Kinetics Database Logo

Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences


Rate Our Products and Services


Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty


Administrative Links

NIST home page

MML home page

Chemical and Biochemical Reference Data Division

MML home page

Chemical and Biochemical Reference Data Division

  NIST Logo Home
©NIST, 2013
Accessibility information

Search Results

Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
1 record matched C(3Pj) + CH3CCH → H· + CH2=C=C=CH·
1 record matched CH3CH=CH2 + ·C2H → CH3CCH + C2H3
1 record matched CH3CCH + N → Products
3 records matched CH3CCH + O· → Products
1 record matched CH3CCH + H· → ·CH2CH=CH2
1 record matched CH3CCH + H· → Products
1 record matched CH3CCH + NO3 → Products
1 record matched CH3CCH + S → Thiirene, methyl-
1 record matched CH3CCH + ·CCl → Products
1 record matched CH3CCH + ·OH → Products
1 record matched CH3CCH + ·CF3 → Adduct
1 record matched CH3CCH + ·CH3 → Products
1 record matched CH3CCH + ·C2H → Products
1 record matched C2H2 + ·CH2 → CH3CCH
1 record matched N2(A3Sigma_u+) + CH3CCH → Products
1 record matched CH3CH=CCH3 → CH3CCH + ·CH3
1 record matched 2-Propenylidene → CH3CCH
1 record matched CH2=C(·)CH3 → CH3CCH + H·
2 records matched CH3CH=C(·)H → CH3CCH + H·
1 record matched CH3C(NO2)=CH2 → CH3CCH + HNO2
1 record matched CH2C≡CH + H· → CH3CCH
3 records matched Cyclopropene → CH3CCH
1 record matched ·CH2CH=CH2 + O· → CH3CCH + ·OH
1 record matched CH2=C=CHCH2CH3 → C2H4 + CH3CCH
2 records matched (CH3)CCl=CH2 → CH3CCH + HCl
2 records matched CH3CBr=CH2 → CH3CCH + HBr
1 record matched Cyclopentadiene + CH2C≡CH → CH3CCH + Cyclopentadienyl
10 records matched CH2=C=CH2 → CH3CCH
3 records matched Furan → CH3CCH + CO
1 record matched Pyrrole → HCN + CH3CCH
1 record matched CH3CCH + CH≡CC≡C → Products
2 records matched CH3CCH + ·Cl → CH2C≡CH + HCl
5 records matched CH3CCH + ·Cl → Products
2 records matched CH3CCH + N → Products
1 record matched CH3CCH + O· → H· + CH2=C=C=O
1 record matched CH3CCH + O· → ·OH + CH2=C=CH
1 record matched CH3CCH + O· → Oxirene, methyl-
1 record matched CH3CCH + O· → HCO + C2H3
1 record matched CH3CCH + O· → ·CH3 + HCCO
2 records matched CH3CCH + O· → CO + CH3CH
1 record matched CH3CCH + O· → C2H2 + CO + H2
1 record matched CH3CCH + O· → C2H4 + CO
6 records matched CH3CCH + O· → Products
1 record matched CH3CCH + O· → CH3C(·)=C=O + H·
1 record matched CH3CCH + I → HI + CH3C≡C
1 record matched CH3CCH + SiH → Products
1 record matched CH3CCH + H· → CH2=C(·)CH3
1 record matched CH3CCH + H· → CH3CH=C(·)H
1 record matched CH3CCH + H· → H2 + CH2=C=CH
2 records matched CH3CCH + H· → CH2=C=CH2 + H·
8 records matched CH3CCH + H· → C2H2 + ·CH3
4 records matched CH3CCH + H· → Products
3 records matched CH3CCH + C3 → Products
1 record matched CH3CCH + C2 → Products
1 record matched CH3CCH + C2 → H2CCCCCH + H·
4 records matched CH3CCH + NO3 → Products
1 record matched CH3CCH + NO2 → Products
1 record matched CH3CCH + Br· → Adduct
1 record matched CH3CCH + Br· → Products
3 records matched CH3CCH + O3 → Products
1 record matched CH3CCH + S → Thiirene, methyl-
1 record matched CH3CCH + S → Products
1 record matched CH3CCH + Ge → Products
2 records matched CH3CCH + Cu → Cu(CH3C≡CH)
1 record matched CH3CCH + C → Products + H·
2 records matched CH3CCH + C → Products
1 record matched CH3CCH + B → Products
1 record matched CH3CCH + Si → Products
2 records matched CH3CCH + CH2=C=CH → Benzene + H·
1 record matched CH3CCH + (CH3)2Si → Products
1 record matched CH3CCH + CBr → Products
2 records matched CH3CCH + ·CCl → Products
2 records matched CH3CCH + CF → Products
1 record matched CH3CCH + ·OH + O2 → Products
8 records matched CH3CCH + ·OH → Products
1 record matched CH3CCH + ·CH → CH2=C=C=CH2 + H·
1 record matched CH3CCH + ·CH → Vinylacetylene + H·
3 records matched CH3CCH + ·CH → Products
1 record matched CH3CCH + 4-methylphenyl → Products
1 record matched CH3CCH + Phenyl → 1-Phenylpropyne + H·
1 record matched CH3CCH + Phenyl → Products
2 records matched CH3CCH + ·CF3 → Adduct
1 record matched CH3CCH + ·CH3 → CH3CH=CCH3
2 records matched CH3CCH + CH3O· → Adduct
2 records matched CH3CCH + ·C2H → CH3C≡CC≡CH + H·
2 records matched CH3CCH + ·C2H → 1,3-Butadiyne + ·CH3
6 records matched CH3CCH + ·C2H → Products
1 record matched CH3CCH + ·C2H → CH2CCHCCH + H·
1 record matched CH3CCH + iso-C3H7 → Adduct
1 record matched CH3CCH + ·CH2CH=CH2 → 2-Methyl-1,3-cyclopentadiene + H·
1 record matched CH3CCH + ·CH2CH=CH2 → 1-Methyl-1,3-cyclopentadiene + H·
1 record matched CH3CCH + ·CH2CH=CH2 → 1,3-Cyclopentadiene, 5-methyl-
1 record matched CH3CCH + ·CH2CH=CH2 → Other Products + Cyclopentadiene
2 records matched CH3CCH + ·CH2CH=CH2 → Adduct
1 record matched CH3CCH + tert-C4H9 → Adduct
1 record matched CH3CCH → 2-Propenylidene
1 record matched CH3CCH → CH2=C=CH + H·
1 record matched CH3CCH → CH2C≡CH + H·
3 records matched CH3CCH → Cyclopropene
5 records matched CH3CCH → CH2=C=CH2
1 record matched CH3CCH → Other Products + C2H2
1 record matched CH3CCH → Other Products + CH4
1 record matched CH3CCH → Products
2 records matched C2H2 + ·CH2 → CH3CCH
4 records matched C2H2 + ·CH3 → CH3CCH + H·
1 record matched C2H4 + ·CH → CH3CCH + H·
1 record matched CN + CH3CCH → Other Products + HCN
1 record matched CN + CH3CCH → Products
1 record matched CN(X2Sigma+) + CH3CCH → Products
1 record matched C(3Pj) + CH3CCH → Products
1 record matched C2(X1ΣPlg) + CH3CCH → Products
1 record matched C2(a3PIu) + CH3CCH → Products
1 record matched CH2=C(OH)CH3 → CH3CCH + H2O
1 record matched 2-Propenylidene → CH3CCH
1 record matched CH2=C=CHCH=CH2 → C2H2 + CH3CCH
1 record matched CH2=C=CH + H· → CH3CCH
1 record matched CH3CH=CHCN → HCN + CH3CCH
1 record matched Cyclopropene → CH3CCH
1 record matched CH3CBr=CH2 → CH3CCH + HBr
1 record matched 2-Methylfuran → CH3CCH + H2C=C=O
1 record matched 2-butyne + CH2=C=CH → CH3CCH + CH3C=C=CH2
3 records matched CH2=C=CH2 → CH3CCH
1 record matched CH2=C(CH3)CN → HCN + CH3CCH
1 record matched 1-butyne + CH2=C=CH → CH3CCH + CHCCH(·)CH3
1 record matched CH3CCH + CH2=CHCH=CH· → Toluene + H·
1 record matched CH3CCH + ·CH2 → 1-methylcyclopropene
1 record matched CH3CCH + ·CH2 → 2-butyne
1 record matched CH3CCH + ·CH2 → 1-butyne
1 record matched CH3CCH + ·CH2 → Adduct
1 record matched CH3CCH + NCO → Products
1 record matched CH3CCH + O· → H· + CH2=CHC(·)O
1 record matched CH3CCH + O· → CH3CH=C=O
2 records matched CH3CCH + O· → CH2C≡CH + ·OH
1 record matched CH3CCH + O· → HCO + C2H3
1 record matched CH3CCH + O· → ·CH3 + HCCO
1 record matched CH3CCH + O· → CO + CH3CH
1 record matched CH3CCH + O· → CH2=CHCHO
1 record matched CH3CCH + O· → C2H2 + CO + H2
1 record matched CH3CCH + O· → C2H4 + CO
1 record matched CH3CCH + O· → CH2C(·)CHO + H·
1 record matched CH3CCH + O· → CH3C(·)=C=O + H·
1 record matched CH3CCH + ·F → CH2=C=CH + HF
1 record matched CH3CCH + ·F → ·CH3 + HCCF
1 record matched CH3CCH + ·F → CH2CCHF + H·
1 record matched CH3CCH + ·F → CH3CC + HF
1 record matched CH3CCH + ·F → H3CCCF + H·
1 record matched CH3CCH + SH → CH2C≡CH + H2S
1 record matched CH3CCH + SiH → H3C(cyc-CSiCH) + H·
1 record matched CH3CCH + H· → C2H2 + ·CH3
2 records matched CH3CCH + H· → Products
1 record matched CH3CCH + CP → Products
1 record matched CH3CCH + C3 → Products
2 records matched CH3CCH + C2 → ·C2H + CH2C≡CH
1 record matched CH3CCH + C2 → H2 + HCCCCCH
1 record matched CH3CCH + C2 → C2H2 + c-C3H2
1 record matched CH3CCH + C2 → H2CCCCCH + H·
1 record matched CH3CCH + C2 → HCCCHCCH + H·
1 record matched CH3CCH + C2 → HCC-CH=C=C: + H2
1 record matched CH3CCH + NO3 → CH3C=C(H)ONO2
1 record matched CH3CCH + Zr → Zr(HCCCH) + H2
1 record matched CH3CCH + Zr → Zr(CCCH2) + H2
1 record matched CH3CCH + Zr → Zr-CCCH2 + H2
1 record matched CH3CCH + Zr → Zr-CCH + ·CH3
1 record matched CH3CCH + Zr → Zr(CC)H + ·CH3
1 record matched CH3CCH + ·OH → CH2C≡CH + H2O
1 record matched CH3CCH + ·CH → Methylenecyclopropene + H·
1 record matched CH3CCH + ·CH → CH2=C=C=CH2 + H·
1 record matched CH3CCH + ·CH → Vinylacetylene + H·
1 record matched CH3CCH + 4-methylphenyl → Products
1 record matched CH3CCH + Phenyl → Benzene, 1,2-propadienyl- + H·
1 record matched CH3CCH + Phenyl → 1-Phenylpropyne + H·
1 record matched CH3CCH + Phenyl → Phenylacetylene + ·CH3
1 record matched CH3CCH + Phenyl → Benzene + CH2=C=CH
2 records matched CH3CCH + Phenyl → Products
1 record matched CH3CCH + ·CH3 → (CH3)2C=CH·
1 record matched CH3CCH + ·CH3 → CH3CH=C(·)(CH3)
1 record matched CH3CCH + ·C2H → H· + CH≡CCH2C≡CH
1 record matched CH3CCH + ·C2H → H· + CH2=C=C=C=CH2
1 record matched CH3CCH + ·C2H → CH3C≡CC≡CH + H·
1 record matched CH3CCH + ·C2H → 1,3-Butadiyne + ·CH3
2 records matched CH3CCH + ·C2H → C2H2 + CH2C≡CH
1 record matched CH3CCH + ·C2H → CH2CCHCCH + H·
1 record matched CH3CCH + ·CH2CH=CH2 → 1,3,5-Hexatriene + H·
1 record matched CH3CCH + ·CH2CH=CH2 → CH3CCCH2CHCH2 + H·
1 record matched CH3CCH → 2-Propenylidene
1 record matched CH3CCH → CH2C≡CH + H·
2 records matched CH3CCH → CH2=C=CH2
1 record matched C2H2 + ·CH2 → CH3CCH
3 records matched C2H2 + ·CH3 → CH3CCH + H·
1 record matched Acetone → CH3CCH + H2O
1 record matched (CH3)2C=CH· → CH3CCH + ·CH3
1 record matched CH3CH=C(·)(CH3) → CH3CCH + ·CH3
1 record matched C(1D) + CH3CCH → Products
1 record matched CH2=C(OH)-CH2· + H· → CH3CCH + H2O
1 record matched cyc-(:)C-O-C(CH3)=CHCH(CH3) → CH3CCH + CH3CH=C=O
1 record matched CH3C(·)=CHCH2C(O)OCH3 → CH3CCH + ·CH2C(O)OCH3
2 records matched CH_2(aA_1) + C2H2 → CH3CCH
1 record matched CH2=C(·)CH3 → CH3CCH + H·

Search returned 291 records.