Click on a link in the table below to see detail on the selected reaction.
Records |
|
Reaction |
1 record matched | | C(3Pj) + CH3CCH → H· + CH2=C=C=CH· |
1 record matched | | CH3CH=CH2 + ·C2H → CH3CCH + C2H3 |
1 record matched | | CH3CCH + N → Products |
3 records matched | | CH3CCH + O· → Products |
1 record matched | | CH3CCH + H· → ·CH2CH=CH2 |
1 record matched | | CH3CCH + H· → Products |
1 record matched | | CH3CCH + NO3 → Products |
1 record matched | | CH3CCH + S → Thiirene, methyl- |
1 record matched | | CH3CCH + ·CCl → Products |
1 record matched | | CH3CCH + ·OH → Products |
1 record matched | | CH3CCH + ·CF3 → Adduct |
1 record matched | | CH3CCH + ·CH3 → Products |
1 record matched | | CH3CCH + ·C2H → Products |
1 record matched | | C2H2 + ·CH2 → CH3CCH |
1 record matched | | N2(A3Sigma_u+) + CH3CCH → Products |
1 record matched | | CH3CH=C(·)CH3 → CH3CCH + ·CH3 |
1 record matched | | 2-Propenylidene → CH3CCH |
1 record matched | | CH2=C(·)CH3 → CH3CCH + H· |
2 records matched | | CH3CH=C(·)H → CH3CCH + H· |
1 record matched | | CH3C(NO2)=CH2 → CH3CCH + HNO2 |
1 record matched | | ·CH2C≡CH + H· → CH3CCH |
3 records matched | | Cyclopropene → CH3CCH |
1 record matched | | ·CH2CH=CH2 + O· → CH3CCH + ·OH |
1 record matched | | CH2=C=CHCH2CH3 → C2H4 + CH3CCH |
2 records matched | | (CH3)CCl=CH2 → CH3CCH + HCl |
2 records matched | | CH3CBr=CH2 → CH3CCH + HBr |
1 record matched | | Cyclopentadiene + ·CH2C≡CH → CH3CCH + Cyclopentadienyl |
10 records matched | | CH2=C=CH2 → CH3CCH |
3 records matched | | Furan → CH3CCH + CO |
1 record matched | | Pyrrole → HCN + CH3CCH |
1 record matched | | CH3CCH + CH3C≡C· → Products |
1 record matched | | CH3CCH + CH≡CC≡C → Products |
2 records matched | | CH3CCH + ·Cl → ·CH2C≡CH + HCl |
5 records matched | | CH3CCH + ·Cl → Products |
2 records matched | | CH3CCH + N → Products |
1 record matched | | CH3CCH + O· → H· + CH2=C=C=O |
1 record matched | | CH3CCH + O· → ·OH + CH2=C=CH |
1 record matched | | CH3CCH + O· → Oxirene, methyl- |
1 record matched | | CH3CCH + O· → HCO + C2H3 |
1 record matched | | CH3CCH + O· → ·CH3 + HCCO |
2 records matched | | CH3CCH + O· → CO + CH3CH |
1 record matched | | CH3CCH + O· → C2H2 + CO + H2 |
1 record matched | | CH3CCH + O· → C2H4 + CO |
6 records matched | | CH3CCH + O· → Products |
1 record matched | | CH3CCH + O· → CH3C(·)=C=O + H· |
1 record matched | | CH3CCH + I → HI + CH3C≡C· |
1 record matched | | CH3CCH + SiH → Products |
1 record matched | | CH3CCH + H· → CH2=C(·)CH3 |
1 record matched | | CH3CCH + H· → CH3CH=C(·)H |
1 record matched | | CH3CCH + H· → H2 + CH2=C=CH |
2 records matched | | CH3CCH + H· → CH2=C=CH2 + H· |
8 records matched | | CH3CCH + H· → C2H2 + ·CH3 |
4 records matched | | CH3CCH + H· → Products |
3 records matched | | CH3CCH + C3 → Products |
1 record matched | | CH3CCH + C2 → Products |
1 record matched | | CH3CCH + C2 → H2CCCCCH + H· |
4 records matched | | CH3CCH + NO3 → Products |
1 record matched | | CH3CCH + NO2 → Products |
1 record matched | | CH3CCH + Br· → Adduct |
1 record matched | | CH3CCH + Br· → Products |
3 records matched | | CH3CCH + O3 → Products |
1 record matched | | CH3CCH + S → Thiirene, methyl- |
1 record matched | | CH3CCH + S → Products |
1 record matched | | CH3CCH + Ge → Products |
2 records matched | | CH3CCH + Cu → Cu(CH3C≡CH) |
1 record matched | | CH3CCH + C → Products + H· |
2 records matched | | CH3CCH + C → Products |
1 record matched | | CH3CCH + B → Products |
1 record matched | | CH3CCH + Si → Products |
2 records matched | | CH3CCH + CH2=C=CH → Benzene + H· |
1 record matched | | CH3CCH + (CH3)2Si → Products |
1 record matched | | CH3CCH + CBr → Products |
2 records matched | | CH3CCH + ·CCl → Products |
2 records matched | | CH3CCH + CF → Products |
1 record matched | | CH3CCH + ·OH + O2 → Products |
8 records matched | | CH3CCH + ·OH → Products |
1 record matched | | CH3CCH + ·CH → CH2=C=C=CH2 + H· |
1 record matched | | CH3CCH + ·CH → Vinylacetylene + H· |
3 records matched | | CH3CCH + ·CH → Products |
1 record matched | | CH3CCH + 4-methylphenyl → Products |
1 record matched | | CH3CCH + Phenyl → 1-Phenylpropyne + H· |
1 record matched | | CH3CCH + Phenyl → Products |
2 records matched | | CH3CCH + ·CF3 → Adduct |
1 record matched | | CH3CCH + ·CH3 → CH3CH=C(·)CH3 |
2 records matched | | CH3CCH + CH3O· → Adduct |
2 records matched | | CH3CCH + ·C2H → CH3C≡CC≡CH + H· |
2 records matched | | CH3CCH + ·C2H → 1,3-Butadiyne + ·CH3 |
6 records matched | | CH3CCH + ·C2H → Products |
1 record matched | | CH3CCH + ·C2H → CH2CCHCCH + H· |
1 record matched | | CH3CCH + 2-C3H7 → Adduct |
1 record matched | | CH3CCH + ·CH2CH=CH2 → 2-Methyl-1,3-cyclopentadiene + H· |
1 record matched | | CH3CCH + ·CH2CH=CH2 → 1-Methyl-1,3-cyclopentadiene + H· |
1 record matched | | CH3CCH + ·CH2CH=CH2 → 1,3-Cyclopentadiene, 5-methyl- |
1 record matched | | CH3CCH + ·CH2CH=CH2 → Other Products + Cyclopentadiene |
2 records matched | | CH3CCH + ·CH2CH=CH2 → Adduct |
1 record matched | | CH3CCH + tert-C4H9 → Adduct |
1 record matched | | CH3CCH → 2-Propenylidene |
1 record matched | | CH3CCH → CH2=C=CH + H· |
1 record matched | | CH3CCH → ·CH2C≡CH + H· |
3 records matched | | CH3CCH → Cyclopropene |
5 records matched | | CH3CCH → CH2=C=CH2 |
1 record matched | | CH3CCH → Other Products + C2H2 |
1 record matched | | CH3CCH → Other Products + CH4 |
1 record matched | | CH3CCH → Products |
2 records matched | | C2H2 + ·CH2 → CH3CCH |
4 records matched | | C2H2 + ·CH3 → CH3CCH + H· |
1 record matched | | C2H4 + ·CH → CH3CCH + H· |
1 record matched | | CN + CH3CCH → Other Products + HCN |
1 record matched | | CN + CH3CCH → Products |
1 record matched | | CN(X2Sigma+) + CH3CCH → Products |
1 record matched | | C(3Pj) + CH3CCH → Products |
1 record matched | | C2(X1ΣPlg) + CH3CCH → Products |
1 record matched | | C2(a3PIu) + CH3CCH → Products |
1 record matched | | CH2=C=CHCHO → CH3CCH + CO |
1 record matched | | CH2=C(OH)CH3 → CH3CCH + H2O |
1 record matched | | 2-Propenylidene → CH3CCH |
1 record matched | | CH2=C=CHCH=CH2 → C2H2 + CH3CCH |
1 record matched | | CH2=C=CH + H· → CH3CCH |
1 record matched | | CH3CH=CHCN → HCN + CH3CCH |
1 record matched | | ·CH2C≡CH + NH3 → CH3CCH + ·NH2 |
1 record matched | | Cyclopropene → CH3CCH |
1 record matched | | CH2ClC≡CH + ·CH2C≡CH → ·CHClC≡CH + CH3CCH |
1 record matched | | CH3CBr=CH2 → CH3CCH + HBr |
1 record matched | | Cyclopentadiene + H· → CH3CCH + C2H3 |
2 records matched | | 2-Methylfuran → CH3CCH + H2C=C=O |
1 record matched | | 2-butyne + CH2=C=CH → CH3CCH + CH3C=C=CH2 |
1 record matched | | H2C=C=O + ·CH3 → CH3CCH + ·OH |
3 records matched | | CH2=C=CH2 → CH3CCH |
1 record matched | | CH2=C(CH3)CN → HCN + CH3CCH |
1 record matched | | 1-butyne + CH2=C=CH → CH3CCH + CHCCH(·)CH3 |
1 record matched | | CH3CCH + CH3C≡C· → Products |
1 record matched | | CH3CCH + CH2=CHCH=CH· → Toluene + H· |
1 record matched | | CH3CCH + ·CH2 → 1-methylcyclopropene |
1 record matched | | CH3CCH + ·CH2 → 2-butyne |
1 record matched | | CH3CCH + ·CH2 → 1-butyne |
1 record matched | | CH3CCH + ·CH2 → Adduct |
1 record matched | | CH3CCH + ·Cl → ·CH2C≡CH + HCl |
1 record matched | | CH3CCH + NCO → Products |
1 record matched | | CH3CCH + O· → H· + CH2=CHC(·)O |
1 record matched | | CH3CCH + O· → CH3CH=C=O |
2 records matched | | CH3CCH + O· → ·CH2C≡CH + ·OH |
1 record matched | | CH3CCH + O· → HCO + C2H3 |
1 record matched | | CH3CCH + O· → ·CH3 + HCCO |
1 record matched | | CH3CCH + O· → CO + CH3CH |
1 record matched | | CH3CCH + O· → CH2=CHCHO |
1 record matched | | CH3CCH + O· → C2H2 + CO + H2 |
1 record matched | | CH3CCH + O· → C2H4 + CO |
1 record matched | | CH3CCH + O· → Adduct |
1 record matched | | CH3CCH + O· → CH2C(·)CHO + H· |
1 record matched | | CH3CCH + O· → CH3C(·)=C=O + H· |
1 record matched | | CH3CCH + ·CH2C(CH3)=CH2 → Products |
1 record matched | | CH3CCH + ·F → CH2=C=CH + HF |
1 record matched | | CH3CCH + ·F → ·CH3 + HCCF |
1 record matched | | CH3CCH + ·F → CH2CCHF + H· |
1 record matched | | CH3CCH + ·F → CH3CC + HF |
1 record matched | | CH3CCH + ·F → H3CCCF + H· |
1 record matched | | CH3CCH + SH → ·CH2C≡CH + H2S |
1 record matched | | CH3CCH + SiH → H3C(cyc-CSiCH) + H· |
1 record matched | | CH3CCH + H· → H2 + ·CH2C≡CH |
1 record matched | | CH3CCH + H· → C2H2 + ·CH3 |
2 records matched | | CH3CCH + H· → Products |
1 record matched | | CH3CCH + CP → Products |
1 record matched | | CH3CCH + C3 → Products |
2 records matched | | CH3CCH + C2 → ·C2H + ·CH2C≡CH |
1 record matched | | CH3CCH + C2 → H2 + HCCCCCH |
1 record matched | | CH3CCH + C2 → C2H2 + c-C3H2 |
1 record matched | | CH3CCH + C2 → H2CCCCCH + H· |
1 record matched | | CH3CCH + C2 → HCCCHCCH + H· |
1 record matched | | CH3CCH + C2 → HCC-CH=C=C: + H2 |
1 record matched | | CH3CCH + NO3 → CH3C=C(H)ONO2 |
1 record matched | | CH3CCH + 2-Naphthalenyl → Products |
1 record matched | | CH3CCH + Zr → Zr(HCCCH) + H2 |
1 record matched | | CH3CCH + Zr → Zr(CCCH2) + H2 |
1 record matched | | CH3CCH + Zr → Zr-CCCH2 + H2 |
1 record matched | | CH3CCH + Zr → Zr-CCH + ·CH3 |
1 record matched | | CH3CCH + Zr → Zr(CC)H + ·CH3 |
1 record matched | | CH3CCH + ·OH → ·CH2C≡CH + H2O |
1 record matched | | CH3CCH + ·CH → Methylenecyclopropene + H· |
1 record matched | | CH3CCH + ·CH → CH2=C=C=CH2 + H· |
1 record matched | | CH3CCH + ·CH → Vinylacetylene + H· |
1 record matched | | CH3CCH + 4-methylphenyl → Products |
1 record matched | | CH3CCH + Phenyl → Phenylallene + H· |
1 record matched | | CH3CCH + Phenyl → 1-Phenylpropyne + H· |
1 record matched | | CH3CCH + Phenyl → Phenylacetylene + ·CH3 |
1 record matched | | CH3CCH + Phenyl → Benzene + CH2=C=CH |
2 records matched | | CH3CCH + Phenyl → Products |
1 record matched | | CH3CCH + ·CH3 → (CH3)2C=CH· |
1 record matched | | CH3CCH + ·CH3 → CH3CH=C(·)(CH3) |
1 record matched | | CH3CCH + ·C2H → H· + CH≡CCH2C≡CH |
1 record matched | | CH3CCH + ·C2H → H· + CH2=C=C=C=CH2 |
1 record matched | | CH3CCH + ·C2H → CH3C≡CC≡CH + H· |
1 record matched | | CH3CCH + ·C2H → 1,3-Butadiyne + ·CH3 |
2 records matched | | CH3CCH + ·C2H → C2H2 + ·CH2C≡CH |
1 record matched | | CH3CCH + ·C2H → CH2CCHCCH + H· |
1 record matched | | CH3CCH + ·CH2CH=CH2 → 1,3,5-Hexatriene + H· |
1 record matched | | CH3CCH + ·CH2CH=CH2 → CH3CCCH2CHCH2 + H· |
1 record matched | | CH3CCH + CO → CH2=C=CHCHO |
1 record matched | | CH3CCH → 2-Propenylidene |
1 record matched | | CH3CCH → ·CH2C≡CH + H· |
2 records matched | | CH3CCH → CH2=C=CH2 |
1 record matched | | C2H2 + ·CH2 → CH3CCH |
3 records matched | | C2H2 + ·CH3 → CH3CCH + H· |
1 record matched | | Acetone → CH3CCH + H2O |
1 record matched | | Benzo[a]pyrene + ·CH2C≡CH → Other Products + CH3CCH |
1 record matched | | Benzo[a]pyrene + ·CH2C≡CH → benzo[a]pyrenyl armchair radical + CH3CCH |
1 record matched | | Benzo[a]pyrene + ·CH2C≡CH → benzo[a]pyrenyl zigzag radical + CH3CCH |
1 record matched | | CH2O + ·CH2C≡CH → CH3CCH + HCO |
1 record matched | | (CH3)2C=CH· → CH3CCH + ·CH3 |
2 records matched | | CH3CH=C(·)(CH3) → CH3CCH + ·CH3 |
1 record matched | | C(1D) + CH3CCH → Products |
1 record matched | | CH2=C(OH)-CH2· + H· → CH3CCH + H2O |
1 record matched | | cyc-(:)C-O-C(CH3)=CHCH(CH3) → CH3CCH + CH3CH=C=O |
1 record matched | | CH3C(·)=CHCH2C(O)OCH3 → CH3CCH + ·CH2C(O)OCH3 |
1 record matched | | benzo[a]pyrenyl armchair radical + CH3CCH → Benzo[a]pyrene + ·CH2C≡CH |
1 record matched | | benzo[a]pyrenyl zigzag radical + CH3CCH → Benzo[a]pyrene + ·CH2C≡CH |
2 records matched | | CH_2(aA_1) + C2H2 → CH3CCH |
1 record matched | | CH2=C(·)CH3 → CH3CCH + H· |