Kinetics Database Logo

Kinetics Database Resources

Simple Reaction Search

Search Reaction Database

Search Bibliographic Database

Set Unit Preferences


Rate Our Products and Services


Other Databases

NIST Standard Reference Data Program

NIST Chemistry Web Book

NDRL-NIST Solution Kinetics Database

NIST Computational Chemistry Comparison and Benchmark Database

The NIST Reference on Constants, Units, and Uncertainty


Administrative Links

NIST home page

MML home page

Chemical Sciences Division

  NIST Logo Home
©NIST, 2020
Accessibility information

Search Results

Click on a link in the table below to see detail on the selected reaction.

Records   Reaction
1 record matched SO3 + O· → SO2 + O2
1 record matched Nitrobenzene + O2 → Products
1 record matched CCl2 (A 1B1) + O2 → Products
1 record matched hv(193 nm) + O3 → O(1S) + O2
1 record matched 2-oxepinoxy + O2 → Products
2 records matched CF3CF2OO· + CF3CF2OO· → O2 + CF3OCF2(·) + CF3OCF2(·)
1 record matched CHF2CF2OO + CHF2CF2OO → Other Products + O2
1 record matched CHF2OO + CHF2OO → Other Products + O2
1 record matched CF3CFHO2· + CF3CFHO2· → Other Products + O2
1 record matched CH2FO2 + CH2FO2 → Other Products + O2
1 record matched CH2BrOO + CH2BrOO → CH2BrO + CH2BrO + O2
1 record matched CH2BrOO + CH2BrOO → CH2BrOOCH2Br + O2
2 records matched CH3C(O)CH2OO· + CH3C(O)CH2OO· → CH3C(O)CHO + CH3C(O)CH2OH + O2
2 records matched CH3C(O)CH2OO· + CH3C(O)CH2OO· → CH3C(O)CH2O· + CH3C(O)CH2O· + O2
2 records matched CH2ClO2 + CH2ClO2 → O2 + CH2ClO + CH2ClO
2 records matched CH3OCH2O2 + CH3OCH2O2 → O2 + CH3OCH2O· + CH3OCH2
4 records matched n-C3H7O2 + n-C3H7O2 → Other Products + O2
3 records matched HOCH2CH2O2· + HOCH2CH2O2· → O2 + HOCH2CH2O + HOCH2CH2O
3 records matched HOCH2CH2O2· + HOCH2CH2O2· → HOCH2CH2OH + HOCH2CHO + O2
1 record matched CH3C(O)OO(·) + CH3C(O)CH2OO· → Other Products + O2
1 record matched CH3C(O)OO(·) + CH3C(O)CH2OO· → CH3C(O)CH2O· + O2 + CH3C(O)O
3 records matched CH3C(O)OO(·) + CH3C(O)OO(·) → O2 + CH3C(O)O + CH3C(O)O
3 records matched CH3C(O)OO(·) + CH3C(O)OO(·) → Other Products + O2
2 records matched HOCH2OO + HOCH2OO → O2 + HOCH2O + HOCH2O
3 records matched HOCH2OO + HOCH2OO → HCOOH + CH2(OH)2 + O2
2 records matched HOCH2OO + HOCH2OO → Other Products + O2
1 record matched O· + NCO → CN + O2
2 records matched O· + O· → O2
8 records matched OClO + O· → O2 + ClO
1 record matched CF3O2 + CF3CFHO2· → Other Products + O2
2 records matched CF3O2 + CF3O2 → O2 + CF3O + CF3O
8 records matched BrO + O· → O2 + Br·
6 records matched BrO + BrO → O2 + Br· + Br·
6 records matched BrO + BrO → Br2 + O2
7 records matched O2F + O· → O2 + OF
7 records matched O2F → O2 + ·F
10 records matched ClO + O· → O2 + ·Cl
7 records matched ClO + BrO → O2 + BrCl
8 records matched ClO + ClO → O2 + Cl2
1 record matched ·F + O2F → F2 + O2
7 records matched IO + O· → O2 + I
1 record matched IO + ClO → O2 + I + ·Cl
1 record matched IO + ClO → O2 + ICl
1 record matched AlO + O· → Al + O2
1 record matched BO + O· → B + O2
1 record matched FeO2 → Fe + O2
2 records matched NaO + O· → Na + O2
7 records matched OF + O· → O2 + ·F
2 records matched OF + OF → O2 + ·F + ·F
2 records matched NaO2 + O· → O2 + NaO
7 records matched NO3 + O· → O2 + NO2
3 records matched NO3 + NO3 → O2 + NO2 + NO2
1 record matched NO3 → O2 + NO
8 records matched NO2 + O· → O2 + NO
2 records matched NO2 + NO3 → O2 + NO + NO2
1 record matched NO2 + NO2 → O2 + NO + NO
5 records matched NO + O· → O2 + N
6 records matched NO + O2F → O2 + FNO
2 records matched ClOO + ·Cl → O2 + Cl2
5 records matched ClOO → O2 + ·Cl
9 records matched O3 + ·Cl → O2 + ClO
4 records matched O3 + CF3O → O2 + CF3O2
3 records matched O3 + N → O2 + NO
7 records matched O3 + O· → O2 + O2
5 records matched O3 + OClO → O2 + ClO3
4 records matched O3 + CF3O2 → O2 + O2 + CF3O
5 records matched O3 + BrO → O2 + O2 + Br·
1 record matched O3 + O2F → O2 + O2 + OF
6 records matched O3 + ClO → O2 + OClO
5 records matched O3 + ClO → O2 + ClOO
8 records matched O3 + ·F → O2 + OF
1 record matched O3 + IO → O2 + Iodine dioxide
1 record matched O3 + IO → O2 + O2 + I
8 records matched O3 + I → O2 + IO
9 records matched O3 + SH → O2 + HSO
9 records matched O3 + SO → SO2 + O2
2 records matched O3 + NaO → O2 + NaO2
2 records matched O3 + NaO → Na + O2 + O2
3 records matched O3 + H· → ·OH + O2
3 records matched O3 + Cl2O2 → O2 + ClOO + ClO
8 records matched O3 + NO2 → O2 + NO3
7 records matched O3 + NO → O2 + NO2
9 records matched O3 + Br· → O2 + BrO
2 records matched O3 → O2 + O·
3 records matched N2O + O· → N2 + O2
2 records matched HNO2 + O3 → HNO3 + O2
1 record matched O2 + CF3CFHO → Products
5 records matched O2 + CS2OH → Products
2 records matched O2 + CH2ClO → HC(O)Cl + HO2
1 record matched O2 + CH2ClO → Products
7 records matched O2 + HSO → Products
4 records matched O2 + HSO2 → HO2 + SO2
3 records matched O2 + HSO2 → Products
1 record matched O2 + ·CH2 → CO + H2O
4 records matched O2 + ·CH2 → Products
2 records matched O2 + HCCO → Products
8 records matched O2 + HOSO2 → HO2 + SO3
4 records matched O2 + CH3SCH2 → CH3SCH2OO·
1 record matched O2 + (CH3)2CHCH2O· → (CH3)2CHCHO + HO2
1 record matched O2 + ·Cl → ClO + O·
11 records matched O2 + ·Cl → ClOO
4 records matched O2 + CF3O → COF2 + O2F
2 records matched O2 + CH3CH2CH2CH2O· → CH3CH2CH2CHO + HO2
6 records matched O2 + N → NO + O·
18 records matched O2 + O· → O3
5 records matched O2 + ·CH2SH → Products
5 records matched O2 + n-C3H7O → C2H5CHO + HO2
1 record matched O2 + n-C3H7O → Products
12 records matched O2 + ·F → O2F
5 records matched O2 + SH → ·OH + SO
3 records matched O2 + SH → Products
10 records matched O2 + SO → SO2 + O·
1 record matched O2 + NH → HNO + O·
2 records matched O2 + NH → Products
7 records matched O2 + NH2 → Products
4 records matched O2 + NaO → NaO3
19 records matched O2 + H· → ·OH + O·
28 records matched O2 + H· → HO2
1 record matched O2 + Cyclohexadienyl → Benzene + HO2
5 records matched O2 + NO + NO → NO2 + NO2
3 records matched O2 → O· + O·
1 record matched H2O2 + O2 → HO2 + HO2
6 records matched S + O3 → O2 + SO
11 records matched S + O2 → SO + O·
1 record matched SO3 + O· → SO2 + O2
1 record matched SO2 + O· → O2 + SO
2 records matched SO2 + O3 → SO3 + O2
1 record matched Ge + O2 → O· + GeO
1 record matched B + O2 → BO + O·
1 record matched Ar + O· + O· → Ar + O2
2 records matched Na + O3 → O2 + NaO
5 records matched Na + O2 → NaO2
1 record matched Fe + O2 → FeO2
2 records matched Fe + O2 → FeO + O·
1 record matched Al + O2 → AlO + O·
4 records matched CH3S· + O2 → Products
4 records matched ·CH2Cl + O2 → CH2ClO2
1 record matched iso-C4H9 + O2 → (CH3)2CHCH2O2
1 record matched iso-C4H9 + O2 → iso-C4H8 + HO2
1 record matched iso-C4H9 + O2 → Products
3 records matched HOCH2CH2· + O2 → Products
1 record matched *CH2C(O)H + O2 → CH2O + CO + ·OH
1 record matched *CH2C(O)H + O2 → Products
3 records matched (CH3)2CHO2 + (CH3)2CHO2 → i-C3H7O + i-C3H7O + O2
2 records matched (CH3)2CHO2 + (CH3)2CHO2 → iso-C3H7OH + Acetone + O2
1 record matched (CH3)2CHO2 + (CH3)2CHO2 → Other Products + O2
6 records matched i-C3H7O + O2 → Acetone + HO2
1 record matched i-C3H7O + O2 → Products
4 records matched CHCl2 + O2 → Methyldioxy, dichloro-
2 records matched (CH3)3CO2 + (CH3)3CO2 → Other Products + O2
14 records matched ·OH + O· → O2 + H·
8 records matched ·OH + OClO → O2 + HOCl
1 record matched ·OH + ClO → HCl + O2
8 records matched ·OH + O3 → HO2 + O2
1 record matched ·OH + O2 → HO2 + O·
2 records matched ·CH + O2 → Products
1 record matched HO2 + CF3CFHO2· → Other Products + O2
2 records matched HO2 + CF3CCl2OO(·) → O2 + CF3CCl2OOH
2 records matched HO2 + CH3C(O)CH2OO· → CH3C(O)CH2OOH + O2
4 records matched HO2 + CH2ClO2 → O2 + CH2ClOOH
2 records matched HO2 + CH3C(O)OO(·) → CH3C(O)OOH + O2
9 records matched HO2 + ·Cl → HCl + O2
1 record matched HO2 + Cylopentyldioxy- → O2 + Hydroperoxide cyclopentyl
12 records matched HO2 + O· → ·OH + O2
3 records matched HO2 + BrO → O2 + HOBr
3 records matched HO2 + ClO → O2 + HOCl
7 records matched HO2 + IO → O2 + HIO
7 records matched HO2 + I → O2 + HI
12 records matched HO2 + H· → H2 + O2
1 record matched HO2 + NO3 → Other Products + O2
9 records matched HO2 + Br· → O2 + HBr
8 records matched HO2 + O3 → ·OH + O2 + O2
16 records matched HO2 + ·OH → H2O + O2
21 records matched HO2 + HO2 → H2O2 + O2
2 records matched HO2 → O2 + H·
10 records matched ·CCl3 + O2 → CCl3O2
4 records matched CH3CO + O2 → CH3C(O)OO(·)
2 records matched C2H5OO· + CF3CCl2OO(·) → CH3CH2O· + O2 + CF3CCl2O(·)
2 records matched C2H5OO· + CF3CCl2OO(·) → CF3CCl2OH + CH3CHO + O2
1 record matched C2H5OO· + NO3 → CH3CH2O· + O2 + NO2
9 records matched C2H5OO· + HO2 → CH3CH2OOH + O2
1 record matched C2H5OO· + C2H5OO· → CH3CH2O· + CH3CH2O· + O2
1 record matched C2H5OO· + C2H5OO· → Other Products + O2
2 records matched CH3C(O)CH2(·) + O2 → CH3C(O)CH2OO·
1 record matched CH3C(O)CH2(·) + O2 → Products
6 records matched CS + O3 → COS + O2
1 record matched CS + O2 → CO + SO
4 records matched CS + O2 → COS + O·
3 records matched CS + O2 → Products
1 record matched C2H3 + O2 → CH2=CHO· + O·
2 records matched C2H3 + O2 → C2H2 + HO2
1 record matched C2H3 + O2 → CH2O + HCO
2 records matched C2H3 + O2 → Products
8 records matched HCO + O2 → CO + HO2
1 record matched HCO + O2 → Products
7 records matched (·)CH2OH + O2 → CH2O + HO2
1 record matched 1-C4H9 + O2 → Products
1 record matched sec-C4H9 + O2 → Products
3 records matched CH3CH(·)OH + O2 → CH3CHO + HO2
11 records matched ·CF3 + O2 → CF3O2
5 records matched ·CH3 + O2 → CH3O· + O·
14 records matched ·CH3 + O2 → CH3O2·
2 records matched ·CH3 + O2 → CH2O + ·OH
2 records matched ·CH3 + O2 → Products
1 record matched ·CH3 + HO2 → CH4 + O2
9 records matched CH3CH2O· + O2 → CH3CHO + HO2
1 record matched CH3CH2O· + O2 → Products
14 records matched CH3O· + O2 → CH2O + HO2
4 records matched 1-C3H7 + O2 → n-C3H7O2
2 records matched 1-C3H7 + O2 → CH3CH=CH2 + HO2
1 record matched Cyclohexyldioxyl + HO2 → Cyclohexyl hydroperoxide + O2
1 record matched CH3O2· + CH3C(O)CH2OO· → CH2O + CH3C(O)CH2OH + O2
1 record matched CH3O2· + CH3C(O)CH2OO· → Other Products + O2
1 record matched CH3O2· + CH3C(O)CH2OO· → CH3C(O)CH2O· + CH3O· + O2
2 records matched CH3O2· + CH3C(O)OO(·) → CH3O· + O2 + CH3C(O)O
3 records matched CH3O2· + CH3C(O)OO(·) → CH2O + CH3C(O)OH + O2
1 record matched CH3O2· + CH3C(O)OO(·) → Other Products + O2
2 records matched CH3O2· + O· → CH3O· + O2
3 records matched CH3O2· + ClO → CH3OCl + O2
1 record matched CH3O2· + NO3 → CH3O· + O2 + NO2
1 record matched CH3O2· + ·OH → CH3OH + O2
9 records matched CH3O2· + HO2 → CH3OOH + O2
1 record matched CH3O2· + CH3O2· → CH3O· + CH3O· + O2
2 records matched CH3O2· + CH3O2· → (CH3O)2 + O2
2 records matched CH3O2· + CH3O2· → Other Products + O2
1 record matched CH3O2· → ·CH3 + O2
1 record matched ·C2H + O2 → O· + HCCO
1 record matched ·C2H + O2 → CO + HCO
3 records matched ·C2H + O2 → Products
1 record matched ·C2H + HO2 → C2H2 + O2
11 records matched ·C2H5 + O2 → C2H5OO·
1 record matched ·C2H5 + O2 → CH3CHO + ·OH
10 records matched ·C2H5 + O2 → C2H4 + HO2
1 record matched ·C2H5 + HO2 → C2H6 + O2
3 records matched iso-C3H7 + O2 → (CH3)2CHO2
2 records matched iso-C3H7 + O2 → CH3CH=CH2 + HO2
1 record matched ·CH2CH=CH2 + O2 → CH2=C=CH2 + HO2
10 records matched ·CCl2F + O2 → CCl2FO2
8 records matched ·CClF2 + O2 → CClF2OO
1 record matched tert-C4H9 + O2 → iso-C4H8 + HO2
1 record matched tert-C4H9 + O2 → Products
1 record matched FeO + O· → Fe + O2
1 record matched FeO + O2 → FeO2 + O·
1 record matched H2 + O2 → ·OH + ·OH
1 record matched H2 + O2 → HO2 + H·
4 records matched CO + O2 → CO2 + O·
3 records matched CO2 + O· → CO + O2
2 records matched CH3CH=CH2 + O2 → ·CH2CH=CH2 + HO2
2 records matched Toluene + O2 → Benzyl + HO2
1 record matched iso-C4H10 + O2 → HO2 + iso-C4H9
1 record matched iso-C4H10 + O2 → tert-C4H9 + HO2
2 records matched CS2 + O2 + ·Cl → Products
1 record matched CH3CHO + O2 → CH3CO + HO2
1 record matched C3H8 + O2 → 1-C3H7 + HO2
1 record matched C3H8 + O2 → iso-C3H7 + HO2
1 record matched C2H2 + O2 → ·C2H + HO2
1 record matched C2H4 + O2 → C2H3 + HO2
2 records matched C2H6 + O2 → ·C2H5 + HO2
2 records matched CH4 + O2 → ·CH3 + HO2
1 record matched CH3OH + O2 → (·)CH2OH + HO2
3 records matched CN + O2 → O· + NCO
1 record matched CN + O2 → Products
2 records matched CH2O + O2 → HCO + HO2
3 records matched O(1D) + O3 → O2 + O· + O·
3 records matched O(1D) + O3 → O2 + O2
4 records matched O(1D) + N2O → N2 + O2
4 records matched O(1D) + O2 → O2 + O·
1 record matched O(1D) + O2 → O(3P) + O2
3 records matched O2(1DELTA) + O3 → O2 + O2 + O·
1 record matched O2(1DELTA) + O2 → O2 + O2
2 records matched O2(1DELTA) + O2 → Products
4 records matched O2(1DELTA) → O2
1 record matched CH3SCH2OO· + CH3SCH2OO· → CH3SCH2O· + CH3SCH2O· + O2
1 record matched CFCl2CH2O· + O2 → Products
1 record matched CH2BrO + O2 → HO2 + HC(O)Br
1 record matched BrCH2CH2OO· + BrCH2CH2OO· → O2 + Acetaldehyde, bromo- + Acetaldehyde, bromo-
1 record matched M + CH3SOO → M + CH3S· + O2
1 record matched M + ClOO → M + O2 + ·Cl
1 record matched M + O2 + ·Cl → M + ClOO
4 records matched M + O2 + O· → M + O3
1 record matched M + O2 + ·F → M + O2F
2 records matched M + O2 + H· → M + HO2
1 record matched M + CH3S· + O2 → M + CH3SOO
3 records matched M + HO2 + HO2 → M + H2O2 + O2
1 record matched M + ·CCl3 + O2 → M + CCl3O2
1 record matched M + ·CF3 + O2 → M + CF3O2
1 record matched M + ·CH3 + O2 → M + CH3O2·
1 record matched M + ·CCl2F + O2 → M + CCl2FO2
1 record matched M + ·CClF2 + O2 → M + CClF2OO
1 record matched N(2D) + O2 → O(3P) + NO
1 record matched N(2P) + O2 → NO + O·
1 record matched O(1D) + O3 → O2 + O2
3 records matched O(1D) + O3 → O(3P) + O(3P) + O2
3 records matched O(1D) + N2O → N2 + O2
3 records matched O(1D) + O2 → O(3P) + O2
3 records matched O2(1Delta_g) + O3 → O2 + O2 + O·
5 records matched O2(1Delta_g) + M → M + O2
1 record matched N2(A3Sigma_u+) + O2 → Products
7 records matched O2(b1Sigma_g+) + M → M + O2
1 record matched Acylperoxy radical + Acylperoxy radical → (CH3)3CC(O)O + (CH3)3CC(O)O + O2
1 record matched (CH3)2CHC(O)O2 + (CH3)2CHC(O)O2 → O2 + (CH3)2CHC(O)O + (CH3)2CHC(O)O
1 record matched CF3C(O)OO(·) + CF3C(O)OO(·) → O2 + CF3C(O)O + CF3C(O)O
2 records matched CF3CFHO2· + CF3CFHO2· → O2 + CF3CFHO + CF3CFHO
2 records matched CF3CFHO2· + CF3CFHO2· → CF3CFHOH + CF3COF + O2
1 record matched CF3CCl2OO(·) + CF3CCl2OO(·) → O2 + CF3CCl2O(·) + CF3CCl2O(·)
1 record matched CH2ClCHClO2 → O2 + CH2ClCHCl·
1 record matched CH3CH(OH)CH(CH3)OO(·) + CH3CH(OH)CH(CH3)OO(·) → O2 + HOCH(CH3)CH(CH3(O(.) + HOCH(CH3)CH(CH3(O(.)
1 record matched CH2BrOO + CH2BrOO → CH2BrO + CH2BrO + O2
1 record matched ICH2OO(·) + ICH2OO(·) → CH2IO + CH2IO + O2
5 records matched CH2ClCH2O2 + CH2ClCH2O2 → O2 + CH2ClCH2O + CH2ClCH2O
3 records matched CH2ClCH2O2 + CH2ClCH2O2 → CH2ClCH2OH + CH2ClCHO + O2
1 record matched FC(O)OO + FC(O)OO → O2 + FC(O)O· + FC(O)O·
1 record matched FC(O)OO + FC(O)OO → FC(O)OO(O)CF + O2
1 record matched FC(O)OO + FC(O)OO → Other Products + O2
1 record matched CD3O2· + CD3O2· → O2 + CD3O-OCD3
2 records matched (CH3)2CHCH(CH3)CH2OO· + (CH3)2CHCH(CH3)CH2OO· → Butanal, 2,3-dimethyl- + O2 + 1-Butanol, 2,3-dimethyl-
1 record matched (CH3)2CHCH(CH3)CH2OO· + (CH3)2CHCH(CH3)CH2OO· → (CH3)2CHCH(CH3)CH2O· + (CH3)2CHCH(CH3)CH2O· + O2
1 record matched CH3CH2C(O)OO + CH3CH2C(O)OO → C2H5OCOCOOC2H5 + O2
1 record matched CH3C(O)CH2OO· + CH3C(O)CH2OO· → CH3C(O)CHO + CH3C(O)CH2OH + O2
2 records matched CH3C(O)CH2OO· + CH3C(O)CH2OO· → CH3C(O)CH2O· + CH3C(O)CH2O· + O2
1 record matched CH3C(O)CH2OO· + CH3C(O)CH2OO· → CH3C(O)CH2O-OCH2C(O)CH3 + O2
1 record matched CH2ClO2 + CH2ClO2 → O2 + CH2ClO + CH2ClO
3 records matched CH3OCH2O2 + CH3OCH2O2 → O2 + CH3OCH2O· + CH3OCH2
1 record matched CCl3O2 + CCl3O2 → O2 + (CCl3O)2
3 records matched CCl3O2 + CCl3O2 → O2 + CCl3O + CCl3O
1 record matched CCl3O2 → ·CCl3 + O2
1 record matched SF5O2 → O2 + SF5
1 record matched HOC(CH3)2CH2OO(·) + HOC(CH3)2CH2OO(·) → HOC(CH3)2CH2O· + HOC(CH3)2CH2O· + O2
1 record matched CH3(CH2)3CH2OO· + CH3(CH2)3CH2OO· → O2 + n-C5H11O· + n-C5H11
1 record matched n-C3H7O2 + n-C3H7O2 → Other Products + O2
1 record matched 2-Cyclohexen-1-yldioxy- → O2 + Cyclohexenyl (unspecified)
1 record matched (C2H5)2CHO2 + (C2H5)2CHO2 → CH3CH2CH(O.)CH2CH3 + CH3CH2CH(O.)CH2CH3 + O2
1 record matched n-C3H7CH(CH3)O2 + n-C3H7CH(CH3)O2 → O2 + CH3(CH2)2CH(CH3)O + CH3(CH2)2CH(CH3)O
2 records matched HOCH2CH2O2· + HOCH2CH2O2· → O2 + HOCH2CH2O + HOCH2CH2O
2 records matched HOCH2CH2O2· + HOCH2CH2O2· → HOCH2CH2OH + HOCH2CHO + O2
1 record matched CCl3CCl2O2 + CCl3CCl2O2 → O2 + C2Cl5O + C2Cl5O
1 record matched CH3C(O)OO(·) + CH3C(O)CH2OO· → CH3C(O)OH + CH3C(O)CHO + O2
1 record matched CH3C(O)OO(·) + CH3C(O)CH2OO· → CH3C(O)CH2O· + O2 + CH3C(O)O
2 records matched CH3C(O)OO(·) + CH3C(O)OO(·) → O2 + CH3C(O)O + CH3C(O)O
1 record matched CH3C(O)OO(·) + CH3C(O)OO(·) → CH3OCOCOOCH3 + O2
3 records matched CH3C(O)OO(·) + CH3C(O)OO(·) → Other Products + O2
2 records matched (CH3)3CCH2OO + (CH3)3CCH2OO → O2 + (CH3)3CCH2O· + (CH3)3CCH2
1 record matched (CH3)3CCH2OO + (CH3)3CCH2OO → (CH3)3CCH2OH + 2,2-dimethylpropanal + O2
1 record matched (CH3)3CCH2OO → Neopentyl + O2
2 records matched HOCH2OO + HOCH2OO → Other Products + O2
1 record matched HO2NO2 → O2 + HNO2
1 record matched (CH3)2CHC(OO)(CH3)2 + (CH3)2CHCH(CH3)CH2OO· → Butanal, 2,3-dimethyl- + O2 + 1-Butanol, 2,3-dimethyl-
1 record matched (CH3)2CHC(OO)(CH3)2 + (CH3)2CHCH(CH3)CH2OO· → (CH3)2CHCH(CH3)CH2O· + O2 + (CH3)2CHC(O)(CH3)2
1 record matched Cylopentyldioxy- + Cylopentyldioxy- → Cyclopentanol + Cyclopentanone + O2
1 record matched O· + BrO2 → O2 + BrO
21 records matched O· + O· → O2
4 records matched OClO + O· → O2 + ClO
1 record matched CF3O2 + CF3C(O)OO(·) → O2 + CF3C(O)O + CF3O
1 record matched CF3O2 + CF3CFHO2· → O2 + CF3O + CF3CFHO
5 records matched CF3O2 + CF3O2 → O2 + CF3O + CF3O
3 records matched BrO + O· → O2 + Br·
13 records matched BrO + BrO → O2 + Br· + Br·
11 records matched BrO + BrO → Br2 + O2
1 record matched O2F + FC(O)O· → O2 + FC(O)OF
1 record matched O2F + O2F → O2 + F2O2
1 record matched O2F + O2F → F2 + O2 + O2
4 records matched O2F → O2 + ·F
15 records matched ClO + O· → O2 + ·Cl
8 records matched ClO + BrO → O2 + BrCl
2 records matched ClO + ClO → O2 + ·Cl + ·Cl
13 records matched ClO + ClO → O2 + Cl2
3 records matched ·F + O2F → F2 + O2
3 records matched IO + O· → O2 + I
1 record matched IO + ClO → O2 + I + ·Cl
2 records matched IO + ClO → O2 + ICl
3 records matched IO + IO → O2 + I + I
1 record matched IO + IO → O2 + I
2 records matched IO + IO → I2 + O2
1 record matched SO + O· → S + O2
1 record matched DO2 + CH3C(O)OO(·) → O2 + OD + CH3C(O)O
5 records matched DO2 + DO2 → D2O2 + O2
1 record matched OD + O· → O2 + D
1 record matched OD + BrO → O2 + DBr
2 records matched OD + ClO → DCl + O2
1 record matched OD + DO2 → O2 + D2O
1 record matched Cl2O6 → O2 + Cl2O4
1 record matched FeO2 + O· → FeO + O2
2 records matched FeO2 → Fe + O2
1 record matched NaO + O· → Na + O2
2 records matched OF + O· → O2 + ·F
5 records matched OF + OF → O2 + ·F + ·F
2 records matched OF + OF → F2 + O2
1 record matched NaO2 + O· → O2 + NaO
1 record matched NO3 + CD3O2· → CD3O + O2 + NO2
2 records matched NO3 + CH3C(O)OO(·) → O2 + NO2 + CH3C(O)O
2 records matched NO3 + O· → O2 + NO2
1 record matched NO3 + OClO → O2 + NO2 + ClO
1 record matched NO3 + ClO → O2 + NO2 + ·Cl
4 records matched NO3 + NO3 → O2 + NO2 + NO2
2 records matched NO3 → O2 + NO
1 record matched FeO3 + O· → O2 + FeO2
1 record matched FeO3 + H· → O2 + FeOH
1 record matched NO2 + N → N2 + O2
35 records matched NO2 + O· → O2 + NO
5 records matched NO2 + NO3 → O2 + NO + NO2
9 records matched NO2 + NO2 → O2 + NO + NO
5 records matched NO + O· → O2 + N
1 record matched NO + O2F → O2 + FNO
3 records matched NO + NO → N2 + O2
1 record matched Br· + DO2 → O2 + DBr
7 records matched ClOO + ·Cl → O2 + Cl2
3 records matched ClOO + O· → O2 + ClO
1 record matched ClOO + NO → NOCl + O2
2 records matched ClOO + Br· → O2 + BrCl
2 records matched ClOO → O2 + ·Cl
1 record matched O3 + CClF2OO → COF2 + O2 + ClOO
1 record matched O3 + FC(O)O· → O2 + FC(O)OO
1 record matched O3 + DSO → O2 + O2 + SD
1 record matched O3 + HSO → O2 + O2 + SH
15 records matched O3 + ·Cl → O2 + ClO
8 records matched O3 + CF3O → O2 + CF3O2
4 records matched O3 + N → O2 + NO
16 records matched O3 + O· → O2 + O2
1 record matched O3 + OClO → O2 + ClO3
5 records matched O3 + CF3O2 → O2 + O2 + CF3O
1 record matched O3 + BrO → O2 + BrO2
2 records matched O3 + BrO → O2 + O2 + Br·
1 record matched O3 + O2F → O2 + O2 + OF
2 records matched O3 + ClO → O2 + OClO
2 records matched O3 + ClO → O2 + ClOO
1 record matched O3 + ClO → O2 + O2 + ·Cl
3 records matched O3 + ·F → O2 + OF
1 record matched O3 + IO → O2 + I
1 record matched O3 + IO → O2 + Iodine dioxide
6 records matched O3 + I → O2 + IO
3 records matched O3 + SH → O2 + HSO
1 record matched O3 + ClO3 → O2 + O2 + ClOO
7 records matched O3 + SO → SO2 + O2
1 record matched O3 + SD → O2 + DSO
2 records matched O3 + NH2 → O2 + NH2O
1 record matched O3 + FeO2 → O2 + FeO3
4 records matched O3 + NaO → O2 + NaO2
6 records matched O3 + H· → ·OH + O2
1 record matched O3 + Cl2O2 → O2 + ClOO + ClO
1 record matched O3 + OF → O2 + O2F
1 record matched O3 + OF → O2 + O2 + ·F
13 records matched O3 + NO2 → O2 + NO3
19 records matched O3 + NO → O2 + NO2
9 records matched O3 + Br· → O2 + BrO
2 records matched O3 + O3 → O2 + O2 + O2
25 records matched O3 → O2 + O·
12 records matched N2O + O· → N2 + O2
1 record matched NO2F + O3 → O2 + O2 + FNO
2 records matched Cl2O + ClO → O2 + Cl2 + ·Cl
1 record matched FNO + O3 → O2 + NO2F
2 records matched HNO2 + O3 → HNO3 + O2
1 record matched O2 + 4-Methylcyclohexoxy radical → Products
1 record matched O2 + C6D11O → Products
1 record matched O2 + HC(O)CO → CO + CO + HO2
1 record matched O2 + HC(O)CO → CO2 + CO + ·OH
1 record matched O2 + CH3CF2CH2(·) → CH3CF2CH2OO·
2 records matched O2 + CF3CClHO(.) → CF3COCl + HO2
14 records matched O2 + CF3CFHO → CF3COF + HO2
1 record matched O2 + Naphthalenyl, 1, ? -dihydro-1-(nitrooxy)- → Products
1 record matched O2 + CS2OH → COS + HSO2
3 records matched O2 + CS2OH → Products
6 records matched O2 + CH2ClO → HC(O)Cl + HO2
1 record matched O2 + HOCH=CH → Other Products + ·OH
1 record matched O2 + HOCH=CH → Products
1 record matched O2 + HOCH2C(·)O → Other Products + ·OH
4 records matched O2 + CD3S(OH)CD3 → Products
1 record matched O2 + [5,6]-Fullerene-C60 → Other Products + CO
1 record matched O2 + DOC(O)· → CO2 + DO2
1 record matched O2 + CCl2=CCl → CO + CCl3O
1 record matched O2 + CCl2=CCl → CO2 + ·CCl3
2 records matched O2 + CCl2=CCl → COCl2 + ClCO
1 record matched O2 + CCl2=CCl → COCl2 + CO + ·Cl
2 records matched O2 + (CH3)2C(CH2OOH)CH2· → Other Products + Acetone
1 record matched O2 + (CH3)2Ge: → Products
1 record matched O2 + CH3CH2N=NCH(·)CH3 → CH3CHO + ·C2H5 + N2O
1 record matched O2 + CH3CH2N=NCH(·)CH3 → C2H4 + C2H5OO· + N2
1 record matched O2 + ·CH2CH2N=NC2H5 → CH3CHO + ·C2H5 + N2O
1 record matched O2 + ·CH2CH2N=NC2H5 → C2H4 + C2H5OO· + N2
1 record matched O2 + HOCH2O → HCOOH + HO2
1 record matched O2 + ·C2D5 → Products
1 record matched O2 + CCl3O2 → CCl3O2
1 record matched O2 + (CF3)2CHO(·) → (CF3)2CO + HO2
1 record matched O2 + ClCH2C(O)(.) → ClCH2C(O)OO(.)
1 record matched O2 + CH=C=CH → CO + H· + HCCO
1 record matched O2 + HSO → ·OH + SO2
1 record matched O2 + HSO → Products
1 record matched O2 + HSO2 → HO2 + SO2
1 record matched O2 + ·CH2CH=CHCH2CH3 → CH2=CHCH=CHCH3 + HO2
1 record matched O2 + ·CH2 → CH2OO
1 record matched O2 + ·CH2 → HOC(·)O + H·
2 records matched O2 + ·CH2 → CO2 + H· + H·
3 records matched O2 + ·CH2 → CH2O + O·
1 record matched O2 + ·CH2 → Other Products + O·
1 record matched O2 + ·CH2 → Other Products + H·
14 records matched O2 + ·CH2 → Products
1 record matched O2 + (·)CH2CH(OH)C≡N → Products
1 record matched O2 + (CF3)2CH· → Adduct
1 record matched O2 + Propyl,2,2,3,3,3-pentafluoro-1-oxo- → C2F5C(O)O2
1 record matched O2 + Cyclohexenyl (unspecified) → 2-Cyclohexen-1-yldioxy-
1 record matched O2 + CH3ICl → Products
3 records matched O2 + (CH3)2S.OH → Products
1 record matched O2 + Phenyl, 2-hydroxy- → Other Products + 2,4-Cyclopentadiene-1-one
1 record matched O2 + Phenyl, 2-hydroxy- → Other Products + o-Benzoquinone
1 record matched O2 + HCCO → CO + CO + ·OH
2 records matched O2 + HCCO → CO2 + CO + H·
7 records matched O2 + HCCO → Products
1 record matched O2 + (CH3)3CC(O)· → Acylperoxy radical
1 record matched O2 + (CH3)3CC(O)· → Other Products + ·OH
1 record matched O2 + CH2=CCl → CH2O + ClCO
2 records matched O2 + CF3CHF → CF3CFHO2·
1 record matched O2 + CF3CHF → Products
1 record matched O2 + CD≡C· → Products
1 record matched O2 + HN=N → ·OH + N2O
1 record matched O2 + HN=N → HO2 + N2
1 record matched O2 + (CH3)2CHC=O → (CH3)2CHC(O)O2
5 records matched O2 + HOSO2 → HO2 + SO3
1 record matched O2 + Methyl, 1,2-phenylenebis- → 2,3-Benzodioxin, 1,4-dihydro-
2 records matched O2 + CH3SCH2 → CH3SCH2OO·
2 records matched O2 + CH3CHNH2 → Products
1 record matched O2 + (CH3)2CHC(O)(CH3)2 → Other Products + HO2
1 record matched O2 + CF3CHCl → CF3CClHOO(.)
2 records matched O2 + HOCH2CH2O → HOCH2CHO + HO2
1 record matched O2 + CH3CH2CH(CH3)O· → Products
2 records matched O2 + (CH3)2CHCH2O· → (CH3)2CHCHO + HO2
1 record matched O2 + (CH3)2CHS → Products
1 record matched O2 + Na2 → Products
1 record matched O2 + :GeH2 → Products
2 records matched O2 + (CH3)2CHC(·)(CH3)2 → (CH3)2C=C(CH3)2 + HO2
1 record matched O2 + (CH3)2CHC(·)(CH3)2 → (CH3)2CHC(CH3)=CH2 + HO2
2 records matched O2 + (CH3)3C-C(·)(CH3)2 → (CH3)3CC(CH3)=CH2 + HO2
1 record matched O2 + CDO → CO + DO2
2 records matched O2 + CDO → Products
1 record matched O2 + S2 → Products
1 record matched O2 + (CH3CH2)2CH → (C2H5)2CHO2
2 records matched O2 + CH2ClCHCl· → CH2ClCHClO2
10 records matched O2 + ·Cl → ClOO
1 record matched O2 + CD3CO → Products
1 record matched O2 + NCO → CO2 + NO
5 records matched O2 + NCO → Products
1 record matched O2 + CH2=C=C=CH· → Products
1 record matched O2 + CF3O → COF2 + O2F
1 record matched O2 + SnO → O· + SnO2
1 record matched O2 + BCl → Products
1 record matched O2 + (CH3)2CCl → Products
1 record matched O2 + CH3CCl2· → Products
1 record matched O2 + SiCl3 → Products
1 record matched O2 + CH3CH2CH2CH2O· → HOC(CH3)2CH2OO(·)
2 records matched O2 + CH3CH2CH2CH2O· → CH3CH2CH2CHO + HO2
1 record matched O2 + CH2=CHCH(·)CH2CH3 → CH2=CHCH=CHCH3 + HO2
13 records matched O2 + N → NO + O·
1 record matched O2 + N → Products
96 records matched O2 + O· → O3
1 record matched O2 + 1,3,5-Trioxan-2-yl → 1,3,5-Trioxan-2-yldioxy-
2 records matched O2 + ·CH2SH → Products
12 records matched O2 + D → DO2
7 records matched O2 + D → OD + O·
1 record matched O2 + (CH3)3Si· → Products
2 records matched O2 + CH3CHCl → CH3CHClO2·
1 record matched O2 + ·CHI2 → Products
10 records matched O2 + CH3OCH2· → CH3OCH2O2
1 record matched O2 + CH3OCH2· → CH2O + HCO + H2O
6 records matched O2 + CH3OCH2· → CH2O + CH2O + ·OH
1 record matched O2 + CH3OCH2· → Other Products + ·OH
3 records matched O2 + CH3OCH2· → Products
6 records matched O2 + ·CH2I → ICH2OO(·)
1 record matched O2 + ·CH2I → I + CH2OO
4 records matched O2 + ·CH2I → CH2O + IO
3 records matched O2 + ·CH2I → Products
1 record matched O2 + ·CH2Br → Products
2 records matched O2 + n-C3H7O → C2H5CHO + HO2
2 records matched O2 + n-C3H7O → Products
1 record matched O2 + SF → Products
1 record matched O2 + SCN → Products
1 record matched O2 + 2-pyridinyl → pyridin-2-olate + ·OH
1 record matched O2 + H2C=N → Products
3 records matched O2 + CH3CH2CO → CH3CH2C(O)OO
1 record matched O2 + CH3CH2CO → CO2 + CH3CH2
2 records matched O2 + CH3CH2CO → Products + ·OH
3 records matched O2 + CH3CH2CO → Products
2 records matched O2 + ·CH2CH=CHCH3 → Products
2 records matched O2 + CH3CO → Products + ·OH
5 records matched O2 + CH3CO → Products
2 records matched O2 + (CH3)2N → CH2=NCH3 + HO2
1 record matched O2 + SCl → Products
1 record matched O2 + SiBr2 → Products
1 record matched O2 + CH3CH2S → Products
23 records matched O2 + ·F → O2F
1 record matched O2 + AlO → AlO3
3 records matched O2 + AlO → AlO2 + O·
2 records matched O2 + PO → PO2 + O·
1 record matched O2 + CHBr2 → CHBr2OO(·)
1 record matched O2 + ·N3 → N2O + NO
1 record matched O2 + ·N3 → Products
2 records matched O2 + HNO → Products
1 record matched O2 + AlH → Products
2 records matched O2 + SiF2 → Products
2 records matched O2 + SH → HSO2
1 record matched O2 + SH → O· + HSO
5 records matched O2 + SH → ·OH + SO
1 record matched O2 + SO → SO3
13 records matched O2 + SO → SO2 + O·
5 records matched O2 + SiH2 → Products
1 record matched O2 + SF2 → Products
2 records matched O2 + CD → Products
1 record matched O2 + SiH → Products
4 records matched O2 + NH → ·OH + NO
4 records matched O2 + NH → Products
4 records matched O2 + NH2 → H2NOO
2 records matched O2 + NH2 → NH2O + O·
5 records matched O2 + NH2 → ·OH + HNO
11 records matched O2 + NH2 → Products
1 record matched O2 + BF → O· + OBF
1 record matched O2 + BF → Products
3 records matched O2 + BH → Products
1 record matched O2 + GeH3 → Products
2 records matched O2 + SiH3 → O· + H3SiO(·)
2 records matched O2 + SiH3 → H· + :Si(OH)2
3 records matched O2 + SiH3 → ·OH + H2Si=O
6 records matched O2 + SiH3 → Products
1 record matched O2 + AlCl → Products
2 records matched O2 + SiCl2 → Products
2 records matched O2 + ·CHF → Products
1 record matched O2 + BH3 → Products
2 records matched O2 + Mo2 → Products
4 records matched O2 + BO → BO2 + O·
3 records matched O2 + NaO → NaO3
47 records matched O2 + H· → ·OH + O·
67 records matched O2 + H· → HO2
1 record matched O2 + Ag2 → Products
3 records matched O2 + Cyclohexadienyl → Products
1 record matched O2 + SO2F → FS(O2)OO·
1 record matched O2 + TiO → Products
4 records matched O2 + C3 → Products
1 record matched O2 + C2O → CO + CO + O·
4 records matched O2 + C2O → Products
1 record matched O2 + C2 → CO + CO
1 record matched O2 + C2 → Products
1 record matched O2 + VO → Products
2 records matched O2 + NO3 → Products
3 records matched O2 + Cyclohexadienyl, 6-hydroxy- → 2,4-Cyclohexadienylperoxy, 6-hydroxy-
2 records matched O2 + Cyclohexadienyl, 6-hydroxy- → Phenol + HO2
1 record matched O2 + Cyclohexadienyl, 6-hydroxy- → Other Products + ·OH
3 records matched O2 + Cyclohexadienyl, 6-hydroxy- → Products
3 records matched O2 + Cyclohexadienyl, 6-hydroxy- → peroxy-hydroxy-cyclohexadienyl, unspecified isomer
1 record matched O2 + SF5 → SF5O2
1 record matched O2 + SF5 → Products
1 record matched O2 + CH2NH2 → NH2CH2OO(·)
3 records matched O2 + CH2NH2 → Products
1 record matched O2 + 2-Naphthalenyl → 2-naphthylperoxy
10 records matched O2 + NO + NO → NO2 + NO2
2 records matched O2 + SiO → Products
1 record matched O2 + HI → HO2 + I
1 record matched O2 + O3 → O2 + O2 + O·
1 record matched O2 + SF4 → Products
1 record matched O2 + F2O2 → O2F + O2F
1 record matched O2 + O2 + O· → O2 + O3
1 record matched O2 + O2 → O3 + O·
12 records matched O2 → O· + O·
1 record matched D2 + O2 → OD + OD
1 record matched H2O + FeO3 → O2 + Fe(OH)2
1 record matched H2O + O3 → H2O2 + O2
4 records matched N2 + O· + O· → N2 + O2
1 record matched N2 + O2 + CCl3O2 → N2 + CCl3O2
1 record matched N2 + O2 + O· → N2 + O3
1 record matched N2 + O2 → N2 + O· + O·
4 records matched P + O2 → PO + O·
1 record matched H2O2 + O3 → H2O + O2 + O2
1 record matched S + O3 → O2 + SO
15 records matched S + O2 → SO + O·
1 record matched HCl + O3 → O2 + HOCl
8 records matched SO3 + O· → SO2 + O2
2 records matched SO2 + O· → O2 + SO
1 record matched SO2 + O3 → SO3 + O2
4 records matched Ca + O2 → CaO2
4 records matched Ca + O2 → CaO + O·
1 record matched Ca + O2 → Adduct
3 records matched Bi + O2 → Products
1 record matched Zr + O2 → Products
2 records matched Zn + O2 → ZnO + O·
1 record matched Y + O2 → Products
1 record matched Y + O2 → O(3P) + YO
1 record matched Yb + N2 + O2 → YbO2 + N2
1 record matched V + O2 → VO + O·
1 record matched V + O2 → Products
1 record matched Ho + O2 → HoO + O·
1 record matched He + O2 + CCl3O2 → He + CCl3O2
1 record matched He + O2 + O· → He + O3
1 record matched Hf + O2 → Products
2 records matched Ge + O2 → O· + GeO
1 record matched Ge + O2 → Products
1 record matched Gd + O2 → GdO + O·
1 record matched Eu + O2 → EuO + O·
1 record matched Er + O2 → ErO + O·
4 records matched Cu + O2 → CuO2
2 records matched Co + O2 → CoO + O·
7 records matched Cr + O2 → CrO2
3 records matched Cr + O2 → CrO + O·
3 records matched Cs + O2 → CsO2
1 record matched Ce + O2 → CeO + O·
9 records matched C + O2 → CO + O·
6 records matched C + O2 → Products
1 record matched Cd + O2 → Cadmium oxide + O·
2 records matched Cd + O2 → Products
2 records matched B + O2 → BO + O·
5 records matched Ba + O2 → BaO + O·
2 records matched As + O2 → Products
1 record matched Ar + O2 + O· → Ar + O3
1 record matched Ar + O2 + H· → HO2 + Ar
1 record matched Ar + O2 → O· + O·
4 records matched Sb + O2 → Products
1 record matched W + O2 → Products
5 records matched Ti + O2 → TiO + O·
2 records matched Ti + O2 → Products
5 records matched Sn + O2 → O· + SnO
1 record matched Tm + O2 → TmO + O·
1 record matched Tb + O2 → TbO + O·
1 record matched Ta + O2 → TaO + O·
1 record matched Sr + O2 → SrO2
3 records matched Sr + O2 → SrO + O·
5 records matched Na + O3 → O2 + NaO
24 records matched Na + O2 → NaO2
1 record matched Na + He + O2 → He + NaO2
1 record matched Si + O2 → SiO + O·
2 records matched Si + O2 → Products
1 record matched Sc + O2 → ScO + O·
1 record matched Sm + O2 → SmO + O·
4 records matched Ru + O2 → RuO + O·
1 record matched Rb + O2 → RbO2
2 records matched Rh + O2 → Products
1 record matched Re + O2 → ReO + O·
1 record matched Pr + O2 → PrO + O·
18 records matched K + O2 → KO2
1 record matched Pt + O2 → PtO2
2 records matched Pd + O2 → PdO2
1 record matched Os + O2 → O· + OsO
2 records matched Ni + O2 → Products
1 record matched Nd + O2 → NdO + O·
3 records matched Mo + O2 → MoO + O·
3 records matched Hg + O3 → O2 + HgO
1 record matched Mn + O2 → MnO + O·
1 record matched Mn + O2 → Products
1 record matched Mg + O3 → MgO + O2
4 records matched Mg + O2 → MgO2
6 records matched Mg + O2 → MgO + O·
1 record matched Lu + O2 → LuO + O·
5 records matched Li + O2 → LiO2
1 record matched Pb + O2 → PbO + O·
1 record matched Pb + O2 → O=Pb=O
16 records matched Pb + O2 → Products
1 record matched La + O2 → Products
1 record matched Fe + O3 → FeO + O2
6 records matched Fe + O2 → FeO2
4 records matched Fe + O2 → FeO + O·
2 records matched Ir + O2 → Adduct
1 record matched Dy + O2 → DyO + O·
8 records matched Al + O2 → AlO + O·
1 record matched CH3CH(OH)CH2 + O2 → CH3CH(OH)CH2O2
1 record matched CD3O + O2 → CD2O + DO2
2 records matched CH3S· + O2 → Products
1 record matched CH3CH(·)CH2OH + O2 → Adduct
1 record matched CD2OD + O2 → Products
6 records matched ·CH2Cl + O2 → CH2ClO2
1 record matched ·CH2Cl + O2 → Products
1 record matched (CH3)2Si + O2 → Products
3 records matched CF3C(O) + O2 → CF3C(O)OO(·)
1 record matched CH3CH=C(·)H + O2 → CH3CHO + HCO
1 record matched CH3CH=C=O + O2 → Products
1 record matched C2H5CH(·)OH + O2 → C2H5CHO + HO2
1 record matched (CH3)2C(OH) + O2 → Acetone + HO2
1 record matched C6H5S + O2 → Products
5 records matched iso-C4H9 + O2 → iso-C4H8 + HO2
1 record matched iso-C4H9 + O2 → (CH3)2CHCHO + ·OH
1 record matched iso-C4H9 + O2 → Products
1 record matched CF2=CF + O2 → CF3C(O)O
1 record matched CH2=CHCH2OO + CH2=CHCH2OO → O2 + CH2=CHCH2O + CH2=CHCH2O
2 records matched CH2=CHCH2OO → ·CH2CH=CH2 + O2
1 record matched 1,4-Dioxan-2-yl + O2 → 1,4-Dioxan-2-yldioxy
2 records matched ·CFBr + O2 → Products
1 record matched HOCH2CH2· + O2 → Products
4 records matched *CH2C(O)H + O2 → O=CHCH2OO
5 records matched *CH2C(O)H + O2 → Products
3 records matched C6H5CH2OO + C6H5CH2OO → O2 + C6H5CH2O + C6H5CH2O
2 records matched C6H5CH2OO + C6H5CH2OO → Benzyl alcohol + Benzaldehyde + O2
1 record matched C6H5CH2OO + C6H5CH2OO → C6H5CH2OOCH2C6H5 + O2
2 records matched C6H5CH2OO → Benzyl + O2
1 record matched (CH3)2CHO2 + (CH3)2CHC(OO)(CH3)2 → i-C3H7O + O2 + (CH3)2CHC(O)(CH3)2
1 record matched (CH3)2CHO2 + (CH3)2CHC(OO)(CH3)2 → Acetone + (CH3)2CHC(OH)(CH3)2 + O2
1 record matched (CH3)2CHO2 + (CH3)2CHO2 → i-C3H7O + i-C3H7O + O2
2 records matched (CH3)2CHO2 + (CH3)2CHO2 → iso-C3H7OH + Acetone + O2
1 record matched (CH3)2Si=CH2 + O2 → CH2O + (CH3)2Si=O
2 records matched SiH2Cl2 + O2 → Products
1 record matched i-C3H7O + O2 → Acetone + HO2
2 records matched i-C3H7O + O2 → Products
1 record matched CBr + O2 → Products
3 records matched ·CCl + O2 → Products
2 records matched CF + O2 → Products
1 record matched Cyclopentyl + O2 → Products
1 record matched Neopentyl + O2 → (CH3)3CCH2OO
1 record matched Neopentyl + O2 → ·OH + 3,3-dimethyl-oxetane
2 records matched Neopentyl + O2 → Products
2 records matched NF2 + O2 → Products
1 record matched Phenyl,2-chloro- + O2 → Adduct
2 records matched Phenyl,2-chloro- + O2 → Phenyl dioxy, 2-chloro-
2 records matched Phenyl, 3-chloro- + O2 → Phenyl dioxy, 3-chloro-
3 records matched CHCl2 + O2 → Methyldioxy, dichloro-
1 record matched CHCl2 + O2 → Products
1 record matched (CH3)3CO2 + (CH3)3CO2 → (CH3)3CO· + (CH3)3CO· + O2
1 record matched (CH3)3CO2 + (CH3)3CO2 → Other Products + O2
1 record matched (CH3)3CO2 → tert-C4H9 + O2
1 record matched Cyclohexyloxy- + O2 → Cyclohexanone + HO2
22 records matched ·OH + O· → O2 + H·
1 record matched ·OH + BrO → O2 + HBr
7 records matched ·OH + ClO → HCl + O2
12 records matched ·OH + O3 → HO2 + O2
1 record matched ·OH + O2 + NO → HO2 + NO2
1 record matched ·OH + O2 → HO2 + O·
2 records matched ·OH + O2 → HO3
1 record matched CHCCH(·)CH3 + O2 → Products
4 records matched ·CH + O2 → CO + ·OH
13 records matched ·CH + O2 → Products
2 records matched ·CH + O2 → OH(A2Sigma+) + CO
1 record matched HO2 + CF3CF2OO· → O2 + CF3CF2OOH
1 record matched HO2 + CF2ClCH2OO· → Other Products + O2
1 record matched HO2 + CFCl2CH2OO(·) → Other Products + O2
3 records matched HO2 + CF3CFHO2· → O2 + CF3CFHOOH
1 record matched HO2 + CF3CCl2OO(·) → O2 + CF3CCl2OOH
1 record matched HO2 + CH3CH(OH)CH(CH3)OO(·) → CH3CH(OH)CH(OOH)CH3 + O2
1 record matched HO2 + CH2FO2 → O2 + CH2FOOH
1 record matched HO2 + CH2FO2 → HFCO + H2O + O2
1 record matched HO2 + CH2BrOO → BrCH2OOH + O2
2 records matched HO2 + CH2ClCH2O2 → ClCH2CH2OOH + O2
1 record matched HO2 + CD3O2· → CD2O + O2 + HDO
1 record matched HO2 + CClF2OO → Other Products + O2
1 record matched HO2 + FC(O)O· → CO2 + HF + O2
1 record matched HO2 + CH3CH2C(O)OO → CH3CH2C(O)OOH + O2
1 record matched HO2 + CH3CH2C(O)OO → ·OH + O2 + CH3CH2C(O)O·
3 records matched HO2 + CH3C(O)CH2OO· → CH3C(O)CH2O· + ·OH + O2
3 records matched HO2 + CH3C(O)CH2OO· → CH3C(O)CH2OOH + O2
3 records matched HO2 + CH2ClO2 → O2 + CH2ClOOH
1 record matched HO2 + CH2ClO2 → HC(O)Cl + H2O + O2
2 records matched HO2 + CH3OCH2O2 → O2 + CH3OCH2OOH
1 record matched HO2 + CH3OCH2O2 → ·OH + O2 + CH3OCH2
1 record matched HO2 + CH3OCH2O2 → HC(O)OCH3 + H2O + O2
1 record matched HO2 + CH3OCH2O2 → CH3OCH(O) + H2O + O2
1 record matched HO2 + HOC(CH3)2CH2OO(·) → (CH3)2C(OH)CH2OOH + O2
1 record matched HO2 + HOCH2CH2O2· → O2 + HOCH2CH2OOH
3 records matched HO2 + CH3C(O)OO(·) → ·OH + O2 + CH3C(O)O
1 record matched HO2 + CH3C(O)OO(·) → CO2 + ·CH3 + ·OH + O2
8 records matched HO2 + CH3C(O)OO(·) → CH3C(O)OOH + O2
1 record matched HO2 + CH3C(O)OO(·) → CH3C(O)O(·) + ·OH + O2
1 record matched HO2 + (CH3)3CCH2OO → (CH3)3CCH2OOH + O2
1 record matched HO2 + HOCH2OO → ·OH + O2 + HOCH2O
1 record matched HO2 + HOCH2OO → HCOOH + H2O + O2
12 records matched HO2 + ·Cl → HCl + O2
2 records matched HO2 + Cylopentyldioxy- → O2 + Hydroperoxide cyclopentyl
15 records matched HO2 + O· → ·OH + O2
2 records matched HO2 + CF3O2 → O2 + CF3OOH
5 records matched HO2 + BrO → O2 + HOBr
5 records matched HO2 + ClO → O2 + HOCl
3 records matched HO2 + IO → O2 + HIO
1 record matched HO2 + I → O2 + HI
2 records matched HO2 + NH2 → NH3 + O2
7 records matched HO2 + H· → H2 + O2
2 records matched HO2 + NO3 → HNO3 + O2
2 records matched HO2 + NO3 → ·OH + O2 + NO2
9 records matched HO2 + NO2 → O2 + HNO2
1 record matched HO2 + NO → O2 + HNO
4 records matched HO2 + Br· → O2 + HBr
1 record matched HO2 + O3 → ·OH + O2 + O2
2 records matched HO2 + FNO → HF + O2 + NO
1 record matched HO2 + F2 → HF + O2 + ·F
1 record matched HO2 + CH2=CHCH2OO → CH2=CHCH2OOH + O2
2 records matched HO2 + C6H5CH2OO → C6H5CH2OOH + O2
37 records matched HO2 + ·OH → H2O + O2
1 record matched HO2 + HO2 + H2O → H2O2 + H2O + O2
46 records matched HO2 + HO2 → H2O2 + O2
1 record matched HO2 + HO2 → H2 + O2 + O2
12 records matched ·CCl3 + O2 → CCl3O2
6 records matched ·CCl3 + O2 → Products
12 records matched CH3CO + O2 → CH3C(O)OO(·)
2 records matched CH3CO + O2 → CO2 + CH3
5 records matched CH3CO + O2 → Other Products + ·OH
1 record matched CH3CO + O2 → Products + ·OH
9 records matched CH3CO + O2 → Products
1 record matched C2H5OO· + CF3CCl2OO(·) → CH3CH2O· + O2 + CF3CCl2O(·)
1 record matched C2H5OO· + CF3CCl2OO(·) → CF3CCl2OH + CH3CHO + O2
1 record matched C2H5OO· + CH3C(O)OO(·) → CH3CH2O· + O2 + CH3C(O)O
1 record matched C2H5OO· + CH3C(O)OO(·) → CH3C(O)OH + CH3CHO + O2
1 record matched C2H5OO· + NO3 → CH3CH2O· + O2 + NO2
3 records matched C2H5OO· + HO2 → CH3CH2OOH + O2
3 records matched C2H5OO· + C2H5OO· → CH3CH2O· + CH3CH2O· + O2
2 records matched C2H5OO· + C2H5OO· → (C2H5O)2 + O2
1 record matched C2H5OO· + C2H5OO· → C2H5OH + CH3CHO + O2
2 records matched C2H5OO· → ·C2H5 + O2
1 record matched Cyclohexyl + O2 → Cyclohexyldioxyl
1 record matched Cyclohexyl + O2 → Products + ·OH
3 records matched Cyclohexyl + O2 → Products
1 record matched CH3C(O)CH2(·) + O2 → CH3CH2C(O)OO
3 records matched CH3C(O)CH2(·) + O2 → CH3C(O)CH2OO·
2 records matched CH3C(O)CH2(·) + O2 → Products
1 record matched CH3C(O)CH2(·) + O2 → ·CH2O(O)COCH3
1 record matched CS + O3 → COS + O2
1 record matched CS + O2 → CO + SO
2 records matched CS + O2 → COS + O·
1 record matched CH2CN + O2 → N≡CCH2OO(·)
1 record matched CH2C≡CH + O2 → CO + CH3CO
2 records matched CH2C≡CH + O2 → H2C=C=O + HCO
1 record matched CH2C≡CH + O2 → CO2 + C2H3
2 records matched CH2C≡CH + O2 → Products
1 record matched 1-C5H11 + O2 → 1-C5H10 + HO2
2 records matched C2H3 + O2 → CH2=CHO2
1 record matched C2H3 + O2 → *CH2C(O)H + O·
1 record matched C2H3 + O2 → CO2 + ·CH3
1 record matched C2H3 + O2 → C2H2 + HO2
7 records matched C2H3 + O2 → CH2O + HCO
4 records matched C2H3 + O2 → Products
1 record matched NCN + O2 → Products
1 record matched benzoyl + O2 → Products
1 record matched ·HCC≡N + O2 → Products
1 record matched ClCO + O2 → ClC(O)O2
2 records matched methyl,(3-fluorophenyl-) + O2 → Products
4 records matched HCO + O2 → HC(O)O2
24 records matched HCO + O2 → CO + HO2
2 records matched HCO + O2 → CO2 + ·OH
3 records matched HCO + O2 → Products
14 records matched (·)CH2OH + O2 → CH2O + HO2
1 record matched (·)CH2OH + O2 → Products
2 records matched HOC(·)O + O2 → CO2 + HO2
2 records matched 1-C4H9 + O2 → CH3CH2CH2CH2OO·
4 records matched 1-C4H9 + O2 → 1-C4H8 + HO2
1 record matched 1-C4H9 + O2 → Products
1 record matched CH3CH2CH2CH(·)CH3 + O2 → n-C3H7CH(CH3)O2
1 record matched Cyclopropyl + O2 → Cyclopropyldioxy
1 record matched Cyclopropyl + O2 → ·OH + Cyclopropanone
1 record matched Cyclopropyl + O2 → Oxirane + HCO
3 records matched Cyclopropyl + O2 → Products
1 record matched Cyclopropyl + O2 → HOCO + C2H4
2 records matched Phenyl + O2 → Phenyl dioxy-
1 record matched Phenyl + O2 → C6H5O + O·
1 record matched Phenyl + O2 → 1,4-Benzoquinone + H·
4 records matched Phenyl + O2 → Products
1 record matched Phenyl + O2 → C6H5OO·
1 record matched Phenyl, 4-chloro- + O2 → Adduct
2 records matched Phenyl, 4-chloro- + O2 → Phenyl dioxy, 4-chloro-
2 records matched sec-C4H9 + O2 → C2H5CH(CH3)O2
1 record matched sec-C4H9 + O2 → ·OH + trans-2,3-Dimethyloxirane
1 record matched sec-C4H9 + O2 → cis-2,3-Dimethyloxirane + ·OH
4 records matched sec-C4H9 + O2 → (E)-2-C4H8 + HO2
4 records matched sec-C4H9 + O2 → (Z)-2-C4H8 + HO2
1 record matched sec-C4H9 + O2 → Tetrahydrofuran + ·OH
1 record matched sec-C4H9 + O2 → 1-C4H8 + HO2
1 record matched sec-C4H9 + O2 → Ethyloxirane + ·OH
2 records matched sec-C4H9 + O2 → C2H5COCH3 + ·OH
1 record matched sec-C4H9 + O2 → Products
1 record matched 4-Methylbenzyl + O2 → Products
2 records matched 2-Methylbenzyl + O2 → Products
1 record matched 3-Methylbenzyl + O2 → Products
1 record matched CH3CH(·)OH + O2 → CH3CHO + HO2
2 records matched CH3CH(·)OH + O2 → Products
1 record matched CH3CH2C(O)CH(·)CH3 + O2 → Products
1 record matched ·CF3 + O3 → O2 + CF3O
19 records matched ·CF3 + O2 → CF3O2
1 record matched ·CF3 + O2 → Products
1 record matched ·CH3 + O3 → CH3O· + O2
2 records matched ·CH3 + O2 → HCO + H2O
14 records matched ·CH3 + O2 → CH3O· + O·
51 records matched ·CH3 + O2 → CH3O2·
22 records matched ·CH3 + O2 → CH2O + ·OH
3 records matched ·CH3 + O2 → Products
1 record matched ·CH3 + HO2 → CH4 + O2
1 record matched Decachlorodicyclopentadienyl + O2 → Pentachlorocyclopentadienoxy + Pentachlorocyclopentadienoxy
2 records matched methyl,(4-fluorophenyl-) + O2 → Products
3 records matched ·CF2 + O2 → COF2 + O·
1 record matched ·CF2 + O2 → Other Products + CO
1 record matched ·CF2 + O2 → Adduct
2 records matched ·CF2 + O2 → Products
3 records matched Benzyl + O2 → C6H5CH2OO
3 records matched Benzyl + O2 → Products
5 records matched CH3CH2O· + O2 → CH3CHO + HO2
1 record matched CH3CH2O· + O2 → Products
1 record matched CH2=C + O2 → CH_2(aA_1) + CO2
1 record matched CH3O· + O· → ·CH3 + O2
25 records matched CH3O· + O2 → CH2O + HO2
4 records matched 1-C3H7 + O2 → n-C3H7O2
1 record matched 1-C3H7 + O2 → C2H5CHO + ·OH
10 records matched 1-C3H7 + O2 → CH3CH=CH2 + HO2
1 record matched 1-C3H7 + O2 → Methyloxirane + ·OH
1 record matched 1-C3H7 + O2 → Products
1 record matched Cyclohexyldioxyl + HO2 → Cyclohexyl hydroperoxide + O2
1 record matched Cyclohexyldioxyl + Cyclohexyldioxyl → Cyclohexanol + Cyclohexanone + O2
2 records matched CH3O2· + CH3C(O)CH2OO· → CH3C(O)CH2O· + CH3O· + O2
1 record matched CH3O2· + CCl3O2 → CH3O· + O2 + CCl3O
2 records matched CH3O2· + CH3C(O)OO(·) → CH3O· + O2 + CH3C(O)O
2 records matched CH3O2· + CH3C(O)OO(·) → CH2O + CH3C(O)OH + O2
2 records matched CH3O2· + O· → CH3O· + O2
4 records matched CH3O2· + ClO → CH3OCl + O2
4 records matched CH3O2· + NO3 → CH3O· + O2 + NO2
1 record matched CH3O2· + O3 → CH3O· + O2 + O2
5 records matched CH3O2· + HO2 → CH3OOH + O2
1 record matched CH3O2· + HO2 → CH2O + H2O + O2
2 records matched CH3O2· + CH3O2· → CH3O· + CH3O· + O2
3 records matched CH3O2· + CH3O2· → (CH3O)2 + O2
1 record matched CH3O2· + CH3O2· → CH2O + CH3OH + O2
1 record matched CH3O2· → ·CH3 + O2
1 record matched ·C2H + O2 → O· + HCCO
1 record matched ·C2H + O2 → CO + HCO
12 records matched ·C2H + O2 → Products
1 record matched ·C2H + O2 → CH(A2Delta, B2Sigma-) + CO2
2 records matched CD3 + O2 → CD3O2·
1 record matched CD3 + O2 → CD2O + OD
1 record matched ·CHCl + O2 → Products
22 records matched ·C2H5 + O2 → C2H5OO·
1 record matched ·C2H5 + O2 → CH3CH2O· + O·
2 records matched ·C2H5 + O2 → Oxirane + ·OH
3 records matched ·C2H5 + O2 → CH3CHO + ·OH
21 records matched ·C2H5 + O2 → C2H4 + HO2
4 records matched ·C2H5 + O2 → Products
4 records matched iso-C3H7 + O2 → (CH3)2CHO2
4 records matched iso-C3H7 + O2 → CH3CH=CH2 + HO2
11 records matched ·CH2CH=CH2 + O2 → CH2=CHCH2OO
1 record matched ·CH2CH=CH2 + O2 → CH2=C=CH2 + HO2
3 records matched ·CH2CH=CH2 + O2 → Other Products + CO
1 record matched ·CH2CH=CH2 + O2 → Other Products + CH2O
4 records matched ·CH2CH=CH2 + O2 → Products
3 records matched ·CH2CH=CH2 + HO2 → CH3CH=CH2 + O2
4 records matched FCO + O2 → FC(O)OO
1 record matched FCO + O2 → Products
4 records matched ·CCl2F + O2 → CCl2FO2
1 record matched ·CClF2 + O3 → O2 + CF2ClO
6 records matched ·CClF2 + O2 → CClF2OO
1 record matched ·CClF2 + O2 → CF2O(*) + ClO
3 records matched ·CClF + O2 → Products
4 records matched tert-C4H9 + O2 → (CH3)3CO2
2 records matched tert-C4H9 + O2 → iso-C4H8 + HO2
1 record matched CCl2 (X 1A1) + O2 → Products
1 record matched FeO + O· → Fe + O2
1 record matched FeO + O3 → O2 + FeO2
3 records matched FeO + O2 → FeO3
6 records matched H2 + O2 → ·OH + ·OH
2 records matched H2 + O2 → HO2 + H·
1 record matched MgO + O3 → O2 + MgO2
2 records matched MgO + O2 → MgO3
2 records matched CaO2 + O· → CaO + O2
4 records matched CaO + O· → Ca + O2
1 record matched CaO + O3 → CaO2 + O2
2 records matched CaO + O2 → CaO3
1 record matched 1,2,4,5-Tetroxane, 3,3,6,6-tetramethyl- → Acetone + Acetone + O2
1 record matched ((CH3)2N)2C=C((N(CH3)2)2) + O2 → Products
1 record matched CO + O3 → CO2 + O2
11 records matched CO + O2 → CO2 + O·
1 record matched CH3ONO + O3 → CH3ONO2 + O2
1 record matched 1,3-Cyclohexadiene + O2 → HO2 + Cyclohexadienyl
2 records matched CH2=CHCH2CH2CH=CH2 + O2 → Other Products + HO2
1 record matched 2-butyne + ·OH + O2 → Products
1 record matched neo-C5H12 + O2 → HO2 + Neopentyl
1 record matched C2H5F + O2 → Products
1 record matched 1-C7H16 + O2 → Products
4 records matched CO2 + O· → CO + O2
1 record matched CO2 + O2 + O· → CO2 + O3
4 records matched C2H5CHO + O2 → HO2 + CH3CH2CO
1 record matched iso-C4H8 + O2 → HO2 + ·CH2C(CH3)=CH2
2 records matched CH3CH=CH2 + O2 → ·CH2CH=CH2 + HO2
1 record matched Cyclohexene + O2 → Products
1 record matched Cyclohexane + O2 → Products
1 record matched Tetrahydrofuran + O2 → Products
1 record matched C2H5ONO + O3 → C2H5ONO2 + O2
1 record matched CH3OCH2OCH3 + O2 → Products
2 records matched Toluene + O2 → Benzyl + HO2
1 record matched Toluene + O2 → Products
1 record matched 1-C4H8 + ·OH + O2 → C2H5CH(OO·)CH2OH
1 record matched 1-C4H10 + O2 + NO → Products
1 record matched CH3CH2CH2CH2CH2C(O)OCH3 + O2 → Products
1 record matched 2-Phenylpropane + O2 → Products
1 record matched 2-Chlorophenol + O2 → Products
1 record matched (CH3)2CHCH(CH3)2 + O2 → HO2 + (CH3)3CC(·)H(CH3)
1 record matched sec-C4H9OH + O2 → Products
1 record matched (CH3)2CHCHO + O2 → HO2 + (CH3)2CHC=O
1 record matched iso-C4H9OH + O2 → Products
1 record matched tert-C4H9OH + O2 → Products
1 record matched CH3CHF2 + O2 → Products
1 record matched Cyclopropane + O2 → Cyclopropyl + HO2
1 record matched CS2 + O2 → CS + SO2
1 record matched CH3CHO + O2 → HO2 + CH2=CHO·
1 record matched CH3CHO + O2 → CH3CO + HO2
1 record matched CH3CHO + O2 → CH3C(O)OOH
1 record matched CH3CCH + ·OH + O2 → Products
2 records matched C3H8 + O2 → Other Products + HO2
1 record matched C2H2 + ·OH + O2 → Products
1 record matched C2H2 + HO2 → C2H3 + O2
2 records matched C2H6 + O2 → ·C2H5 + HO2
2 records matched CH4 + O2 → ·CH3 + HO2
1 record matched CH4 + N2 + O2 → Products
1 record matched n-C4H9OH + O2 → Products
1 record matched CH3OH + O2 + NO → Products
1 record matched CH3OH + HO2 + HO2 → CH3OH + H2O2 + O2
1 record matched C2H5OH + O2 + NO → Products
18 records matched CN + O2 → O· + NCO
2 records matched CN + O2 → CO + NO
1 record matched CN + O2 → CO2 + N
8 records matched CN + O2 → Products
4 records matched CH2O + O2 → HCO + HO2
1 record matched CH2O + HO2 → (·)CH2OH + O2
4 records matched O(1D) + NO2 → O2 + NO
5 records matched O(1D) + NO → O2 + N
16 records matched O(1D) + O3 → O2 + O2
8 records matched O(1D) + N2O → N2 + O2
1 record matched O(1D) + O2 → O3
11 records matched O(1D) + O2 → O2 + O·
4 records matched O(1D) + O2 → Products
3 records matched O(1D) + O2 → O(3P) + O2
1 record matched O(1D) + H2O → H2 + O2
5 records matched O(1D) + CO2 → CO + O2
1 record matched O2(1DELTA) + I → O2 + I
1 record matched O2(1DELTA) + NO2 → O2 + NO2
4 records matched O2(1DELTA) + NO → O2 + NO
9 records matched O2(1DELTA) + O3 → O2 + O2 + O·
2 records matched O2(1DELTA) + N2O → O2 + N2O
1 record matched O2(1DELTA) + O2 → O3 + O·
10 records matched O2(1DELTA) + O2 → O2 + O2
3 records matched O2(1DELTA) + H2O → H2O + O2
5 records matched O2(1DELTA) + N2 → N2 + O2
3 records matched O2(1DELTA) + NH3 → NH3 + O2
1 record matched O2(1DELTA) + HCl → HCl + O2
2 records matched O2(1DELTA) + He → He + O2
3 records matched O2(1DELTA) + Ar → Ar + O2
2 records matched O2(1DELTA) + SF6 → SF6 + O2
4 records matched O2(1DELTA) + H2 → H2 + O2
1 record matched O2(1DELTA) + 2,5-Dimethylpyrrole → 2,5-Dimethylpyrrole + O2
2 records matched O2(1DELTA) + (CH3S)2 → (CH3S)2 + O2
1 record matched O2(1DELTA) + (CH2=CHCH2)2S → (CH2=CHCH2)2S + O2
1 record matched O2(1DELTA) + (CH3)2C=C(CH3)2 → (CH3)2C=C(CH3)2 + O2
1 record matched O2(1DELTA) + (C2H5)2S → (C2H5)2S + O2
1 record matched O2(1DELTA) + 1,4-Diazabicyclo[2.2.2]octane → 1,4-Diazabicyclo[2.2.2]octane + O2
1 record matched O2(1DELTA) + (CH3)2NH → (CH3)2NH + O2
6 records matched O2(1DELTA) + CO2 → CO2 + O2
1 record matched O2(1DELTA) + (C2H5)3N → (C2H5)3N + O2
1 record matched O2(1DELTA) + CH3CH=CH2 → CH3CH=CH2 + O2
2 records matched O2(1DELTA) + Thiophene → Thiophene + O2
1 record matched O2(1DELTA) + (C2H5)2NH → (C2H5)2NH + O2
1 record matched O2(1DELTA) + 1-C5H10 → 1-C5H10 + O2
1 record matched O2(1DELTA) + 1-C4H8 → 1-C4H8 + O2
1 record matched O2(1DELTA) + CF2Cl2 → CF2Cl2 + O2
1 record matched O2(1DELTA) + (CH3)3N → (CH3)3N + O2
2 records matched O2(1DELTA) + (CH3)2S → (CH3)2S + O2
1 record matched O2(1DELTA) + CS2 → CS2 + O2
1 record matched O2(1DELTA) + C2H5SH → C2H5SH + O2
1 record matched O2(1DELTA) + C2H5NH2 → C2H5NH2 + O2
1 record matched O2(1DELTA) + C3H8 → C3H8 + O2
1 record matched O2(1DELTA) + CH3SH → CH3SH + O2
1 record matched O2(1DELTA) + CH3NH2 → CH3NH2 + O2
1 record matched O2(1DELTA) + CH3Cl → CH3Cl + O2
2 records matched O2(1DELTA) + C2H4 → C2H4 + O2
1 record matched O2(1DELTA) + CH4 → CH4 + O2
1 record matched O2(1DELTA) + Benzene → Benzene + O2
7 records matched O2(1DELTA) + O2(1DELTA) → O2 + O2
1 record matched C2F5C(O)O2 + HO2 → C2F5C(O)O + ·OH + O2
1 record matched HCCCO + O2 → Products
1 record matched CF3CF2CF2C(O)· + O2 → n-C3F7C(O)OO·
1 record matched CH3CHClO· + O2 → CH3COCl + HO2
1 record matched CH3CHClO2· + CH3CHClO2· → CH3COCl + CH3CHClOH + O2
1 record matched CH3CHClO2· + CH3CHClO2· → CH3CHClO· + CH3CHClO· + O2
1 record matched CH3CF2OO· + HO2 → CH3CF2OOH + O2
1 record matched CH3CF2OO· + HO2 → CH3CF2O(·) + ·OH + O2
1 record matched CH3CH2CH2C(O)OO· + HO2 → O2 + CH3CH2CH2C(O)OOH
1 record matched CH3CH2CH2C(O)OO· + HO2 → ·OH + O2 + CH3CH2CH2C(O)O·
2 records matched CFCl2CH2O· + O2 → HO2 + CCl2FCHO
1 record matched CH3C(O)C(O)· + O2 → CH3C(O)C(O)O2
1 record matched BrCH2CH2OO· + BrCH2CH2OO· → Other Products + O2
3 records matched CF3CF2CFHO(.) + O2 → Other Products + HO2
1 record matched (CH3)2C(OH)COO(.)(CH3)2 + HO2 → (CH3)2C(OH)C(OOH)(CH3)2 + O2
1 record matched (CH3)2C(OH)COO(.)(CH3)2 + (CH3)2C(OH)COO(.)(CH3)2 → HOC(CH3)2C(CH3)2O(.) + HOC(CH3)2C(CH3)2O(.) + O2
1 record matched CF2ClCH2O(.) + O2 → Acetaldehyde, chlorodifluoro- + HO2
1 record matched CH2ClCHClO(.) + O2 → CH2ClCOCl + HO2
1 record matched (·)CH2C(CH3)2OOH + O2 → (CH3)2C(OOH)CH2OO·
1 record matched CH2DO + O2 → CHDO + HO2
1 record matched CH3OCH2OCH2O(.) + O2 → CH3OCH2OCHO(.) + HO2
1 record matched CF3CH(.)OCH2CF3 + O2 → CF3CH(OO.)OCH2CF3
1 record matched 3-pentoxy radical + O2 → (C2H5)2CO + HO2
1 record matched 3-pentoxy radical + O2 → Products
1 record matched C10H15 + O2 → C10H15OO
1 record matched [CH3OH..HO2] complex + HO2 → CH3OH + H2O2 + O2
1 record matched CF (A 2Sigma+, v=1) + O2 → CF + O2
1 record matched CF (A 2Sigma+, v=0) + O2 → CF + O2
1 record matched CCl2 (a 3B1) + O2 → CCl2 (X 1A1) + O2
1 record matched CCl2 (A 1B1) + O2 → CCl2 (X 1A1) + O2
1 record matched C3H4ClO2 → CH2=CCl=CH2 + O2
3 records matched CH2=CCl=CH2 + O2 → C3H4ClO2
1 record matched (CH3)2SBr + O2 → (CH3)2S + BrO
1 record matched C6H5C(O)O2 + HO2 → C6H5C(O)OOH + O2
1 record matched C6H5C(O)O2 + HO2 → C6H5C(O)O· + ·OH + O2
1 record matched C6H5C(O)O2 + C6H5C(O)O2 → 2C6H5COO + O2
1 record matched C6H6-OH + O2 → C6H6-OH-O2
1 record matched C6H6-OH-O2 + O2 → Products
1 record matched CH2=C(CH3)CO + O2 → Products
1 record matched CH3CH2CH2CH2CH2O + O2 → CH3CH2CH2CH2CHO + HO2
1 record matched CH3CH2CH2CH2O· + O2 → CH3CH2CH2CHO + HO2
1 record matched ClS(CH3)2 + O2 → Products
1 record matched M + CH3OCH2O· → HC(O)OCH3 + O2
1 record matched M + O2 + ·F → M + O2F
10 records matched M + O2 + H· → M + HO2
1 record matched M + HO2 + HO2 → M + H2O2 + O2
2 records matched M + FCO + O2 → M + FC(O)OO
1 record matched M + ·CClF2 + O2 → M + CClF2OO
1 record matched NCCO + O2 → CO2 + NCO
2 records matched NCCO + O2 → Products
1 record matched BrC(CH3)2C(CH3)2O2 + BrC(CH3)2C(CH3)2O2 → BrC(CH3)2C(CH3)2O + BrC(CH3)2C(CH3)2O + O2
1 record matched methyl formate radical + O2 → CO2 + ·OH + HOCH
1 record matched N(2D) + O2 → NO(X2Pi) + O(1D)
1 record matched CN(X2Sigma+) + O2 → O· + NCO
2 records matched O(3P) + NO2 → O2 + NO
2 records matched O(1D) + O2 → O(3P) + O2
1 record matched O(1S) + O2 → Products
1 record matched O2(1Delta_g) + O2 → O2(X3Sigma_g-) + O2
1 record matched NF(a1Delta) + O2 → Products
1 record matched ·CH(OH)C(O)CH3 + O2 → CH3C(O)CHO + HO2
1 record matched ·CH(OH)C(O)CH3 + O2 → CH3C(O)OH + CO + ·OH
1 record matched ·CH(OH)C(O)CH3 + O2 → CH3C(O)OH + CO2 + H·
1 record matched ·CH(OH)C(O)CH3 + O2 → HCOOH + H2C=C=O + ·OH
1 record matched ·CH(OH)C(O)CH3 + O2 → HCOOH + CO2 + ·CH3
1 record matched hydroxy-isoprene + O2 → isoprene hydroxy-peroxy
1 record matched CH3CHOCH2CH3 + O2 → Products
1 record matched CH2(X3B_1) + O2 → Products
1 record matched CH2ClCH(OO)C(O)CH3 + HO2 → CH2ClCH(OOH)C(O)CH3 + O2
1 record matched CH2ClCH(OO)C(O)CH3 + HO2 → CH2ClCH(O·)C(O)CH3 + ·OH + O2
1 record matched Pentadienyl radical + O2 → Pentadienylperoxy radical
1 record matched Pentadienylperoxy radical → Pentadienyl radical + O2
1 record matched C(3Pj) + O2 → CO + O·
1 record matched CH2=C(CH3)CHClCH2· + O2 → C5H8ClO2
1 record matched CH2FOCHFO + O2 → CH2FOC(O)F + HO2
1 record matched C3H7CF(OCHO(·)CH3)CF(CF3)2 + O2 → C3H7CF(OC(O)CH3)CF(CF3)2 + HO2
1 record matched C6H11O + O2 → Products
1 record matched OHC5H8 + O2 → isoprene hydroxy-peroxy
1 record matched OHC5H8 + O2 → C5H8(OH)O2
1 record matched CHCl2CCl2O2 + CHCl2CCl2O2 → CHCl2CCl2O· + CHCl2CCl2O· + O2
1 record matched ClCH2CH(O)CF3 + O2 → CF3C(O)CH2Cl + HO2
1 record matched CH3(Cl)S(O)CH3 + O2 → Products
1 record matched CH2=CHCH(·)CH2OH + O2 → Products
1 record matched CH2=CHCH(·)CH2OH + O2 → trans-OHCH2CH=CHCH2OO·
1 record matched C2H2F3O + O2 → Products
1 record matched C2H4FO + O2 → Products
1 record matched C2H3F2O + O2 → Products
1 record matched (CH3)CH(OO·)COCH3 + HO2 → ·OH + O2 + CH3C(O)CH(O·)CH3
1 record matched (CH3)CH(OO·)COCH3 + HO2 → O=C(CH3)CH(CH3)OOH + O2
1 record matched (CH3)CH(OO·)COCH3 → O2 + CH3C(O)CH(·)CH3
1 record matched (CH3)CH(OO·)COCH3 + (CH3)CH(OO·)COCH3 → (CH3CO)2 + CH3CH(OH)C(O)CH3 + O2
1 record matched (cyc-C(i-C3F7)CFCF2CF(i-C3F7)O)-O-CH(O·)CH3 + O2 → 2-acetoxy-3,3,4,4,5-pentafluorotetra-hydro-2,5-bis[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]-furan + HO2
1 record matched m-xylene-OH adduct + O2 → Products
1 record matched p-xylene-OH adduct + O2 → Products
1 record matched 6-hydroxy-1,2,3,4,5,6-hexamethylcyclohexa-2,4-dien-1-yl + O2 → Products
1 record matched aniline-OH adduct + O2 → Products
1 record matched m-cresol-OH adduct + O2 → Products
1 record matched CH3CH2C(O)CH2CH2· + O2 → Products
1 record matched CH3C(·)(OH)CH2CH=CH2 + O2 → HO2 + CH3C(O)CH2CH=CH2
1 record matched CH3CH2CH2S(OH)CH2CH2CH3 + O2 → Products
1 record matched CH3CH2CH2CH2S(OH)CH2CH2CH2CH3 + O2 → Products
1 record matched cis-CHCl=CCl· + O2 → Products
1 record matched CH2ClC(CH3)(OO·)CHO + HO2 → CH2ClC(CH3)(OOH)CHO + O2
1 record matched CH2ClC(CH3)(OO·)CHO + HO2 → CH2ClC(CH3)(O·)CHO + ·OH + O2
2 records matched (CH3)2CBr-C(·)(CH3)2 + O2 → BrC(CH3)2C(CH3)2O2
1 record matched BrH2CC(·)(CH3)CH=CH2 + O2 → BrH2CC(OO·)(CH3)CH=CH2
1 record matched H2C=CHC(·)HCH2Br + O2 → H2C=CHC(OO·)HCH2Br
1 record matched CH3C(O)CH2CH2OO· + (CH3)CH(OO·)COCH3 → Other Products + (CH3CO)2 + O2
1 record matched propyne-OH adduct + O2 → Products
1 record matched ·CH2CH(CH3)CH2CH2CH(CH3)2 + O2 → Products
1 record matched (CH3)2CHC(·)HCH2CH(CH3)2 + O2 → Products
1 record matched (CH3)2CHCH2CH2C(·)(CH3)2 + O2 → Products
1 record matched 4-hydroperoxy-cyclohepta-2,6-dienyl radical + O2 → Products
1 record matched cyclohepta-2,6-dienyl radical + O2 → Products
1 record matched Tetrahydropyranyl (unspecified isomer) + O2 → Products
1 record matched CH(X2 Pi) + O2 → Products
1 record matched (CH3)2C(OH)CH2O2· + HO2 → (CH3)2C(OH)CH2OOH + O2
1 record matched 2-butyne-OH adduct + O2 → (CH3CO)2 + ·OH
1 record matched 2-butyne-OH adduct + O2 → CH3C(O)OH + CH3CO
2 records matched 2-butyne-OH adduct + O2 → Products
1 record matched Propyl Radical + O2 → C2H4 + HO2
1 record matched Propyl Radical + O2 → Other Products + ·OH
1 record matched 2-methylvinoxy radical + O2 → CH3CHOOCHO
1 record matched NCNO2 → NCN + O2
1 record matched CH2=CHCH(OD)CH2(·) + O2 → Products
1 record matched NaO(A2SIGMA+) + O(3P) → Na + O2
2 records matched NaO(A2SIGMA+) + O(3P) → Na(2P) + O2
1 record matched NaO(A2SIGMA+) + O(3P) → Na(2S) + O2
1 record matched C2H5ICl + O2 → Products
1 record matched O2- + O2(1Delta_g) → O2 + O2
1 record matched CF3C(O·)HCHFCl + O2 → CF3C(O)CHFCl + HO2
1 record matched NBr(a1Δ) + O2 → Products
1 record matched (CH3)3COCH2· + O2 → Products
1 record matched C2H5CH(OH)CH2OO· + HO2 → C2H5CH(OH)CH2OOH + O2
1 record matched C2H5CH(OH)CH2OO· + C2H5CH(OH)CH2OO· → CH3CH2CH(OH)CH2O + CH3CH2CH(OH)CH2O + O2
1 record matched C2H5CH(OO·)CH2OH + HO2 → C2H5CH(OOH)CH2OH + O2
1 record matched C2H5CH(OO·)CH2OH + C2H5CH(OH)CH2OO· → C2H5CH(O·)CH2OH + CH3CH2CH(OH)CH2O + O2
1 record matched C2H5S(OH)C2H5 + O2 → Products
1 record matched peroxy-hydroxy-cyclohexadienyl, unspecified isomer → O2 + Cyclohexadienyl, 6-hydroxy-
1 record matched CH3S(OH)C2H5 + O2 → Products
1 record matched n-CF3CF2CF2CF2C(O)· + O2 → n-CF3CF2CF2CF2C(O)OO·
1 record matched CHCl2CHClO2· + CHCl2CHClO2· → CHCl2CHClO· + CHCl2CHClO· + O2
1 record matched iso-C3D7 + O2 → Products
1 record matched n-C3D7 + O2 → Products
1 record matched HCO(X2A,v=001) + O2 → Products
1 record matched HCO(X2A,v=010) + O2 → Products
1 record matched HCO(X2A,v=000) + O2 → Products
1 record matched C6H5C2H2 + O2 → C6H5C2H2OO
1 record matched CF2-trip + O2 → Products
1 record matched CH3S·(A-state) + O2 → CH3S· + O2
1 record matched 6-chlorocyclohexadienyl radical + O2 → Products
1 record matched CH2OC4F9 + O2 → C4F9OCH2O2
1 record matched CH2ClCH2O2 + CH2ClCH2O2 → O2 + CH2ClCH2O + CH2ClCH2O
1 record matched FC(O)OO + FC(O)OO → O2 + FC(O)O· + FC(O)O·
1 record matched FC(O)OO + FC(O)OO → FC(O)OO(O)CF + O2
1 record matched CH3CH2C(O)OO + CH3CH2C(O)OO → C2H5OCOCOOC2H5 + O2
1 record matched CH2=CHO2 → C2H3 + O2
1 record matched CH3C(O)CH2OO· + CH3C(O)CH2OO· → CH3C(O)CH2O· + CH3C(O)CH2O· + O2
2 records matched CH2ClO2 + CH2ClO2 → O2 + CH2ClO + CH2ClO
1 record matched CH2ClO2 + CH2ClO2 → CH2O + O2 + ·Cl + CH2ClO
1 record matched CH3OCH2O2 + CH3OCH2O2 → O2 + CH3OCH2O· + CH3OCH2
1 record matched CH3OCH2O2 + CH3OCH2O2 → HC(O)OCH3 + CH3OCH2OH + O2
1 record matched CH3OCH2O2 → O2 + CH3OCH2·
1 record matched CCl3O2 + CCl3O2 → O2 + (CCl3O)2
1 record matched HOCH2CH2O2· + HOCH2CH2O2· → O2 + HOCH2CH2O + HOCH2CH2O
1 record matched CCl3CCl2O2 + CCl3CCl2O2 → O2 + C2Cl5OOC2Cl5
1 record matched CCl3CCl2O2 + CCl3CCl2O2 → O2 + C2Cl5O + C2Cl5O
1 record matched CCl3CCl2O2 → C2Cl5 + O2
1 record matched CH3C(O)OO(·) + CH3C(O)OO(·) → CH3OCOCOOCH3 + O2
1 record matched HOCH2OO + HOCH2OO → O2 + HOCH2O + HOCH2O
1 record matched O· + HSO → O2 + SH
1 record matched O· + BrONO2 → O2 + BrNO2
2 records matched O· + O· → O2
2 records matched OClO → O2 + ·Cl
1 record matched CF3O2 + CF3CFHO2· → O2 + CF3O + CF3CFHO
1 record matched CF3O2 → ·CF3 + O2
2 records matched BrO + BrO → Br2 + O2
1 record matched O2F → O2 + ·F
1 record matched ClO + O· → O2 + ·Cl
2 records matched ClO + BrO → O2 + BrCl
2 records matched ClO + ClO → O2 + Cl2
3 records matched HNO + O· → O2 + NH
2 records matched SO + O· → S + O2
1 record matched DO2 + DO2 → D2O2 + O2
1 record matched H· + SiH3OO → O2 + SiH4
2 records matched NO3 → O2 + NO
1 record matched KO2 → K + O2
2 records matched NO2 + O· → O2 + NO
1 record matched NO2 + ·N3 → N2 + N2 + O2
1 record matched NO2 + C2O → NCCO + O2
1 record matched NO2 + OF → O2 + FNO
2 records matched NO2 + NO3 → O2 + NO + NO2
1 record matched NO + O· → O2 + N
1 record matched NO + O2F → O2 + FNO
1 record matched NO + NO → N2 + O2
1 record matched ClOO + NO → ClNO + O2
3 records matched ClOO → O2 + ·Cl
1 record matched O3 + CH3CH(·)OO· → CH3CHO + O2 + O2
1 record matched O3 + CH3SOO → O2 + CH3SO3
1 record matched O3 + S2 → O2 + S2O
2 records matched O3 + ·Cl → O2 + ClO
1 record matched O3 + O· → O2 + O2
1 record matched O3 + D → O2 + OD
1 record matched O3 + O2F → O2 + O2 + OF
1 record matched O3 + ·F → O2 + OF
1 record matched O3 + HNO → O2 + HNO2
1 record matched O3 + SH → O2 + HSO
2 records matched O3 + H· → ·OH + O2
1 record matched O3 + NO3 → O2 + O2 + NO2
2 records matched O3 + NO2 → O2 + NO3
1 record matched O3 + NO2 → O2 + O2 + NO
4 records matched O3 → O2 + O·
2 records matched N2O + O· → N2 + O2
1 record matched H2S + O3 → H2S=O + O2
1 record matched O2 + CH2=C(CH3)CH2CH(OH)(·) → Products
1 record matched O2 + CH3CHBrO(·) → CH3COBr + HO2
1 record matched O2 + CH2(OH)C(CH3)=CHCH2(·) → CH2=CHC(CH3)(OO·)CH2OH
1 record matched O2 + CH2(OH)C(CH3)=CHCH2(·) → (E)-CH2OHC(CH3)=CHCH2OO·
1 record matched O2 + HC(O)CO → CO2 + CO + ·OH
1 record matched O2 + HC(O)CO → Products
2 records matched O2 + HC(O)CO → HC(O)C(O)O2
1 record matched O2 + HC(O)CO → OC(·)C(O)OOH
1 record matched O2 + CH2=C(CH3)CH(OH)CH2(·) → CH2=C(CH3)CH(OH)CH2OO·
1 record matched O2 + CH2=CHC(CH3)(OH)CH2(·) → CH2=CHC(CH3)(OH)CH2OO·
1 record matched O2 + (·)C(CH2OOH)(CH3)CH2CH3 → Products
2 records matched O2 + CF3CFHO → CF3COF + HO2
1 record matched O2 + 2-(·)C6H4C2H3 → H2C=C=O + C6H5O
1 record matched O2 + CS2OH → Products
1 record matched O2 + HOOCH2O → HC(O)OOH + HO2
1 record matched O2 + 1,4-Dicyclopropylbuta-1,3-diyne → Products
1 record matched O2 + CH2CHC·CH2 → Vinylacetylene + HO2
1 record matched O2 + CH2CHC·CH2 → H2C=C=O + CH2=CHO·
1 record matched O2 + CH2CHC·CH2 → CH2O + CH2=CHC(·)O
1 record matched O2 + CH2CHC·CH2 → Products
1 record matched O2 + CH2CHC·CH2 → H2C=CHC(O)CH2(·) + O·
1 record matched O2 + CH2CHC·CH2 → CH2=C=CHCH2OO·
1 record matched O2 + CH2CHC·CH2 → CH2=C(OO·)CH=CH2
1 record matched O2 + CH2CHC·CH2 → cyc-CH2OOC(=CH2)CH·
1 record matched O2 + CCl2=CCl → O· + ·CCl2C(O)Cl
1 record matched O2 + CCl2=CCl → COCl2 + ClCO
1 record matched O2 + CCl2=CCl → Products
1 record matched O2 + CH2CH2OCH2 → 1,2,4-Trioxane
1 record matched O2 + CH2CH2OCH2 → ·CH2OCH2CH2OO·
1 record matched O2 + CH2CH2OCH2 → ·OCH2OCH2CH2
1 record matched O2 + CH2CH2OCH2 → ·OCH2CH2O· + CH2O
1 record matched O2 + HOCH2O → HCOOH + HO2
1 record matched O2 + CF2I → COF2 + IO
1 record matched O2 + CH2=CHCH(·)CH3 → Products
3 records matched O2 + ·CH2CH=CHCH2CH3 → CH2=CHCH=CHCH3 + HO2
1 record matched O2 + ·CH2 → HCO + ·OH
2 records matched O2 + ·CH2 → CO + H2O
1 record matched O2 + ·CH2 → CO + ·OH + H·
3 records matched O2 + ·CH2 → CO2 + H· + H·
2 records matched O2 + ·CH2 → CO2 + H2
2 records matched O2 + ·CH2 → CH2O + O·
1 record matched O2 + ·CH2 → Other Products + ·OH
4 records matched O2 + ·CH2 → Products
1 record matched O2 + ·CH2 → O(1D) + HCO + H·
1 record matched O2 + ·CH2 → O(1D) + CO + H2
1 record matched O2 + ·CH2 → O(1D) + CH2O
1 record matched O2 + CH2OCH2 → 1,2,4-Trioxolane
1 record matched O2 + CH2OCH2 → ·CH2OCH2OO·
1 record matched O2 + CH2OCH2 → ·OCH2OCH2
1 record matched O2 + CH2OCH2 → ·OCH2O· + CH2O
1 record matched O2 + cyclopentyloxy → Cyclopentanone + HO2
1 record matched O2 + (CH3)2S.OH → (CH3)2SO + HO2
3 records matched O2 + HCCO → Products
1 record matched O2 + CH3NH → CH2=NH + HO2
2 records matched O2 + CH3NH → Products
1 record matched O2 + CH3C(·)HCHO → CH(O)CH(CH3)OO·
1 record matched O2 + CH3C(·)HCHO → HOOCH(CH3)C(·)O
1 record matched O2 + HC=S → CS + HO2
1 record matched O2 + HC=S → SC(O)H + O·
2 records matched O2 + HOSO2 → HO2 + SO3
2 records matched O2 + HOSO2 → HOS(O)(O)OO·
1 record matched O2 + ClSO2 → Products
1 record matched O2 + ·CH2CH2CH2· → 1,2-Dioxolane
1 record matched O2 + ·CH2CH2CH2· → ·CH2CH2CH2OO·
1 record matched O2 + ·CH2CH2CH2· → ·OCH2CH2CH2
1 record matched O2 + ·CH2CH2CH2· → ·CH2CH2O· + CH2O
1 record matched O2 + CH3SCH2 → CH2O + CH3SO
1 record matched O2 + CH3SCH2 → CH2O + CH2S + ·OH
1 record matched O2 + CH3SCH2 → CH3SCH2OO·
1 record matched O2 + CH3SCH2 → ·CH2SCH2OOH
1 record matched O2 + CH3SCH2 → CH3SC(O)H + ·OH
1 record matched O2 + CH3SCH2 → 1,3-oxathietane + ·OH
1 record matched O2 + CH2NHCH3 → Products
1 record matched O2 + CH3CHNH2 → Products
1 record matched O2 + (CH3)3C-C(·)(CH3)2 → (CH3)3CC(CH3)=CH2 + HO2
1 record matched O2 + (CH3)3CCH2C(·)(CH3)2 → (CH3)3CCH2C(OO·)(CH3)2
1 record matched O2 + ·C(O)N(CH3)2 → Products
1 record matched O2 + 2-methylphenyl → C7H7O2
5 records matched O2 + ·Cl → ClOO
1 record matched O2 + CH3CH2CH2C(·)HOH → Products
3 records matched O2 + CH2=CHCH(·)CH2CH3 → CH2=CHCH=CHCH3 + HO2
2 records matched O2 + N → NO + O·
4 records matched O2 + O· → O3
1 record matched O2 + O· → O2 + O·
1 record matched O2 + 2-phenylethyl → Styrene + HO2
1 record matched O2 + 2-phenylethyl → Products
1 record matched O2 + 2-phenylethyl → 2-phenylethyl peroxy radical
1 record matched O2 + D → OD + O·
1 record matched O2 + CH3OCH2· → CH3OCH2O2
1 record matched O2 + CH3OCH2· → Other Products + ·OH
1 record matched O2 + CH3OCH2· → CH2OCH2OOH
1 record matched O2 + ·CH2I → CH2O + IO
1 record matched O2 + ·CH2(CH2)3CH=CH2 → CH2=CH(CH2)3CH2OO(·)
1 record matched O2 + CH3CH2CO → Products
1 record matched O2 + CH2=C(·)CH3 → CH2O + CH3CO
6 records matched O2 + ·F → O2F
1 record matched O2 + SH → HSO2
2 records matched O2 + SH → HSOO
1 record matched O2 + SiH2 → SiH2OO
2 records matched O2 + NH → HNO + O·
5 records matched O2 + NH → ·OH + NO
1 record matched O2 + NH → Products
1 record matched O2 + NH → (3)HNO + O·
1 record matched O2 + NH → H-cNOO
1 record matched O2 + NH → cis-(1)HNOO
1 record matched O2 + NH → trans-(1)HNOO
1 record matched O2 + NH → cis-(3)HNOO
1 record matched O2 + NH → trans-(3)HNOO
1 record matched O2 + NH2 → ·OH + HNO
1 record matched O2 + NH2 → HO2 + NH
1 record matched O2 + NH2 → Products
1 record matched O2 + SiH3 → O· + H3SiO(·)
1 record matched O2 + SiH3 → H· + HSi(O)OH
1 record matched O2 + SiH3 → ·OH + H2Si=O
1 record matched O2 + H· → H· + O· + O·
16 records matched O2 + H· → ·OH + O·
20 records matched O2 + H· → HO2
1 record matched O2 + Cyclohexadienyl → Benzene + HO2
1 record matched O2 + Cyclohexadienyl → 2,4-cyclohexadienyl peroxy radical
1 record matched O2 + Cyclohexadienyl → 2,5-cyclohexadienyl peroxy radical
1 record matched O2 + Cyclohexadienyl → Cyclohexadienyldioxy
2 records matched O2 + TiO → TiO + O·
1 record matched O2 + CrO → CrO2 + O·
1 record matched O2 + Cyclohexadienyl, 6-hydroxy- → Phenol + H2O
1 record matched O2 + Cyclohexadienyl, 6-hydroxy- → Phenol + HO2
1 record matched O2 + Cyclohexadienyl, 6-hydroxy- → Products
1 record matched O2 + Cyclohexadienyl, 6-hydroxy- → trans-2,4-Cyclohexadienylperoxy, 6-hydroxy-
1 record matched O2 + Cyclohexadienyl, 6-hydroxy- → cis-2,4-Cyclohexadienylperoxy, 6-hydroxy-
1 record matched O2 + Cyclohexadienyl, 6-hydroxy- → trans-2,5-Cyclohexadienylperoxy, 4-hydroxy-
1 record matched O2 + Cyclohexadienyl, 6-hydroxy- → cis-2,5-Cyclohexadienylperoxy, 4-hydroxy-
1 record matched O2 + Cyclohexadienyl, 6-hydroxy- → peroxy-hydroxy-cyclohexadienyl, unspecified isomer
1 record matched O2 + 2-Isopropylfuran → 2-(furan-2-yl)-2-propyl radical + HO2
1 record matched O2 + CH2NH2 → CH2=NH + HO2
4 records matched O2 + 2-Naphthalenyl → 2-naphthylperoxy
1 record matched O2 + 2-Naphthalenyl → naphthalen-2-olate + O·
2 records matched O2 + NO + NO → NO2 + NO2
1 record matched O2 + NO → NO3
1 record matched O2 + SiH4 → H· + SiH3OO
1 record matched O2 + H2S → HO2 + SH
1 record matched O2 + O2 + (CH3)2S.OH → CH3S(OH)(OO·)CH3 + O2
2 records matched O2 → O· + O·
1 record matched F2 + O2 → ·F + O2F
1 record matched H2O + O· → H2 + O2
1 record matched H2O + O2 + HOSO2 → HO2 + H2SO4
1 record matched H2O + O2 → HO2 + ·OH
1 record matched N2 + O2 + (CH3)2S.OH → CH3S(OH)(OO·)CH3 + N2
1 record matched H2O2 + O2 → HO2 + HO2
8 records matched S + O2 → SO + O·
1 record matched Ca + O2 → CaO + O·
1 record matched C + O2 → Products
1 record matched Be + O2 → BeO + O·
1 record matched Ba + O2 → BaO + O·
1 record matched W + NO2 → WN + O2
1 record matched Sr + O2 → SrO + O·
3 records matched Na + O2 → NaO2
1 record matched K + O2 → KO2
1 record matched Ni + O2 → NiO2
1 record matched Ni + O2 → ONiO
1 record matched Mg + O2 → MgO + O·
2 records matched Li + O2 → LiO2
1 record matched Pb + O2 → PbO2(isomer mix)
1 record matched ·CH2CH(CH3)CH2CH3 + O2 → CH3CH2CH(CH3)CH2OO·
2 records matched CD3O + O2 → CD2O + DO2
1 record matched CH3S· + O2 → CH3SOO
1 record matched CH3S· + O2 → O· + CH3SO
1 record matched CH3S· + O2 → ·CH3 + SO2
2 records matched CH3S· + O2 → CH2S + HO2
1 record matched CH3S· + O2 → Products
1 record matched CH3S· + O2 → anti-CH3SOO
1 record matched C2Cl5 + O2 → CCl3CCl2O2
1 record matched CH2=CHO· + O2 → O=CHCH2OO
1 record matched CH2=CHO· + O2 → Products
1 record matched CH2=CHO· + O2 → C(OOH)H2CO
1 record matched ·CH2Cl + O2 → HC(O)Cl + ·OH
1 record matched ·CH2Cl + O2 → H2CO2 + ·Cl
1 record matched CH3CH=C(·)H + O2 → CH3CHO + HCO
1 record matched iso-C4H9 + O2 → iso-C4H8 + HO2
1 record matched *CH2C(O)H + O2 → H2C=C=O + HO2
3 records matched *CH2C(O)H + O2 → Products
1 record matched C6H5CH2OO + O3 → O2 + O2 + C6H5CH2O
1 record matched C6H5CH2OO → Benzyl + O2
1 record matched (CH3)2CHO2 → iso-C3H7 + O2
2 records matched Neopentyl + O2 → (·)C(CH2OOH)(CH3)CH2CH3
2 records matched Neopentyl + O2 → (CH3)2C(CH2OOH)CH2·
1 record matched Neopentyl + O2 → (CH3)3CCH2OO
2 records matched Neopentyl + O2 → ·OH + 3,3-dimethyl-oxetane
2 records matched Neopentyl + O2 → ·CH3 + 2-Methyl-2-propenylhydroperoxide
2 records matched Neopentyl + O2 → 2,2-dimethylpropanal + ·OH
2 records matched Neopentyl + O2 → CH2O + iso-C4H8 + ·OH
1 record matched (CH3)3CO2 + O3 → (CH3)3CO· + O2 + O2
1 record matched (CH3)3CO2 + (CH3)3CO2 → Other Products + O2
2 records matched Cyclohexyloxy- + O2 → Cyclohexanone + HO2
1 record matched ·OH + BrO2 → O2 + HOBr
12 records matched ·OH + O· → O2 + H·
1 record matched ·OH + OClO → O2 + HOCl
1 record matched ·OH + CF3O2 → CF3OH + O2
1 record matched ·OH + CF3O2 → COF2 + HF + O2
1 record matched ·OH + ClO → HCl + O2
1 record matched ·OH + NO3 → trans-HONO + O2
3 records matched ·OH + O3 → HO2 + O2
2 records matched ·OH + ·OH → H2 + O2
1 record matched ·CH + O2 → HCO + O·
1 record matched ·CH + O2 → CO + ·OH
1 record matched ·CH + O2 → CO2 + H·
1 record matched 2-Ethylfuran + O2 → 2-(furan-2-yl)ethyl radical + HO2
1 record matched HO2 + CF3C(O)OO(·) → CF3C(O)OOH + O2
1 record matched HO2 + CF3CFHO2· → O2 + CF3CFHOOH
1 record matched HO2 + CF3CCl2OO(·) → O2 + CF3CCl2OOH
2 records matched HO2 + CH2BrOO → CH2BrO + ·OH + O2
2 records matched HO2 + CH3C(O)CH2OO· → CH3C(O)CH2O· + ·OH + O2
2 records matched HO2 + CH3C(O)CH2OO· → CH3C(O)CH2OOH + O2
2 records matched HO2 + CH2ClO2 → O2 + CH2ClOOH
1 record matched HO2 + CH2ClO2 → HCl + O2 + CH2OO
1 record matched HO2 + CH2ClO2 → HC(O)Cl + H2O + O2
1 record matched HO2 + CH2ClO2 → CH2O + O2 + HOCl
1 record matched HO2 + Methyldioxy, dichloro- → CHCl2OOH + O2
1 record matched HO2 + CCl3O2 → CCl3OOH + O2
1 record matched HO2 + CH3(CH2)3CH2OO· → 1-C5H11OOH + O2
3 records matched HO2 + CH3C(O)OO(·) → ·OH + O2 + CH3C(O)O
3 records matched HO2 + CH3C(O)OO(·) → CH3C(O)OOH + O2
1 record matched HO2 + (CH3)3CCH2OO → (CH3)3CCH2OOH + O2
1 record matched HO2 + CH3SO → O2 + CH3SOH
1 record matched HO2 + NCO → HN=C=O + O2
1 record matched HO2 + n-C8H17O2 → 1-C8H17OOH + O2
1 record matched HO2 + 1-C7H15-OO· → 1-C7H15OOH + O2
1 record matched HO2 + n-C6H13O2 → 1-C6H13OOH + O2
1 record matched HO2 + CH3CH2CH2CH2OO· → 1-C4H9OOH + O2
4 records matched HO2 + O· → ·OH + O2
1 record matched HO2 + CF3O2 → O2 + CF3OOH
1 record matched HO2 + ·CH2C(CH3)=CH2 → iso-C4H8 + O2
4 records matched HO2 + ClO → O2 + HOCl
1 record matched HO2 + ·F → HF + O2
1 record matched HO2 + SH → O2 + H2S
7 records matched HO2 + H· → H2 + O2
1 record matched HO2 + NO2 → trans-HONO + O2
1 record matched HO2 + HgBr → BrHgH + O2
1 record matched HO2 + O3 → ·OH + O2 + O2
1 record matched HO2 + O3 → HO3 + O2
1 record matched HO2 + H2O + SH → H2O + O2 + H2S
1 record matched HO2 + H2O2 → ·OH + H2O + O2
1 record matched HO2 + SO3 → O2 + HOSO2
1 record matched HO2 + SO2 → O2 + HSO2
1 record matched HO2 + SO2 → HOSO + O2
1 record matched HO2 + CH3S· → CH3SH + O2
8 records matched HO2 + ·OH → H2O + O2
9 records matched HO2 + HO2 → H2O2 + O2
2 records matched CH3CO + O2 → CH3C(O)OO(·)
1 record matched CH3CO + O2 → CO2 + CH3
1 record matched C2H5OO· + O3 → CH3CH2O· + O2 + O2
2 records matched C2H5OO· + HO2 → CH3CH2OOH + O2
1 record matched C2H5OO· + HO2 → CH3CH2O· + ·OH + O2
1 record matched C2H5OO· + HO2 → CH3CHO + H2O + O2
1 record matched C2H5OO· + C2H5OO· → CH3CH2O· + CH3CH2O· + O2
1 record matched C2H5OO· → ·C2H5 + O2
2 records matched Cyclohexyl + O2 → Products
1 record matched CH3C(O)CH2(·) + O2 → CH3C(O)CH2OO·
1 record matched CH3C(O)CH2(·) + O2 → Products
1 record matched CH3C(O)CH2(·) + O2 → HOOCH2C(O)C(·)H2
1 record matched CH2C≡CH + O2 → CO + CH3CO
2 records matched CH2C≡CH + O2 → H2C=C=O + HCO
1 record matched CH2C≡CH + O2 → CO2 + C2H3
1 record matched ·CH2C(O)OH + O2 → ·OOCH2C(O)OH
2 records matched C(O)NH2 + O2 → Products
1 record matched C2H3 + O3 → O2 + HOCH=CH
1 record matched C2H3 + O3 → CH3CO + O2
1 record matched C2H3 + O3 → CH2C(·)OH + O2
3 records matched C2H3 + O2 → CH2=CHO2
3 records matched C2H3 + O2 → CH2=CHO· + O·
1 record matched C2H3 + O2 → CO2 + ·CH3
1 record matched C2H3 + O2 → C2H2 + HO2
3 records matched C2H3 + O2 → CH2O + HCO
1 record matched C2H3 + O2 → CH2O + CO + H·
2 records matched C2H3 + O2 → Products
1 record matched C2H3 + O2 → trans-CH2=CHOO·
1 record matched C2H3 + O2 → cis-CH2=CHOO·
1 record matched C2H3 + HO2 → C2H4 + O2
1 record matched NCN + O2 → NO + CNO
1 record matched NCN + O2 → NO + NCO
1 record matched NCN + O2 → ONCN + O·
1 record matched NCN + O2 → Products
1 record matched NCN + O2 → O(1D) + ONCN
1 record matched HCO + O3 → CO2 + O2 + H·
1 record matched HCO + O2 → HC(O)O2
3 records matched HCO + O2 → CO + HO2
2 records matched HCO + O2 → Products
1 record matched (·)CH2OH + O2 → HOCH2OO
4 records matched (·)CH2OH + O2 → CH2O + HO2
1 record matched (·)CH2OH + O2 → Products
1 record matched HOC(·)O + O2 → CO2 + HO2
1 record matched 1-Naphthalenyl + O2 → 1-napthoxy + O·
1 record matched 1-Naphthalenyl + O2 → 1-naphthylperoxy
1 record matched CH3CH2CH2CH(·)CH3 + O2 → Products
1 record matched CH3CH2CH2CH(·)CH3 + O2 → CH3CH2CH2CH(OO·)CH3
1 record matched (CH3)2CHCH2CH2· + O2 → (CH3)2CHCH2CH2OO·
1 record matched Phenyl + O2 → Phenyl dioxy-
2 records matched Phenyl + O2 → C6H5O + O·
1 record matched Phenyl + O2 → Products
1 record matched Phenyl + O2 → 2-oxooxepine-3-yl radical
4 records matched Phenyl + O2 → C6H5OO·
1 record matched 4-Methylbenzyl + O2 → 1,4-Cyclohexadiene,3,6-bis(methylene)- + HO2
1 record matched 4-Methylbenzyl + O2 → (4-methyl-phenyl)-methyl peroxy radical
1 record matched 1-phenylethyl + O2 → Styrene + HO2
1 record matched 1-phenylethyl + O2 → Products
1 record matched 1-phenylethyl + O2 → 1-phenylethyl peroxy radical
1 record matched 2-Methylbenzyl + O2 → (2-methyl-phenyl)-methyl peroxy radical
1 record matched 3-Methylbenzyl + O2 → (3-methyl-phenyl)-methyl peroxy radical
1 record matched CH3CH(·)OH + O2 → CH2=CHOH + HO2
2 records matched CH3CH(·)OH + O2 → CH3CHO + HO2
1 record matched CH3CH(·)OH + O2 → CH3CH(O·)OOH
1 record matched CH3CH(·)OH + O2 → ·CH2CH(OOH)OH
2 records matched CH3CH(·)OH + O2 → CH3CH(OH)O2
1 record matched CH3CH2C(O)CH(·)CH3 + O2 → Products
3 records matched ·CF3 + O2 → O· + CF3O
5 records matched ·CF3 + O2 → CF3O2
1 record matched ·CH3 + O3 → CH3O· + O2
1 record matched ·CH3 + O2 → HCO + H2O
1 record matched ·CH3 + O2 → CH3O· + O·
4 records matched ·CH3 + O2 → CH3O2·
6 records matched ·CH3 + O2 → CH2O + ·OH
1 record matched ·CH3 + O2 → Products
2 records matched Benzyl + O2 → O· + C6H5CH2O
2 records matched Benzyl + O2 → C6H5CH2OO
1 record matched Benzyl + O2 → Benzaldehyde + ·OH
1 record matched Benzyl + O2 → CH2O + C6H5O
2 records matched CH3O· + O· → ·CH3 + O2
6 records matched CH3O· + O2 → CH2O + HO2
1 record matched CH3O· + HO2 → CH3OH + O2
1 record matched 1-C3H7 + O2 → n-C3H7O2
1 record matched 1-C3H7 + O2 → C2H5CHO + ·OH
2 records matched 1-C3H7 + O2 → CH3CH=CH2 + HO2
2 records matched 1-C3H7 + O2 → Methyloxirane + ·OH
2 records matched 1-C3H7 + O2 → Products
2 records matched 1-C3H7 + O2 → CH3CH2CH2OO·
1 record matched 1-C3H7 + O2 → CH3CH(·)CH2OOH
1 record matched 1-C3H7 + O2 → (·)CH2CH2CH2OOH
1 record matched Cyclohexyldioxyl + O3 → cyc-[CH(O·)CH2CH2CH2CH2CH2] + O2 + O2
1 record matched Cyclohexyldioxyl + HO2 → Cyclohexyl hydroperoxide + O2
1 record matched CH3O2· + CH3C(O)CH2OO· → CH3OH + CH3C(O)CHO + O2
1 record matched CH3O2· + CH3C(O)CH2OO· → CH2O + CH3C(O)CH2OH + O2
1 record matched CH3O2· + CH3C(O)CH2OO· → CH3C(O)CH2O· + CH3O· + O2
1 record matched CH3O2· + CH3C(O)OO(·) → CH3O· + O2 + CH3C(O)O
1 record matched CH3O2· + O· → CH3O· + O2
2 records matched CH3O2· + ClO → CH3OCl + O2
1 record matched CH3O2· + I → CH3I + O2
1 record matched CH3O2· + H· → CH4 + O2
1 record matched CH3O2· + Br· → CH3Br + O2
1 record matched CH3O2· + O3 → CH3O· + O2 + O2
6 records matched CH3O2· + HO2 → CH3OOH + O2
4 records matched CH3O2· + CH3O2· → CH3O· + CH3O· + O2
1 record matched Cyclopentadienyl + O2 → ·OH + 2,4-Cyclopentadiene-1-one
1 record matched Cyclopentadienyl + O2 → HCO + CH2=CHCH=C=O
1 record matched Cyclopentadienyl + O2 → Products
2 records matched Cyclopentadienyl + O2 → 2,4-cyclopentadienoxy + O·
2 records matched Cyclopentadienyl + O2 → cyclopentadienyl peroxy radical
1 record matched Cyclopentadienyl + O2 → cyclopentene-3,4-dione-5-yl
1 record matched Cyclopentadienyl + O2 → HC(O)CH=CHCH=C=O + H·
1 record matched Cyclopentadienyl + O2 → CH2=CHCH=CHO· + CO
2 records matched ·C2H + O2 → O· + HCCO
2 records matched ·C2H + O2 → ·OH + C2O
2 records matched ·C2H + O2 → CO + HCO
2 records matched ·C2H + O2 → CO + CO + H·
2 records matched ·C2H + O2 → CO2 + ·CH
1 record matched ·C2H + O2 → Products
1 record matched ·C2H + HO2 → C2H2 + O2
2 records matched C6H5O + O2 → Products
1 record matched C6H5O + O2 → cyc-CH=CH-CH=CH-CH(OO·)-C(O)
1 record matched C6H5O + O2 → cyc-CH=CH-C(OO·)H-CH=CH-C(O)
1 record matched CH2=NH + O2 → HC=NH + HO2
1 record matched ·C2H5 + O3 → CH3CH2O· + O2
5 records matched ·C2H5 + O2 → C2H5OO·
7 records matched ·C2H5 + O2 → C2H4 + HO2
1 record matched ·C2H5 + HO2 → C2H6 + O2
3 records matched iso-C3H7 + O2 → (CH3)2CHO2
1 record matched iso-C3H7 + O2 → CH3CH=CH2 + HO2
1 record matched iso-C3H7 + O2 → Methyloxirane + ·OH
1 record matched iso-C3H7 + O2 → Products
1 record matched iso-C3H7 + O2 → ·CH2CH(OOH)CH3
3 records matched ·CH2CH=CH2 + O2 → CH2=CHCH2OO
1 record matched ·CH2CH=CH2 + O2 → CH2=C=CH2 + HO2
1 record matched ·CH2CH=CH2 + O2 → CH2=CHCHO + ·OH
1 record matched ·CH2CH=CH2 + O2 → CH2O + CH2=CHO·
1 record matched ·CH2CH=CH2 + O2 → CH2O + C2H2 + ·OH
1 record matched ·CH2CH=CH2 + O2 → c-CH2CHCH2OO
1 record matched ·CH2CH=CH2 + O2 → ·CH=CHCH2OOH
1 record matched ·CH2CH=CH2 + O2 → c-CHCHCH2O + ·OH
1 record matched ·CH2CH=CH2 + O2 → c-C(CH2·)HCH2OO
3 records matched ·CH2CH=CH2 + HO2 → CH3CH=CH2 + O2
2 records matched ·CClF2 + O2 → CClF2OO
1 record matched tert-C4H9 + O2 → (CH3)3CO2
1 record matched tert-C4H9 + O2 → Products
1 record matched (CH3)3GeH + O2 → Products
1 record matched H2 + O2 + O2 → HO2 + O2 + H·
1 record matched H2 + O2 + O2 → HO2 + HO2
1 record matched H2 + O2 → H2O + O·
2 records matched H2 + O2 → ·OH + ·OH
5 records matched H2 + O2 → HO2 + H·
1 record matched H2 + O2 → Products
2 records matched CO + O2 → CO2 + O·
1 record matched CO + O2 → Products
1 record matched (C2H5)4Sn + O2 → Products
1 record matched CH2=CHCH2CH=CH2 + O2 → Pentadienyl radical + HO2
1 record matched (CH3)2CHCH=CH2 + O2 → CH2=CHC(·)(CH3)2 + HO2
1 record matched CH2=CHOH + HO2 → CH3CH(·)OH + O2
1 record matched Octamethyltetrasiloxane + O2 → Products
1 record matched 1,3-dichloropropene + O2 → CHCl=CHCH2· + ClOO
1 record matched 1,3-dichloropropene + O2 → CHCl=CHCHCl· + HO2
1 record matched 2-Methylfuran + O2 → furan-2-yl methyl radical + HO2
1 record matched 2-butyne + O2 → Products
1 record matched Cyclopentane, decafluoro- + O2 → Products
1 record matched CF2BrCl + O2 → Products
1 record matched 1,2,4,5-tetroxane → CH2O + CH2O + O2
1 record matched CO2 + O2 → Products
1 record matched CO2 + HO2 + HO2 → CO2 + H2O2 + O2
1 record matched CF3CF=CF2 + O2 → Products
1 record matched C2F4 + O2 → COF2 + COF2
1 record matched C2F4 + O2 → Products
2 records matched iso-C4H8 + O2 → HO2 + ·CH2C(CH3)=CH2
1 record matched (CH3)2O + O2 → HO2 + CH3OCH2·
1 record matched (CH3)2O + O2 → Products
1 record matched CH3CH=CH2 + O2 → ·CH2CH=CH2 + HO2
1 record matched CH3CH=CH2 + O2 → Products
1 record matched CH3OCH2OCH3 + O2 → Products
1 record matched 1-C5H10 + O2 → HO2 + CH2=CHCH2CH(·)CH3
1 record matched Phenol + O3 → 1,2-Dihydroxybenzene + O2
3 records matched Toluene + O2 → Benzyl + HO2
4 records matched Toluene + O2 → Products
1 record matched Toluene + O2 → C6H4CH3 + HO2
1 record matched Toluene + ·OH + O2 → Products
1 record matched 1,3-Dimethylbenzene + O2 → Products
1 record matched CH3CH=CHCH3 + O2 → HO2 + (E)-CH3CH=CHCH2
1 record matched 1-C4H8 + O2 → HO2 + CH2=CHCH(·)CH3
1 record matched 1,4-Dimethylbenzene + O2 → Products
1 record matched Benzeneacetic acid + O2 → C6H5CH2C(O)O· + HO2
1 record matched 1-Phenylpropane + O2 → Products
1 record matched 1-Phenylpropane + O2 → CH3CH(·)CH2C6H5 + HO2
1 record matched Ethylbenzene + O2 → HO2 + 2-phenylethyl
1 record matched Ethylbenzene + O2 → 1-phenylethyl + HO2
3 records matched Ethylbenzene + O2 → Products
1 record matched 2-Phenylpropane + O2 → HO2 + 2-Phenyl-2-propyl radical
1 record matched 1,2,4-Trimethylbenzene + O2 → HO2 + 3,4-dimethylphenyl-methyl
1 record matched 1,2-Dimethylbenzene + O2 → Products
1 record matched 2,4,6-trichlorophenol + 1-C6H14 + O2 → Products
1 record matched Methyl methacrylate + O2 → CH2O + CH3C(O)C(O)OCH3
1 record matched Methyl methacrylate + O2 → HOOCH2C(CH2)C(O)OCH3
1 record matched CH2=C(CH3)COOH + O2 → CH2O + CH3COCOOH
1 record matched CH2=C(CH3)COOH + O2 → HOOCH2C(CH2)C(O)OH
1 record matched Methacrolein + ·OH + O2 → Products
1 record matched (CH3)2S + O3 → (CH3)2SO + O2
1 record matched HN=C=O + O2 → CO2 + HNO
1 record matched CH3CHO + O2 → Products
2 records matched CH3CHO + HO2 → CH3CH(·)OH + O2
1 record matched CH3CN + ·OH + O2 → Products
1 record matched C3H8 + O2 → Products
1 record matched HCN + O2 → Products
1 record matched HCN + ·OH + O2 → Products
1 record matched C2H2 + O2 → HCO + HCO
1 record matched C2H2 + O2 → Products
1 record matched C2H4 + O2 → C2H3 + HO2
1 record matched C2H4 + O2 → (3)·CH2CH2OO·
2 records matched C2H6 + O2 → ·C2H5 + HO2
5 records matched CH4 + O2 → ·CH3 + HO2
1 record matched CH4 + O2 → CH3O2· + H·
2 records matched CH4 + O2 → Products
1 record matched Benzene + O2 → Phenyl + HO2
8 records matched Benzene + O2 → Products
1 record matched n-C5H11OH + O2 → Products + HO2
1 record matched n-C4H9OH + O2 → Products + HO2
1 record matched n-C3H7OH + O2 → Products + HO2
1 record matched (CH3)2SO + O· → (CH3)2S + O2
1 record matched CH3OH + O2 → (·)CH2OH + HO2
1 record matched CH3OH + O2 → Products + HO2
2 records matched CH3OH + O2 → Products
1 record matched Naphthalene-1-carboxyaldehyde + O2 → C10H7C(O)· + HO2
1 record matched C2H5OH + O2 → Products + HO2
1 record matched C2H5OH + O2 → Products
1 record matched (C2H5)2O + O2 → Products
1 record matched CN + O2 → O· + NCO
1 record matched CN + O2 → Products
1 record matched CH2O + O3 → HCOOH + O2
1 record matched CH2O + O2 → HCO + HO2
1 record matched CH2O → H2 + O2
1 record matched NO3 - isoprene radical adduct + O2 → Products
1 record matched O(1D) + N2O → N2 + O2
1 record matched O2(1DELTA) + SO2 → SO2 + O2
1 record matched O2(1DELTA) + O(1D) → O2 + O·
1 record matched HCCCO + O2 → Products
1 record matched CH3SCH2OO· → O2 + CH3SCH2
1 record matched CH3CF2OO· + HO2 → COF2 + ·CH3 + ·OH + O2
1 record matched CH3CF2OO· + HO2 → CH3OH + COF2 + O2
1 record matched CH3CF2OO· + HO2 → CH3CF2OOH + O2
2 records matched CH2BrO + O2 → HO2 + HC(O)Br
1 record matched CH2DO + O2 → CHDO + DO2
1 record matched CH2DO + O2 → CD2O + HO2
1 record matched BrCH2CH2O(.) + O2 → HO2 + Acetaldehyde, bromo-
1 record matched HO2-H2O Complex + HO2 → H2O2 + H2O + O2
1 record matched HO2-H2O Complex + CH3O2· → CH3OOH + H2O + O2
1 record matched 1-methyl-2-hydroxy-3,5-cyclohexadienyl + O2 → 2-Methylphenol + HO2
1 record matched 1-methyl-2-hydroxy-3,5-cyclohexadienyl + O2 → 1-methyl-2-hydroxy-cyclohex-3,5-dien-1-yl-dioxyl
2 records matched 1-methyl-2-hydroxy-3,5-cyclohexadienyl + O2 → 1-methyl-2-hydroxy-cyclohex-4,6-dien-3-dioxyl
1 record matched 1-methyl-2-hydroxy-3,5-cyclohexadienyl + O2 → 1-methyl-2-hydroxy-cyclohex-3,6-dien-5-dioxyl
1 record matched 1-methyl-4-hydroxy-1,5-cyclohexadienyl + O2 → 4-Methylphenol + HO2
1 record matched 1-methyl-4-hydroxy-1,5-cyclohexadienyl + O2 → 1-methyl-4-hydroxy-cyclohex-2,5-dien-1-dioxyl
2 records matched 1-methyl-4-hydroxy-1,5-cyclohexadienyl + O2 → 1-methyl-4-hydroxy-cyclohex-1,5-dien-3-dioxyl
1 record matched OH(v=4) + O3 → HO2 + O2
1 record matched OH(v=4) + O3 → HO2 + ·OH + O2 + H· + O·
1 record matched OH(v=2) + O3 → HO2 + O2
1 record matched OH(v=2) + O3 → HO2 + ·OH + O2 + H· + O·
1 record matched OH(v=1) + O3 → HO2 + O2
1 record matched OH(v=1) + O3 → HO2 + ·OH + O2 + H· + O·
1 record matched CH3CH(O)CH2CH2OCH3 + O2 → CH3C(O)CH2CH2OCH3 + H2O
1 record matched CH3CH2CH(O)CH2OCH3 + O2 → CH3CH2C(O)CH2OCH3 + HO2
1 record matched CH3CH2CH2CH(O)OCH3 + O2 → CH3CH2CH2C(O)OCH3 + HO2
1 record matched CH3OCH2OCH2· + O2 → Products
1 record matched CH3OCH(·)OCH3 + O2 → Products
1 record matched HOCH2CH(O)OCH(CH3)2 + O2 → HOCH2C(O)CH(CH3)2 + HO2
1 record matched HOSO + O2 → HO2 + SO2
1 record matched OCH2OCH2CH2CH2CH3 + O2 → OCHOCH2CH2CH2CH3 + HO2
1 record matched NCCO + O2 → CO2 + NCO
2 records matched N(2D) + O2 → NO + O·
1 record matched N(2D) + O2 → O(1D) + NO
2 records matched O(3P) + OClO → O2 + ClO
1 record matched O(3P) + ClO → O2 + ·Cl
1 record matched O(3P) + ClONO2 → O2 + ClNO2
2 records matched O(3P) + O2 + O2 → O2 + O3
2 records matched O(3P) + N2 + O2 → N2 + O3
1 record matched O(3P) + HO2 → ·OH + O2
1 record matched hydroxy-isoprene + O2 → Products
1 record matched CH3CH2CH2OO· + HO2 → Propylhydroperoxide + O2
1 record matched CH3CH2CH2OO· → 1-C3H7 + O2
1 record matched HC(O)C(O)O2 → O2 + HC(O)CO
2 records matched CHBr2OO(·) + HO2 → CHBr2O(.) + ·OH + O2
2 records matched CBr3OO(·) + HO2 → CBr3O(·) + ·OH + O2
1 record matched CH2=C(CH3)CH(·)CH2OH + O2 → Products
1 record matched CH2(X3B_1) + O2 → Products
1 record matched (E)-CH2=C(CH3)CH(·)CH2OH + O2 → CH2=C(CH3)CH(OO·)CH2OH
1 record matched (E)-CH2=C(CH3)CH(·)CH2OH + O2 → CH2(OH)CH=C(CH3)CH2OO·
1 record matched 1-methyl-2-hydroxy-cyclohex-3,5-dien-1-yl-dioxyl → 1-methyl-2-hydroxy-3,5-cyclohexadienyl + O2
1 record matched 1-methyl-2-hydroxy-cyclohex-4,6-dien-3-dioxyl → 1-methyl-2-hydroxy-3,5-cyclohexadienyl + O2
1 record matched 1-methyl-2-hydroxy-cyclohex-3,6-dien-5-dioxyl → 1-methyl-2-hydroxy-3,5-cyclohexadienyl + O2
1 record matched 1-methyl-4-hydroxy-cyclohex-2,5-dien-1-dioxyl → 1-methyl-4-hydroxy-1,5-cyclohexadienyl + O2
1 record matched 1-methyl-4-hydroxy-cyclohex-1,5-dien-3-dioxyl → 1-methyl-4-hydroxy-1,5-cyclohexadienyl + O2
1 record matched 1-methyl-4-hydroxy-3,5-epidixy-cyclohex-1-en-6-yl + O2 → 1-methyl-4-hydroxy-3,5-epidixy-cyclohex-6-en-2-dioxyl
1 record matched 1-methyl-2-hydroxy-1,3-epidixy-cyclohex-4-en-6-yl + O2 → 1-methyl-2-hydroxy-1,3-epidixy-cyclohex-4-en-6-dioxyl
1 record matched 1-methyl-2-hydroxy-1,3-epidixy-cyclohex-4-en-6-yl + O2 → 1-methyl-2-hydroxy-1,3-epidixy-cyclohex-5-en-4-dioxyl
1 record matched HOCO + O· → O2 + COH
1 record matched HOCO + O2 → Products
1 record matched CH3CH2CH(·)CH2OH + O2 → Products
1 record matched CH3CH(·)CH2CH2OH + O2 → Products
1 record matched (·)CH2CH2OOH + O2 → Products
1 record matched (·)CH2CH2OOH + O2 → HOOCH2CH2OO·
1 record matched HOOCH2CH2OO· → (·)CH2CH2OOH + O2
1 record matched 2-chlorophenoxy + O2 → Products
1 record matched anti-CH3SOO → CH3S· + O2
1 record matched (CH3)2S-H2O complex + O3 → (CH3)2SO + H2O + O2
1 record matched (CH3)2S-(H2O)2 complex + O3 → (CH3)2SO + H2O + H2O + O2
1 record matched (CH3)2S-(H2O)3 complex + O3 → (CH3)2SO + H2O + H2O + H2O + O2
1 record matched O3-H2O complex + (CH3)2S → (CH3)2SO + H2O + O2
1 record matched O3-H2O complex + (CH3)2S-H2O complex → (CH3)2SO + H2O + H2O + O2
1 record matched O3-H2O complex + (CH3)2S-(H2O)2 complex → (CH3)2SO + H2O + H2O + H2O + O2
1 record matched O3-(H2O)2 complex + (CH3)2S → (CH3)2SO + H2O + H2O + O2
1 record matched O3-(H2O)2 complex + (CH3)2S-H2O complex → (CH3)2SO + H2O + H2O + H2O + O2
1 record matched O3-(H2O)3 complex + (CH3)2S → (CH3)2SO + H2O + H2O + H2O + O2
1 record matched ·OCH2C(O)OH + O2 → OCHCOOH + HO2
1 record matched ·C(O)C(O)OH + O2 → ·OOC(O)C(O)OH
1 record matched (CH3)2C(OH)CH(O·)CH2OH + O2 → Products
1 record matched (CH3)2C(OH)CH(OH)CH2O· + O2 → Products
1 record matched CH3C(OOH)HCH2C(·)HCH3 + O2 → CH3C(OOH)HCH2C(OO·)HCH3
1 record matched ·CH2CH2CH2CH2CH2· + O2 → 1,2-Dioxepane
1 record matched ·CH2CH2CH2CH2CH2· + O2 → ·CH2CH2CH2CH2CH2OO·
1 record matched ·CH2CH2CH2CH2CH2· + O2 → ·OCH2CH2CH2CH2CH2
1 record matched ·CH2CH2CH2CH2CH2· + O2 → ·CH2CH2CH2CH2O· + CH2O
1 record matched CH3CHI + O2 → CH3CHO + IO
1 record matched C2H5CHI· + O2 → C2H5CHO + IO
1 record matched 3-chlorophenoxy + O2 → Products
1 record matched 4-chlorophenoxy + O2 → Products
1 record matched CH3CH2C(O)CH2CH2· + O2 → Products
1 record matched trans-2,4-Cyclohexadienylperoxy, 6-hydroxy- → O2 + Cyclohexadienyl, 6-hydroxy-
1 record matched cis-2,4-Cyclohexadienylperoxy, 6-hydroxy- → O2 + Cyclohexadienyl, 6-hydroxy-
1 record matched trans-2,5-Cyclohexadienylperoxy, 4-hydroxy- → O2 + Cyclohexadienyl, 6-hydroxy-
1 record matched cis-2,5-Cyclohexadienylperoxy, 4-hydroxy- → O2 + Cyclohexadienyl, 6-hydroxy-
1 record matched CH2BrCHBrO· + O2 → CH2BrC(O)Br + HO2
1 record matched CHBrO(·)CHO + O2 → CBr(O)CH(O) + HO2
1 record matched CHBrO(·)COBr + O2 → H2O + BrCOCOBr
1 record matched c-N3 + O2 → N2 + NO + O·
1 record matched cis-CHCl=CCl· + O2 → HC(O)Cl + ClCO
1 record matched cis-CHCl=CCl· + O2 → CO + ClCO + HCl
1 record matched cis-CHCl=CCl· + O2 → CO2 + ·CCl + HCl
1 record matched cis-CHCl=CCl· + O2 → CO2 + CHCl2
1 record matched CH3S(O)(OH)CH3 + O2 → (CH3)2SO2 + HO2
1 record matched (2-methyl-phenyl)-methyl peroxy radical → 2-Methylbenzyl + O2
3 records matched HOS(O)(O)OO· → O2 + HOSO2
1 record matched (CH3)2CHCH2CH2OO· → (CH3)2CHCH2CH2· + O2
1 record matched CH3C(OOH)HCH2C(OO·)HCH3 → CH3C(OOH)HCH2C(·)HCH3 + O2
1 record matched cyc-CH=CH-CH=CH-CH(OO·)-C(O) → C6H5O + O2
1 record matched cyc-CH=CH-C(OO·)H-CH=CH-C(O) → C6H5O + O2
1 record matched CH3CH2CH(CH3)CH2OO· → ·CH2CH(CH3)CH2CH3 + O2
1 record matched 2,5-cyclohexadienyl, 2-methyl,3,4-dihydroxy + O2 → 1,2-Dihydroxy-3-methylbenzene + HO2
1 record matched cyclopentadienyl peroxy radical → Cyclopentadienyl + O2
1 record matched CH2(OOH)C(CH3)=CHC(·)HOH + O2 → Products
1 record matched HOCH2C(·)(CH3)CH2CH2OH + O2 → HOCH2C(OO·)(CH3)CH2CH2OH
1 record matched ·CH2C(OH)(CH3)CH2CH2OH + O2 → ·OOCH2C(OH)(CH3)CH2CH2OH
1 record matched ·CH2OCH2CH2CH2· + O2 → ·OCH2CH2CH2O· + CH2O
1 record matched ·CH2OCH2CH2CH2· + O2 → ·CH2OCH2CH2CH2OO·
1 record matched ·CH2OCH2CH2CH2· + O2 → ·OCH2OCH2CH2CH2
1 record matched ·CH2OCH2CH2CH2· + O2 → 1,2,4-Trioxepane
1 record matched ·CH2CH2OCH2CH2· + O2 → ·CH2CH2OCH2CH2OO·
1 record matched ·CH2CH2OCH2CH2· + O2 → ·OCH2CH2OCH2CH2
1 record matched ·CH2CH2OCH2CH2· + O2 → 1,2,5-Trioxepane
1 record matched ·CH2CH2OCH2CH2· + O2 → ·CH2OCH2CH2O· + CH2O
1 record matched Cyclopentylcyclopentane 1j-2j biradical + O2 → Products
1 record matched HOCH=N· + O2 → Products
1 record matched CH3C(O)C(CH3)2CH2· + O2 → Products
1 record matched CH3C(O)CH2C(·)(CH3)2 + O2 → Products
1 record matched ·CH2C(O)C(CH3)3 + O2 → Products
1 record matched CH3N(·)NO2 + O2 → Products
1 record matched CH3N(NO2)CH2· + O2 → Products
1 record matched ·CH2NHNO2 + O2 → HO2 + H2C=NNO2
1 record matched (CH3)3CCH2C(OO·)(CH3)2 → O2 + (CH3)3CCH2C(·)(CH3)2
2 records matched HC(O)NHCH2· + O2 → Products
2 records matched ·C(O)NHCH3 + O2 → Products
1 record matched 2-oxocyclopentyl + O2 → Products
1 record matched 3-oxocyclopentyl + O2 → Products
1 record matched (CH3)2C=CHCH(·)OH + O2 → Products
1 record matched ·CH2C(=CH2)CH2CH2OH + O2 → Products
1 record matched CF3CF(·)CHFOH + O2 → Products
1 record matched CF3CF(OH)CHF· + O2 → Products
1 record matched (CF3)2CHOCHFO· + O2 → (CF3)2CHOCFO + HO2
1 record matched CF3CH(O·)OCH3 + O2 → Products
1 record matched CF3CH2OCH2O· + O2 → Products
1 record matched NH2CH(·)CH2OH + O2 → CH2O + HCONH2 + ·OH
1 record matched NH2CH(·)CH2OH + O2 → NH=CHCH2OH + HO2
1 record matched NH2CH(·)CH2OH + O2 → NH2CH(O2·)CH2OH
1 record matched NH2CH2CH(·)OH + O2 → Products
1 record matched tetrahydropyran-2-yl + O2 → Products
1 record matched 4-OH-methyl salicylate adduct + O2 → Methyl 2,4-dihydroxybenzoate + HO2
1 record matched 4-OH-methyl salicylate adduct + O2 → 1-C8H9O6
1 record matched 4-OH-methyl salicylate adduct + O2 → 2-C8H9O6
1 record matched 4-OH-methyl salicylate adduct + O2 → 3-C8H9O6
1 record matched 2-methyl-cyclohexyl + O2 → Products
1 record matched Cyclohexylmethyl + O2 → Products
1 record matched 2-methylfuran-5-yl methylperoxy radical → 2-methylfuran-5-yl methyl radical + O2
1 record matched 1-phenylethyl peroxy radical → 1-phenylethyl + O2
1 record matched 2-phenylethyl peroxy radical → O2 + 2-phenylethyl
1 record matched CH3CH=CHCH(·)CH2CH2CH3 + O2 → Products
1 record matched 2-methylfuran-5-yl + O2 → 2-methylfuran-5-yl peroxy radical
1 record matched Cyclopentadienone-2-yl + O2 → Products
1 record matched Cyclopentadienone-2-yl + O2 → Cyclopentadienone-2-yl peroxy radical
1 record matched Cyclopentadienone-3-yl + O2 → Products
1 record matched Cyclopentadienone-3-yl + O2 → Cyclopentadienone-3-yl peroxy radical
1 record matched Cyclopentadienone-2-yl peroxy radical → Cyclopentadienone-2-yl + O2
1 record matched Cyclopentadienone-3-yl peroxy radical → Cyclopentadienone-3-yl + O2
1 record matched SCSOH + O2 → HOSO + COS
1 record matched SC(OH)S + O2 → Products
1 record matched SC(O)OH + O2 → SOOH + CO2
1 record matched O=P(OCH(CH3)CH2Cl)2(OCH(CH3)CHCl·) + O2 → Products
1 record matched O=P(OCH(CH3)CH2Cl)2(OCH(CH2·)CH2Cl) + O2 → Products
1 record matched O=P(OCH(CH3)CH2Cl)2(OC(·)(CH3)CH2Cl) + O2 → Products
1 record matched (H2O)O=P(OCH(CH3)CH2Cl)2(OC(·)(CH3)CH2Cl) + O2 → Products
1 record matched CH3CH=CHCH2CH(·)CH2CH3 + O2 → Products
1 record matched CH3CH=CHCH(·)CH=CHCH3 + O2 → Products
1 record matched 1-naphthylperoxy + HO2 → 1-naphthylperoxide + O2
1 record matched tetrahydropyran-3-yl + O2 → Products
1 record matched tetrahydropyran-4-yl + O2 → Products
1 record matched 1-methyl-cyclohexyl + O2 → Products
1 record matched ·CH2C(CH3)2OOH + O2 → Products
1 record matched 1-Oxa-4-thiacyclohex-2-yl radical + O2 → 1-Oxa-4-thiacyclohex-2-yl peroxy radical
1 record matched 1-Oxa-4-thiacyclohex-2-yl peroxy radical + HO2 → 2-hydroperoxy-1,4-thioxane + O2
1 record matched α-hydroxy-2,3,7,8-tetrachlorodibenzofuranyl radical + O2 → Products
1 record matched ·CH2CH2CH2CH2CH2C(·)=O + O2 → ·CH2CH2CH2CH2CH2C(O)OO·
1 record matched ·CH2CH2CH2CH2CH2C(·)=O + O2 → ·OOCH2CH2CH2CH2CH2C(·)=O
1 record matched 1-hydroxy,2-hydro-2-naphthalenyl + O2 → 1-Naphthalenol + HO2
1 record matched 1-hydroxy,2-hydro-2-naphthalenyl + O2 → 1-hydroxy,2-hydro-2-naphthalenyl peroxy radical
1 record matched 1-hydroxy,2-hydro-2-naphthalenyl + HO2 → 2-Hydroperoxy-1,2-dihydronaphthalene-1-ol + O2
2 records matched ·OCH2N(CH3)NO + O2 → HO2 + N-Methyl-N-nitrosoformamide
1 record matched ·CH2OCH(OOH)OCH3 + O2 → Products
1 record matched CH3OCH(·)OCH2OOH + O2 → Products
1 record matched ·CH2OCH2OCH2OOH + O2 → Products
1 record matched 1-methyl-3-hydroxy-1,5-cyclohexadienyl + O2 → 3-Methylphenol + HO2
1 record matched 1-methyl-3-hydroxy-1,5-cyclohexadienyl + O2 → 1-methyl-3-hydroxy-cyclohex-1,4-dien-5-dioxyl
1 record matched 2-methylfuran-5-yl peroxy radical → 2-methylfuran-5-yl + O2
1 record matched cyclopentene-3,4-dione-5-yl → Cyclopentadienyl + O2
1 record matched 2,4-cyclohexadienyl peroxy radical → O2 + Cyclohexadienyl
1 record matched 2,5-cyclohexadienyl peroxy radical → O2 + Cyclohexadienyl
1 record matched 2-methyl-5-isopropyl-cyclohexadienyl + O2 → Products
1 record matched 2-isopropyl-5-methyl-cyclohexadienyl + O2 → Products
1 record matched 1-isopropyl-4-methyl-cyclohexadienyl + O2 → Products
1 record matched 1-decalinyl + O2 → Adduct
1 record matched 2-decalinyl + O2 → Adduct
1 record matched C7H7O2 → O2 + 2-methylphenyl
1 record matched (·)CH2CH2CH2CH2OH + O2 → Products
1 record matched CH3CH(·)CH2OOH + O2 → HOOCH2CH(CH3)OO·
1 record matched CH3CH(·)CH2OOH → 1-C3H7 + O2
1 record matched (·)CH2CH2CH2OOH + O2 → HOOCH2CH2CH2OO·
1 record matched (·)CH2CH2CH2OOH → 1-C3H7 + O2
1 record matched HOCH2CH(CH3)=CHCHOH + O2 → HOCH2CH(CH3)=CHCHO + HO2
1 record matched CH2CH2CH2CH2 + O2 → 1,2-Dioxane
1 record matched CH2CH2CH2CH2 + O2 → CH2O + CH2CH2CH2O
1 record matched CH2CH2CH2CH2 + O2 → ·CH2CH2CH2CH2OO·
1 record matched CH2CH2CH2CH2 + O2 → ·OCH2CH2CH2CH2
1 record matched cis-ClOOO → O2 + ClO
1 record matched CH3CH(OH)O2 → CH3CH(·)OH + O2
2 records matched HSOO → O2 + SH
1 record matched trans-CH2=CHOO· → C2H3 + O2
1 record matched cis-CH2=CHOO· → C2H3 + O2
1 record matched o-Benzosemiquinone + O2 → Products
1 record matched p-Benzosemiquinone + O2 → Products
1 record matched C6H5C(CH3)2OO· + O3 → C6H5C(O*)(CH3)2 + O2 + O2
1 record matched c-C6H10(CH3)OO· + O3 → c-C6H10(CH3)O· + O2 + O2
1 record matched CH2OCH2OOH → O2 + CH3OCH2·
1 record matched CH3CH2CH2CH(OO·)CH3 + O2 → Products
1 record matched CH3CH2CH2CH(OO·)CH3 → CH3CH2CH2CH(·)CH3 + O2
1 record matched (CH3)2C(OO·)CH2CH3 + O3 → CH3CH2C(CH3)2O(·) + O2 + O2
1 record matched C6H5OO· → Phenyl + O2
1 record matched ·CH2CH(OOH)CH3 + O2 → HOOCH(CH3)CH2OO·
1 record matched ·CH2CH(OOH)CH3 → iso-C3H7 + O2
2 records matched Cl(2P) + O2 + O2 → O2 + ClOO
2 records matched Cl(2P) + N2 + O2 → N2 + ClOO
1 record matched O=P(·)(OH)2 + O2 → HO2 + HOPO2
1 record matched CH_2(aA_1) + O2 → Products
1 record matched cis-HOOO → ·OH + O2
1 record matched trans-HOOO → ·OH + O2
1 record matched C2(a3PIu) + O2 → O· + c-COC
1 record matched C2(a3PIu) + O2 → CO + CO
1 record matched C2(a3PIu) + O2 → C(3Pj) + CO2
1 record matched C2(a3PIu) + O2 → cyc-COO + C(3Pj)
1 record matched CH2OC4F9 + O2 → Products
1 record matched C + O2 → O(1D) + CO

Search returned 5013 records.