched CH2=C(CH3)OC2H5 → Acetone + C2H4
1 record matched CH2=CHCH2C(CH3)2OH → Acetone + CH3CH=CH2
1 record matched n-C4H9COCH3 → Acetone + CH3CH=CH2
1 record matched (CH3)2C=C(CH3)2 + O3 → Acetone + (CH3)2C(·)OO·
1 record matched (CH3)2C=C(CH3)2 + O3 → Acetone + Dimethyldioxirane
1 record matched (CH3)2C=C(CH3)2 + O3 → Acetone + CH3C(O)CH2(·) + ·OH
1 record matched (CH3)2C=C(CH3)2 + O3 → Acetone + CH3C(O)CH2OH
1 record matched i-C3H7ONO → Acetone + HNO
2 records matched CH2OHCHOHCH3 → Acetone + H2O
1 record matched (CH3)2C(OC2H5)2 → C2H5OH + Acetone + C2H4
1 record matched (CH3)2C(OH)CH2C(O)CH3 → Acetone + CH2=C(OH)CH3
1 record matched Myrcene + O3 → syn-CH2=CHC(=CH2)CH2CH2CH(·)OO· + Acetone
1 record matched Myrcene + O3 → anti-CH2=CHC(=CH2)CH2CH2CH(·)OO· + Acetone
1 record matched iso-C4H8 + O3 → Acetone + CH2OO
1 record matched CH3CH=CH2 + CH3C(O)CH2(·) → Acetone + ·CH2CH=CH2
1 record matched (iso-C3H7)2O → Acetone + C3H8
1 record matched 2-methyl-1-phenyl-2-propanol → Acetone + 5-Methylene 1,3-cyclohexadiene
2 records matched Methyloxirane → Acetone
1 record matched Acetone + CH2OO → Products
3 records matched Acetone + ·Cl → CH3C(O)CH2(·) + HCl
2 records matched Acetone + ·Cl → Products
1 record matched Acetone + O· → CH3C(O)CH2(·) + ·OH
1 record matched Acetone + O· → ·CH3 + CH3C(O)O
1 record matched Acetone + ·F → Products
1 record matched Acetone + H· → (CH3)2C(OH)
3 records matched Acetone + H· → i-C3H7O
1 record matched Acetone + H· → H2 + CH3C(O)CH2(·)
5 records matched Acetone + ·OH → CH3C(O)CH2(·) + H2O
1 record matched Acetone + ·OH → CH3C(O)OH + ·CH3
1 record matched Acetone + ·OH → Adduct
1 record matched Acetone + ·OH → Products
1 record matched Acetone + HO2 → CH3C(O)CH2(·) + H2O2
2 records matched Acetone + HO2 → (CH3)2C(OH)OO
1 record matched Acetone + C2H3 → C2H4 + CH3C(O)CH2(·)
1 record matched Acetone + Phenyl → Benzene + CH3C(O)CH2(·)
1 record matched Acetone + Phenyl → C6H5OC*(CH3)2
1 record matched Acetone + Phenyl → C6H5C(O*)(CH3)2
3 records matched Acetone + ·CH3 → (CH3)3CO·
2 records matched Acetone + ·CH3 → CH4 + CH3C(O)CH2(·)
1 record matched Acetone + ·CH3 → Adduct
1 record matched Acetone + ·CH3 → Products
1 record matched Acetone + ·CH3 → (CH3)2C(·)OCH3
1 record matched Acetone + CH3CH2O· → CH3CH2C(CH3)2O(·)
1 record matched Acetone + CH3O· → Adduct
1 record matched Acetone + CH3O2· → CH3OOH + CH3C(O)CH2(·)
1 record matched Acetone + ·C2H5 → Adduct
1 record matched Acetone + ·CH2CH=CH2 → CH3CH=CH2 + CH3C(O)CH2(·)
1 record matched Acetone + iso-C4H8 → CH2=C(CH3)CH2C(CH3)2OH
1 record matched Acetone + CH3CH=CH2 → CH2=CHCH2C(CH3)2OH
1 record matched Acetone + 1-C4H8 → CH3CH=CHCH2C(CH3)2OH
2 records matched Acetone → CH2=C(OH)CH3
1 record matched Acetone → CH3C(O)CH2(·) + H·
1 record matched Acetone → ·CH3 + CH3CO
1 record matched Acetone → CH2=C=CH2 + H2O
1 record matched Acetone → Oxacyclobut-2-ene + H2
1 record matched Acetone → CH3CCH + H2O
1 record matched Acetone → C2H6 + CO
3 records matched Acetone → CH4 + H2C=C=O
4 records matched iso-C3H7OH → Acetone + H2
1 record matched (CH3)2C(O)OCH2CH2OH → Acetone + HOCH2CH2O
3 records matched (CH3)2C(OH)OO → Acetone + HO2
1 record matched CH3CH2CH2OO· → Acetone + ·OH
1 record matched CH3CH2C(CH3)2O(·) → Acetone + ·C2H5
1 record matched CH3CH3COOCH3 → Acetone + (·)CH2OH
1 record matched HOC(CH3)2CH2NO2 → Acetone + CH3NO2
1 record matched CH3C(O)CH=CHCH(CH3)C(CH3)2O· → CH3C(O)CH=CHCH(·)CH3 + Acetone
1 record matched (CH3)3CC(CH3)2O· → Acetone + tert-C4H9
1 record matched (CH3)3CCH2C(CH3)2O· → Acetone + Neopentyl
1 record matched (CH3)2C(O·)CH(OH)CH2OH → HOCH2CH(·)OH + Acetone
1 record matched (CH3)2C(·)OCH3 → Acetone + ·CH3
1 record matched CH2=C(CH3)CH2C(CH3)2OH → Acetone + iso-C4H8
1 record matched CH3CH=CHCH2C(CH3)2OH → Acetone + 1-C4H8
1 record matched HC(O)OC(CH3)2O· → Acetone + HCOO
1 record matched CH3C(·)HC(CH3)2OOH → Acetone + CH3CH=CH2 + ·OH
1 record matched ·CH2CH2C(CH3)2OOH → Acetone + C2H4 + ·OH
1 record matched (CH3)2CHOC(·)(CH3)2 → Acetone + iso-C3H7
1 record matched (CH3)2C(OH)CH(OO·)CH2OH → Acetone + HOCH2CHO + ·OH
1 record matched CH3C(O)C(O·)C(CH3)CH3 → Acetone + CH3CO
1 record matched (CH3)2C(·)OCH2CH3 → Acetone + ·C2H5
1 record matched Acetone + Y → CO + Y(CH3)2

Search returned 412 records.