Kinetics Database Logo

Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences


Rate Our Products and Services


Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty


Administrative Links

NIST home page

MML home page

Chemical Sciences Division

  NIST Logo Home
©NIST, 2020
Accessibility information

Search Results

Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
1 record matched NO + NH2 → N2 + H2O
1 record matched Al + H2O + H2O → Al(OH)2 + H2
1 record matched Al + H2O → HAlOH
2 records matched Al + H2O → H· + AlOH
1 record matched Cyclopentanone + ·OH → cyclopentanon-2-yl + H2O
1 record matched Cyclopentanone + ·OH → cyclopentanon-3-yl + H2O
1 record matched Nitrobenzene + H2O → Products
3 records matched Acetone + ·OH → CH3C(O)CH2(·) + H2O
1 record matched N(2D) + H2O → H· + :NOH
1 record matched HNO + HNO → H2O + N2O
1 record matched NO + NH2 → N2 + H2O
1 record matched O2 + ·CH2 → CO + H2O
1 record matched H2O + ·CH2 → ·CH3 + ·OH
1 record matched H2O + ·Cl → ·OH + HCl
1 record matched H2O + NCO → HN=C=O + ·OH
4 records matched H2O + CF3O → CF3OH + ·OH
1 record matched H2O + N → ·OH + NH
5 records matched H2O + O· → ·OH + ·OH
8 records matched H2O + ·F → ·OH + HF
1 record matched H2O + ClONO2 → HNO3 + HOCl
2 records matched H2O + ClONO2 → Products
1 record matched H2O + NH → ·OH + NH2
1 record matched H2O + NH2 → ·OH + NH3
2 records matched H2O + NaO → NaOH + ·OH
7 records matched H2O + H· → H2 + ·OH
1 record matched H2O + N2O5 → HOONO + HOONO
5 records matched H2O + N2O5 → HNO3 + HNO3
1 record matched H2O + Br· → ·OH + HBr
1 record matched H2O + H2O + N2O5 → HNO3 + H2O
3 records matched H2O → ·OH + H·
4 records matched H2O2 + H· → ·OH + H2O
2 records matched SO3 + H2O → Products
1 record matched Kr + H2O → ·OH + H·
1 record matched Cyclobutyl + H2O → Cyclobutane + ·OH
1 record matched ·OH + CF3CF2CH2CH2F → Other Products + H2O
2 records matched ·OH + CF3CHFCHFCF2CF3 → Other Products + H2O
1 record matched ·OH + CF3CH2CF2CH2CF3 → CF3CH2CF2CH(.)CF3 + H2O
1 record matched ·OH + CF3CF2CH2CH2CF2CF3 → CF3CF2CH2CH(.)CF2CF3 + H2O
1 record matched ·OH + CCl2FCHO → Other Products + H2O
1 record matched ·OH + CCl2FCHO → CFCl2C(O)(.) + H2O
1 record matched ·OH + CHF2OCHClCF3 → Other Products + H2O
6 records matched ·OH + CH3CCl2F → ·CH2CCl2F + H2O
1 record matched ·OH + CHF2CHFCHF2 → Other Products + H2O
1 record matched ·OH + HNO → H2O + NO
2 records matched ·OH + CHF2OCF2CHFCl → Other Products + H2O
1 record matched ·OH + NH → H2O + N
1 record matched ·OH + NH2 → H2O + NH
8 records matched ·OH + H· → H2O
12 records matched ·OH + HBr → H2O + Br·
9 records matched ·OH + HI → H2O + I
7 records matched ·OH + HOCl → H2O + ClO
9 records matched ·OH + H2S → H2O + SH
7 records matched ·OH + HNO2 → H2O + NO2
14 records matched ·OH + H2O2 → HO2 + H2O
5 records matched ·OH + HNO3 → H2O + NO3
13 records matched ·OH + NH3 → H2O + NH2
10 records matched ·OH + HCl → H2O + ·Cl
4 records matched ·OH + CH3CF2CCl2F → Other Products + H2O
1 record matched ·OH + CH3CF2CCl2F → CH2CF2CFCl2 + H2O
1 record matched ·OH + iso-C4H9 → iso-C4H8 + H2O
2 records matched ·OH + Pentafluorodimethyl ether → H2O + CF3OCF2(·)
20 records matched ·OH + ·OH → H2O + O·
1 record matched ·CH + H2O → Products
8 records matched HO2 + H· → H2O + O·
1 record matched HO2 + H2O → ·OH + H2O2
16 records matched HO2 + ·OH → H2O + O2
1 record matched CH3CO + ·OH → H2C=C=O + H2O
5 records matched CH3OOH + ·OH → H2O + CH2OOH
5 records matched CH3OOH + ·OH → CH3O2· + H2O
9 records matched CF3CHFCl + ·OH → CF3CFCl· + H2O
1 record matched C2H3 + H2O → C2H4 + ·OH
1 record matched C2H3 + ·OH → C2H2 + H2O
1 record matched HCO + H2O → CH2O + ·OH
3 records matched HCO + ·OH → CO + H2O
1 record matched (·)CH2OH + ·OH → CH2O + H2O
3 records matched HC(O)Cl + ·OH → ClCO + H2O
2 records matched ·CH3 + H2O → CH4 + ·OH
1 record matched ·CH3 + ·OH → H2O + ·CH2
1 record matched ·CH3 + ·OH → CH2(1) + H2O
1 record matched CH3O· + ·OH → CH2O + H2O
1 record matched 1-C3H7 + ·OH → CH3CH=CH2 + H2O
2 records matched ·C2H5 + H2O → C2H6 + ·OH
1 record matched ·C2H5 + ·OH → C2H4 + H2O
1 record matched iso-C3H7 + ·OH → CH3CH=CH2 + H2O
1 record matched ·CH2CH=CH2 + ·OH → CH2=C=CH2 + H2O
4 records matched CHF2-O-CHF2 + ·OH → CHF2OCF2· + H2O
7 records matched CF2ClCH2Cl + ·OH → ·CHClCClF2 + H2O
1 record matched tert-C4H9OCH3 + ·OH → Other Products + H2O
1 record matched tert-C4H9 + ·OH → iso-C4H8 + H2O
5 records matched CHBrF2 + ·OH → H2O + CBrF2
1 record matched CF3OH + ·OH → H2O + CF3O
2 records matched HFCO + ·OH → FCO + H2O
24 records matched H2 + ·OH → H2O + H·
2 records matched NaOH + HCl → NaCl + H2O
1 record matched n-C11H24 + ·OH → Other Products + H2O
1 record matched Pentane, 3,3-diethyl- + ·OH → Other Products + H2O
9 records matched CF3CH2F + ·OH → H2O + CF3CHF
1 record matched Acetaldehyde, chlorodifluoro- + ·OH → Other Products + H2O
1 record matched Acetaldehyde, chlorodifluoro- + ·OH → CF2ClC(O)(.) + H2O
4 records matched Propane, 1,1,1,3,3,3-hexafluoro- + ·OH → H2O + (CF3)2CH·
3 records matched Propane, 1,1,2,2,3-pentafluoro- + ·OH → Other Products + H2O
4 records matched Propane, 1,1,1,2,2,3-hexafluoro- + ·OH → CF3CF2CHF· + H2O
2 records matched CHD3 + ·OH → Other Products + H2O
2 records matched CH2D2 + ·OH → Other Products + H2O
2 records matched CH3D + ·OH → Other Products + H2O
1 record matched CH3(CH2)11CH3 + ·OH → Other Products + H2O
5 records matched CH2FCH2F + ·OH → H2O + CH2FCHF
6 records matched (CH3)3CC(CH3)3 + ·OH → H2O + (CH3)3CC(CH3)2CH2
9 records matched CH2FCl + ·OH → H2O + ·CClFH
7 records matched CH3F + ·OH → ·CH2F + H2O
2 records matched CD4 + ·OH → Other Products + H2O
4 records matched (CH3)2CHCH2C(CH3)3 + ·OH → Other Products + H2O
4 records matched CF2ClCF2CHClF + ·OH → Other Products + H2O
1 record matched CF2ClCF2CHClF + ·OH → CFClCF2CF2Cl + H2O
2 records matched 2,2,3-Trimethylbutane + ·OH → H2O + (CH3)3C-C(·)(CH3)2
6 records matched 2,2,3-Trimethylbutane + ·OH → Other Products + H2O
6 records matched neo-C5H12 + ·OH → Neopentyl + H2O
1 record matched CF3CH2CHF2 + ·OH → Other Products + H2O
4 records matched CF3CHFCF3 + ·OH → (CF3)2CF + H2O
3 records matched 1,1,1,2,3,3-Hexafluoropropane + ·OH → Other Products + H2O
1 record matched CF3CHFCH2F + ·OH → Other Products + H2O
5 records matched CH2FCHF2 + ·OH → Other Products + H2O
4 records matched CF3CF2CHCl2 + ·OH → Other Products + H2O
1 record matched CF3CF2CHCl2 + ·OH → (.)CCl2CF2CF3 + H2O
1 record matched CF3OCH3 + ·OH → CF3OCH2(.) + H2O
1 record matched CH3CH2CF3 + ·OH → Other Products + H2O
3 records matched CF3CBrH2 + ·OH → CF3CHBr· + H2O
6 records matched CH3CF3 + ·OH → CF3CH2 + H2O
2 records matched CF3CH2CH2CF3 + ·OH → CF3CH2CH(·)CF3 + H2O
1 record matched CF3CH2CF2CH3 + ·OH → Other Products + H2O
2 records matched CHF2CF2CF2CHF2 + ·OH → CHF2CF2CF2CF2· + H2O
6 records matched CHF2CHF2 + ·OH → H2O + CHF2CF2
6 records matched C2F5H + ·OH → C2F5 + H2O
3 records matched CF2ClCHFCl + ·OH → H2O + ·CFClCF2Cl
3 records matched Ethane, 1,2,2-trichloro-1,1-difluoro- + ·OH → H2O + CCl2CF2Cl
3 records matched CCl2FCHClF + ·OH → H2O + CFCl2CFCl
1 record matched CF2BrCHFCl + ·OH → CF2BrCFCl· + H2O
5 records matched C2H5F + ·OH → Other Products + H2O
9 records matched CF3CHCl2 + ·OH → H2O + CF3CCl2
6 records matched Cyclopentane + ·OH → Cyclopentyl + H2O
4 records matched Cyclobutane + ·OH → Cyclobutyl + H2O
4 records matched CF3CHClBr + ·OH → H2O + CF3CClBr
5 records matched 1-C7H16 + ·OH → Other Products + H2O
4 records matched HOCH2CHO + ·OH → H2O + HOCH2C(·)O
4 records matched HOCH2CHO + ·OH → HOCH(·)CHO + H2O
4 records matched CF3CHBrF + ·OH → CF3CFBr· + H2O
4 records matched 1-C10H22 + ·OH → Other Products + H2O
4 records matched (CH3)2O + ·OH → H2O + CH3OCH2·
1 record matched CH3CH=CH2 + ·OH → H2O + CH2=C(·)CH3
1 record matched CH3CH=CH2 + ·OH → CH3CH=C(·)H + H2O
1 record matched CH3CH=CH2 + ·OH → ·CH2CH=CH2 + H2O
1 record matched CH3(CH2)10CH3 + ·OH → Other Products + H2O
4 records matched n-C9H20 + ·OH → Other Products + H2O
5 records matched n-C8H18 + ·OH → Other Products + H2O
6 records matched Cyclohexane + ·OH → Cyclohexyl + H2O
1 record matched 1,2-Dimethoxyethane + ·OH → CH3OCH2CH2OCH2· + H2O
4 records matched 1-C6H14 + ·OH → Other Products + H2O
1 record matched n-C5H12 + ·OH → H2O + (CH3CH2)2CH
4 records matched n-C5H12 + ·OH → Other Products + H2O
2 records matched Toluene + ·OH → Benzyl + H2O
1 record matched Pentane, 2,4-dimethyl- + ·OH → Other Products + H2O
3 records matched (CH3)2CH(CH2)2CH3 + ·OH → Other Products + H2O
1 record matched (CHO)2 + ·OH → H2O + HC(O)CO
1 record matched (CHO)2 + ·OH → Other Products + H2O
1 record matched 1-C4H10 + ·OH → sec-C4H9 + H2O
8 records matched 1-C4H10 + ·OH → Other Products + H2O
1 record matched CH2BrCH2Br + ·OH → Other Products + H2O
2 records matched 1,4-Dimethylbenzene + ·OH → 4-Methylbenzyl + H2O
1 record matched (C2H5)2CHCH3 + ·OH → H2O + (C2H5)2(CH3)C
3 records matched (C2H5)2CHCH3 + ·OH → Other Products + H2O
1 record matched (CH3)2CHCH(CH3)2 + ·OH → H2O + (CH3)2CHC(·)(CH3)2
6 records matched (CH3)2CHCH(CH3)2 + ·OH → Other Products + H2O
3 records matched CHCl2CH2Cl + ·OH → Other Products + H2O
3 records matched CH3C(O)CHO + ·OH → CH3C(O)C(O)· + H2O
1 record matched iso-C5H12 + ·OH → (CH3)2C(·)CH2CH3 + H2O
1 record matched iso-C5H12 + ·OH → (CH3)2CHCH(·)CH3 + H2O
3 records matched iso-C5H12 + ·OH → Other Products + H2O
3 records matched CF3CHO + ·OH → CF3C(O) + H2O
7 records matched CF3CH2Cl + ·OH → H2O + CF3CHCl
2 records matched CCl3CHO + ·OH → Other Products + H2O
3 records matched CCl3CHO + ·OH → CCl3C(O)(.) + H2O
3 records matched (CH3)3CCH2CH3 + ·OH → Other Products + H2O
9 records matched CH3CF2Cl + ·OH → CF2ClCH2· + H2O
9 records matched CHF3 + ·OH → ·CF3 + H2O
9 records matched CHF2Cl + ·OH → ·CClF2 + H2O
9 records matched CHFCl2 + ·OH → ·CCl2F + H2O
8 records matched CH3CHF2 + ·OH → Other Products + H2O
3 records matched CH3COCl + ·OH → H2O + CH2C(O)Cl
1 record matched CH3CHCl2 + ·OH → Other Products + H2O
1 record matched iso-C4H10 + ·OH → iso-C4H9 + H2O
2 records matched iso-C4H10 + ·OH → tert-C4H9 + H2O
7 records matched iso-C4H10 + ·OH → Other Products + H2O
1 record matched CHBr3 + ·OH → CBr3 + H2O
1 record matched Oxirane + ·OH → H2O + Oxiranyl
2 records matched Cyclopropane + ·OH → Cyclopropyl + H2O
10 records matched (CH3)2S + ·OH → H2O + CH3SCH2
1 record matched HN=C=O + ·OH → H2O + NCO
7 records matched CH2F2 + ·OH → ·CHF2 + H2O
9 records matched CH2Cl2 + ·OH → CHCl2 + H2O
7 records matched CH3CHO + ·OH → CH3CO + H2O
2 records matched C2H5Cl + ·OH → Other Products + H2O
2 records matched C3H8 + ·OH → iso-C3H7 + H2O
12 records matched C3H8 + ·OH → Other Products + H2O
1 record matched CH2ClBr + ·OH → H2O + ·CHBrCl
4 records matched CH2Br2 + ·OH → H2O + CHBr2
1 record matched CH3SH + ·OH → CH3S· + H2O
2 records matched HCN + ·OH → CN + H2O
5 records matched CH3I + ·OH → H2O + ·CH2I
10 records matched CH3Cl + ·OH → ·CH2Cl + H2O
2 records matched C2H2 + ·OH → ·C2H + H2O
4 records matched C2H4 + ·OH → C2H3 + H2O
15 records matched C2H6 + ·OH → ·C2H5 + H2O
2 records matched C2H6 + ·OH → Other Products + H2O
11 records matched CH3Br + ·OH → H2O + ·CH2Br
21 records matched CH4 + ·OH → ·CH3 + H2O
2 records matched CH4 + ·OH → Other Products + H2O
9 records matched CH3CCl3 + ·OH → H2O + CCl3CH2
2 records matched Benzene + ·OH → Phenyl + H2O
2 records matched n-C3H7OH + ·OH → Other Products + H2O
9 records matched CHCl3 + ·OH → ·CCl3 + H2O
4 records matched Acetone + ·OH → CH3C(O)CH2(·) + H2O
2 records matched iso-C3H7OH + ·OH → Other Products + H2O
1 record matched CH3OH + ·OH → (·)CH2OH + H2O
2 records matched CH3OH + ·OH → CH3O· + H2O
1 record matched CH3OH + ·OH → CH2O + H2O + H·
4 records matched CH3OH + ·OH → Other Products + H2O
4 records matched CH3C(O)OH + ·OH → Other Products + H2O
2 records matched C2H5OH + ·OH → HOCH2CH2· + H2O
2 records matched C2H5OH + ·OH → CH3CH(·)OH + H2O
2 records matched C2H5OH + ·OH → CH3CH2O· + H2O
5 records matched C2H5OH + ·OH → Other Products + H2O
9 records matched C2H5OH → C2H4 + H2O
1 record matched CN + H2O → HCN + ·OH
1 record matched CN + H2O → Products
11 records matched CH2O + ·OH → HCO + H2O
6 records matched O(1D) + H2O → ·OH + ·OH
2 records matched O2(1DELTA) + H2O → Products
2 records matched cis-HONO + ·OH → H2O + NO2
1 record matched N(2D) + H2O → Products
3 records matched O(1D) + H2O → ·OH + ·OH
1 record matched N2(A3Sigma_u+) + H2O → ·OH + N2 + H·
1 record matched O2(X3Sigma_g-) + H2O → HO2 + ·OH
1 record matched :Si(OH)2 → H2O + SiO
1 record matched CH2OO → CO + H2O
2 records matched CD3C(CH3)2OH → H2O + (CD3)(CH3)C=CH2
10 records matched HNO + HNO → H2O + N2O
1 record matched H· + H2Si(·)OH → H2O + SiH2
1 record matched Cyclohexadienyl, 6-hydroxy- → Phenyl + H2O
5 records matched NO2 + NH2 → H2O + N2O
18 records matched NO + NH2 → N2 + H2O
1 record matched H2S + O3 → SO2 + H2O
2 records matched HNO2 + HNO2 → H2O + NO + NO2
1 record matched O2 + CH3OCH2· → CH2O + HCO + H2O
1 record matched H2O + (CH3)2C(·)OO· → Products
1 record matched H2O + CH3CH(·)OO· → Products
1 record matched H2O + CH2OO → HOCH2OOH
1 record matched H2O + CH2OO → HCOOH + H2O
1 record matched H2O + CH2OO → CH2O + H2O2
5 records matched H2O + CH2OO → Products
1 record matched H2O + Na2 → Products
1 record matched H2O + H2Si=O → H2 + HSi(O)OH
4 records matched H2O + CF3O → CF3OH + ·OH
3 records matched H2O + O· → ·OH + ·OH
5 records matched H2O + ·F → ·OH + HF
4 records matched H2O + ClONO2 → HNO3 + HOCl
1 record matched H2O + AlH → Products
1 record matched H2O + SiH2 → SiH3OH
1 record matched H2O + SiH2 → H· + H2Si(·)OH
1 record matched H2O + SiH2 → H2 + HSiOH
1 record matched H2O + SiH2 → H2 + H2Si=O
2 records matched H2O + SiH2 → Products
4 records matched H2O + SiH2 → SiH2(H2O) Adduct
2 records matched H2O + CD → Products
1 record matched H2O + NH → Products
1 record matched H2O + NH2 → ·OH + NH3
2 records matched H2O + BF → H2 + OBF
2 records matched H2O + BH → Products
1 record matched H2O + SOF4 → Other Products + SO2F2
2 records matched H2O + OD → ·OH + HDO
1 record matched H2O + BH3 → Products
1 record matched H2O + Cyclotrisiloxane-2,4,6-triylidene- → Adduct
1 record matched H2O + Cyclodisiloxane-2,4-diylidene- → Adduct
3 records matched H2O + NaO → NaOH + ·OH
4 records matched H2O + H· → H2 + ·OH
1 record matched H2O + C2 → Products
1 record matched H2O + FeO3 → O2 + Fe(OH)2
2 records matched H2O + N2O3 → HNO2 + HNO2
1 record matched H2O + N2O4 → HNO3 + HNO2
1 record matched H2O + NO2 → ·OH + HNO2
4 records matched H2O + NO + NO2 → HNO2 + HNO2
7 records matched H2O + N2O5 → HNO3 + HNO3
1 record matched H2O + SiO → Products
1 record matched H2O + O3 → H2O2 + O2
2 records matched H2O + Cl2O → HOCl + HOCl
3 records matched H2O + SF4 → HF + HF + SOF2
2 records matched H2O + SOF2 → Other Products + SO2
4 records matched H2O + H2O + SiH2 → H2O + SiH3OH
1 record matched H2O + H2O + N2O5 → HNO3 + HNO3 + H2O
1 record matched H2O + H2O → ·OH + H2O + H·
6 records matched H2O → ·OH + H·
9 records matched H2O2 + H· → ·OH + H2O
1 record matched H2O2 + NO → H2O + NO2
1 record matched H2O2 + O3 → H2O + O2 + O2
2 records matched SOCl2 + H2O → SO2 + HCl + HCl
1 record matched HNO3 + H· → H2O + NO2
1 record matched HF + HF + POF3 → PF5 + H2O
1 record matched PF5 + H2O → HF + HF + POF3
3 records matched SO3 + H2O → H2SO4
1 record matched Zr + H2O → Products
1 record matched Hf + H2O → Products
2 records matched C + H2O → Products
1 record matched B + H2O → Products
1 record matched Na + H2O → NaOH + H·
1 record matched Na + H2O2 → H2O + NaO
1 record matched K + H2O → KOH + H·
1 record matched Ni + H2O → Nickel, aqua-
1 record matched Li + H2O → LiOH + H·
1 record matched Kr + H2O → ·OH + H·
3 records matched Fe + H2O → Fe(OH)2
1 record matched Fe + H2O → Products
1 record matched Al + H2O → Products
1 record matched (CH3)2Si + H2O → Products
1 record matched HOCH2CH2· → C2H3 + H2O
1 record matched C2H5(CH3)C(OH)COOH → C2H5COCH3 + CO + H2O
1 record matched (C2H5)2C(OH)COOH → (C2H5)2CO + CO + H2O
1 record matched ·OH + CH3OC4F9 → CH2OC4F9 + H2O
1 record matched ·OH + CF3CF2CH2CH2F → Other Products + H2O
2 records matched ·OH + CF3CHFCHFCF2CF3 → Other Products + H2O
1 record matched ·OH + (CH3)2CHCH(CH3)ONO2 → CH3C(·)(ONO2)CH(CH3)2 + H2O
1 record matched ·OH + (CH3)2CHCH(CH3)ONO2 → CH3CH(ONO2)C(·)(CH3)2 + H2O
1 record matched ·OH + (CH3)2CHCH(CH3)ONO2 → CH3CH(ONO2)CH(CH3)CH2· + H2O
1 record matched ·OH + C2H5CH(CH3)CH(CH3)ONO2 → CH3C(·)(ONO2)CH(CH3)CH2CH3 + H2O
1 record matched ·OH + C2H5CH(CH3)CH(CH3)ONO2 → CH3CH(ONO2)C(·)(CH3)CH2CH3 + H2O
1 record matched ·OH + C2H5CH(CH3)CH(CH3)ONO2 → CH3CH(ONO2)CH(CH3)CH(·)CH3 + H2O
1 record matched ·OH + CF3CH2CF2CH2CF3 → CF3CH2CF2CH(.)CF3 + H2O
1 record matched ·OH + CF3CF2CH2CH2CF2CF3 → CF3CF2CH2CH(.)CF2CF3 + H2O
2 records matched ·OH + (CH3)2CHCH2OCH(CH3)2 → Other Products + H2O
2 records matched ·OH + HSO2 → SO2 + H2O
1 record matched ·OH + CF3CHClOCH2CH3 → Other Products + H2O
1 record matched ·OH + CH3C(O)OCH(CH3)CH2CH3 → Other Products + H2O
1 record matched ·OH + HN=N → N2 + H2O
2 records matched ·OH + 2,2-Dichloroethyl methyl ether → Other Products + H2O
2 records matched ·OH + CH2FOCH(CF3)2 → Other Products + H2O
3 records matched ·OH + CHF2OCHClCF3 → Other Products + H2O
10 records matched ·OH + CH3CCl2F → ·CH2CCl2F + H2O
1 record matched ·OH + CHF2CHFCHF2 → Other Products + H2O
1 record matched ·OH + Diborane(6) → H2O + B2H5
1 record matched ·OH + CH3SD → CH2SD + H2O
3 records matched ·OH + 2,2-Dimethyl-3-ethylpentane → Other Products + H2O
1 record matched ·OH + HOCH2OOH → HCOOH + ·OH + H2O
5 records matched ·OH + HNO → H2O + NO
3 records matched ·OH + CHF2OCF2CHFCl → Other Products + H2O
1 record matched ·OH + NH2 → H2O + NH
1 record matched ·OH + NH2O → H2O + HNO
45 records matched ·OH + H· → H2O
23 records matched ·OH + HBr → H2O + Br·
7 records matched ·OH + HI → H2O + I
2 records matched ·OH + SiH4 → H2O + SiH3
1 record matched ·OH + PH3 → H2O + PH2
1 record matched ·OH + NH2OH → H2O + NHOH
1 record matched ·OH + HOCl → H2O + ClO
16 records matched ·OH + H2S → H2O + SH
2 records matched ·OH + HN3 → H2O + ·N3
10 records matched ·OH + HNO2 → H2O + NO2
3 records matched ·OH + GeH4 → H2O + GeH3
1 record matched ·OH + H2O + H· → H2O + H2O
1 record matched ·OH + H2O → ·OH + H2O
34 records matched ·OH + H2O2 → HO2 + H2O
17 records matched ·OH + HNO3 → H2O + NO3
24 records matched ·OH + NH3 → H2O + NH2
17 records matched ·OH + HCl → H2O + ·Cl
1 record matched ·OH + CH3CF2CCl2F → Other Products + H2O
2 records matched ·OH + Ethane, 1-bromo-2-methoxy- → Other Products + H2O
2 records matched ·OH + d-Limonene → Other Products + H2O
1 record matched ·OH + (E)-CH3CH=CHCHO → Other Products + H2O
3 records matched ·OH + Pentafluorodimethyl ether → H2O + CF3OCF2(·)
26 records matched ·OH + ·OH → H2O + O·
2 records matched ·OH + ·OH → H2O + H·
1 record matched ·CH + H2O → (·)CH2OH
1 record matched ·CH + H2O → Products + H·
5 records matched ·CH + H2O → Products
1 record matched HO2 + CH2FO2 → HFCO + H2O + O2
1 record matched HO2 + CH2ClO2 → HC(O)Cl + H2O + O2
1 record matched HO2 + CH3OCH2O2 → HC(O)OCH3 + H2O + O2
1 record matched HO2 + CH3OCH2O2 → CH3OCH(O) + H2O + O2
1 record matched HO2 + HOCH2OO → HCOOH + H2O + O2
1 record matched HO2 + NH2 → H2O + :NOH
4 records matched HO2 + NH2 → H2O + HNO
5 records matched HO2 + H· → H2O + O·
1 record matched HO2 + H2S → H2O + HSO
1 record matched HO2 + H2O + NO → HNO3 + H2O
1 record matched HO2 + H2O → HO2-H2O Complex
37 records matched HO2 + ·OH → H2O + O2
1 record matched HO2 + HO2 + H2O → H2O2 + H2O + O2
1 record matched HO2 + HO2 + H2O → Products + H2O
1 record matched ·CCl3 + HOCH2CH2· → CH2=CHCCl3 + H2O
1 record matched CH3OOH + H· → CH3O· + H2O
3 records matched CH3OOH + ·OH → H2O + CH2OOH
2 records matched CH3OOH + ·OH → CH3O2· + H2O
1 record matched (CH3)3SiCH2CH2OH → CH2=CHSi(CH3)3 + H2O
1 record matched HOCH2CH(CH3)NO2 → CH3C(NO2)=CH2 + H2O
6 records matched CF3CHFCl + ·OH → CF3CFCl· + H2O
1 record matched NOCl + H2O → HCl + HNO2
2 records matched HCO + ·OH → CO + H2O
1 record matched HC(O)Cl + H2O → Products
1 record matched Phenyl + H2O → Benzene + ·OH
1 record matched CH3C(O)OONO2 + H2O → Products
1 record matched ·CF3 + HOCH2CH2· → H2O + CH2=CHCF3
3 records matched ·CH3 + NO → HCN + H2O
2 records matched ·CH3 + O2 → HCO + H2O
1 record matched ·CH3 + HOCH2CH2· → CH3CH=CH2 + H2O
3 records matched ·CH3 + ·OH → H2O + ·CH2
2 records matched ·CH3 + ·OH → CH2(1) + H2O
2 records matched CH3O2· + ·OH → H2O + CH2OO
1 record matched CH3O2· + HO2 → CH2O + H2O + O2
2 records matched ·C2H + H2O → Products
1 record matched C6H5O + C6H5O → Dibenzofuran + H2O
2 records matched (CH3)2CHONO2 + ·OH → (CH3)2C(·)ONO2 + H2O
5 records matched CHF2-O-CHF2 + ·OH → CHF2OCF2· + H2O
3 records matched CF2ClCH2Cl + ·OH → ·CHClCClF2 + H2O
13 records matched tert-C4H9OCH3 + ·OH → Other Products + H2O
1 record matched CCl2 (X 1A1) + H2O → Products
1 record matched C6D5CH3 + ·OH → H2O + C6D5CH2
5 records matched CHBrF2 + ·OH → H2O + CBrF2
2 records matched HFCO + ·OH → FCO + H2O
1 record matched H2 + HNO → H2O + NH
1 record matched H2 + N2O → N2 + H2O
50 records matched H2 + ·OH → H2O + H·
2 records matched SrO + H2O → Strontium hydroxide
3 records matched NaOH + H· → Na + H2O
1 record matched KOH + H· → K + H2O
2 records matched MgO + H2O → Mg(OH)2
4 records matched CaO + H2O → Ca(OH)2
1 record matched CaO + H2 → Ca + H2O
2 records matched BaO + H2O → Ba(OH)2
3 records matched 2,2,3,4-Tetramethylpentane + ·OH → Other Products + H2O
3 records matched n-C11H24 + ·OH → Other Products + H2O
2 records matched 2,2,4,4-tetramethylpentane + ·OH → Other Products + H2O
3 records matched 2,4-Dimethyl-3-ethylpentane + ·OH → Other Products + H2O
2 records matched Pentane, 3,3-diethyl- + ·OH → Other Products + H2O
4 records matched C2H5C(CH3)2OCH3 + ·OH → Other Products + H2O
1 record matched C6H5CH=NOH → Benzonitrile + H2O
1 record matched 1-Propanol, 2,2-dimethyl-, nitrate + ·OH → (CH3)3CCH(·)ONO2 + H2O
13 records matched CF3CH2F + ·OH → H2O + CF3CHF
1 record matched HC(O)OC(CH3)3 + ·OH → Other Products + H2O
6 records matched (n-C5H11)2O + ·OH → Other Products + H2O
8 records matched Propane, 1,1,1,3,3,3-hexafluoro- + ·OH → H2O + (CF3)2CH·
3 records matched Propane, 1,1,2,2,3-pentafluoro- + ·OH → Other Products + H2O
1 record matched Propane, 1,1,1,2,2,3-hexafluoro- + ·OH → CF3CF2CHF· + H2O
7 records matched tert-C4H9OC2H5 + ·OH → Other Products + H2O
2 records matched (C2H5)4Si + ·OH → Other Products + H2O
1 record matched CH2ClCCl3 + ·OH → H2O + CCl3CHCl
1 record matched CO + H2O → Products + CO2
1 record matched CH3(CH2)13CH3 + ·OH → Other Products + H2O
1 record matched CH3(CH2)12CH3 + ·OH → Other Products + H2O
1 record matched CH3(CH2)11CH3 + ·OH → Other Products + H2O
8 records matched n-C4H9OC2H5 + ·OH → Other Products + H2O
1 record matched n-C5H11OCH3 + ·OH → Other Products + H2O
5 records matched CH3CH2CH2CH2OCH3 + ·OH → Other Products + H2O
2 records matched 2-Chloroethyl methyl ether + ·OH → Other Products + H2O
1 record matched n-C3H7ONO2 + ·OH → CH3CH2CH(·)ONO2 + H2O
1 record matched C2H5ONO2 + ·OH → CH2CH2ONO2 + H2O
2 records matched HCOOCH(CH3)2 + ·OH → Other Products + H2O
1 record matched HOCH2CH2NO2 → CH2=CHNO2 + H2O
1 record matched 2-Hexanol, 2-methyl- → Other Products + H2O
1 record matched C2H5NC + ·OH → CH3CHCN + H2O
1 record matched CH2FCH2F + ·OH → H2O + CH2FCHF
2 records matched (E)-2-C4H8 + ·OH → H2O + (E)-CH3CH=CHCH2
3 records matched 3-Ethylpentane + ·OH → Other Products + H2O
2 records matched iso-C3H7C(O)OCH(CH3)2 + ·OH → Other Products + H2O
1 record matched CH3OCOOCH3 + ·OH → H2O + CH3OC(O)OCH2·
1 record matched C6H5CH(OH)COOH → Benzaldehyde + CO + H2O
2 records matched 2-Methyl-3-ethylpentane + ·OH → Other Products + H2O
1 record matched CH2=CHCH(OH)CH3 → 1,3-Butadiene + H2O
3 records matched (CH3)3CC(CH3)3 + ·OH → H2O + (CH3)3CC(CH3)2CH2
1 record matched (CH3)2COHCOOH → Acetone + CO + H2O
1 record matched (CH3)2CHC(OH)(CH3)2 → (CH3)2C=C(CH3)2 + H2O
1 record matched (CH3)2CHC(OH)(CH3)2 → (CH3)2CHC(CH3)=CH2 + H2O
1 record matched (CH3)2CHC(OH)(CH3)2 → Other Products + H2O
7 records matched CH2FCl + ·OH → H2O + ·CClFH
12 records matched CH3F + ·OH → ·CH2F + H2O
1 record matched 2-Methylheptane + ·OH → Other Products + H2O
2 records matched CH3C(O)OCH2CH=CH2 + ·OH → Other Products + H2O
1 record matched CH3C(O)CH2CH2OH → CH2=CHCOCH3 + H2O
2 records matched 2-Pentanol, 2-methyl- → Other Products + H2O
2 records matched Pentane, 2,2-dimethyl- + ·OH → Other Products + H2O
1 record matched (Z)-2-C4H8 + ·OH → H2O + (Z)-CH3CH=CHCH2·
2 records matched (n-C3H7)2CHCH3 + ·OH → Other Products + H2O
3 records matched 2,3,4-Trimethylpentane + ·OH → Other Products + H2O
2 records matched 2,3-Dimethylpentane + ·OH → Other Products + H2O
3 records matched 2,2,3-Trimethylpentane + ·OH → Other Products + H2O
1 record matched CH3COF + ·OH → ·CH2CFO + H2O
2 records matched Octamethyltetrasiloxane + ·OH → Other Products + H2O
1 record matched CH3(CH2)14CH3 + ·OH → Other Products + H2O
1 record matched (n-C4H9)2S + ·OH → Products + H2O
2 records matched 1-C6H13Cl + ·OH → Other Products + H2O
2 records matched n-C5H11Cl + ·OH → Other Products + H2O
2 records matched Hexamethylcyclotrisiloxane + ·OH → Other Products + H2O
2 records matched Cyclopentasiloxane, decamethyl- + ·OH → Other Products + H2O
4 records matched CH3C(O)OC(CH3)3 + ·OH → Other Products + H2O
5 records matched (CH3)2CHCH2C(CH3)3 + ·OH → Other Products + H2O
1 record matched C2H5OCH3 + ·OH → Other Products + H2O
4 records matched n-C3H7Cl + ·OH → Other Products + H2O
1 record matched iso-C4H9Cl + ·OH → Other Products + H2O
2 records matched CF2ClCF2CHClF + ·OH → Other Products + H2O
2 records matched tert-C4H9Cl + ·OH → H2O + (CH3)2CClCH2
1 record matched tert-C4H9Cl + ·OH → Other Products + H2O
1 record matched (CH3)3CCH(CH3)OH → (CH3)2C=C(CH3)2 + H2O
1 record matched (CH3)3CCH(CH3)OH → (CH3)3CCH=CH2 + H2O
1 record matched 2,2,3-Trimethylbutane + ·OH → H2O + (CH3)3CCH(CH3)CH2·
1 record matched 2,2,3-Trimethylbutane + ·OH → H2O + (CH3)3C-C(·)(CH3)2
8 records matched 2,2,3-Trimethylbutane + ·OH → Other Products + H2O
16 records matched neo-C5H12 + ·OH → Neopentyl + H2O
1 record matched H2C=C=O + ·OH → H2O + HCCO
1 record matched Fluorobenzene + ·OH → Other Products + H2O
2 records matched CF3CH2CHF2 + ·OH → Other Products + H2O
1 record matched CF3CH2OCH3 + ·OH → CF3CH2OCH2· + H2O
1 record matched CF3CH2OCH3 + ·OH → CF3CH(·)OCH3 + H2O
5 records matched CF3CHFCF3 + ·OH → (CF3)2CF + H2O
5 records matched 1,1,1,2,3,3-Hexafluoropropane + ·OH → Other Products + H2O
1 record matched CF3CHFCH2F + ·OH → Other Products + H2O
4 records matched CH2FCHF2 + ·OH → Other Products + H2O
2 records matched CF3CF2CHCl2 + ·OH → Other Products + H2O
4 records matched CF3OCH3 + ·OH → CF3OCH2(.) + H2O
1 record matched CH3CH2CF3 + ·OH → Other Products + H2O
2 records matched CF3CBrH2 + ·OH → CF3CHBr· + H2O
6 records matched CH3CF3 + ·OH → CF3CH2 + H2O
1 record matched iso-C3H7F + ·OH → Other Products + H2O
2 records matched CF3CH2CH2CF3 + ·OH → CF3CH2CH(·)CF3 + H2O
3 records matched CF3CH2CF2CH3 + ·OH → Other Products + H2O
2 records matched CHF2CF2CF2CHF2 + ·OH → CHF2CF2CF2CF2· + H2O
1 record matched n-C3F7OCH3 + ·OH → CF3CF2CF2OCH2 + H2O
1 record matched CH2FCH2OH → CH2=CHF + H2O
4 records matched CHF2CHF2 + ·OH → H2O + CHF2CF2
6 records matched C2F5H + ·OH → C2F5 + H2O
1 record matched CF2ClCHFCl + ·OH → H2O + ·CFClCF2Cl
4 records matched Ethane, 1,2,2-trichloro-1,1-difluoro- + ·OH → H2O + CCl2CF2Cl
2 records matched CCl2FCHClF + ·OH → H2O + CFCl2CFCl
2 records matched CF2BrCHFCl + ·OH → CF2BrCFCl· + H2O
4 records matched C2H5F + ·OH → Other Products + H2O
11 records matched CF3CHCl2 + ·OH → H2O + CF3CCl2
2 records matched N2H4 + O· → HN=NH + H2O
2 records matched Cyclooctane + ·OH → Cyclooctyl radical + H2O
3 records matched Cycloheptane + ·OH → Cycloheptyl + H2O
11 records matched Cyclopentane + ·OH → Cyclopentyl + H2O
4 records matched Cyclobutane + ·OH → Cyclobutyl + H2O
3 records matched CF3CHClBr + ·OH → H2O + CF3CClBr
1 record matched CH(OCH3)3 + ·OH → Trimethoxymethane radical + H2O
14 records matched (n-C4H9)2O + ·OH → Other Products + H2O
7 records matched 1-C7H16 + ·OH → Other Products + H2O
2 records matched CH2ClCH2CH2Cl + ·OH → Other Products + H2O
1 record matched CH3C(O)OC2H5 + ·OH → CH3C(O)OCH2CH2· + H2O
1 record matched CH3C(O)OC2H5 + ·OH → CH3C(O)OCH(·)CH3 + H2O
1 record matched CH3C(O)OC2H5 + ·OH → ·H2CC(O)OCH2CH3 + H2O
1 record matched HOCH2CHO + ·OH → HOCH(·)CHO + H2O
2 records matched CF3CHBrF + ·OH → CF3CFBr· + H2O
1 record matched CHClBr2 + ·OH → H2O + CClBr2
1 record matched (CH3)2NH + ·OH → H2O + CH3CHNH2
2 records matched (CH3)2NH + ·OH → H2O + (CH3)2N
1 record matched (CH3)2NH + ·OH → Other Products + H2O
2 records matched nonanal + ·OH → Other Products + H2O
1 record matched nonanal + ·OH → CH3(CH2)7CO + H2O
4 records matched 1-C10H22 + ·OH → Other Products + H2O
1 record matched 1-C10H22 + ·OH → Products + H2O
2 records matched 1-C10H22 + ·OH → C10H21(·) + H2O
6 records matched CH3COO(CH2)3CH3 + ·OH → Other Products + H2O
1 record matched CH3COCH2COCH3 → Other Products + H2O
1 record matched 3-methyl-1-butanol + ·OH → Other Products + H2O
2 records matched C2H5CHO + ·OH → H2O + CH3CH2CO
1 record matched C2H5CHO + ·OH → Other Products + H2O
1 record matched 1,2-Dihydroxybenzene → 2,4-Cyclopentadien-1-ylidene methanone + H2O
2 records matched iso-C4H8 + ·OH → H2O + ·CH2C(CH3)=CH2
1 record matched iso-C4H8 + ·OH → (CH3)2C=CH· + H2O
15 records matched (CH3)2O + ·OH → H2O + CH3OCH2·
2 records matched CH3CH=CH2 + ·OH → CH3CH=C(·)H + H2O
4 records matched CH3CH=CH2 + ·OH → ·CH2CH=CH2 + H2O
3 records matched CH3(CH2)10CH3 + ·OH → Other Products + H2O
1 record matched 1-Octanol + ·OH → Other Products + H2O
7 records matched n-C9H20 + ·OH → Other Products + H2O
1 record matched n-C9H20 + ·OH → Products + H2O
1 record matched n-C7H15OH + ·OH → Other Products + H2O
1 record matched n-C8H18 + ·OH → H2O + 3-C8H17
1 record matched n-C8H18 + ·OH → H2O + 4-C8H17
1 record matched n-C8H18 + ·OH → 1-C8H17 + H2O
1 record matched n-C8H18 + ·OH → 2-C8H17 + H2O
5 records matched n-C8H18 + ·OH → Other Products + H2O
1 record matched n-C8H18 + ·OH → Products + H2O
1 record matched n-C8H18 + ·OH → C8H17 + H2O
1 record matched (n-C3H7)2S + ·OH → Products + H2O
12 records matched (n-C3H7)2O + ·OH → Other Products + H2O
1 record matched n-C6H13OH + ·OH → Other Products + H2O
2 records matched Hexane, 1-bromo- + ·OH → Other Products + H2O
1 record matched 1,3,5-Trioxane + ·OH → H2O + 1,3,5-Trioxan-2-yl
22 records matched Cyclohexane + ·OH → Cyclohexyl + H2O
17 records matched 1-C6H14 + ·OH → Other Products + H2O
2 records matched n-C5H11Br + ·OH → Other Products + H2O
3 records matched isobutyl acetate + ·OH → Other Products + H2O
1 record matched (C2H5)2NH + O· → (E)-CH3CH=NC2H5 + H2O
4 records matched CH3OCH2OCH3 + ·OH → Other Products + H2O
1 record matched HOCH2CH2CN → CH2CHCN + H2O
3 records matched n-C4H9Cl + ·OH → Other Products + H2O
1 record matched n-C5H12 + ·OH → H2O + (CH3CH2)2CH
1 record matched n-C5H12 + ·OH → 1-C5H11 + H2O
1 record matched n-C5H12 + ·OH → CH3CH2CH2CH(·)CH3 + H2O
14 records matched n-C5H12 + ·OH → Other Products + H2O
2 records matched n-C4H9Br + ·OH → Other Products + H2O
8 records matched CH3COOCH2CH2CH3 + ·OH → Other Products + H2O
3 records matched Phenol + ·OH → C6H5O + H2O
1 record matched Chlorobenzene + ·OH → Other Products + H2O
7 records matched Toluene + ·OH → Benzyl + H2O
2 records matched 1,3,5-Trimethylbenzene + ·OH → H2O + 3,5-dimethylbenzyl radical
2 records matched 1,3-Dimethylbenzene + ·OH → 3-Methylbenzyl + H2O
5 records matched CH3COOCH(CH3)2 + ·OH → Other Products + H2O
5 records matched (iso-C3H7)2O + ·OH → Other Products + H2O
3 records matched Pentane, 2,4-dimethyl- + ·OH → Other Products + H2O
1 record matched (CH3)2NCH2CH2OH + ·OH → Other Products + H2O
7 records matched (CH3)2CH(CH2)2CH3 + ·OH → Other Products + H2O
2 records matched ((CH3)3Si)2O + ·OH → Other Products + H2O
1 record matched HC(O)OOH → CO2 + H2O
1 record matched HC(O)OCH3 + ·OH → CH3OCO + H2O
1 record matched CH3CH=NOH (unspecified) + ·OH → Other Products + H2O
1 record matched C2H5CN + ·OH → H2O + N=C-CH2CH2
6 records matched CH2ClCH2Cl + ·OH → H2O + CH2ClCHCl·
1 record matched CH2=CHCHO + ·OH → H2O + CH2=CHC(·)O
1 record matched CH2=CHCHO + ·OH → Other Products + H2O
1 record matched 1-C4H8 + ·OH → H2O + CH2=CHCH(·)CH3
3 records matched 1-C4H10 + ·OH → 1-C4H9 + H2O
3 records matched 1-C4H10 + ·OH → sec-C4H9 + H2O
29 records matched 1-C4H10 + ·OH → Other Products + H2O
1 record matched n-C3H7Br + ·OH → H2O + CH3CH2CHBr(·)
1 record matched n-C3H7Br + ·OH → H2O + BrCH2CHCH3
1 record matched n-C3H7Br + ·OH → H2O + CH2BrCH2CH2(·)
4 records matched n-C3H7Br + ·OH → Other Products + H2O
1 record matched n-C3H7Br + ·OH → C3H6Br + H2O
5 records matched CH2BrCH2Br + ·OH → Other Products + H2O
3 records matched 1,4-Dimethylbenzene + ·OH → 4-Methylbenzyl + H2O
3 records matched n-C3H7C(O)OC2H5 + ·OH → Other Products + H2O
1 record matched 2-methyl-1-phenyl-2-propanol → Other Products + H2O
1 record matched Methoxybenzene + ·OH → H2O + C6H5OCH2
1 record matched Benzonitrile + ·OH → Other Products + H2O
2 records matched γ-Terpinene + ·OH → Other Products + H2O
1 record matched γ-Terpinene + ·OH → γ-Terpenenyl (radical on the ring) + H2O
1 record matched Trifluoromethylbenzene + ·OH → Other Products + H2O
1 record matched CH2=CHC(O)OCH3 + ·OH → Other Products + H2O
1 record matched (C2H5)2CO + ·OH → CH3CH2C(O)CH(·)CH3 + H2O
5 records matched (C2H5)2CHCH3 + ·OH → Other Products + H2O
1 record matched 2-Methylphenol + ·OH → Other Products + H2O
2 records matched 1,2-Dimethylbenzene + ·OH → 2-Methylbenzyl + H2O
1 record matched Benzene,1-methyl-2-nitro- → Anthranil + H2O
3 records matched Hexamethylbenzene + ·OH → pentamethylbenzyl radical + H2O
1 record matched Methyl methacrylate + ·OH → Other Products + H2O
3 records matched (CHCl2)2 + ·OH → H2O + CHCl2C(·)Cl2
1 record matched (CH3)2CHCH(CH3)2 + ·OH → H2O + (CH3)2CHC(·)(CH3)2
13 records matched (CH3)2CHCH(CH3)2 + ·OH → Other Products + H2O
1 record matched HOCH2COOH → CH2O + CO + H2O
1 record matched C2H5COOH → CH3CH=C=O + H2O
5 records matched C2HCl3 + ·OH → H2O + CCl2=CCl
3 records matched CHCl2CH2Cl + ·OH → Other Products + H2O
2 records matched CH3C(O)CHO + ·OH → CH3C(O)C(O)· + H2O
1 record matched C2H5COCH3 + ·OH → H2O + CH3C(O)CH(·)CH3
1 record matched sec-C4H9OH + ·OH → H2O + CH3CH2CH(CH3)O·
1 record matched sec-C4H9OH + ·OH → CH3CH2C(·)(OH)CH3 + H2O
1 record matched sec-C4H9OH + ·OH → CH3CH(·)CH(OH)CH3 + H2O
1 record matched sec-C4H9OH → (E)-2-C4H8 + H2O
1 record matched sec-C4H9OH → (Z)-2-C4H8 + H2O
1 record matched sec-C4H9OH → 1-C4H8 + H2O
1 record matched sec-C4H9OH → Other Products + H2O
1 record matched sec-C4H9Cl + ·OH → Other Products + H2O
1 record matched Methacrolein + ·OH → Other Products + H2O
2 records matched Methacrolein + ·OH → CH2=C(CH3)CO + H2O
1 record matched (CH3)2CHCHO + ·OH → H2O + (CH3)2CCHO
8 records matched (CH3)2CHCHO + ·OH → Other Products + H2O
1 record matched iso-C4H9OH + ·OH → H2O + (CH3)2CHCH2
1 record matched iso-C4H9OH + ·OH → (CH3)2C(·)CH2OH + H2O
1 record matched iso-C4H9OH + ·OH → ·CH2CH(CH3)CH2OH + H2O
1 record matched iso-C4H9OH + ·OH → (CH3)2CHC(·)HOH + H2O
1 record matched iso-C4H9OH → iso-C4H8 + H2O
1 record matched iso-C5H12 + ·OH → ·CH2CH(CH3)CH2CH3 + H2O
1 record matched iso-C5H12 + ·OH → (CH3)2C(·)CH2CH3 + H2O
1 record matched iso-C5H12 + ·OH → (CH3)2CHCH(·)CH3 + H2O
1 record matched iso-C5H12 + ·OH → (CH3)2CHCH2CH2· + H2O
6 records matched iso-C5H12 + ·OH → Other Products + H2O
3 records matched CF3COOH + ·OH → H2O + CF3C(O)O
1 record matched CHCl2CCl3 + ·OH → C2Cl5 + H2O
2 records matched CF3CHO + ·OH → CF3C(O) + H2O
6 records matched CF3CH2Cl + ·OH → H2O + CF3CHCl
7 records matched CCl3CHO + ·OH → Other Products + H2O
2 records matched C2H5C(CH3)2OH → Other Products + H2O
1 record matched (CH3)3CCH2OH + ·OH → H2O + (CH3)3CCH(·)OH
4 records matched (CH3)3CCH2CH3 + ·OH → Other Products + H2O
2 records matched (CH3)4Si + ·OH → H2O + (CH3)3SiCH2
12 records matched CH3CF2Cl + ·OH → CF2ClCH2· + H2O
2 records matched tert-C4H9OH + H· → tert-C4H9 + H2O
1 record matched tert-C4H9OH + ·OH → (CH3)2C(OH)CH2· + H2O
1 record matched tert-C4H9OH + ·OH → (CH3)3CO· + H2O
7 records matched tert-C4H9OH + ·OH → Other Products + H2O
11 records matched tert-C4H9OH → iso-C4H8 + H2O
2 records matched Methyloxirane + ·OH → Other Products + H2O
1 record matched (CH3)3N + ·OH → H2O + (CH3)2CNH2
12 records matched CHF3 + ·OH → ·CF3 + H2O
15 records matched CHF2Cl + ·OH → ·CClF2 + H2O
1 record matched COCl2 + H2O → Other Products + CO2
11 records matched CHFCl2 + ·OH → ·CCl2F + H2O
10 records matched CH3CHF2 + ·OH → Other Products + H2O
2 records matched CH3COCl + ·OH → H2O + CH2C(O)Cl
2 records matched CH3CHCl2 + ·OH → Other Products + H2O
3 records matched iso-C3H7Cl + ·OH → Other Products + H2O
3 records matched iso-C4H10 + ·OH → iso-C4H9 + H2O
6 records matched iso-C4H10 + ·OH → tert-C4H9 + H2O
23 records matched iso-C4H10 + ·OH → Other Products + H2O
1 record matched CHBrCl2 + ·OH → H2O + BrCCl2
3 records matched iso-C3H7Br + ·OH → Other Products + H2O
1 record matched iso-C3H7Br + ·OH → C3H6Br + H2O
4 records matched CHBr3 + ·OH → CBr3 + H2O
1 record matched Oxirane + H· → C2H3 + H2O
3 records matched Oxirane + ·OH → H2O + Oxiranyl
7 records matched Cyclopropane + ·OH → Cyclopropyl + H2O
16 records matched (CH3)2S + ·OH → H2O + CH3SCH2
1 record matched CH2=NOH + ·OH → Other Products + H2O
2 records matched CH2=NOH → HCN + H2O
1 record matched HN=C=O + ·OH → H2O + NCO
10 records matched CH2F2 + ·OH → ·CHF2 + H2O
14 records matched CH2Cl2 + ·OH → CHCl2 + H2O
1 record matched CH3CHO + ·OH → CH2=CHO· + H2O
1 record matched CH3CHO + ·OH → *CH2C(O)H + H2O
4 records matched CH3CHO + ·OH → CH3CO + H2O
2 records matched CH3CHO + ·OH → Other Products + H2O
1 record matched CH3CN + ·OH → CH2CN + H2O
1 record matched C2H5NH2 + ·OH → H2O + CH3CHNH2
5 records matched C2H5Cl + ·OH → Other Products + H2O
1 record matched C2H5Cl + ·OH → C2H4Cl + H2O
3 records matched C3H8 + ·OH → 1-C3H7 + H2O
5 records matched C3H8 + ·OH → iso-C3H7 + H2O
42 records matched C3H8 + ·OH → Other Products + H2O
3 records matched CH2ClBr + ·OH → H2O + ·CHBrCl
4 records matched C2H5Br + ·OH → Other Products + H2O
1 record matched C2H5Br + ·OH → C2H4Br + H2O
5 records matched CH2Br2 + ·OH → H2O + CHBr2
1 record matched CH3SH + ·OH → H2O + ·CH2SH
1 record matched CH3SH + ·OH → Other Products + H2O
2 records matched HCN + ·OH → CN + H2O
1 record matched CH3NH2 + ·OH → H2O + CH3NH
1 record matched CH3NH2 + ·OH → H2O + CH2NH2
1 record matched CH3NH2 + ·OH → Other Products + H2O
1 record matched CH3I + ·OH → H2O + ·CH2I
14 records matched CH3Cl + ·OH → ·CH2Cl + H2O
4 records matched C2H2 + ·OH → ·C2H + H2O
1 record matched C2H4 + H2O → Products
15 records matched C2H4 + ·OH → C2H3 + H2O
53 records matched C2H6 + ·OH → ·C2H5 + H2O
14 records matched CH3Br + ·OH → H2O + ·CH2Br
62 records matched CH4 + ·OH → ·CH3 + H2O
19 records matched CH3CCl3 + ·OH → H2O + CCl3CH2
6 records matched Benzene + ·OH → Phenyl + H2O
1 record matched n-C5H11OH + ·OH → Other Products + H2O
1 record matched n-C4H9OH + ·OH → H2O + CH3CH2CH2C(·)HOH
1 record matched n-C4H9OH + ·OH → H2O + CH3CH2CH2CH2
2 records matched n-C4H9OH + ·OH → Other Products + H2O
1 record matched n-C4H9OH + ·OH → CH3CH2CH(·)CH2OH + H2O
1 record matched n-C4H9OH + ·OH → CH3CH(·)CH2CH2OH + H2O
1 record matched n-C4H9OH + ·OH → CH3CH2CH2CH(·)OH + H2O
1 record matched n-C4H9OH + ·OH → (·)CH2CH2CH2CH2OH + H2O
1 record matched n-C4H9OH → 1-C4H8 + H2O
2 records matched n-C3H7OH + ·Cl → CH3CH(·)CH2OH + H2O
2 records matched n-C3H7OH + ·Cl → HOCH2CH2CH2· + H2O
2 records matched n-C3H7OH + ·Cl → C2H5CH(·)OH + H2O
4 records matched n-C3H7OH + ·OH → Other Products + H2O
10 records matched CHCl3 + ·OH → ·CCl3 + H2O
11 records matched Acetone + ·OH → CH3C(O)CH2(·) + H2O
7 records matched iso-C3H7OH + ·OH → Other Products + H2O
3 records matched iso-C3H7OH → CH3CH=CH2 + H2O
1 record matched CH3OH + Kr → CH2(1) + Kr + H2O
7 records matched CH3OH + ·OH → (·)CH2OH + H2O
4 records matched CH3OH + ·OH → CH3O· + H2O
14 records matched CH3OH + ·OH → Other Products + H2O
1 record matched CH3OH → H2O + ·CH2
1 record matched CH3OH → CH2(1) + H2O
1 record matched CH3C(O)OH + ·OH → CO2 + ·CH3 + H2O
3 records matched CH3C(O)OH + ·OH → Other Products + H2O
8 records matched CH3C(O)OH → H2C=C=O + H2O
9 records matched HCOOH → CO + H2O
1 record matched C2H5OH + H· → ·C2H5 + H2O
4 records matched C2H5OH + ·OH → HOCH2CH2· + H2O
4 records matched C2H5OH + ·OH → CH3CH(·)OH + H2O
3 records matched C2H5OH + ·OH → CH3CH2O· + H2O
13 records matched C2H5OH + ·OH → Other Products + H2O
6 records matched C2H5OH → C2H4 + H2O
11 records matched (C2H5)2O + ·OH → Other Products + H2O
1 record matched 2-Phenylethanol → Styrene + H2O
3 records matched CN + H2O → HCN + ·OH
1 record matched Propanoic acid, 2-hydroxy- → CH3CHO + CO + H2O
24 records matched CH2O + ·OH → HCO + H2O
1 record matched OD(v=1) + H2O → Products
1 record matched O(1D) + H2O → H2O + O·
21 records matched O(1D) + H2O → ·OH + ·OH
1 record matched O(1D) + H2O → H2 + O2
9 records matched O(1D) + H2O → Products
3 records matched O2(1DELTA) + H2O → H2O + O2
1 record matched CH3(CH2)11CHOO + H2O → Products
2 records matched (CH3)2CHOCH2C(CH3)2ONO2 + ·OH → Other Products + H2O
2 records matched CH3C(O)OCH2C(OH)(CH3)2 + ·OH → Other Products + H2O
1 record matched HO2-H2O Complex + NO → HNO3 + H2O
1 record matched OH-toluene adduct + H2O → Products
1 record matched OD(v=2) + H2O → Products
1 record matched OH(v=1) + H2O → Products
1 record matched CCl2 (a 3B1) + H2O → CCl2 (X 1A1) + H2O
1 record matched CCl2 (A 1B1) + H2O → CCl2 (X 1A1) + H2O
1 record matched CH3CH2CH2CHO → 1-butyne + H2O
2 records matched HO3-H2O → HO3 + H2O
1 record matched M + HCOOH → M + CO + H2O
1 record matched N(2S) + H2O → Products
1 record matched O(3P) + C3H8 → CH3CH=CH2 + H2O
1 record matched O(3P) + C2H6 → C2H4 + H2O
1 record matched O(1D) + H2O → Products
2 records matched O(1D) + H2O → O(3P) + H2O
1 record matched O(1D) + H2O → O(3P) + Other Products
1 record matched O(1S) + H2O → Products
1 record matched O2(1Delta_g) + H2O → O2(X3Sigma_g-) + H2O
1 record matched C15H12N2O2 → 3-benzoylcinnoline + H2O
1 record matched C15H11ClN2O2 → 3-(4-chlorobenzoyl)cinnoline + H2O
1 record matched C16H14N2O2 → 3-(4-methylbenzoyl)cinnoline + H2O
1 record matched C16H14N2O3 → 3-(4-methoxybenzoyl)cinnoline + H2O
1 record matched C19H14N2O3 → 3-(2-furylbenzoyl)cinnoline + H2O
1 record matched C19H14N2O2S → 3-(2-thienylbenzoyl)cinnoline + H2O
1 record matched C16H14N2O3 → 3-benzoyl-6-methoxycinnoline + H2O
1 record matched C15H11N3O4 → 3-benzoyl-6-nitrocinnoline + H2O
1 record matched C15H11ClN2O2 → 3-benzoyl-6-chlorocinnoline + H2O
1 record matched C16H14N2O3 → 3-benzoyl-7-methoxycinnoline + H2O
1 record matched C15H11ClN2O2 → 3-benzoyl-7-chlorocinnoline + H2O
1 record matched (H2O)2 + CH2OO → H2O + HOCH2OOH
1 record matched (H2O)2 + CH2OO → HCOOH + H2O + H2O
1 record matched (H2O)2 + CH2OO → CH2O + H2O2 + H2O
1 record matched CF3CF2CH2OCH3 + ·OH → C2F5CH(·)OCH3 + H2O
1 record matched CF3CF2CH2OCH3 + ·OH → C2F5CH2OCH2· + H2O
1 record matched CD3CD2CD2Br + ·OH → CD2CD2CD2Br + H2O
1 record matched CD3CD2CD2Br + ·OH → CD3CDCD2Br + H2O
1 record matched CD3CD2CD2Br + ·OH → CD3CD2CDBr + H2O
2 records matched C4F9CH2C(OO)HOH → CF3CF2CF2CF2CH2CHO + H2O
1 record matched HOCH2C(CH3)(OOH)CH=CH2 + ·OH → HOCH2C(CH3)(OO·)CH=CH2 + H2O
1 record matched HOCH2CH(OOH)C(CH3)=CH2 + ·OH → HOCH2CH(OO·)C(CH3)=CH2 + H2O
2 records matched alpha-pinene-derived Criegee intermedate + H2O → Products
1 record matched 3SO2 + H2O → HOSO + ·OH
1 record matched H2O(|04>-) + H2O → H2O(ν_OH<4) + H2O
3 records matched OH(X2Π) + OH(X2Π) → O(3P) + H2O
2 records matched H2O-HOCO + M → HOCO + M + H2O
1 record matched anti-CH3CH(·)OO· + H2O → Products
1 record matched O2(b1Sigma_g+) + H2O → Products
2 records matched SiH2(H2O) Adduct → H2O + SiH2
1 record matched NH2(OH)O → H2O + HNO
1 record matched CH2ClOOH → HC(O)Cl + H2O
1 record matched CH3SO3 → ·CH=SO2 + H2O
1 record matched SiCl3OH + SiCl3OH → H2O + SiCl3OSiCl3
1 record matched CH2=CHOOH → Oxirene + H2O
1 record matched HSi(O)OH → H2O + SiO
1 record matched CH2=C(OH)CH3 → CH2=C=CH2 + H2O
1 record matched CH2=C(OH)CH3 → CH3CCH + H2O
1 record matched Strontium hydroxide → SrO + H2O
1 record matched Ba(OH)2 → BaO + H2O
1 record matched HC-N=O + ·OH → H2O + NCO
1 record matched HNO + HNO → H2O + N2O
1 record matched NH2 + ClO → H2O + NCl
4 records matched H· + HOPO2 → H2O + PO2
1 record matched H· + Strontium hydroxide → H2O + SrOH
1 record matched H· + Ba(OH)2 → H2O + BaOH
2 records matched H· + HOPO → H2O + PO
2 records matched NO2 + NH2 → H2O + N2O
2 records matched NO + CH3NH → CH2N2 + H2O
1 record matched NO + NH2 → N2 + H2O
1 record matched HBr + HOBr → Br2 + H2O
1 record matched NH2OH + NH2OH + NH2OH → NH2NH2O + NH3O + H2O
1 record matched NH2OH + NH2OH → H2O + H2O + (E)-HN=NH
1 record matched NH2OH + NH2OH → NH3 + H2O + HNO
1 record matched HOCl + HNO → H2O + NO + ·Cl
1 record matched HOCl + HOCl → H2O + ClClO
1 record matched HOCl + HOCl → H2O + Cl2O
1 record matched H2S + S2O → H2O + S3
3 records matched H2S + O3 → SO2 + H2O
1 record matched HNO2 + H· → H2O + NO
1 record matched HOIO2 + HOIO2 → H2O + I2O5
2 records matched O2 + ·CH2 → CO + H2O
1 record matched O2 + Cyclohexadienyl, 6-hydroxy- → Phenol + H2O
1 record matched H2O + CH2=C(CH3)-CH(OH)(OOH) → CH2=C(CH3)COOH + H2O + H2O
1 record matched H2O + CH2=C(CH3)-CH(OH)(OOH) → Methacrolein + H2O2 + H2O
1 record matched H2O + CH2=C(CH3)-CH(OH)(OOH) → Other Products + H2O
1 record matched H2O + CH2=CH-C(OH)(OOH)-CH3 → CH2=CHCOCH3 + H2O2 + H2O
1 record matched H2O + CH2=CH-C(OH)(OOH)-CH3 → Other Products + H2O
1 record matched H2O + NH2(OH)O → H2O + H2O + HNO
1 record matched H2O + (CH3)2C(·)OO· → Other Products + ·OH
1 record matched H2O + (CH3)2C(·)OO· → Products
1 record matched H2O + (CH3)2C(·)OO· → (CH3)2C(OH)OOH
1 record matched H2O + CF2(OH)2 → HF + H2O + FC(O)OH
1 record matched H2O + SiCl3OH → SiCl2(OH)2 + HCl
1 record matched H2O + CH3CH(·)OO· → Other Products + H2O
1 record matched H2O + CH3CH(·)OO· → Other Products + ·OH
1 record matched H2O + ·CH2 → CH3OH
4 records matched H2O + CH2OO → HOCH2OOH
1 record matched H2O + CH2OO → HCOOH + H2O
1 record matched H2O + CH2OO → CH2O + H2O2
3 records matched H2O + CH2OO → Products
1 record matched H2O + FC(O)OH → CO2 + HF + H2O
1 record matched H2O + ·Cl → ·OH + HCl
1 record matched H2O + C2F → ·F + c-H2COC
1 record matched H2O + C2F → ·F + HC≡COH
1 record matched H2O + C2F → HF + HCCO
2 records matched H2O + C2F → HCCF + ·OH
1 record matched H2O + C2F → CO + ·CH2F
1 record matched H2O + C2F → H2C=C=O + ·F
1 record matched H2O + C2F → Oxirene + ·F
3 records matched H2O + C2F → CHFCO + H·
1 record matched H2O + C2F → c-COCHF + H·
2 records matched H2O + CF3O → CF3OH + ·OH
1 record matched H2O + 5-Methylene 1,3-cyclohexadiene → Toluene + H2O
1 record matched H2O + O· → H2O + O·
4 records matched H2O + O· → ·OH + ·OH
2 records matched H2O + O· → HO2 + H·
1 record matched H2O + O· → H2 + O2
1 record matched H2O + ONONO2 → cis-HONO + HNO3
1 record matched H2O + ONONO2 → trans-HONO + HNO3
1 record matched H2O + ONONO2 → t-ONONO2-H2O complex
1 record matched H2O + ONONO2 → HONO (unspecified cis/trans isomer) + HNO3
1 record matched H2O + HSS(O)OH → H2O + H2O + S2O
1 record matched H2O + ClO → Products
2 records matched H2O + ·F → ·OH + HF
1 record matched H2O + IO → ·OH + HIO
1 record matched H2O + ClONO2 → HNO3 + HOCl
1 record matched H2O + I → ·OH + HI
1 record matched H2O + NH → ·OH + NH2
1 record matched H2O + BH3NH3 → H2 + H2O + BH2NH2
1 record matched H2O + NH2 → ·OH + NH3
1 record matched H2O + OD → ·OH + HDO
1 record matched H2O + ·CHF → CH2FOH
1 record matched H2O + KO → KOH + ·OH
4 records matched H2O + H· → H2 + ·OH
1 record matched H2O + C2O → ·OH + HCCO
1 record matched H2O + C2 → c-H2COC
1 record matched H2O + C2 → HC≡COH
1 record matched H2O + C2 → H· + c-HCOC(·)
1 record matched H2O + C2 → H· + (·)C#COH
1 record matched H2O + C2 → ·C2H + ·OH
1 record matched H2O + C2 → H2 + c-COC
1 record matched H2O + C2 → H2 + C2O
1 record matched H2O + C2 → CO + ·CH2
1 record matched H2O + C2 → H2C=C=O
1 record matched H2O + C2 → Oxirene
1 record matched H2O + C2 → CCOH2
1 record matched H2O + I2O5 → HOIO2 + HOIO2
1 record matched H2O + N2O4 → trans-HONO + HNO3
1 record matched H2O + NO2 + NH2 → H2NONO + H2O
1 record matched H2O + NO2 + NO2 → cis-HONO + HNO3
1 record matched H2O + NO2 + NO2 → trans-HONO + HNO3
1 record matched H2O + NO2 + NO2 → HONO (unspecified cis/trans isomer) + HNO3
2 records matched H2O + N2O5 → HNO3 + HNO3
1 record matched H2O + HBr + HOBr → Br2 + H2O + H2O
1 record matched H2O + SiCl4 → HCl + SiCl3OH
1 record matched H2O + SiH4 → H2 + SiH3OH
1 record matched H2O + SiH4 → Products
1 record matched H2O + NH2OH + NH2OH → NH2NH2O + H2O + H2O
1 record matched H2O + Cl2O → HOCl + HOCl
1 record matched H2O + SiF4 → HF + SiF3OH
1 record matched H2O + H2S + CH2OO → CH2S + H2O2 + H2O
1 record matched H2O + O2 + HOSO2 → HO2 + H2SO4
1 record matched H2O + O2 → HO2 + ·OH
1 record matched H2O + H2O + ·CHF → CH2FOH + H2O
1 record matched H2O + H2O + NO2 + NH2 → H2NONO + H2O + H2O
1 record matched H2O + H2O + SiCl4 → HCl + H2O + SiCl3OH
1 record matched H2O + H2O + H2O + SiCl4 → HCl + H2O + H2O + SiCl3OH
1 record matched H2O → ·OH + H·
1 record matched H2O2 + HNO → H2O + HNO2
9 records matched H2O2 + H· → ·OH + H2O
1 record matched SiO(OH)2 + H2O → Si(OH)4
1 record matched HNO3 + CH2OO → ·OC(O)H + H2O + NO2
1 record matched HNO3 + HOCl → H2O + ClONO2
1 record matched HNO3 + HNO3 → H2O + N2O5
1 record matched NH3 + NH2(OH)O → NH3 + H2O + HNO
2 records matched NH3 + HNO3 → H2O + NH2NO2
1 record matched NH3 + HNO3 → H2NONO + H2O
1 record matched HF + BHO2 → H2O + OBF
1 record matched HCl + HOBr → H2O + BrCl
1 record matched HCl + H2O + ClONO2 → HNO3 + H2O + Cl2
1 record matched HCl + H2O + HOBr → H2O + H2O + BrCl
1 record matched SiO2 + H2O + H2O → Si(OH)4
1 record matched SiO2 + H2O → SiO(OH)2
1 record matched SO3 + H2O → H2SO4
1 record matched SO2 + H2S → H2O + S2O
1 record matched C + H2O → ·CH + ·OH
1 record matched C + H2O → Products
1 record matched B + H2O → BOH + H·
1 record matched B + H2O → trans-HBOH
1 record matched Ba + H2O → BaOH + H·
1 record matched K + H2O → KOH + H·
1 record matched Li + H2O → LiOH + H·
1 record matched Fe + H2O → Products
1 record matched Al + H2O → HAlOH
1 record matched Al + H2O → H· + AlOH
1 record matched Al + H2O → H2 + AlO
1 record matched ·CH2Cl + NO2 → H2O + ClNCO
1 record matched ·CH2Cl + NO2 → ClCNO + H2O
1 record matched CH2=CHCH2OOH → CH2=CHCHO + H2O
1 record matched n-C3H7CH(OH)CH3 → CH3CH=CHC2H5 + H2O
1 record matched n-C3H7CH(OH)CH3 → 1-C5H10 + H2O
1 record matched (Z)-CH3CH=NOH + NO → CH3CN + H2O + NO
1 record matched CH(O)NO + H2O → O=CHN(OH)2
2 records matched 2,4-Cyclopentadien-1-ylidene methanone + H2O → 1,2-Dihydroxybenzene
1 record matched CH3CH + H2O → C2H5OH
1 record matched CH2DOH + H· → H2O + CH2D
1 record matched H2C=N(O)OH → H2O + HC-N=O
1 record matched ·CH2F + NO2 → FNCO + H2O
1 record matched ·CH2F + NO2 → FOCN + H2O
1 record matched ·CH2F + NO2 → FCNO + H2O
2 records matched ·OH + HCF2OCF2CF2OCF2H → CHF2OCF2CF2OCF2 + H2O
1 record matched ·OH + CH3OC4F9 → CH2OC4F9 + H2O
1 record matched ·OH + 1,3-Cyclopentadiene, 5-ethynyl- → fulvallenyl + H2O
2 records matched ·OH + CF3CF2CH2CH2F → Other Products + H2O
1 record matched ·OH + 1,1-diamino-2,2-dinitroethene → cis-(·)NHC(NH2)=C(NO2)2 + H2O
1 record matched ·OH + 1,1-diamino-2,2-dinitroethene → trans-(·)NHC(NH2)=C(NO2)2 + H2O
2 records matched ·OH + CF3CHFCHFCF2CF3 → Other Products + H2O
1 record matched ·OH + HN(CN)OH → H2O + ·N(CN)OH
2 records matched ·OH + CF3CH2CF2CH2CF3 → CF3CH2CF2CH(.)CF3 + H2O
2 records matched ·OH + CF3CF2CH2CH2CF2CF3 → CF3CF2CH2CH(.)CF2CF3 + H2O
1 record matched ·OH + cis-2,cis-5-heptadiene → CH3CH=CHCH(·)CH=CHCH3 + H2O
1 record matched ·OH + cis-2,cis-5-heptadiene → (5Z)(·)CH2CH=CHCH2CH=CHCH3 + H2O
1 record matched ·OH + CF3CHFCF2OCH2CF2CHF2 → Other Products + H2O
1 record matched ·OH + HSSH → H2O + HSS
1 record matched ·OH + CCl2FCHO → CFCl2C(O)(.) + H2O
1 record matched ·OH + (Z)-CH3CH=CHOH → H2O + CH(OH)CH=CH2
1 record matched ·OH + (Z)-CH3CH=CHOH → CH3CHC-O-H + H2O
1 record matched ·OH + (Z)-CH3CH=CHOH → CH3C(·)=CHOH + H2O
1 record matched ·OH + (Z)-CH3CH=CHOH → 2-methylvinoxy radical + H2O
1 record matched ·OH + (E)-CH3CH=CHOH → H2O + CH(OH)CH=CH2
1 record matched ·OH + (E)-CH3CH=CHOH → CH3CHC-O-H + H2O
1 record matched ·OH + (E)-CH3CH=CHOH → CH3C(·)=CHOH + H2O
1 record matched ·OH + (E)-CH3CH=CHOH → 2-methylvinoxy radical + H2O
1 record matched ·OH + CF3CHFOCHF2 → Other Products + H2O
1 record matched ·OH + CF3CHFOCHF2 → CF3C(·)FOCHF2 + H2O
1 record matched ·OH + CF3CHFOCHF2 → CF3CHFOC(·)F2 + H2O
1 record matched ·OH + CH2OO → H2O + HCOO
1 record matched ·OH + Methyl 2-methylbut-3-enoate → CH2=CHCH(CH3)C(O)OCH2· + H2O
1 record matched ·OH + Methyl 2-methylbut-3-enoate → CH2=CHC(·)(CH3)C(O)OCH3 + H2O
1 record matched ·OH + Methyl 2-methylbut-3-enoate → CH2=C(·)CH(CH3)C(O)OCH3 + H2O
1 record matched ·OH + Methyl 2-methylbut-3-enoate → ·CH=CHCH(CH3)C(O)OCH3 + H2O
1 record matched ·OH + Methyl 2-methylbut-3-enoate → CH2=CHCH(CH2·)C(O)OCH3 + H2O
1 record matched ·OH + HCCO → H2O + C2O
1 record matched ·OH + CHCl=CHAsCl2 → ·CCl=CHAsCl2 + H2O
1 record matched ·OH + CHCl=CHAsCl2 → CHCl=C(·)AsCl2 + H2O
1 record matched ·OH + (2E,5E)-2,5-Heptadiene → CH3CH=CHCH(·)CH=CHCH3 + H2O
1 record matched ·OH + (2E,5E)-2,5-Heptadiene → (5E)(·)CH2CH=CHCH2CH=CHCH3 + H2O
1 record matched ·OH + CH3OCH(OH)CH3 → Other Products + H2O
1 record matched ·OH + CH2=C(OH)CH3 → CH3C(O)CH2(·) + H2O
1 record matched ·OH + CH2=C(OH)CH3 → CH2=C(OH)-CH2· + H2O
1 record matched ·OH + CH2=C(OH)CH3 → ·CH=C(OH)CH3 + H2O
2 records matched ·OH + CH3CD2CD3 → CD3CD2CH2(.) + H2O
3 records matched ·OH + CH2FOCH(CF3)2 → Other Products + H2O
2 records matched ·OH + CH2FOCH(CF3)2 → (CF3)2CHOCHF· + H2O
2 records matched ·OH + CH2FOCH(CF3)2 → (CF3)2C(·)OCH2F + H2O
1 record matched ·OH + 1,3-Cyclopentadiene, 5-ethenylidene- → fulvallenyl + H2O
1 record matched ·OH + CHF2OCHClCF3 → Other Products + H2O
1 record matched ·OH + CHF2OCHClCF3 → CF3C(·)ClOCHF2 + H2O
1 record matched ·OH + CHF2OCHClCF3 → CF3CHClOC(·)F2 + H2O
2 records matched ·OH + CH3CCl2F → ·CH2CCl2F + H2O
1 record matched ·OH + Bicyclo[3.1.1]heptan-2-one, 6,6-dimethyl- → 1-nopinonyl + H2O
1 record matched ·OH + Bicyclo[3.1.1]heptan-2-one, 6,6-dimethyl- → 3-nopinonyl + H2O
1 record matched ·OH + Bicyclo[3.1.1]heptan-2-one, 6,6-dimethyl- → 4-nopinonyl + H2O
1 record matched ·OH + Bicyclo[3.1.1]heptan-2-one, 6,6-dimethyl- → 5-nopinonyl + H2O
1 record matched ·OH + Bicyclo[3.1.1]heptan-2-one, 6,6-dimethyl- → 7-nopinonyl + H2O
1 record matched ·OH + Bicyclo[3.1.1]heptan-2-one, 6,6-dimethyl- → 8-nopinonyl + H2O
1 record matched ·OH + Bicyclo[3.1.1]heptan-2-one, 6,6-dimethyl- → 9-nopinonyl + H2O
1 record matched ·OH + Bicyclo[3.1.1]heptan-2-one, 6,6-dimethyl- → nopinonyl + H2O
3 records matched ·OH + CHF2CHFCHF2 → Other Products + H2O
1 record matched ·OH + CHF2CHFCHF2 → ·CF2CHFCHF2 + H2O
1 record matched ·OH + CHF2CHFCHF2 → CHF2C(·)FCHF2 + H2O
1 record matched ·OH + CH3S(O)OH → CH3S(O)2 + H2O
1 record matched ·OH + Acetaldehyde, bromo- → BrCH2C(O)(.) + H2O
1 record matched ·OH + Acetaldehyde, bromo- → ·CHBrCHO + H2O
1 record matched ·OH + Cyclopropanol → Other Products + H2O
1 record matched ·OH + Cyclopropanol → trans-cyclopropanol-2-yl radical + H2O
1 record matched ·OH + Cyclopropanol → cyclopropoxy radical + H2O
1 record matched ·OH + Cyclopropanol → cis-cyclopropanol-2-yl radical + H2O
1 record matched ·OH + 1,4-Oxathiane → 1-Oxa-4-thiacyclohex-2-yl radical + H2O
1 record matched ·OH + 2,3,4-Trichlorophenol → 2,3,4-trichlorophenoxy radical + H2O
1 record matched ·OH + HOCH2OOH → H2O + HOOCH2O
1 record matched ·OH + HOCH2OOH → H2O + HOCH2OO
1 record matched ·OH + HOCH2OOH → HOC(·)HOOH + H2O
2 records matched ·OH + nitrosoazetidine → nitrosoazetidin-2-yl + H2O
3 records matched ·OH + HNO → H2O + NO
1 record matched ·OH + HIO → H2O + IO
2 records matched ·OH + HOPO → H2O + PO2
1 record matched ·OH + HD → H2O + D
1 record matched ·OH + NHOH → H2O + HNO
1 record matched ·OH + NH → H2O + N
4 records matched ·OH + NH2 → H2O + NH
1 record matched ·OH + NH2 → (3)NH + H2O
3 records matched ·OH + NH2 → NH(a1Δ) + H2O
2 records matched ·OH + (E)-3-C6H12 → CH3CH=CHCH(·)CH2CH3 + H2O
1 record matched ·OH + (E)-3-C6H12 → trans-CH3CH3CH=CHCH2CH2· + H2O
1 record matched ·OH + (E)-3-C6H12 → trans-CH3CH3CH=C(·)CH2CH3 + H2O
1 record matched ·OH + (CF3)2CHOCH3 → Other Products + H2O
5 records matched ·OH + H· → H2O
1 record matched ·OH + ·NHC=N → NCN + H2O
1 record matched ·OH + ·NHC=N → NCN(singlet) + H2O
1 record matched ·OH + CH3CH2OCH2OH → Other Products + H2O
3 records matched ·OH + HBr → H2O + Br·
1 record matched ·OH + HI → H2O + I
1 record matched ·OH + SiH4 → H2O + SiH3
2 records matched ·OH + NH2OH → H2O + NHOH
1 record matched ·OH + NH2OH → H2O + NH2O
2 records matched ·OH + HOCl → H2O + ClO
1 record matched ·OH + AsH3 → H2O + AsH2·
4 records matched ·OH + H2S → H2O + SH
1 record matched ·OH + HN3 → H2O + ·N3
1 record matched ·OH + GeH4 → H2O + GeH3
5 records matched ·OH + H2O → ·OH + H2O
12 records matched ·OH + H2O2 → HO2 + H2O
2 records matched ·OH + HNO3 → H2O + NO3
2 records matched ·OH + H2SO4 → HOSO3 + H2O
9 records matched ·OH + NH3 → H2O + NH2
1 record matched ·OH + HF → H2O + ·F
1 record matched ·OH + HCl + H2O → H2O + H2O + ·Cl
1 record matched ·OH + HCl + NH3 → NH3 + H2O + ·Cl
10 records matched ·OH + HCl → H2O + ·Cl
2 records matched ·OH + HOClO3 → ClO4 + H2O
1 record matched ·OH + ·CH2Cl → ·CHCl + H2O
1 record matched ·OH + CH3NHC(O)OCH3 → CH3NHC(OH)(O·)OCH3 + H2O
2 records matched ·OH + CH3NHC(O)OCH3 → CH3N(·)C(O)OCH3 + H2O
2 records matched ·OH + CH3NHC(O)OCH3 → ·CH2NHC(O)OCH3 + H2O
2 records matched ·OH + CH3NHC(O)OCH3 → CH3NHC(O)OCH2· + H2O
1 record matched ·OH + CH3SSH → H2O + CH3SS
1 record matched ·OH + CH3SSH → ·CH2SSH + H2O
1 record matched ·OH + Chlordimeform → 1-(2-methyl-4-chlorophenyl)-3-methyl-3-methylenyl-formanidine radical + H2O
1 record matched ·OH + Chlordimeform → 1-(2-methyl-4-chlorophenyl)-3,3-dimethylformanidin-2-yl radical + H2O
1 record matched ·OH + Chlordimeform → 6-(3,3-dimethylformanidinyl)-3-chloro-5-methyl-phenyl radical + H2O
1 record matched ·OH + Chlordimeform → 5-(3,3-dimethylformanidinyl)-2-chloro-4-methyl-phenyl radical + H2O
1 record matched ·OH + Chlordimeform → 3-(3,3-dimethylformanidinyl)-6-chloro-2-methyl-phenyl radical + H2O
1 record matched ·OH + Propylhydroperoxide → CH3CH2C(·)HOOH + H2O
1 record matched ·OH + n-C3H7CH(OH)CH3 → CH3CH(OH)C(·)HCH2CH3 + H2O
1 record matched ·OH + C2H5CH(OH)C(O)C2H5 → Other Products + H2O
1 record matched ·OH + C2H5CH(OH)C(O)C2H5 → C2H5C(OH)(·)C(O)C2H5 + H2O
1 record matched ·OH + C2H5CH(OH)C(O)C2H5 → CH3CH2C(OH)C(O)CH2CH2· + H2O
1 record matched ·OH + C2H5CH(OH)C(O)C2H5 → CH3CH2C(OH)C(O)CH(·)CH3 + H2O
1 record matched ·OH + C2H5CH(OH)C(O)C2H5 → CH3CH(·)C(OH)C(O)CH2CH3 + H2O
1 record matched ·OH + C2H5CH(OH)C(O)C2H5 → ·CH2CH2C(OH)C(O)CH2CH3 + H2O
1 record matched ·OH + C2H5CH(OH)C(O)C2H5 → CH3CH2C(O)CH(O·)C2H5 + H2O
1 record matched ·OH + 2,3,4,5-Tetrachlorophenol → 2,3,4,5-tetrachlorophenoxy radical + H2O
1 record matched ·OH + CH3OCHCl2 → CH3OCCl2· + H2O
1 record matched ·OH + CH3OCHCl2 → ·CH2OCHCl2 + H2O
1 record matched ·OH + 1-C4H9OOH → CH3CH2CH2CH(·)OOH + H2O
1 record matched ·OH + (1-Methylbutyl)cyclopentane → (1-Methylbutyl)cyclopent-1-yl radical + H2O
1 record matched ·OH + (1-Methylbutyl)cyclopentane → 2-cyclopentyl-pent-2-yl radical + H2O
1 record matched ·OH + CH3OCH2OH → Other Products + H2O
1 record matched ·OH + 1-C6H13OOH → CH3CH2CH2CH2CH2C(·)HOOH + H2O
2 records matched ·OH + Pentafluorodimethyl ether → H2O + CF3OCF2(·)
1 record matched ·OH + n-Pentylcyclopentane → pentyl cyclopent-1-yl radical + H2O
1 record matched ·OH + Cyclopropane,(1-methylethyl)- → Products + H2O
1 record matched ·OH + Cyclopropane,(1-methylethyl)- → cy-CH2CH2C(·)-CH(CH3)2 + H2O
1 record matched ·OH + Cyclopropane,(1-methylethyl)- → cy-CH2CH(·)CH-CH(CH3)2 + H2O
1 record matched ·OH + Cyclopropane,(1-methylethyl)- → cy-CH2CH2CH-C(·)(CH3)2 + H2O
1 record matched ·OH + Cyclopropane,(1-methylethyl)- → cy-CH2CH2CH-CH(CH3)(CH2·) + H2O
1 record matched ·OH + HN=NH → H2O + HN=N
4 records matched ·OH + ·OH → H2O + O·
2 records matched ·CH + H2O → CH2O + H·
2 records matched ·CH + H2O → Products
1 record matched CH2=C(C6H5)CH2CH2OH → 2-Phenyl-1,3-butadiene + H2O
1 record matched HO2 + CH2ClO2 → HC(O)Cl + H2O + O2
6 records matched HO2 + H· → H2O + O·
2 records matched HO2 + H· → O(1D) + H2O
1 record matched HO2 + H2O + SH → H2O + O2 + H2S
1 record matched HO2 + H2O + NO → HNO3 + H2O
1 record matched HO2 + H2O + NO → ·OH + H2O + NO2
1 record matched HO2 + H2O → ·OH + H2O2
1 record matched HO2 + H2O2 → ·OH + H2O + O2
8 records matched HO2 + ·OH → H2O + O2
1 record matched HO2 + ·OH → O2(1DELTA) + H2O
1 record matched HO2 + HO2 → H2O + O3
1 record matched C2H5OO· + HO2 → CH3CHO + H2O + O2
1 record matched C2H5OO· → C2H4 + H2O
1 record matched DL-Asparagine + ·OH → H2O + NH2-C(O)-CH(·)CH(NH2)CO2H
1 record matched DL-Asparagine + ·OH → NH2-C(O)-CH2C(·)(NH2)CO2H + H2O
1 record matched NH2CH2OH → CH2=NH + H2O
1 record matched C6H5CH2OOH → Benzaldehyde + H2O
1 record matched C6H5CH2OOH → CH2O + Benzyne + H2O
1 record matched (CH3)2CHOOH + ·OH → (CH3)2CHO2 + H2O
1 record matched (CH3)2CHOOH + ·OH → Other Products + H2O
1 record matched (CH3)2CHOOH + ·OH → (CH3)2C(·)OOH + H2O
1 record matched (CH3)2CHOOH + ·OH → ·CH2CH(OOH)CH3 + H2O
1 record matched CH3CH2OOH + ·OH → C2H5OO· + H2O
1 record matched CH3CH2OOH + ·OH → (·)CH2CH2OOH + H2O
2 records matched CH3CH2OOH + ·OH → CH3C(·)HOOH + H2O
1 record matched CH3CH2OOH → CH3CHO + H2O
2 records matched CH3OOH + ·OH → H2O + CH2OOH
2 records matched CH3OOH + ·OH → CH3O2· + H2O
1 record matched CH3OOH + ·OH → CH2O + ·OH + H2O
1 record matched CH2CN + H2O → CH3CN + ·OH
2 records matched Cyclobutanol + ·OH → Other Products + H2O
1 record matched Cyclobutanol + ·OH → cyclobutanol-1-yl radical + H2O
1 record matched Cyclobutanol + ·OH → trans-cyclobutanol-2-yl radical + H2O
1 record matched Cyclobutanol + ·OH → cis-cyclobutanol-2-yl radical + H2O
1 record matched Cyclobutanol + ·OH → trans-cyclobutanol-3-yl radical + H2O
1 record matched Cyclobutanol + ·OH → cis-cyclobutanol-3-yl radical + H2O
1 record matched Cyclobutanol + ·OH → cyclobutoxy radical + H2O
2 records matched CH3CH2CD3 + ·OH → Other Products + H2O
1 record matched CH3CH2CD3 + ·OH → CD3CH(.)CH3 + H2O
1 record matched CD3CH2CD3 + ·OH → (CD3)2CH(.) + H2O
2 records matched CH3CD2CH3 + ·OH → H2O + CH3CD2CH2
3 records matched CF3CHFCl + ·OH → CF3CFCl· + H2O
1 record matched Cyclobutaneacetaldehyde, 3-acetyl-2,2-dimethyl- + ·OH → Other Products + H2O
1 record matched C2H3 + H2O → C2H4 + ·OH
2 records matched C2H3 + ·OH → CH2=C + H2O
2 records matched C2H3 + ·OH → C2H2 + H2O
1 record matched ·HCC≡N + H2O + H2O → HOCH2CN + H2O
1 record matched ·HCC≡N + H2O → HOCH2CN
2 records matched HCO + HNO2 → CO + H2O + NO
2 records matched HCO + ·OH → CO + H2O
1 record matched (·)CH2OH + NO2 → CH(O)NO + H2O
1 record matched (·)CH2OH + NO2 → HCO + H2O + NO
1 record matched (·)CH2OH + NO2 → HOCNO + H2O
1 record matched (·)CH2OH + NO2 → HONCO + H2O
2 records matched (·)CH2OH + H2O → CH3OH + ·OH
1 record matched (·)CH2OH + HO2 → HCOOH + H2O
1 record matched HC(O)Cl + ·OH → ClCO + H2O
1 record matched Phenyl + H2O → Benzene + ·OH
1 record matched CCl3CH2F + ·OH → ·CHF-CCl3 + H2O
1 record matched 1,2,2,2-tetrafluoroethyl trifluoromethyl ether + ·OH → H2O + CF3OCF2CF2·
2 records matched 1,2,2,2-tetrafluoroethyl trifluoromethyl ether + ·OH → CF3CF(.)OCF3 + H2O
2 records matched CH3CH(·)OH + H· → CH3CH + H2O
2 records matched CH3CH(·)OH + H· → C2H4 + H2O
1 record matched ·CF3 + H2O → CHF3 + ·OH
1 record matched CF3CH2CH2OH + ·OH → Other Products + H2O
1 record matched CF3CH2CH2OH + ·OH → CF3CH(·)CH2OH + H2O
1 record matched CF3CH2CH2OH + ·OH → CF3CH2CH(·)OH + H2O
1 record matched CF3CH2CH2OH + ·OH → CF3CH2CH2O· + H2O
1 record matched CF3CH2CH2OH → H2O + CH2=CHCF3
1 record matched ·CH3 + O2 → HCO + H2O
2 records matched ·CH3 + H2O → CH4 + ·OH
2 records matched ·CH3 + ·OH → H2O + ·CH2
1 record matched ·CH3 + ·OH → CH2(X3B_1) + H2O
2 records matched ·CH3 + ·OH → CH2(1) + H2O
1 record matched CH3CH2O· + H· → CH3CH + H2O
2 records matched CH3CH2O· + H· → C2H4 + H2O
1 record matched CH3O· + H2O → CH3OH + ·OH
1 record matched CH3O· + ·OH → CH2O + H2O
3 records matched ·C2H + H2O → C2H2 + ·OH
1 record matched ·C2H + H2O → Products
1 record matched ·C2H + HO2 → H2O + C2O
1 record matched C6H5O + C6H5O → Dibenzofuran + H2O
1 record matched ·CHCl + H2O + H2O → H2O + ClCH2OH
1 record matched ·CHCl + H2O → ClCH2OH
1 record matched CH2=NH + ·OH → H2O + H2C=N
1 record matched CH2=NH + ·OH → trans-HCNH + H2O
1 record matched CH2=NH + ·OH → cis-HCNH + H2O
1 record matched Propylcyclopentane + ·OH → 1-cyclopentyl-prop-2-yl radical + H2O
1 record matched n-Butylcyclopentane + ·OH → 1-cyclopentyl-but-2-yl radical + H2O
1 record matched ·C2H5 + ·OH → CH3CH + H2O
1 record matched ·C2H5 + ·OH → ·C2H5 + H2O
1 record matched ·C2H5 + ·OH → C2H4 + H2O
1 record matched ·C2H5 + HO2 → CH3CHO + H2O
1 record matched ·CH2CH=CH2 + HO2 → CH2=CHCHO + H2O
3 records matched CF3CH2OCHF2 + ·OH → Other Products + H2O
1 record matched CHFBr2 + ·OH → H2O + CFBr2
1 record matched Phenyl formate + ·OH → C6H5OC(=O)· + H2O
1 record matched Phenyl formate + ·OH → 2-Formyloxy phenyl + H2O
1 record matched Phenyl formate + ·OH → 3-Formyloxy phenyl + H2O
1 record matched Phenyl formate + ·OH → 4-Formyloxy phenyl + H2O
2 records matched CD3OH + H· → CD3 + H2O
1 record matched CH2FCFCl2 + ·OH → ·CHFCFCl2 + H2O
2 records matched CHF2-O-CHF2 + ·OH → CHF2OCF2· + H2O
3 records matched CF2ClCH2Cl + ·OH → ·CHClCClF2 + H2O
3 records matched tert-C4H9OCH3 + ·OH → Other Products + H2O
1 record matched (E)-CHF=CHF + ·OH → H2O + Ethenyl, 1,2-difluoro-, (E)-
1 record matched (Z)-CHF=CHF + ·OH → H2O + Ethenyl, 1,2-difluoro-, (Z)-
1 record matched Ethane, 1-chloro-1-fluoro- + ·OH → Other Products + H2O
1 record matched CCl2 (X 1A1) + H2O → Products
1 record matched CH3CH2CHCHCHO + ·OH → Other Products + H2O
1 record matched (CF3)2C(OH)CH3 + ·OH → Other Products + H2O
1 record matched CF2ClC(O)OCH3 + ·OH → CF2ClC(O)OCH2· + H2O
2 records matched CHBrF2 + ·OH → H2O + CBrF2
1 record matched CF3OH + H2O → COF2 + HF + H2O
1 record matched CF3OH + ·OH + H2O → COF2 + ·OH + HF + H2O
2 records matched CF3OH + ·OH → H2O + CF3O
2 records matched HFCO + ·OH → FCO + H2O
2 records matched H2 + NO2 → H2O + NO
1 record matched H2 + N2O → N2 + H2O
1 record matched H2 + O2 → H2O + O·
24 records matched H2 + ·OH → H2O + H·
1 record matched NiO + H2 → Ni + H2O
1 record matched NaOH + H· → Na + H2O
2 records matched LiOH + H· → Li + H2O
1 record matched KOH + H· → K + H2O
1 record matched KOH + ·OH → H2O + KO
1 record matched Ca(OH)2 + H· → H2O + CaOH
1 record matched Ca(OH)2 → CaO + H2O
1 record matched (CH3)2SiH2 + ·OH → H2O + CH3SiH2CH2(·)
1 record matched (CH3)2SiH2 + ·OH → Other Products + H2O
1 record matched (CH3)2SiH2 + ·OH → SiH3CH(·)CH3 + H2O
1 record matched Nitric acid, pentyl ester + ·OH → Other Products + H2O
3 records matched CF3CHFCF2OCH2CF3 + ·OH → Other Products + H2O
2 records matched CF3CHFCF2OCH2CF3 + ·OH → CH2OC4F9 + H2O
1 record matched O=P(OH)2CH3 + ·OH → O=P(OH)2CH2· + H2O
1 record matched O=P(OH)2CH3 + ·OH → O=P(OH)(O·)CH3 + H2O
1 record matched O=P(OH)2CH3 → PO2CH3 + H2O
1 record matched O=P(OH)2CH3 → CH2=P(O)OH + H2O
1 record matched (C6H5)CH=CHCH2CH2OH → H2O + 1-Phenyl-1,3-butadiene(E)
1 record matched 2,3,5,6-Tetrachlorophenol + ·OH → 2,3,5,6-tetrachlorophenoxy radical + H2O
1 record matched 2,3,5-Trichlorophenol + ·OH → 2,3,5-trichlorophenoxy radical + H2O
1 record matched 2,3,6-Trichlorophenol + ·OH → 2,3,6-trichlorophenoxy radical + H2O
2 records matched 1-Nitrosopyrrolidine + ·OH → Nitrosopyrrolidin-2-yl + H2O
1 record matched n-C4H9ONO2 + ·OH → Other Products + H2O
1 record matched CF3CH(OH)CF3 + ·OH → Other Products + H2O
1 record matched CF3CH(OH)CF3 + ·OH → CF3CHOCF3 + H2O
1 record matched CCl3COCH3 + ·OH → ·CH2C(O)CCl3 + H2O
1 record matched Methyl 2-methylbutanoate + ·OH → CH3CH2CH(CH3)C(O)OCH2· + H2O
1 record matched Methyl 2-methylbutanoate + ·OH → CH3CH2C(·)(CH3)C(O)OCH3 + H2O
1 record matched Methyl 2-methylbutanoate + ·OH → CH3CH(·)CH(CH3)C(O)OCH3 + H2O
1 record matched Methyl 2-methylbutanoate + ·OH → ·CH2CH2CH(CH3)C(O)OCH3 + H2O
1 record matched Methyl 2-methylbutanoate + ·OH → CH3CH2CH(CH2·)C(O)OCH3 + H2O
1 record matched CH3NO → HCN + H2O
1 record matched Methyl-2-pentenoate + ·OH → CH3CH2CH=CHC(O)OCH2· + H2O
1 record matched Methyl-2-pentenoate + ·OH → CH3CH2CH=C(·)C(O)OCH3 + H2O
1 record matched Methyl-2-pentenoate + ·OH → CH3CH2C(·)=CHC(O)OCH3 + H2O
1 record matched Methyl-2-pentenoate + ·OH → CH3CH(·)CH=CHC(O)OCH3 + H2O
1 record matched Methyl-2-pentenoate + ·OH → ·CH2CH2CH=CHC(O)OCH3 + H2O
1 record matched Methyl-3-pentenoate + ·OH → CH3CH=CHCH2C(O)OCH2· + H2O
1 record matched Methyl-3-pentenoate + ·OH → CH3CH=CHCH(·)C(O)OCH3 + H2O
1 record matched Methyl-3-pentenoate + ·OH → CH3CH=C(·)CH2C(O)OCH3 + H2O
1 record matched Methyl-3-pentenoate + ·OH → CH3C(·)=CHCH2C(O)OCH3 + H2O
1 record matched Methyl-3-pentenoate + ·OH → ·CH2CH=CHCH2C(O)OCH3 + H2O
1 record matched Methyl-4-pentenoate + ·OH → CH2=CHCH2CH2C(O)OCH2· + H2O
1 record matched Methyl-4-pentenoate + ·OH → CH2=CHCH2CH(·)C(O)OCH3 + H2O
1 record matched Methyl-4-pentenoate + ·OH → CH2=CHCH(·)CH2C(O)OCH3 + H2O
1 record matched Methyl-4-pentenoate + ·OH → CH2=C(·)CH2CH2C(O)OCH3 + H2O
1 record matched Methyl-4-pentenoate + ·OH → ·CH=CHCH2CH2C(O)OCH3 + H2O
1 record matched CHF2CFCl2 + ·OH → ·CF2CFCl2 + H2O
5 records matched CF3CH2F + ·OH → H2O + CF3CHF
1 record matched Acetaldehyde, chlorodifluoro- + ·OH → CF2ClC(O)(.) + H2O
1 record matched CH2ClCFCl2 + ·OH → ·CHClCFCl2 + H2O
1 record matched Cyclohexyl hydroperoxide + Cyclohexyl hydroperoxide → C6H11O2 + cyc-[CH(O·)CH2CH2CH2CH2CH2] + H2O
1 record matched 1-C7H15OOH + ·OH → C6H13CH(·)OOH + H2O
1 record matched Ethylene glycol monovinyl ether + ·OH → CH2=CHOH + CH2=CHO· + H2O
1 record matched Ethylene glycol monovinyl ether + ·OH → H2C=C=O + HOCH2CH2· + H2O
1 record matched n-C3H7OCH=CH2 + ·OH → ·CH2CH2CH2OCH=CH2 + H2O
1 record matched n-C3H7OCH=CH2 + ·OH → CH3C(·)HCH2OCH=CH2 + H2O
1 record matched n-C3H7OCH=CH2 + ·OH → CH3CH2C(·)HOCH=CH2 + H2O
1 record matched n-C3H7OCH=CH2 + ·OH → CH3CH2CH2OC(·)=CH2 + H2O
1 record matched n-C3H7OCH=CH2 + ·OH → CH3CH2CH2OCH=CH· + H2O
1 record matched CH2=C(CH3)CH2CH2OH → CH2=C(CH3)CH=CH2 + H2O
1 record matched Ethane, 1-chloro-2-fluoro- + ·OH → Other Products + H2O
1 record matched CH2FCH2Br + ·OH → Other Products + H2O
1 record matched CF3CH2NH2 + ·OH → CF3CH2NH· + H2O
1 record matched CF3CH2NH2 + ·OH → CF3CH(·)NH2 + H2O
1 record matched Benzeneethanol, α-methyl- → (Z)-1-Phenylpropene + H2O
3 records matched Propane, 1,1,1,3,3,3-hexafluoro- + ·OH → H2O + (CF3)2CH·
1 record matched CH3CH2OCF3 + ·OH → Other Products + H2O
2 records matched CH3CH2OCF3 + ·OH → CF3OCH2CH2· + H2O
2 records matched CH3CH2OCF3 + ·OH → CF3OCH(·)CH3 + H2O
2 records matched Propane, 1,1,2,2,3-pentafluoro- + ·OH → Other Products + H2O
3 records matched Propane, 1,1,1,2,2,3-hexafluoro- + ·OH → CF3CF2CHF· + H2O
1 record matched CF3CHCH2 + ·OH → CF3CH=CH· + H2O
1 record matched CF3CHCH2 + ·OH → CF3C(·)=CH2 + H2O
1 record matched CH2ClCCl3 + ·OH → H2O + CCl3CHCl
1 record matched 1,1,1,2-Tetrabromoethane + ·OH → CBr3CHBr· + H2O
2 records matched CO + H2O → CO2 + H2
2 records matched CO + H2O → HCOOH
1 record matched CO + ·OH + H2O → CO2 + H2O + H·
1 record matched CH2=CHCH2CH2OH → 1,3-Butadiene + H2O
1 record matched n-C3H7ONO2 + ·OH → Other Products + H2O
1 record matched 2,5-Dimethylfuran + ·OH → 2-methylfuran-5-yl methyl radical + H2O
1 record matched 2,5-Dimethylfuran + ·OH → 2,5-dimethylfuran-3-yl radical + H2O
2 records matched C2H5ONO2 + ·OH → Other Products + H2O
2 records matched Propane, 1-methoxy-2-methyl- + ·OH → Other Products + H2O
1 record matched CH2=CHCH2CH(OH)CH3 → CH2=CHCH2CH=CH2 + H2O
1 record matched CH2=CHCH2CH(OH)CH3 → CH2=CHCH=CHCH3 + H2O
1 record matched CH2=CHCH2C(CH3)2OH → (CH3)2C=CHCH=CH2 + H2O
1 record matched CH2=CHCH2C(CH3)2OH → CH2=C(CH3)CH2CH=CH2 + H2O
1 record matched C2H5SCH3 + ·OH → H2O + CH3SCH2CH2
1 record matched C2H5SCH3 + ·OH → ·CH2SCH2CH3 + H2O
1 record matched C2H5SCH3 + ·OH → CH3SCH(·)CH3 + H2O
3 records matched CH2FCH2F + ·OH → H2O + CH2FCHF
1 record matched (E)-2-C4H8 + ·OH → H2O + CH3CH=C(·)CH3
2 records matched (E)-2-C4H8 + ·OH → H2O + (E)-CH3CH=CHCH2
1 record matched Methyl levulinate + ·OH → CH3C(O)CH2CH2C(O)OCH2· + H2O
1 record matched Methyl levulinate + ·OH → CH3C(O)CH2CH(·)C(O)OCH3 + H2O
1 record matched Methyl levulinate + ·OH → CH3C(O)CH(·)CH2C(O)OCH3 + H2O
1 record matched Methyl levulinate + ·OH → ·CH2C(O)CH2CH2C(O)OCH3 + H2O
1 record matched Methyl pentanoate + ·OH → CH3CH2CH2CH2C(O)OCH2· + H2O
1 record matched Methyl pentanoate + ·OH → CH3CH2CH2CH(·)C(O)OCH3 + H2O
1 record matched Methyl pentanoate + ·OH → CH3CH2CH(·)CH2C(O)OCH3 + H2O
1 record matched Methyl pentanoate + ·OH → CH3CH(·)CH2CH2C(O)OCH3 + H2O
1 record matched Methyl pentanoate + ·OH → ·CH2CH2CH2CH2C(O)OCH3 + H2O
1 record matched Methyl butanoate + ·OH → ·CH2OC(O)CH2CH2CH3 + H2O
1 record matched Methyl butanoate + ·OH → CH3OC(O)CH·CH2CH3 + H2O
1 record matched Methyl butanoate + ·OH → CH3OC(O)CH2CH·CH3 + H2O
1 record matched Methyl butanoate + ·OH → CH3OC(O)CH2CH2CH2· + H2O
1 record matched 3-Ethylpentane + ·OH → CH3CH2C(·)(CH2CH3)CH2CH3 + H2O
1 record matched 3,4,5-Trichlorophenol + ·OH → 3,4,5-trichlorophenoxy radical + H2O
1 record matched (CH3)2CHCH(OH)CH3 → (CH3)2CHCH=CH2 + H2O
1 record matched (CH3)2CHCH(OH)CH3 → (CH3)2C=CHCH3 + H2O
1 record matched CH3NHNO2 → N2 + H2O + HOCH
1 record matched CH3NHNO2 → CHNNOH + H2O
3 records matched iso-C3H7OCH3 + ·OH → Other Products + H2O
1 record matched CH2BrC(O)Br + ·OH → ·CHBrCBrO + H2O
3 records matched (CH3)3CC(CH3)3 + ·OH → H2O + (CH3)3CC(CH3)2CH2
3 records matched (CH3)2COHCOOH → H2O + Oxiranone, dimethyl-
1 record matched (CH3)2CHC(OH)(CH3)2 → (CH3)2C=C(CH3)2 + H2O
1 record matched (CH3)2CHC(OH)(CH3)2 → (CH3)2CHC(CH3)=CH2 + H2O
1 record matched CHFClBr + ·OH → CFClBr + H2O
1 record matched COBr2 + H2O → Products
1 record matched (CH3)2Se + ·OH → CH3SeCH2· + H2O
1 record matched CH3OCl + ·OH → H2O + (·)CH2OCl
4 records matched CH2FCl + ·OH → H2O + ·CClFH
8 records matched CH3F + ·OH → ·CH2F + H2O
1 record matched HCOO(CH2)3CH3 + ·OH → CH3CH2CH2CH2OC(=O)· + H2O
1 record matched HCOO(CH2)3CH3 + ·OH → CH3CH2CH2CH(·)OC(O)H + H2O
1 record matched HCOO(CH2)3CH3 + ·OH → CH3CH2CH(·)CH2OC(O)H + H2O
1 record matched HCOO(CH2)3CH3 + ·OH → CH3CH(·)CH2CH2OC(O)H + H2O
1 record matched HCOO(CH2)3CH3 + ·OH → ·CH2CH2CH2CH2OC(O)H + H2O
1 record matched 3,5-Dichlorophenol + ·OH → 3,5-dichlorophenoxy radical + H2O
1 record matched (Z)-2-C4H8 + ·OH → H2O + (Z)-CH3CH=CHCH2·
1 record matched (Z)-2-C4H8 + ·OH → H2O + CH3CH=C(·)CH3
1 record matched (C2H5)2CHOH + ·OH → (C2H5)2C(·)OH + H2O
1 record matched 2,5-Dichlorophenol + ·OH → 2,5-dichlorophenoxy radical + H2O
1 record matched 2,3-Dichlorophenol + ·OH → 2,3-dichlorophenoxy radical + H2O
1 record matched 3-methyl-2-butanone + ·OH → Other Products + H2O
2 records matched 3-methyl-2-butanone + ·OH → Products + H2O
1 record matched 3-methyl-2-butanone + ·OH → (CH3)2CHC(O)CH2(·) + H2O
1 record matched 3-methyl-2-butanone + ·OH → (CH3)2C(·)C(O)CH3 + H2O
1 record matched 3-methyl-2-butanone + ·OH → CH3C(O)CH(CH3)CH2(·) + H2O
1 record matched C2H5C(CH3)=CH2 + ·OH → (C2H5)(CH3)C=CH· + H2O
1 record matched (CH3)2CHCH=CH2 + ·OH → H2O + (CH3)2CHCH=CH·
1 record matched (CH3)2CHCH=CH2 + ·OH → (CH3)2CHC·=CH2 + H2O
2 records matched CH3CHBr2 + ·OH → Other Products + H2O
1 record matched CH3CHBr2 + ·OH → ·CH2CHBr2 + H2O
1 record matched CH3CHBr2 + ·OH → CH3C(·)Br2 + H2O
1 record matched CH2=CHOH → CH2=C + H2O
1 record matched CH2=CHOH → C2H2 + H2O
2 records matched CH3CH2CH2OCH3 + ·OH → Other Products + H2O
1 record matched 3-Nitrophenol + ·OH → m-C6H4(NO2)O· + H2O
2 records matched C2H5C(O)OCH3 + ·OH → CH3CH(·)C(O)OCH3 + H2O
2 records matched C2H5C(O)OCH3 + ·OH → CH3CH2C(O)OCH2· + H2O
2 records matched C2H5C(O)OCH3 + ·OH → CH3OC(O)CH2CH2· + H2O
2 records matched (CH3)2CHCH2C(CH3)3 + ·OH → H2O + (CH3)3CCH2CH(CH3)CH2
2 records matched (CH3)2CHCH2C(CH3)3 + ·OH → H2O + (CH3)3CCH2C(·)(CH3)2
1 record matched (CH3)2CHCH2C(CH3)3 + ·OH → Other Products + H2O
3 records matched C2H5OCH3 + ·OH → Other Products + H2O
1 record matched n-C3H7Cl + ·OH → Other Products + H2O
1 record matched 2-Methylfuran + ·OH → 2-methylfuran-3-yl + H2O
1 record matched 2-Methylfuran + ·OH → 2-methylfuran-4-yl + H2O
1 record matched 2-Methylfuran + ·OH → 2-methylfuran-5-yl + H2O
1 record matched CH3CH(OH)C(O)CH3 + ·OH → H2O + CH3C(O)CH(O·)CH3
1 record matched CH3CH(OH)C(O)CH3 + ·OH → Other Products + H2O
1 record matched CH3CH(OH)C(O)CH3 + ·OH → CH3C(OH)C(O)CH3 + H2O
2 records matched CH3CH(OH)C(O)CH3 + ·OH → ·CH2CH(OH)C(O)CH3 + H2O
1 record matched (CH3O)3PO + ·OH → (CH3-O)2P(O)-O-CH2· + H2O
2 records matched CH3CH2OCF2CF2H + ·OH → Other Products + H2O
2 records matched CH2OHCHOHCH3 → H2O + (Z)-CH3CH=CHOH
2 records matched CH2OHCHOHCH3 → H2O + CH2=C(OH)CH3
2 records matched CH2OHCHOHCH3 → CH2=CHCH2OH + H2O
2 records matched CH2OHCHOHCH3 → Acetone + H2O
1 record matched Ethane, 1,1-dichloro-2,2-difluoro- + ·OH → Other Products + H2O
1 record matched (CH3)3CCH(CH3)OH → (CH3)3CCH=CH2 + H2O
2 records matched 2,2,3-Trimethylbutane + ·OH → H2O + (CH3)3CCH(CH3)CH2·
3 records matched 2,2,3-Trimethylbutane + ·OH → H2O + (CH3)3C-C(·)(CH3)2
3 records matched 2,2,3-Trimethylbutane + ·OH → Other Products + H2O
4 records matched neo-C5H12 + ·OH → Neopentyl + H2O
1 record matched neo-C5H12 + ·OH → Other Products + H2O
1 record matched CH2(OH)2 → CH2O + H2O
1 record matched NH2CHNH + H2O + H2O → HCN + NH3 + H2O + H2O
1 record matched NH2CHNH + H2O → HCN + NH3 + H2O
1 record matched CH2=C=CH2 + ·OH → CH2C≡CH + H2O
2 records matched CF3CH2CHF2 + ·OH → Other Products + H2O
2 records matched CF3CH2OCH3 + ·OH → Other Products + H2O
1 record matched CH3OCH2F + ·OH → Other Products + H2O
3 records matched CF3CHFCF3 + ·OH → (CF3)2CF + H2O
2 records matched 1,1,1,2,3,3-Hexafluoropropane + ·OH → Other Products + H2O
2 records matched 1,1,1,2,3,3-Hexafluoropropane + ·OH → CF3C(·)FCHF2 + H2O
2 records matched 1,1,1,2,3,3-Hexafluoropropane + ·OH → CF3CHFCF2· + H2O
2 records matched CF3C(O)OCH3 + ·OH → CF3C(O)OCH2· + H2O
5 records matched CF3CHFCH2F + ·OH → Other Products + H2O
1 record matched CHF2CHFCl + ·OH → Other Products + H2O
1 record matched 1,2-Dichloro-1,2-difluoroethane + ·OH → ·CFClCHFCl + H2O
1 record matched CH2FCHF2 + ·OH → H2O + CHF2C(·)HF
1 record matched CH2FCHF2 + ·OH → H2O + CH2FC(·)F2
5 records matched CH2FCHF2 + ·OH → Other Products + H2O
1 record matched CH2FCHF2 + ·OH → Products + H2O
1 record matched Ethane, 1,2-dichloro-1-fluoro- + ·OH → Other Products + H2O
1 record matched CH2FCHCl2 + ·OH → Other Products + H2O
2 records matched CH3COCH2F + ·OH → CH3C(O)CHF· + H2O
2 records matched CH3COCH2F + ·OH → ·CH2C(O)CH2F + H2O
1 record matched CH3COCH2F + ·OH → C3H4FO + H2O
2 records matched CH3OCF2CHF2 + ·OH → Other Products + H2O
1 record matched C2F5CH2OH + ·OH → CF3CF2CH(·)OH + H2O
1 record matched C2F5CH2OH + ·OH → CF3CF2CH2O + H2O
1 record matched CH3COCF3 + ·OH → H2O + CF3COCH2
4 records matched CF3OCH3 + ·OH → CF3OCH2(.) + H2O
3 records matched CH3CH2CF3 + ·OH → Other Products + H2O
1 record matched CF3CBrH2 + ·OH → CF3CHBr· + H2O
1 record matched CH2FCF2Cl + ·OH → ·CHFCF2Cl + H2O
5 records matched CH3CF3 + ·OH → CF3CH2 + H2O
1 record matched HO-C≡N + H· → CN + H2O
1 record matched H2NCN + ·OH → H2O + ·NHC=N
2 records matched CF3CH2CH2CF3 + ·OH → CF3CH2CH(·)CF3 + H2O
1 record matched CF3C(O)OCH2CF3 + ·OH → CF3C(O)OCHCF3 + H2O
1 record matched CF3CH2CH2CHO + ·OH → Other Products + H2O
3 records matched CF3CH2OCF2CF2H + ·OH → Other Products + H2O
2 records matched CF3CH2CF2CH3 + ·OH → Other Products + H2O
1 record matched CF3COOC2H5 + ·OH → Other Products + H2O
1 record matched CF3COOC2H5 + ·OH → CF3C(O)OCH(·)CH3 + H2O
1 record matched CF3COOC2H5 + ·OH → CF3C(O)OCH2CH2· + H2O
1 record matched CF2ClC(O)OCH2CH3 + ·OH → CF2ClC(O)OCH2CH2· + H2O
1 record matched CF2ClC(O)OCH2CH3 + ·OH → CF2ClC(O)OCH(·)CH3 + H2O
2 records matched CF3CHFCF2OCH3 + ·OH → Other Products + H2O
2 records matched CHF2CF2CF2CHF2 + ·OH → CHF2CF2CF2CF2· + H2O
1 record matched CH2FBr + ·OH → H2O + CHFBr
1 record matched CH2FCH2OH + ·OH → Other Products + H2O
1 record matched CH2FCH2OH → CH2=CHF + H2O
1 record matched CH3CH2CH2C(O)OCH2CF3 + ·OH → Other Products + H2O
6 records matched CHF2CHF2 + ·OH → H2O + CHF2CF2
1 record matched Ethane, 1,1,2-trichloro-2-fluoro- + ·OH → Other Products + H2O
1 record matched CHBr2CHF2 + ·OH → Other Products + H2O
2 records matched CH3OCHF2 + ·OH → Other Products + H2O
6 records matched C2F5H + ·OH → C2F5 + H2O
1 record matched Ethane, 1-chloro-1,1,2,2-tetrafluoro- + ·OH → ·CF2CF2Cl + H2O
3 records matched CF2ClCHFCl + ·OH → H2O + ·CFClCF2Cl
2 records matched Ethane, 1,2,2-trichloro-1,1-difluoro- + ·OH → H2O + CCl2CF2Cl
3 records matched CCl2FCHClF + ·OH → H2O + CFCl2CFCl
3 records matched Ethane, 1,1,2,2-tetrachloro-1-fluoro- + ·OH → ·CCl2CFCl2 + H2O
1 record matched CCl3CHF2 + ·OH → CCl3CF2· + H2O
1 record matched Ethane, 1,1,1,2-tetrachloro-2-fluoro- + ·OH → CCl3CFCl· + H2O
1 record matched CF2BrCHFCl + ·OH → CF2BrCFCl· + H2O
1 record matched 1,2-Dibromo-1,1,2-trifluoroethane + ·OH → CF2BrCFBr· + H2O
1 record matched COF2 + H2O + H2O → H2O + CF2(OH)2
1 record matched COF2 + H2O + H2O → HF + H2O + FC(O)OH
2 records matched COF2 + H2O → CF2(OH)2
2 records matched COF2 + H2O → HF + FC(O)OH
5 records matched C2H5F + ·OH → Other Products + H2O
1 record matched CH2ClCHF2 + ·OH → Other Products + H2O
1 record matched CH2FCHFCl + ·OH → Other Products + H2O
3 records matched CF3CH2OCH2CF3 + ·OH → CF3CH(.)OCH2CF3 + H2O
3 records matched CF3CHCl2 + ·OH → H2O + CF3CCl2
1 record matched HSSNH2 + ·OH → ·SSNH2 + H2O
1 record matched OCHCOOH + ·OH → ·C(O)C(O)OH + H2O
1 record matched 1,3,5-Triazine + ·OH → s-triazinyl + H2O
1 record matched Cyclopentane + ·OH → Cyclopentyl + H2O
1 record matched Cyclobutane + ·OH → Cyclobutyl + H2O
1 record matched (Z)-CHCl=CHCl + ·OH → Other Products + H2O
1 record matched CF3CHClBr + ·OH → H2O + CF3CClBr
3 records matched HOOCCOOH → CO2 + CO + H2O
1 record matched 1-C7H16 + ·OH → H2O + 4-C7H15
1 record matched 1-C7H16 + ·OH → H2O + 3-C7H15
1 record matched 1-C7H16 + ·OH → 2-C7H15 + H2O
1 record matched 1-C7H16 + ·OH → 1-C7H15 + H2O
1 record matched 1-C7H16 + ·OH → Other Products + H2O
1 record matched CH3C(O)OC2H5 + ·OH → Other Products + H2O
2 records matched CH3C(O)OC2H5 + ·OH → CH3C(O)OCH2CH2· + H2O
2 records matched CH3C(O)OC2H5 + ·OH → CH3C(O)OCH(·)CH3 + H2O
1 record matched CH3C(O)OC2H5 + ·OH → ·H2CC(O)OCH2CH3 + H2O
3 records matched HOCH2CHO + ·OH → H2O + HOCH2C(·)O
3 records matched HOCH2CHO + ·OH → HOCH(·)CHO + H2O
2 records matched HOCH2CHO + ·OH → Products + H2O
1 record matched HOCH2CHO + ·OH → (·)OCH2CHO + H2O
1 record matched HOCH2CHO → Oxirene + H2O
1 record matched NH2CH2CH2OH + ·OH → ·NHCH2CH2OH + H2O
1 record matched NH2CH2CH2OH + ·OH → NH2CH(·)CH2OH + H2O
1 record matched NH2CH2CH2OH + ·OH → NH2CH2CH(·)OH + H2O
1 record matched NH2CH2CH2OH + ·OH → NH2CH2CH2O· + H2O
1 record matched CH3CH2CH(CH3)CH2OH → C2H5C(CH3)=CH2 + H2O
1 record matched 1,2-Benzenedicarboxylic acid, dimethyl ester + ·OH → Other Products + H2O
1 record matched beta-pinene + ·OH → Other Products + H2O
2 records matched CHClBr2 + ·OH → H2O + CClBr2
1 record matched (CH3)2NH + ·OH → H2O + CH2NHCH3
1 record matched (CH3)2NH + ·OH → H2O + (CH3)2N
1 record matched (CH3)2NH + ·OH → Other Products + H2O
1 record matched CO2 + H2 → CO + H2O
1 record matched 1-C10H22 + ·OH → H2O + CH3(CH2)4CH(·)CH2CH2CH2CH3
1 record matched 1-C10H22 + ·OH → H2O + CH3(CH2)6CH(·)C2H5
1 record matched 1-C10H22 + ·OH → H2O + CH3(CH2)7CH(·)CH3
1 record matched 1-C10H22 + ·OH → H2O + 1-C10H21
1 record matched 1-C10H22 + ·OH → Other Products + H2O
1 record matched 1,4-Dioxane + ·OH → 1,4-Dioxan-2-yl + H2O
1 record matched CH3CH=CHCHO + ·OH → H2O + CH3CH=CHC(O)·
1 record matched CH3CH2CH2CHO + ·OH → H2O + C2H5CHCHO
1 record matched CH3CH2CH2CHO + ·OH → H2O + CH3CH2CH2CO
1 record matched CH3CH2CH2CHO + ·OH → CH3CH(·)CH2CHO + H2O
1 record matched CH3COCH2COCH3 → Other Products + H2O
1 record matched 3-methyl-1-butanol + H· → CH3CH(CH3)CH2CH2O(·) + H2O
1 record matched 3-methyl-1-butanol → (CH3)2CHCH=CH2 + H2O
1 record matched C2H5CHO + ·OH → H2O + ·CH2CH2CHO
1 record matched C2H5CHO + ·OH → H2O + CH3C(·)HCHO
1 record matched C2H5CHO + ·OH → H2O + CH3CH2CO
1 record matched 1,4-Benzenediol + ·OH → 4-Hydroxyphenoxy + H2O
1 record matched Cyclopentanone + ·OH → 2-oxocyclopentyl + H2O
1 record matched Cyclopentanone + ·OH → 3-oxocyclopentyl + H2O
1 record matched 2,4-Dichlorophenol + ·OH → 2,4-diclhorophenoxy radical + H2O
1 record matched 1,2-Dihydroxybenzene + ·OH → 4-Hydroxyphenoxy + H2O
2 records matched 1,2-Dihydroxybenzene → 2,4-Cyclopentadien-1-ylidene methanone + H2O
1 record matched CH3C(O)CH2OH + ·OH → ·CH(OH)C(O)CH3 + H2O
1 record matched CH3C(O)C(OH)(CH3)2 + ·OH → Other Products + H2O
1 record matched CH3C(O)C(OH)(CH3)2 + ·OH → ·CH2C(O)C(CH3)2OH + H2O
1 record matched CH3C(O)C(OH)(CH3)2 + ·OH → CH3C(O)C(OH)(CH3)CH2· + H2O
1 record matched CH3C(O)C(OH)(CH3)2 + ·OH → CH3C(O)C(O·)C(CH3)CH3 + H2O
1 record matched CH2=CHC(CH3)2OH + ·OH → Other Products + H2O
2 records matched iso-C4H8 + ·OH → H2O + ·CH2C(CH3)=CH2
2 records matched iso-C4H8 + ·OH → (CH3)2C=CH· + H2O
10 records matched (CH3)2O + ·OH → H2O + CH3OCH2·
1 record matched (CH3)2O + ·OH → Other Products + H2O
3 records matched CH3CH=CH2 + ·OH → H2O + CH2=C(·)CH3
2 records matched CH3CH=CH2 + ·OH → CH3CH=C(·)H + H2O
4 records matched CH3CH=CH2 + ·OH → ·CH2CH=CH2 + H2O
1 record matched n-C9H20 + ·OH → H2O + 1-C9H19
1 record matched n-C9H20 + ·OH → Other Products + H2O
2 records matched n-C8H18 + ·OH → H2O + 3-C8H17
2 records matched n-C8H18 + ·OH → H2O + 4-C8H17
2 records matched n-C8H18 + ·OH → 1-C8H17 + H2O
2 records matched n-C8H18 + ·OH → 2-C8H17 + H2O
1 record matched n-C8H18 + ·OH → Other Products + H2O
1 record matched Morpholine + ·OH → Other Products + H2O
2 records matched Piperazine + ·OH → 1-piperazinyl + H2O
2 records matched Piperazine + ·OH → 2-piperazinyl + H2O
2 records matched Cyclohexane + ·OH → Cyclohexyl + H2O
2 records matched Cyclohexane + Cyclohexyl hydroperoxide → cyc-[CH(O·)CH2CH2CH2CH2CH2] + Cyclohexyl + H2O
1 record matched HOCH2CH2OC2H5 + ·OH → Other Products + H2O
1 record matched n-C4H9CHO + ·OH → H2O + CH3CH2CH2CH2CO·
1 record matched n-C4H9CHO + ·OH → CH3CH2CH2CH(·)C(O)H + H2O
1 record matched n-C4H9CHO + ·OH → CH3CH2CH(·)CH2C(O)H + H2O
1 record matched 1-C6H14 + ·OH → H2O + 3-hexyl radical
1 record matched 1-C6H14 + ·OH → 1-hexyl radical + H2O
1 record matched 1-C6H14 + ·OH → 2-hexyl radical + H2O
1 record matched 1-C6H14 + ·OH → Other Products + H2O
1 record matched Tetrahydrofuran + ·OH → H2O + 2-Tetrahydrofuranyl
2 records matched Tetrahydrofuran + ·OH → Other Products + H2O
1 record matched Tetrahydrofuran + ·OH → 3-Tetrahydrofuranyl + H2O
2 records matched HC(O)OC2H5 + ·OH → H2O + CH3CH2OC(O)·
1 record matched HC(O)OC2H5 + ·OH → Other Products + H2O
2 records matched HC(O)OC2H5 + ·OH → CH3CH(·)OC(O)H + H2O
2 records matched HC(O)OC2H5 + ·OH → ·CH2CH2OC(O)H + H2O
1 record matched CH3OCH2OCH3 + ·OH → CH3OCH2OCH2· + H2O
1 record matched CH3OCH2OCH3 + ·OH → CH3OCH(·)OCH3 + H2O
1 record matched HOCH2CH2OCH3 + ·OH → Other Products + H2O
1 record matched 1-C5H10 + ·OH → CH3CH2CH2C·=CH2 + H2O
1 record matched 1-C5H10 + ·OH → CH3CH2CH2CHCH· + H2O
2 records matched n-C5H12 + ·OH → H2O + (CH3CH2)2CH
3 records matched n-C5H12 + ·OH → 1-C5H11 + H2O
3 records matched n-C5H12 + ·OH → CH3CH2CH2CH(·)CH3 + H2O
2 records matched n-C5H12 + ·OH → Other Products + H2O
1 record matched CH3COOCH2CH2CH3 + ·OH → Other Products + H2O
1 record matched CH3COOCH2CH2CH3 + ·OH → ·CH2C(O)OCH2CH2CH3 + H2O
1 record matched CH3COOCH2CH2CH3 + ·OH → CH3C(O)OCH(·)CH2CH3 + H2O
1 record matched CH3COOCH2CH2CH3 + ·OH → CH3C(O)OCH2CH(·)CH3 + H2O
1 record matched CH3COOCH2CH2CH3 + ·OH → CH3C(O)OCH2CH2CH2· + H2O
2 records matched Phenol + ·OH → C6H5O + H2O
1 record matched Cyclohexanone + ·OH → cyc-[C(O)CH2CH2CH2CH2C(·)H] + H2O
1 record matched Cyclohexanone + ·OH → 3-cyclohexanone-yl radical + H2O
1 record matched Cyclohexanone + ·OH → 4-cyclohexanone-yl radical + H2O
1 record matched Cyclohexanone + Cyclohexyl hydroperoxide → cyc-[CH(O·)CH2CH2CH2CH2CH2] + cyc-[C(O)CH2CH2CH2CH2C(·)H] + H2O
1 record matched Cyclohexanol + Cyclohexyl hydroperoxide → cyc-[CH(O·)CH2CH2CH2CH2CH2] + C6H11O + H2O
2 records matched Chlorobenzene + ·OH → Phenyl,2-chloro- + H2O
2 records matched Chlorobenzene + ·OH → Phenyl, 3-chloro- + H2O
2 records matched Chlorobenzene + ·OH → Phenyl, 4-chloro- + H2O
1 record matched 4-Methylpyridine + ·OH → H2O + 4-Pyridylmethyl radical
1 record matched 4-Methylpyridine + ·OH → 4-methyl-2-pyridyl radical + H2O
1 record matched 4-Methylpyridine + ·OH → 4-methyl-3-pyridyl radical + H2O
2 records matched Toluene + ·OH → H2O + 2-methylphenyl
2 records matched Toluene + ·OH → 3-methylphenyl + H2O
2 records matched Toluene + ·OH → 4-methylphenyl + H2O
4 records matched Toluene + ·OH → Benzyl + H2O
2 records matched Toluene + ·OH → C6H4CH3 + H2O
1 record matched Methylcyclohexane + ·OH → 3-methyl-cyclohexyl + H2O
1 record matched Methylcyclohexane + ·OH → 2-methyl-cyclohexyl + H2O
1 record matched Methylcyclohexane + ·OH → 4-methyl-cyclohexyl + H2O
1 record matched Methylcyclohexane + ·OH → Cyclohexylmethyl + H2O
1 record matched Methylcyclohexane + ·OH → 1-methyl-cyclohexyl + H2O
1 record matched 1,3,5-Trimethylbenzene + ·OH → H2O + 2,4,6-trimethylphenyl
2 records matched 1,3,5-Trimethylbenzene + ·OH → H2O + 3,5-dimethylbenzyl radical
1 record matched 1,3-Benzenediol + ·OH → H2O + 3-Hydroxyphenoxy
2 records matched 3-Chlorophenol + ·OH → 3-chlorophenoxy + H2O
1 record matched 1,3-Dimethylbenzene + ·OH → H2O + 2,6-dimethylphenyl
1 record matched 1,3-Dimethylbenzene + ·OH → H2O + 3,5-Dimethylphenyl
1 record matched 1,3-Dimethylbenzene + ·OH → H2O + 2,4-dimethylphenyl
1 record matched 1,3-Dimethylbenzene + ·OH → 3-Methylbenzyl + H2O
1 record matched Pentane, 2,4-dimethyl- + ·OH → (CH3)2CHCH(·)CH(CH3)2 + H2O
1 record matched CH3CO2CH=CH2 + ·OH → ·CH2OC(O)CH=CH2 + H2O
1 record matched CH3CO2CH=CH2 + ·OH → CH3OC(O)C(·)=CH2 + H2O
1 record matched CH3CO2CH=CH2 + ·OH → CH3OC(O)CH=CH· + H2O
1 record matched n-C3H7C(O)CH3 + ·OH → H2O + CH3C(O)CH2CH2CH2(·)
2 records matched n-C3H7C(O)CH3 + ·OH → Products + H2O
1 record matched n-C3H7C(O)CH3 + ·OH → CH3CH2CH2C(O)CH2(·) + H2O
1 record matched n-C3H7C(O)CH3 + ·OH → CH3CH2CH(·)C(O)CH3 + H2O
1 record matched n-C3H7C(O)CH3 + ·OH → CH3CH(·)CH2C(O)CH3 + H2O
1 record matched (CH3)2CH(CH2)2CH3 + ·OH → H2O + (CH3)2CHCH(·)C2H5
1 record matched (CH3)3CCH=C(CH3)2 + ·OH → C(CH3)2=CHC(CH3)2CH2· + H2O
1 record matched (CH3)3CCH=C(CH3)2 + ·OH → C(CH3)2=C(·)C(CH3)3 + H2O
2 records matched (CH3)3CCH=C(CH3)2 + ·OH → ·CH2C(CH3)=CHC(CH3)3 + H2O
1 record matched (tert-C4H9)CH2C(CH3)=CH2 + ·OH → ·CH2C(CH3)2CH2C(CH3)=CH2 + H2O
1 record matched (tert-C4H9)CH2C(CH3)=CH2 + ·OH → (CH3)3CCH(·)C(CH3)=CH2 + H2O
1 record matched (tert-C4H9)CH2C(CH3)=CH2 + ·OH → (CH3)3CCH2C(CH3)=CH· + H2O
2 records matched (tert-C4H9)CH2C(CH3)=CH2 + ·OH → (CH3)3CCH2C(=CH2)CH2· + H2O
3 records matched HC(O)OCH3 + ·OH → H2O + CH3OC(·)(O)
3 records matched HC(O)OCH3 + ·OH → HC(O)OCH2(·) + H2O
2 records matched HC(O)OCH3 + ·OH → Other Products + H2O
1 record matched (CHO)2 + ·OH → H2O + HC(O)CO
1 record matched (CHO)2 + ·OH → CO + HCO + H2O
2 records matched HOCH2CH2OH → CH2=CHOH + H2O
2 records matched HOCH2CH2OH → CH3CHO + H2O
1 record matched HC≡CCH2OH + ·OH → HCCC(·)HOH + H2O
2 records matched HC≡CCH2OH + ·OH → HCCCH2O· + H2O
1 record matched CH2=CHCH2OH + ·OH → H2O + CH2=CHCH2O
1 record matched CH2=CHCH2OH + ·OH → H2O + CH(OH)CH=CH2
1 record matched CH2=CHCH2OH + ·OH → CH2=C(·)CH2OH + H2O
1 record matched CH2=CHCH2OH + ·OH → ·CH=CH-CH2OH + H2O
1 record matched CH2CHCN + H· → H2O + CH2=C(CN)
1 record matched CH2CHCN + H· → trans-(·)CH=CHC≡N + H2O
1 record matched CH2CHCN + H· → cis-(·)CH=CHC≡N + H2O
2 records matched CH2ClCH2Cl + ·OH → H2O + CH2ClCHCl·
1 record matched CH2BrCH2Cl + ·OH → Other Products + H2O
1 record matched CH2=CHCHO + ·OH → H2O + CH2=CHC(·)O
1 record matched CH2=CHCHO + ·OH → ·CH2CH=CO + H2O
1 record matched 1-C4H8 + ·OH → H2O + CH2=CHCH(·)CH3
1 record matched 1-C4H8 + ·OH → H2O + CH2=CHCH(·)CH3
3 records matched 1-C4H8 + ·OH → H2O + CH3CH2C(·)=CH2
2 records matched 1-C4H8 + ·OH → CH3CH2CH=CH· + H2O
2 records matched 1-C4H8 + ·OH → CH2=CHCH2CH2· + H2O
1 record matched 1-C4H8 + ·OH → trans-CH3CH2CH=CH· + H2O
1 record matched 1-C4H8 + ·OH → cis-CH3CH2CH=CH· + H2O
5 records matched 1-C4H10 + ·OH → 1-C4H9 + H2O
3 records matched 1-C4H10 + ·OH → sec-C4H9 + H2O
3 records matched 1-C4H10 + ·OH → Other Products + H2O
1 record matched 1-C4H10 + ·OH → C4H9 (mixture of 2-C4H9 and 1-C4H9) + H2O
1 record matched CH2=CHCH2Br + ·OH → CH2=CHCHBr + H2O
2 records matched n-C3H7Br + ·OH → H2O + CH3CH2CHBr(·)
2 records matched n-C3H7Br + ·OH → H2O + BrCH2CHCH3
2 records matched n-C3H7Br + ·OH → H2O + CH2BrCH2CH2(·)
2 records matched CH2BrCH2Br + ·OH → Other Products + H2O
2 records matched CH2BrCH2Br + ·OH → CH2BrCH(·)Br + H2O
3 records matched 4-Chlorophenol + ·OH → 4-chlorophenoxy + H2O
1 record matched 4-Chlorophenol + ·OH → 2-hydroxy-5-chlorophenyl radical + H2O
1 record matched C2H5C(O)OC2H5 + ·OH → Other Products + H2O
1 record matched C2H5C(O)OC2H5 + ·OH → ·CH2CH2C(O)OC2H5 + H2O
1 record matched C2H5C(O)OC2H5 + ·OH → CH3CH(·)C(O)OC2H5 + H2O
1 record matched C2H5C(O)OC2H5 + ·OH → CH3CH2C(O)OCH(·)CH3 + H2O
1 record matched C2H5C(O)OC2H5 + ·OH → CH3CH2C(O)OCH2CH2· + H2O
1 record matched 1-Phenylpropane + ·OH → H2O + C6H5CH2CH2CH2·
1 record matched 2-methyl-1-phenyl-2-propanol → Benzene,(2-methyl-1-propenyl)- + H2O
2 records matched 1-Nitrosopiperidine + ·OH → Nitrosopiperidin-2-yl + H2O
1 record matched Benzyl alcohol + ·OH → H2O + C6H5CH2O
1 record matched Ethylbenzene + ·OH → Other Products + H2O
1 record matched 4-Nitrophenol + ·OH → p-C6H4(NO2)O· + H2O
1 record matched Cyclopentanol + ·OH → H2O + cyclopentyloxy
1 record matched Cyclopentanol + ·OH → Other Products + H2O
1 record matched Cyclopentanol + ·OH → cyclopentanol-1-yl radical + H2O
1 record matched Cyclopentanol + ·OH → trans-cyclopentanol-2-yl radical + H2O
1 record matched Cyclopentanol + ·OH → cis-cyclopentanol-2-yl radical + H2O
1 record matched Cyclopentanol + ·OH → trans-cyclopentanol-3-yl radical + H2O
1 record matched Cyclopentanol + ·OH → cis-cyclopentanol-3-yl radical + H2O
1 record matched (C2H5)2CHCH3 + ·OH → H2O + (C2H5)2(CH3)C
1 record matched 2,4,5-Trichlorophenol + ·OH → 2,4,5-trichlorophenoxy radical + H2O
1 record matched 3,4-Dichlorophenol + ·OH → 3,4-dichlorophenoxy radical + H2O
4 records matched 2-Chlorophenol + ·OH → 2-chlorophenoxy + H2O
1 record matched 2-Methylphenol + ·OH → H2O + 2-OH-benzyl
1 record matched 2-Methylphenol + ·OH → Phenoxy, 2-methyl- + H2O
2 records matched Indene + ·OH → H2O + 1H-inden-1-yl
2 records matched Naphthalene + ·OH → H2O + 2-Naphthalenyl
2 records matched Naphthalene + ·OH → 1-Naphthalenyl + H2O
1 record matched 2-Nitrophenol + ·OH → o-C6H4(NO2)O· + H2O
3 records matched Benzene,1-methyl-2-nitro- → Anthranil + H2O
1 record matched 2,4,6-trichlorophenol + ·OH → 2,4,6-trichlorophenoxy radical + H2O
1 record matched pentachlorophenol + ·OH → pentachlorophenoxy radical + H2O
1 record matched 2,6-Dichlorophenol + ·OH → 2,6-dichlorophenoxy radical + H2O
2 records matched (CHCl2)2 + ·OH → H2O + CHCl2C(·)Cl2
3 records matched (CH3)2CHCH(CH3)2 + ·OH → H2O + (CH3)2CHC(·)(CH3)2
1 record matched (CH3)2CHCH(CH3)2 + ·OH → H2O + (CH3)2CHCH(·)C2H5
3 records matched (CH3)2CHCH(CH3)2 + ·OH → Other Products + H2O
1 record matched Ethane, 1,1,2,2-tetrabromo- + ·OH → Other Products + H2O
2 records matched CH3C(O)OCH3 + ·OH → H2O + ·CH2C(O)OCH3
2 records matched CH3C(O)OCH3 + ·OH → CH3C(O)OCH2· + H2O
2 records matched HOCH2COOH → H2O + Oxiranone
1 record matched HOCH2COOH → CH2O + CO + H2O
1 record matched CH2ClCOOH + ·OH → Other Products + H2O
3 records matched CHCl2CH2Cl + ·OH → Other Products + H2O
1 record matched CH3C(O)CHO + ·OH → CH3C(O)C(O)· + H2O
1 record matched C2H5COCH3 + ·OH → Other Products + H2O
1 record matched sec-C4H9OH + ·OH → CH3CH2CH(OH)CH2· + H2O
1 record matched sec-C4H9OH + ·OH → CH3CH(OH)CH2CH2· + H2O
1 record matched sec-C4H9OH + ·OH → CH3CH2C(·)(OH)CH3 + H2O
1 record matched sec-C4H9OH + ·OH → CH3CH(·)CH(OH)CH3 + H2O
1 record matched sec-C4H9OH → (E)-2-C4H8 + H2O
1 record matched sec-C4H9OH → (Z)-2-C4H8 + H2O
1 record matched sec-C4H9OH → CH3CH=CHCH3 + H2O
2 records matched sec-C4H9OH → 1-C4H8 + H2O
1 record matched Methacrolein + ·OH → CH2=C(CH3)CO + H2O
3 records matched iso-C4H9OH + ·OH → H2O + (CH3)2CHCH2
4 records matched iso-C4H9OH + ·OH → (CH3)2C(·)CH2OH + H2O
1 record matched iso-C4H9OH + ·OH → Other Products + H2O
3 records matched iso-C4H9OH + ·OH → ·CH2CH(CH3)CH2OH + H2O
2 records matched iso-C4H9OH + ·OH → (CH3)2CHC(·)HOH + H2O
2 records matched iso-C4H9OH → iso-C4H8 + H2O
2 records matched iso-C5H12 + ·OH → ·CH2CH(CH3)CH2CH3 + H2O
2 records matched iso-C5H12 + ·OH → (CH3)2C(·)CH2CH3 + H2O
2 records matched iso-C5H12 + ·OH → (CH3)2CHCH(·)CH3 + H2O
1 record matched iso-C5H12 + ·OH → (CH3)2CHCH2CH2· + H2O
1 record matched CHBr2CH2Br + ·OH → Other Products + H2O
1 record matched (C2H5O)3PO + ·OH → (C2H5-O)2P(O)-O-CH2CH2· + H2O
1 record matched (C2H5O)3PO + ·OH → (C2H5-O)2P(O)-O-CH(·)CH3 + H2O
1 record matched CHCl2CCl3 + ·OH → C2Cl5 + H2O
1 record matched Pentabromoethane + ·OH → CBr3CBr2· + H2O
1 record matched tert-C4H9OOH + ·OH → (CH3)3CO2 + H2O
1 record matched tert-C4H9OOH + ·OH → Other Products + H2O
1 record matched tert-C4H9OOH + ·OH → ·CH2C(CH3)2OOH + H2O
1 record matched CF3CHO + ·OH → CF3C(O) + H2O
1 record matched CF3CH2OH + ·OH → CF3CH2O· + H2O
1 record matched CF3CH2OH + ·OH → CF3CH(·)OH + H2O
3 records matched CF3CH2Cl + ·OH → H2O + CF3CHCl
1 record matched CCl3CHO + ·OH → CCl3C(O)(.) + H2O
1 record matched (CH3)3CCH2CH3 + ·OH → H2O + (CH3)3CCH2CH2·
1 record matched (CH3)3CCH2CH3 + ·OH → H2O + C2H5C(CH3)2C(·)H2
1 record matched (CH3)3CCH2CH3 + ·OH → H2O + (CH3)3CC(·)H(CH3)
1 record matched (CH3)3CCH2CH3 + ·OH → Other Products + H2O
1 record matched CF2BrCH2Br + ·OH → CF2BrCHBr + H2O
1 record matched 1,2-Dibromo-1,1-dichloroethane + ·OH → CCl2BrCHBr· + H2O
1 record matched (CH3)4Si + ·OH → H2O + (CH3)3SiCH2
4 records matched CH3CF2Cl + ·OH → CF2ClCH2· + H2O
1 record matched tert-C4H9OH + ·OH → (CH3)2C(OH)CH2· + H2O
1 record matched tert-C4H9OH → iso-C4H8 + H2O
1 record matched tert-C4H9NH2 + ·OH → Other Products + H2O
2 records matched CH3NO2 + ·OH → H2O + CH2NO2
1 record matched (CH3)3N + ·OH → H2O + CH2N(CH3)2
8 records matched CHF3 + ·OH → ·CF3 + H2O
4 records matched CHF2Cl + ·OH → ·CClF2 + H2O
4 records matched CHFCl2 + ·OH → ·CCl2F + H2O
1 record matched CH2=CF2 + ·OH → H2O + CF2=CH·
3 records matched CH3CHF2 + ·OH → H2O + CH2CHF2
2 records matched CH3CHF2 + ·OH → H2O + CH3CF2
6 records matched CH3CHF2 + ·OH → Other Products + H2O
1 record matched CH2=CCl2 + ·OH → H2O + CCl2=CH·
1 record matched CH3CHCl2 + ·OH → H2O + CHCl2CH2·
3 records matched CH3CHCl2 + ·OH → Other Products + H2O
1 record matched CH3CHCl2 + ·OH → CH3Cl2 + H2O
1 record matched iso-C3H7Cl + ·OH → Other Products + H2O
6 records matched iso-C4H10 + ·OH → iso-C4H9 + H2O
5 records matched iso-C4H10 + ·OH → tert-C4H9 + H2O
2 records matched iso-C4H10 + ·OH → Other Products + H2O
1 record matched iso-C4H10 + ·OH → C4H9 (mixture of 2-C4H9 and 1-C4H9) + H2O
2 records matched CHBrCl2 + ·OH → H2O + BrCCl2
1 record matched CHBr3 + ·OH → CBr3 + H2O
1 record matched Oxirane → C2H2 + H2O
4 records matched (CH3)2S + ·OH → H2O + CH3SCH2
1 record matched CH2=NOH → HCN + H2O
1 record matched HN=C=O + ·OH → H2O + NCO
1 record matched HCONH2 + ·OH → C(O)NH2 + H2O
2 records matched HCONH2 → HCN + H2O
6 records matched CH2F2 + ·OH → ·CHF2 + H2O
4 records matched CH2Cl2 + ·OH → CHCl2 + H2O
1 record matched CH3CHO + H2O → CH3CH(OH)2
1 record matched CH3CHO + ·OH → H2O + CH3CO
1 record matched CH3CHO + ·OH → CH2=CHO· + H2O
2 records matched CH3CHO + ·OH → *CH2C(O)H + H2O
2 records matched CH3CHO + ·OH → CH3CO + H2O
1 record matched CH3CHO + ·OH → Other Products + H2O
7 records matched CH3CN + ·OH → CH2CN + H2O
1 record matched C2H5NH2 + ·OH → H2O + CH3CH2NH·
1 record matched C2H5NH2 + ·OH → H2O + CH3CHNH2
1 record matched C2H5NH2 + ·OH → Other Products + H2O
1 record matched C2H5NH2 + ·OH → ·CH2CH2NH2 + H2O
1 record matched CH2=CHF + ·OH → Other Products + H2O
2 records matched CH2=CHCl + ·OH → H2O + CHCl=CH
2 records matched CH2=CHCl + ·OH → H2O + CH2=CCl
3 records matched C2H5Cl + ·OH → Other Products + H2O
1 record matched CH3CCH + ·OH → CH2C≡CH + H2O
10 records matched C3H8 + ·OH → 1-C3H7 + H2O
8 records matched C3H8 + ·OH → iso-C3H7 + H2O
2 records matched C3H8 + ·OH → Other Products + H2O
1 record matched C3H8 + ·OH → Propyl Radical + H2O
2 records matched CH2ClBr + ·OH → H2O + ·CHBrCl
2 records matched C2H5Br + ·OH → H2O + CH3CHBr
2 records matched C2H5Br + ·OH → H2O + CH2BrCH2
2 records matched C2H5Br + ·OH → Other Products + H2O
3 records matched CH2Br2 + ·OH → H2O + CHBr2
2 records matched CH3SH + ·OH + ·OH → H2O + CH3SOH
2 records matched CH3SH + ·OH → H2O + ·CH2SH
4 records matched CH3SH + ·OH → CH3S· + H2O
6 records matched HCN + ·OH → CN + H2O
1 record matched CH3NH2 + H2O + N2O3 → cis-HONO + H2O + CH3-NH-N=O
1 record matched CH3NH2 + ·OH → H2O + CH3NH
1 record matched CH3NH2 + ·OH → H2O + CH2NH2
1 record matched CH3NH2 + ·OH → Other Products + H2O
7 records matched CH3Cl + ·OH → ·CH2Cl + H2O
5 records matched C2H2 + ·OH → ·C2H + H2O
1 record matched C2H4 + COH → H2O + Cycloprop-1-enyl
6 records matched C2H4 + ·OH → C2H3 + H2O
10 records matched C2H6 + ·OH → ·C2H5 + H2O
3 records matched CH3Br + ·OH → H2O + ·CH2Br
32 records matched CH4 + ·OH → ·CH3 + H2O
1 record matched 1-C5H11OOH + ·OH → CH3CH2CH2CH2CH(·)OOH + H2O
2 records matched sec-C4H9CH(NH2)COOH + ·OH → CH2(·)CH2CH(CH3)CH(NH2)COOH + H2O
2 records matched sec-C4H9CH(NH2)COOH + ·OH → CH3CH(·)CH(CH3)CH(NH2)COOH + H2O
1 record matched Adenine + ·OH → Other Products + H2O
1 record matched Adenine + ·OH → 6-amino-1H-Purin-1-yl radical + H2O
1 record matched Adenine + ·OH → 6-amino-1H-Purin-9-yl radical + H2O
1 record matched Adenine + ·OH → 6-amino-1H-Purin-4-yl radical + H2O
2 records matched Adenine + ·OH → 6-(·NH-)-1H-Purine + H2O
4 records matched CH3CCl3 + ·OH → H2O + CCl3CH2
1 record matched Benzene + O· → Benzyne + H2O
2 records matched Benzene + ·OH → Phenyl + H2O
1 record matched Benzene + H2 + H2O → 1,4-Cyclohexadiene + H2O
1 record matched Benzene + H2 + H2O → 1,3-Cyclohexadiene + H2O
1 record matched n-C5H11OH + ·OH → H2O + n-C5H11
1 record matched n-C5H11OH + ·OH → Other Products + H2O
2 records matched n-C5H11OH + ·OH → CH3CH2CH2CH(·)CH2OH + H2O
1 record matched n-C5H11OH + ·OH → ·CH2CH2CH2CH2CH2OH + H2O
1 record matched n-C5H11OH + ·OH → CH3CH2CH2CH2CH(·)OH + H2O
1 record matched n-C5H11OH + ·OH → CH3CH2CH(.)CH2CH2OH + H2O
1 record matched n-C5H11OH + ·OH → CH3CH(·)CH2CH2CH2OH + H2O
1 record matched n-C5H11OH → 1-C5H10 + H2O
3 records matched n-C4H9OH + ·OH → H2O + CH3CH2CH2C(·)HOH
4 records matched n-C4H9OH + ·OH → H2O + CH3CH2CH2CH2
4 records matched n-C4H9OH + ·OH → HOCH2CH2CH2CH2 + H2O
4 records matched n-C4H9OH + ·OH → Other Products + H2O
2 records matched n-C4H9OH + ·OH → CH3CH2CH2CH2O· + H2O
6 records matched n-C4H9OH + ·OH → CH3CH2CH(·)CH2OH + H2O
7 records matched n-C4H9OH + ·OH → CH3CH(·)CH2CH2OH + H2O
2 records matched n-C4H9OH + ·OH → CH3CH2CH2CH(·)OH + H2O
3 records matched n-C4H9OH + ·OH → (·)CH2CH2CH2CH2OH + H2O
1 record matched n-C4H9OH → CH3CH2CH2CH + H2O
1 record matched n-C4H9OH → Methylcyclopropane + H2O
1 record matched n-C4H9OH → Cyclobutane + H2O
3 records matched n-C4H9OH → 1-C4H8 + H2O
1 record matched Cytosine + ·OH → C4H4N3O + H2O
2 records matched n-C3H7OH + ·OH → H2O + n-C3H7O
2 records matched n-C3H7OH + ·OH → CH3CH(·)CH2OH + H2O
2 records matched n-C3H7OH + ·OH → HOCH2CH2CH2· + H2O
2 records matched n-C3H7OH + ·OH → C2H5CH(·)OH + H2O
1 record matched n-C3H7OH + ·OH → Other Products + H2O
2 records matched n-C3H7OH → CH3CH=CH2 + H2O
3 records matched (CH3)2SO + ·OH → CH3SCH2O· + H2O
1 record matched CHCl3 + H· → ·CCl3 + H2O
4 records matched CHCl3 + ·OH → ·CCl3 + H2O
5 records matched Acetone + ·OH → CH3C(O)CH2(·) + H2O
1 record matched Acetone → CH2=C=CH2 + H2O
1 record matched Acetone → CH3CCH + H2O
1 record matched iso-C3H7OH + ·OH → CH3CH(OH)CH2 + H2O
1 record matched iso-C3H7OH + ·OH → (CH3)2C(OH) + H2O
1 record matched iso-C3H7OH + ·OH → OCH(CH3)2 + H2O
4 records matched iso-C3H7OH → H2O + (CH3)2C
7 records matched iso-C3H7OH → CH3CH=CH2 + H2O
5 records matched CH3OH + H· → ·CH3 + H2O
6 records matched CH3OH + ·OH → (·)CH2OH + H2O
7 records matched CH3OH + ·OH → CH3O· + H2O
2 records matched CH3OH + ·OH → Other Products + H2O
2 records matched CH3OH → CH2(1) + H2O
1 record matched CH3OH → CH_2(aA_1) + H2O
2 records matched CH3C(O)OH + ·OH → H2O + CH3C(O)O
2 records matched CH3C(O)OH + ·OH → ·CH2C(O)OH + H2O
1 record matched CH3C(O)OH + ·OH → CO2 + ·CH3 + H2O
1 record matched CH3C(O)OH + ·OH → Other Products + H2O
1 record matched CH3C(O)OH → H2C=C=O + H2O
1 record matched HCOOH + H2SO4 → HCOOH + SO3 + H2O
1 record matched HCOOH + SO3 + H2O → HCOOH + H2SO4
1 record matched HCOOH + ·OH + H2O → HOCO + H2O + H2O
1 record matched HCOOH + ·OH + H2O → ·OC(O)H + H2O + H2O
1 record matched HCOOH + ·OH + HCl → HCOOH + H2O + ·Cl
3 records matched HCOOH + ·OH → H2O + HCOO
1 record matched HCOOH + ·OH → HOC(·)O + H2O
1 record matched HCOOH + ·OH → Other Products + H2O
2 records matched HCOOH + ·OH → HOCO + H2O
2 records matched HCOOH + ·OH → ·OC(O)H + H2O
3 records matched HCOOH → CO + H2O
1 record matched C2H5OH + H· → ·C2H5 + H2O
4 records matched C2H5OH + ·OH → HOCH2CH2· + H2O
5 records matched C2H5OH + ·OH → CH3CH(·)OH + H2O
4 records matched C2H5OH + ·OH → CH3CH2O· + H2O
2 records matched C2H5OH + ·OH → Other Products + H2O
8 records matched C2H5OH → C2H4 + H2O
1 record matched Carbaril + ·OH → C10H7OC(O)NHCH2· + H2O
1 record matched Carbaril + ·OH → C10H7OC(O)N(·)CH3 + H2O
1 record matched Carbaril + ·OH → 1-(2-methylcarbomato)-naphthalen-2-yl + H2O
1 record matched Carbaril + ·OH → 1-(2-methylcarbomato)-naphthalen-3-yl + H2O
1 record matched Carbaril + ·OH → 1-(2-methylcarbomato)-naphthalen-4-yl + H2O
1 record matched Carbaril + ·OH → 1-(2-methylcarbomato)-naphthalen-6-yl + H2O
1 record matched Carbaril + ·OH → 1-(2-methylcarbomato)-naphthalen-7-yl + H2O
1 record matched Carbaril + ·OH → 1-(2-methylcarbomato)-naphthalen-8-yl + H2O
1 record matched Carbaril + ·OH → 1-(2-methylcarbomato)-naphthalen-9-yl + H2O
2 records matched (CH3)2NNO + ·OH → ·CH2N(CH3)NO + H2O
1 record matched Dimethoate + ·OH → ·H2COP(CH3O)(S)SC(·)HC(O)NHCH3 + H2O
1 record matched Dimethoate + ·OH → (CH3O)2P(S)SCH(·)C(O)NHCH3 + H2O
1 record matched Dimethoate + ·OH → (CH3O)2P(S)SCH2C(O)N(·)CH3 + H2O
1 record matched CH3NHNH2 + ·OH → Products + H2O
2 records matched CH3NHNH2 + ·OH → CH3N(·)NH2 + H2O
1 record matched CH3NHNH2 + ·OH → CH3NHNH· + H2O
2 records matched CH3NHNH2 + ·OH → ·CH2NHNH2 + H2O
1 record matched CH3NHNH2 + ·OH → cis-CH3NHNH· + H2O
1 record matched CH3NHNH2 + ·OH → trans-CH3NHNH· + H2O
1 record matched (C2H5)2O + ·OH → C2H5OCH2CH2· + H2O
2 records matched (C2H5)2O + ·OH → Other Products + H2O
1 record matched (C2H5)2O + ·OH → CH3CH(·)OCH2CH3 + H2O
1 record matched 2-Phenylethanol → Styrene + H2O
1 record matched L-CH3SCH2CH2CH(NH2)COOH + ·OH → H2O + CH3SC(·)HCH2CH(NH2)CO2H
1 record matched L-CH3SCH2CH2CH(NH2)COOH + ·OH → CH3SCH2C(·)HCH(NH2)CO2H + H2O
1 record matched L-CH3SCH2CH2CH(NH2)COOH + ·OH → CH3SCH2CH2C(·)(NH2)CO2H + H2O
1 record matched 2,3,4,6-Tetrachlorophenol + ·OH → 2,3,4,6-tetrachlorophenoxy radical + H2O
3 records matched CH3CH(OH)CH2OH → CH2=CHCH2OH + H2O
1 record matched CH3CH(OH)CH2OH → Methyloxirane + H2O
2 records matched CH3CH(OH)CH2OH → CH2O + C2H4 + H2O
1 record matched CN + H2O → HO-C≡N + H·
2 records matched CN + H2O → HCN + ·OH
1 record matched Glycerol → Glycidol + H2O
2 records matched Glycerol → CH3C(O)CH2OH + H2O
2 records matched Glycerol → cis-CH2OHCH=CHOH + H2O
2 records matched Glycerol → trans-CH2OHCH=CHOH + H2O
4 records matched Glycerol → CH2OHCOH=CH2 + H2O
1 record matched L-Serine + ·OH → HOCHCH(NH2)C(O)OH + H2O
1 record matched L-Serine + ·OH → HOCH2C(NH2)C(O)OH + H2O
1 record matched Benzo[a]pyrene + ·OH → Other Products + H2O
1 record matched Benzo[a]pyrene + ·OH → benzo[a]pyrenyl armchair radical + H2O
1 record matched Benzo[a]pyrene + ·OH → benzo[a]pyrenyl zigzag radical + H2O
2 records matched Propanoic acid, 2-hydroxy- → H2O + Oxiranone, methyl-
1 record matched Propanoic acid, 2-hydroxy- → CH3CHO + CO + H2O
1 record matched CH2O + CH2OO → CH2O + CO + H2O
1 record matched CH2O + H2O → ·CH3 + HO2
1 record matched CH2O + NH3 + H2O → NH2CH2OH + H2O
1 record matched CH2O + CH3NHCH2OH + H2O → CH3N(CH2OH)2 + H2O
14 records matched CH2O + ·OH → HCO + H2O
2 records matched CH2O + ·OH → CO + H2O + H·
1 record matched CH2O + (CH3)2NH + H2O → H2O + (CH3)2NCH2OH
1 record matched CH2O + CH3NH2 + H2O → CH3NHCH2OH + H2O
1 record matched CH2FCF2OCHF2 + ·OH → Other Products + H2O
1 record matched O(1D) + NH3 → H2O + NH
1 record matched O(1D) + CH3CN → ·HCC≡N + H2O
1 record matched O2(1DELTA) + H2S → H2O + SO
1 record matched O2(1DELTA) + H2O → HO2 + ·OH
1 record matched Bicyclo[4.4.0]decane, cis- + ·OH → Other Products + H2O
1 record matched (Z)-CH2=CHCH=CH2 + ·OH → (Z)-CH2=CHCH(·)CH2OH + H2O
1 record matched (Z)-CH2=CHCH=CH2 + ·OH → CH2=CHCH(OH)CH2(·) + H2O
1 record matched cis-HONO + HOCl → cis-ClONO + H2O
1 record matched cis-HONO + H2O + CH3-NH-N=O → CH3-N=N-OH + cis-HONO + H2O
1 record matched cis-HONO + HNO3 → H2O + ONONO2
2 records matched cis-HONO + HCl → ClNO + H2O
1 record matched cis-HONO + ·OH → H2O + NO2
1 record matched cis-HONO + cis-HONO → H2O + N2O3
1 record matched cis-HONO + cis-HONO → H2O + NO + NO2
1 record matched trans-HONO + NH2NH → H2O + NO + (Z)-HN=NH
1 record matched trans-HONO + HOCl → H2O + ClNO2
2 records matched trans-HONO + HNO3 → H2O + ONONO2
2 records matched trans-HONO + HCl → ClNO + H2O
1 record matched trans-HONO + ·OH → H2O + NO2
1 record matched trans-HONO + cis-HONO → H2O + N2O3
1 record matched trans-HONO + cis-HONO → H2O + NO + NO2
1 record matched trans-HONO + trans-HONO → H2O + NO + NO2
1 record matched C3H + H2O → H· + CH2=C=C=O
1 record matched C3H + H2O → CO + C2H3
1 record matched C3H + H2O → HC≡CCHO + H·
1 record matched C3H + H2O → C2H2 + HCO
3 records matched HO2-H2O Complex + SO3 → HOS(O)(O)OO· + H2O
1 record matched HO2-H2O Complex + HO2 → H2O + H2O + O3
1 record matched HO2-H2O Complex + HO2 → H2O2 + H2O + O2
1 record matched HO2-H2O Complex + CH3O2· → CH3OOH + H2O + O2
1 record matched HO2-H2O Complex + CH3O2· → CH3OH + H2O + O3
1 record matched (CH3)3CCH2CH2CH2CH3 + ·OH → Other Products + H2O
1 record matched CD3F + ·OH → CD2F + H2O
1 record matched CH3CH(O)CH2CH2OCH3 + O2 → CH3C(O)CH2CH2OCH3 + H2O
2 records matched CH3OCF(CF3)2 + ·OH → CF3CF2CF2OCH2 + H2O
2 records matched CH3OCF2CF2CF3 + ·OH → CF3CF2CF2OCH2 + H2O
4 records matched CH3OCF2CF3 + ·OH → ·CH2OCF2CF3 + H2O
1 record matched O(1D) + C2H5F → H2O + CH2FCH:
1 record matched O(1D) + C2H5F → H2O + CH3CF:
1 record matched O(1D) + C2H5F → CH2=CHF + H2O
1 record matched O(1D) + C2H6 → Products + H2O
1 record matched O(1D) + CH4 → CH_2(aA_1) + H2O
1 record matched O2(1Delta_g) + H2O → HO2 + ·OH
2 records matched CHF2OCH2CF2CHF2 + ·OH → Other Products + H2O
2 records matched CHF2OCH2CF2CF3 + ·OH → Other Products + H2O
1 record matched C6H5CH(OOH)CH3 + Ethylbenzene → C6H5CH(O·)CH3 + 1-phenylethyl + H2O
1 record matched SiCl2(OH)2 + H2O → SiCl(OH)3 + HCl
1 record matched SiCl2(OH)2 + SiCl2(OH)2 → SiCl2(OH)OSiCl2(OH) + H2O
1 record matched (H2O)2 + (CH3)2C(·)OO· → (CH3)2C(OH)OOH + H2O
2 records matched (H2O)2 + CH2OO → H2O + HOCH2OOH
2 records matched (H2O)2 + N2O5 → HNO3 + HNO3 + H2O
1 record matched (H2O)2 + HBr + HOBr → Br2 + H2O + H2O + H2O
1 record matched (H2O)2 + HCl + HOBr → H2O + H2O + H2O + BrCl
1 record matched (H2O)3 + HBr + HOBr → Br2 + H2O + H2O + H2O + H2O
1 record matched (H2O)3 + HCl + HOBr → H2O + H2O + H2O + H2O + BrCl
1 record matched SiCl(OH)3 + H2O → Si(OH)4 + HCl
1 record matched SiCl(OH)3 + SiCl(OH)3 → SiCl(OH)2OSiCl(OH)2 + H2O
1 record matched (2,4-dichlorocyclohexa-2,4-dienon-5-yl)-(2,4-dichlorocyclohexa-2,4,6-trienenol-5-yl) → 2,4,6,8-tetrachlorodibenzofuran + H2O
1 record matched Si(OH)4 + Si(OH)4 → Si(OH)3OSi(OH)3 + H2O
1 record matched (E)-CH2=CHCH=CH2 + ·OH → (E)-CH2=CHCH(·)CH2OH + H2O
1 record matched (E)-CH2=CHCH=CH2 + ·OH → CH2=CHCH(OH)CH2(·) + H2O
1 record matched (E)-CH2=C(CH3)CH=CH2 + ·OH → H2O + CH2=C(CH3)CH(OH)CH2(·)
1 record matched (E)-CH2=C(CH3)CH=CH2 + ·OH → H2O + CH2=CHC(CH3)(OH)CH2(·)
2 records matched (E)-CH2=C(CH3)CH=CH2 + ·OH → CH2=CHC(·)(CH3)CH2OH + H2O
2 records matched (E)-CH2=C(CH3)CH=CH2 + ·OH → CH2=C(CH3)CH(·)CH2OH + H2O
1 record matched CH2(X3B_1) + ·OH → ·CH + H2O
1 record matched CF3CF2OC(O)H + ·OH → CF3CF2OC(O)· + H2O
2 records matched HOCO + ·OH → CO2 + H2O
1 record matched HOCO + ·CH3 → H2C=C=O + H2O
1 record matched (3)NH + H2O → ·OH + NH2
4 records matched CF3CF2CF2CF2OCH2CH3 + ·OH → Other Products + H2O
1 record matched CHF2CH2OCF3 + ·OH → Other Products + H2O
1 record matched CHF2CF2CH2OCH3 + ·OH → Other Products + H2O
1 record matched CF3CF2CH2OCH3 + ·OH → Other Products + H2O
1 record matched CHF2CF2CF2OCH3 + ·OH → Other Products + H2O
2 records matched CF3CF2CH2OCF3 + ·OH → CF3CF2CH(.)OCF3 + H2O
3 records matched CHF2CF2CH2OCF2CHF2 + ·OH → Other Products + H2O
1 record matched CHF2CF2CF2CF2CH2OCH3 + ·OH → Other Products + H2O
2 records matched (HO)2PO + H· → H2O + HOPO
1 record matched trans-HBOH → B + H2O
1 record matched HOOOCl + ·OH → cis-ClOOO + H2O
1 record matched Ni(3D) + CO2 + H2 → Ni(3D) + CO + H2O
1 record matched HOBrO + ·OH → H2O + BrO2
1 record matched (CH3)2S-H2O complex + O3 → (CH3)2SO + H2O + O2
1 record matched (CH3)2S-(H2O)2 complex + O3 → (CH3)2SO + H2O + H2O + O2
1 record matched (CH3)2S-(H2O)3 complex + O3 → (CH3)2SO + H2O + H2O + H2O + O2
1 record matched O3-H2O complex + (CH3)2S → (CH3)2SO + H2O + O2
1 record matched O3-H2O complex + (CH3)2S-H2O complex → (CH3)2SO + H2O + H2O + O2
1 record matched O3-H2O complex + (CH3)2S-(H2O)2 complex → (CH3)2SO + H2O + H2O + H2O + O2
1 record matched O3-(H2O)2 complex + (CH3)2S → (CH3)2SO + H2O + H2O + O2
1 record matched O3-(H2O)2 complex + (CH3)2S-H2O complex → (CH3)2SO + H2O + H2O + H2O + O2
1 record matched O3-(H2O)3 complex + (CH3)2S → (CH3)2SO + H2O + H2O + H2O + O2
1 record matched CH3N(·)NH2 + ·OH → H2O + CH2=N-NH2
1 record matched CH3N(·)NH2 + ·OH → H2O + CH3N=NH
1 record matched CH3NHNH· + ·OH → H2O + CH3N=NH
1 record matched CH3NHNH· + ·OH → CH3NHN + H2O
1 record matched HOC(O)OH + ·OH → CO2 + ·OH + H2O
1 record matched HOC(O)OH → CO2 + H2O
1 record matched CHCl2OOH → COCl2 + H2O
1 record matched 1-C8H17OOH + ·OH → C7H15CH(·)OOH + H2O
1 record matched [13]CH3Cl + ·OH → [13]CH2Cl + H2O
1 record matched CH2=CHC(=CH2)OOH + H2O → CH2=CHC(O)CH2OH + H2O
1 record matched W(1S) + H2O → WO(1sigma+) + H2
1 record matched W(3P) + H2O → WO(3sigma+) + H2
1 record matched W(5D) + H2O → WO(3sigma+) + H2
1 record matched W(7S) + H2O → WO(3sigma+) + H2
1 record matched NH2COCH2NHCOH + ·OH → NH2C(O)CH(·)NHC(O)H + H2O
1 record matched CH3NHC(O)CH2NHC(O)CH2NHC(O)CH3 + ·OH → CH3NHC(O)CH2NHC(O)CH(·)NHC(O)CH3 + H2O
1 record matched CH3NHCH2C(O)NH2 + ·OH → CH3NHCH(·)C(O)NH2 + H2O
1 record matched CH3C(O)CCl2F + ·OH → ·CH2C(O)CCl2F + H2O
1 record matched CH3C(O)CCl2Br + ·OH → ·CH2C(O)CCl2Br + H2O
1 record matched CCl3CH2CH2OH → CH2=CHCCl3 + H2O
1 record matched trans-2,4-Cyclohexadienylperoxy, 6-hydroxy- → Phenol + H2O
1 record matched CH2=C(OH)-CH2· + H· → CH2=C=CH2 + H2O
1 record matched CH2=C(OH)-CH2· + H· → CH3CCH + H2O
1 record matched CBr(O)CH(O) + ·OH → BrC(O)C(O)· + H2O
1 record matched CHBrO(·)COBr + O2 → H2O + BrCOCOBr
1 record matched s-triazinyl + H2O → 1,3,5-Triazine + ·OH
1 record matched c-N3 + H2O → c-N3H + ·OH
1 record matched CH3-N=N-OH + cis-HONO + H2O → trans-HONO + CH2N2 + H2O + H2O
1 record matched CH3NiOH → H2O + Ni(CH2)
1 record matched CH3S(O)(OH)CH3 + ·OH → (CH3)2SO2 + H2O
1 record matched HOS(O)(O)OO· + H2O → HSO5•H2O
1 record matched n-C4F9OC(O)H + ·OH → CF3CF2CF2CF2OC(O)· + H2O
1 record matched (CH3)2C=CHCH2CH(·)OO· + H2O → (CH3)2C=CHCH2CH(OH)OOH
1 record matched (CH3)2C=CHCH2CH(OH)OOH → (CH3)2C=CHCH2C(O)OH + H2O
1 record matched (CH3)2C=CHCH=CHOOH + H2O → (CH3)2C=CHCH(OH)CHO + H2O
1 record matched HONO (unspecified cis/trans isomer) + HNO3 → H2O + NO2 + NO2
1 record matched HONO (unspecified cis/trans isomer) + ·OH → H2O + NO2
1 record matched (CF3)2CFOCHO + ·OH → (CF3)2CFOC(O)· + H2O
1 record matched (CH3)2SeO + ·OH → CH3Se(O)CH2· + H2O
1 record matched CH3OC(O)C(·)(CH3)OO· + H2O → Other Products + H2O
1 record matched 2-methylfuran-3-yl + H2O → 2-Methylfuran + ·OH
1 record matched 2-methylfuran-4-yl + H2O → 2-Methylfuran + ·OH
1 record matched 2-methylfuran-5-yl + H2O → 2-Methylfuran + ·OH
1 record matched 2-(4-Chlorophenyl)ethenol + ·OH → 2-(4-Chlorophenyl)vinoxy radical + H2O
1 record matched [H2SO4..OH2] complex + ·OH → HOSO3 + H2O + H2O
1 record matched NH2NH2O + H2O → NH3 + HNO
1 record matched O=CHN(OH)2 → CH(O)NO + H2O
1 record matched (L)-C6H5CH(OH)OOH + H2O → Products
1 record matched (L)-C6H5CH(OH)OOH → Benzoic acid + H2O
1 record matched (D)-C6H5CH(OH)OOH + H2O → Products
1 record matched (D)-C6H5CH(OH)OOH → Benzoic acid + H2O
1 record matched (L)-C6H5CH(NH2)OOH → Benzamide + H2O
2 records matched (D)-C6H5CH(NH2)OOH → H2O
1 record matched C6H5CH(·)OO· + H2O → Products
1 record matched Aziridine borane + H2O → Ethyneimine borane + H2 + H2O
1 record matched 3-Methyl-1,2-BN-cyclopentane + H2O → 3-Methyl-1,2-BN-cyclopent-1-ene + H2 + H2O
1 record matched HO(O)CSSH + ·OH → HSSC(O)O· + H2O
1 record matched HO(O)CSSH + ·OH → ·SSC(O)OH + H2O
1 record matched 3SO2 + H2O → HOSO + ·OH
1 record matched HSSCN + ·OH → ·SSCN + H2O
1 record matched HSSNO2 + ·OH → ·SSNO2 + H2O
1 record matched anti-Syn-CH3CH2CH(·)OO(·) + H2O → CH3CH2CH(OH)OOH
1 record matched anti-Syn-CH3CH2CH(·)OO(·) + (H2O)2 → CH3CH2CH(OH)OOH + H2O
1 record matched anti-Gauche-CH3CH2CH(·)OO(·) + H2O → CH3CH2CH(OH)OOH
1 record matched anti-Gauche-CH3CH2CH(·)OO(·) + (H2O)2 → CH3CH2CH(OH)OOH + H2O
1 record matched syn-Anti-CH3CH2CH(·)OO(·) + H2O → CH3CH2CH(OH)OOH
1 record matched syn-Anti-CH3CH2CH(·)OO(·) + (H2O)2 → CH3CH2CH(OH)OOH + H2O
1 record matched syn-Gauche-CH3CH2CH(·)OO(·) + H2O → CH3CH2CH(OH)OOH
1 record matched syn-Gauche-CH3CH2CH(·)OO(·) + (H2O)2 → CH3CH2CH(OH)OOH + H2O
1 record matched anti-Syn-CH2CHCH(·)OO(·) + H2O → HOCH2CH=CHOOH
1 record matched anti-Syn-CH2CHCH(·)OO(·) + (H2O)2 → HOCH2CH=CHOOH + H2O
1 record matched anti-Anti-CH2CHCH(·)OO(·) + H2O → HOCH2CH=CHOOH
1 record matched anti-Anti-CH2CHCH(·)OO(·) + (H2O)2 → HOCH2CH=CHOOH + H2O
1 record matched syn-Syn-CH2CHCH(·)OO(·) + H2O → HOCH2CH=CHOOH
1 record matched syn-Syn-CH2CHCH(·)OO(·) + H2O → CH2=CHCH(OH)OOH
1 record matched syn-Syn-CH2CHCH(·)OO(·) + (H2O)2 → HOCH2CH=CHOOH + H2O
1 record matched syn-Syn-CH2CHCH(·)OO(·) + (H2O)2 → CH2=CHCH(OH)OOH + H2O
1 record matched syn-Anti-CH2CHCH(·)OO(·) + H2O → HOCH2CH=CHOOH
1 record matched syn-Anti-CH2CHCH(·)OO(·) + (H2O)2 → HOCH2CH=CHOOH + H2O
1 record matched syn-CHCCH(·)OO(·) + H2O → Products
1 record matched syn-CHCCH(·)OO(·) + (H2O)2 → Other Products + H2O
1 record matched anti-CHCCH(·)OO(·) + H2O → Products
1 record matched anti-CHCCH(·)OO(·) + (H2O)2 → Other Products + H2O
1 record matched (CF3)2CHOCHO + ·OH → Other Products + H2O
1 record matched CH3OS(O)2N + H2O → Products
1 record matched CH3CH(CH3)CH2OOH + ·OH → CH3CH(CH3)CH(·)OOH + H2O
1 record matched C2H5CH(CH3)CH2OOH + ·OH → C2H5CH(CH3)CH(·)OOH + H2O
1 record matched CH3CH(CH3)C2H4CH2OOH + ·OH → CH3CH(CH3)C2H4CH(·)OOH + H2O
1 record matched C3H7CH(CH3)CH2OOH + ·OH → C3H7CH(CH3)CH(·)OOH + H2O
1 record matched CH3CH(CH3)C3H6CH2OOH + ·OH → CH3CH(CH3)C3H6CH(·)OOH + H2O
1 record matched C2H5CH(CH3)C2H4CH2OOH + ·OH → C2H5CH(CH3)C2H4CH(·)OOH + H2O
1 record matched C4H9CH(CH3)CH2OOH + ·OH → C4H9CH(CH3)CH(·)OOH + H2O
1 record matched CH3CH(CH3)CH2CH(CH3)CH2OOH + ·OH → CH3CH(CH3)CH2CH(CH3)CH(·)OOH + H2O
1 record matched CH3CH(CH3)C4H8CH2OOH + ·OH → CH3CH(CH3)C4H8CH(·)OOH + H2O
1 record matched C5H11CH(CH3)CH2OOH + ·OH → C5H11CH(CH3)CH(·)OOH + H2O
1 record matched C2H5CH(CH3)CH2CH(CH3)CH2OOH + ·OH → C2H5CH(CH3)CH2CH(CH3)CH(·)OOH + H2O
1 record matched C2H5CH(C2H5)C2H4CH2OOH + ·OH → C2H5CH(C2H5)C2H4CH(·)OOH + H2O
1 record matched benzo[a]pyrenyl armchair radical + H2O → Benzo[a]pyrene + ·OH
1 record matched benzo[a]pyrenyl zigzag radical + H2O → Benzo[a]pyrene + ·OH
1 record matched HNCO···(CH3)2NH complex + H2O → (CH3)2NCONH2 + H2O
1 record matched HNCO···H2O complex + (CH3)2NH → (CH3)2NCONH2 + H2O
1 record matched CH2OO···H2O complex + H2O → H2O + HOCH2OOH
1 record matched ·CH2OC(O)CH2CH2CH3 + H2O → Methyl butanoate + ·OH
1 record matched CH3OC(O)CH·CH2CH3 + H2O → Methyl butanoate + ·OH
1 record matched CH3OC(O)CH2CH·CH3 + H2O → Methyl butanoate + ·OH
1 record matched CH3OC(O)CH2CH2CH2· + H2O → Methyl butanoate + ·OH
1 record matched trans-HC(S·)OH → CS + H2O
1 record matched CH2(1) + H2O → CH3OH
1 record matched CF2-trip + H2O → ·CHF2 + ·OH
1 record matched H2GeNaF + H2O → Products
1 record matched [13]CH4 + ·OH → [13]CH3 + H2O
1 record matched [·OH..OH2] complex + H2SO4 → HOSO3 + H2O + H2O
1 record matched [·OH..OH2] complex + CO → CO2 + H2O + H·
1 record matched CH2=P(O)OH → HCPO + H2O
1 record matched O=P(OH)3 + H· → O=P(·)(OH)2 + H2O
1 record matched O=P(OH)3 → H2O + HOPO2
3 records matched syn-CH3CH(·)OO· + H2O → Products
1 record matched syn-CH3CH(·)OO· + H2O → CH3CH(OH)OOH
1 record matched syn-CH3CH(·)OO· + (H2O)2 → CH3CH(OH)OOH + H2O
2 records matched anti-CH3CH(·)OO· + H2O → Products
2 records matched anti-CH3CH(·)OO· + H2O → CH3CH(OH)OOH
1 record matched anti-CH3CH(·)OO· + (H2O)2 → CH3CH(OH)OOH + H2O
1 record matched O2(b1Sigma_g+) + H2O → HO2 + ·OH
1 record matched (·)P(OH)4 → O=P(·)(OH)2 + H2O

Search returned 5165 records.