 |
Home ©NIST, 2023 Accessibility information |
Contact Us to Submit an Article
Other Databases
NIST Standard Reference Data Program
NDRL-NIST Solution Kinetics Database
NIST Computational Chemistry Comparison and Benchmark Database
The NIST Reference on Constants, Units, and Uncertainty
Administrative Links
Search Results
Click on a link in the table below to see detail on the selected reaction.
| Records | Reaction | |
|---|---|---|
| 1 record matched | CH2=CHCOCH3 + ·OH → Products | |
| 1 record matched | CH3C(O)CHICH3 → CH2=CHCOCH3 + HI | |
| 1 record matched | 2H-Pyran, 3,4-dihydro-2-methyl- → C2H4 + CH2=CHCOCH3 | |
| 1 record matched | CH3C(O)OCH2CH2C(O)CH3 → CH3C(O)OH + CH2=CHCOCH3 | |
| 2 records matched | CH3C(O)OCH(CH3)C(O)CH3 → CH3C(O)OH + CH2=CHCOCH3 | |
| 1 record matched | 2-Butanone, 3-chloro- → CH2=CHCOCH3 + HCl | |
| 1 record matched | Ethanone, 1-cyclobutyl)- → C2H4 + CH2=CHCOCH3 | |
| 1 record matched | CH3C(O)CH2CH2OH → CH2=CHCOCH3 + H2O | |
| 2 records matched | 2-Methylfuran + O· → Other Products + CH2=CHCOCH3 | |
| 1 record matched | CH2=CHCOCH3 + CH2OO → Products | |
| 10 records matched | CH2=CHCOCH3 + ·Cl → Products | |
| 1 record matched | CH2=CHCOCH3 + ·Cl → H2C=CHC(O)CH2(·) + HCl | |
| 1 record matched | CH2=CHCOCH3 + ·Cl → CH3C(O)C(·)HCH2Cl | |
| 3 records matched | CH2=CHCOCH3 + NO3 → Products | |
| 1 record matched | CH2=CHCOCH3 + Br· → Products | |
| 1 record matched | CH2=CHCOCH3 + O3 → Other Products + CH3C(O)CHO | |
| 1 record matched | CH2=CHCOCH3 + O3 → Other Products + CH2O | |
| 1 record matched | CH2=CHCOCH3 + O3 → Products + ·OH | |
| 9 records matched | CH2=CHCOCH3 + O3 → Products | |
| 17 records matched | CH2=CHCOCH3 + ·OH → Products | |
| 2 records matched | CH2=CHCOCH3 + ·CF3 → CF3CH2CH(·)C(O)CH3 | |
| 1 record matched | H2O + CH2=CH-C(OH)(OOH)-CH3 → CH2=CHCOCH3 + H2O2 + H2O | |
| 1 record matched | 2-Hexanone → C2H6 + CH2=CHCOCH3 | |
| 1 record matched | 5-Methylfuran-2(3H)-one → CH2=CHCOCH3 + CO | |
| 1 record matched | 1,2-Dimethoxyethane → CH3OH + CH2=CHCOCH3 | |
| 1 record matched | CH2=CHCOCH3 + ·Cl → Products | |
| 1 record matched | CH2=CHCOCH3 + H· → ·CH3 + CH3CH=C=O | |
| 1 record matched | CH2=CHCOCH3 + H· → C2H4 + CH3CO | |
| 1 record matched | CH2=CHCOCH3 + H· → CH2=CHCH(CH3)O | |
| 1 record matched | CH2=CHCOCH3 + NO3 → Products | |
| 1 record matched | CH2=CHCOCH3 + ·CH2Cl → CH2=CHC(CH3)(O·)CH2Cl | |
| 1 record matched | CH2=CHCOCH3 + ·OH → CH3CHO + CH3CO | |
| 3 records matched | CH2=CHCOCH3 + ·OH → Products | |
| 1 record matched | CH2=CHCOCH3 + HO2 → Products | |
| 1 record matched | CH2=CHCOCH3 + HO2 → CH2=CHC(CH3)(OH)OO· | |
| 1 record matched | CH2=CHCOCH3 + (·)CH2OH → CH2=CHC(CH3)(O·)CH2OH | |
| 1 record matched | CH2=CHCOCH3 + ·CH3 → CH3CH=CH2 + CH3CO | |
| 2 records matched | CH2=CHCOCH3 → C2H3 + CH3CO | |
| 2 records matched | CH2=CHCOCH3 → ·CH3 + CH2=CHC(·)O | |
| 1 record matched | CH2=CHCOCH3 → Products | |
| 2 records matched | CH2=CHCOCH3 → H2C=CHC(O)CH2(·) + H· | |
| 1 record matched | CH2=CHC(CH3)(O·)CH2Cl → CH2=CHCOCH3 + ·CH2Cl | |
| 1 record matched | CH2=CHC(CH3)(OO·)CH2OH → CH2O + CH2=CHCOCH3 + ·OH | |
| 1 record matched | 1-methyl-1-ethenyl-2,3,4-trioxacyclopentane → CH2=CHCOCH3 + cyc-H2CO2 | |
| 1 record matched | CH2=CHCH(CH3)O → CH2=CHCOCH3 + H· | |
| 1 record matched | 2-Methylene-3,5-cyclohexadiene-1-one + CH2=CHCOCH3 → methyl (2-2H-1-Benzopyranyl, 3,4-dihydro) ketone | |
| 1 record matched | (CH3)CH(OO·)COCH3 → CH2=CHCOCH3 + HO2 | |
| 1 record matched | cyc-OOOC(CH3)(CH=CH2)C(CH2CH=C(CH3)2) → (CH3)2C=CHCH2CH(·)OO· + CH2=CHCOCH3 | |
| 1 record matched | CH3C(O)CH2CH2OO· → CH2=CHCOCH3 + HO2 | |
| 1 record matched | HOCH2C(CH3)(OO·)CH=CH2 + NO → CH2=CHCOCH3 + (·)CH2OH + NO2 | |
| 1 record matched | HOCH2C(CH3)(OO·)CH=CH2 + NO → HONO (unspecified cis/trans isomer) + CH2O + CH2=CHCOCH3 | |
| 1 record matched | CH3C(O)CH(·)CH2C(O)OCH3 → CH2=CHCOCH3 + CH3OC(·)(O) | |
| 9 records matched | CH2=CHC(CH3)(O·)CH2OH → CH2=CHCOCH3 + (·)CH2OH |
Search returned 104 records.