Click on a link in the table below to see detail on the selected reaction.
Records |
|
Reaction |
1 record matched | | C2H4 + O· → CH2=CHO· + H· |
1 record matched | | C2H4 + O· → ·CH3 + HCO |
1 record matched | | C2H4 + O· → CH2O + ·CH2 |
1 record matched | | C2H4 + O· → Products |
1 record matched | | C2H4 + Zr → Products |
1 record matched | | C2H4 + Nb → Products |
1 record matched | | C2H4 + ·CH2C≡CH → Adduct |
1 record matched | | C2H4 + ·CH2CH=CH2 → CH2=CHCH2CH2CH2· |
1 record matched | | CN + C2H4 → Products |
1 record matched | | O(3P) + C2H4 → Products |
1 record matched | | C(3Pj) + C2H4 → H2 + c-C3H2 |
1 record matched | | iso-C4H9 + ·CH2 → C2H4 + 2-C3H7 |
1 record matched | | Cyclobutanecarbonitrile → C2H4 + CH2CHCN |
1 record matched | | C2H3 + H2O → C2H4 + ·OH |
1 record matched | | C2H3 + H2O2 → C2H4 + HO2 |
1 record matched | | C2H3 + iso-C4H9 → C2H4 + Isobutene |
2 records matched | | C2H3 + C2H3 → C2H4 + C2H2 |
1 record matched | | HCO + C2H3 → C2H4 + CO |
1 record matched | | (·)CH2OH + ·CH2 → C2H4 + ·OH |
1 record matched | | (·)CH2OH + C2H3 → CH2O + C2H4 |
2 records matched | | 1-C4H9 → C2H4 + ·C2H5 |
3 records matched | | ·CH3 + ·CH2 → C2H4 + H· |
1 record matched | | ·CH3 + ·CH3 → C2H4 + H2 |
1 record matched | | CH3O· + C2H3 → CH2O + C2H4 |
1 record matched | | 1-C3H7 + ·CH2 → C2H4 + ·C2H5 |
1 record matched | | 1-C3H7 + C2H3 → C2H4 + CH3CH=CH2 |
7 records matched | | 1-C3H7 → C2H4 + ·CH3 |
1 record matched | | ·C2H5 + ·CH2 → C2H4 + ·CH3 |
1 record matched | | ·C2H5 + H· → C2H4 + H2 |
10 records matched | | ·C2H5 + O2 → C2H4 + HO2 |
1 record matched | | ·C2H5 + iso-C4H9 → C2H4 + iso-C4H10 |
1 record matched | | ·C2H5 + ·OH → C2H4 + H2O |
1 record matched | | ·C2H5 + HO2 → C2H4 + H2O2 |
1 record matched | | ·C2H5 + (·)CH2OH → CH3OH + C2H4 |
2 records matched | | ·C2H5 + ·CH3 → CH4 + C2H4 |
1 record matched | | ·C2H5 + 1-C3H7 → C2H4 + C3H8 |
1 record matched | | ·C2H5 + ·C2H → C2H4 + C2H2 |
3 records matched | | ·C2H5 + ·C2H5 → C2H6 + C2H4 |
7 records matched | | ·C2H5 → C2H4 + H· |
1 record matched | | ·CH2CH=CH2 + C2H3 → C2H4 + CH2=C=CH2 |
1 record matched | | ·CH2CH=CH2 + ·C2H5 → C2H4 + CH3CH=CH2 |
1 record matched | | tert-C4H9 + C2H3 → C2H4 + Isobutene |
1 record matched | | tert-C4H9 + ·C2H5 → C2H4 + iso-C4H10 |
1 record matched | | H2 + C2H3 → C2H4 + H· |
1 record matched | | Thiirane + O· → C2H4 + SO |
1 record matched | | Cyclobutane → C2H4 + C2H4 |
1 record matched | | CH3CH=CH2 + C2H3 → C2H4 + ·CH2CH=CH2 |
2 records matched | | Cyclohexene → C2H4 + 1,3-Butadiene |
1 record matched | | iso-C4H10 + C2H3 → C2H4 + iso-C4H9 |
1 record matched | | iso-C4H10 + C2H3 → C2H4 + tert-C4H9 |
1 record matched | | C3H8 + C2H3 → C2H4 + 1-C3H7 |
1 record matched | | C3H8 + C2H3 → C2H4 + 2-C3H7 |
1 record matched | | C2H2 + 1-C3H7 → Other Products + C2H4 |
1 record matched | | C2H2 + H2 → C2H4 |
2 records matched | | C2H4 + ·CH2 → Products |
1 record matched | | C2H4 + CBrF2 → Adduct |
1 record matched | | C2H4 + Te → Adduct |
9 records matched | | C2H4 + ·Cl → CH2CH2Cl |
1 record matched | | C2H4 + N → Products |
2 records matched | | C2H4 + O· → ·CH3 + HCO |
5 records matched | | C2H4 + O· → Products |
1 record matched | | C2H4 + D → CH2DCH2 |
1 record matched | | C2H4 + ·F → C2H3 + HF |
1 record matched | | C2H4 + ·F → CH2=CHF + H· |
9 records matched | | C2H4 + H· → ·C2H5 |
3 records matched | | C2H4 + H· → H2 + C2H3 |
5 records matched | | C2H4 + NO3 → Products |
1 record matched | | C2H4 + SF5 → Adduct |
1 record matched | | C2H4 + Br· → CH2BrCH2 |
1 record matched | | C2H4 + O3 → Other Products + CH2OO |
1 record matched | | C2H4 + O3 → Other Products + ·OH |
8 records matched | | C2H4 + O3 → Products |
1 record matched | | C2H4 + Se → Selenirane |
1 record matched | | C2H4 + O2 → C2H3 + HO2 |
1 record matched | | C2H4 + S → Thiirane |
1 record matched | | C2H4 + CH3S· → CH3SCH2CH2· |
1 record matched | | C2H4 + iso-C4H9 → CH3CH=CH2 + 2-C3H7 |
1 record matched | | C2H4 + ·CCl → Cyclopropyl, 1-chloro- |
1 record matched | | C2H4 + ·CH2F → CH2FCH2CH2 |
1 record matched | | C2H4 + NF2 → F2NCH2CH2 |
12 records matched | | C2H4 + ·OH → HOCH2CH2· |
4 records matched | | C2H4 + ·OH → C2H3 + H2O |
3 records matched | | C2H4 + ·OH → Products |
1 record matched | | C2H4 + ·CH → Products |
1 record matched | | C2H4 + HO2 → Oxirane + ·OH |
1 record matched | | C2H4 + HO2 → CH3CHO + ·OH |
1 record matched | | C2H4 + HO2 → Adduct |
1 record matched | | C2H4 + HO2 → Products |
2 records matched | | C2H4 + ·CCl3 → CCl3CH2CH2 |
1 record matched | | C2H4 + CF3CF2CF2· → Adduct |
1 record matched | | C2H4 + CF3CH2CH2 → CF3(CH2)3CH2 |
1 record matched | | C2H4 + C2H3 → 1,3-Butadiene + H· |
1 record matched | | C2H4 + C2H3 → Products |
1 record matched | | C2H4 + (·)CH2OH → HOCH2CH2CH2· |
1 record matched | | C2H4 + 1-C4H9 → 1-hexyl radical |
1 record matched | | C2H4 + (CH3)2CHCH2CH2· → (iso-C3H7)(CH2)3CH2· |
1 record matched | | C2H4 + ·CF3 → CF3CH2CH2 |
5 records matched | | C2H4 + ·CH3 → 1-C3H7 |
3 records matched | | C2H4 + ·CH3 → CH4 + C2H3 |
1 record matched | | C2H4 + CH2=C → C2H3 + C2H3 |
1 record matched | | C2H4 + CH3O· → Products |
1 record matched | | C2H4 + 1-C3H7 → 1-C5H11 |
1 record matched | | C2H4 + ·C2H → Vinylacetylene + H· |
1 record matched | | C2H4 + ·C2H → Products |
2 records matched | | C2H4 + ·C2H5 → 1-C4H9 |
1 record matched | | C2H4 + ·C2H5 → C2H6 + C2H3 |
1 record matched | | C2H4 + 2-C3H7 → (CH3)2CHCH2CH2· |
1 record matched | | C2H4 + 2-C3H7 → CH3CH=CH2 + ·C2H5 |
1 record matched | | C2H4 + ·CH2CH=CH2 → Cyclopentene + H· |
1 record matched | | C2H4 + tert-C4H9 → (CH3)3CCH2CH2· |
1 record matched | | C2H4 + tert-C4H9 → Products |
1 record matched | | C2H4 + H2 → ·C2H5 + H· |
1 record matched | | C2H4 + CO → HCO + C2H3 |
1 record matched | | C2H4 + CH3CH=CH2 → 1-C3H7 + C2H3 |
1 record matched | | C2H4 + CH3CH=CH2 → 2-C3H7 + C2H3 |
1 record matched | | C2H4 + CH3CH=CH2 → ·CH2CH=CH2 + ·C2H5 |
1 record matched | | C2H4 + CH3CH=CH2 → 1-C5H10 |
1 record matched | | C2H4 + C2H2 → C2H3 + C2H3 |
1 record matched | | C2H4 + C2H4 → ·C2H5 + C2H3 |
2 records matched | | C2H4 → C2H3 + H· |
3 records matched | | C2H4 → C2H2 + H2 |
1 record matched | | C2H6 + C2H3 → C2H4 + ·C2H5 |
1 record matched | | CH4 + C2H3 → C2H4 + ·CH3 |
1 record matched | | CH3OH + C2H3 → C2H4 + (·)CH2OH |
1 record matched | | CH3OH + C2H3 → C2H4 + CH3O· |
9 records matched | | C2H5OH → C2H4 + H2O |
1 record matched | | CH2O + C2H3 → C2H4 + HCO |
1 record matched | | M + C2H4 + ·Cl → M + CH2CH2Cl |
2 records matched | | N(2D) + C2H4 → Products |
2 records matched | | N(2P) + C2H4 → Products |
1 record matched | | N2(A3Sigma_u+) + C2H4 → Products |
1 record matched | | Bicyclo[2.2.2]oct-5-ene-2-carbonitrile, 3-methyl-,(1α,2α,3α,4α)-(endo,endo) → Other Products + C2H4 |
1 record matched | | Bicyclo[2.2.2]oct-5-ene-2-carbonitrile, 3-methyl-,(1α,2β,3β,4α)-(exo,exo) → Other Products + C2H4 |
1 record matched | | Bicyclo[2.2.2]oct-5-ene-2-carbonitrile, 3-methyl-,(1α,2α,3β,4α)-(endo,exo) → Other Products + C2H4 |
1 record matched | | Bicyclo[2.2.2]oct-5-ene-2-carbonitrile, 3-methyl-,(1α,2β,3α,4α)-(exo,endo) → Other Products + C2H4 |
1 record matched | | Carbonothioic acid O-ethyl S-(4-nitrophenyl) ester → Other Products + C2H4 |
1 record matched | | Carbonothioic acid S-(3-chlorophenyl) O-ethyl ester → Other Products + C2H4 |
1 record matched | | Carbonothioic acid S-(4-chlorophenyl) O-ethyl ester → Other Products + C2H4 |
1 record matched | | Carbonothioic acid O-ethyl S-(2-meyhoxyphenyl) ester → Other Products + C2H4 |
3 records matched | | (Z)-Cr(CO)4(C2H4)2 → C2H4 + Cr(CO)4(C2H4) |
1 record matched | | bicyclo[2.2.2]oct-2-ene,5-(1-methylethyl)-,(1α,4α,5α)- → C2H4 + 1,3-Cyclohexadiene, 5-(1-methylethyl)- |
1 record matched | | bicyclo[2.2.2]oct-2-ene, 5-ethyl-,(1α,4α,5α)- → C2H4 + 1,3-Cyclohexadiene. 5-ethyl- |
1 record matched | | bicyclo[2.2.2]oct-2-ene, 5-ethyl-,(1α,4α,5β)- → C2H4 + 1,3-Cyclohexadiene. 5-ethyl- |
1 record matched | | Bicyclo[2.2.2]oct-2-ene, 5-(1-methylethyl)-,(1α,4α,5β)- → C2H4 + 1,3-Cyclohexadiene, 5-(1-methylethyl)- |
1 record matched | | (Z)-Fe(CO)2(C2H4)3 → Other Products + C2H4 |
1 record matched | | (E)-Fe(CO)2(C2H4)3 → Other Products + C2H4 |
1 record matched | | Pyrimidine, 2-chloro-4-ethoxy- → Other Products + C2H4 |
1 record matched | | Pyridine, 2-ethoxy-5-methyl- → C2H4 + 2(1H)-Pyridinone, 5-methyl- |
1 record matched | | Pyridine, 2-ethoxy-4-methyl- → C2H4 + 2(1H)-Pyridinone, 4-methyl- |
1 record matched | | Pyridine, 2-ethoxy-3-methyl- → C2H4 + 2(1H)-Pyridinone, 3-methyl- |
1 record matched | | CH3OC(S)OC2H5 → C2H4 + CH3OC(O)SH |
1 record matched | | C2H5SiH → C2H4 + SiH2 |
1 record matched | | Carbonothioic acid O-ethyl S-phenyl ester → Other Products + C2H4 |
1 record matched | | Carbonothioic acid O-ethyl S-(4-methylphenyl) ester → Other Products + C2H4 |
1 record matched | | Cyclobutane-1,2-d2, trans- (unspecified) → C2H4 + (E)-CHD=CHD |
2 records matched | | Fe(CO)3(C2H4)2 → C2H4 + Fe(CO)3(C2H4) |
1 record matched | | Cyclobutane-1,2-d2, cis- → C2H4 + (Z)-CHD=CHD |
1 record matched | | Carbonothioic acid O-ethyl S-(4-methoxyphenyl) ester → Other Products + C2H4 |
1 record matched | | 1-Ethoxyisoquinoline → C2H4 + 1(2H)-Isoquinolinone |
3 records matched | | F2NCH2CH2 → C2H4 + NF2 |
1 record matched | | Pyridazine, 3-ethoxy- → C2H4 + 3(2H)-Pyridazinone |
1 record matched | | Isoquinoline, 3-ethoxy- → C2H4 + 3(2H)-Isoquinolinone |
1 record matched | | Benzoic acid, 3-iodo-, ethyl ester → C2H4 + Benzoic acid, 3-iodo- |
1 record matched | | (·)CH2CH(OH)C≡N → C2H4 + NCO |
1 record matched | | ·CH2CH2C(O)CH3 → C2H4 + CH3CO |
1 record matched | | Ethyl 1-Piperidineglyoxylate → C2H4 + CO2 + 1-Piperidinecarboxaldehyde |
1 record matched | | Benzoic acid, 4-iodo-, ethyl ester → C2H4 + Benzoic acid, 4-iodo- |
1 record matched | | 2-Ethoxyquinoline → 2(1H)-Quinolinone + C2H4 |
2 records matched | | CH3OC(O)SC2H5 → C2H4 + CH3OC(O)SH |
1 record matched | | Pyrazine, ethoxy- → C2H4 + 2(1H)-Pyrazinone |
1 record matched | | 1,2-Cyclobutanedione → Other Products + C2H4 |
1 record matched | | N,N-Dimethylglycine ethyl ester → C2H4 + (CH3)3N + CO2 |
1 record matched | | Cyclobutane, 1,1,2-trimethyl- → C2H4 + (CH3)2C=CHCH3 |
1 record matched | | Spiropentane, methyl- → C2H4 + 1,2-butadiene |
2 records matched | | ethyl 1-methyl-2-piperidine carboxylate → C2H4 + CO2 + N-Methylpiperidine |
1 record matched | | Pyrimidine, 4-ethoxy- → C2H4 + 4(3H)-Pyrimidinone |
2 records matched | | Benzoic acid, 3-bromo-, ethyl ester → C2H4 + Benzoic acid, 3-bromo- |
1 record matched | | Ethyl 1-piperidineaceate → C2H4 + CO2 + N-Methylpiperidine |
2 records matched | | CH2DCH2Br → C2H4 + DBr |
1 record matched | | CH2DCH2Cl → C2H4 + DCl |
1 record matched | | Germacyclobutane, 1,1-dimethyl- → C2H4 + (CH3)2Ge=CH2 |
1 record matched | | 1-Piperidinepropanoic acid, ethyl ester → C2H4 + CO2 + Piperidine, 1-ethyl- |
1 record matched | | Pyridine, 2-ethoxy-6-methyl- → C2H4 + 2(1H)-Pyridinone, 6-methyl- |
1 record matched | | (CH3)3SiCH2CH2OCH3 → C2H4 + (CH3)3SiOCH3 |
1 record matched | | ClCH2CH2Si(C2H5)Cl2 → C2H4 + C2H5SiCl3 |
1 record matched | | 1H-Pyrazole, 1-ethyl-3,5-dimethyl- → 1H-Pyrazole, 3,5-dimethyl- + C2H4 |
1 record matched | | (CH3)3SiCH2CH2Cl → C2H4 + (CH3)3SiCl |
1 record matched | | (C2H5)3SiCH2CH2Cl → C2H4 + (C2H5)3SiCl |
1 record matched | | Pyridazine, 3-chloro-6-ethoxy- → C2H4 + 3(2H)-Pyridazinone, 6-chloro- |
4 records matched | | CH2BrCH2 → C2H4 + Br· |
1 record matched | | CH2CH2Cl + CH2CH2Cl → C2H4 + CH2ClCH2Cl |
3 records matched | | CH2CH2Cl → C2H4 + ·Cl |
1 record matched | | Thiazole, 2-ethoxy- → C2H4 + 2(3H)-Thiazolone |
1 record matched | | Cyclobutane, 1,2-dimethyl-, trans- → C2H4 + CH3CH=CHCH3 |
1 record matched | | Cyclobutane, 1,2-dimethyl-, cis- → C2H4 + CH3CH=CHCH3 |
2 records matched | | bicyclo[2.2.2]oct-2-ene, 5-methyl-,(1α,4α,5α)- → C2H4 + 5-Methyl-1,3-cyclohexadiene |
1 record matched | | C2H5OC(O)SCH3 → C2H4 + CH3OC(O)SH |
2 records matched | | Bicyclo[2.2.2]oct-2-ene, 5-methyl-,(1α,4α,5β)- → C2H4 + 5-Methyl-1,3-cyclohexadiene |
2 records matched | | Pyridine, 2-ethoxy- → C2H4 + 2(1H)-Pyridinone |
1 record matched | | 2H-Pyran, 3,4-dihydro-2-methyl- → C2H4 + CH2=CHCOCH3 |
2 records matched | | Benzoic acid, 3-methoxy-, ethyl ester → C2H4 + 3-Methoxybenzoic acid |
1 record matched | | O2 + CH3CH2N=NCH(·)CH3 → C2H4 + C2H5OO· + N2 |
1 record matched | | O2 + ·CH2CH2N=NC2H5 → C2H4 + C2H5OO· + N2 |
1 record matched | | Benzoic acid, 3-hydroxy-, ethyl ester → C2H4 + Benzoic acid, 3-hydroxy- |
2 records matched | | Benzoic acid, 4-chloro-, ethyl ester → Benzoic acid, 4-chloro- + C2H4 |
2 records matched | | CH2=CHCH2CH2CH2· → C2H4 + ·CH2CH=CH2 |
1 record matched | | CH2=CHSiH3 → C2H4 + SiH2 |
1 record matched | | Bicyclo[3.2.0]hept-2-ene → C2H4 + Cyclopentadiene |
1 record matched | | ·CH2Cl + CH2CH2Cl → C2H4 + CH2Cl2 |
1 record matched | | 1-Propanone, 1-cyclobutyl- → C2H4 + C2H5COCH=CH2 |
1 record matched | | 2,2-dimethyl-oxetane → Acetone + C2H4 |
1 record matched | | ClCH2CH2SiCl3 → C2H4 + SiCl4 |
2 records matched | | Benzoic acid, 4-bromo-, ethyl ester → C2H4 + 4-Bromobenzoic acid |
1 record matched | | 3-Thiophenecarboxylic acid ethyl ester → C2H4 + 3-Thiophenecarboxylic acid |
1 record matched | | Bicyclopropyl → C2H4 + 1,3-Butadiene |
1 record matched | | t-C4H9CH2C(O)OCH2CH3 → C2H4 + (CH3)3CCH2COOH |
1 record matched | | Ethyl 1-methylnipecotate → C2H4 + CO2 + N-Methylpiperidine |
1 record matched | | Ethyl piperidine-3-carboxylate → C2H4 + 3-Piperidine Carboxylic Acid |
1 record matched | | Cyclobutane, propyl- → C2H4 + 1-C5H10 |
1 record matched | | Cyclobutane, ethyl- → C2H4 + 1-C4H8 |
1 record matched | | Cyclooctyl radical + O· → C2H4 + ·CH2(CH2)4CHO |
2 records matched | | Cyclobutanecarbonitrile → C2H4 + CH2CHCN |
2 records matched | | HOCH2CH2· → C2H4 + ·OH |
1 record matched | | Cyclobutanemethanol → C2H4 + CH2=CHCH2OH |
1 record matched | | Cyclopentanecarbonitrile → C2H4 + (E)-CH3CH=CHCN |
1 record matched | | ClCH2CH2SiCl(C2H5)2 → C2H4 + Silane, dichlorodiethyl- |
1 record matched | | CH3CH → C2H4 |
1 record matched | | Cyclopentyl → C2H4 + ·CH2CH=CH2 |
1 record matched | | Carbonic acid ethyl phenyl ester → C2H4 + Carbonic acid monophenyl ester |
1 record matched | | Pyrimidine, 2-ethoxy- → C2H4 + 2(1H)-Pyrimidinone |
1 record matched | | Ethyl diethylcarbamate → C2H4 + (C2H5)2NH + CO2 |
1 record matched | | Silacyclobutane, 1-ethenyl-1-methyl- → Other Products + C2H4 |
1 record matched | | C2H5OCH2CH2· → C2H4 + CH3CH2O· |
2 records matched | | C2H5OO· → C2H4 + HO2 |
1 record matched | | Cyclohexyl + O· → ·CH2CH2CH2CHO + C2H4 |
2 records matched | | Cl(CH2)3C(O)OC2H5 → C2H4 + Cl(CH2)3COOH |
1 record matched | | Ethanone, 1-cyclobutyl)- → C2H4 + CH2=CHCOCH3 |
2 records matched | | Cyclobutane,(1-methylethenyl)- → C2H4 + CH2=C(CH3)CH=CH2 |
1 record matched | | Bicyclo[2.2.2]oct-5-ene-2-carbonitrile,(1α,2α,4α)- → C2H4 + 2,4-Cyclohexadiene-1-carbonitrile |
1 record matched | | Bicyclo[2.2.2]oct-5-ene-2-carbonitrile,(1α,2β,4α)- → C2H4 + 2,4-Cyclohexadiene-1-carbonitrile |
1 record matched | | Cyclobutanecarboxaldehyde → C2H4 + CH2=CHCHO |
1 record matched | | BrCH2CH2CH2C(O)OC2H5 → C2H4 + BrCH2CH2CH2COOH |
1 record matched | | Cyclobutanol → C2H4 + CH3CHO |
1 record matched | | (CH3)3SiCH2CH2OH → C2H4 + (CH3)3SiOH |
1 record matched | | 1H-Pyrazole, 1-ethyl- → C2H4 + Pyrazole |
1 record matched | | 2-Thiophenecarboxylic acid ethyl ester → C2H4 + 2-Thiophenecarboxylic acid |
2 records matched | | C2H3 + H· → C2H4 |
1 record matched | | C2H3 + HI → C2H4 + I |
4 records matched | | C2H3 + HCl → C2H4 + ·Cl |
8 records matched | | C2H3 + C2H3 → C2H4 + C2H2 |
1 record matched | | Carbamic acid, methylphenyl-, ethyl ester → C2H4 + N-Methylbenzenamine + CO2 |
2 records matched | | Ethenylcyclobutane → C2H4 + 1,3-Butadiene |
2 records matched | | 2-Pyridinecarboxylic acid ethyl ester → C2H4 + Pyridine + CO2 |
1 record matched | | 2-Pyridinecarboxylic acid ethyl ester → C2H4 + 2-Pyridinecarboxylic acid |
8 records matched | | 1-C4H9 → C2H4 + ·C2H5 |
1 record matched | | Cyclopropyl + O2 → HOCO + C2H4 |
1 record matched | | Silacyclobutane, 1,1-dimethyl- + Silacyclobutane, 1,1-dimethyl- → C2H4 + C2H4 + 1,1,3,3-Tetramethyl-1,3-disilacyclobutane |
1 record matched | | Silacyclobutane, 1,1-dimethyl- → C2H4 + (CH3)2Si=CH2 |
3 records matched | | ·CH3 + ·CH2 → C2H4 + H· |
1 record matched | | ·CH3 + ·CH2F → C2H4 + HF |
5 records matched | | ·CH3 + ·CH3 → C2H4 + H2 |
3 records matched | | 2-methyl-oxetane → C2H4 + CH3CHO |
10 records matched | | 1-C3H7 → C2H4 + ·CH3 |
1 record matched | | ·C2H5 + (Z)-CH3CH=CHCH2CH2· → C2H4 + 2-(Z)-C5H10 |
5 records matched | | ·C2H5 + ·Cl → C2H4 + HCl |
1 record matched | | ·C2H5 + O· → C2H4 + ·OH |
1 record matched | | ·C2H5 + CH2CH2Cl → C2H4 + C2H5Cl |
1 record matched | | ·C2H5 + H· → C2H4 + H2 |
2 records matched | | ·C2H5 + Br· → C2H4 + HBr |
21 records matched | | ·C2H5 + O2 → C2H4 + HO2 |
1 record matched | | ·C2H5 + iso-C4H9 → C2H4 + iso-C4H10 |
1 record matched | | ·C2H5 + Cyclobutyl → C2H4 + Cyclobutane |
1 record matched | | ·C2H5 + Cyclopentyl → C2H4 + Cyclopentane |
2 records matched | | ·C2H5 + ·CH2F → C2H4 + CH3F |
1 record matched | | ·C2H5 + CHCl2 → C2H4 + CH2Cl2 |
3 records matched | | ·C2H5 + C2F5 → C2H4 + C2F5H |
1 record matched | | ·C2H5 + HO2 → C2H4 + H2O2 |
2 records matched | | ·C2H5 + ·CCl3 → CHCl3 + C2H4 |
4 records matched | | ·C2H5 + CF3CF2CF2· → C2H4 + C2F5CF2H |
1 record matched | | ·C2H5 + Cyclohexyl → C2H4 + Cyclohexane |
2 records matched | | ·C2H5 + ·CHF2 → C2H4 + CH2F2 |
1 record matched | | ·C2H5 + C2H3 → C2H4 + C2H4 |
1 record matched | | ·C2H5 + 1-C4H9 → C2H4 + 1-C4H10 |
3 records matched | | ·C2H5 + ·CF3 → C2H4 + CHF3 |
8 records matched | | ·C2H5 + ·CH3 → CH4 + C2H4 |
2 records matched | | ·C2H5 + CH3CH2O· → C2H5OH + C2H4 |
2 records matched | | ·C2H5 + 1-C3H7 → C2H4 + C3H8 |
1 record matched | | ·C2H5 + ·C2H5 → C2H4 + ·C2H5 |
32 records matched | | ·C2H5 + ·C2H5 → C2H6 + C2H4 |
29 records matched | | ·C2H5 → C2H4 + H· |
3 records matched | | 2-C3H7 + ·C2H5 → C2H4 + C3H8 |
4 records matched | | 2-C3H7 → C2H4 + ·CH3 |
1 record matched | | ·CH2CH=CH2 + O· → C2H4 + HCO |
1 record matched | | ·CH2CH=CH2 + O· → C2H4 + CO + H· |
2 records matched | | ·CH2CH=CH2 + ·C2H5 → C2H4 + CH3CH=CH2 |
1 record matched | | 1,2-Dimethylcyclohexene → C2H4 + CH2=C(CH3)C(CH3)=CH2 |
3 records matched | | tert-C4H9 + ·C2H5 → C2H4 + iso-C4H10 |
1 record matched | | tert-C4H9 → C2H4 + ·C2H5 |
1 record matched | | C6H5COC(O)OC2H5 → C2H4 + Benzaldehyde + CO2 |
1 record matched | | 4-Pyridinecarboxylic acid ethyl ester → 4-Pyridinecarboxylic acid + C2H4 |
1 record matched | | Ethylidenecyclobutane → C2H4 + 1,2-butadiene |
1 record matched | | Cyclohexene-3,3,6,6-d4 → C2H4 + CD2=CHCH=CD2 |
4 records matched | | H2 + C2H3 → C2H4 + H· |
1 record matched | | Naphthalene, 1,2,3,4,4a,5,6,7-Octahydro- → C2H4 + Cyclohexene, 1-ethenyl- |
1 record matched | | 2,3-Dihydrofuran → C2H4 + H2C=C=O |
3 records matched | | Cyclobutanone → C2H4 + H2C=C=O |
2 records matched | | Benzoic acid, 3-chloro-, ethyl ester → C2H4 + Benzoic acid, 3-chloro- |
3 records matched | | cyclobutyl chloride → C2H4 + CH2=CHCl |
1 record matched | | Methylenecyclobutane → C2H4 + CH2=C=CH2 |
2 records matched | | Bicyclo[2.2.2]oct-2-ene → C2H4 + 1,3-Cyclohexadiene |
2 records matched | | CH3C(S)OCH2CH3 → C2H4 + CH3COSH |
2 records matched | | CH2=C(CH3)OC2H5 → Acetone + C2H4 |
1 record matched | | Isopropylcyclobutane → C2H4 + (CH3)2CHCH=CH2 |
1 record matched | | CH3C(S)SC2H5 → C2H4 + CH3C(S)SH |
1 record matched | | Cyclobutanecarboxylic acid methyl ester → C2H4 + CH2=CHC(O)OCH3 |
1 record matched | | Silacyclobutane, 1-methyl- → C2H4 + CH2=SiHCH3 |
1 record matched | | Silacyclobutane, 1-methyl- → C2H4 + CH2=CHSiH3 |
1 record matched | | C2H5CH2C(CH3)=CH2 → C2H4 + Isobutene |
2 records matched | | C2H5OC(O)N(CH3)2 → C2H4 + CO2 + (CH3)2NH |
1 record matched | | tert-C4H9OC2H5 → C2H4 + tert-C4H9OH |
1 record matched | | C3H7C≡CH → C2H4 + CH2=C=CH2 |
1 record matched | | CH3COSC2H5 → C2H4 + CH3COSH |
1 record matched | | ClCH2CH2C(O)OC2H5 → C2H4 + ClCH2CH2COOH |
1 record matched | | (E)-CH3CH=CHCOOC2H5 → C2H4 + (E)-CH3CH=CHCOOH |
1 record matched | | CH3SC(S)OC2H5 → C2H4 + CH3OC(S)SH |
3 records matched | | CH3OC(O)OCH2CH3 → C2H4 + CH3OC(O)OH |
1 record matched | | HOCH2COOC2H5 → C2H4 + HOCH2COOH |
1 record matched | | Benzoic acid, 3-nitro-, ethyl ester → C2H4 + 3-Nitrobenzoic acid |
1 record matched | | (C2H5)3As → C2H4 + (C2H5)2AsH |
1 record matched | | 2-Furancarboxylic acid ethyl ester → C2H4 + 2-Furancarboxylic acid |
1 record matched | | 3-Furancarboxylic acid ethyl ester → C2H4 + 3-Furancarboxylic acid |
1 record matched | | 3-Pyridinecarboxylic acid ethyl ester → 3-Pyridinecarboxylic acid + C2H4 |
3 records matched | | Methylcyclobutane → C2H4 + CH3CH=CH2 |
1 record matched | | 1,5-Hexadiene → C2H4 + 1,3-Butadiene |
1 record matched | | CH2=C=CHCH2CH3 → C2H4 + CH3CCH |
1 record matched | | 1-Methylcyclohexene → C2H4 + CH2=C(CH3)CH=CH2 |
1 record matched | | 1,2-butadiene + H· → C2H4 + C2H3 |
1 record matched | | Benzoic acid, 3-amino-, ethyl ester → C2H4 + 3-Aminobenzoic acid |
2 records matched | | Oxetane → CH2O + C2H4 |
2 records matched | | Azetidine → C2H4 + CH2=NH |
1 record matched | | Bicyclo[2.2.2]octa-2,5-diene → Benzene + C2H4 |
3 records matched | | Bicyclo[2.2.1]hept-2-ene → C2H4 + Cyclopentadiene |
1 record matched | | Naphthelene, 1,2,3,4,5,6,7,8-Octahydro- → C2H4 + Cyclohexane 1,2-bis(methylene)- |
5 records matched | | H2C=C=O + ·CH2 → C2H4 + CO |
5 records matched | | CH2=C=CH2 + O· → C2H4 + CO |
1 record matched | | CH2=C=CH2 → Other Products + C2H4 |
1 record matched | | CH2(OC2H5)2 → C2H4 + CH3CH2OCH2OH |
1 record matched | | CH2FC(O)OC2H5 → C2H4 + CH2FCOOH |
1 record matched | | CHF2COOC2H5 → C2H4 + CHF2COOH |
1 record matched | | C2F5COOC2H5 → C2H4 + C2F5COOH |
3 records matched | | Thiirane + ·Cl → C2H4 + SCl |
1 record matched | | Thiirane + O· → C2H4 + SO |
2 records matched | | Thiirane + H· → C2H4 + SH |
3 records matched | | Thiirane + S → C2H4 + S2 |
1 record matched | | Thiirane + CH3S· → C2H4 + CH3SS |
1 record matched | | Thiirane + ·CH3 → C2H4 + CH3S· |
1 record matched | | Thiirane + CD3 → C2H4 + CD3S |
2 records matched | | Thiirane → C2H4 + S |
1 record matched | | CF3COOC2H5 → C2H4 + CF3COOH |
1 record matched | | Cyclobutane,1,1,2,2-tetrafluoro- → C2H4 + C2F4 |
1 record matched | | CH2FCH2OH → C2H4 + HOF |
1 record matched | | n-C3F7COOC2H5 → C2H4 + Heptafluoro-1-butanoic acid |
9 records matched | | C2H5F → C2H4 + HF |
1 record matched | | Cyclopentane → C2H4 + Cyclopropane |
1 record matched | | Silacyclobutane → C2H4 + CH2=SiH2 |
2 records matched | | Thietane → C2H4 + CH2S |
19 records matched | | Cyclobutane → C2H4 + C2H4 |
1 record matched | | cyclopentene epoxide → C2H4 + CH2=CHCHO |
1 record matched | | Bicyclo[3.2.0]heptane → C2H4 + Cyclopentene |
1 record matched | | Spirohexane → C2H4 + Cyclobutylidene |
2 records matched | | Silacyclopropane → C2H4 + SiH2 |
1 record matched | | Cyclopentene + O· → Products + C2H4 |
2 records matched | | Cyclopentene + H· → C2H4 + ·CH2CH=CH2 |
20 records matched | | CH3C(O)OC2H5 → CH3C(O)OH + C2H4 |
1 record matched | | (CH3)2C(OC2H5)2 → C2H5OH + Acetone + C2H4 |
1 record matched | | Pyrrolidine → C2H4 + Aziridine |
1 record matched | | Benzoic acid, 4-hydroxy-, ethyl ester → C2H4 + Benzoic acid, 4-hydroxy- |
2 records matched | | Benzoic acid, 3-methyl-, ethyl ester → C2H4 + 3-Methylbenzoic acid |
1 record matched | | 1,2,3,4-Tetrahydronaphthalene → C2H4 + Benzocyclobutene |
1 record matched | | Propane, 1,1,1-triethoxy- → C2H5OH + C2H4 + C2H5C(O)OC2H5 |
1 record matched | | CH3CH=CH2 + N → C2H4 + HCN + H· |
1 record matched | | CH3CH=CH2 + O· → CH2O + C2H4 |
3 records matched | | CH3CH=CH2 + H· → C2H4 + ·CH3 |
1 record matched | | CH3CH=CH2 → C2H4 + ·CH3 |
6 records matched | | 3,4-Dihydro-2H-pyran → C2H4 + CH2=CHCHO |
16 records matched | | Cyclohexene → C2H4 + 1,3-Butadiene |
1 record matched | | NCCH2CH2CN → C2H4 + NCCN |
1 record matched | | Tetrahydrofuran → C2H4 + CH2OCH2 |
2 records matched | | HC(O)OC2H5 → HCOOH + C2H4 |
6 records matched | | CH2=CHOC2H5 → C2H4 + CH3CHO |
1 record matched | | C2H5NCO → C2H4 + HN=C=O |
1 record matched | | 1-C5H10 → C2H4 + CH3CH=CH2 |
1 record matched | | (CH3)2CHCH2C(O)OC2H5 → C2H4 + iso-C4H9COOH |
4 records matched | | C2H5CN → C2H4 + HCN |
1 record matched | | CH2ClCH2Cl → C2H4 + Cl2 |
1 record matched | | 1,3-Butadiene → C2H4 + C2H2 |
1 record matched | | 1-C4H8 + H· → C2H4 + ·C2H5 |
6 records matched | | C2H5OC(O)OC2H5 → C2H4 + C2H5OC(O)OH |
1 record matched | | NCCH2COOC2H5 → C2H4 + NCCH2COOH |
1 record matched | | CH3CH2CH2C(O)OC2H5 → C2H4 + n-C3H7COOH |
1 record matched | | ClCH2C(O)OC2H5 → C2H4 + CH2ClCOOH |
1 record matched | | C2H5C(O)OC2H5 → C2H4 + C2H5COOH |
1 record matched | | CH2BrC(O)OC2H5 → C2H4 + CH2BrCOOH |
1 record matched | | Carbamic acid, phenyl-, ethyl ester → C2H4 + Carbamic acid, phenyl- |
1 record matched | | Benzeneacetic acid ethyl ester → C2H4 + Benzeneacetic acid |
1 record matched | | Ethylbenzene → Benzene + C2H4 |
1 record matched | | Benzoic acid, 4-nitro-, ethyl ester → 4-Nitrobenzoic acid + C2H4 |
1 record matched | | (C2H5)3B → C2H4 + (C2H5)2BH |
1 record matched | | Benzoic acid, 4-methoxy-, ethyl ester → C2H4 + 4-Methoxybenzoic acid |
1 record matched | | Benzoic acid, 4-amino-, ethyl ester → C2H4 + 4-Aminobenzoic acid |
2 records matched | | Benzoic acid, 4-methyl-, ethyl ester → C2H4 + 4-Methylbenzoic acid |
3 records matched | | Ethyl benzoate → Benzoic acid + C2H4 |
1 record matched | | Acenaphthene + C2H3 → C12H9 + C2H4 |
1 record matched | | C2H5NO2 → C2H4 + HNO2 |
1 record matched | | Ethane, 1,1,1-triethoxy- → C2H5OH + C2H4 + CH3C(O)OC2H5 |
1 record matched | | (C2H5O)4Si → C2H4 + HOSi(OCH2CH3)3 |
1 record matched | | iso-C4H10 + C2H3 → C2H4 + tert-C4H9 |
1 record matched | | Oxirane + H· → C2H4 + ·OH |
1 record matched | | Oxirane + C2O → C2H4 + CO + CO |
1 record matched | | Oxirane + (CH3)2Si → C2H4 + (CH3)2Si=O |
1 record matched | | C2H5SH → C2H4 + H2S |
1 record matched | | CH3CHO + ·CH → C2H4 + HCO |
6 records matched | | C2H5I → C2H4 + HI |
17 records matched | | C2H5Cl → C2H4 + HCl |
1 record matched | | CH3CCH + O· → C2H4 + CO |
2 records matched | | C3H8 → CH4 + C2H4 |
16 records matched | | C2H5Br → C2H4 + HBr |
1 record matched | | C2H2 + 1-C3H7 → Other Products + C2H4 |
1 record matched | | C2H2 + 1,3-Cyclohexadiene → Benzene + C2H4 |
1 record matched | | C2H4 + W(CO)4 → W(CO)4(eta2-CH2=CH2) |
1 record matched | | C2H4 + Cr(CO)4(C2H4) → (Z)-Cr(CO)4(C2H4)2 |
1 record matched | | C2H4 + CH2=CHCH=Si(CH3)2 → Silacyclohex-2-ene, 1,1-dimethyl- |
1 record matched | | C2H4 + W(CO)4(eta2-CH2=CH2) → W(CO)4(eta2-CH2=CH2)2 |
1 record matched | | C2H4 + H2Fe(CO)3 → H2Fe(CO)3(CH2=CH2) |
1 record matched | | C2H4 + CF3(CH2)3CH2 → Products |
2 records matched | | C2H4 + Fe(CO)3(C2H4) → Fe(CO)3(C2H4)2 |
1 record matched | | C2H4 + C2H5SiH → Adduct |
3 records matched | | C2H4 + CH3GeH → Products |
1 record matched | | C2H4 + (CH3)2Ge: → Products |
1 record matched | | C2H4 + :SiD2 → Products |
2 records matched | | C2H4 + ·CH2 → CH3CH=CH2 |
1 record matched | | C2H4 + ·CH2 → Cyclopropane |
4 records matched | | C2H4 + ·CH2 → Products |
1 record matched | | C2H4 + Cr(CO)4 → Products |
1 record matched | | C2H4 + CH2OO → Products |
1 record matched | | C2H4 + CH≡CC≡C → Products |
1 record matched | | C2H4 + Fe(CO)3 → Fe(CO)3(C2H4) |
1 record matched | | C2H4 + CF2BrCF2 → Adduct |
1 record matched | | C2H4 + CH3C(O)OO(·) → Products |
1 record matched | | C2H4 + Cr(CO)5 → Cr(CO)5(C2H4) |
1 record matched | | C2H4 + CH3Sn(·)CH3 → Products |
1 record matched | | C2H4 + Te → Adduct |
11 records matched | | C2H4 + ·Cl → CH2CH2Cl |
6 records matched | | C2H4 + ·Cl → C2H3 + HCl |
21 records matched | | C2H4 + ·Cl → Products |
1 record matched | | C2H4 + NCO → (·)CH2CH(OH)C≡N |
6 records matched | | C2H4 + NCO → Products |
2 records matched | | C2H4 + CF3O → CF3OH + C2H3 |
6 records matched | | C2H4 + CF3O → Adduct |
1 record matched | | C2H4 + SiCl3 → Adduct |
11 records matched | | C2H4 + N → HCN + ·CH3 |
9 records matched | | C2H4 + N → Products |
1 record matched | | C2H4 + O· → CH2=CHO· + H· |
8 records matched | | C2H4 + O· → *CH2C(O)H + H· |
1 record matched | | C2H4 + O· → C2H3 + ·OH |
12 records matched | | C2H4 + O· → ·CH3 + HCO |
3 records matched | | C2H4 + O· → H2C=C=O + H2 |
2 records matched | | C2H4 + O· → Oxirane |
3 records matched | | C2H4 + O· → CH2O + ·CH2 |
48 records matched | | C2H4 + O· → Products |
3 records matched | | C2H4 + D → CH2DCH2 |
1 record matched | | C2H4 + D → CH2=CHD + H· |
2 records matched | | C2H4 + D → Products |
1 record matched | | C2H4 + H2C=N → Products |
1 record matched | | C2H4 + BrO → Products |
1 record matched | | C2H4 + Fe(CO)4 → (CH2=CH2)(CO)4Fe |
1 record matched | | C2H4 + ·F → CH2CH2F |
6 records matched | | C2H4 + ·F → C2H3 + HF |
5 records matched | | C2H4 + ·F → CH2=CHF + H· |
6 records matched | | C2H4 + ·F → Products |
1 record matched | | C2H4 + IO → Products |
1 record matched | | C2H4 + AlO → Products |
1 record matched | | C2H4 + AlH → Products |
1 record matched | | C2H4 + SiF2 → Products |
1 record matched | | C2H4 + SH → Products |
1 record matched | | C2H4 + SiHCl → Products |
1 record matched | | C2H4 + SiHCl → chlorosilirane |
8 records matched | | C2H4 + SiH2 → Silacyclopropane |
1 record matched | | C2H4 + CD → Products |
2 records matched | | C2H4 + NH → Products |
4 records matched | | C2H4 + ·NH2 → Products |
6 records matched | | C2H4 + BH → Products |
1 record matched | | C2H4 + OD → C2H3 + HDO |
2 records matched | | C2H4 + OD → Adduct |
1 record matched | | C2H4 + OD → Products |
1 record matched | | C2H4 + SiCl2 → Adduct |
3 records matched | | C2H4 + ·CHF → Products |
1 record matched | | C2H4 + BH3 → Products |
1 record matched | | C2H4 + W2 → W2-C2H4 |
111 records matched | | C2H4 + H· → ·C2H5 |
13 records matched | | C2H4 + H· → H2 + C2H3 |
3 records matched | | C2H4 + H· → Products |
4 records matched | | C2H4 + Cu2 → Cu2CH2=CH2) |
1 record matched | | C2H4 + Au2 → Adduct |
2 records matched | | C2H4 + TiO → Products |
3 records matched | | C2H4 + C3 → Products |
2 records matched | | C2H4 + C2O → Products |
1 record matched | | C2H4 + C2 → H· + CH2C(·)CCCH |
1 record matched | | C2H4 + C2 → Products |
1 record matched | | C2H4 + MoO → Products |
1 record matched | | C2H4 + ZrO → Products |
1 record matched | | C2H4 + TaO → Products |
1 record matched | | C2H4 + NbO → Products |
11 records matched | | C2H4 + NO3 → Products |
1 record matched | | C2H4 + SF5 → SF5CH2CH2· |
1 record matched | | C2H4 + NO2 → Adduct |
4 records matched | | C2H4 + NO2 → Products |
1 record matched | | C2H4 + Br· → CH3CHBr |
4 records matched | | C2H4 + Br· → CH2BrCH2 |
5 records matched | | C2H4 + Br· → Products |
1 record matched | | C2H4 + HI → C2H5I |
3 records matched | | C2H4 + O3 → CH2O + CH2OO |
4 records matched | | C2H4 + O3 → Other Products + ·OH |
1 record matched | | C2H4 + O3 → Other Products + HO2 |
24 records matched | | C2H4 + O3 → Products |
1 record matched | | C2H4 + N2O → CH3CHO + N2 |
1 record matched | | C2H4 + F2 → ·F + CH3C(·)HF |
4 records matched | | C2H4 + F2 → ·F + CH2CH2F |
1 record matched | | C2H4 + H2O → Products |
3 records matched | | C2H4 + P → Products |
4 records matched | | C2H4 + S → Thiirane |
4 records matched | | C2H4 + Bi → Products |
2 records matched | | C2H4 + Zr → Products |
1 record matched | | C2H4 + Y → Y(C2H4) |
1 record matched | | C2H4 + Y → H2 + Y(C2H2) |
2 records matched | | C2H4 + Y → Products |
1 record matched | | C2H4 + Hf → Products |
1 record matched | | C2H4 + Ge → Products |
1 record matched | | C2H4 + Ga → Adduct |
1 record matched | | C2H4 + Cu → Cu(CH2=CH2) |
1 record matched | | C2H4 + Cr → Products |
1 record matched | | C2H4 + C → ·CH2C≡CH + H· |
5 records matched | | C2H4 + C → Products |
1 record matched | | C2H4 + B → Products |
2 records matched | | C2H4 + As → Products |
3 records matched | | C2H4 + Sb → Products |
1 record matched | | C2H4 + Sn → Products |
2 records matched | | C2H4 + Ta → Products |
3 records matched | | C2H4 + Si → Products |
2 records matched | | C2H4 + Ru → Products |
1 record matched | | C2H4 + Rh → Products |
1 record matched | | C2H4 + Pt → Products |
2 records matched | | C2H4 + Pd → Products |
2 records matched | | C2H4 + Nb → Products |
4 records matched | | C2H4 + Ni → Ni(CH2=CH2) |
3 records matched | | C2H4 + Ni → Products |
1 record matched | | C2H4 + Mo → Products |
1 record matched | | C2H4 + Mn → Products |
7 records matched | | C2H4 + Pb → Products |
4 records matched | | C2H4 + Fe → Products |
1 record matched | | C2H4 + Ir → Products |
2 records matched | | C2H4 + Al → Adduct |
1 record matched | | C2H4 + CH3S· → Adduct |
1 record matched | | C2H4 + (CH3)2Si → Adduct |
1 record matched | | C2H4 + (CH3)2Si → Products |
2 records matched | | C2H4 + CBr → Products |
3 records matched | | C2H4 + ·CCl → Products |
2 records matched | | C2H4 + CF → Products |
1 record matched | | C2H4 + ·CH2F → CH2FCH2CH2 |
1 record matched | | C2H4 + ·CH2F → CH3F + C2H3 |
3 records matched | | C2H4 + NF2 → F2NCH2CH2 |
1 record matched | | C2H4 + NF2 → Products |
1 record matched | | C2H4 + (CH3)3CO2 → Oxirane + (CH3)3CO· |
1 record matched | | C2H4 + ·OH + NO → Products |
18 records matched | | C2H4 + ·OH → HOCH2CH2· |
16 records matched | | C2H4 + ·OH → C2H3 + H2O |
42 records matched | | C2H4 + ·OH → Products |
1 record matched | | C2H4 + ·CH → Cyclopropene + H· |
2 records matched | | C2H4 + ·CH → CH2=C=CH2 + H· |
1 record matched | | C2H4 + ·CH → CH3CCH + H· |
1 record matched | | C2H4 + ·CH → Products + H· |
6 records matched | | C2H4 + ·CH → Products |
5 records matched | | C2H4 + HO2 → Oxirane + ·OH |
1 record matched | | C2H4 + HO2 → Products |
4 records matched | | C2H4 + ·CCl3 → CCl3CH2CH2 |
3 records matched | | C2H4 + CF3CH2CH2 → CF3(CH2)3CH2 |
1 record matched | | C2H4 + ·CH2C≡CH → Products |
1 record matched | | C2H4 + ·CHF2 → CH2F2 + C2H3 |
1 record matched | | C2H4 + C2H3 → 1,3-Butadiene + H· |
3 records matched | | C2H4 + C2H3 → Products |
1 record matched | | C2H4 + ·HCC≡N → Products |
1 record matched | | C2H4 + HCO → Products |
1 record matched | | C2H4 + HOC(·)O → CO2 + ·C2H5 |
1 record matched | | C2H4 + 1-Naphthalenyl → C10H7CH2CH2· |
2 records matched | | C2H4 + 1-C4H9 → 1-hexyl radical |
1 record matched | | C2H4 + (CH3)2CHCH2CH2· → (iso-C3H7)(CH2)3CH2· |
2 records matched | | C2H4 + Phenyl → Styrene + H· |
1 record matched | | C2H4 + Phenyl → Other Products + H· |
1 record matched | | C2H4 + Phenyl → Other Products + C2H3 |
1 record matched | | C2H4 + Phenyl → Adduct |
4 records matched | | C2H4 + Phenyl → Products |
4 records matched | | C2H4 + ·CF3 → CF3CH2CH2 |
1 record matched | | C2H4 + ·CF3 → Products |
6 records matched | | C2H4 + ·CH3 → 1-C3H7 |
1 record matched | | C2H4 + ·CH3 → CH3CH=CH2 + H· |
7 records matched | | C2H4 + ·CH3 → CH4 + C2H3 |
1 record matched | | C2H4 + ·CH3 → Products |
1 record matched | | C2H4 + ·CF2 → CH3CH=CF2 |
1 record matched | | C2H4 + ·CF2 → Products |
1 record matched | | C2H4 + CH2=C → Products |
2 records matched | | C2H4 + CH3O· → CH3OCH2CH2· |
1 record matched | | C2H4 + CH3O· → Products |
2 records matched | | C2H4 + 1-C3H7 → 1-C5H11 |
2 records matched | | C2H4 + CH3O2· → Oxirane + CH3O· |
2 records matched | | C2H4 + ·C2H → Vinylacetylene + H· |
1 record matched | | C2H4 + ·C2H → C2H2 + C2H3 |
4 records matched | | C2H4 + ·C2H → Products |
1 record matched | | C2H4 + CD3 → CHD3 + C2H3 |
1 record matched | | C2H4 + ·CHCl → Products |
3 records matched | | C2H4 + ·C2H5 → 1-C4H9 |
1 record matched | | C2H4 + ·C2H5 → CH3CH=CH2 + ·CH3 |
1 record matched | | C2H4 + ·C2H5 → 1-C4H8 + H· |
6 records matched | | C2H4 + ·C2H5 → C2H6 + C2H3 |
2 records matched | | C2H4 + 2-C3H7 → (CH3)2CHCH2CH2· |
1 record matched | | C2H4 + ·CH2CH=CH2 → CH2=CHCH2CH2CH2· |
1 record matched | | C2H4 + ·CH2CH=CH2 → CH2=CHCH=CHCH3 + H· |
1 record matched | | C2H4 + ·CH2CH=CH2 → Cyclopentene + H· |
1 record matched | | C2H4 + ·CClF → Products |
1 record matched | | C2H4 + tert-C4H9 → (CH3)3CCH2CH2· |
2 records matched | | C2H4 + CCl2 (X 1A1) → Products |
4 records matched | | C2H4 + H2 → C2H6 |
1 record matched | | C2H4 + (E)-2-C4H8 → C2H5CH(CH3)CH=CH2 |
2 records matched | | C2H4 + (E)-2-C4H8 → Products |
1 record matched | | C2H4 + 1,3-Cyclohexadiene → Bicyclo[2.2.2]oct-2-ene |
1 record matched | | C2H4 + (Z)-2-C4H8 → C2H5CH(CH3)CH=CH2 |
2 records matched | | C2H4 + (Z)-2-C4H8 → Products |
1 record matched | | C2H4 + Cyclopentadiene → Bicyclo[2.2.1]hept-2-ene |
1 record matched | | C2H4 + CSe2 → Selenirane + CSe |
1 record matched | | C2H4 + Benzyne → Benzocyclobutene |
1 record matched | | C2H4 + Benzyne → Styrene |
1 record matched | | C2H4 + CF3CN → ·CF3 + N=C-CH2CH2 |
1 record matched | | C2H4 + Cyclopentene → ·C2H5 + Cyclopentenyl |
1 record matched | | C2H4 + Cyclopentene → C2H6 + Cyclopentadiene |
1 record matched | | C2H4 + Isobutene → C2H5CH2C(CH3)=CH2 |
1 record matched | | C2H4 + CH3CH=CH2 → 1-C5H10 |
1 record matched | | C2H4 + 1,3-Butadiene → Cyclohexene |
1 record matched | | C2H4 + 1-C4H8 → CH3CH=CH2 + CH3CH=CH2 |
1 record matched | | C2H4 + CH2=C(CH3)CH=CH2 → 1-Methylcyclohexene |
1 record matched | | C2H4 + C3H8 → Products |
4 records matched | | C2H4 + C2H4 → ·C2H5 + C2H3 |
1 record matched | | C2H4 + C2H4 → Cyclobutane |
1 record matched | | C2H4 + C2H4 → 1,3-Butadiene + H2 |
1 record matched | | C2H4 + C2H4 → 1-C4H8 |
3 records matched | | C2H4 + C2H4 → Products |
5 records matched | | C2H4 → C2H3 + H· |
11 records matched | | C2H4 → C2H2 + H2 |
4 records matched | | C2H4 → Products |
1 record matched | | C2H6 + ·CH → C2H4 + ·CH3 |
1 record matched | | C2H6 + C2H3 → C2H4 + ·C2H5 |
2 records matched | | C2H6 + C2H4 → 1-C4H8 + H2 |
5 records matched | | C2H6 → C2H4 + H2 |
3 records matched | | CH4 + C → C2H4 |
3 records matched | | CH4 + ·CH → C2H4 + H· |
7 records matched | | C2H5OH → C2H4 + H2O |
1 record matched | | C2H5OSO2CH3 → C2H4 + HOSO2CH3 |
3 records matched | | Diethyl ether → C2H5OH + C2H4 |
3 records matched | | 2-Oxetanone → C2H4 + CO2 |
3 records matched | | CN + C2H4 → CH2CHCN + H· |
1 record matched | | CN + C2H4 → HCN + C2H3 |
1 record matched | | CN + C2H4 → Other Products + CH2CHCN |
1 record matched | | CN + C2H4 → Products + H· |
13 records matched | | CN + C2H4 → Products |
1 record matched | | CN + C2H4 → CH2=CH-NC + H· |
1 record matched | | Cl(2P3/2) + C2H4 → C2H3 + HCl |
1 record matched | | O(1D) + C2H4 → ·CH3 + HCO |
2 records matched | | O(1D) + C2H4 → Products |
2 records matched | | O2(1DELTA) + C2H4 → C2H4 + O2 |
1 record matched | | SF5CH2CH2· → C2H4 + SF5 |
1 record matched | | CH2CHCOH → C2H4 + CO |
1 record matched | | CH3CH2CH2CHO → C2H4 + CH2=CHOH |
4 records matched | | Mu + C2H4 → CH2CH2Mu |
1 record matched | | N(D) + C2H4 → Products |
1 record matched | | N(P) + C2H4 → Products |
1 record matched | | NCCO + C2H4 → Products |
1 record matched | | N(2D) + C2H4 → Products |
1 record matched | | O(3P) + C2H6 → C2H4 + H2O |
2 records matched | | S(1D) + C2H4 → H· + CH2=CHS |
2 records matched | | S(1D) + C2H4 → ·CH3 + HC=S |
2 records matched | | S(1D) + C2H4 → H2 + CH2=C=S |
3 records matched | | S(1D) + C2H4 → Products |
1 record matched | | ·CH2CH2ONO → C2H4 + NO2 |
1 record matched | | B(2P1/2,3/2) [Mix of states] + C2H4 → Products |
1 record matched | | Propyl Radical + O2 → C2H4 + HO2 |
1 record matched | | 1-ethylpiperazine carboxylate → C2H4 + Piperazine + CO2 |
1 record matched | | C2H5OCH=CHN(C2H5)2 → CHOCH2N(C2H5)2 + C2H4 |
1 record matched | | C2H5OCH=CHNH2 → CHOCH2NH2 + C2H4 |
2 records matched | | CH3CH(CH3)CH2CH2CH2· → C2H4 + iso-C4H9 |
1 record matched | | Zr (4d2_5s2,3F) + C2H4 → C2H2Zr + H2 |
1 record matched | | C2(X1ΣPlg) + C2H4 → H· + CH2C(·)CCCH |
2 records matched | | C2(X1ΣPlg) + C2H4 → Products |
1 record matched | | NCO(X2PI) + ·C2H5 → C2H4 + C#N(OH) |
1 record matched | | NCO(X2PI) + ·C2H5 → C2H4 + HN=C=O |
1 record matched | | (2-piperdine)-C(O)OCH2CH3 → C2H4 + Piperidine + CO2 |
1 record matched | | (N-piperdine)-C(O)OCH2CH3 → C2H4 + Piperidine + CO2 |
2 records matched | | CH_2(aA_1) + C2H4 → ·CH2CH=CH2 + H· |
1 record matched | | CH_2(aA_1) + C2H4 → Other Products + H· |
2 records matched | | CH_2(aA_1) + C2H4 → Products |
1 record matched | | O2(b1Sigma_g+) + C2H4 → Products |
1 record matched | | cyclopentoxy (chemically activated) → C2H4 + CH2=CHCHO + H· |
1 record matched | | cyclopentoxy (chemically activated) → C2H4 + C2H4 + CO + H· |
1 record matched | | C2(a3PIu) + C2H4 → H· + CH2C(·)CCCH |
3 records matched | | C2(a3PIu) + C2H4 → Products |
1 record matched | | ethyl 3-phenyl glycidate → C2H4 + Phenylethanal + CO2 |
1 record matched | | ethyl 3-methyl-3-phenyl glycidate → C6H5CH(CH3)CHO + C2H4 + CO2 |
1 record matched | | C2H5OCH=CHNH2 → C2H4 + CH3NH2 + CO |
1 record matched | | 3-C8H17 → C2H4 + 1-hexyl radical |
1 record matched | | 1,2-Diethylcyclohexene → C2H4 + C2H5C(=CH2)C(=CH2)C2H5 |
1 record matched | | (CH3)3CCH2CH2· → C2H4 + tert-C4H9 |
1 record matched | | C2H5OCH=CHN(C2H5)2 → C2H4 + (C2H5)2(CH3)N + CO |
2 records matched | | CH2CH2SH → C2H4 + SH |
1 record matched | | (iso-C3H7)(CH2)3CH2· → C2H4 + (CH3)2CHCH2CH2· |
1 record matched | | CH2=CHCH(·)CH3 → C2H4 + C2H3 |
1 record matched | | ·CH2 + ·CH2 → C2H4 |
1 record matched | | ·CH2CH2C(O)CH3 → C2H4 + CH3CO |
1 record matched | | 1,3-Hexadien-6-yl → C2H4 + CH2=CHCH=CH· |
2 records matched | | 1-C10H21 → C2H4 + 1-C8H17 |
1 record matched | | CH3OC(O)SC2H5 → CH3OC(S)OH + C2H4 |
2 records matched | | 1-C9H19 → C2H4 + 1-C7H15 |
1 record matched | | ethyl 1-methyl-2-piperidine carboxylate → C2H4 + CO2 + N-Methylpiperidine |
1 record matched | | CH2=CHCH2O → C2H4 + HCO |
1 record matched | | C6H5CH2CH2CH2· → C2H4 + Benzyl |
1 record matched | | CH3CH=CHCH2CH2· → C2H4 + CH3CH=C(·)H |
1 record matched | | 4-C7H15 → C2H4 + 1-C5H11 |
1 record matched | | 3-C7H15 → C2H4 + 1-C5H11 |
1 record matched | | 4-C8H17 → C2H4 + 1-hexyl radical |
1 record matched | | 3-hexyl radical → C2H4 + 1-C4H9 |
1 record matched | | ClCH2CH2Si(C2H5)Cl2 → C2H4 + C2H5SiCl3 |
1 record matched | | (C2H5)3SiCH2CH2Cl → C2H4 + (C2H5)3SiCl |
1 record matched | | 2-phenylethyl → C2H4 + Phenyl |
2 records matched | | CH2BrCH2 → C2H4 + Br· |
2 records matched | | CH2CH2Cl → C2H4 + ·Cl |
3 records matched | | ·CH2CH2CH2CH2CH=CH2 → C2H4 + CH2=CHCH2CH2· |
1 record matched | | H2C=N + H2C=N → C2H4 + N2 |
1 record matched | | ·CH2C(CH3)=CH2 → C2H4 + C2H3 |
1 record matched | | C2H5OC(O)SCH3 → C2H4 + CH3OC(O)SH |
2 records matched | | C2H5OC(O)OH → C2H5OH + C2H4 |
1 record matched | | C2H5OC(O)OH → HOC(O)OH + C2H4 |
2 records matched | | CH2=CHCH2CH2CH2· → C2H4 + ·CH2CH=CH2 |
1 record matched | | Thiirane, 1-oxide- → C2H4 + SO |
1 record matched | | HOCH2CH2CH2CH2 → C2H4 + HOCH2CH2· |
2 records matched | | (C2H5O)PO2 → C2H4 + HOPO2 |
1 record matched | | 7-Oxabicyclo[2.2.1]hept-2-ene → C2H4 + Furan |
1 record matched | | ClCH2CH2SiCl3 → C2H4 + SiCl4 |
2 records matched | | CH3CH=C=O → C2H4 + CO |
1 record matched | | C2H5CH(·)OH → C2H4 + (·)CH2OH |
1 record matched | | Cyclopropanone → C2H4 + CO |
1 record matched | | iso-C4H9 → C2H4 + ·C2H5 |
3 records matched | | 1-C8H17 → C2H4 + 1-hexyl radical |
1 record matched | | Cyclooctyl radical + O· → C2H4 + ·CH2(CH2)4CHO |
5 records matched | | HOCH2CH2· → C2H4 + ·OH |
1 record matched | | ClCH2CH2SiCl(C2H5)2 → C2H4 + Silane, dichlorodiethyl- |
1 record matched | | Ethyl diethylcarbamate → C2H4 + (C2H5)2NH + CO2 |
1 record matched | | 2-C7H15 → C2H4 + 1-C5H11 |
4 records matched | | 1-C7H15 → C2H4 + 1-C5H11 |
4 records matched | | C2H5OCH2CH2· → C2H4 + CH3CH2O· |
1 record matched | | 2-C8H17 → C2H4 + 1-hexyl radical |
1 record matched | | C2H5OO· → C2H4 + H2O |
4 records matched | | C2H5OO· → C2H4 + HO2 |
1 record matched | | Cyclohexyl + O· → ·CH2CH2CH2CHO + C2H4 |
1 record matched | | CH3CH2OOH → C2H4 + H2O2 |
3 records matched | | ·CH2C≡CH + ·OH → C2H4 + CO |
1 record matched | | Chlorpyrifos → C2H4 + Phosphorothioic acid, O-ethyl O-(3,5,6-trichloro-2-pyridinyl) ester |
1 record matched | | Chlorpyrifos → 3,4,6-Trichloro-2(1H)-pyridinone···CH3CH2OP(=O)=S complex + C2H4 |
1 record matched | | Chlorpyrifos → (3,5,6-trichloro-2-pyridinyl)-O-P(=O)(OC2H5)SH + C2H4 |
5 records matched | | 1-hexyl radical → C2H4 + 1-C4H9 |
11 records matched | | 1-C5H11 → C2H4 + 1-C3H7 |
2 records matched | | 1-C5H11 → C2H4 + 2-C3H7 |
3 records matched | | C2H3 + H· → C2H4 |
1 record matched | | C2H3 + H2O → C2H4 + ·OH |
1 record matched | | C2H3 + NH3 → C2H4 + ·NH2 |
2 records matched | | C2H3 + HCl → C2H4 + ·Cl |
1 record matched | | C2H3 + HO2 → C2H4 + O2 |
1 record matched | | C2H3 + C2H3 → C2H4 + C2H2 |
1 record matched | | 2-Pyridinecarboxylic acid ethyl ester → C2H4 + Pyridine + CO2 |
1 record matched | | 2-hexyl radical → C2H4 + 1-C4H9 |
11 records matched | | 1-C4H9 → C2H4 + ·C2H5 |
1 record matched | | CH3CH2CH2CH(·)CH3 → C2H4 + 1-C3H7 |
1 record matched | | CH3CH2CH2CH(·)CH3 → C2H4 + 2-C3H7 |
2 records matched | | (CH3)2CHCH2CH2· → C2H4 + 2-C3H7 |
2 records matched | | 1-phenylethyl → C2H4 + Phenyl |
2 records matched | | CH3CH(·)OH + H· → C2H4 + H2O |
2 records matched | | ·CH3 + ·CH2 → C2H4 + H· |
1 record matched | | ·CH3 + ·CH2Cl → C2H4 + HCl |
1 record matched | | 2-methyl-oxetane → C2H4 + CH3CHO |
7 records matched | | CH2=CHCH2CH2· → C2H4 + C2H3 |
2 records matched | | CH3CH2O· + H· → C2H4 + H2O |
15 records matched | | 1-C3H7 → C2H4 + ·CH3 |
1 record matched | | ·C2H + NH3 → C2H4 + ·NH2 |
1 record matched | | ·C2H5 + NCO → C2H4 + HO-C≡N |
1 record matched | | ·C2H5 + NCO → C2H4 + HN=C=O |
1 record matched | | ·C2H5 + N → (3)NH + C2H4 |
3 records matched | | ·C2H5 + O· → C2H4 + ·OH |
3 records matched | | ·C2H5 + H· → C2H4 + H2 |
7 records matched | | ·C2H5 + O2 → C2H4 + HO2 |
1 record matched | | ·C2H5 + ·OH → C2H4 + H2O |
1 record matched | | ·C2H5 + HO2 → C2H4 + H2O2 |
2 records matched | | ·C2H5 + C2H3 → C2H4 + C2H4 |
1 record matched | | ·C2H5 + 1-C4H9 → C2H4 + 1-C4H10 |
5 records matched | | ·C2H5 + ·CH3 → CH4 + C2H4 |
2 records matched | | ·C2H5 + ·C2H5 → C2H6 + C2H4 |
9 records matched | | ·C2H5 → C2H4 + H· |
3 records matched | | 2-C3H7 + C2H3 → C2H4 + CH3CH=CH2 |
2 records matched | | 2-C3H7 + ·C2H5 → C2H4 + C3H8 |
1 record matched | | ·CH2CH=CH2 + ·C2H5 → C2H4 + CH3CH=CH2 |
1 record matched | | 1,2-Dimethylcyclohexene → C2H4 + CH2=C(CH3)C(CH3)=CH2 |
2 records matched | | PO(OH)2(OC2H5) → O=P(OH)3 + C2H4 |
19 records matched | | H2 + C2H3 → C2H4 + H· |
1 record matched | | H2 + CH2=C → C2H4 |
2 records matched | | Cyclobutanone → C2H4 + H2C=C=O |
1 record matched | | Methylenecyclobutane → C2H4 + CH2=C=CH2 |
1 record matched | | Dihydro-3-(2H)-thiophenone → C2H4 + CO + CH2S |
1 record matched | | 2-Azetidinone → C2H4 + HN=C=O |
1 record matched | | CH2=C(CH3)OC2H5 → Acetone + C2H4 |
1 record matched | | CH3C(S)SC2H5 → C2H4 + CH3C(S)SH |
1 record matched | | Ethane, 1-chloro-2-fluoro- → C2H4 + ClF |
1 record matched | | C2H5OC(O)N(CH3)2 → C2H4 + CO2 + (CH3)2NH |
1 record matched | | (C2H5O)2P(O)CH3 → C2H4 + PO(OH)(CH3)(OC2H5) |
1 record matched | | C2H5C(O)OCH(CH3)2 → CH(O)OCH(CH3)2 + C2H4 |
1 record matched | | CH3CH2CH2CH2OCH3 → CH2O + C2H6 + C2H4 |
1 record matched | | 2-Chloroethyl methyl ether → C2H4 + CH3OCl |
1 record matched | | CH3COSC2H5 → CH3C(S)OH + C2H4 |
1 record matched | | CH3SC(S)OC2H5 → CH3SC(O)SH + C2H4 |
1 record matched | | CH3OC(O)OCH2CH3 → C2H4 + CH3OC(O)OH |
1 record matched | | CH3OC(O)OCH2CH3 → CH3OH + C2H4 + CO2 |
1 record matched | | Methyl butanoate → C2H4 + CH3C(O)OCH3 |
1 record matched | | Methyl butanoate → CH2=C(OH)OCH3 + C2H4 |
1 record matched | | 2-Furancarboxylic acid ethyl ester → C2H4 + Furan + CO2 |
2 records matched | | 2-Furancarboxylic acid ethyl ester → C2H4 + 2-Furancarboxylic acid |
1 record matched | | 1-Methylcyclohexene → C2H4 + CH2=C(CH3)CH=CH2 |
1 record matched | | 1,2-butadiene → C2H4 + CH2=C |
1 record matched | | 1,2-butadiene → C2H4 + C2H2 |
2 records matched | | CH3CHBr2 → C2H4 + Br2 |
1 record matched | | (C2H5)2Zn → HZnC2H5 + C2H4 |
1 record matched | | Tris(2-chloroethyl)amine → C2H4 + Bis-(2-chloroethyl)chloroamine |
1 record matched | | Methyl propanoate → C2H4 + HC(O)OCH3 |
1 record matched | | Cyclopentadiene + H· → C2H4 + ·CH2C≡CH |
1 record matched | | 2-Methylfuran → C2H4 + C2H2 + CO |
1 record matched | | Bis(2-chloroethyl) sulfide → C2H4 + ClCH2CH2SCl |
2 records matched | | Oxetane → CH2O + C2H4 |
1 record matched | | 2-butyne → C2H4 + CH2=C |
1 record matched | | 2-butyne → C2H4 + C2H2 |
1 record matched | | H2C=C=O + ·CH2 → C2H4 + CO |
1 record matched | | H2C=C=O + H2C=C=O → C2H4 + CO + CO |
1 record matched | | CH2=C=CH2 + O· → C2H4 + CO |
1 record matched | | CH2=C=CH2 + ·CH3 → C2H4 + C2H3 |
1 record matched | | CH2=C=CH2 + CH2=C=CH2 → C2H4 + CH2=C=C=CH2 |
1 record matched | | Thiirane + GeHCl → GeHClS + C2H4 |
1 record matched | | Thiirane + CH3GeH → CH3GeHS + C2H4 |
1 record matched | | Thiirane + (CH3)2Ge: → C2H4 + Ge(CH3)2S |
1 record matched | | Thiirane + :GeH2 → GeH2S + C2H4 |
1 record matched | | Thiirane + GeBr2 → GeBr2S + C2H4 |
1 record matched | | Thiirane + GeF2 → GeF2S + C2H4 |
1 record matched | | Thiirane + GeCl2 → GeCl2S + C2H4 |
1 record matched | | C2H5F → C2H4 + HF |
1 record matched | | Cyclopentane → C2H4 + Cyclopropane |
1 record matched | | Thietane → C2H4 + CH2S |
3 records matched | | Cyclobutane → C2H4 + C2H4 |
1 record matched | | Acenaphthylene + C2H3 → acenaphthylenyl + C2H4 |
1 record matched | | aceanthrylene + C2H3 → alpha-aceanthrylenyl + C2H4 |
1 record matched | | Acephenanthrylene + C2H3 → alpha-acephenanthrylenyl + C2H4 |
1 record matched | | Acephenanthrylene + C2H3 → beta-acephenanthrylenyl + C2H4 |
1 record matched | | Spiropentane → C2H4 + CH2=C=CH2 |
1 record matched | | CH3C(O)OC2H5 → CH3C(O)OH + C2H4 |
1 record matched | | (CH3)2C(OC2H5)2 → C2H5OH + Acetone + C2H4 |
1 record matched | | (C2H5O)3P → C2H4 + OPH(OC2H5)2 |
1 record matched | | Isobutene + C2H3 → C2H4 + ·CH2C(CH3)=CH2 |
1 record matched | | CH3CH=CH2 + O· → CH2O + C2H4 |
1 record matched | | CH3CH=CH2 + H· → C2H4 + ·CH3 |
1 record matched | | CH3CH=CH2 + C2H3 → C2H4 + CH2=C(·)CH3 |
1 record matched | | CH3CH=CH2 + C2H3 → C2H4 + CH3CH=C(·)H |
1 record matched | | CH3CH=CH2 + C2H3 → C2H4 + ·CH2CH=CH2 |
1 record matched | | CH3CH=CH2 + ·C2H5 → C2H4 + 2-C3H7 |
1 record matched | | CH3CH=CH2 → C2H4 + ·CH3 |
3 records matched | | Cyclohexene → C2H4 + 1,3-Butadiene |
1 record matched | | Tetrahydrofuran → C2H4 + CH3CHO |
6 records matched | | HC(O)OC2H5 → HCOOH + C2H4 |
2 records matched | | CH2=CHOC2H5 → C2H4 + CH3CHO |
1 record matched | | 2-C5H10 + H· → C2H4 + 2-C3H7 |
1 record matched | | 1-C5H10 + H· → C2H4 + 2-C3H7 |
1 record matched | | 1-C5H10 → C2H4 + CH3CH=CH2 |
1 record matched | | γ-Valerolactone → C2H4 + CH3CHO + CO |
1 record matched | | 1-nitropropane → C2H4 + H2C=N(O)OH |
3 records matched | | CH2ClCH2Cl → C2H4 + Cl2 |
1 record matched | | CH3CH=CHCH3 + C2H3 → C2H4 + CH2=CHCH(·)CH3 |
1 record matched | | 1,3-Butadiene + H· → C2H4 + C2H3 |
1 record matched | | 1,3-Butadiene → C2H4 + CH2=C |
4 records matched | | 1,3-Butadiene → C2H4 + C2H2 |
1 record matched | | 1-C4H8 + C2H3 → C2H4 + CH2=CHCH(·)CH3 |
1 record matched | | 1-C4H8 + ·CH3 → C2H4 + 2-C3H7 |
2 records matched | | CH2BrCH2Br → C2H4 + Br2 |
4 records matched | | C2H5OC(O)OC2H5 → C2H4 + C2H5OC(O)OH |
2 records matched | | C2H5OC(O)OC2H5 → C2H5OH + C2H4 + CO2 |
1 record matched | | C2H5C(O)OC2H5 → C2H4 + HC(O)OC2H5 |
3 records matched | | C2H5C(O)OC2H5 → C2H4 + C2H5COOH |
2 records matched | | Ethoxybenzene → C2H4 + 2,4-Cyclohexadienone |
2 records matched | | Ethoxybenzene → C2H4 + Phenol |
1 record matched | | 1-Phenylpropane → C2H4 + 5-Methylene 1,3-cyclohexadiene |
1 record matched | | 1-Phenylpropane → C2H4 + Toluene |
1 record matched | | Naphthalene + C2H3 → C2H4 + 2-Naphthalenyl |
1 record matched | | Naphthalene + C2H3 → C2H4 + 1-Naphthalenyl |
1 record matched | | 1-Methylnaphthalene + C2H3 → C2H4 + 1-Naphthylmethyl |
1 record matched | | C2H5NO2 → cis-HONO + C2H4 |
2 records matched | | C2H5NO2 → trans-HONO + C2H4 |
1 record matched | | CH2=CHCOCH3 + H· → C2H4 + CH3CO |
3 records matched | | (C2H5O)3PO → PO(OH)(OC2H5)2 + C2H4 |
1 record matched | | Oxirane + GeHCl → GeHClO + C2H4 |
1 record matched | | Oxirane + CH3GeH → CH3GeHO + C2H4 |
1 record matched | | Oxirane + (CH3)2Ge: → C2H4 + Ge(CH3)2O |
1 record matched | | Oxirane + :GeH2 → C2H4 + GeH2O |
1 record matched | | Oxirane + GeBr2 → GeBr2O + C2H4 |
1 record matched | | Oxirane + GeF2 → C2H4 + GeF2O |
1 record matched | | Oxirane + GeCl2 → GeCl2O + C2H4 |
1 record matched | | HN=C=O + C2H3 → C2H4 + NCO |
1 record matched | | C2H5SH → C2H4 + H2S |
1 record matched | | CH3CHO + C2H3 → C2H4 + CH3CO |
2 records matched | | C2H5I + O· → C2H4 + HIO |
1 record matched | | C2H5I → C2H4 + HI |
7 records matched | | C2H5Cl → C2H4 + HCl |
1 record matched | | CH3CCH + O· → C2H4 + CO |
1 record matched | | C3H8 + C2H3 → C2H4 + 1-C3H7 |
1 record matched | | C3H8 + C2H3 → C2H4 + 2-C3H7 |
1 record matched | | C2H5Br → C2H4 + HBr |
1 record matched | | CH3Cl + C2H3 → C2H4 + ·CH2Cl |
1 record matched | | C2H2 + H2 → C2H4 |
1 record matched | | C2H4 + Germacyclobutylidene → 3-Germaspiro[2.3]hexane |
1 record matched | | C2H4 + CH2I-Cl → Cyclopropane + ICl |
1 record matched | | C2H4 + CH2Cl-I → Cyclopropane + ICl |
1 record matched | | C2H4 + CH2Br-I → Cyclopropane + IBr |
1 record matched | | C2H4 + CH2I-Br → Cyclopropane + IBr |
1 record matched | | C2H4 + CH2Ge → Germacyclobutylidene |
1 record matched | | C2H4 + CH2Ge → 1-Methylenegermacyclopropane |
2 records matched | | C2H4 + HCNCH2 → 2H-Pyrrole, 3,4-dihydro- |
1 record matched | | C2H4 + 5,5-Difluoro-1,3-cyclopentadiene → Adduct |
1 record matched | | C2H4 + (CH3)2Ge: → 1,1-dimethylgermacyclopropane |
1 record matched | | C2H4 + COH → ·CH2CH2CHO |
1 record matched | | C2H4 + COH → CH3C(·)HCHO |
1 record matched | | C2H4 + COH → H2O + Cycloprop-1-enyl |
1 record matched | | C2H4 + COH → Cyclopropanone + H· |
1 record matched | | C2H4 + COH → CO + ·C2H5 |
1 record matched | | C2H4 + COH → H2C=C=O + ·CH3 |
1 record matched | | C2H4 + COH → CH2=CHCHO + H· |
2 records matched | | C2H4 + CH2=CHCH(·)CH3 → CH2=CHCH(CH3)CH2CH2· |
1 record matched | | C2H4 + ·CH2 → CH3CH=CH2 |
1 record matched | | C2H4 + ·CH2 → Cyclopropane |
1 record matched | | C2H4 + ·CH2 → Adduct |
1 record matched | | C2H4 + ·CH2 → Products |
1 record matched | | C2H4 + CH2OO → 1,2-Dioxolane |
2 records matched | | C2H4 + CH2OO → Products |
1 record matched | | C2H4 + ·CH2C(O)OCH3 → CH3OC(O)CH2CH2CH2· |
1 record matched | | C2H4 + HCCO → ·CH2CH2CHCO |
1 record matched | | C2H4 + (CH3)2C → 1,1-Dimethylcyclopropane |
1 record matched | | C2H4 + Silane,2,4-cyclopentadien-1-yl- → Adduct |
2 records matched | | C2H4 + CBrF2 → Adduct |
1 record matched | | C2H4 + CH3Sn(·)CH3 → 1,1-dimethylstannancyclopropane |
2 records matched | | C2H4 + ·Cl → CH2CH2Cl |
2 records matched | | C2H4 + ·Cl → C2H3 + HCl |
2 records matched | | C2H4 + O· → CH2=CHO· + H· |
2 records matched | | C2H4 + O· → *CH2C(O)H + H· |
2 records matched | | C2H4 + O· → CH3CO + H· |
2 records matched | | C2H4 + O· → C2H3 + ·OH |
6 records matched | | C2H4 + O· → ·CH3 + HCO |
1 record matched | | C2H4 + O· → CH2=CHOH |
2 records matched | | C2H4 + O· → H2C=C=O + H2 |
1 record matched | | C2H4 + O· → CH3CHO |
3 records matched | | C2H4 + O· → CH2O + ·CH2 |
1 record matched | | C2H4 + O· → Adduct |
2 records matched | | C2H4 + O· → Products |
1 record matched | | C2H4 + 2-phenylethyl → C6H5CH2CH2CH2CH2· |
2 records matched | | C2H4 + HC-N=O → cy-CH=NOCH2CH2 |
1 record matched | | C2H4 + CH3OC(·)(O) → CH3OC(O)CH2CH2· |
1 record matched | | C2H4 + ·CH2CH=CHCH3 → trans-CH3CH=CHCH2CH2CH2· |
1 record matched | | C2H4 + CH2=C(·)CH3 → CH2=C(CH3)CH2CH2· |
1 record matched | | C2H4 + ·CH2C(CH3)=CH2 → CH2=C(CH3)CH2CH2CH2· |
2 records matched | | C2H4 + ·F → CH2=CHF + H· |
1 record matched | | C2H4 + SH → CH2CH2SH |
1 record matched | | C2H4 + SH → C2H3 + H2S |
1 record matched | | C2H4 + SH → Adduct |
1 record matched | | C2H4 + SiHCl → chlorosilirane |
1 record matched | | C2H4 + NH → Adduct |
2 records matched | | C2H4 + ·NH2 → C2H3 + NH3 |
1 record matched | | C2H4 + ·NH2 → ·CH2CH2NH2 |
1 record matched | | C2H4 + SiH3 → SiH3CH2CH2(·) |
1 record matched | | C2H4 + OD → C2H3 + HDO |
12 records matched | | C2H4 + H· → ·C2H5 |
11 records matched | | C2H4 + H· → H2 + C2H3 |
1 record matched | | C2H4 + C2 → Products |
1 record matched | | C2H4 + NO3 → Oxirane + NO2 |
3 records matched | | C2H4 + NO3 → Products |
2 records matched | | C2H4 + NO3 → CH2CH2ONO2 |
1 record matched | | C2H4 + NO3 → cyc-CH2CH2ON(O)O |
1 record matched | | C2H4 + NO2 → C2H3 + HNO2 |
1 record matched | | C2H4 + NO2 → Oxirane + NO |
1 record matched | | C2H4 + NO2 → CH3CHO + NO |
1 record matched | | C2H4 + NO2 → HONO (unspecified cis/trans isomer) + C2H3 |
3 records matched | | C2H4 + O3 → 1,2,3-Trioxolane |
1 record matched | | C2H4 + O3 → CH2O + CH2OO |
2 records matched | | C2H4 + O3 → Products |
1 record matched | | C2H4 + O3 → ·CH2CH2OOO· |
2 records matched | | C2H4 + N2O → cy-N=NOCH2CH2 |
1 record matched | | C2H4 + HN3 → 1H-1,2,3-Triazole |
2 records matched | | C2H4 + HN3 → cy-N=NNHCH2CH2 |
1 record matched | | C2H4 + O2 → C2H3 + HO2 |
1 record matched | | C2H4 + O2 → (3)·CH2CH2OO· |
2 records matched | | C2H4 + F2 → ·F + CH2CH2F |
1 record matched | | C2H4 + F2 → CH2=CHF + HF |
2 records matched | | C2H4 + S → H· + CH2=CHS |
1 record matched | | C2H4 + S → C2H3 + SH |
1 record matched | | C2H4 + S → ·CH3 + HC=S |
1 record matched | | C2H4 + S → CH3CS + H· |
1 record matched | | C2H4 + NH3 → Products |
1 record matched | | C2H4 + HF → C2H5F |
1 record matched | | C2H4 + HCl → C2H5Cl |
1 record matched | | C2H4 + C → ·CH2C≡CH + H· |
1 record matched | | C2H4 + C → C2H2 + ·CH2 |
1 record matched | | C2H4 + CH3S· → Adduct |
1 record matched | | C2H4 + CH2=CHO· → ·CH2CH2CH2CHO |
1 record matched | | C2H4 + (CH3)2Si → 1,1-dimethylsilacyclopropane |
1 record matched | | C2H4 + iso-C4H9 → (CH3)2CCH2CH2CH2· |
1 record matched | | C2H4 + (CH3)2Si=CH2 → Silacyclobutane, 1,1-dimethyl- |
1 record matched | | C2H4 + Neopentyl → (CH3)3C(CH2)2CH2· |
10 records matched | | C2H4 + ·OH → HOCH2CH2· |
6 records matched | | C2H4 + ·OH → C2H3 + H2O |
1 record matched | | C2H4 + ·OH → CH2=CHOH + H· |
1 record matched | | C2H4 + ·OH → Adduct |
1 record matched | | C2H4 + ·OH → Products |
1 record matched | | C2H4 + CHCCH(·)CH3 → HC≡CCH(CH3)CH2CH2· |
2 records matched | | C2H4 + HO2 → C2H5OO· |
1 record matched | | C2H4 + HO2 → Oxirane + ·OH |
4 records matched | | C2H4 + HO2 → (·)CH2CH2OOH |
1 record matched | | C2H4 + CF3CF2CF2· → CF3CF2CF2CH2CH2 |
1 record matched | | C2H4 + CH3CO → ·CH2CH2C(O)CH3 |
2 records matched | | C2H4 + C2H5OO· → Oxirane + CH3CH2O· |
1 record matched | | C2H4 + ·CH2C≡CH → HC≡CCH2CH2CH2· |
1 record matched | | C2H4 + Cyclopropene → Cyclopropene, 2-ethyl |
1 record matched | | C2H4 + 1-C5H11 → 1-C7H15 |
3 records matched | | C2H4 + C2H3 → CH2=CHCH2CH2· |
1 record matched | | C2H4 + C2H3 → 1,2-butadiene + H· |
1 record matched | | C2H4 + C2H3 → 1-butyne + H· |
2 records matched | | C2H4 + C2H3 → 1,3-Butadiene + H· |
1 record matched | | C2H4 + C2H3 → C2H4 + C2H3 |
1 record matched | | C2H4 + HCO → CH(OH)CH=CH2 |
1 record matched | | C2H4 + HCO → CO + ·C2H5 |
1 record matched | | C2H4 + HCO → H2C=C=O + ·CH3 |
1 record matched | | C2H4 + HCO → CH2=CHCHO + H· |
1 record matched | | C2H4 + HCO → CH2O + C2H3 |
1 record matched | | C2H4 + HCO → CH2CH2C-O-H |
1 record matched | | C2H4 + HCO → CH3CHC-O-H |
1 record matched | | C2H4 + HCO → CH3(cy-CHC(·)HO) |
2 records matched | | C2H4 + 1-C4H9 → 1-hexyl radical |
2 records matched | | C2H4 + Phenyl → 2-phenylethyl |
1 record matched | | C2H4 + Phenyl → 1-phenylethyl |
1 record matched | | C2H4 + Phenyl → Styrene + H· |
2 records matched | | C2H4 + Phenyl → Benzene + C2H3 |
2 records matched | | C2H4 + Phenyl → Products |
1 record matched | | C2H4 + Phenyl → C6H5CH2CH2· |
1 record matched | | C2H4 + Phenyl → 4-vinylphenyl |
1 record matched | | C2H4 + 1-phenylethyl → C6H5C(CH3)CH2CH2· |
1 record matched | | C2H4 + 1,3,5-Hexatriene → 1-(2-Propenyl)cyclopentene |
1 record matched | | C2H4 + 1,3,5-Hexatriene → 1,3-Cyclooctadiene |
1 record matched | | C2H4 + 1,3,5-Hexatriene → Products |
1 record matched | | C2H4 + 1,3,5-Hexatriene → 1,3-butadienylcyclobutane |
6 records matched | | C2H4 + ·CH3 → 1-C3H7 |
3 records matched | | C2H4 + ·CH3 → CH4 + C2H3 |
1 record matched | | C2H4 + ·CH3 → Adduct |
2 records matched | | C2H4 + ·CH3 → Propyl Radical |
1 record matched | | C2H4 + Benzyl → C6H5CH2CH2CH2· |
1 record matched | | C2H4 + Benzyl → 2,3-Dihydroindene + H· |
1 record matched | | C2H4 + Benzyl → 3-Phenylpropene + H· |
1 record matched | | C2H4 + Benzyl → Products |
1 record matched | | C2H4 + Benzyl → C6H5CH2CH2CH2· |
1 record matched | | C2H4 + CH2=C → Methylenecyclopropane |
1 record matched | | C2H4 + CH2=C → Cyclobutene |
1 record matched | | C2H4 + CH2=C → Products |
1 record matched | | C2H4 + CH3O· → Adduct |
7 records matched | | C2H4 + 1-C3H7 → 1-C5H11 |
1 record matched | | C2H4 + 1-C3H7 → C2H4 + 2-C3H7 |
1 record matched | | C2H4 + ·C2H → CH2=C=C=CH2 + H· |
1 record matched | | C2H4 + ·C2H → Vinylacetylene + H· |
2 records matched | | C2H4 + ·C2H → C2H2 + C2H3 |
1 record matched | | C2H4 + ·C2H → Products |
9 records matched | | C2H4 + ·C2H5 → 1-C4H9 |
1 record matched | | C2H4 + ·C2H5 → C2H6 + C2H3 |
1 record matched | | C2H4 + ·C2H5 → Adduct |
1 record matched | | C2H4 + 2-C3H7 → 1-C5H11 |
1 record matched | | C2H4 + 2-C3H7 → CH3CH2CH2CH(·)CH3 |
1 record matched | | C2H4 + 2-C3H7 → (CH3)2CHCH2CH2· |
1 record matched | | C2H4 + 2-C3H7 → CH3CH=CH2 + ·C2H5 |
1 record matched | | C2H4 + 2-C3H7 → 2-C5H10 + H· |
1 record matched | | C2H4 + 2-C3H7 → 1-C5H10 + H· |
1 record matched | | C2H4 + 2-C3H7 → 1-C4H8 + ·CH3 |
1 record matched | | C2H4 + 2-C3H7 → 2-methylbutan-1-yl |
1 record matched | | C2H4 + 2-C3H7 → 3-C5H11 |
2 records matched | | C2H4 + ·CH2CH=CH2 → CH2=CHCH2CH2CH2· |
1 record matched | | C2H4 + ·CH2CH=CH2 → CH2=CHCH2CH2CH2· |
1 record matched | | C2H4 + tert-C4H9 → (CH3)3CCH2CH2· |
1 record matched | | C2H4 + tert-C4H9 → Isobutene + ·C2H5 |
1 record matched | | C2H4 + tert-C4H9 → 2,2-methylbutan-1-yl |
1 record matched | | C2H4 + H2 → ·C2H5 + H· |
2 records matched | | C2H4 + H2 → C2H6 |
1 record matched | | C2H4 + CH3N3 → Products |
1 record matched | | C2H4 + CH3N3 → 4,5-dehydro-1-methyl-1H-[1,2,3]triazole |
1 record matched | | C2H4 + 1,3-Cyclohexadiene → Bicyclo[2.2.2]oct-2-ene |
2 records matched | | C2H4 + Cyclopentadiene → Bicyclo[2.2.1]hept-2-ene |
1 record matched | | C2H4 + Cyclopentadiene → Adduct |
2 records matched | | C2H4 + CH2N2 → 3H-Pyrazole, 4,5-dihydro- |
1 record matched | | C2H4 + CH3CH=CH2 → 2-C3H7 + C2H3 |
1 record matched | | C2H4 + CH3CH=CH2 → ·CH2CH=CH2 + ·C2H5 |
1 record matched | | C2H4 + CH3CH=CH2 → 1-C5H10 |
1 record matched | | C2H4 + Furan + CO2 → 2-Furancarboxylic acid ethyl ester |
4 records matched | | C2H4 + 1,3-Butadiene → Cyclohexene |
1 record matched | | C2H4 + 1,3-Butadiene → Products |
2 records matched | | C2H4 + 2-Furancarboxylic acid → 2-Furancarboxylic acid ethyl ester |
1 record matched | | C2H4 + C2H5COOH → C2H5C(O)OC2H5 |
1 record matched | | C2H4 + CH3CHO → Tetrahydrofuran |
1 record matched | | C2H4 + C2H2 → C2H3 + C2H3 |
3 records matched | | C2H4 + C2H4 → ·C2H5 + C2H3 |
4 records matched | | C2H4 → C2H3 + H· |
1 record matched | | C2H4 → H2 + CH2=C |
4 records matched | | C2H4 → C2H2 + H2 |
1 record matched | | C2H4 → Products |
4 records matched | | C2H6 + C2H3 → C2H4 + ·C2H5 |
2 records matched | | C2H6 → C2H4 + H2 |
1 record matched | | CH4 + C → C2H4 |
1 record matched | | CH4 + ·CH → C2H4 + H· |
4 records matched | | CH4 + C2H3 → C2H4 + ·CH3 |
2 records matched | | Benzene + C2H3 → C2H4 + Phenyl |
1 record matched | | Acetone + C2H3 → C2H4 + CH3C(O)CH2(·) |
8 records matched | | C2H5OH → C2H4 + H2O |
1 record matched | | C2H5OH → C2H4 + ·OH + H· |
7 records matched | | Diethyl ether → C2H5OH + C2H4 |
1 record matched | | 2-Oxetanone → C2H4 + CO2 |
2 records matched | | CH3CH(OH)CH2OH → CH2O + C2H4 + H2O |
3 records matched | | CH2O + C2H3 → C2H4 + HCO |
1 record matched | | O2(1DELTA) + C2H4 → C2H2 + H2O2 |
1 record matched | | O2(1DELTA) + C2H4 → (1)·CH2CH2OO· |
7 records matched | | Mu + C2H4 → CH2CH2Mu |
1 record matched | | O2(1Delta_g) + ·C2H5 → C2H4 + HO2 |
1 record matched | | O2(1Delta_g) + C2H6 → C2H4 + H2O2 |
1 record matched | | 2-methylbutan-1-yl → C2H4 + 2-C3H7 |
1 record matched | | 2,2-methylbutan-1-yl → C2H4 + tert-C4H9 |
1 record matched | | CH2=CHCH(CH3)CH2CH2· → C2H4 + CH2=CHCH(·)CH3 |
1 record matched | | CH2=CHC(·)(CH3)2 + C2H4 → CH2=CHC(CH3)2CH2CH2· |
1 record matched | | CH2=CHC(CH3)2CH2CH2· → CH2=CHC(·)(CH3)2 + C2H4 |
1 record matched | | CH2=CHCH(·)CH=CH2 + C2H4 → CH2=CHCH(CH=CH2)CH2CH2· |
1 record matched | | CH2=CHCH(CH=CH2)CH2CH2· → CH2=CHCH(·)CH=CH2 + C2H4 |
1 record matched | | CH2=CHC(CH3)(·)CH=CH2 + C2H4 → CH2=CHC(CH3)(CH=CH2)CH2CH2· |
1 record matched | | CH2=CHC(CH3)(CH=CH2)CH2CH2· → CH2=CHC(CH3)(·)CH=CH2 + C2H4 |
1 record matched | | C6H5CH2CH2CH2· → C2H4 + Benzyl |
1 record matched | | C6H5C(CH3)CH2CH2· → C2H4 + 1-phenylethyl |
1 record matched | | C6H5C(·)(CH3)CH3 + C2H4 → C6H5C(CH3)2CH2CH2· |
1 record matched | | C6H5C(CH3)2CH2CH2· → C6H5C(·)(CH3)CH3 + C2H4 |
1 record matched | | HC≡CCH2CH2CH2· → C2H4 + ·CH2C≡CH |
1 record matched | | HC≡CCH(CH3)CH2CH2· → C2H4 + CHCCH(·)CH3 |
1 record matched | | HC≡CC(CH3)2CH2CH2· → HC≡CC(·)(CH3)CH3 + C2H4 |
1 record matched | | HC≡CC(·)(CH3)CH3 + C2H4 → HC≡CC(CH3)2CH2CH2· |
2 records matched | | CH2=C(CH3)CH2CH2· → C2H4 + CH2=C(·)CH3 |
1 record matched | | HC≡CCH2CH2· → C2H4 + ·C2H |
1 record matched | | C6H5CH2CH2· + C2H4 → C6H5(CH2)3CH2· |
1 record matched | | C6H5CH2CH2· → C2H4 + Phenyl |
1 record matched | | C6H5(CH2)3CH2· → C6H5CH2CH2· + C2H4 |
1 record matched | | (CH3)2CCH2CH2CH2· → C2H4 + iso-C4H9 |
1 record matched | | (CH3)3C(CH2)2CH2· → C2H4 + Neopentyl |
1 record matched | | CH3CH2C(·)(CH2CH3)CH2CH3 + C2H4 → CH3CH2C(CH2CH3)2CH2CH· |
1 record matched | | CH3CH2C(CH2CH3)2CH2CH· → CH3CH2C(·)(CH2CH3)CH2CH3 + C2H4 |
1 record matched | | (CH3)3C-C(CH3)2CH2CH2· + C2H4 → (CH3)3C-C(CH3)2CH2CH2· |
1 record matched | | (CH3)3C-C(CH3)2CH2CH2· → (CH3)3C-C(CH3)2CH2CH2· + C2H4 |
1 record matched | | CH2=Sn: + C2H4 → CH2=(cyclic-SnCH2CH2) |
1 record matched | | CH2=Sn: + C2H4 → cyclo-SnHCHCH2CH2 |
1 record matched | | CH2-S-C(CH3)2 radical + C2H4 → tetrahydro-2,2-dimethyl-thiophene |
1 record matched | | Si(OH)4 + C2H4 → (OH)3SiOCH2CH3 |
1 record matched | | CH2(X3B_1) + ·CH3 → C2H4 + H· |
2 records matched | | C6H5CH2CH2CH2CH2· → C2H4 + 2-phenylethyl |
1 record matched | | (CH3)2Pb + C2H4 → 1,1-dimethyplumbancyclopropane |
2 records matched | | S(1D) + C2H4 → H· + CH2=CHS |
2 records matched | | S(1D) + C2H4 → C2H3 + SH |
2 records matched | | S(1D) + C2H4 → ·CH3 + HC=S |
2 records matched | | S(1D) + C2H4 → H2 + CH2=C=S |
2 records matched | | S(1D) + C2H4 → CH4 + CS |
2 records matched | | S(1D) + C2H4 → CH3CS + H· |
2 records matched | | (·)CH2CH2OOH → C2H4 + HO2 |
2 records matched | | HCNNH + C2H4 → 2-Pyrazoline |
2 records matched | | CH2NHO + C2H4 → Isoxazolidine |
2 records matched | | CH2=NH=NH + C2H4 → Pyrazolidine |
2 records matched | | CH2=NH=CH2 + C2H4 → Pyrrolidine |
1 record matched | | CH3CH(OH)CH2CH2· → C2H4 + CH3CH(·)OH |
1 record matched | | ·CH2CH2CH2CH2CH2· → C2H4 + Cyclopropane |
1 record matched | | HNCS + C2H3 → C2H4 + SCN |
1 record matched | | OsO3CH2 + C2H4 → cyc-Os(O)(CH2)OCH2CH2O |
1 record matched | | OsO3CH2 + C2H4 → cyc-Os(O)(O)OCH2CH2CH2 |
1 record matched | | OsO3CH2 + C2H4 → cyc-Os(O)(O)(CH2)OCH2CH2 |
1 record matched | | OsO3CH2 + C2H4 → cyc-O(OsO2CH2)CH2CH2 |
1 record matched | | OsO3CH2 + C2H4 → Os(O)(O)(CH3)OCHCH2 |
1 record matched | | OsO3CH2 + C2H4 → Os(O)(O)(CH)OCH2CH3 |
1 record matched | | cyc-OsO2-O-CH2 + C2H4 → cyc-Os(O)(O)(CH2)OCH2CH2 |
1 record matched | | cyc-OsO2-O-CH2 + C2H4 → cyc-Os(O)(O)(O)CH2CH2CH2 |
1 record matched | | cyc-OsO2-O-CH2 + C2H4 → bicyc-Os(-O-CH2-CH2-O)(O-CH2) |
1 record matched | | cyc-OsO2-O-CH2 + C2H4 → bicyc-Os(O)(-O-CH2-CH2)(O-CH2) |
1 record matched | | cyc-OsO2-O-CH2 + C2H4 → bicyc-(OCH2CH2)-(Os(O)OCH2) |
1 record matched | | O2OsOCH2 + C2H4 → cyc-Os(OCH2)OCH2CH2 |
1 record matched | | cyc-Os(O)(CH2)-O-O + C2H4 → cyc-Os(O)(O)(CH2)OCH2CH2 |
1 record matched | | GeHF + Thiirane → GeHFS + C2H4 |
1 record matched | | GeHF + Oxirane → GeHFO + C2H4 |
1 record matched | | GeHBr + Thiirane → GeHBrS + C2H4 |
1 record matched | | GeHBr + Oxirane → GeHBrO + C2H4 |
1 record matched | | ·CH2CH2OC(O)H → ·OC(O)H + C2H4 |
1 record matched | | ·CH2CH2C(CH3)2OOH → Acetone + C2H4 + ·OH |
1 record matched | | 3-C5H11 → C2H4 + 2-C3H7 |
2 records matched | | PO(OH)(OC2H5)2 → C2H4 + PO(OH)2(OC2H5) |
1 record matched | | PO(C2H5)(OC2H5)(SC2H5) → PS(OH)(C2H5)(OC2H5) + C2H4 |
1 record matched | | ·CH2CH2CH(CH3)CH2OOH → CH3CH(·)CH2OOH + C2H4 |
1 record matched | | ·CH2CH2CH2CH(CH3)OOH → ·CH2CH(CH3)CH2OOH + C2H4 |
1 record matched | | 3·CH2CH2CH2CH2CH2CH2· → 3·CH2CH2CH2CH2· + C2H4 |
1 record matched | | 3·CH2CH2CH2CH2· → (3)C2H4 + C2H4 |
1 record matched | | ·CH2CH2NH2 → C2H4 + ·NH2 |
1 record matched | | (OH)3SiOCH2CH3 → Si(OH)4 + C2H4 |
1 record matched | | trans-CH3CH=CHCH2CH2CH2CH2· → C2H4 + CH3CH=CHCH2CH2· |
1 record matched | | CH2=CHCH2CH(CH3)CH2CH2· → C2H4 + CH2=CHCH2CH(·)CH3 |
1 record matched | | CH2=CHCH(CH3)CH2CH2CH2· → C2H4 + CH2=CHCH(CH3)CH2· |
1 record matched | | CH2=C(CH3)CH2CH2CH2CH2· → CH2=C(CH3)CH2CH2· + C2H4 |
1 record matched | | CH2=CHCH2CH2CH2CH2CH2· → CH2=CHCH2CH2CH2· + C2H4 |
1 record matched | | ·CH2CH2NHCH2CH=O → ·NHCH2CH=O + C2H4 |
1 record matched | | ·CH2CH2OCH2CH=NH → ·OCH2CH=NH + C2H4 |
1 record matched | | ·CH2CH2N=CH2 → C2H4 + H2C=N |
1 record matched | | CH2=CHC(O)CH2CH2· → C2H4 + CH2=CHC(·)O |
1 record matched | | ·CH2CH2CH2CH=C=O → C2H4 + CH2=CHC(·)O |
1 record matched | | ·CH2CH2CH2CH=C=O → ·CH2CH=CO + C2H4 |
1 record matched | | ·CH2CH2CH=CHC(O)OCH3 → CH3OC(O)CH=CH· + C2H4 |
1 record matched | | 1-fluoro-2,5-cyclopentadiene + C2H4 → Adduct |
1 record matched | | 2,4-Cyclopentadiene-1,1-diyldisilane + C2H4 → Adduct |
1 record matched | | ·CH2CH2CH2CH2C(O)O· → ·CH2CH2C(O)O· + C2H4 |
1 record matched | | ·CH2CH2C(O)O· → C2H4 + CO2 |
1 record matched | | ·CH2CH2CH2CH2OC(O)H → ·CH2CH2OC(O)H + C2H4 |
1 record matched | | ·CH2CH2CH2CH2C(O)OCH3 → CH3OC(O)CH2CH2· + C2H4 |
1 record matched | | 1-C12H25 → C2H4 + 1-C10H21 |
1 record matched | | (ClCH2CH2)2NCH2CH2· → (ClCH2CH2)2N· + C2H4 |
1 record matched | | BrHgO + C2H4 → BrHgOCH2CH2· |
1 record matched | | ·CH2CH2OCH2OCH2CH3 → CH3CH2OCH2O(.) + C2H4 |
1 record matched | | CH3CH(·)OCH2OCH2CH3 → CH3CH2OCH2O(.) + C2H4 |
1 record matched | | CH3CH2OCH(·)OCH2CH3 → CH3CH2OCH2O(.) + C2H4 |
1 record matched | | ·CH2CH2CH2CH2CH2CH2CH2CH2CH2C(O)OCH3 → ·CH2CH2CH2CH2CH2CH2CH2C(O)OCH3 + C2H4 |
1 record matched | | HOOCH2SCH2CH2· → HOOCH2S· + C2H4 |
1 record matched | | ·CH2CH2CH2CH(OOH)CH=CH2 → C2H4 + 1,3-Butadiene + HO2 |
1 record matched | | ·CH2CH2CH(OOH)CH2CH=CH2 → C2H4 + ·OH + CH2=CHCH2CHO |
1 record matched | | thioformaldehyde S-methylide + C2H4 → Tetrahydrothiophene |
1 record matched | | (·)CH2CH2CH2CH2OH → C2H4 + HOCH2CH2· |
1 record matched | | ·CH2CH2CH(CH3)CH2OH → C2H4 + CH3CH(·)CH2OH |
1 record matched | | (·)CH2CH2CH2CH2OOH → (·)CH2CH2OOH + C2H4 |
1 record matched | | (·)CH2CH2CH2OOH → CH2O + C2H4 + ·OH |
1 record matched | | Propyl Radical + C2H4 → CH3CH=CH2 + ·C2H5 |
2 records matched | | Propyl Radical → C2H4 + ·CH3 |
4 records matched | | ·CH2CH2CH2CH2· → C2H4 + C2H4 |
2 records matched | | CH2CH2CH2CH2CH2CH2 → ·CH2CH2CH2CH2· + C2H4 |
2 records matched | | ·CH2CH2CH2CHO → C2H4 + CH2=CHO· |
1 record matched | | ·CH2CH2CHCO → C2H4 + HCCO |
1 record matched | | CH3OC(O)CH2CH2· → C2H4 + CH3OC(·)(O) |
1 record matched | | ·CH2CH=CO + C2H4 → Products |
1 record matched | | CH3OC(O)CH2CH2CH2· → C2H4 + ·CH2C(O)OCH3 |
1 record matched | | CrO(CH3)2(CH2) + C2H4 → Products |
1 record matched | | MoO(CH3)2(CH2) + C2H4 → Products |
1 record matched | | CH2=CHCH2CH2CH2· → CH2=CHCH2CH2CH2· + C2H4 |
1 record matched | | ·CH2CHCCH2 + C2H4 → Products |
1 record matched | | CH2(1) + ·CH2 → C2H4 |
1 record matched | | CH2(1) + ·CH3 → C2H4 + H· |
1 record matched | | CH2(1) + CH2(1) → C2H4 |
1 record matched | | CH_2(aA_1) + H2C=C=O → C2H4 + CO |
1 record matched | | O2(X3Sigma_g-) + C2H4 → H· + CH2=CHO2 |
1 record matched | | O2(X3Sigma_g-) + C2H4 → H· + CH3C(O)O· |
1 record matched | | O2(X3Sigma_g-) + C2H4 → ·OH + CH2=CHO· |
1 record matched | | O2(X3Sigma_g-) + C2H4 → CH3CO + ·OH |
5 records matched | | O2(X3Sigma_g-) + C2H4 → C2H3 + HO2 |
1 record matched | | O2(X3Sigma_g-) + C2H4 → ·CH3 + HCOO |
1 record matched | | O2(X3Sigma_g-) + C2H4 → Products |
1 record matched | | O2(X3Sigma_g-) + C2H4 → O(3P) + Oxirane |
1 record matched | | O2(X3Sigma_g-) + C2H4 → H2C=CHOOH + H· |
1 record matched | | O2(X3Sigma_g-) + C2H4 → trans-CH2CH2O2 peroxy radical(triplet) |
1 record matched | | (·)CH2(CH2)3CHO → C2H4 + ·CH2CH2CHO |
1 record matched | | O(3P) + C2H4 → Products |